From ac1307ee6903b8d42dbfb45e9e9a5e9e5c808839 Mon Sep 17 00:00:00 2001 From: nocollier Date: Thu, 7 Dec 2023 02:22:50 +0000 Subject: [PATCH] deploy: 54913bee84baadc45c9f89fbddc5ec6fdf32312e --- _preview/4/.buildinfo | 4 + _preview/4/README.html | 529 + _preview/4/_images/NCAR-contemp-logo-blue.svg | 1 + .../ProjectPythia_Logo_Final-01-Blue.svg | 1 + .../4/_images/UAlbany-A2-logo-purple-gold.svg | 1125 ++ .../Unidata_logo_horizontal_1200x300.svg | 891 ++ _preview/4/_images/esgf.png | Bin 0 -> 128511 bytes _preview/4/_images/esgf2-us.png | Bin 0 -> 18651 bytes _preview/4/_images/globus-logo.png | Bin 0 -> 8023 bytes _preview/4/_sources/README.md | 83 + .../4/_sources/notebooks/complex-search.ipynb | 544 + .../4/_sources/notebooks/enso-globus.ipynb | 1104 ++ _preview/4/_sources/notebooks/how-to-cite.md | 7 + .../notebooks/notebook-template.ipynb | 358 + ...e.4045f2051d55cab465a707391d5b2007.min.css | 1 + .../4/_sphinx_design_static/design-tabs.js | 27 + _preview/4/_static/__init__.py | 0 .../__pycache__/__init__.cpython-310.pyc | Bin 0 -> 200 bytes _preview/4/_static/basic.css | 906 ++ _preview/4/_static/check-solid.svg | 4 + _preview/4/_static/clipboard.min.js | 7 + _preview/4/_static/copy-button.svg | 5 + _preview/4/_static/copybutton.css | 94 + _preview/4/_static/copybutton.js | 248 + _preview/4/_static/copybutton_funcs.js | 73 + _preview/4/_static/css/blank.css | 2 + ...index.ff1ffe594081f20da1ef19478df9384b.css | 6 + _preview/4/_static/css/theme.css | 120 + ...e.4045f2051d55cab465a707391d5b2007.min.css | 1 + _preview/4/_static/design-tabs.js | 27 + _preview/4/_static/doctools.js | 358 + _preview/4/_static/documentation_options.js | 14 + _preview/4/_static/esgf2-us.png | Bin 0 -> 18651 bytes _preview/4/_static/favicon.ico | Bin 0 -> 15086 bytes _preview/4/_static/file.png | Bin 0 -> 286 bytes _preview/4/_static/images/logo_binder.svg | 19 + _preview/4/_static/images/logo_colab.png | Bin 0 -> 7601 bytes _preview/4/_static/images/logo_jupyterhub.svg | 1 + _preview/4/_static/jquery-3.5.1.js | 10872 ++++++++++++++++ _preview/4/_static/jquery.js | 2 + .../_static/js/index.be7d3bbb2ef33a8344ce.js | 32 + _preview/4/_static/language_data.js | 297 + _preview/4/_static/minus.png | Bin 0 -> 90 bytes ...69c37c29e427902b24a333a5f9fcb2f0b3ac41.css | 2342 ++++ _preview/4/_static/plus.png | Bin 0 -> 90 bytes _preview/4/_static/pygments.css | 75 + _preview/4/_static/searchtools.js | 525 + _preview/4/_static/sphinx-book-theme.css | 5 + ...-theme.d59cb220de22ca1c485ebbdc042f0030.js | 22 + ...theme.e2363ea40746bee74734a24ffefccd78.css | 5 + .../4/_static/sphinx-pythia-theme.min.css | 1 + _preview/4/_static/sphinx-pythia-theme.min.js | 1 + _preview/4/_static/sphinx-thebe.css | 129 + _preview/4/_static/sphinx-thebe.js | 126 + _preview/4/_static/togglebutton.css | 160 + _preview/4/_static/togglebutton.js | 187 + _preview/4/_static/underscore-1.13.1.js | 2042 +++ _preview/4/_static/underscore.js | 6 + .../vendor/fontawesome/5.13.0/LICENSE.txt | 34 + .../vendor/fontawesome/5.13.0/css/all.min.css | 5 + .../5.13.0/webfonts/fa-brands-400.eot | Bin 0 -> 133034 bytes .../5.13.0/webfonts/fa-brands-400.svg | 3570 +++++ .../5.13.0/webfonts/fa-brands-400.ttf | Bin 0 -> 132728 bytes .../5.13.0/webfonts/fa-brands-400.woff | Bin 0 -> 89824 bytes .../5.13.0/webfonts/fa-brands-400.woff2 | Bin 0 -> 76612 bytes .../5.13.0/webfonts/fa-regular-400.eot | Bin 0 -> 34390 bytes .../5.13.0/webfonts/fa-regular-400.svg | 803 ++ .../5.13.0/webfonts/fa-regular-400.ttf | Bin 0 -> 34092 bytes .../5.13.0/webfonts/fa-regular-400.woff | Bin 0 -> 16800 bytes .../5.13.0/webfonts/fa-regular-400.woff2 | Bin 0 -> 13584 bytes .../5.13.0/webfonts/fa-solid-900.eot | Bin 0 -> 202902 bytes .../5.13.0/webfonts/fa-solid-900.svg | 4938 +++++++ .../5.13.0/webfonts/fa-solid-900.ttf | Bin 0 -> 202616 bytes .../5.13.0/webfonts/fa-solid-900.woff | Bin 0 -> 103300 bytes .../5.13.0/webfonts/fa-solid-900.woff2 | Bin 0 -> 79444 bytes _preview/4/_static/webpack-macros.html | 25 + _preview/4/genindex.html | 342 + _preview/4/index.html | 1 + _preview/4/notebooks/complex-search.html | 839 ++ _preview/4/notebooks/enso-globus.html | 1856 +++ _preview/4/notebooks/how-to-cite.html | 396 + _preview/4/notebooks/notebook-template.html | 661 + _preview/4/objects.inv | Bin 0 -> 379 bytes _preview/4/search.html | 371 + _preview/4/searchindex.js | 1 + 85 files changed, 37231 insertions(+) create mode 100644 _preview/4/.buildinfo create mode 100644 _preview/4/README.html create mode 100644 _preview/4/_images/NCAR-contemp-logo-blue.svg create mode 100644 _preview/4/_images/ProjectPythia_Logo_Final-01-Blue.svg create mode 100644 _preview/4/_images/UAlbany-A2-logo-purple-gold.svg create mode 100644 _preview/4/_images/Unidata_logo_horizontal_1200x300.svg create mode 100644 _preview/4/_images/esgf.png create mode 100644 _preview/4/_images/esgf2-us.png create mode 100644 _preview/4/_images/globus-logo.png create mode 100644 _preview/4/_sources/README.md create mode 100644 _preview/4/_sources/notebooks/complex-search.ipynb create mode 100644 _preview/4/_sources/notebooks/enso-globus.ipynb create mode 100644 _preview/4/_sources/notebooks/how-to-cite.md create mode 100644 _preview/4/_sources/notebooks/notebook-template.ipynb create mode 100644 _preview/4/_sphinx_design_static/design-style.4045f2051d55cab465a707391d5b2007.min.css create mode 100644 _preview/4/_sphinx_design_static/design-tabs.js create mode 100644 _preview/4/_static/__init__.py create mode 100644 _preview/4/_static/__pycache__/__init__.cpython-310.pyc create mode 100644 _preview/4/_static/basic.css create mode 100644 _preview/4/_static/check-solid.svg create mode 100644 _preview/4/_static/clipboard.min.js create mode 100644 _preview/4/_static/copy-button.svg create mode 100644 _preview/4/_static/copybutton.css create mode 100644 _preview/4/_static/copybutton.js create mode 100644 _preview/4/_static/copybutton_funcs.js create mode 100644 _preview/4/_static/css/blank.css create mode 100644 _preview/4/_static/css/index.ff1ffe594081f20da1ef19478df9384b.css create mode 100644 _preview/4/_static/css/theme.css create mode 100644 _preview/4/_static/design-style.4045f2051d55cab465a707391d5b2007.min.css create mode 100644 _preview/4/_static/design-tabs.js create mode 100644 _preview/4/_static/doctools.js create mode 100644 _preview/4/_static/documentation_options.js create mode 100644 _preview/4/_static/esgf2-us.png create mode 100644 _preview/4/_static/favicon.ico create mode 100644 _preview/4/_static/file.png create mode 100644 _preview/4/_static/images/logo_binder.svg create mode 100644 _preview/4/_static/images/logo_colab.png create mode 100644 _preview/4/_static/images/logo_jupyterhub.svg create mode 100644 _preview/4/_static/jquery-3.5.1.js create mode 100644 _preview/4/_static/jquery.js create mode 100644 _preview/4/_static/js/index.be7d3bbb2ef33a8344ce.js create mode 100644 _preview/4/_static/language_data.js create mode 100644 _preview/4/_static/minus.png create mode 100644 _preview/4/_static/mystnb.4510f1fc1dee50b3e5859aac5469c37c29e427902b24a333a5f9fcb2f0b3ac41.css create mode 100644 _preview/4/_static/plus.png create mode 100644 _preview/4/_static/pygments.css create mode 100644 _preview/4/_static/searchtools.js create mode 100644 _preview/4/_static/sphinx-book-theme.css create mode 100644 _preview/4/_static/sphinx-book-theme.d59cb220de22ca1c485ebbdc042f0030.js create mode 100644 _preview/4/_static/sphinx-book-theme.e2363ea40746bee74734a24ffefccd78.css create mode 100644 _preview/4/_static/sphinx-pythia-theme.min.css create mode 100644 _preview/4/_static/sphinx-pythia-theme.min.js create mode 100644 _preview/4/_static/sphinx-thebe.css create mode 100644 _preview/4/_static/sphinx-thebe.js create mode 100644 _preview/4/_static/togglebutton.css create mode 100644 _preview/4/_static/togglebutton.js create mode 100644 _preview/4/_static/underscore-1.13.1.js create mode 100644 _preview/4/_static/underscore.js create mode 100644 _preview/4/_static/vendor/fontawesome/5.13.0/LICENSE.txt create mode 100644 _preview/4/_static/vendor/fontawesome/5.13.0/css/all.min.css create mode 100644 _preview/4/_static/vendor/fontawesome/5.13.0/webfonts/fa-brands-400.eot create mode 100644 _preview/4/_static/vendor/fontawesome/5.13.0/webfonts/fa-brands-400.svg create mode 100644 _preview/4/_static/vendor/fontawesome/5.13.0/webfonts/fa-brands-400.ttf create mode 100644 _preview/4/_static/vendor/fontawesome/5.13.0/webfonts/fa-brands-400.woff create mode 100644 _preview/4/_static/vendor/fontawesome/5.13.0/webfonts/fa-brands-400.woff2 create mode 100644 _preview/4/_static/vendor/fontawesome/5.13.0/webfonts/fa-regular-400.eot create mode 100644 _preview/4/_static/vendor/fontawesome/5.13.0/webfonts/fa-regular-400.svg create mode 100644 _preview/4/_static/vendor/fontawesome/5.13.0/webfonts/fa-regular-400.ttf create mode 100644 _preview/4/_static/vendor/fontawesome/5.13.0/webfonts/fa-regular-400.woff create mode 100644 _preview/4/_static/vendor/fontawesome/5.13.0/webfonts/fa-regular-400.woff2 create mode 100644 _preview/4/_static/vendor/fontawesome/5.13.0/webfonts/fa-solid-900.eot create mode 100644 _preview/4/_static/vendor/fontawesome/5.13.0/webfonts/fa-solid-900.svg create mode 100644 _preview/4/_static/vendor/fontawesome/5.13.0/webfonts/fa-solid-900.ttf create mode 100644 _preview/4/_static/vendor/fontawesome/5.13.0/webfonts/fa-solid-900.woff create mode 100644 _preview/4/_static/vendor/fontawesome/5.13.0/webfonts/fa-solid-900.woff2 create mode 100644 _preview/4/_static/webpack-macros.html create mode 100644 _preview/4/genindex.html create mode 100644 _preview/4/index.html create mode 100644 _preview/4/notebooks/complex-search.html create mode 100644 _preview/4/notebooks/enso-globus.html create mode 100644 _preview/4/notebooks/how-to-cite.html create mode 100644 _preview/4/notebooks/notebook-template.html create mode 100644 _preview/4/objects.inv create mode 100644 _preview/4/search.html create mode 100644 _preview/4/searchindex.js diff --git a/_preview/4/.buildinfo b/_preview/4/.buildinfo new file mode 100644 index 0000000..4c1b2c3 --- /dev/null +++ b/_preview/4/.buildinfo @@ -0,0 +1,4 @@ +# Sphinx build info version 1 +# This file hashes the configuration used when building these files. When it is not found, a full rebuild will be done. +config: 80d32701004a5ef0eb8fd00ee5142c1c +tags: 645f666f9bcd5a90fca523b33c5a78b7 diff --git a/_preview/4/README.html b/_preview/4/README.html new file mode 100644 index 0000000..9a93336 --- /dev/null +++ b/_preview/4/README.html @@ -0,0 +1,529 @@ + + + + + + + + ESGF Cookbook — ESGF Cookbook + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+
+ + + + + +
+
+
+
+ + + + +
+ + +
+ + + + + + +
+
+ + + +
+ +
+ + + +
+
+ + + + + + + +
+ + +
+ +
+ On this page +
+ +
+
+
+
+
+ +
+ + thumbnail +
+

ESGF Cookbook

+

nightly-build +Binder +DOI

+

This Project Pythia Cookbook covers … (replace ... with the main subject of your cookbook … e.g., working with radar data in Python)

+
+

Motivation

+

(Add a few sentences stating why this cookbook will be useful. What skills will you, “the chef”, gain once you have reached the end of the cookbook?)

+
+
+

Authors

+

First Author, Second Author, etc. Acknowledge primary content authors here

+
+

Contributors

+ + + +
+
+
+

Structure

+

(State one or more sections that will comprise the notebook. E.g., This cookbook is broken up into two main sections - “Foundations” and “Example Workflows.” Then, describe each section below.)

+
+

Section 1 ( Replace with the title of this section, e.g. “Foundations” )

+

(Add content for this section, e.g., “The foundational content includes … “)

+
+
+

Section 2 ( Replace with the title of this section, e.g. “Example workflows” )

+

(Add content for this section, e.g., “Example workflows include … “)

+
+
+
+

Running the Notebooks

+

You can either run the notebook using Binder or on your local machine.

+
+

Running on Binder

+

The simplest way to interact with a Jupyter Notebook is through +Binder, which enables the execution of a +Jupyter Book in the cloud. The details of how this works are not +important for now. All you need to know is how to launch a Pythia +Cookbooks chapter via Binder. Simply navigate your mouse to +the top right corner of the book chapter you are viewing and click +on the rocket ship icon, (see figure below), and be sure to select +“launch Binder”. After a moment you should be presented with a +notebook that you can interact with. I.e. you’ll be able to execute +and even change the example programs. You’ll see that the code cells +have no output at first, until you execute them by pressing +Shift+Enter. Complete details on how to interact with +a live Jupyter notebook are described in Getting Started with +Jupyter.

+
+
+

Running on Your Own Machine

+

If you are interested in running this material locally on your computer, you will need to follow this workflow:

+

(Replace “cookbook-example” with the title of your cookbooks)

+
    +

  1. Clone the https://github.com/ProjectPythia/cookbook-example repository:

    +
     git clone https://github.com/ProjectPythia/cookbook-example.git
+
    +
    +
    2. +

  2. Move into the cookbook-example directory

    +
    cd cookbook-example
+
    +
    +
    3. +

  3. Create and activate your conda environment from the environment.yml file

    +
    conda env create -f environment.yml
+conda activate cookbook-example
+
    +
    +
    4. +

  4. Move into the notebooks directory and start up Jupyterlab

    +
    cd notebooks/
+jupyter lab
+
    +
    +
    5. +
+
+
+
+
+
+
+
+ + + + +
+ +
+ +
+

next

+

How to Cite This Cookbook

+
+ + +
+
+
+
+ +
+
+ + + + + + \ No newline at end of file diff --git a/_preview/4/_images/NCAR-contemp-logo-blue.svg b/_preview/4/_images/NCAR-contemp-logo-blue.svg new file mode 100644 index 0000000..3bcda63 --- /dev/null +++ b/_preview/4/_images/NCAR-contemp-logo-blue.svg @@ -0,0 +1 @@ +NCAR-contemp-logo-blue.a diff --git a/_preview/4/_images/ProjectPythia_Logo_Final-01-Blue.svg b/_preview/4/_images/ProjectPythia_Logo_Final-01-Blue.svg new file mode 100644 index 0000000..961efc2 --- /dev/null +++ b/_preview/4/_images/ProjectPythia_Logo_Final-01-Blue.svg @@ -0,0 +1 @@ + diff --git a/_preview/4/_images/UAlbany-A2-logo-purple-gold.svg b/_preview/4/_images/UAlbany-A2-logo-purple-gold.svg new file mode 100644 index 0000000..4fdfe3a --- /dev/null +++ b/_preview/4/_images/UAlbany-A2-logo-purple-gold.svg @@ -0,0 +1,1125 @@ + + + + + + image/svg+xml + + + + + + + + + + + diff --git a/_preview/4/_images/Unidata_logo_horizontal_1200x300.svg b/_preview/4/_images/Unidata_logo_horizontal_1200x300.svg new file mode 100644 index 0000000..0d9fd70 --- /dev/null +++ b/_preview/4/_images/Unidata_logo_horizontal_1200x300.svg @@ -0,0 +1,891 @@ + + + + + + image/svg+xml + + + + + + + + + + diff --git a/_preview/4/_images/esgf.png b/_preview/4/_images/esgf.png new file mode 100644 index 0000000000000000000000000000000000000000..c55455b289b495d208170b495901c67ae1f34176 GIT binary patch literal 128511 zcmeFYWmlW;6D>?}iUetK2wEIk+}*u6ZE^SF7NBTwm*Nh^9f}us3-0dj5&{pu^FJ@1 z4{`D)Yh76@xia^jnLT@E!c>)IFy9luhl7K|l#`WIgM&k$fP;hAK}CK$NplPM`SwQS zBBkS^?qKfXZscSJCuZtkY(^nxXJlcfW@cpS={RI22>0$bS58t)!(-`W6~!?9HdEwf zf?9X2@xwq(CU4D7Dv}ObkSMxjWUV~Ob!(%{rez`os<&*g{QLN}a{dl$zjFRK%J0j( zRF&!n`qPGbjm=^DVCh^Wal)^trXIu8Zlr9U-+R1X*3UT#_NNAadGvaAicaargmgOi zbOfTlUGe|D{+|W@p9TJ(1^)jQFpR^lM*Hu;Tt?*_jVa8O`YvWr1$)+6l95HPhTuCY zw&;JKQi%DzidN90ptaJ|p$RP4{V5UGxDR_i0ip|RsZxPu(8zonujPxwdMlZh79G=x zWhH%^7j}JY*R{18ao-`~7joLdzkSWG-<_}7?$(Q0nT7As0Ur!HjQC=ZnLmWSTYEg-d>&@_Gcv~Ziq+if36dJ?PM(m~3+Ql^y@eR18|5>X*AIyKNckkeiE(3)k?YnVCkm^i4@*J1I8zuJ%R*wuyo7XSEZ*yDJnoxzE%dH}CwUdXU4Cca>M& zGV0a)Y9vAU?thmG-U9l$CW5hwHBKpN_bmtq8##NNb#)tg=z9JQSb8MB2RHq-Os)K~ zK0WOX6lnL)JT$H-eu8`)DZFlN^=_p9h%LO=lSi~p83j1JL$Px43JLkt{ZiEN%gn`E z`aOj;#pa`_Ze^U#ze|kB;2$S{_ffK;qB7sp9l$PrPJjPYnQjJTnw!sGTud`E4Hs4# zR@ilXb9+^`BP=OrUJuqL`5y@Px-P2M1$l8Qy_?)?g>fmpk41l>z>{+q*ek!@SlB3k z=i>EkyT>Vso9I@sIt=HqUU7GE(M|e70jh4^xI^n4 zoFI^rVUCp*04{r4hjYNbTaPL`yQRgfn(AqqdCJ(>v=WOGmoYNs#S|7ctTJjUBU)j% zNuaStX=;8X;}tw_V@vK-lSm=>&3yO!QqQ#9#P1T2POFZ6x48EU)4Udv$xvT1o#TcxN4el8glY9 zk^iZzT%jO)J4V#dk(HA*(j88()Cz?b$yt-3&N990zXZB3 z7j8^1E!ihoOyFix$stVm&}f_eQ1Y2>EZI=p4vUM;ccvGmPB3B!m88OH;NN;#FdJdk zq+M)GI~ul`-CvtosVy#QIr?^bXK8J}Dz4VVQNjrM#~O2{`+u*B6(GZs{WYAYQ8%#T zveg^9+Lk;1jo;0=XzG5`wK-}}5dlDg^)<^_o7gWG4S(2+>`GBf5c^^oZ}*Z46e-o+ zLMm)vQSsr2@n#^fk*Uc-z>8huexT7RVu*f{?9O)h^ZT}~T;-DE-Fr-hA0j#QF!4gEl7jR$M7^e$wp4M2TUI z4!6QBDmF=aZD~Oer8xe3Hy*C03nYNpST*wY59cj%`Htu zE$m*e%(gmGo~r;bdqt%l5ni{-HKPDsUyB77eXitD>8;bWrG)pZi_fd&r0_=!1tS{V zum@cV$Lj_uH{Z4v{T3FnpXIuGEUV`%e%B&u4ZAO$ZKD+{>LIol`r1ZUOq6}nN5&yn8?O33mrRsB#U~z`A?Ia*%d=d<4;!B3 zp9ERID8k;nexu%vG+Zehs%~^gn+Ph3EjRl9@^<$G@E>bcOB@NtoPCiT37kTI+1< zsrH0ykJ@Xhk4%!q#tfQF=WD+AD`%wAW;-h@J5z-pq!z@!?9m)?CPBZRhP9Q@qB;dC zV9)fYY*>KX3o_h#(!@)k({a=T4_kpz0Tc_I+mfX6pD&n+ zVF7_v%kw+#(aOO`;DG=&DH;)`s9MEQ+AR0tQ@oxBOb^HptSm9P0t#=dNl9c1(kHf%Q9)7OII2gJhFG z5$T^&p6IB~)*P*{Texj_IngAu(s;Z$i6xD@Bs1eu$OgyQAq%ED{2ep{l1U@ZgQlE= z00v@F#MR3MiDZ?}s=eu~AtyLp2gBHb!U=>|1?s9qVAesssvX0v97}gr&ui6k<8GjH zKCZOKFGnuHsS^U~IAnZr+aq3_Mw{o;P9I~7T05VI!7suueSHoVt4p(gLjLF5KUBK{ z0WivYICCDozuSOD2vL4DuByE+Fo+OQr zFMq|ZRP#B{Dmb(BOTRc;YA;1$m{B$Z?p4v(g|ZB@{2j60Vp1)HFug_h`s|DXu)#rW zDJ9Mw>FA=B%WaGJy5@1pBRw~Hu)ze=;4X2BlO7#96}1Ns{Qr3z%y$=#2F`vt9fzj> zAi}*UDd<-VsQ!XUNS{=eRb>wYXl8t#Aj}=UC>VGm#eE~1UgE0?x=*_FI0+%xr@q9k@w9ZA@12x1 zVpEhKb&LLzCS`o{{OS}PgM@3aH(DT~hao$mi$;|EFjkC++UfNiHHWjV?vU|w{juxg zng}^jb<tbPylNztw{xG9H0QClfHk$IDU}nD^|$$TprgbVx*; ziV^3>uGq6JR#=uy55_SQ!u9e$B?R)(Vpi1mV7Ib@S#hRLbu(5xL=20d-|`?<1uq^kPL)^u z+)YJx7C_xPS`-fQTmfT~oOb~LDnUBfXj9ne)PW}N^ibopO;g-y6>1A8YV#-}YB?ar zltIP}k~4^SU-4uyj2BY4@h;3KBEQpfYqEVUxA_RWi4lrE+=zVTn6E0;?tTxj&hi;R zK4tUpWNYYlGs0?H~a>+aFk2#ApE7TTT16W>Re%}Da&YLpv+2+GmKdW{`Rq07aL9O{NjTW zVmF#t5Rhm8_h2J4SnGqidNi(d{iXyNVwILeLC*R6s!Rh$9q-oDd`!sfcL) zd@r)P`PWi2y47C2#sKZ38c#*UTvhu#towx}=G>}^gcy_8!rYvhIp|@olAXu5#$HIo zpj5E^`Yg_l2Jq9pZn|+>5B>kp@Vvjs;$ZMn zuH-U1)jVf}>3VnMPZxFHsJ1ogSCwrW*BdOAg!7%C89fD{(ah-QsuWf84F7Q(%)$&?RYGjdHhr_qYws28#0i9|~L&|Pr4R~qs2i1Nb z$sVwiZ|xTf6#o7&wqJuJPh}|<(@xG_%pRyty|P+pVcZ=-mKbp=CMa}8JuV>2_$B2? zh1G^UN*b#3^vHk@;*2T#UoYcNbdV&;2&g^*s1D=gUfJ&IpJD*YOC65h!7^whuETl) z^xShja!$b|m)Gk)!EE{m;iIDq>^lFP)_zEkl%-rAbJL6M;Osu#S_dQkkAC30Jm_f0 zA3hpNVVR|3DA(~B%m*KtzWz#O;~gZPybVmiS@JRcX4m|1rju>Y#P;1$+U|EhfzNkD zgl3&Tu`S<-k_?SB0>Mr?1j1?v3m?y6y{Gvh7i9M>m(iTm#^0PWWI_l*nbsnD}8OF4VTW246 z*%Wm5yY^+yW_&;heMMk5z*|Rlt85rb&%Gvbly&PavgSZUnp&Ejnwq;b4F5C=p09y& z%ZUXUxOvzvIo*CFu^$j1{y!C_VHYtO8As=`z^>6d$uzsLV8ANd0i6n#t=ZVV^qgp8 z4RXE3{glSMcsj$he;wH&m~%K6KIK&0f<8RQ)m&H z<}F?LIkzJ6VnDrtDtm7E{T~W8bplDM;m!PxcV3Qu0(L)IGg$S$5BCJteO{@mOtV+N z^UV3F0L?of*qts&?O(ga^dtuz=|K-9|Mgp(K5b>sK8>X8E1;9t!Wl!?*w$}ew*<1q z-2ZQ;2__QO*-qsNXlM2~Ag+L^%?ADey%TdI63(=TQKNj)mC&}-AZ9tMS~G5MFFWRS z@D&)=qGhFDnA@v6JB*%z1_mS`p+*q%*J}dui;i+DLJ2vyMI#wn3?Gr;;l(VeZ zCs9hTj5n!uFH`|G5;B~igC1GNni3Bwh9FMY7}bf5f)B!yUvM$0-h%NV6~1IS?c)?h zx5QvwRlTas{b!$(Csz%_@pxqgyq-#0oKAIJ^GtBN^j9oO!QU4jC*8?~okp3#*!p2q zuPT1)JAU?^6a8hB>2n{v&tSdM_}Ee-L%DJzDL{`d*9~nyF!uin_iBnBa71tn%2xLP z{v4d!H8P70#fcEvtSX|23l~ zz3&UYWI+uD$bjtkINy9_$>K-=YPL@#_+LvjUjEI-nZ%6SiVAb+U%!VW5>W77`I9!l zb$T55T9bPmoGEar{9h6D+m)&6Rpx~$wFS4T1y!py$ur?A!7zmU&b{+NMaR+o&Y
bRd5pub0ffj_vyNOIz2dUAlb)O& ze@sL;{d<1XfG%Kr3DYi4%mo@Eh%Kf3BE;+%jtG;pqEtdRe-Awv7Ik7Dl2d;(hgcSE zXkwv=bIiCIN9v2r$x!2o;j`{w;~E*!@J!R3wkSu(SM(}2fpXMJ(qij@ajjO5x(8)! zI4DU;(}gt@g1T#Ko#U~AF!$Jjqx|sGPEv& z#_DJ0BhLjrRnuJ;IqHWKM8iE#}L?m9gl*N}vw7TOe+poL5;O8;R4wa?6| z$T$I>1|u1yJ3tMt`GuV%RZ-fLqLnpBwrP_Q2kde1lPOzw?RJ<{oK^?60H>ddVfA4??G^w zokaNTlXkkbQL4(+91;`2b0vDrNV6`pl09U|X=2*(*0WTD547CTEBw0~SG6G80UNM{ z06KKwJ<~dwo9jP5bYKJMSM$tnc<Vh=N}X(XcYyq<(6jKRaF+t~}n$ z-AFpazEuo0<-97DF@~Gc5`}P@h}{HEGB|#2u_wdM+v~78B0*PR@$pTc*Vs>BPzq&H z{&VPMHmN1JHUDnPr6-)bS4~4ga_pU*7!CjA59h2Fb5s!!L_`YZ+tcCd-5W97T&-p` zXbP|{i@<{q{lP`)K&~`fqnCfPN{Nc~m9_bA;(V3k*wK-95_Wf|%?~;--O0LByF81Y zgvO6pJp)ba61E@lc8{ZTn9;5_+WENeQ7Jy3`>jaX20Kq*nEOqR>>qF~OV>PZPDI${ zBjUzDE)M^~32SR9eRj#Ppv*?WA@I(0V~e$G29I|@i88*yHrGMH?w6Z^Nkhh8&NaFR zxP@V5?2{{BH8eavvw{X^0nN?hOu3Dnt#=JeX(B?=O<>q00+fUDH}mKx64^n$Ep{c_VnLQX%&_0Mr!dqssEY5x&+ub( z$C&Rv$};?52Eup(CS3!4Ssn-0;?8GTmWnE!A`E$)KYktoSr0HuuVLq){sn1>AWDR2 zUNML9W!-X>1%d0E9%{dxgzY9I&`JRnp!usyvFXQQ`R1wZC!A1&6{i{~lb>UuOSS{~ zp=$2g2axXg(Q^$n{#@rGTl6nQvA_`l!IWE?Ad#gCkB9Hw=HQ*Ju zS0PyZq!ara<9b~w3JVXNr|6*1;T(414J!sa&m_rq55eG*G(Qwqe1 zJu>_ug;36YbJfdu+Y)wTBd|krUOe|);$(zFy}C@5ftO%~Uf|54fZ`n&)4}jJzKDnb zLmVB|6V&v~xq2MBSCTGq)L9MfEBW09B_)=aiz8HYN^UovTP`lm=W8$Mn__&goy=PD zTIT1o8m;_JRQv$-7ZeY56=9C4*PkP;CS?;)g;l_S|&U~0W30yMqT#4o^;c2?ep2Y983 zl{o>*0-Zl9lU1ZI!itEy=Fc9Y%ESXQ-DzjaHIv<~ZmAs8xZPke^}`JS-6CPE!LgeEJ`IIr;uFHjcW`)8Yc zE%Ur&vTgnh3zN|vlM+`Dy(bclunyW1W={0wq;TRvVp~mWb$rx2&nfQ=eTU=$?-idO z>u;Ybd@C`OW3pl4r)&0S`RnI4xkHB(Qsz`3f3eaZnzB3wb9nu?L5amNOG&_r zj9JZ(5SyV^bB5we;6Mg*knDOB$;-*|{XLZK_}Yox(wK3_>kU_z*Q+*(UB^F--Ws=i zd1ApGv-{Ear0t(T@;m+LhTf0kDHr}5ak%FlUkEzW^5C7YE*yab%kvP2Y>@s_hw@GgTB`Dyno|i758&Q2?=ckvNW(yD`lNOgh2H z5Bqgw=+v}(Hw7QDVJ>Yo)p7Ok-E388q*uDe^#aL_TeV%akB6twFSlreky zoiJfI2Z2ayG6!9->W+<7=zsOZOp+fI!xw%4{J3>r_d*l88>QS=GI-YAKJW0R^JAlU z)7w!;(VmSAMBfE*xg<5;vZ11PK$9Stm6z~dO5rH^!`F$XEPIP}p*(dfdgy{LwZP8H5sQ|UV{3Lhq`AU|d5&I~TQZs;EyN?| z0u{L{5BRf!Y=?}bx6M@Ty$do_Ao5>DC%M*)E628@lB-?3XqiTKPUV z2rDq>oVCzkD&wHnQuh9Nj%6Y*=7(`^8RNC3k{o`;=k$Uc9FepP;QO)A87|VCl<(4q zVLZ@7p0#&g6?TasGmG_zkg*)IP;~XnE_sm!J%Q`w9Dwdg$GR<1q;PbEokBi3%~5}e zuN_3_Ax_6gw(=%|Vst!d%2P7(~d!9Hma9+&U6*gqL zcjXK>q`QS-U~y(j6v(#b#REVArw*%Qd>azK2UI9WZf zEgV!JM&l(=kjUJb#jw2M7HB_`~VNwPNrowgR_77_!LH5hu`s9X6i)t1<2Kv-Kl}z?90>u$;e+hy& z0P@AO&0k^=7(T?l46;mKbd`}~qLQN@arL^-KwWmZ(g)|~qzV=44yS>g;aR-A@+R-5 zx{3dcxAN?8CVwCh!uHD?ue9eluk0BJt&a+&Vbi7LNo<9J3np>V0awwu@RFduU$~{@ z*4sbq4UYpuDeW^tT0AI#%ef8KaxG_f4VyU>0#V6(1ye1%SHlNwS5rL1dC^@~#DGzn zNFY&qR&L%H#MXK7qkYa$_ZRh`- zyCs#Y<(9y!{c4eq18o4PJl=Gwf7xVM4uipOIk(AFenNADQaCZP2_ zU8U4kLsNdW21KjiTxiv#wffVb0$1E^wZ1v;QX+kXEUC%oSQzB>M(@narh+@Nt_ejK z?$+hgbj?^lpCR4w{n6AHQM_*XY#@Rdd%rnc#W|>W9C$i50@!D(=I6a zp=wM}eqdL#jd#+e2sV-EoMmvorIbOF_(1TBvn>DG8QodQMa~M#=ed@u1sZPLQo6*P zS(LxR2K;x%$1l0=R}<*gIV)4)gNOD`@ojt!m_|Vf20YdqE8y!oL0n@L2)OC(4G1KI zg2J&yvXYGQR94*hR$a!V5>r!^r@OGLM*j-G0A82>G3f)84aA$1~)@Y zp7!=Dol8`jT3W8wI-70kifdiuBxYqg^deN=q(!)wYPLMMJYCa^0Nb|lOU9*QFR}+X zB|t8&N8=CYo2Q(2H^R(pEJYugA{f|2QiT831o$>VJ&#V$wpXR@OH<7&KExP0%3Po6hTo`5nVhpJl zi{-dXwDLb?zamY6sULs(niDT-?@nc=5F}g&j#w!~1z*)caJx}oiwhm%eXq@dFiRD> z_C;awclsZ5dnxjKPN0t)&bI&uPqFv`$uNKE9CZyb5XYs-V&5MV3$y&nb-)_R@d`zGyutz>3R#5mG zkg!GZzry9Bo5Xc#2%^(~R*E?brgo1`9_lf5Kr$>pNZ2|ht>^TcY9iM>Pg(A|F+YK{ zYpT0izwx!S=sx7=JRGEsFZlKx3HrwIyDB2QY6=N*&oMsY|?x#36HcDBH66=2b{r!H3 zWPZt}@db(nihr}mI2Q?b*9r=D;c?P7{F>JF8cd$(Vf|OrX@DQ>g6x+3@(5+Ug25c~ zCQjJvITc|Ft^}PT?|`<0Je0lyhtjpRR%dj1KFKtGF+*kQoU!ByX9g)~;X{*L(OjYW zY0zKQSVH~!2>4QHdpJ-K}NRnd<9Dm8BgL= zMal=Yw+R)sCUA}}{f_E9z0k>F&Va#L-nhTqs@Q{$j^tLJCOT62!Z!bS5Uf%S@(O<5J{E|9P@m@mUGb^-8+4jBo}@;bc!^VI$r{K}P(JF!s`G4YOT@LcdYB2XdiK44 zdUiFdFIl0|l)6DYBK(~<@G>K{4%K67Up*`ye?dD+C|XOJO=b(T6OcdoBt6t0(Ce^n z*;Mub>s7Vr9F!gxsG^SGOZik3Sbv?Ha_~66^pN`O%&bWW1=GRW;JcM~5HwdRh7Dai zk_QQd8>b8`hq`092nZE>(CZdaCDxCe7ybxGoQ}7`7VzbN<}Fm^W=(U#O=wC?3dNjz z)?EosG}#N0k3mQM(njPFg1De{I23^KO=lT`@_Py%Hkq`?(nijNmraz3=>=1YMW`H= zbg#5$i_TOTCNP}e4p>qmN`H8?D_#yGLnlm2*t%~>nRnxX=&O1YcVbk5Fce1*vMh}3 z)Arsky%#g)^5@JAr0+;iF(*au8yhb4d^w_2XbiLeVIT`MZf$CnK5UpX;@`}k6XJd~ z4bAe(*Urk*Zgw(H`&#-dG_3*hc++CMvi-3k#vh2E#5J3gw3;9Db!S3O|47g4WZ0)9 zMZIVEYK!)!+1oyM!0)cDvpIkL>O7`HQ7IGQ4zny}+TWxd;>tK|hqAonbK3^ZyrS+o z)lAx@W~n$GPiJlN43X}f_Sl*CTlH5VfJglYHS78G8ww|W4IOFyZUwp+@GkOsaJR;q zXT%f-uYC4Y!CZMf@okvw0jqf0wWZA;!Z7A|Z1mY&UtuA*^Q6eqOh%w_?^>hjK8UZ( zcY;&TcCJOJB4pMFgknP>pxZiIRUg){DRJL}0DQ&4p*H=n<$D_g1d#*zagl@Ruq2Bg zd_p3ozXwy}q_5~18P;C-oFNB6Ch6maaMd1Awx;TIK=R#&%~ogF@m44S*#8ujC`@sE{G4X2+eP@0$D^vAsd4Zi@lZf*0m%Gmc_7;0M ztGgA}^)ExF(N9dvk96WYd=M2B&`XdFsgSTd;Q5YTudXuG+D@T>Bn$}v364J43QVIY z4#8M8x~&~Xn;HhYwEQ{l?(5m(Id@*_cme>frBL;T#2H$P)DwN5u}PMe1Xe!o&PCID zrrwT!pYsmsCni~gnZZ!s8Xy0l8^3p#2iR!Cj`k@%M)!;zTa)zK&D~24%2zFLXUrKu zyaba_QR0)5lf9>yW@6cg{W>krvGMw}-PG+%frn@>K%?*T9<)&U3p#-V>DgN92|Luy zXKt7{-#$)qP2NpsbT3e%r^nun?8SGXEC^7>jfgBxspn1;p4}C`)glzKIgb-V)@AE2m@G)~cSNvw7;_eS`11U)L^&NzPkd?#7i|mwn}0QSpT^ z#KDWE>3z$0hS#4s10I3b%}+>cg)8$vV7VJn2bsg(;b8LD)HXH`!YSl<-KDd8ww#Mi zHR4&4g)@IoRN$otmv!q^3m=2MTfv7IKi09meX}WFnbbN+!TsAvRQ%Pg@!L=gfSmt$ zZ0|V`!i!WwOf}cg_*iZne+onm;fgX9o0nB##z8G6MaUB>C==`r#=Wh7LG!t#j%tYZ zxGxJrS2L!NZ(&m%hI2W(h$~1)iS+1`8^K+B%)7KK;8B<^|K5qX zs->Vl>#g41@ZlUDts@l$EexaWStr@0K>lRJ^j8o|p2!iG2_~K>U;1WL-1D7ZHDbRQ zwj@rF`03rT{=44`#nl>7!INC6BO~0ukcpRiBx@MBEwrOnHzH?l1NfX5%av)qA?ME5 ztYx)7U!q@cSUl)C<-EP^7*k+05EV(>2;3+qNcNr`o@}M zF>t8GpwQCvc>h5DqxcP)q^uLA&qHWBx6VB;k`L-vtj;;obT1x`RoPo$CFQ`A@nQAd z(4%tnbl?PO(R$m`c%!3E)0zy3P;O8$;6*qgn0M9Y<8k;b_Wk45`owrGiMw!KvkL-r zV8UX=`rh?76QeElNy}NI+dBR;pA6hPk1BI$iU%9FBm6#TNX+A0t{@h;C^yCFaZ@U0z8re-gF}`l-5hS;u z{<5mq=Zp4qJHBE014)EHi8iyP!IzTjm`HoHiBZYUx=%$2a%xgnpPZf<_ruKK?08rx zckSNnaJgC)eyvy%PA=)F4oAm4l$B>xm3gN{kU{^*Y;YOnYxlsvu$f}srBmEYZ8IF}+X@arSD{Lh`~p=85pYgu=SNv zX7R19WqE?ud<)U-bRnd5(6 zxyo_Qtvr-11_7ai=PM8d_`gR0M5?i;$CqxDggfsUmXLeYGU^Bs%wKkbK` zHt587d9-I9;qsBc;w`%3xGk)$t@#I|;fTVm;gP)jorwO>xhJry0 zqOC^IV7jR#X=2`(=ub)XY3lTua}eXHuE0ZY`}c28yYhWK>wbc{Wk7U%*2cQflh&;W zk(GJJwmNM-y~s+GK) zfbW4%AFR$=J|Mhx(An!A2UcaSMgHE2FRf*O@%I)2?ui%HILvZo1_Xu3$l)Cfg3ezb zJ%sBXsfXS$f90mMfBfZ0Wq!fL8JtB%nJ721-m_d>!l_Xv(^r zGB`iGiUCKp9IGHnT;H`ltG~e<{|qs=E%S_z9eWHHH0%A5-0fhaVkciq|iZVm9+t+OHra-1}v4O$;*_} ziqA@x{?w?zLA=-zcA7qD_&JV(aM3J^6YqTYM`y=bMcWqgrk7dBdDUmSf>D63Hgm0?nQo} zG;+^9Y$2#MlM+g|#hq%Ox(KGyt;BnZ*UQ4=Ffg|8MO#bxua3R8rLsuaPi+SnPaP+P zUNk#q8>?&ih{N(j3Ca{E`diE|C$?&+0}+th?jknocKGnD%|rgiJfa%w@7@Z9Ha&Xc zEfK7`&vY5g&1aFKFUKP>n@#eGOgzqJlM^2bt;x8rw)it@|%O5m=PJa=pJe5?H+n zq+8Fq%Q8B(Nx%9s@SefATd%1pJ2b1_*C)8Dza{Y{GdMQA^JYO`3|mlpapdGKEgm`f z(<8LsuA%Y>8}S9k$h(Mc%Rz+s%n@Y&Ur}gb*4T>hSRJ;{`RfAt!gDcmht$2(I;Yvd zY^{tlk!^t$T*n)@XxnKY@!nvw#ZNHt;`u)`Y0W`w4Fx6ws~+61j|ODOjx7faen|M) zW)~D=si@vto@n2$YU!Z*S^{St)|0(on-^M1&>UPcAv{ zQ4UYDtgL}E?yzBYBKi+FCim2zn)hisU&`jOwT7E3a^b3p3C!TX@A6lqvh8?cRS7g0MzkewTSFsJeMAE zxOY0Aqc)`;2VgMH{zN3yns$pgh+*cj*aHFRfj6czAAdE5Mm;ywBvBh(66OwXp^@n_=NA!fW7_GoTsb=2vr^k>wq@WMT5n3&k}rf0yoso-BdD!Dml?t;`b3_W3xuau#Q8k@pZ>T~#D12R z#3VMZ$DrsBMuKrnpWkpHeIX{6^!YhyhWjY{JgVJjwrHAckrZAgdvGlSDGhfrRMLI7 z3Jn{vjB+hGyU|`h%L6_;0Uu?GZ#VZee5MnxvEEdEecMN;L$^YCX(d^ z-2>gIEBk}C+ExU!?uqvV0@mN5CdV$%J18OvYbjMiPt7cO^jG&*Jt}LzPb|Im=}-Ue zn|n1fh%(#S8b!&{o!irf=1G0vOlZBDEBQdWqh170d2}5kKj3j8%R$U3;2(Kp6u9TI zHL&PuTf9n;AA$e=L$bw7;RZ&hUYvMb9oi47<>13!o!@`JT*;A=BTmzQc-JNSJP(IC z+pnBev%`F|c?M@6-MGL>=wZVhIh;pGVo{Xh@u)p0hi^SJXGsFC%0G;gLGWKw_%wTyQdj_SpuhoBH@?>|3yxlW~_an zA@I>R%^#q@Z^E}gX7RQcYm=j?5UJ5HDoMbiQk+JGr;Dyw-<{DfK9VZrX_aP(Z|Eg0 z?vi5@pCxcoY|z0a%hnY2RpGUsb3tgcrq{g?lEG%(9dLHlLPyd{BLZvC63IrS@DfP2 z#jBXZ5}wym>@~&twUg3dWW8$vKI*Pdl~(HGYSOQ1b}6S!bPkJDyU^z z^HLa^Dq@vk{XX}$npOH^;)63YGxo{iAP{A@N$2A*s=$u{tYtUB3lx;){o}!l@H*|^ zokS?_-soLje_E2cyU*J$FfaA~*1WUXhUYe^ur08AAftNh%I5E%>c+SI35TUByZ);q z6oJ9@vRe^P6JyicmSGmA^0K?w8QKUWw=cx~9;h{Tbr!ZBrh?eEXEDQM{R`|UME$JE z@&^pgiwUBi4l}dRh|{r-5q|wa)5yEy{5mhiC>(0p>TxMl0!=bUnE5uAmP7ps5%9Id ziw4~)%tX=HpNeBuGP~{2xMjOYVW)<27{O!qI3Fnd60cDKvHcx1Uoti?qdxua@BmkV zJZVs``k{~PO}I(Jq@M8TD_%YoUaLDjsOkj824j=+9|0OLbrzcM=-k(g)saiyn9;ws z7bAm2zm-`dx`XdR)C$VO5Vz{huBbO^~Z|0TsiK)u> zf!x=pdyF{c{(5#S>EeXWtUIJ?UCZ%wUgSrI&2q>n)*9isG7s-IiYy&TB$?eWI?mq> zEY1zz;|Ndn3+$?801;tLUH3gWai1ifybZFlrAbC=5Bj-0U7ESlOH<4yA*9<3@wz95 z`>Mb08e*nj+k{0sy=;DAxv5Oj1E@b}GhjEEa7e;T3U^uqGxODMC4{oN#Ao(~1A>-6 zFvuNDx^#vE>!_>)WI&(4nS7VdhV_0l{r(ku)xI5;f0GF|FoaUKKp|@<{(&r0c(#qW z;j^`aU9G7NjYE_LEu{hOJx=IX&|t6z|Fa|v;jx)$%>m}p8H0o;0@OBTPdx~KJ?`ek ze&b!!PNP?+-qm4vI^);#E@EoLrOtd88Lv3~4@K7^)oi8b^k$JL-pYAWRyt3!M>0^= z-@$;XGLUk?M%Qwti1kXtH3_ifU~&anNm216R8q2p9k&x%wtkc86VVQHf51Qq6UCD> z&sXC<$z{VVj8Fd`0L?%$zg9KOy!xRu=9grrQFT!UeV`(jwqCM?uCC0bDi%mAnhHt6 ztWe5z2PZ=GO4}&?bl*vO=A9ur(mO$cP$c#o#JF&v2_mBAL95629v#$1D5>jJhRI0L zv=;Zo#pvxOnWZaP$k7Bf?ennYWzzP#P2|{A8NL2=AVfcSY!4lHw<95halHGLdM|6& z+B88>v_IQvkb*>Oo1D>0S1jjUuXqS?96#P;?LOXPe&9>j*~X_rmOs4J#s99=g@QpZ zeq=)c0ayrs+%W^z{DeyL1-Px|viiZhdF{s6$D;U=WKn%b@yf@BJN|1oYe-6;h04No z2d{n{>krZk%~Sj{Vk3Ey2HSuC*P}cC`+-LjDtHqUlje@0K*K~ZqWprNrV9!)kw{`_ zP%0bAex=t{IZ}iWF+RY=1%QHD>zoMHbp@ z%b}H)^yFJi(}-^$n4%Yt_{sI^33~qU5OohvC#hOc^tqDm`HE8YV`MUY zHQOxSHvfeU-BS{I=HNb@bOEixJ;&7#-eA2KZ{s-&+xU)pZ|qWKAj{x*rG1JHoe1(S zG*Y+0*4JL$yXW=RQ^gopw?Amn$AnmedNL49>}I9RE~Wd0UepXt7v&kF;>S$r#!g6+ zPbrtv-VST;js^7NPK4-*pF|;#RnA-IOl()X1SpT^Mg0W%@^47or~&+I_?AT9knpUjgEf1ciR7UZ$SOw z!)7%MpE7(LYiilTu2$FS55xvyYsY_R!$sWeO8P<4qCRA(jcVP)6m^5qlU+w`V2=kh zl?t}Y&om?*n~~6{7e!se+GI3PB?}_g)|lz8%M0o1s(i8*WF(ukEBY8mro!Yo=BI~V zI!@2MGeCW#!KC9}d;?R|HxkfQfv#S?G)d({Oxn#X_Lxu6?MinYebpy^jEN;Ln?8Hj z7P7A^i*Dby4z<(IfBi@5?HgtRq%%5bJxTS0-;TYa+$IMuwrgwmNn1o9p;7u_KoHz3 zOIOI*rtM1JJ$N91;kLmf~Ea*I+PQYspROp1;lX3w^n-_-NG79P zlMkCXX@h(395$9~FMy!ND-v^2{osw&2k;I)w*m4r?~U1h|1PrcD3N!&@@d=7tBca9 z?xI}FJ)3f@yuta#;qIi@+_&qqG%-1KA76`(zt??3f!M8R8sYJcUphtAf|688Qq3Hd z*u5w=o@6Q*(S-uO9!NG1AjulvVqDk|PqVMwa=KBVi&o^&pIy3)KE`&dOR}ZYbgPqV zsv=#3(^3fe(Vk8^)HO;S1C!EDTM3e@AM#_0=t5Xx_#mPbk1z`mw_g@Hbiqn(uKLKj=sfC*^&W#r!yG-ldc1A%9krn2he(!7Kl$B*cir=` zTD2uvYEE;De60^rbn;3I1x-^$^oIVQSxwS_)&^$NOv?Gh@?GwH&ZcIXEm zaQ^Ju{q*yFJ-U#_r{2A2m01@&B4X;wM2+W9Ny3GkxCcQkbeuz9^v(Ui<{ilA~WQp$vrMdOQsz&^@yD7S5C3ZE^jsDOzd?T6$^h8h} zoaE|C?=jRQbM>YF0xQ&hDp~A?wM!zNwZ-^l1=+7 zlC7`ro%2{tRn@AbxlUh!`J+L|U3_q8rvN zrT^<#MVl+l(rj1>!Aw(;c)M$q-tHXHgrvmVjKqZxG1+6&2C}#i5{cV(k+?zVk+=ZF zAIFiVZW{KFM}wraU}5hd{p8`_($rKi?zItVQ)z~a1rHAk9(-q?o(>%30b@Ea-N8bL zFTNcyG!}46-L+U)!8aoU2tcw1gLM%#u+K;CIle#MfZn#q-oyMCwz-&*iZ{qGo%9(7 z5d@I=#Tt!##dDA5=XjgaK5pdaX)pU43m?jKuMNs&8`i9@9*IOmTYS}mG$ABem!F83 zq|y=B9V>Fmu?>j|Z6;fWNG1)>UG%^{arw^QI2Zc9iLS(*#k-q9C*POEEH(Y8@vqkL!N8@>fyaSZB*R)FVXjak}*8W=yXTy-66>T34#URh6o@4^ASKi z*u6#DDOx?&}EYto01gvtczyN5+YeU(8yjSoQQ)AH(P2@{j9-_gm!$It)h zqo?0EPE)~|xG^bWLTE@f4kV)Kx}|--`YvxtsvpXEoW)u}bJP1)4*uldZwd{t|Y z)a8nIZspgo~F`4NvEHUr0m+HuZC!^ z9|-Bo3cUMOgyO0a31dt2YiUH{f<`2+>X9_OXdZj)a{6$!uhmcSi!OfJVWS%_DWd$W zwCL)L+G^3Ej$wN6xnuNt^MGy~Nc`aUNZeyjI)FY!c+mw9<#N8xljKvY9}&6wk#EkC zj%Q?;=A)LD)Z27amle?0oL7^&7D)Bhf0L>l(}CcKAb*Y=$GZHq z@ly}->)UuYEM=xFKmY-l(?9O~TN%F^pWeZFYy|ONJs&xbx7}P+Kiqg9<2&j+iy*dN zKDK)|$w5SIwA&Is`=aQanx5Xm&g0($7S?KPxa-ypRJpQ%dPYN<#Rug^Y$zOwt^1K; ztb~|QNr)Sl5YaS>Bk|p?G?j(8K*K8_T6}t2ZI`R~u^f^3YC)1JLVUwMlBD{et1ze) z8O>>YY)ae73EfKZD+@9yH#3damgdu^uPvt=YfC6E%cNh|kX>Oq7^WA!J@m*6P1Mmh zp5(rgRX`{qjOfOLBvf|v&(HJnyPD~FMcTA!jV=JDXQa~|ci%!qN_VW6_r6K(t=-aP zv$C>kud%_z|6zNp$3A8q@}+ zt}lLOW@ZOFnGZ<+|Ji#Jz$ogw|Nk?yXYS2G4gzF>gc}lWK?|#ROH1&mSFORePmA@Z zp?z%o)Ta{dzlTo`Lv3r@=cxv@wI0<_wTKrRPys>MaG$aXA@{MHW3%VX|NH&UcdpIi z0VHh5_oKtiPG)E4+S$)*KA-pJLrU{f7^{BZYfE73Ngw>{V4u!$m7Q_5@T~N&5Dgfb zNC&48A?qD#ae&ZTh)Q$PF6R%6Q9B5bh$A3T+6N)Zfsa*9YT&Zsz-U1fWQdyAV${6a zIxhr50%#*3^CxELwtwmv1R_^VfJ-K2f>~2FONM~fu6}sF<~Y2wrvdsAl*9rgAqF7D z1S?(TFa5DOeC#y1>syrLQ7|?K#*NDvP$kT4Hp9)gUjwOW$@nb7mUnhSPj?@VdpPhv z>%M;t*?t`Tn7r~=@>y}=InyU(F9j*`VZ-OYaC9mI5C$O3nCXr7PGBZk-B3GYQ6k;- zaAC!;CDIQ_{C7-`vcZmk;A6u2eq6i{Nrt0+>V4v-+n1*y=hC_TneP-}H`m)Aang!X zC3+uTL=a+m1cQet9plO#!Rmdfwj1_01%c-{jTl-l8kcn-2D;3^bShER01!`Aq|>5K zq%K4`{Lv8yIV~v|(x+n?4Vtv57=R!~X+MO|gdcqbWPk=mcH#w11O#oIAA!f-`fgqS zkNk8ij7Ec?ODmJswQy1v+;inbm^~pw(;;5f*6cdk234C5L49ja3_yYb$4iI-QlbC@ zz)^nv)_X1`^$L%_blI$^{T7w;Z8n?Wx)n=Fg{)981h4(;18C{&RlbXxpS(*dfQ3%< zwcmRQND7t|39(b~#Jxgb>R8qWgaHUMW<&dAaX6VXPPU^W4jesvEQSS`B7noNG}skZ zSoGsO0XKU{a$ceMjD|r2`H;xdB;RM3<`3ZS4-ju~$1|(7f@umgqHE*P0Q3YUco@*p zoI1LlJw63O60PPa?SWb?%fRF37Q6@yeKy(yDyS|X14+2??TuiNocm~H@I78ai zz;UeUSP>Cv9)=GLA#&;!{%_vIbltuQO4^z9UX#H9OQz?*osNl+pOvT+gX6*57lh~E zI|A>1To3($uC*AAd|?5kCYTg$jeM>?KGFhJ8}~zfbN3nH zLX1@%3kK?7eEuN3z1gLM$;&RC8C7yv9FY2k_djQJ7A$tmBe1dONV8+veScd)QmoK_ zM_zpp{R4-w{0NFNaS&;t!b!4|-T+*G*ZiXtePm^GkpiMQ7e|9JNxe6aUa)c$Fn!m4qf@X< z22ST7>mBKVX;`B0S&>$Za$?S}x%E}uIf z-7Qwyn09=}m*>Hxaas6e+R%xu(nhrozElpW$re26qz?^b9f*tNU@-t;#!P24f1a6S z@g_2^fcWXoTuOgb(njF*%K(HuBpH?uOLjc7x>)k>MGx+5uF)8jU?2WuXBh6BVJN1h zdC7JD;t{TnK6EHMc<2a8!4zrqM9`GX4TU56Do*q%JJvR&SS^r}V1d+x1T>uhNftDi zEs$WcfEA4`MiZC~CNS|PFmMLsn;Ots3}}-iO^4*nb9CL3V;_!)1L}a`4(J33gcy+u z>Xb)f!G<7>Bf_V_#~ISEGy?Pk4LuNys(e*4-WJ=Dm!k^W=!g6{f<9`InVNtgWC|>p zmZ$8$T)Mcv*$dCS?t=OzkGe0>z#(X%OPYRt)5kjD`Sj`IAuHQ9ASFzH3X{r<~K@tHb(x{*Xe*4=-FbmmA$bk0GSbF;530}y7+*ptO`_(4AxJBug6 zUKkpE!{@aU3Pi5%4t}RBW*!= z=U6}X<4b8EqVg}ldj|fp?isl1yU%T)4?wC896Y=fM^B>5(|Ub=1rYFu&7GJJ3nz_* zSp|78F)tIcQ&J!Wfk(2{3dt4=B$};|fZ)SwG$Q~p696%y!GIuy=Zwgi!TD4M5F$JT z!#wx{0KNc62Q(ejcN8}px!5UEf_O#w=gYI*6fUZ?rOxuQl9lT-+m=v9mvOQ9 z2Lljh%wjo}%;L8TGLFiW$Ic;2uU{woY77Z%vxg+-`F^$V>rZ+`l71zYEH3+t zSAqpBMwguBH)=a%u)_~IT+3EJqbor^ZR+Gl0QUv~sJ?z$MhSLG6U;^!pJRhXlg7Y; z!hE$K2pUarNx1`>HGa6q4b|`NL&qSbfKeoByM6u;yz$mA;&Nu?v% z)06;&qu3ygY0+Kecp_*BhiQpcsSGQg!hJ;yyg_=uMi;<|8i_gwN($DQEG*#OCIT6- z;fP40nTI3`56M;o5vVKMCU8;@5}s}@1!TucG6!I67vP)Hz&rK3Dn$k4?#Nzb?+>gM^AW-$o2`b!WM6%=Gs8^lDPqbC>J@ z<5Vh6Zg|I$^1L4E8V>;N|9XC3!E<}V708JsJs)g|7WzJsIODhq7IxN6Mgws)+q(PU zREHN#CJr*vtfV<1M__{^&OA@XJOvPSo`L7lveJBxjtLcz$jawW+zEt4(uusQPkL=d z+mV`JMB8mZP-2j%0Y?EaY@jju98LlzEjaO{c_K%Efb>nI{Vr4(;h?Uyk3>H}>Gm$d z%mPVIp%9b?J46kEXnBxAqN=~wGt+OPdYKSY`yns?_-(~CKk4cs8(jUf z<#jhbyb)g`73jE>qrHA)`d2FzqIUfRj9a;0-*56#8Z~8+{y{A-JFq zFHq|bif9Nzi${u%*bWO~Zh~>)=D41_f3Q;=Ugm_((Jx zp1a~NjDnzp?wIej<%o?sMC27Do&5kRHO)9#!aIiYIQ1rX=78*Q29z6C|;K} zDT12jB(GcftfY1>Cfz|-9)=|1pz zLCalr)qIVJUes-eR{s%+0+NV2?fUiGpWyT8LI2ni60GpXV=KKJ&*LZvF3Vef)xwGR z1eQwaR~&rj+9F3B{$?>_0K)77n}Z#KVdrRKTLbYG1sPNbkwN4FINihLx)=^ly6YUS zD`o>9n0zj?n9W|~n%YIZ$Xn@%-slaJq7q-dYegCwHluks@?oRSbro9He)k;f(iPpnOQ}^Bvw>D%<&^H{q8tt3)Se*fzv`d`2sLd{WBOy`|0|h7PIezKk ztJZTo=jM4{Dwx7?r3gwOFC)R7mSncwSg{F5*jOV%1|ZCsDQ0JfU|0eOw)GSso;3M2#Z1GJ$F z6(gu)to@JYLDxCmWaJjIa% z8=AWO3TS9yL7uK}^Ff~+{h$$|$z#%V&>@KW280TXL{*bgL1bW*MH>wfG|>+&$jD;z zq$DeR<(j!LsW4CN^Ff!x+7CQEdUPff7Z>W_Bcg>YMfV}7pAjPxg0GYL`4$;J$l%BI zl5r{-~cEBeseb5(( zM5SbjaOAXJ`;nPqfebY0O6>~Kkq>!3C{BMwr?mjRqpy?$rhgMeU3p;bI^@4$UC8B^ z&48KH3KUIkx)2aczISEb24BBldE=G$ zK1(NMQ8ZdEszQ>-7f_-BxEF}hl1>2;4!AQFv*Kc)hp16=Xi}ZTC}2>UBI;m8g%AP{ zfVB@CWZTS8G&&h3<|RT_s+pv4MMH=@gu()xZ0Us$54FRAdM|i=A+oQh+I-*(Xrdoz zUeV|jeZ)W$wGc#oD%P2`C2C5QI$x{z(162$=me-y8Z^#GPf;pf2}0HTiW)vp@|TbaZrToqwmGO~XP%d$&(<-V@Cx zRqGK|1&fP@4jp{xF+|s_5G37(77~m`eS}2q(9Wr;Sz2(RuPr7Xax<(j-JS~La}psn z$*5VcBDz<`jh#N&exx0C9qWJ-O+6YQLe74Q8EnZGz2<`gM3@fInh?F{9dr=~`E{(+ zuShh!h?*z~9a`JFVe5wnR4oXF5B&Pzfs?T3<0E?b&{e+@^bjRPRmPHD6YWs4nb!ek z;qqUAy}?7MsczhmeeFJ-rc#$k;GA0p_hV2PS4 zSlVe7prZ90QnW*gfKYt|XuF-OkrEl6QW8xtJ~s)9C)i+2Rw60YtKV03+}RV*M?cU% z6Y^4{^c>M?RG_ac6-%5Rtv3;2z~5p;L9|g1JoNj6@Lo+VX*ej*^edc}WilBlTnJFJ zc^4emcR~|A5n@I`qEpCJAc1N@*3(3t(4rNO(R4em42#b>j`z$f%#^NI+7E`~IQH$m z$c*&?VRp7=9|FhIJq(V+#a5YPJ#|v5A%4`1ejDfupxsR1--YVpLmh+^^2KJJ9ToSju-|t_eVgLtsUOyWqj>&-2-jEVic{yM#(g_lDS*f>sgdI$%n9lyNCM;mVsuW^3q+3|a=#7Gbp}`4m#AfV@ux^t zuQ+vYISEF11Vgw1I!~a4wi(2ZFohA0HXp=}@hF=GvTauA?GHgiTOV}$LNpZ&Xw(B# z2%;6gWI)hHcDSepgu1;tQzODyeLx^OdLx6A+8abpF+;ooA8bDaZEao&K4?VaiYwoSRxE zrD)kTTEF>$uPuSCCw;KLIY^veUMgKxx@deVYuVg4Cx2r(tEKB$D19xT|@D z6BX_lkbXr689y{F2|?{kt_~O!B4O>5ce!~XN4l1aoZ2i=1`o0fY5C4ckV01~P*mYa z140#ec#t}uCnXqR$~YSYLlFWZtzG?~L|ilgf^{N054AvgvIVA(&x8c*Y>R4%;g}ex z0M)=|gxc=s*o5eA=rVXH8W*(+*3o09;mDCwI{27AV*-pT$Rl8}ymTqN`qDcP4u#0y zw!FI&(lTt2o|&eDk26L=q$rPT^UH75S*#YAX3s)9nrX)yxbFMcKyp&j-56~DwY`pL zKS=j;j<>aS2VhjHMTveCj!tF2%omxl6f9=(=(w;49bdqq{+wOVzo^BdE(B{r&R2CT zR?<;2`!Lu>H@im-z1?*Cayc^L#=Sti{SopV41|PA?5KWqekRbSgLpanLHjNI%Aj%p6POW&QNySpKuyk-D!oaqKn&yHU zvA9%%SJXJ|swPDrF`y9wQEj@X6|*Z!eWM_eo}LN|E}5a| zIBW~75fgxN?p%c`M;uBaexB%K zAS#G+fF4fQup`d5&x4@5E)Mt2b+Lc(Wk=j-G}g!tcWER)~4@n`^gf>LxtcJiP5S`qdj9SiNLPC?rv0t=v#Bd!2KL`uPlB}V5o5fH^V zF{%`Abc;fb4n&mFzO)daR=v`^1~r{YTO~_SO7?0sBC$Y3n%Cj=Lns{4f1WT9L>gLq zpyuOxI9lI%Mh%5dNPZ>_i11mjK>?J0e+V|d`H@oT3Il`DXn-q7w{v|t;Pea|f{-h~ zWR{XXwloV(o6=J83k>J^bm;& zBXoFk(?^QvT!w~Amy|$4QbJVpMIeJM(*_Hd%vGNZba-I9bC(W2&QO}y^@lrVxPNim ztOxcy|Nr)&w>l9{kO!E(eSK?IJp6A50t^RL@nl_1w$1AH_(F>Q0}r+&Gy5fG z0K$yfpg%Qb01|&D_X~*!=N~)GYd>qD3#k7XE;iVa%nNxhU_}Pb(Z*$1;FW*8Av@I;a1=yPqaa4) zrJHzZY~ZL4Lk5jl)1Xc(F%TNvh=c_dK=|k~yPC4VnrMjv7NF`U#51H}sa3Mnd99s3 z@CU;*>LHNr&(BVQF}W!)Z~AB$o101^Ju09GWWdcCckDd{wTGJ^5R5=1a;9iVEC`7W zB;ly>`ycLy_Kt3iU|fJ%C6ge3Y_9Yk^yV-IiHM+k-^9swSiEeZ0tN14_0Uk)7zHc( zs$SR6%*OW^3=dTeeQ%$}MDqcW0o{W9e3Y-sU< zbH{OLYU|PU1qpv@ik3bK5{{t>Ie4fZjvsGO(ys70e@r&aC@zY<{)nJNLGWvPQ2~sf zR6v7L9JoGoL2plARN9rAhV`YQ3@2K)^w*nDr$6@YsWorZw$#Zmnl(CiEjkuaZMvq5!S+%SAPNRL!|1TMTT1V2@)I>+~qbaM=Y zZFI*WfVfA>1+wFr)$*hh`PdHJ?*pgQsBkEjK6u?28v+w2etIupK%r3(YzGe=A>)_t znOaQ0bJZHByh?UbiNj6-gv<+zU_=h56am2?LdO(B47}PaBxWX-V*1o7?A#ko+yHU9 z5Tz4Q`+>;s(^r}jw13xv2whj368(@;lgvf~krdU;> zI)#y7C=9#z*OMWD)~8LY3P(jjWY`GDYGg=X*Pm*IUAqqJA|GkC6j*R+F@28^75$)4 z5s}v+&6|7K9LUNWMGkg26oLI8?T<>kQqF5t)y}q6zuA0xgAA!wi;0|>(`|h=bOOs| z?FX8!XgJ*n>+Zh-t|`tb;dvfd4-f_*%$Tts_c*XPODT#6T?qdCrDu7pSR>70a179S ztck;Y8yOK=QFY*rMuV4#tOcP24Kz2OJb)-eL*<-;~ z>iTCyi_7IGidKj&iO{9_r(3&qLi42pJ+OV-ehEAx5*T68`K3$ef&q;qTIkS>W$2L8vE=p5 zT{;gElM@Lfc-p(*)baXQ`j0C49LxK%Y)S@+T>s%;`$~9@v*G9mT1QpY{R_!=JufR6 zpUV;qCfT+G1wa^rFaTjT!fgn;3p?3S9yS&ax{xY%8qNv!o#$bQD@UJpxwkU_IX7GQ z^(U27rNw1`!DA0{B3;;#lmX>$`y%)rP_b;9t;}lVTtv_;iZ~)tK5gn`&@|t`KcI(K`IQYk9r7bNiDrBp1Oh9!@++7MME5?v`tt%oJV z5SD8rBPyh*rFWIch$bQ;fr>DoEUzGU8mG~ZKp?C*-N}h2$gm|26s?Q;v@QJpQONmT zFxw8Jb8VnWYa_=e7!1RnS~na#a(ZBS-WV_vrebwG?&;}=&F_8;0e?_Qy)vLW|eye_y}Spb(9nv&LuF$onBjeeid4+o5LI zPs;9+=!XZbqe3pJoS2Y6v}tIbyWQ(2>+kLEVR!3`&{!ivX7Ti7QFe-$4Ih(rAy^b% zaRELbJDRvR2y0yV#cj=bSjW;qgb-JBkDJdK1!Nkv^JLl%+&_F~pNqpnVxChTINVii z!VdWQNF-8HIw!OI`R%R9ixe;ol;89C=1TNdZy+p!*+3ptIIk_4D76ZdqZOi9g?!pF zsn>^;hBY%kgOtkk_XC&=yap7s<#9R9SZW0*MJ!YT5$VT-!;%wEnF)+$PE)9tqktlb z+(}DC(g7VeB$U=804RC~fmYFy4~w=y7tn2LYLUdZOn6wHvcB;?#`s)Na3 zS>MuQU-wEa;1nx7pzEo!y{Wlw#Y3;bhM#?ze1DHN`S9P|9L=$-e)Kwax4sCCML?LH zjl;)&+%JG(XG|XA(6BC~3@(f=r0gu5RA%x2K*Ak|+cdK7QJP9tg_FnE5hoN8!ymVH z)`&RzNgZhe&#xJmX>pE8H_J{ciGn=0Hw-Ty66D_vr`+fd{~tsS>*{Og)*#2!DLb@1 z{*cs^kUnh>^heYPh=Es9u#7rwh$K)qa`^9nrh$sprHDv$&kg;KiCWZ>YY)@t$G}L5 zw%MRoCnC?o@DT`vlw~t)36PXz(M3w4qaTqo%uh_Tz?|6=VBEMYDi#+N(YO~KqYpnk z2u;nMYP2IpwJcm_cgyD8(AC*Z)2^iStJw>u!x;N$CB-TniJg8$)*U@RDjh4or~nev zl1UV#r`-cRUEO%TyJTX{dM(Jv5OeSEYRY_ph@4vGYHw_QgrkBUijO6si0I~c-bG6D z0!zPQ0K$yf(EPa9vP1mEERGy*9EEUP00_aKSsZ7eW@Gn*b2jH$Ugv{-kE(+aYRG|g zA}7+Jed>XgcO%Xzfj(Ex~1Tb8N8gf>pI=h4YlqTcyGTOHtsnN9Xjk)`LSl7hvzvL zo>x2}LklO&7=SPv!RBC37MXnpKwbz4DUUVt0)og$5xLvr@P064P;{}I93Qyz8#hZS zMWpA4V5g3}3ylk8&+w}I{^p&Oo9M_(GrN^2h#*wR=i`>A4%ciwd>bt+uEwQoGO5~MyL9Q^yS z6S09!TJ8=WNSy zvkF+}$t-5GTAmiYo-(7TmgMoDY{0(-ZW%zode;gv{Pm+gZ)yTxiYsLa5=4|8Zt~&p zrmG)0$kELQJwCbW6_g7U5(1$JoWx>uG>skl-rgXMe8_!4c%>qiNfD%T1EL~^C;*YV zpo>aWL>u)0&@>vtpP7}c+t+~+5B)lH5fC}zBG04C zPAtlY=`+U@0lAV=g@)7hEwJ;$eMIkpo&DNfhvAgFNhygd!^g~d({v!A0}mPzkyEl_ ziPB^D29ZD{eM~Nx608IycmuDTPrUs0Eql|@AF4I*;d=4Eu2>^SHeP!8DiS@R_Y+rr zXTXJ*&C5uDv?Q|}8DYi%gxLr-CO~HvuMmP$o>rXck1^7BoWs;Hk0&dRH%A|VX7M2J z^N6}f&AsCZ;;G+zS-O(5gq%uTxvG+$qY~$_KH6|ka?rcPv;dROmZf_t&D?kZQcd8o>AMb=+wXLuR4X%A{uy=nu>_5;B2M%?> zp+lYU$q6qsoa%wo4L#7&)(@UeKluB?5cEfg7DQ?CCrZ__wCPz`8Lo#AwMF58s#uz) zgxc2_J}`tx&?P`#o=y5(5C=ktpr02}szeD&H85@EDB|FYYIDELQE4!D;Zzb8(MCf& zo*vlo!Cu(6`v^4DY2X9Ff-N%*rq7wGL`Nj;hoy*hJQ-mtDWhzcbsIazMn z)x2cWYacF^_YGMUnrG)pnidbYE}2*<3;6y10GZ;Y#)GB%8hTwk$2&2|Ts?atO^#hcmfb7JH!_qgp|S1mFdNf&W1SI_mQ9hvB%-PfCMVS2u&KNNxN6f3PbC6J0#{r)f+q^Jc)-Y3#ZTAV0N<0gHG0~(u98v`p?JXz0vMvE ze6XO?wtya#w9%O;AQEC$#3F+yF*DuK+uUA-V8Vf518aLO-?63kah^AnV)($2@r`RH z!KEPRh}>qR16`2jFj)n#lDa3v%Kc*gS^i*Fv3iB(!X=5jX0_^il^3LEy&gbt!217 zx;8E8dspUxuir2E+=5spKb>#r@Rv9Er}H#>Q0OJnP1H0@3_@fBG~W=*vx zjn+XFR57!r8k9Uw)J6^z5xk(JM9Ge|zdr=^Cp~cda0fJ>?t$(uKZFAjB~?plYN&w| z3SG3UuG%$Sj)IWrM<}9f*C<+cS52eR_6rd-nh;UlH&Gn0tvY94SzgqwW6F&2FlFWh zohBq2KIUFF8+fCUYB2=0qj^M=YIUZDgJk)tD`STTQ6ULAsk3IYrWLbf?; z*K!kU_I^$@yj$-}cB5!DY!805Vj#KgkKQ_|2B%d~$Jk~yan)~rw>S+u!k6Tx6fDR|#^B*Z zpx{sdLeQik=}OOvkeOzIN#kr#I4%t)qG9|PJfuKwRwAS(n;|vD1ZESj!ieImYk@=^ zdb<74(%b{?Pdee`u?}c&=>=a;kO0-8wL`Y1w4A75| z?a*~rmn(B=DrtR2FOD<)Jtsd4($Z59bVMZZ(3IPqG_w%Fhk<;4gbMq$S`RtZN=eI7 zfa6SMc{Sb96&(nH64%1Xqu1f-D{oj-!}FY*mxSdNGJN2&y7#Y`jt`}i29L;4xcnDj zFBpgCV6Bknrk}pO9=~Tk0uT~&Ld&3eaLdo%W51*qnXwcsW}nMgcVTAdXk|lmjTp2IO`_o(w^au$)vWP)HY2;W|m27lhx4F%)J*0?{ZcfPr+ z(Q)tfMJuWg_%~p$yuaVCH2GV$`dL`KWPU|zg0bA&AAvr9q~x7_9nR%N8C6|<;R@uO z+GsBbl2(PsBFA~q$hoi4#mPWI4@^swM*#_31~@n0 zM*b!!%WJA`DJ#;JFxHndR>z`p><2U#6t$WZfCGDuLPu+t2HY@+NMNz+eHYAIG6#~= zlF9N!OG5u9YL20D`~*=CM1l%SYKdS`eJw$r2hA>1bR$HBZ@|^AD%EC#yyrGYVP%rl zR0T?Ur5tVoC|dCt1rV;3YDi#SVJ2NnzD8IQ*2QKl0>UgFe%Jw+{^Mdd>`+z>!RLHl z?Zr?4h~pwYpM&{8;;ilkv`XJ#YHvp1LlVgg4u`_@6^(#M&Td5?a@v3W>Y*}G6rkVl z2d%4q=k>GU$@?z#-nuwXiEMoQiMOP^JBXtqHf`Dvj)dTpt^6^$>1ktZD-Sk%%UXK; zaJ02YS;l?Z3uasa%gBQn4+eFRD`UyyWCRYGX;v7UmjV+DY|1*aG7=y^FBy`POc3?? zN~vC)PSw%Y3!fZmgJTCd5sx21_~V1?s3eSQ)i0Q)fG$BN9_@rz8A2&eKgP~!07L&hVrlT-6yXj8S8 zb>_|H4x!NIhxQ$<6)lw4-O1v65 z2KS*)yREJ|gB}t(w($G(%aU8y=F|2@!lifF-v;HFKo@_@p+C($_kqVBXSm=5VDy!M zPr}ugDer3w0>TOTvark?%paa`^nP;lNyGEi=Xhyg_rn+R^OL=Z7CqDl_ET4NBI~2? z^gqheHqj!_d-+$TfOpn>oBf810){YoG7&83K;nnSnc1H~Y^lWF#kc)pPHf39rLs-K zitU?C1M-Z@5qV3Dj@yWNv~5juU+kS(-7X#OmfAdDvFZMjE8rycYYW<=EaMW}T;V2>RUFXR^vPld5Go#@fz0+_~%86xGA_DzyniS<1mpcU?U-q$F zNhy`jhO5@Wb1^QzYbU|FLGRpJg^cy>?~2-TKMAs%;Hs6_WTQW9Ovl~zBf)lBx19K* zUi|}jgny?M{y?L3nYWs){~b4FCotVwSi=mT8}M5f+40?m9a007KB4~^i+a9;NW9{Mj3D40tksYx*^QmzQ5*6oO1K(Br93$f_6oVf?;6Agb2T zd~jevjQE{Uwb9=~Gk*bxB;jl$V8ZRWSD7UD%m4LW*}SW&c=l@)q!|C=OC1RiqkxcO z0#IXkRlz)~(wwI<3wYYg6!-}>TKD5Y6RwD2NQvV@t)?|L_^o@Jk8tD=4G7UHoaM3WdH@sLVvFmjWLc z^gX&a&cZb5gwh7et!X9PYP5A1baQLUQ9)lKOK2G>qtR*fS7enARw!V|dVXAnT{e)C zP@7$6@p{K<@U8^Uti4ShNx10)q3|ouR7NmX%<>_O90lnsze)4Z{HZXr4W@>aSYO9k zr1)h=O>*AR-&zY{7K-)s30}utOS$-^AE0#=rrr2)ipruVtV~MmBF<=illKQB{|LpU zrjM*4;2KBGQ}TQ?6%xKR#V+i{BSl(FCh^x|7bznCuvjnbdC1RXL#js%w@p-(U>hQf zF&b-wb$Mzt{XopIX^uI6WIU&Xtc<^}KciIlJN|NhRa;&pqh89MxW_<;5O zHNJrFi4T{WB|YCAODxfG=Y{73CH!k@nk+$T{sq>!IWg!NnCVD z!R7EBv<4v`;&l~1G`XQz?HpYL3MN6Cv*n0=L#)=+F%gf+jh@)~_8rL$jnD^DZjicV zp_Pdx`?XE~ki=D(Q=4o%rjHAM-VNisahI-+Lk-0|8aH=AU6?~Ij&MJEId-*Z3(NRa zpa@tjA+qI#*^D3vjwg0UTY?Knq&t%G+|+J@!!$Vt@o%{Ot%F+r-sVbx>vISe9ry@r z@I1!H!4m_y-V?CKH1w0Q2Tx$nZ8nJ$hC)ze>_ZUEHMp7<(q43;tc_yman`YtX{*}N zbuJ2W#+g;lm`PSbXSOAUb2$!)i_tGEr6o0A0~-K9zn#>z0}o@l^~SPd7cJ2x?%LQx zC8WS#fdGpl;T@s}0Iid_@s~qzXfv;#$GA_Hs0iAEMm@AfE9ey(d~L=e_E?f?tSk(T zwhMKGDb;M`{^nuX57MtiIdQlfoT>LKZXB&FGc>afx&&g5F^$DgcvPM^&{9q58zRf3 zrhsmViMInF{QLSLQ0)A=%(hqx%cA(5Bw>paw@>LCu7b+6IUzZemwX0f>Z zd1oVF%aK8=CSsKpM1klZqr1Y6S)=VgSmep(5~Lr^AeHB}Nxw9D_%G;jtR!)Z(trg` z=7SSaFCUBiXl#UHa!KhkABVaA3VjUWnQ4`X-d-(OVYw~?<;8)9ng3c}YT_+FM9Glk z_0?p_2#EQnVw{>VRFyyU@PjAaxT{^3Y%p&UP^8ayKn<*2Ak&d#3rkF$u7QGX2zqjb z=7Of_3=UE{=MPDKsLS<{*dJ18l+b3>HR@(deq!Avg!Nqq7x_*dXMkF2{?YUXALtnW z_(G0A?eN&Ud4E2YO1nEC=h%|XOa*A zigtV8yUwrUc)%J(qw#wWS{yig8Ol%W2JE7J9ysX#FtA zqkd#bXI{ba7|XB(e98D)>AIq8)$jy60%J(KUe{!1P2%u3Kmm@-%F9deudQra^F39EDA1KKl>g(Qgye|Z=+fDgac8W?0y zK#yLCi&lsS)B|az#SR1^U%g1xOGux&IPW-33rb=c)w;vHxeEnM&%9)b??_#a zu~I^$P?EE31;aV2(?lkECwUm7YNWM>j-)qMJwiL{j-1Hod4J-#D7&J5r8|Qh{*Rc0 z^XvB6y+Dd~m94q+ zG?S4(@4$%0tFB6;Bx;pxGT>z9s_wN&uQZ>0n@2e)p0lkkPOuI~x?*f|z^Ar6!`Ni$ zATQRm$KFjL1o;bY0h8?6qh9h6Fw-J5s$d)T^W!-UiiDqJ@*DfHX}FEJ1%$+gLn7k} zldM!cAmE(=O#Lw<~fMJycjAr%oPhv)Hm+Gm?H zv+IZF!6HbEmz^4%)<0FzZ<%WJFn*%^@Ry}1*rH{gs#!V^t!()cGf_ol4z_;LfH36S zXFn)(L|JkkHX?^ocbusHkxhs|u#^KSQnC~QNZ*uZ*J#Hcf{Tp3`gp8w5$o+XsCSbt zA@lFz8E;cqB*^c5`lpDbfF2&af+urS;Qsb@0rH%zu-Lg6#xPU0{gvBJjDn-RIgorF zWQO@l@6p9MFWe+_On`vcv z1Ep$(u@3LG49GQbuvjxePi#NRmw(SxZVg$I3m-mws?Rb`$g@%f*zrbJI^HAn_ncpi zn)xT9;3^YBBjL{8P|E(1@C}i}0M`6dJ&pV9Y+rmGtv9Nrhupn8?JlK%fkcLNXJxtt z#_HR=Fr4V@%zgPdb{5)wFsk%8(erVb2Z$ryE<{7KRhpjoMUSPR2XIL_S^xl7n?Y46 zbt85>Ll!XPoLLr03XzI!|%>ZzeMS}ou zUAFU8L!@bxdPM)7%X1nqC>z6du8x6y@v2RpQc4!^!S3+{o32$`Cn=<-0gPTX0Bo#i z2jyg}E+I}olz+!i(h`V8(s2xQ_ZwR75M6g4+%yhdtf%)e<)^n7{Mym*p+|E6^e|F5 zz{_>PW>WYtXmZ6WAn@J8P9QREpkG%vW@m&cy5!Ngs@5NN;WIgl+*ahe*Q>EG-mk}R zmF-B{=0B5CKu*HfM|Q8Q|7+z(5KXT&Erm^7UIcwnP^Ink5Z-rz?FH=AfG^{KS1VPVJqI=|Sgy|1Pzi6QtR@GVaQxTH-Tqj<`h<@uR6Q=$X zb(_!($&>A&zx}!UTeS-;%E9NI+fu%cVcpEA9uh+d{xMQwtdEE(x5;*+60_WdyCP+lVpr#6T|=hphQ8i$7bPu@aze7eg{@b$8jMC2-?sT8F^E zgv-4R7Q(|AyUYC!gN@yBa912{2+a`Gdg2XKLg>zS6uR8qol7iqWSDedH-oJ_yY;wI z6YW{o7)SJ?gc@d`Vs(djC(~Ga93d zLl*DHM`j#hZ;z#TMqc?^R-=u&%Rw(SvN`h1sYC>Ta4k4|`ql*dLG?shp5lkCLdqs^ zJeKmgzpPTuiTeSE)IMsdZ>rQyK=us|+~$Ayp43d%MLj*&I-X)m2Dj>AE!RP*U>u|K`N0@+-7?T!!6U{2p;2 zAVBQx+F6KashQdlo|Nuu0+2oj%ag{hRPkwIQAU}&Y#T2;$>;&bv_f?vf}_i}EjB}j zN>a144i{@G+cB!PF$bZ#8o}-}9v-*)DcC&~NuNkat_(ngGNk0~^5j~z>4gvV5qwYT z;g3jrI8weco4G?(<4OTxQzV5(y}IUXb3#+CYu9DO&@yCDpA0O7177FCnYicnqroTm z@7U?;VpBc)xWDe(?AjH?PB;IfVp-e!xN2mf54y`NFK-lS@lT=`d8SBjaQg1A2r>%V z?EB&vGa|lCrAGcX-VXcxq2B%N;x~$$owlEOYl(8oJa71q2!O7Ot+DBeF4zu`pyiHy z3nB>i5A=g5TR-XME-))WVJHH3N`&%9LP%=0qjH9=AG@2MxJDv-kqwfw8nVi8Gp@nx4ly;jjBk+0+=5YXfIBd$;U zWe;=O+fYnF+QON-3p%qNi6=1kMBjUY+m$+kTB(<+4I<7Le4HPhDX` z1%?ump(VQO5}=CbQa}*ZyTt9nltO!*Ef-z=sCI)5Hked3WO+r~+>FR`dNcl?U@4xr zC?ZNK5gknNb90d_*kqusB|{3P@#556QDYvD-w%?8t_plitSJR*cr;nmKj7snVv*hZ%Gb*SKcsYXb!}O* zvh%;_Zu=9&vyLSqke2*AKW-!Q0BO0idHBBD32fqr1rz(aJE4vd#>-jbWf!J?i>Ms% zj5+%F^^(pIW5oyZi$Nx1kk@%0y13gNGC11XCf^7WHV}HvJu|Yu{J!44ds*q_CyR4{ zl?;Cm+Uath=^}EBeIMB;B^IDKDz7EF{0M6;_x-ib*C(9dBn%cu|Fe2ovLL*@a-3xN zwEcpc_N;{W`OoL|I0+u|ufewueYiH7MLoM`>xhLE&&3d*=|+K*yZl!d*|`akjEwp?ANT%KPeLC$A8W9yd8-F{C=Uf0|5M0-n7HwN)#$lm#UKtJGr6QUu;iDbtv+$(UJ)+8I3(r? z{xaXAc+_ZPoDXtVMI!|V0&+|Y@Qw^Q6dhhL$i-8ADV5Ek^|RVHsh$m8y~gm+y4)wQ z)tA9g#MyAEqj0ll*Wk=(E837oF}Z~C#N2Ht%`|tDK_QSSy81Fon4y3 zI=Tv_*Xq20LT?#}7h+qxb{8`Z$C|k&uPnnbw7gxx-Z?a?^K()je%_}^?Cgp6&dUZ@=HA;KSb@PNskL*cq6i5gNX(n_hi*Jx^Esepp0YxL`o|&DaK} zH?iHif;{W}3}wCvxJ8Tj7!6c4MBohg66N&xC#PpX=>1};w6xW1o5B{HlIaR5hD`Kd zKpZ_=A9C2+&9JwYwv{<3py<_Ln5@#8UKm7(sGzPTXy|d`oyrwbhoe~Fz!=OZKsM<* zh1QP5oT-&O0 zYy@1fapWjDwT-8bK9c$XKI#lImC_Iii-xYyk{JqkN&l|Q)oT6j_IR+{nx8b9erzZ9}k9YoIFLQ#nxbPgar9*w0kmvu5ddc;+@EO!>OJy-^D5@^``( zRi)+07br4p8JqBfLgx#rV3$#pR`7X>soB|(c9t&jbMSoIU)d#t z2O0FzZHz4OMX!(i_jATwHWm;pHr)SbqI*2N66?;JYNgz<_gG1ZmNPR(tTXIMu@(Q{ zFoDtZSCkpuJ%x_vcU@AF%_Nu8(_mNePvqEwH6v1jl1#+fkuwI))~R~iDmC(pDc z!u@5ws+tV8UKaYfOyt@BTWxDumu+nOyzZ7S0K`EGf(56E4K%+*?jeKrO4|`h9-PUN z`S6{Sm3+A3`ck-9y2GJf+ZSj;qMR>U3$b4?0;tQ1i%ANMKS|I3dMbq^Heo`>1kd6H z>wfHp&+sNek?KFI5mLIXzd*2%h_3pzk#zfo*>Opj6J0Yp>B9 zCky55FLe6Dj^5Bjw9=LOmFTH7h9C-@N-$cDgXMq8GED1diU_~89K4lc&vc^rFL1^y z&FcZ4KAT9D2g8|oxXGTTx&P_WWKC^aoU9Y_)c@bTmvrQMJu#xo#Rl$z|0j9CHn9O8 zLnX@M1wH)46>CRxWg_}ln0wELC55Mv^HrKsD6<8Bcst!jiMcNFNev206B7GpE z`k+8q_N+=l!;x)T+&)8+KnX<`0NoU>94un?0Nr1X>r*|@Tdsiw#s_se#BLp#o32X- z3+2B`jeZi)p?0Y;0w^1dHVhRHRnEXITFsY{v3MYZJ-ewXyo3}^XnGG_qGH&M`E@c> z*Vh=A6U$b+6fDEQ-XZgzixj?^4l*0YjaPXg=6svh_s8GW>@e!)?8wdz0x$%&2u+|`@ctb;9qwcoLHr^0q|+5I$)#3!R`j`@0A=~+ z;gw56#O>ZAM)quEY{}udm7}QB%nr$LfaLug1`3Tt8(YK3h06{A?m28XOY$zd;;n%f z1t}n7a(zubeP;**kvLne2s+92PidLWOqwih2KM(){}txH+oi<$I!BwIPp%2X5AbIt zWSD8ay}m;lpbbslfRDdD^WEq8qKVy)PRSl*!hZ+82?})Ny`d2zW`07Q!|tcqUxIaS zuI1?DwFnsWS9pQM)fj
pWKmk-91or*y^v?D1! z10|9{PW*KnS>|LB6Ukk{Qx9Fk!S|u#wIXJaBtztpx5_Udf&BEYqJ~ROLC4WjB^kS z=nX?J;MMZ%t@3jJn2bE{nrnH2_w#*-RyA!Jo

i^aop!U>_b9&(5mzC7-0mFQr9K+DI1Yp9H;-S`YdinYaFz zU6P1k0tMy9-Z(JfqyKP3>iWw233&WvOY|?*L5pR;EVbW_R6NkIfuJ{f@d-<5rre7MAdTXA;kG3%H|-IQ4ZoQk+pf5F-O zxqZ*h*tfxK@; z=NhZ-ounW4ULvmKVjn-_3Ul_aGR~OLK3aWu%iVQ8K%%4Tcv~WdH+wy@Rbx3!@0ZS7 zk$|A%kkX-EPb^O0*xN!Qb4`Hd2%H{YXb|57W8e#;=o2c4lrC!W&d&c2mq1;Nk9g38 zgw#=U>h-kAA1RFrl>VT7;xR?`!QW44Bh$Jw;omjyv_p8!^HN z-QmnpQEKG>ji4YfIW2>xXv}O@)Or;`at3wGo>)!)>nyBdMm!RMXg@s48Z+nNr zDw=KnV$hyALa5f~7zHl}Ux_Svzgg-g)b*(M{8HRkXTa?`O@|wj<Vs^9)@p?bjx zT((SxIqVRiJtZ{QYt`grzyq7^B9dzQmH%x%9~+n!nTF@e+Nsc{DUF#jVExyL!;~Hx zIiAbqwdUIs%nsEF9(2MdUR4SnSg)1MD?(Bi1YRkW|hL+w{sKvws+Dx#m30)lXN|KG`}X45Ly zCzXtKf)veeJyh3iwDGuerTg%MrRQ7>=a+1t+dg)t`D16z_P|@S<0qZo;?Agwy`_w- z`HL)B9&7G^kIM87i1m3XX#1Rp@Fo4}^XU%FR2fR221<7(;axLX$jbfMcaL01WIjWT zvAp|Hk128k^B{KPn-QBWrQ7j_{;qY9%nVz8hp7_=xcwd*lqez3D=CbQL??c?vAc?_ zG=4+(y7W}s3HfL8qY1v>ZJJoFgN7jmn-ndN8-K1hl;i95=F-ZDGijqv(aG`rVw2yI zI=$rRb7^V4OH%_U{kK4tNHle*2sfY;O{{`h2>j+i1QyrsKto~p-Tg#???4xE7&%+a zimhEH_B4H#pw8OA0Vmgy8ny%~qMrYmMuDh=CqE<%ydh-D_0x`JcaOFHDgWoyker%9 zl`!PzC_hIJtkFhZ@NK42?PeW42^3<*3>H4Sg0EfR>-1W@nB*aul?KX0fJv^^m$%b5 zrPbCam}ra?;pYCUq>bH}C8Tjqkx-nix{F9s7~%-5;A2>R<(0FpOl;>WA&<6}^4i(1 z)@i=i0b}RC*OP2VnQuYc#v1MW;-&jRe19YjGSU3XyxKb5M__x9(BX-BSdHQ!oWR5?WYSj$~FG45PUJ9`@ndgN9JbEhQ;4oz?!oA;FoB2(#M;^ckTb6xqgeg(v05Q$ye^#y%;ef z&tXwlqtC}UG|9%WJ;fo5>2!Zdo<2ud6?~^aCia3A=GTa+K~&aK$`PwaZA2=}tE+@#ZR8kFZPC+R1M`f2nDA|g*?Y{dC8vycs9L?0l?Z-^Y82GZkPO5YI<%+$S94Xc-f zzu2?uu5?d&N)js5WC)mm271Qsp^4}sNHj#U7%S+vb_W%GXL1egzMjn=tqrpjBcr>U ztc?=2Y#i6?gZRB*&u!XcOkVE`e?p>{WhVJJ#D7-XVmdylZwj1!R;vlX|ImqVQzwK_ zN2grzL!;R!l^4j;9>Wqr(O(6>y#>hXWnT}$pkus7C?uk}HfMx*Q z4(%9u)+458a`T8~(rVIU^X=FE?A72?%&DV+mmq7GLjxaX4FCL(j9o+T>!Qo{gjW&y0ueYQWf z66VCS8vL^p8ceDNTpp3X2`9Xn_qRbf1PL)wUYdhd!ZbNJ(w=#a#-GFQ8Jd+bsPnvn zNDf`4X*MW0xmXvlqGDp5U1gzx9mGsQ1Jgu`udZjqH!fAxjdmjiGr)>V^hi8pzC(Ob zi{ob1){&F_1Q=QmH6)Feys9B!Iu17|M0DWBf@I2o9Sclsh|p^+Vi^FlHyQpTHYmVR zK|8%!xsYQ;_@capjOSvC@3L**8N&Gq!hddhTd+g^gg(;ga$4Q!L`JH6-DkSq@!Zxa zXfuaP+lQn*q{U?Oxloo?yJ>+RP4q7bjzFdmhlP1P6GoRv6r4Fbl17lE9sq^~ISHYN zfgYD?17D6hc)>9p$SO%So$r_F#-M=O;g#Q?Zv&S2tc;D_SI(>|3P_UM0jP1a`Jv=| zRdJmkHlj}_+Mb_JD+ykP zGq})Lk)d!wZ&Mm|6cUN8VZ&Mx^m2V{*P>QYg5=hF{5B}AbBn7`F%o3iWRi)VCX$5D zSm^P^CwQVYQFz`38U=sc^Gf84H>yN`WiHlz6ZwPZ_%(T9t;PeQ*hYgiXwk0W z0wVw=Iisu(B-p(AIe{~Y81oe+pJM&9_$%d`wZZSy za+CZumxEHP=vgxXq4O{+Yd_X(hye5pa3bp;stlPY0nU^=1|EpC`q?9@8H?Qm1T}s^ z>64cbii6+7=)!IOQ0MQTYdx63^b?Pt=WbM^vE=0RwNP83KIzqUvUWK!vR|vaR&BGt znPggaFAspu&lH(^m{EjV{$StI^LSEB8{qZctRJeehZ|kmdw<^b-_4vi%`hV|FU#Kj z>7Klt61wVLc?-O9-<&f?iAFf=DT*Fbrt@Auk0S1QQWE8VI2H+o%H~82vBTbPMMFVY6Ist9767+*!&ho*Y^W}*C#IXs@ppO8X-G8GLTG2VT)P#qSEkpG z(HAK>lAh<+sE7{dpzF7K1)|8n(p~ZhjwB1So$q#O=lwynd zVD^3{xmOAbf~_Z(Bxo`=zH1lv-L}>x>vgH(>-kG!A5VP~AMbbD zF(&5GV7JT4puvc^%-ut_M2u8&ggPH9h$+KDSlEUFbTy;M5PDF(DpBxc-|J7^e4$s8 z9CNCp22Bycn#zA&3>?k54cZmznU{QACDTx+ZVccp$O;LRT+)5H{dJC8p4ib40wt5< zv=YP5nJe~m$O&3R2{PE}@&fx2Y%}CyXlWkKhcy?i)!o(AZY4%#n461ijmEKWl>K@) z4qxm!X(Xu2RTO^*w~#XU(d)ktw++b&;qsAXgR?}kVSs`BIrT=R{SD(&3^EmJHii>4 zrWuOShycpwXW_XVG_JM>x73H@9W3P#zv-AWX@+B2#NVa%ry_Pt>UxGOt*=*BHJapi zTnKb@k>MQ8Ksgtuv=I{~40Wk~q8dI8w$rA6q0hef`J2U>+oZ|vkC^>|-B3IuIv|6syD>L^9a^L0}+6(|?L% zw37u91$6S&Cv*ti$DhJD_KGlnkpF!8 zwzZRd<#LHxllPNKpc}>HJicT`+ce4#n>Q13%Wy$rAi0&#lSFnyjFt^PLxazN-t*m)u;@=J%SfOlKh&MqA^ovyAPN8eRh2cJzcK@O-` zHE@>Q6;xF_5X4N$kA0K8ICH4MLrHd&RLD7JrQ7!9cV7Y$QOPP`7)RBQ99biA8%9c+ zgp{4^d~wLYT+j>!KX9x%@K-uBjr=rLPxPl5LFR0!FAo+2crjSnnZLVU)$YdcxjZ1S@NXK zm)l0`ku*A5YUfY0j*MhP0#Ar#2mjaY!u#!oeVO+^;q*%f7@Pb4eSfhQbVh5jXX!Y` zrLYE!Fe|I?9E868O#MuNr3Ek9nxa-ocl}+6Y>P%u*)psYWYwSaYIo=^xPFpj7bU&| zI0V+O->o1XAC&-rooBIu;i;|QffnkiWnv-zC6RPG23;{i%mg#X2uRvoPf{|!%-FAj zJYnYDF;d97QE6S>s7BcRCBsS#(Z=k}(i+{v@wjI1Sk{@tlOd zmjEq~;jT>oa9J2=ZDa&`8w=Dhrv|GsGoz-X!Pt;R35jt?Mp^RZpb?e>ob~7PAp}IT z#{|+pYL>!gH&zX*aCOhAE1tej&quf26Q)ymrPB2-1sbTJw1>88`zCFH7 zwawr0mWZklk}fg`Ql0&fG0};Tqg!^U+en8zj-Y1br03wC)6Mnkfw5=NaT2WA_S)Ig z@KEMz#h^}^%ayR=Vw6I~MRDgwykaUJM>TF;34H8@gtRRE3ibY$Z&gav>+;SU%U&+= zT^{|bUblzTc@!DrVp%x+dAB~$j60Xh&h9iLU#Ji%2@Nqj&AW$sXm(U8B|Sh^U0)r# zl5H!zw#&PX=5Wc)ql3ZD0u^??Q{)C!Oo|)ANLDI9GUv-dFqv|2zyIIT5f^wPAQ1iY z>9TVSHawYW`>(6KtYL36?Vgu9&4s-b7dpH8VO!iW6l^x$O*?7;sEqBwQ=wvpJXJ$H z=ynh_=WStqt+KsbAr_y$tj@d(OB*ld_HT2l;Cf@2JSRP*wJw7V@AN*kTw6SWgN{r- z8Nuajj#cw|lBM73m_bCxt=Ync5c$J<%yUPb0gl5 z-(LETDUMp4DnL|!>@7AaoIJD|S6;3(n)*~#7LbWaGIxanZAQ~;VBP6Re(LQ-V z3bEsB@~=4q=f*|gtT=u;@o^qalONrC{x7)j@0nv9*+n05$o6nsj(^E34B(E@cTg^! zW=_?id#Ke1irsid3JuJQ;H9{Uj5B@tS}U|YL^2X$#J?+PjiDXZ8)c@l9E`wp!CJ1~ z#|jk8hstek4hd1?2Y&kGusxJ_mvpNH^4H=+S(3UOdX<9|Bxuf(w|;NJcEkD6I<4mX zP*ZU8B`-uXVdK+dZzn@O!-7&{D`FiiWm*`T-auLw*+ff1@<83kx}E7{H%yUN3@R>l zqF@=F_Fv!4Gq=*V=QiN{k&66e<;oiiK4+I%es*c54dDKah6(=yUq!;1!yb8sLog2E z%f};4eZeb@GR@Vocc$1SCw|$-E=q1y3-AHoX~F_(tp2z_m9#L@*EWOm3cyurt@x@{1_`)Iot zmcMq$T^tHPoSB^4wXHo026_B2Zhu6#k9=^UYb>9~xZtR!)K#V?Nx2<*c9I-2KgfHL zTxQ^+6ZE5*(kiEQA0J(naPx8W4cgJy zEbc~D3ruLoE#M@Bzno7mXqDD}CQerCK57m9IHPdkL&aRD1tuaVq z^?6ev-Qc?@oek8PBR4L2_jozSkWq0HrJ_3_f4a)$i=z;^fJ#f#8DvsLl?VK^FdTlG zgn|l?*y7>eKbTjn=Fx7aX6izC3tJ!l@l>(H(ZEEnPCkHy0J)E&-R>%G@3}XXg`Q1- zq6#Gi!<+{3g#OS282L_HT_w6$VZyA`1vDXjm(^(|#()F}g6~p&l6`HOpw~0#0K@cB zJg0Hfu_$jMZyyF$!r#cp;YfZ?0bc?d`NvBTpoS%j==sQMCK*jfxHx>S-(0nmV!kW{ zVrN45H?Rix!Ob>R=n@$dgpRKM?C{#TY4&@e_BYm%fIT>KgUF8PV`r7jiw0L-nwq@i zFEl#UXH+ULO`CWk8UUcLN7RDMoZ|Cw;$9^kJt|^Y3a<9g=_Q<+np&G-3CN$9eN;_J zGLH#{!Mhi$`=q%%2m_4*#;A@WWy!i057iRwb*?`eo=CQDv9rQU}t*^jc z^)as2bplZ5pU}!4F4!Mu?1{z$q9l9Pqr-c@7Ex$}Bgpy(XuR$xx5>(4)dN85&uutj zmXh?I)0uQKW)s-WHUo*2g5xAK3u(6#-Qk`+oZ5a##+nq?M`P>*Wo3u0i|DT6^LbTR z$r%6@@H5ofr6?RrP4d47?Ipd=$Q~VJQfq8$ntuh}-YhxrNJEt%>@HA3(Udb-0| zh+-{-eDKZ-Jw`W1c-bJORw9SW`oY$T)0%5R1E>nK4Z6I^*(#F{bU4CVkvy-$C@D&G z@#}XH2!%2M zwnyKfeB!2!J+Nu9^4qS*(lH%E&8g+z=Y&Ah7gns;1wGNT2G`f(xMKzNo)J%baG`}A zOez^siAHyu68zb&L^EoQu2?v>Xv$jg;(_Eyq8|@J^^aEgf-~hma91i*3+X%y2wDQd zkh@w;VahZSW0^RLc)|eLy*%$z?UQ^~Oms4}F;^199}h@ChTx=@SSIjZV%EHpfgtCa zP>>O8iYW>Vh%}-keSYw-Ja5qa?=>VmXGHhn53gbf9u0(X8o2 zJlPNs%!Pi}=MXTIj>%F|lIbxGhp(1L&w@He&2K{*ElaTQ2@^bmmQn(x0(MA_(FTGZ zutlA8Whg|q*M7mKCNX6ntsTTJMtPS*6RI`V)Y!erD`27(OtY9%nJ1jAgd`x-(o#AE zP(D`CKm0eqAR>32>(DR=g@~dGF5dvl77zKKAwi~$A}6N=^jx0 z60JqfN^Eh9d=H<_1H>gq1h)gpa+uyh!pbLmdo8yP4Ukp=?wIR1he1(CMFhYpj{;_qr`{MQtr#grcrKFKI@`)@n<7H#(~)8SN~gW|~-cYfmp~kTL(~eVcpsfVg$+(v!f?GgON-Bkh z;hojIR9irxIid09k!-dK)g^m}k`tQ6luDY1) zUvCq)FQZ-1UoS=#iCWlG!~t;Wo;-KNA8+@ar0lLPbV_>bKg!AM^^JIGOZxk_RzLTr zoj(Rg`-P|ojbB0RqCp!#j=BDTV15dNlxSML5*LZ=MmbU9FW-nEe|v~W6)Hn0hB8Yt z*^<4HJKD~H@M1&m^J{Q`ax4_YF&6PZI`uH*q>;9B>4_;~(R_9x3H&`*!P)4(gKJ!P zJ5P5VW=bB(zsSNRn?DIRAsHE&Zniy^Jp>D-F7p{ncsL|1;KUqqJg5f3X(%d_tiQ37 zaaExaRcMnQp!Ah=tFLs+Nd?sSPmi~vFAea`bxA|WBm@kK=i>&MUSZ@#JKyj{9hk$7 zFMV#gC=r?R(rL))$Bd2eB>kA|_E8{T)oyXv%}bfwdNy_clU=vrBT_!dyHIr^JNqJ; zz>Ttb@Zkb-6NSiMp-SxMtst_Qs^z6+(^F^y9kjAXV>1wwd|B zqRoR0?i5K2*X+*l`A~nMe@XDB@7(<#VKWygt{~yWb8NmcDhpgevx`yi4{2|oQ5`5G zX|(mS%bBY;yEu*T!LI}-Y4A7&?LyCmhFUPwZX-R$^NN-j%13$$Lv}G^<{oKL(682L zoTNe|Q^KykQp+o8sZCN=nIE#Z$7$!Em9AAxPeDf5iqJSsTJvf#i$l+?CD{o#c;m+K z^ASF>qY^Lzy$Mx(bq`2O`G0)fRal%`wTIkAh^4`LvV*6!QG{B2u^U9;O_1o z+}+*XrE9Idd;i~mbzgnLSshSsRn0laxaTu;x#@Y-7y&l}=}_!0)bCX5MDhpof>;H{ zVRFTdXJQF%fq`45dYk*R0lD4+LSx1_cb9@=}`Zl~_M8YaQ{ z&xbTsw*ED&T9JE z%#FO^VT0aw8{K^a+&t+XTBQhtSVsIiT8c4FYszr1U2|=b=SIMp8AInk0*88R98g}a zoARM8@>`mT zw&j<1pJ06CZwCMtxlZz3`dW3)Dg-awR=}a!&nQ)yjfBp*tE<_3&eNmrply>nfMk`ZLUcmm?BjXwfck0`Y2o{YYWPi= zT)C}H>eMC(7p;ziTX-{vV^eQ@HeVhn#%Vs%YnlJr{VQf2KqVeb+pe*u@dYmevdC#~ z|9gYnvL;3Cbv{kJJYhES-NwlJ9;j4+I(}uo*q{Hhu_#E$aF~>L8RsenW9=whlJT(K zEV~P=&Hg*=hFK%Dm@v~x&GtoD4ARdJls-PRXTn{AKmL?OhVgCx?`a+CweZBJBR>R4A4>!Cc+JA{{7VncT-tg4 z*kut9l!5m%-x*W534Obi!M9mB36T-0D9VdDM8|SE?Qh`ZMWPF`gC2{m+FAeb(!RI^ zeAiLzX*ms6Qc({E)^28|gD%|@BN3uQYSjJO7W`ENtgFL30M!5)T{H?El9Huzd~_7y z;I9^b=(a@3pZpw;UuKsO+O|TARg6zNt^TqN1Q2Wa$3qF!9+`_lp`VQ9;LQn=p6MROHz_&$LB2#d4)8>&2JF!_VPR3@R^Rq1HX(r@2IVa}!7CJRCmitSbRX2YFk>`boQ1Oe;n8 zu8R0nK;1r%wE@U?dY%xd$sq2IHwZBuIjMH9;!LfwQPuMU#wuVQf(Y<5Go^92Dh}l8qBqGYzPMCJ{KI;oJ9UK(*?0Y(3$>3YTB^Xv zEE|G$>?#L-CbHazhcb(3a(#spo&Ij=X3w=jWR9?{Ys<|iNREqL!5tkVUdR^)?ah(= z07=W<(zku4P5TEcH+`7(iLaDAYkB2v#GF|Qv+r}VhL z;4iu*)N+SfVtqM2Jz@kvZ`rB*&CvHG*W#A&y z61RsMq>6@{_9<i#C1o9YW;CbB{bzB$I< z3yw-v(~MN1%7>*#1tHistPwmHoy0(_rt3i6zK%+5E7i=DfG!;bNzVK=9U#1q8!*7 zj!}mdUJR;LU@FHRZ86$2VE>U00Fz!3+&BA#t=Ftjx%z0*f|$U>Ew9LzkLlzq59JM} zn#va?xVm=^nApzT!k_U?Ii^1xOYJiKj!`S@7bs`TRLr3x7nSAXP21jff>X?s4*&OX zBA|ih>(%u&Bu}?bhv-&OV6x$Pv|O4$7#WwrdH=qR?mfNt?KHg-gRa#za_p4m!n`zu z;HNqMo9739tyISWzpmw7e4^idXj5gYjipKpszfubMe zFb};xe=Q8h_Vi?iAw(Z=jlwV%-$rNW;S*wNe^L}=Fa%+=IwpDR@>G!Zi}t3uI79@V ze|p46l~EZLW1i>_W{ZnR?u>pZ4{GY-gUi~`$AW=TE&cL_k7dI-Ua1 zZ4}XNGgq`Xq&`=fBEg2Bi}Gs6+^_ra_99fWE!FT8i^lusk0>-biCMkrOkZvnL;)#W zfF0FE$TVYR=(~Xc^d>Q5ewY;17~T=Qs-$zMC52b_Y4-V$FGNz93YcR16MH3|sOQm< zvU8?^CqLeU4+qBJ`X-jTHBX42V7xEH1;Gjl%}1XHC#_Os_Znis`(*Ck7tW4Jozj`Z!p+jLzH_u|dCl z{cS+mTDpLAe275${$``LX+h{BLq08sJBPON+G;iQ0GL*pk7W2-5zXt;K+ACcmVJ}a zivYE9A4tAhlC3h_Gc+4aj{nHGe+P!13WbKsI^&$C+S>JORhm$O!dFJuonMIHjSFg< zSn{jV7LFr2-W-YWJO$Fz=43rU`k1l&?h+W!)6Hx@fvdV4y6ef@-l=eu;#Y-glKFWW z2MDTnHS zkz2n!HMMsYn(xz32EON+MO?YAT4R8iI81Lc$#}@&M?=#1Sf%%g@RRE}BbO*Qx!myE zaYNI>cI{o0ovLYnMx+7tZSO-S&vp*+oZaZ_+uHBq58CZ*Sqv|+S7Rn?h1^al!s;_l zqMS86Fgnj`FQ{{q_ zQIUV%Us44;XAIMZIbBZ+=6u{Wl0<}Tkb4ehJjpz#y)>(l9Bq@kV`~D1{D#0n{kZ!Z zpXX-}a}TeCw{|WjLNv_SNQ>=;J9-KfV^AH955(H@K09rgdZw+Qm23)#mKZa*}fg$48zX&+j}Bo0OSNT?_sOss&K3PjrbwA4ilaU&qJXCRz1TKR6r%$f4@v& zQD!~tFGG#<$T2N=ykfmJ*C-yg1Z(@7ACuMrA3N~<*gmn1?ils$Av6{NHaJ-qNj2n`U=!Or|;3Q|PQH=u1u30<0| zkgPy=y}8DA%<<+JaDG*x2gHWvPT9&|-=I_8Z+>z)U*XdSX0cwo^3K0t!@QbkkedqE&YmquYN63gBao zM0^!9gRlD4(+QI*Bdw%qaFQ*Q8v4+ft4$YIOXfbm5LZ>b2`6pn{xDp_=DZf0Ka{&L zfV?K>GL>b9cAwGEqW#C5_!xHg;uL`lT;R&{MBG|`e|>?#SOO&k!|S8_+$8V9Al(7J z73t`g&a`oWc)E2<>lC%B3pGz3o(3d3F{*!+(}y~hJV&t;Lk5@lFd~t3nbYM&zx7|S zQRe_b;YaOwfwe z&o1-Zvta-?l zkSy~e-@`mPiB=Buy2>VY4fFvRAri(;bZQTgIGx>wIKb1yvc_3_+)_fElXuIAlpGU~ z`=L))g}N?lZROc`aIX$k97LRj$?qmCk;@aln*>PK8AZMDm>yu(`D;O_E4S9Bg6Z9P z*mSJrNWzj7=ff?8(}_Pxej!s6e$m0MfVmgh+pWwX%h;Sgy;_uM%(5fB0bYduzfsSi z4F>TUB!)U+r6k{2ig$fcgC=H)AxnnI4Veo$S{3CKbOHe5+}f`8DG?L*C``TilL4ov z*w#0RgS?ZZSii-Cb6edA&l&zcv|{LHfbgGQ7U(?}d)`E!ek;9y+-=62RgMOY(~4yU z<>!5WZ@rdeF0alHTGGqqG&iRyuBb4{9MQUys;6K!(#M1!34TuS>M1iI`6FLZysNM2 zk+KKOk^es+57L?9a%jw|;}*GZjp4q5>UOxjq6!VXDLs*bPc-y^)8>4cYjqcn^@>xH z?%y5rZqzUJyD_E{?NwK=E8iInRm;r}e8yLid^@w0OpCj-H9nmQyA(c|y7YPZeGO>b zcRHCG^-u>=?ziVXOFl&~D$H3|GUTzdh6M!8ThF?iqY z-e{~BO3_IWS=(E7S*VF4?V>yD@qeC1Zegqun}WIp!$X~4>?P9?iG5k@9bJO4W?y?( z2`oONLIs{PE9iK-%DM#QN#U;zz4<0c1jWZHkGj@Zn+QS9{qL|; z`|QoON4%f*+-ix*qBi1G^T`sl6BB`b*#ht&bW^Pz^}odp%k&nS4 zUkT%z$_vzVJwPkIj8!s-(&UvBpUGoE$zXp#rlaz^e^&<`aX%3tc4S?Le;e|~Wv1QX zct)6q)d^unGa1H%KZ)c~`NLHZp+Fuj6si+ONkL3*PfOA52-RjA^4k^HCbQR#F|kY% zl7)Zks7(1bg1;5zVjeyc30*uH;n=f8oXR^eP#?J8=GeW=m;!o^_)&%R4%2$4Kj;N3 zIeUdj;2*?eQC0u^GOycenl$e{@*uco?la*LmRPWvO8#CGT(O!6G;sHqfDyLHVcgqb z=<%ysbH;2WY7X;37{e|klM|b|5ICG{$mUn1fn$@+$?n1sIPAS&r3V+Pbv}l9x)P<5 z3YRchoJTJgFDWSrbUJj}z7{5nm7E`%9D=N^y%e$(N6zSU$EZBm$b}PT?_9;ar>dP* z41>{hEU5OAJwDP$nj(2TVj7GQ8JN`zqo*s`)X1ZV{nyqkyro#cKv0)vxT5LhkS0w0 zbqpgXDVAn&!Bo!i|JVZ(k#^N%D_F@gGso6O@7D*uw3yInk@t!%JGv$Yn9cGj%xVuJ zsUIjEN`}1F6>60~1nxZw?PG6@hDzIA`p-Sm>}=NBey`roXHnVkkUw-?s5`^#Ha5Wg~4T7)fhG=_0BA?3NC7`AL|e*+3aUc4@vKd$zxigLPefb&r9BrWa)zB=rX zjb`6_7qe|b8OT^@ONtx)by0GM+f|el18dH=sBYR)=c)vjx3I$Z`!b%(maDv+QT%I1 z@fXO_bjCoKW*5_vSyuFZvm@bSw^Hsr@)G9Wz*Lj>%61oqd7Y>Ghbrj`eZ;H#PYV_k zYqqx*_7o<2c2YBA?H?v@e=Tl|0@eaptUU+BT8-;TRovXJP~by01+zlB%8M%l`?Lmz zrHL!oDud{t6U$q^6S(0V5ud>mG!{-51ac+5dbacgl)M{ilE@A^OAzbDq1bNdS6>|a zy8m+lHapgBFnHTaLHh-fptb4BOkll}khM%Ze>uJ;6Sp*VfL#l;XRG%NcU9s}``nkv zk%ILlwb%d33zWax^pDgkJ3LSPtv+qeT1W>!T-P)yRs&Zjx~UdRZzXL!g4Q5Jq)Nz^ zWUOOBEXi9febE9>wF}w%q|Q{xF>L8gB905=d>xX>dC@skcYKU@)c)R8AS^U_p`@k` z{bQb;iHi@)ia;SzIw!j*oFP&qU1!Elh?j)3m^Qhaz)mqVMqo*fTmby+)0;Y^VDr2U zf~FQh*uW%6M{AL3IP2XWb8ZgbXg14MC&JK-{>S8JR~H=BP1(GVnN z-gKdYN8jH(j%4N!@BZjq&D><(zv-WNP)MCf?$lbiQI>1rJ-!YRpCKzopCk5sY&<3O116AUCuFsV@_(4@H|Mg8u{nb2oaP1KI@jwGTCT`YX8Dv}dajsTwFJKaHfOY-!Lf0Ls%E7=>*%WuV&W~aJg(>#W zvvQ65oP~#j7U-n-)m9Gw=%n!q+B^(-m3+4-4Ikof+O-1;sA>yF;$aX^e_3Y;C-3g$ zrWDznDTukVgdihWdoFa`(zW^`UziU!%)dNmNV*wWRAgiWc@AmZh>BWA^%Z+`R+t04 zd{GD)BMt#L8sLPJOHYcMkx6M-TpR!m00boR#`L8kAXvA~P8Z40m2K~SOTB9_M+$Dj zRtyDvK@WgRH9I$8$0!_f4Jq@0k&C#??A@x(#Wqt6>%DJrDMFf2IPG4Y#ZtFh1IR?A zWc+O(Lx} z6UW1&aVqPw+n^7*t4CB)(FU*L3>?CjZCWp}Eojjv4e}(3Z!v*uH$B23Y%pN#6L}1>UcQHemKk{V%mh2}8x=c#0 z#O$E^PtHSEKW^bI-2LpM6SYUC>1=>}9J<&~xbo0~#)_@_+hbGx@~4Up~fQbg4YW9Yl$8XejtaX$bbo*z%x&yUiGE~Ftu4of0jWeaedHvgc;!D z)JISjEbmbSN0ONF$0j&n4uOk2iv0=+gPFgaCKRf2sdj2^|6(P?8YXYDxad_|+1%19 z^4$eXo{QFhslyHGVS2bT4w0#y$ZO4{j(YnMJt6iv5kA|Fdb)-W@h0ah7t|fr_aswy z%$u=t*AM}QhOOfZIp8@@WaeU(V(8OyO?3)6nUv(s_N$H|$iqMnci z|D$5MiE1nasdw4S+wN!lqWlgNk`TAU)ov5;?6e z-1J%hZ|xEY{BP`1Ss}xNAW9q&@Tq_-Y0`1qv`kq@hCL-beI?%3-3S-b%6k&tVAWAZ?pBDb&*rfD{b3edYtLTE@p4)QGqf=iQ- zG!kMhB8}gOC@N?E6>SI(LWdYo7aw0HM%n>NynS9DL}OJuP~8aR1Tb^~Vb-X)QPMJW zr*)o&%9JGX)Fg1YH1Wwm^8_-yBSVZDC^f2$GMNPKR9C>zZ;AsJk{ao!Hru5;zZ+Jr z_6IF@2Me928`SZ*li(e3$U_HYMe?`S!DItYqeU6u6t z^|7$`>M-G$*Kj!e_p>U*Esjn9P^I^$wDvBLu(ISeUohR$F#tXss!(|^a9X@Q%W+o2 zu(HJKKGDRGQTR~hJgA$;L?)#2zPq`zT5~#>N{)CV(ejAm=Ds;i6=HyDz8`iCNtm`O z6l3Tzhze5yRQSnLqKZ6+Ljz_tqlbCh`$_hjzpw5Bjj&w$Q#0o8n6i~a9)$dsTHKKY zoI!f!Tz2Oy^72*Yz=Mz*DUlmgQ9(yT%BhWT9W{sBUS4D2U|C4Mc)R2c%$2!+Z~CBkb-p-o|lSyZh&x2J#?J0=5g#B0x3*SOZxm8A9DNYA+9*)+s&#alZnp9OYRT1qO(9> z$k*;5eKI92tDuLCi>>o*2q%(b=+Xj=?&j~N8GNulCZ5xH^CfnJkt8Tx?~Y*`hQr_d zV-`0<;*@7e&&Rhh!`Qpa?G!}X^1Q(ipjdO>R^<70W#_w_O7Ku;`QbvZzg3h2YZU#! zPwsDx_RhX9F~12CMECk}5Dyee-|=JY^cWgG_)^7QO;9_2_HPEhy!Gsq(32@UTZ^)h zfK~Z=;buUz-c)J`>;Hf;FJWAO!*vKA*JSOvPjDxQ13;`Lf4E|0YpQD@ax!iVYLocI zQSJatp3gO5}_s- z;X53H*QH3R^7is)8p_S|%Jx)=!GukV9wvmg57U~}qlQ4X41k(|%>BSPA}PF74YGcz zc#-RI3hUI*9#4txdUaK(LgKyD19w~1wBovFVN+r}2p${}xml%b=0%84`kmVUP1SIW z$wb4(N`OrT+yBb83xe=k%50zShGWY?SnZ zVc}_uyI%DbN^{=GYN9*7xKrPe@birRDrLM+coPgQEpgP%J%j|zl~o-~U4|5YbT~wz z;^DGCfJY7j&iDhmUYRNaGH+Ewkh?FB1uqra4yLhphSmhbXD^%2O^xaWrZD7*@N`o z?AJ&)IKWCbFe`tg`ku`e;(dp78@SlG@0cZe0oCszR3t^B3j@98qEguyc$-QFE=93@ zydS)nx5lER^kc`-7_+b5l&>&@*OeU7QlR%$9D;K+aat-NrcvKl*^s$M>^wf@-Q4#p z&sAc@GM95xdK+(3MLn9b&lQhk93U``GWd+;!>76P)#hb;|1_{Fh>iKk7gp>^R4fc| z5o{wXc3ZYUOJ0H*oCrFAqTKj%*Yo0ULiCGLRih%pLwvP?9<5W58Jr^kMnC~?)a2y+ zZgOntr$qplBkK2Ch_i7bD|1OU9i!mS&?!Xfov%Vd91U?k{hZj=3km*G-zGcA?TI$~ znRBRYQih?Ep~g5Dtm(taNv}=IZ|D6uN)pzhYtehY-g30i2ndzb*Xgcxs&UJXG&iuD zDG3g-v)(o-`5jAdnsd2tOop`iM9uB}LH}tkwgm?c8U{JIjF2cF_D9Adq37q=$n(kc z81)w7Z~wt7Q`iJPYC=cRU3tX|S$hSF&1m!lUR5(ullZFjyFVVBE5=;_PMW7(CjNpX z{#!7@(Xqh5BB$-n>s@^Q%U0+VB(prwEz*DC4CaF83q%*AJRx^XmG^nBUYD!H$}gko zTvCvVF<6*O-HN|JaTkBk`Dw1>NVVPXdoLp)+q(xiuEJedVp3QE^~ZT;%~a6gE?3)f zudC>XN94_hLz+VAkd6;v*G1dOv@b;ClKH$|<5H91vjsM|1E)X6^qmkA0D_mUvK|Lk zxU79`JPhuft2tZc|wilLV@BmAq7qvM&PUQWbe!g+qtYf@lZXVudQExWEKk-nY|rCsP_h_lNDysWvMx z4$Hh@No&;wx`K-C=$-m6nxa-&*spF%RhRl_fb79X;818#cSgey>a&HMAd8bc|7R#c zxq$`Ie5i{vx^P4HEyqA~qsXFyr;E-7rD2B<7&-Mf8bMjju7rOG3OFZ5J8gxG7zVv^ zbx^eSj+KegPmAk%x}Y+lVzoB6K>X*eI{3K?IWIzRvvdM|3~*q9*@cBU*e62)A-x9% zl6<>h`s47jM+c&iwk3mi?scyIvs`qVJU(|$Ma{j@D&+YIYoT|B!&f^A5{^P*1hr4I zpsXm26!X8@7OCO3y?pWwkKSarWoDJU59NZcj~W<@8kCmErXP=|)x(4!T*E zxjB8Ln7kVp2_T167m>N7H^NFB#?#!UDI~_!-@Uw8dWxFQd_iOHejuxBw0Q`DD2hG1 zB4F2G6DE*^aCyysF6}#fzWso}s&g2;*4poTnO(8?`?#}Pj>}8`1CbT!d5gEyaP5bi z7kXT*^}3SBz-SG|r|Xb6MbTW~^*gFN2V0{xmWyP`bewRk$2|w3q9?H*_x^eZ+jibX zQxq?3mdYdg`asqGS&#TXRZG7TxNo-Mu372R-H?tYU~p3jp&3cuN#I?hIfObwt>SeVq-D` zOSApDPiHSE?bm~Evd)2UqkVZciMohHjM1g6f^y5(X%-qB# zs#X{?X0Rqe))AjJ!P1WXP&b!dlYr6*l2x217SdC^0WS_<06WI}XWBxpGTXAf zhn*|9PS}5_|M>k?72wT;XV)(XVj{R)GDcSNQ}%OFV2nj{%6`02pYwQbK@`i>`2dsd$S$fTif%4*w2P9v2DcH{K>_Q z92IQwTae35c6dAufJXCm2!d1HyRubBAB_*I@}4qz0+h+vYO>Hz`jQYZ5>EA3w2dA~ zG0T7U@`(|7c!wNf0>;q9^;~@A_mzU-mv%VdWB?gqCfj|l>c}UQql#{EzAvXplf9Mo z7~V_d_6wa5U$>e%l6iATlCQy@JbAVEfQGX)L0mAmjZNLryat~uWi4B$MVb&9_1@=` zPn%0ethz%my_eL>VE7ITyeAO8G!GYV>-&PDiAC68Z`!90l0@mWU@B>?vQ~d}2ew6q zv&zwK*%n^hBZPJY{LIch1PGj?x>sT??EI8!V|mPZ0b4d-Zt1+lt@8DJY*2$SS)!5n z3h3j^^%?3+Y;#yJa`qJ0Zz%$drtt}R+*0{?%o?L=A}NR+TyIpZ$J=r{{Z9THja*GU zUNwief9RY2jph>-+T(!J%~-bAal0voDX6@d^6R%}^Zi}(&fB+OSS5@w3&=z1qRau@wJMOMSNrQH`a_Tn?ny3~Cn5e&71weh#uDY-(HQ5W3JDk5QU z$eoeblN@nE_ZwAEgfH1`1!9Pd_f(eZVKrc8>7(QMMX@jFK>RaO>o)`lf=pR0RZ{|A z!^?^}3Yc3&lz3m<8^6aj*4j$`$Q)^pPdA;G;LU#+ZuX`Q9A};RqXCHO=8Jr|xsjnD z8#TPCieCr zf~&L;mZ{kJAe%E`Frr!rgaH3Cu^mEt7W+ z-ch^`9ahZ#v~$YpMXomvvt5uLVV2gr%#LCW_SfR{l!8SJ?pLp{%MP6+0NF}4?=0oE zIEx~UTXETANR<5i{yPRaNn^%*f;(K;0%&a_#E{oH&m?7%bYD%JoeWqcbqcKNlx8_h zd*Tfi|4(wForGZ_(&}L=k;|vDl1_%OK5!D2b0h3({p(S^1&R5KemEa(jczh2P4r> zhMH@?@>7#g$FCE281Q>-pl%c;M;v+(MXijBg~=>##cJld7V3w{7O|J(Vci@KPqfz7 zs+vMw>YAcY?_Ld1(!giZPQyDQ&~2YH0s@MfaL7!_r7%E0v=!geUi{~l!0+}TNV^Tq z_3ERbKC}q{2DzSt2w)`#_1P8crZ$KVKVV8?R ztxD%r)zm1a-llA|w8WG%HVwHT*^JSu{4 z`c_VZjMcn>GK5d=&ogQ$E(ypP!kuEv-8D&VtWR@cG$M440^}(C z5fsnl6mVscb9F6~{^-LXTDbAH=Eaa!yiR_7L@PzL-V9(ClZ%*J^Y)6k{l<7o6MmpB zWlaJNJoPmH-K_#->8_9Ht147~*y-sG<$&Q!6tqcAuW@$an8p@Q_+fOWTv`4}wkwdF z4#y6N;WDfLeV^%gd%7K};D12Lx#zP2HPVUH`s|4u~T?tn9OCDS_EHkQ}jQ-o^TrZ|?<)K^pIBg^s}P z&M{to32iUqJl3T~F4v=-HI8y6EYL3NBr} zyS<7Ewxb7S!xcHmfeuD{)^4T>7NFNHnlmvaqyPabu`MYF2+`LPH0}GBL9HqbX#+hO zch_Di!O>~!U&o4`g$;4{Wu?i%loulfOh|G>4m2jq`AL32T1e=mW-&Wl1n1FEX#+Rf zUgieh*|5(>iKK+m(h_=!A@Uk-+xrK9rb#iNa!=~Y?&7U_6JY#JV=W|X?<_r|*BO3u zjz=aR;f&t3F6WibV5UFx!OkIa`hBg7fQq*lj^!YqCFI70y-k$@)R`G8!< ze4u;*IB8{g`V|9MWMjLGm%~hDO0}jInj6DiVfbdlE6)>)E%7`Tcy*p;(47j=YE}nD zGwpR=;WEq^JQ<4I@CzX>10+tW4Io;VK;Xom5jv#l$F(49LF8`p{HaPX=Owj9Brf_w?`LZ zjC_g*CYU{TXdy_6y0#$tUkhl1^ieTY4M(?eLc-p%dkPiDjqv&sYP&o*QuKs>rEM?w zx3~`8tU0O?7-6xlqGc@-Zh-VYq-O~SSX*o#4@8vA4uuJT%jT=5+R{@ev&m4J)L$Yd z*9Hiu5&f-oLI+In>9t*t(we#$)ikc;hH-0+T)04y+e&U5a8us__Ph+J3EkbO$cF_u z)3QyNq_-!UVD)c}O#4_^LWfj`B(HXYYtY!0OX2LK(HU-D95#b#%HdRrc$@dCI|d*4 z3qBtZW4<2jggov@FA@qttvnQCelFj1Fv-imc=;_E8`c)*fAT(_p%`4W z$|V4c1r{FjyBxOTCzc0-qs9ifhB2aoz>LVGAx0DgA)6S_Gi^QvL-TtHQ2XVek7oC+?(?H(#UBAi4bmU@dn?b50mK??$eIvPQC4Qa|w|!(9 z14+5+UPuV2!yKs87_yt`HdZovYTd%ERw>ReW$!|dU3MOXNFFbA|3=D8x6AgTGbw8) zhj|Ezp=p!maPRfOz)i7L_t|hNq1ju{b28U8=ivqAC>I1RPcT zYzu$1jZ*wDiw*7gW&_|cpexXF6v`eUnkw`TKPD8;Vn-oA_(lb9817ks$wfUralP^T zNbjLh)I^@#X1=cF)Uclad@qN+tR}A>f#Tbmtr(=pn0;8vc0;HLG$$m3ZaY%y;;-t< z;J^dD8G=53Y~nXZ4oqmbLDEH2bV|;jYKwS`-rx=F4b3QY8a74U&O{soj&U+u13`8v zt=E~^L17qQNr27;-$0B6@OC#580LMImQmvLi!92s#Hm=r6|G=@t>^OOj5lDiQN;=Q ztjiJOL2o4RUCZNYbzhfD7SvGVa1s-MLp@xt7aDr2;UPZYBSa>8>wvBrpcJQP(O^Fy#3WYXwx;8|XO-iHUql(F z6h+7+tj`&4(U2>!a<(bRN(wIHtqDUi_k;5?;JvGiTpbC*eCKsT4TFW$t=r(0F{Ee> zmbGDH(1J5}X`|ZfT^CA5PJd;h9EFubm^f0hnVpe7JvtJ-(GBO{`-tC;eHW0AS^#Cq zT&g>P3Hldo`+6Ad8(naZr@C3_e%ZjiAXdCXi>-0yD%KcU)m3HoAXQFJ@nkhM{uhy? z&=5y8u>2tdB$Ae2FWaLCX zUM)x@bb53IX1sGY*ZI~w7WLF5A2}FOyh(S2yX2V8flTSUf(rL^M0io9iZgFLPoai> zjQ>Wl^chD}@6@Z)?mso&Msd%q__c_uv#P?^D(p->0qud}A9*kP_5B95NbY{#k}eu$$6U6+){a zy25#l+g>LX`_g<}j%JG=*?!7#KO>HUzoyi+#D4i;yAp8P=7#aU`~T?>hI05%-#Q@s zDjFP-m5I6D?f&Q?m_yQkS`d-Xuh2tmEZ^c&jNbE@>6N{FUgbCB8M5=}TEXjFwNJ=v zQmm!RCD~pKbQHD)rqu z!RZ8g0v@78Hr77G-`S{#%2n?Ijm%6Bvs63_Ka>zax#zV2F25bc2Vc8^WUPmme`k3F zzvX%*(whj&LAa#HD$X-z$~U<_Y_x3xRZnvS!pB>;-b3AH-*hS{6XI;@Be|}9Z?cU4 zibVmouTpIt?t*JAy^UtOC0GqzCTk&sKF*)uNnJHg9Mu#14`WoUaOnRLaN^(*N_zuL zqf|Bb_m4#pc}xrV#aDLLH>m5mQ?KyUh6SL zhyN+)MUEiOj-7&7&ugcaU#On7_r5hdF^oTL{v;eZ=9;DDMeKJCq8K8N1=abA+VTA# z^JZRQXC+WCN;Zd@wQgs;1s4#7-?e#9f6|2)R@iUvJ;IwZn{kgZxc(I~T&|%rM z#f9`nQ|L8+-N+|zn#W9-a0skKFzwI zkxHpF&0uGm?nSUW043Zq*OjuTS#tdigcI#AZIa2`C@qk|I?20_-wj{-o8B zocl_I?51{P_{N&^e(3B?40(8Z{&m(nC&bKqXXET)K1)O?Wx54|CSxu4gpkK0el zcNZZjPg{cO=P~Dry}J|N5P0Iq?)B7gx;*zl!7vp6+)@qhev~E9LV?KUAyyiF^e;D; zRTQ!`>6PFicQ6#qtA`*-P%^V6X3c~V#?^3|5iy)eo{fA~kl^2q=luyc-+`4U zTmIH9MxKZ8=!P2C?ygTe?DTR#2Z6M26ey%*TcT#Gjx(?Lo~BI5Yt%29xv3}pe9Y)r^0zkhHp(Q#Phy=u9Qp^Vi6SZo?qPQNb0Mo zfG2=>*j(WcW5pDKSrtDrxDlDs?{vWY53K6#R9uN4Mil1ZP#o`;(DvP8|Qp36myY>qr>!=j1O^#8kJ5TTruKLqcCsq2?=raQbce3(7*b z&`}<7QZ?OaXjDukjIC&i`+`vXMtf`%@mVp>MXkq4{^G5+VY;7F5d(_Dbmy(jb=JPp zNY+HpE{k-0@c11Ti8)__8X=AvG+g^I)8#pB;8)RZI~FLb1X`l&ji1Br<*wnn`ut?w z%KpYql9flMKw- zM0=V&#Q+qDNsww_M*^*d9jJUIzhESQlmsXpM2MR??VcYrNY2q~F+i_KrdPN4X6o;< zbO1d3X!C_!I>R3}`^mHSyuM7TBfWqT*deH2ZbbHvrBF1FEX`^8p{sK~c?Cf8N`}@ro}A3z1!A1_J^4( zD=o$MGycD_h8M95e-<`me-j^yF#iy9pes~Z9aX8s+%&$X4&v9Lso@9LdYFFVX^gAd znXEwg9@Gfyge8c3Rd&?GQfVJE7r_XL#ttQg7)@})GukMa%|L_Goaf1UQ5Duvr34oB z6)iUxj05~C$jaDB9Lv|{gGjV$BbjA5%aKkKxIhR(f(E5|xp-#{y+PVM`@!qot_#c2 z_E~adnZXe!O*+Ft5AiW3vp0KTl~$9U_pRLvB%^)59U||+y+aUd@J=WN7Hw`qAKGE= zFm)b1-etR0Soag6-nb<&dfFk<`+m}-c^jgW2iG{-Jv~wgk34L!Ms)568NmJKUA_aq zzN(a?D=QBsNPQ-q*9hpsBlYKD3{&`8Y%L;4K9iR-92ys?F(lIpjiv7!LWPAOdPI2XS!JyJyGQa(S0C)%)k@Z9K z5z;OJzhK>8hN9j?1^Ek>C=ZTu{rb zUu*&#b4--)54cES)7Qz$Ov^GSZHQRf;XY~P6Vh^c0uFgH zvW3UxDK3S2tmT+7b4+|MOUT=RWp^oyqYuYRwK${`>gEKGIU%1j98{N072X3PeDiSr z5I!Ls?<2RclT89h<65!_-p)n?h!hrUun&s&!*%=d{BQj+EuWQ;CasWfohFq0FWGaKgTI-Ee}Nsg(MBugAXszy)|RX1K%U8jT0ZAGH(xA3Z@`=foJ}kL3$$ zNuEli6OcUOFI$YL_U7?8A0D?!z!$zeJ*6#c6>|^Be#m>8g^<}jQH1Sxav;W1vfC}a z61Kmf>1S%p$Pk@QosDh193f!{JYqb)b=)Z(1_*0mq{K_X(u$DN zeF}JKtt`yfEzA?9V@G9Hr`h76oj-JYEHoQqk3+y zYfe)jHf4-(usAZlKSbafw;9oS60(c~Z~sL=wdfU;Fte-w!a}J^PD!zo79{?^#T}M%qRYH)8DU|i;`ZQ@-nAhF_AQ35N+W3pZor<6V%<^YS7-5 z9+W_b8^3e>bp)yhA7JuB(1%!*_@UYN;qGWBV`*}rW+A;>>JG4emdYu`orx4WB=qq! zOW(evgdL67whG6K`EJb<&(X;jjr7)gs|}(X<1zZxcZAs&Dsng0!pQuMGb_$XgULR%RL6pgZ0c*XVN)e~#>pDCwm%lPf;lOrB~+BgP*On=Ghq?=K)fX z%Z=G|?AhzS9TYE=(DEha=ef9m41z3=0CADGF(d|EXvkH6Dam`ky?vSasBSo`B-43+ zsVJAd1(K#@4yzMqt`IV#%bz8euwaN_f{B5F3_6my1 ziVF-AGZ%Loun<@KIZz(6X7`PYie|X%aey*qAeewMDGM*_HwvV+u2Q(Ca z?~M7rV1r+S9@C>Y+AJLRYZDq@p-j{se_w6YW1b5$|Kr#3S(^(PLFtyOA z;~k+qy;V+V%o_5kQh-2Dzv}j_%*FXhTIGHs>oN+yA#F{$E|=cT>BRelxrBBy?WphMK zZrMbDr~;K{fvr7mWR{pnXM2Zqj)}`_>>1HYW8aS3g)A=gd(gOQL~<7=Ex_T2Q-MOt z99k9?*5KdbxKUd1-QMY#h;^@OQp|Cy^5123fq~Q{y(A@<7|l+%HI33aV5(2kCXG$= zQL@?65=Fa^x{MwiSa-`&(c?I$f&Gw>$RyYAbTz$6e39*f9=rx%xOOkl47mcyJX}CE zO!nU)b5h3)0W3qwW+ULmaw;qvRhyOM*+l5QMA)m8Bk1%GZ3O#q(})v`VVAx20R=0q zftf0RO7%XvCnh?g;g8N#GqE2t=WI&W?0zT2X3x9si@mnsC#IOmpecMjwT1yKwnR{3 z5Tv)jCYstyoe#WI)|dckW-PzqDb?z?0qNU6F_}W|d+P5Y9ul>KA&+#}YV=WDT@x~t zwC;`UmMzp(gF10^vga&z9I%Bm)=>VTG(>z0Pt{^-#t%b3+_2WTHFj&&x^hH)8i~2P zwwxHxG1(LxxQ>s1vniA%Y74_B-RC$u?ki&;k5vX=gvw2>f^ICR*Jh@rVLskobmlob z$#1}~aSc(($$#sffIP&WjPxNF;z_2Bksbvr+OIb?<4%l)ucA|-`$M#=?_}@CBtJih z)NKOCVj1E|t+X-x5H8puFD_yr4qQ9i8<_SQwoHMVnb6RwmKw_CrXqwN(Ym$8R(9F@IjL29&A%ww&2 zEJfQhA?K8obQJtC@32*`ju?qZwEg_TFbM*M!s@lNYG_{EoFq*B;3J4;?#CkBqzr8mpBa8cwVxHJhIOs^O=Pd$ZyH&*j3Z! zNa#JFk-dJ$QZ-GQWSq5OvIp}oYJ-LxzZdHQ6%RPg5o>+#12i_aK>3Gn5&!3j9!06z z`+67LkB!=f4=Y}7kvA|7Fw*Wqx>xXQw*h{yqjpx6tvi>xYKDgdRYNa)4<$#3xpCf; z&AkNWWHIwLX&GK|WI%4F%c&&mNBrPY@~a!5q%;2WeOuohzXxBX_Wky$glv%bdNU6y z=MK*LBPG&SM8eCgUQlbLB>sm44FJFZw(TC*i@hixnfYhv4KDLw5O|p_V;kpG^0(8! ziV$|b;_nmzUH+Gl1L(U{7&#p5ADx~j0A@&-*c z2pzOGE)>JpCIzvfx^_2Kl+1Rnh+5p;y7(;7GNIfBZ*)T3W-<*QU7tb8iCly3$P;vVps`DbCsWT2IILL5vaNbdfUIk4R zNeWiq>;+DTn&^;m><}R>JKsPhOk2LpornkE(D}vv|(?6 zh%<}&O~;SQ&6*x>;?65quXDr4g)iRU-i2;hV`5W^S`Gptktq+Ab zE1@yq8?34(O;6Pc4{BNlKPA)Ml!TE=pXAzrt)YpmAY4xo_tJ)FAZ`d|)ykkfi3wK) z20rP$guH?;!-Kspv)5pf5aLN#NTyPLL!F^eA;t?&*m+j{cDqYLPzJ?AA3M^E@o;5c z)vL6DV*U2O7Nm57?-igXY0n%S9T1?l(2N#0SIu+;`U4N z(hTT%iOR7)WSO0x*Xlmnur-8&yeY{icejCRK>TI16XJ(AEj z-`g$EKL2pXXZjDmu`>*|z=SNzy-o)z#=dH0ip$mRxmbO|-jG{q9=0je@Z&R|G3&_R zB3!{(gXCSj{?s(Iu!tgvNC}Gmgr>K5%|f>V5HVDX5x;Y!dTgw%2v5qbQq3Nv zt54{NaXm8TVjvK1`H>4EdvFgn+S%Py+I2yOpD%<=Omy3M(|+srhXN6i*!{*}7ahGH z4wysQ^*dvo>76|hnV&(YGcq@SPhDIpKAbrg^4fjna>+sova=MnAp3_OdNQ3mh(d0ZTx8YGL@=-b=X6#^wv@a-nFdtZ+>yO5LK zhlPc9`ftX3yKd>Zt(n{8-GrqN-0T_d?dw=|NmL}z5lwua7BL=UD2dAIQjX{lM$X0S zDx$lJwp4u``oi zbzpK^6fv(LUTH?VRloNQ7xJ)-Y)Zi;-_4Vxw`lw^C*oAmQ_Gvwdy8e^lyx^W&+Ph( z)0af6(?4;iFFTuNL4Hm<^jq+Ir42s`Rz~j|Lo5F`Sw&eNj7S#~Mn|%t;l7J34j)2O zW}=MA5GR4qKN=&0{u#NP93HKgcUchE<=Cs-Z3lGcU~gYgDBf5k>l;-1P@Tmw-F^e|wy z<^Pl!W5f#d;<0RZ+U7Nc*0Xx$%Sc0R7f2#n)?8^I%8l>oEaQ3YqOSWV1<_9zJtZ`B zJ+s5*A2WV|_I!t*?I;{ynq*H(BTx&TknOpf$rh%Cj-{D=hqK@H`z2~;^wZ;&J*+-A z@(zhrBNmXpp<`O-c5uxo+&47P3*4Mc^FLEHCq_Y4Ty)kOdW)m))E;^{?5+VQblv^jJ( zLS_;3`=|qdW+7U+&;=fDyz=@yyMVZ8cYm3P%%yV~(kSLdBc5dL95*MS zzXiyi(ggfR;SqtHb%99W8TUQ2zs}@-ge9w!XQXeQUj*?}7EBHwAFI7)Dt)Vn48$Jo z@x;DdE8r%>Kg8r*JY>avVL^;Mw^CtdmUF;L8c&}S{!TeOa+9!PI1MJtE|%$Ox5Ra}GG+2gA=U`0zh)lf5t|A4$^Nok{d` z^jsLap6;PH@W5GPLQL&0X3G6P)(XjA%n}xB-of6?=~$o7W>jd;0KoTPI?h{Gey49@ zz{k)`N`R-vH_9v@VLdFwJW7P~X%gQR10(6>V)HNSI`6sVxcm|xx zkmii8M^>4Cc1xZF0#}XSeA_T$kV)zZB|y4&GhclyAbAX;lsEWxm>?{cs*59Mu`tG0 zqJ@f^%1QAFcR3_&joR&TPLCSzyxsLlJndH9Ew*sXrE=zT#2~rw)D*}x0$Q;PL^U&N zQ&92o)8MoCxC_;u-<1p*>$PlKzi%Sr7pOvIy>Ux;(n20#iN+9so>RlA+qeOAMle^xg@>)W%9tdZ^d0mEah!H=k5y&uSBx`n(Oz zhn0;;Jf3U;K|`wfGl~98!lYs+g4#5+c2%x861-W#gyjxbOuZdgV>uct+)(fPg0UF? zyZk)HvXbZ}pGE8fEL_ z&)w^VO6dNA#l+6$dTsWm@TKn$_v{4jAeJM5R}-&Y($BI*LK)QE2u2p-f>ncIeZ>=w z{e86}8Pb@Z>Z7_taN7=HH#i>0%!-tg*C&<#$KT&Tqd}e#)+pxK3EECU=2~|YbY!Ru ziK5Uh&p0V3I*n8m!{zxJCG3D734fX>1j|3J3p73#lfq-%1(=#-0YWiNVo`2qY58gI`L2(l#|5#IH02AYQuP zs3WWI?5n)YyKt5nM)kp72-8R6zBo3xf(C*#7)#~JlzAuaqf8N4jnYm%vuAeT;z&6i zD%ocEnq&-3?6u03t|$68jW}&<2qD7mh__3xw#z5FQa`N-wN_csOLLJy$?7@$VPD6+ zFt@`cdQJ>Q{WhEr6rsI&CBDw}6Z83WraL=fs%gQ#=`&CJ7t`T%$u;Bs zThs4EYw;V!#S6u(Z_a8rsUuZUX*XZP*towNOJ(NrFfnw7rII||VovV@#<98l0dGC7 zm)+S(7^FM*vLP$ZTfdd9omSt#JGg80liu$pZS{X;p2ToMaa1BX+B-8Vz-7F zsAM(d?q63{m+$^4^)wR>)mUs>Z6eWNM^A>}Y^$*4)p66rzMk^%1&;JU@1qzC=I4z~ z+{@`vE+WCDnXIa2(C}ZiA9Ib#jO{(_Uim&+K|&6^f2`S`mrxYZ!uCBlw!Ghq+o-)n zKDPMNR;7=R==rL-!1$g6G0U{0Gjd7s&d1?`&yNDM-p_*}Z##3Snk2bCNN0R+V|9HTOmTe$*FS4SxHC zHx!F6$CLL0?Az^s_+gTVY{*yqZ&RjxBrYW3-n3PGrcm~!^PuHwgf{g?mrJqB@IqKC zaJr_$j@Bch;A#4}BXw5txo?lJ_!_LP`QfP>Flj97Ib4MQ4OZx4EM44Z|8B9x?_wb! zjV0Y2uHM&Y^uRwDRE{3!DSAMD_5Y$mSa?ByRfeShIV=R8z-a#%5P}xuSH#tob!Dhd zrPTYZIa}yfG~6RBwP!}o+G>pWh&a}vR$U<*9wiCPO&ek`KWse~`-7goyby&34$v%F z+11;UyZ-NVFgb}Xa{?94U~V=$EvA_?G1B7pJ&tq9#>qaxw2YC#fexQZHDF<~E;p;s z6NzeYI7z5ytPT(k?WxB{EDQ;hG;9?u0Q?>9b(k6cLuDSKQi$7s*xg!=2JymO>Y5Kt zNN6J4pD=0=@_Qz`js1e^plsl`mw&0r=Oi4sP!PtG9CNUaB}j@YmA&4yoIuh&18HHPwdz7m3=gz-uyGS&DGhrg0HU zGUsYWy=IaL3&UA5nKKq^X5h?G11Mh~nqIqOd-w!?^@{;CXXH69wVhg-&Qu=HYHZe~ zO$){YEDH0RoO04swpraPn_FWr`|Sd>d6{YDz8s&2a=h<8$z%I^&fV(j>X)u7k7@Rn z;^GvmECZBc@~>OQpto=)1D!vBxFNY#3(ve%QvRhX-Xl1oEA^|PxB)b?VZ<-|a4KxW z;b~9fGxz@34O9DF8`JOjv11vzvs^c|EfJW4eTQpHC}$c9kkCh=Bc{qghdGfi!OMms zcM;*&ySdrd&@bXyn_964=bI{F_*)rG+fidLG^17Tks#;UZsKbr@rxIR0JGUx&ydxSO^q5QU<5n!<73|(+VZ)ysXAzH%qp+ChwG$v z^Q0Jlv@ed2HTS%;qu}uL!~g;sb8_xDwFse#uXI9O4pMLbV+y!zN5IBfkyKu>KMt@O z^%p)j;R}};6t3?r*R(g2E4ynj9_LE5;Ll99|Duo$%IB$BR6MnE#aZbP$3P}I^h+?K z0PbDallbKAhIS~}Qd+y>@vVNUDz-NeSlQv*d_;$BV?!y;7K~~%AD4T1!Pqegv!_<( z`^@;u%`ziT8ycULzZI)k`y1<$cK@9aI~d)K)KddH0rhX5j_tf2_td9yFUL|NtLO2drL!R131 z+C}6IjHY6bKEXZ!;V0eFO;*I9Xa}E6T2eeH(ux=q0G^QLsxU!%cTp1o7sh&-JQdA&)PE}_*-oJrRA{(So{LZ z{83^|eZ6l&R7=fj7ZBcq@Px;AVza=xxT0Qb4MvAcxJ$?(g7?cKOU^&>6f5TqFBLxa z#NgsO1en$LugS$e3p>z+=KQMvZ?{8I_N`WxlB_1t7IQ{!DC2f?8S)p%M}6JK3dIn; zE5H{#uj*$cY8Vcp^s@8+4EY`KT-bkC7LSZTAf4vEio;v>m2Km!d>WI5JX;vhc>`f3 zW*JNXS<)Dy=MRn&(4aaD#rYO zsNZM`h1jr6atdWM0xWDqsayzVZ}dfr`wOI6XiETFhW*J;i6Mv%BLxsWA`jXzP=ZH5 zwC&#RzV4ncBKledat89q*Z({N7(BWd*vUa&zEt{WMe%6(`U44M`3imhvY+bePY+cY z8KGQdR-liPo&FQ0uWMwYCKyjPIe9_hd!s8oHr^m>a(qL6I!t+(evuNRDIdg~{haT~ zyUQ+hB@>nHW;b*KobSblPte?1;l2~3Q~DZc%o3-25eo%E+igwTaOW%9Sdo1*5ZxWM zUjT+rhZ;(MNO9Q8g3s%c5#mY$Fw3XwTpb4lr`$3#Jny{U`{%F}iYdvVo-V7nVwXb^ zaJjN`a%;AF;|;>4%J1Vn5VpI}U<)|#usK||r?sC3O;%mnRcVs}`v+$Q&cMjjk%o0- zKcJk6bQHoLitrm1Ev`BUw_QM99TPn#xZaZI5b8aT`~d=|ISO2Pres$O4wM~D2e*1q z>u+1+f=OOK!=D$KxXjSP?{9HY_dR)wS|$hkMDNZ!L9lm5>;&!K<)r63RGxl78vk4! z`dYKT>~Ej+-60|mLR=#3hgzvNQX#2Xg~b@X%3SUv68Pw26W|wLE$N&52m7l?_)s@& zij4yjbI1)Glz^fjm>J7HxL+8L3Xsc%)-ttA1ca4Nl}txWUU08o(~pH1#+B|H=GxH$t$3)u#d*TR}&4T7+zjo{92A=n-|};5q-7=_~p+XXN)Xhp^)MtZ!AfQ z!XGsps&SFDwu7uBUa@LVmlwO9Me#@g+#V2}=nX*qMb$q*Hc)+9SEo{v(ZMC{&c5o^ z=Y}OZ7~k8ISSFofLf?(z5G7ONbNbmFZKIGK*FG*}>v3St;NTJ|sjgmJrK#OIBkRy}m2`CE9ApfTfs~%b^fGG3pP2csoa-D7KTK(Tf}N93 zq`RX;MCL+JcVZ0q(kyXS6*qusL60|zE6d4Fs5leSP8yT#&@a@Jsm2fGC-tIhmgqzt z3S1%LrKD^g9(uA-ummO1_tVfjV?v|%Z9?hn`}!(ins;0CzUIMD0Vb1Z*8sMtwCW9PGMI?s&>|7Dlx8L zkA@>WV0W9Yub>f&&Ac)?hcRPl^-YA4_`*{i&!Ag5!o1n_^cn~6kn&9kOw+_Om^&i@ zsf2}aGPwT`=M%^hg7+X!MSDQMCEQ}Qp*(gmD?@q%euSL8rZk_>plj;(=qggm`pUHR zo7O3B@g^8m)rHy%=X|g}TKy+~V?oNL@^gLK4HCPdor0g4xG&6s+N5$G0>j0zv&Xm$V@vD)XB_|EY z5>k=AkZX2@rBz?*dVE2m`C*IK@$DcCsu+QkSv2TlGA`<}3j}t)DWAG;w61V-W(>EF z^{I$jd8fryHkRW1T6()XU8)l1!!n#3rxR5c&q_W@QA}0}Y<>oIrfVZaOU&!7I2GPXGp{Pb;O_796R35Aiw<(Q&5=KTN^hxWwlE& zBjsyx-Adb|H~q$^sZjiu)_~8nZbNdneV+|!V!ezds-i8%_G1&7X!_UAYFnYbd!)BQ zYO4|<4z_=Smw`M%js1jcTbBRS4SNZl<(=)1Bt=3F8II>!@w6I8hE9_#w(Bh##ARi) zr@x+P+N;g7(2|m6vhL)+vtY%AHt)|?95R^N8KGz1+oeA|m24U3Vjo>uXY!(mlm`cBA$6!-K(r#0vL84tF)cd zgmqYK-1h~b=b%kYwGgSc`(cpFI(D93wzdp{tWXx7BzAm1f!`r%xAdXKCV2?Fujb6U{zVTJE;6C{% z&Jl;6s22jUt1Y_xSX4W1PzFOkS5~?#*O#~EMb`v4Jsbj@9^Q?Nw7I+L?@FLIF*MW! zc^@PT5{8$~81Q#n+IgW0D#kPFx-nAIjY)|mD&lO*IvfjI=X}n)wfXj) zvZhEyJ}$_*W@UuHdArO}||VvqnbhjnK3b{#6Qo6uX}@bKfm z;bCgzeY5B4wN@T-xohC?@B=u6%PNT!x&?#7#tbv6K#zusa=LD&pt zY@p0sxVWyI6cK0(q_Q=t7btj$yw$W0V+11L=Ygh%i$%#(v|H@he3xYS-=)u-u1x~rxFe)u{}MmfLt;X5Hw!!HK?=l6UvHOpyC_M^MSIz4Dk z>RgqOoOF)Cv(w8_{~3BdM5UKojNNE%RdNamsO{JTIiouxl6vZ8<)&d zw6);LiEz82la9x4GAQGuGGM^l2arWurZju;Tkgj5SfSDEwz$g^sES5o^09HT64H@bAjdU~YIQyeElDBsHT9ixNJ4 z#W&(r7SZX>8Pz079C%TGkzNQozvbI~&?z_A)PJf#O?Rh(u8J&R8J|S)AsxN&S`P%n zrkJHAwr2sNzwu2;ZA_J3kGmF0YiiJcjQgW8%^Z2o%!UK z`+usyh`vZ1iGQj<%LdzTfrS55fm51a8OJDdgiifsbMBnmZE#ny&L$h4F|tfGXrG2C zN;{Xc8^H{HR5c zqo(3X*D#k+l#e={B^abMo79ALu^VtDm!P-8-{wblr96^HGL-NT&y^K15D^%pvFjOF2&s`=`V$Fsj1K8bnl#~fS*I{nP8a6tYDz$i@10qcT%@>+>SP)FPGCI%^Ads-HF4C!@(smb`hG*PM*E zY;^@6Qtp}d_N6=XuRemR@nQ6&6S4%DyC=MoaU2j)CbsMcaM-<@gEE<|HmCXPvK^iZ z*O8io+s9*3ZPEt^5YFe*T)3>JzC-$)vB|y2lwG!-r!w3w&FqBYYc+kAnk=@dNLTNO zy5Mu9y>H{Y0c)*lfc4tkfunI@9T$Z56#8JZP_*|rDp!f~IsywiXGeUjV)XaxIMY;^>@z-K8H-&;%y9*H)F7V(n_Z`^A>5?#qkRo_?=?klLzIWuaJbXNi!c zCZU-bri|K!g~A6M@v9I>TO`a0EO!O#aFc-{N!@@TYnc1}0I9U2Y(Sf(vpL3uV^eZ*x831Q)90Sn;}+Jp!XvwonMX z?}rtaw+^@S?a4{xBw&q}s5a<|NCfXRx zh==!Ira+*qoN-@mg9|NW?gm0nDIOlRl-n%+5znQ4sT|_!4zCXjZ>s&z-M6pLlB)O~ zIil@k1JOLZhqZXf93aSeFiMc($@+Dqc5^r(HH>l6;^zR`twmcygm$qrYz@JS@0XJnKfEu z!=NgxdfY=$NTQy?`rx;x=(<=kV*}C*4TT!`dxHuNd)DJ`6kJN(Ni+tDzx`T{_krl) zlfW4H{xR0SV;(6_YA-hmMnKx_+gjAgQom*Tyng$DTs(=#%EQLK%$Ra$a}f~Zfd|6` zh8mdUgGh{tNSoL$HO~a$Y$Ryh0(;u7|J}T;EokuG&iPN|j#;Dt#mQ`NNE%S30;~~{ zEU?x0!s1Sd_iyt`6I#05&1Z)hXQB>($Gyti_1g8V3&vT8j~fui!yju5zw)TJ!E0zo z^t_wptg<+@tWYN1?;6UlN!eEu_nU&Xq_@mKlfY zW^-v~HF4(t=H66=i2;1nF#B)%MxitTtjqHUJvwmL|3rZ>8OZu4j9G-5mgsI{5>OrH zRzdrT^~U1n{a73F5#9_8Gi`K{uk%b3foxA{p5e^pTSw^Dzcii0+i$;zO^WL9SA&v9=J8lv1P`Kf`ObsHyo+$egiSEx z`gM1SUO!IYTnH0#M!bzUztUV!$r6xmzc|>e@jZVB)XN1vnQI?QYG?$T(9Pw<<@Bg7+Hi{k2^a zJw@-EzfblXlB(xGZ7sHZUyurJX^M;*fqWyry+No>twTJy{6a=u#ZUS6!m^m2d_sQ_ zCZ}+@lhL(v)bgZ6U7m{Z!|hUUFCAP1Lk-^hqqs}>sMeBpFL=J=lcFaS{KU+!Z^RR8 zW7%H``P^;$Ak-f;d!I9ka~u}{91u5J8rIR)Jp8UPN|21R3i=w!-y?eKu5U_2q}rg} zjnVug!jU)u^3$>!>4*`n zPprLA9Zm-JhPV&kbdK6C-(y5SEeJNRh<8vmajCo` zoU~o2+_WD0rM03igpQE?gt^0$TWOd%=YK$7MdWP!;ngah)KG~D+#@c%lQ(~WMWj34vq7UQ%B(M|- zP7nfFkCQBSF9DC)cs0?XP@Z@x<45NZ&Ya(C>}d@ac@)S_0(fs^dso?4YA`YX{VmIc zt4n1e9d-pA_FJ`5>($s_nz(=+A;QRdzTF;r;-|}X`%-`F01x4+1F-|q+M}%BDB?hP zwZ>;>57!z2D)oY?@dbMde`Mz%v!Z!p@7`^L4SLT7vMOG864%>-sz8bapek@_YRyK6 zorZ0YdbE|ae@puWkpFXd&g|!%xyp6FkZ8vb0y`lW7MTuEyXp=J3~y?zpX-VEa@yIA zk}f90g83!m&tQ9w49h5V4M3M0GI`qgn$s%tcL=i(mr3&$+P8Pe7{GAd5JTl@` z{=p*M!`;I{_LA@H_<0*mNx!EGwKp{ffUZE#|K$qwyzE$r!r|`~zTjCSumcv8SWfdv z?ovkdV*K0=!6pq&Jp&AGuFZw4(OSa%f=1;p0lETPpyx#)8T(>;ug4wrsmup}QoRt& zz)uA4sY5F)RYln#JJ`PoVqC82kn8E_-m|CB%^-SGr|%C&3^w2LsnKAFq@rPZE0?_afPF);QTu6nvZi+md~Dpl!lTkG z&v$}THplHyY$}HE@(f>8StOy~bt~jn$Ow7S7Q4k7A!?0q{8?`}Q_`N46kL(#OX5+Q zEUZ{pBRjnZX9Ht0wmThm`vlgJLVPE&!sXF`LnK_#S~%x5kY;BzOLd{qf#65TJ2cSm z8wK%yh$(|k0nr)%T!9mz#Wwb~-f@1|mSGE;zstVp>-_sXX+|@d6C2J?TYI)B>`S>B zS$<25@mf*4z*gM-$-$)yvFk*S#hA$PE3@|EHNYWHi<;j2aehIFRd++#UUvVi0``Iu ze0pJN;uZO>;n);c$+Ieha0YhvM+vg9Tb6pOQnj@JOU!*p7U&WcI&&wi`UXzWpDqx` z`Hd{?NDz&stbv5p-&lh!Qn(KXT4LFz9G7Yb8CtkM3DOub9)J7L*xho!J&adN@TsTdV>cK4i7(^$j`wY*$(#U zy+h#vogS@ z1rBHpz9cS#o?cf@#gYE0ew5gFgm6*;%!zqD@a5Fc3d^k69XTRiMVrH+yg$E-6siMPCF9aAxiJe~_y+sc(d>~d=0inX? zpKWDisdVBZzEC3>8qa+IMP=neoTMDHe}&=?P&cFIqIN|39YskUs@VyM zWy*~XI>)n-S2;K@&$5E9gZ*ueBP0QLMOSjzWm2kCJT$E^2ObNQ}!JWH9 zcZK4X$0Ru=p-M_s`MPK_F@37S0DmTg175n<=Acj%C5K*_NYb+dcq}0N9)A?2#Rujg zOo>La*kP?}@KTtAaFV=hkWY{A>Ce;R{)k`o4oXA*4Xg;U+6c*jn5kp` z^4szqo}sOP3xD!C5d9la7l^VT)d2WPCe_BX!rmJK|C_j&HR1C1h}aFwu{3FLEB5+A zaI8S7%#m8#SwX`?!qb`=g)?t$xd)o;vKSkx9|bih?yVwqO(2Y zK1Pb{j$vnn@G_hJUckUJVox;@bvEKQK5W#}RxUEW=l9)$gt;Hc4@<%~SJ=sd7`e1? zQ1$?xJ?&Zstcwtj2qukuTyWcEd^b9hBdC5dKJMR~L0;Mpz#3{I4>1bJKz0;uyk~9& za!Au?g?)X`Ec)A&?--oOC->?^G~|L`cY@Xqk}7dVH$!^DVI&d^PvGm0uQ?ajP7;&N z&@YsmsU{5OXY|lB39JY~0#<|!VPkI{??m`f8cz-nH-o>%$ihY8WU@s;-Bk}fsKd$g z(vq1quG@1xtNzB)(5$=~vY7&Cu-PkNQkB+L24`&;87bXGm}xl-f#DYzYrxDy0V_gu z>;>l2{R?xEkGeC#01hCr!ziXaUi@UE9xo z^U9kduO*9>c3;5-{UP&|B6}ri%(B9^4xOcUo>U*Q|Lhhhfrh7%H4pcME=!Z>7dIp5B?B^+~rNOx<9Urb_ZIir4cgZb|Z#GaK7 ztsvni6j1oh8|L2f`EqgR4Al@U)CU7I)zR7)m@2>iaI&y)cx|$sN#r|dehtzw|38i91H)r0wXuvJ4R62Q=X*maj zDFe?nV(REeU_-i(lq;HQ_5$g1t!*L8=L1-SVNu0ffEZE z6AZ5hUUxJGEdRq`&~Mp)eUD^@$8 zFv3<7=_0u;-^@~#1tJ!qas^Hd^wsVKHz#DjTtjSIA^EA}FS(@hm{4Ky)Di(}Z zp8eB;ak(3LBbRKn%GVo2a;-F7NHm=Mm?)GRJs2Gvt-T&PrzF{&H>=9suN3;8>rH%WS3gE#Rh^COSOV%38U!nY`fwG|Oh4NoHNTvC*k8Uxf%0Aw4|Ki>Wy=-Ly zLZzkWnA%Li`l@UggKQOp`NpD?+HWKNg%mo=WnU5IU3arXM>ENfjC+oQeU*W-Cy=me zGPHl?AOcK-3x262u5dV0+fL)yY{6YI*&ME0i{fp$fS00O?3U=hxinn&tnmr>^VNJ$ zF1u;axB)jJx)4$&-<{{hY`~?1vruBQao9?;%{Bw^_8Vb0%wOr?myDtBEv|L1t){|J zGZ|5xmv|oZ#t3siXkJOxuaj5J1sAVRX^)Kw0;G*^vwZ^uXv5Oqh^a5!kd^K1ruxPr z;PFS_nDt$e0`D$-k_rQKj@dhOU#hQe7jclruVMb3DtV{Pye3B_g(Ok%_KDc*@pxeF zGAcojm=(N}-QGs2+SQJ&^(9+=6=*!{XD3j(Mpf1~F*(9+gm90g_+nBB$2~jL;H4qi z8bg4+KR{%)?6d_u?8umXz0VjP2!?{MYy5wxx(D~T8lX|&ZP3`Zlg8#I8{0v2EK%@Amz^d!Oh23;UciJ2Piye&dFUzft`)qf%QX=H|Gv>o=B*KZsgyeOCt-ESwrGy>)smTq7N$pU>ih0w=JbzK~v#Ue&7q*KO5vWso*Pf zRrcjTM;D9}06Np#^piyJLq34i1sM~b@Ja9hU?povt%Zmk$e5O&Od_G`l(owV9W$ctp+BmLk)KAvIOCqvL?os$C=sTz33j2Yu@Cy*OH2B+7Yj zHIlMG*_DnJT4KMYXFbeO8uR3t+hc{fzwXYWK^8d@$eimR#l035s{NrVhzjWIy|Nl> z==5PiFFQo(FaJuypyfCB^;-A}RHyeJ4Z>%Q>Y1izQhmE1X9`cAzFGqZf6G76S zXA6^XlIKHG&$q{z?;o??r%{INgfk5#rglhxOfXEC| z7Czxdu;ep@z2N1I5_i6TAw)DZPZ*}QP=bcRJ$X3<4Z>i=lz!}s&;!s z)*Uz9Ru`TGxFbFCcNp3lO`x5GIwnR)B-Igb_t|D!$j*o2<)p;hczJ16ze-^&FhSOw zeY_zY%m(*TH|^2A++A_C$k!s&p6p*c9Iwqurf{+5q+&9ZK2wO-)*9OGc;Bz0R27XZcFTS6KHvw9kwsNVOz=jNpO zPD_G={P-Q`H@~}nhf^Sw_FvmTi(>^rRltzH$9a(BWZ4711P3PUU1tew#7KDIzb0Ki z8SLfdi7E6y9&fb<-{HL36d>M8w#}GuQ=cNs1IT)@B%{r@Tn^-gm9B%6?K7(OoI}rm zDH0?@k|E*g8jM;TBdBe6G)tSMeH|17@?F1Nf7h2;aSF!RP3$1QBlYT*rH;2?g1unf zr53nm_a7DlI5;>$4*XdU8+KM!h1xVN1u}F(PiUVZL2WE-15mJ#qOVl7FVU8kfWmN; z8lV|e}OulFk=ctZAd~);aeSr#$bTHk+Hry(0tuGJ0XW< z8%#hMKIgKw>a-+uL-bh6-04quJ#961zto#S}&h;S_`Y(|EK@gl^Q zF}sd(;e~B>XgFN$U#zr%5O|Om+Tz}5&dv4jwbY3*)y_jb8V)-e^X%ZTZE$;V_MzrK zh^Fp`3V!ZSTxzf$&rq{|zrd@Drivl!N_K`)qlO7+PcJE%ZgYIEwu#`Nl^-n;$}2?! zk_A$pzVD)rgsz7H4W5S>JAA0Zkksjpp zR_{ec#rx8V?L}TWWc$MHnfj%0eA44#YiAVA?-X%NyPEnHA)}dbkMQTzqMqK^4&0BS zR^iHMJ8!nfMxH~z&R%pgdU;19fB$8j03-8UYnsXTGgi58YGgVNtOC1TZiBJ1}_}t76LJAD7(TdD-%-A`u7)joI*T72o^Qys?rW49;Nj!#LUcF#rmfoU8A# zJ#A$eZAL4&T9^zW8WBGR+_1_MP_4qL!uB&x2Xz*r3t$;BxDjnzqBlbwdvd4Od1^~@ zk@xY{=zoK5c+lE;SwEF5W4XZer!T!Y zR{8s^xp15Er$r${MKNdj80#^?J z&6rCWX=>G^x<*YZMYcSw+JfHTKokOe70Atc(NF^suGb|Iw>dcR>?93^O|HhI_BOFV0=$b8DRa8Ye^>$Vrkm{;@fG>-aESvs#-1D8{E8FO|ypTagk2jnOw%)>hUm zg*ui}I!dn`uSyz zPA7gOQ|J<+pu~7u?lVXw_HuAp-Wk>+J+E4+7A~k6JWC304$m zZKsczDy!9^=jUi6PdzjyrPhq#Hpp?leVK>=GgRK5mT>R)^v}iW3rc7=BYBWi?(`4> z&q3kH3auEb@jyPe3$XzhG-8ml(ct?`Phb(#YgA0+;Jta@ZQrr?#=2g;!Z8@iN*$YC zTAV-V27$kCqgHo&*hIZ0|E~y){+|f^MTak>*wfm<@Ejzw(I6M={nEEAfvFLm#sZB* zV3+to{Q=PT*fS8k9yXK%e>7oYir(?#_FY>uZKT*~BfTGe(Jae^m}cnnUNPAKd~;wb z({he=F%PqhlZ%pMli=D!8| z8aqmvU?1cluB!NGE85Y?DHlDVT~kL}c6_PSZq1aN{9l~J9h2_2MH&oAvqibJDBXm| zU^tMJeV^6wCerS^x2XVjHeQz-vdxMG9U@)?VU0vlH>9O`rJ`$S*98R_@N+|$;JgcE z#lSxXgM$iPX=?nltsIXig8vfomup%jZdxR1vfKnh$333*wg6)152r8<)c%Q7GB3He z7M1*r(V=o9;McD$pHaAJOqFiw*E=x)D23MUpG;TYNG!bMeMGYFkyxQrfV^~-8Fudw zO6gwyjqafsB&ISd&UD+yv$A(QCtA#LeN_9K5vlSOI;Xmw7sbs_$uApr;0||6Km<`A_Fk@z)|& zi_9Px4zLMasJP%c7K=(E2K6Y?T1w+1PcCX186_dm5Douj{NiVh_DTUIHfvKnfUkFc zhyX@&BK!AmSEMJ3JVIgteph0QlkYK?O@xI3hDvh|9fzR1I#ZtJR>R$d?cDcfmxFRH z9W6^EG{LU%vGNmw`SzoD1QEH(X54ZNu!+-i5L(U)rzlB7y}*@~?<30oz3Ep_+@J#`}^xmg3^l3S*~Bi$YB)uv-Ru1A)KzZM78wi28C z~1&?0lJ#A0M=KC z7+vXBC4bF4V>P;df4U#APyqE$JFCre8TR?}D}zg=_e98cl<*)pY`pC$&rQRpfQGN* z^fPIUdb^7dWT!21$z{i*ZnqExQX@2Mdm99VTaIZwM%6^sM5rNLU>+p>N3wu^NAQa+ z;_`ny2rCCkQzcQsLTjd2WbAEyf66kL2La5ucQ7twt6f3JmbX3l#&A+ATU#PQk)U#x ze$N1lz#%y`$}4gap|KS|6^yD)Abou53XxZt0c+w{aG{nOGdO=y*h#J=scBU5q5RA0 z1Qy<6gFG={C>S~QtOrf)7fm-PLYn+KkYjG>VTrpBYp#fJsd+WsaSZ zq41852~J1V8lWI#lG3^f`R~vNm4eWdoxrc7%p!Wf(KneRW7le@B9C8_axEI9?a%TT zO%}sx@0ufxsluIZNSo^V*ir6HxK;jzkn*HtmSl+&on0?&CnQu=(I{9lGi{YN%8Cr} zwC4yd{ZFeq9g>@mwVZ>?@0o^q(G&oJqWA~$ogUVBaxr-O4o(cp==sg0A(Jx$zx)IF zvLw0g#<8|j-^W+9r$2kem6qLuL28u5Be`uD!af4kMgzL3Ka?=ktu`03&@hSs30~TZ zq)%>~Hj$L&%veNhS8(W-iH=~0q>P?M$O5Y6 zQu{lR$a_B+1a9Y4q=39@EI}gyfZpdH3(oV` z%nFsVyNduRviBpSbRN}!SzS+y84La~tX!eS?FqsXsJx6EBV>}b(u1x5@lgxx5<41-7&bcKU5X)Z>zvTG zR`6Im{4a-HN@++%b3HCkeo8cQG?IQqtJyRRu~SZq-V3Kg*Yjl}m@eOdtQhu!+@Uc- zR}_+|AM_0ku6HRCsF~wcGZKU0NS6gsh=b^8Y@d6(yA8h>kB3UHX3nm4GRpmE8h4ks ziT-ACvATO-pU8;~@M0O~@jYu=AB4k=Ud!Z-lW>QgJ{n7u`Iu z1{FH??9r4}LsrD46})?g5i|EA>_{;I8O(-paxQidfxQb zBzZ}`KPZm?+{hxzxCI}88CfK2EwZnmy?i+8n0qN>bj5P0q5B%q_pRfLNCwwQ>?YUk zeoLADSIHnewJg*}Kmv~2t<|&VY&3BZfW&`W_{nU7w3Jr=NwIN{wPi89dVkqyZc+?B zYvM>08X?ROoA*^#cjKPAa&Ip;B8`AVB>B~T@P-ocbQ6+U5us0< z-oL6cAb0(+RaAz2kr^L2yVu{_!H~>OUgG;!`$Xzs++c4%f+}T{kI!p zBU@+N6Z}pLzf^W;ZnbFY`(ra(nC?y;mB?!LIacL)VJ+%}=pt;^iH; z8O1EL`1=u5p08^5?>p_FicgNNwUTPpFfXso1Zt(n%!=EDI&!ydkjtIYE@?80ixz8nb z%T?nteEG&D%_R&vC@DO@F#$sMa%14ipae5iPXVaO(~(|WJQAiRf~hO$jf_N zc+MjjA6#~Pv^{?ccwd{Yssf0-y7t9R5f3Ji`d6DDXc|w5<|N-b6pxr7pX~YzDiQ`w zdGnWqC9&=V{xJPqb;SKW_$rM0IhRlr0y<|lKE!6i)gI^vtEr%0nSa2YSE#^MGG3jG%kXLe*f6-pNc_7?^Y)%VB+;aP zxD~Y3x$bZ-!ARZSigZb(k<5R8I2@07sXq3LUp_5BE^9$ z3AWlo^$Rf~0;?qh^BXroOck#}#+WoKPG~wT!c8v3?ovq6vG?qzV!lY=-lyX;i$&Ai zz78CT8-JE1Of6jfFA~3O#JaU!__S9E*HW-D&bg{zqZ!NZABf3UN7w!NqRV*EOUhL# zsO?I%SE!U5I8p|q-W}i6RL~zjZ1KPMB_v(2@T@jt0zv%=@qgnG7RbFk1m%cH{DU}l z*#>Wyd;Qm5B<|)_ANy--nmY6|l3{3)Cd^W;v5@rSg5>Q+)bEbBZJp9gaZKk&ceiI+ zN@Cb-jYW8AU{AM>53<+aVbAsl?JWM4N6BCcn6?x1z~WmLN+9p>&k8C*b{B=nibYVg zOM}r7Cp*&J1^}fu@=p%Rl(`7*w0q(EIPHETZ$shD|o_L6s4hnLUCs-X6 zu@{PKF(%+92oWBJW@J~;yPYKJj^lxO^SWzTQZg((^m4Yx72%lqX;}vEAjYj=$WCs7 zDAi3Qh(4Ndvio=}Eg*XbfpwG5VB`>W*@rC(7#)L%#ap3MZ4poAcC1+4rT)`fGCa+f z_LR<2bKc6Acs+f9=!GDtMT0ZVnHF^utEJi*!{PGNv=73}V9-i3jowt+w_}HJ=VzpSaUHTbCDkZLBPI^? z#Xpl(FTPx8`|js>JJ$~^)#dnGln$LG=N-jyfifWzGm+>I`ps2z^( zMIzschXC3*4?*|KwxF{eD||Q2gq-)C5zJyDLI^>4!9`V#}6EXnhM5CR4)x|6C0D76f&N;*}7E#U2UjXkghY&S@C2RD;3 zuKNXS0po!!;3NcUE%?3P3tQt=4?WBC;;5#P%&g%5VZ%Z}vvb->NcJJiRcoOG1Dshg7{yz&C@{qU2X`2pnEnCm3jP?7DR>r;c>AaKzy~Irm`nkdv+8D&!eP9P5 zuem%ImbXAgX5}ZeYad45`_{o)*y|RMZ|DR7+jewcQn@!-5Gy-z|GV6!+1qoY@l`le z_Bn;4SZ##})n`X^ckU8r=V!o}2p#pEzbRi)8_C)|!`MVmtP!MgPC3q(aY;1iOPfhM zn}4rmJ@H7b1ld#^#&pW9m*tAp`Pt!%oW~fEd?+0JZ5U&X^bS{3SWLAeTy@@i_evr5Lc2(f z^6TdN2)`>bSzbs^LLLQJ13n9i^*z-8BbMds?@lB-HguO_pvUi-8q+&)-}6^r&Ax>aZCSd)%Z#l=&niQ)>qG3{Z$LG0{e5sIh_^_*&L=U z`Y2#As-c`n7EOoR4tK?gs0(d3Ks>L_(NtZW=nrSH2Ho?XBe{pO@h6o!dhnbWZ_Vpw z+H^Nu>|lrlhl4oc?cW!q1)m2>PBOmw%db@Y`5(7c<%j$`2ai=aeK`)=BBf z?7f$=AQup3R$-m*!*fLS>0B7STm2MEs~fzIm^ALloLy0~yilx2ZCsHPmDM&MqR)f3 znBaXy@e@z0IkSM<_MSsOa|}jS6A8EIK-AwqDG}|w_;3}n#4RE(IkF(sDZVvVl%oy3 zdRsiO2E0QtXMoB8N>d3)EGMje6?OwkRVE0~7xs=1d{#hqt7p`AAE}3k^#2#0+=N%k zfB({!?Yci#NdX+EG{9*|eArrdxU0pPUp)m8#jcJ!%xT?Jd(3p+;>^T(wTzW-e={K1 z5Arb>7f)&G;%cwLl`=3Fyj7grEG_cUx*u?hmg81ZEmt5s_OZLx8RHdrr~~OGpU+yBx85Bg_k2^VO9`qs6Ba3L-lwjj z!`-tulO`|+ti&nxKO8VS2?BLUj;6b&V;pHRyLyslE@hDrDj6Ly2nDK4~aHizdRF#eUKZBzNnW6vn68Y9N z;(C&e5mLPiqVny+R`<&DuXgJc(#N}>bx~i-F}aQ4@wwI*-sRui+pmVZe0Sn{lCft= z^mGXa{@T4Yw~W|G_PYz8B;8kO2tem*hdkB~wYxWN>1xy*kRDH<&yuI$rzH+r1+SE? zBDiX}(zgYXIs00kM4+Bazn1+a@}+#K_HaffBpi_6X@z;oX>7&6Prp(s!&lDy_CruZ zFq#5ykt$u!P`E11!-sor|4bslXHO-ASp(>4+P%jge1087|uS> zZ1tgWBbHmd_%vMqEI4(S`Vu5`N?;6|4{}n|1+2e7XY<@c*j}R20Ed6&AE@=t79|}y z&eiCX|CIgHg~OSq)3DG2T32?wX1(uN2X~;|WUH`^{-gn}Z=HaLvV-bWU9S|d30WI{ z$?J&V(UqekzbycH9Jjj*^_TVh5nbya$>$ciRO>14={dXMK6*Ks%P4Rm6f8?5Nlf}7 z<;qch#0-6P(|Xt7+H>TbxGP5@KSC%CddKHU1kU%bF;}DM+*aCT6GitB5%(`wdCEmp zVY0Ve-&gMtf*bx055_M~-npd*i3?;p@Y2_-ag@8kbCm{9$QEo3LvmT=x5;E=z);wW zU>9}8msGKk8C-%WFDoJ}#ME^Z(YktBX$E6EDtDKlvKVgU%5-6R`cwQXNeNzlFOL&` z>bX(kO?zHB=$`E2ZLi7aBl8gl2iKlKnm+MY$Kx?=+xqI6UUFaGv=r@m?o!WbDx9F? zOh;BNnq(B%z;QHfXY|Zy1-Wutp!92q*&jPvINP#&!-zKe^ODQP2O|4%*K+h5;o^D5 zyg>7W1aZNLi0JMSI=suRjpAG~@7;vDIAtZc@2&!aAC`O&7bK!Y*hPj-cNF_Dh2(7tL>-#1{|tyv(?MggEA$AW z1;!@`rH-_Gf6JSj5I*$X*166x`VR!Y>`sM#+A5g_S$qrb-D=TiRpwtd>D_s~K8=`8 ze+tbzEH1U}4uSLpPxfxTGQxO}V8UTAu=VELcJ^FBTPvq(=5v2*9jt;DS#VBa(VR^> zKY*5ri&r!q?%?L>-sN)aH3S#}ND*ysU}||kvwF9CA>6Ox)_xx?gzmLtkEA%;bq04cwX|wlGj<%k!B(NX&p+F>(s|Qg9HO=HBJcWN^3C$PzkMtqYMO z8G`x!|8U;SomT^z4@SJ8Bt8l2oIO zR$*q3Pt$h@0w`LI?p|l{I%8MpJuGFJfMK`dH^C~=dz!l-JT$DG9qRolqlzb3BA}Xi zM%o|vF+D%{OdlVmM1!DKI;u_sT(Xw$Ie4>=%;M8l2^&k&RYR3nsz;7^12UNVd%||+ zKh23xhV1hHg%B-fRwI_ExrV{}+C6;I!Vr8kk+Ir*H)$O}1lKK2P5Ya3%kS2a zb*}o9SCS`XbGg(meb zZV!I>!H%JAWEnRZ4qG%01LDhS=RzTB&ca0agdu@7SOZ=GYrq8>$Lr8>A}`Z@JdTA> zMJ+c|`O_ZB^kV)tqjT>BRun~0PHi4!o9k)l%f+L?NyQ&9=i#p zcsv6!$eeU6;zgrP6CzLD!V{+%RMr(Fh`+0Wj=&nQONoDP4Sb3x*4OR9e;V*atIdsv z6uB5VFcfdDkeeoS!FnoaeShL~r4E4X`wk^YVlE>dlfrvK49xzlX=QzS#2!V;pJq@H z6^TW#AxnT4Nkwi7-h1%xLF`XOOK21*0&Bp@pX}2vQXfyK|x`NgMy8nB{<5%j`GdH_ul&6chk zEz+(mP;n#9Fwv3eos`&~aq~|E3Z2Lv?&V>447E4j+Ly4-g6!Z}C(F+}dpd!osa~c< z*uwhCffrWY34jS%qf|!(aOYw8n{-zESCgG@_)#L{qU0jJp7a{uIFI91%-?YhIL!pQ z(;Dv2mLYw8eTo~OuJ3X6m0aWVu4Irq^!+y~lOHas#$fs-dMYhpLJG(YQv!<#Op>Z5 z#dx3aoFy4�F-{eN0v@N0O2B%m?c&5y;nLFH3S3OE}-%S8mhOOo*Be zP#FH?>ZbF0Mx!s28lYIE?(uqvMXd6=ACZ2M47u40HetSxemT#JcRv%s*0lFM^WhT| zY<5n1cpjF!-}rf{Q*i`T5c_yN;)QlF4Xy+8Z|eEA%l2mc1BAcHvIVe0DH@ zb6ZFxpx_RK=nK3WPZw5GZNJL088LCH!ZI4I>nqL*!vtnb|Afaz?_qFyNNR3BmDe2^ z5y#=?1_rS_Zbt4)<1Tc;=x1UFlw7`roR1F9ns`g`jIy(Ut4b*8vUg#2Zahx)AIS-4 zO97u)=iGbI^EZ_~8=u^>H$7REbVYHV*Csoyr~TAu+!N?sIarzF1krqOn8Vu@6Uv{= zjtAJt^k)!ZK5deKE}|c?H)2FfpqJd~NGPcJ=XSUP1=K~L^f|3g@Re0pf6RE9=e@Xp z-R8zWay8YmfAVzAxzy9Rq!@cs}cV z-Z?RiDK2VSF85e6M;o`>>uhLhCt-r~a#f<)7&|3?!(I(zFnh^RdwQ;?{ zni=Xhw7FsR-AWwagxa<6)>Phk(x6*#a{_J82FG30N=c|)M! zMT($Pw*K{Lt3|YW3CjfH${wWBD^fr@PLF|bL(vpkI!@~Vr}&-)t)YX|rWEB3& z>3k^(#!RTZXxMw=(1SHdinEV}U0G7WUq(L9EKgUCi2d|tj@*MZs-~@GX-ACwx*YnW z=FYXYk++$ho^RFG@R8`7*6F!`SYuKfq${DOGo^}lk%Ziu8aNrswX$T3B6!_>D#@oj zdtc@F6GFqhZsgGDNDF!jrJ?#ufm1GicjcSR4}^fT9Q+=6SQiZ0avyb6R&){e-NfFz zgO3$Ofhl90W04NOH5oQ-Exzn%wr_QhYlLaIG-;@>z*&{#`$~V1lLG2O&+NEx+bi1A zXw>@De}h(+B-UQpNf@fSWoUl#xT zzDv3U4`3db7h$7+T=%Q{CC&e);&G&ecJh`K8@xiRCl0-n+zHbKbw1-_A}hoX`8{|D z;vZX{8FcRY#l=LU^P+7Q1)gHh7+lr;W*Z|pmx)y1Jiwu0bo_Z6zfsW*K{lbS0m*C7}?n&U=S3|Be5jCk>wf z3JcDY>45z&hT}mq=qbHODHN(uc?EfLDXkafKI6$Z0=7|vOhja2wKXQcbj&Z@njAXn z5h1-?C2-84-ymN}>38946|;i;JofbN-@Q>)3?#>^U~BFWkC;6#?2wUg(N-epflIBI z>Gq5l z3b|cVO{f$q$0?>MW>43E|99_e#jvMe^jf6s5k@{Btp!nJPM^*6#D*D1t{QWgzM?11 z;5@LdEP`|x*WllJbdQ|h*otZ=Xabc78WgVli!_*tVt_4!p_7^q4wv!1QCUiJ8S01A~BGn%ssZF3qXfBI|qP8S!-;?gxD_nfI#G7wdW@eW3Pyxb)mwZ+k#WPbmuM?p9Vp^NaoVmXA@3piLi2oiXl1)LA%YJx2 zQ$N45Jb9mTl?+Hl#lSqk_-4FV$?2|Aao=V>#+S$+@@71Nrj$Ymd*f7CC~-M>-&e~x zlh46e1QAs#@f3s@U;Y>)N=e~H^8(r@X}Wv(P06KJl8-Sr9(@r4x#~GB>}GTzz>54= z=aGI~sZwLK*q|?-n@i@U05y)ix6l8DDmLN$`^+bo?cu9N#JCsu0oz_tRVF$;*9GRU zRe95up)K>^evH(z%SGdEr#6q0Y=5BsYVh%+Wayo0r9AQ1{n2>O6G9OQBvBek$qjA2 zB{;J8iH=`kz;}pCzL4aYWA?6Aj~fn>;E2<}za74Jxa2@Dm=o+c`du&U1Z;2yYe~5< zjH-CXqdaHxDEj5HQsFGb(!@}?8drxA0((`xT0x|kHjy&Xy^_FM8<0p|FSo{0zt87O zF$f(Y;l4Xu8qW92TB$Y)EqzM19}5vsHCV;6UxKL%+OQk2D3IPSsUdxG-U zGifUk7mH1084s!VLj&zebGk!#G&W@I|bi~COwg6yEdN^Pj$3etg;ycCHf_cyGXU3xC)>c zwRue+1J6LQx-{Mza=~d4km-bH7T?-0;w_JP)YXrl+k-^gUfIU~`{gx5lWB zd|O@cx-2H2+`5JXkT#`l7uW0=UFZ88GUrp=JEds%HFa|RfqU&tjbO9)v-L1wjqRN9 zJ;*BVQdfMfK8ZLdOtH%@)XLzQd0pFSi1(rB4Xamtqa3#DY5r`t^zy(1g+yFj_wn)O zM7Z_mgTHbwaa(A^^`%+xvGs`8uGF6FScU9Cmrh7U;6 zN0S*4TMkjQ>Y{RoT$shYl&MNgTEU-GM2&-^R)owBRTS7&)K*k2>&RU^%gdehSq*gM zEa5J67lcxnA_TRGGE?;yAX4t-i#UjKAwAUZ^y6R7*A0svxC|S`D<)+v(N!DtWN1CX zg6l;D&hu+pIRElB)~QYzl-X0feR1eD*Lcs-q^y?%@u*CTzBnDMD=$sP+0iOplO`is zzGS0eAYl8*lbDcrt2x>6w{m>fGN`-9B`1E>y#rAhC`eu>%^sQ9*yG5ZZxY#$ArAdi z3x_uEc}!9%W%rGF#8Mfo%ATSxA#8 zMVFrL?$dk)j}GouY?3AhnrV>WduE0r-4MGqoHr(wvGogPg+o#dZOqHP_!h^wxd#=&%{<|M*Pk4n6PBYx zF9YV7PYo)(;Kk|?FD+v{FKv2S%8kc`XELY?#o0Ky7^CLl8#J46PRdU-+~7nH-e%@- z$W{^_H2(tLr0$Ha4+wd9!qfU)QSL--T{%y9w{tW&bNQP-`IY+;O0reT^5rC~qtW_1 zaROl6kTbRpj{WWb^8e!gv-^>h_$^G-6THWtCfS*r8weO283~h-yV1A&&d6y}*6NtB z9{OK*mxTtci4&K=u2Entuf&&Lt~!~7@m|sT+|?9mv996eX=Si3U_=fBEt9<&LxYk# zbwdCtz>`@+AL9xFUvUpoY*{$^+LCEn0dS!!50TfFsJzf%2q{uwITWr!HhMe@vkJ*Z= z!K%XfxixQR$K(W@fETP)CA}C}~(N$fVbfsGW!ZmtQNyJg;qM zcTXo_Rlrv?N(#rH3!(q@Dj5CkW5C8{q_~GW%U<$F48ZQ|X{uBuS%Aos`1`{nBKMxB z*R>Af)uWjDIAeuqJ!bq)6NU63LWy42715NbRZI#{`;b*s1cZvVhHzY(dB+)sSis7K ze?P}Zhs)7M5@KeV6tC64CUbEFt4U%{sLLCup|QZZ6%*;?ad$Q6DOa2%(7EZ93?Cq@ z+;^XOJ3Se{y>${0r5FHM&YOi*iE6W7SDzIx@t-wNp`X!B` z_JER~C?i>G6%_w~H2!N{1${;1v*8;8h0 zL7i=*r$bp>^kI<3oFXq9{m+S4Z?DH zU~a&Zy*=O^=PTe>bZRZrAkjmgz-@$uT#hO!`$m^21B9URLpGzzLgv+RgkR)TS;Mj3 z_6|RWYN21%77?dW5%$7MgYevW>W-QO{TMy^!l_-h@ZVqmj0CPtAW!no#jH#H zTluWkH|{mWFR_j~{XW7eB!|RF9+doD`aHhg4cqpB+1T^5O~fOy&*ta?uKA;PKono} znN7OPN<=8kkW@G-ZTtO#Tr7`U=e8e08Uq%WyZ1RKE6Li??D` zW%{QQR*%X-em2B1bgW2}a+))P%l3(QS6@>wb_{dr>@ zZobfn?A1?E{v;fs##=ncWX#jfZ_SA0|5N-lWgf79qyiaig2i@Ar_>vjK#9bk;kvwc z9V-?p20~>ombX_xtys*4Ya7j2Y%q5xe0zcO1y1}5CuVn^695T8R?aOfOq=5idvJBh z5a7{swI^}0;mV2)gZCaF1MxyRDX49|6`WriSw3%YZF1J|+C{b4$1Kk3ENGn_^>FMy z)oi*E&=~SKc^`=3uVX3Awv$`+E8tS;_#GlV_KZ&>`;=8(rwl?TWR>^Am%sBuD>5l| zx16cq4<>;!+bMb&c6DEb`8RYrf8&s-1r4)qOk$D9Kd?0;q5H@RBarRSK=h9^d{O7T zA68%tXwUt!KL3NpJw2(HV;39Td5CL@2T~~y_BV0h2aAP>1-;#9ls8(S|>j&yg>VPuyHn?m7sMZ(sCACtd(q2RkTXg`sK3zke7Ri z&u*MV>z8;7kMj*7RjqI*@f^p9^HnHzlk>%tFk&>~{s_X5{t40jswCCrQZPg1#@o`X zi?6T4A=CM7Tmp46{{lsrG=B{`;o=bTePB@=d+nUSx3z^}j3QdJOA<6QB_ENsOF8|e z@v{9xd4N~?1qdnxW;=~Hu(;4;TW~pkXiuNMH_`m3vLFU6h%XNXi-9sgd+&_d(Q`4a zIX)qR$<7W0Yjn|tH=4jw?uXLO&j_Wu`HZxh6je0z5bKa={_m;{T)f6>pqU+;Rp}>I zn&lek&&I`)+^sx_glG9Dr`o)gBr#gO01t0-Yh3D*OYiu z=Zeyxmw$x<0AH`V1fSN3E*aZNeySi;U#bBmpq;dft`K2f{eUK!tWZFTapr{fC!M0TK& z(#0U|=?U$_eDN+2yGnbtMghq}S5LG4ImbC$X{-A$>!$KI2=E!sYFwLT$^k-N_$5x; zHtR)wSUQA>Zo}gS3fJ_KoxtvKWnuZkQfq?iGn47L^pkT=80B58fA{vDE)O7KADkt- zIxk?)7m-9oym1u+pn5Y?48nL(f{iEoa;Rf?i(_Cu_#IJ2F0b>c^#?;yAmX9ZU;LNw zutPLWD(}yo!sz4;5PmnL;D!U+)$ zGe`k}t><5#)-bp_h*!g#T=P7R=NtQT{oVx(Ml_LRb^Tte`yORrMNRZLr#*XK`|}%_ zF0W@xeClRoD&KNGSD&$Q^;zDzhu?sr)<;a%)uW;t?z%=sAV$EeTVDe~L-N%LI1*?X z-6VHuy^#_VVMOlIYBy_Zn7IJNKo;S^GkIRc;GtIY-e6tw?p%314;F_0{F?TwO&k8s z10Gj4ngLx>Cvt}22>3`7g3Q88c|XB8c%*p9{JK27gfQesecTb4UPDzwBM&@WV;MBP#b1|r7BPkk8NemZG+U{PA2+apDF z5}aK0w3+Qj*5Rx3MW+)<*qX-kJH3oW-$US8WGw7Iv22jrC?@ z*8=mfQljkZ1iQobwzoFL30=!W9=rIN(bt1Bu0uz%UDdE1P#U64_hhZ3oaOJ&h?T$T zkC`{Y1DG?~ij0(RyJ2M?Ol9=44m(otdk@i}k=qm&0;tC^{TMAzpj+0jgz1zqf6uOc zIc8>;x{3dQ=)poa7fkUh0apH$8Vz-A62xsmG zor0*cL`@$@I9_;wY-)S;Rz11WAxi~&M*zQO6s0TXp zHWLLxAkDqr3Hk00@Nig5bMvQw-RJs8H&s>kalR2ob(PP(F|fE>tHE)!|Hl7UnB(T% z;UJbXMygriVcSffgpcx+%hGlOE1_JzBgA^?d~SLH2igXmz#=c z;CBF_81!TRU-L`ZPr0QJe+Ak5m`KULhT@~KuO7H1x3>1aqOye~;eIyi?HBVK z)A_Hnc z8~8s>odsJ|4I6Hi4w3F|kuK?O7+OF&mF|*G>28otkrL_dF6nNhhi(MU9(d3Bjz59x z8u!ez@3mHo*8bP>=ywb#RXuHr8pfNcNW+A?zWpb9(sifUWkSZ|?nn-y{H$)dW-Xgd z*AuL75f2ncYWpoMzoq-{eXfYe5&oy-nQC_5t!irS&^9+jq}kwriDWYomH0P>+a_W3 zE^*qTn|hm)saUvVfb4Io$a1|c>F_%y`T;S?oH+k0kw;=y%RsJl;?f3Yk|N8}R@7hN zdRb>Gk2**VTUx92Nl>_`*KiA{XIg_}`H}?_7Qz>?sFA8|uD)Cj6ApB#e`u*Dd8WPX zX4$y}prPR|MM8gTrEri+3>RdeG*z-fbq30u`!P6DL0R*lXV6t77glVKdY6v{_Dzik z;^nXq&to*Xj1G2PJ^B{*BEy)Lhq}CeE3FdDx z>Ez|LQ_Ozphs>KEc>?f3z_fKr;~fDSs=SOkFQCd()se{4MRzPg#&<<;qb?R{az?&0 z^Q(XQ{gA@OA#RfHV0|V`r=L`PE`xw4h%n>g(p=S;jYz&Z+ME`2B=C>K>}5wtoz>J1 zfWy6O=P6v)V*OGYLd#SR&L$c!ra+V)0-Uv|Wz+M0b0L$HLxVA!6dW4B6d3;n0EerQ zwh<9H3#k46KHT@}Tq(%C){?YI;UD(;r(REq6S>>(r-tqPZdSTMWq>vsGq$epmV&$` z&_WnQ2k*TQL=fdWH8YhPL~q1)U2%YR+2aYE760|qApvK_o(kJ7$c_*VpOxn(%gm%m zx2T<;k~-1IDAK!jq$Z{CjtT{O&L^m zD*Ze5Wc!0jl~mrn)CTlVaF2|ZZFOpKrYHYkP=MzHAPN*@1Vn*niC9!R%xva2GoQP_ z_FLcQ-<@5I2VG-hvd!Q#KO#?G|J=iyDP8XI+as_D`#j>elALT6LqtffkngiWD^d-c z=fP*(*Oa%uS`j^ZCsh@WK9rcJsWZSJYBgi+&Y$L{eL>_peU0YGi5pzLO-92B-&SO@ zIWaJa@;i0$r^SERa8|h6rvIOw5t(#|C-84i!Mpx`bm{+j0%$=dzZC}xN+K(W%Q03Tfbw$OIuqA~bqxLDkb&^A*M)jYM z`SON+X)Y2>onHBX@`X#vSRbEfW-tu1m~XoJ_cqh7%FJ z6As)Iy{%!AM(_|S;yk}5ZRg0Dwa8N8Ya|`PglzvE%ipR$BZi z-rIZIKb&Qcw~X{nqk6r|acBX65|I*$k%d$aTBs07#?t1C`9sbWeLOdpknP8$S@$kQV* zl+LfdKt>g?1O_>C%-DWI$C;Efewa-2AWa3J;c`}{MNb)))MDsP_IpiZHJvi$hc7fb z*}iJ(%sFcd$-xFwxum-X>mAE$8z#|lzZ*@wzhCR-e+x;0gIEF&Qi7<^#}T8r?T8Kw zv#pu*ng3w;hwQ0JEQ-@&Q?SwzPQts97p=Y3$pFX7zFZV}l5(e?CxlAZnJ*K&|P)F(g()q>^xYp>N`0l8E65J1lA&K$pezWP@6v{KL!3{hR3`|^TBb? z6T$$PuAYh_)N&gA;8OKSA7c7WIYZ(TbDe_mhs=gNNgt`#ACTMcqv>I9yufd)6wBHh zD_lBehhSY3)SSs?(L~Alm2GcQ0ZAY;!@Tc`;L*F1`XWFQ7?-lE8xngeZtkx5Law$eUJ0=sY}l{>S?z46itbi<6$9qAh~h|`<-?X509YH4b! z1z;BU*nzjotK_qTQEF|T0xa;ym+)!NFF@$a#Q7pZ(MoPBA& z2urnQe9K!M?LF*Qg1G?GjS880!750$`N@~; zYiT;pcYLy&5_B4y4)X^z%D5S=k`~}1;9s*P7VvyfY@540KN;^te_0UL=y59W&u_L; zi=7^n7!uuv7K35X{2~LY zkSNI5-EHFsGFlLWR0>?+fY>dxCaG@$}`L3yk z*y?K8kIwRgTGUsb6o4e~3;3z4n$|O>Hx`RdbZyHZ;8LjDV6@&_8YDdqR6#yX167cL zrnZ$J%Ttt#!;ziJ-5FYGhqqat{Hnl&kjN5Xh8r4sq?tchW$3M@Mjo6NRi5Y3U3f`8 z5<{5bn}^#eo0tjg=2`*FED0B}r9{!UTgjUa=;YWNTQrY1q*`a_++VXtd0i8!Q(8{> zmq<@Vm0d`F4kpYsl8LK)&Pkn|nH4p!Ikg4n%o;!a46W9+XvJ{D*NoBDT<y4-pM1Zigi*RABu^` ztz|w}AL0rBi7>ZS@Qd@ApUPqmdK?(6BPRkJEv{91*Y~l>PrUgmUmvz8~?L)hV;^ z137(6lqsr?*FKkJ1+JVg(zAMX;bSGLlmF4?znfZhF)=p-KA)UhU2+uF6*OmR!Q~|N z9!)Sm_X%3AR7?aHlcKv@Jg#?nCEB`zkpC)UXl02QVVkdKnQ;`%B9V77N*38NFt*`&)cUdBUNA06m{t zc#m(v*ayS5=s~vF6Av}-2?-7Z)Nq@?+gX(fR#VRyU_^-Z`*?{sDzM)?N9HY0j67Sp zHXQ+cm9#TGKF{F0Ti~YndFRvXZ@Tyszh#x$M}V7RvmLl`{G2=#4Iuu%C~2>d&}&sl zV!9;rRj8VB5#77sw2|Ni^L!_y+Ni)fEq?P%6*}Rfp5`>n3%6D z;XouuJo4bhPK2AT+p^Fyd&g2Q%jV4O-+dI47kT)7icc=t<}g9fb+}_RDrLTD+t|vK zMu&FecOH6fM58Y1U-SRrJcmIVlC=F%+PaM&2fd_ane%}#$hCdbb*f3`kWg4JAHD0z zRzMu!3H-{p9*;-@cm3iC%mzU5IX<=Q(p-W)M7NmakL~g(^^RbEtX}*&w6mPhX6$pG zP&S(Ki67V)_!tnZ*S2Yj@QGIn;_~HpnK>LMypT=1v-%|X74PSYy-kT4nqb!@s z?@eMzH3i?e34{cCtH7XYjX z6FdcL_^2UA#V36I&AZ1sdrC@7a7M;0TIbS}sz$GYQia0J;?^sW`!Uy{7Hd!~m};G2 zED#-yCL)Gok(5I2gCqQ$$AMnCehj+K@%oOQOv+w3n; z21!}eB5VpiP8J$T58->ym)GmWMVkR-53ddT=;{xYK>!6kcV( z1#rV_vs_BH5C2N77+>4}t`jj+)VMfv5RIv0PdXYlzqoBnKgt8HihTP-&Ocq9_suQ@ zbp;COsR;uiGs5bYA!QvMQK9gECum#hNX`F1wr@}mL7ZexC|F3{kB~A5l_AY1kQRsm zxGG{nu8Lk?XUl6|eZ)!klaV_nE_UgSL!}sXL9$>|)6)!3&P2}J{&-w26oeGrP7{kt z@wAK+p1H!bdm4fa<>A!r+pZuFF9KztIKz9*cwbGW*U?L#t)>lfXqidj(@ zgGxb#%zX)6$;R-eqF3jjDfxbLsKJXxU<&#CL#74BE!pq-%$a~2_ZTB2@|QMW2b_VlnnlN-|q#Wg%EZ3&eeK!+9I_URXPQ||W|Jfp*M?=#;Zu~;xw z{No}Xs}K@{pu>r1yy#oUB8a_v^2~q63O&EZU_cIw85wFBz+q7n4LB@z=LUXT|J>;t z_YExtsDo_R!d(OZeJ;SctX2lLtSpF`c+}6S^x1R5QzWWc1Ol-WnKr7QNi>sRRY{|= zqC-2@+Y}4UzIL81!YXPZ=(QjN<85k=<;0Zx<*c*@X^ZfQ8!M287%((U?pJcK; zQL{MoOa*FUPNLz+6XALi{ZrC7{UV_uvZU%?JVjX@UIKuqf<9tGgCSV^wH?M8!*J8^^*_i&9TMwIrkOp#Dd|x02To#?3T+m#1E6``O)NDrz0&mLuVMij5 zjawuRczAiCfXm_*>RTn?vM4yf@KFV-a|~g3xl90BHNuz0aKhcMwDm(IxbM>$`3E>h zxCF*nx}_LSwjh>TAP-`EozZZNZ|q$(0^~s$1Ep>Di3+Y#!>0w7m>5KlnZSQmL|&7& z9n~kfL+{~^cF@*8L0@|DqATf309(RePS;>+x1*?9PCSgcZ}fU|_Eh+U*Hj@h%O`uF zVK?VI03PP-anqvssHz+_E)oU6!}}FB6in+hRzyVT91I_;ACgj3>to~n{$yrUI<3Eh zadPfR6XODGfwy~xZ;qx@CGGc@M_^apegNR%8*WshhOmo&4$ttgz^xAdRBdfN8fTlx zGMDSl-XZ1grT(At+&4(SXNY`JqrR$Kcz#Z#PVhuy%OQ6Fh5>7{JFLo3#TX%jd6{}~ zmKmOcnb+E}=Z{3G#Tw(w`mP@w@dJOfm<&$M>oKJm(8T~!-MTg&D0o^azZll$Zpej# z=FWH~?TnwrF+JD=rT^{#YPsz55@Ul9kOw($IZiom+{H9?qqg~rtIUG8HXS7u*@@}2 z8uL0A{QhWKrO(kz+|WFQ@zJZ1fN<=i!HO`vco1MJimWhuzz?5Mjgi|59l(@0AYN@r zjut3ZnpWnc41aAz9FVbf6%EjOJ=xz58CVp44i+3qy=veAcObKO3*pL#js!`95Lo_Ly*AERwyiU1wjW4}?0a;)| z^0O>(_O7=EtNv>}*B|egS)dNW`94t{Iyc(WEd8zpx;ZvJNp2uekUVv?_$r_&vtbV( zkL3rdY{GPB{_Q&>Ca~39WF+wL0;Qpvq*9`r4TbK409l|Hr|YvUun>?1B7EEHhsXjI z$NFS;HxdJcBMgUh};MN=anu2FnApR;L zn1`jAT@7#rj{AN!ll?s*WBQQ3@ty!2mZGiOUmt$MD1)+4ru|0>x%(j*+?S9;PO3Vzp61i)cacn<&^W-(O$mBOJ7!%(QkqA2`>juDaJc$I7W zx2qP?A2x@sEyJVDx=!LsGjXZ6r9Xd&HAoIVw?RUh1x9fZ_ozQY8_DvVOn#WMgUPQg z#NpIIk8kkN4gSHrt%{kuDW#y?F1F9??M0bYoK7FuA2QJKBu>c(=7rtHrz^(N@u^~l z%@U{GFU|7i!B?M|(W%V+7BpU?@`nPcQ@YTFUIH3Q1ZhArvpw+-tTNusgnA(3KZOL( zbY7>FT3r@$ym5NUo>_38wUYgLn>}kPmlS1=^FS=U2~lG|Ji1nJ(^0F9O|I8a$Soc@ zsh=Q};re|7MYYKe8W?^YG9wIDm-nyAV?4AjGt=ikjx$HZgFH1^%(1gabVO1cBDAxT z2B&1kh9leAPHZ*rTgu}219oW5gbC7s8R3OFFe6N^$R}HOkCo}FV1Gg4P>%W*q{PdgzuS|Bt#^mg#Wi9Z1tHM(fy;s{|>;0wH5Vc1#dX> z2>#~@jG*VE#kItV?oRQ}*h>e(AdtU-;j7Tlfme}q($bESZ5D`U9argwM!U|X6`aPF zmUmuOp9``TO9)?iL$j=hTPo~QBSun^x+Gl0RO)#8a7Q_0YsbZF?VFlPAi6he#fk8%+sZbd&KU3h)m1U$xO9@C%^tuhu5_wYy0Ygr-C}vz#Ac%62At#E^GwSNkOke*4G8jAeo; zi_1L~`-$L&RZUvU5uk?20BV@Q5S7E_ZI0s%rAwC%(n^hVjK^(Pf!0&O{$w2L!xrNa0 z-3_;HdB2;9rio6KN-UJqQv)#d1*7AO>i}pt)I~fjdkHk=n^?w~zN~w?oCOcbf(V7C z7I0@$XUK#1Lp@@WJ%wVb7SmEQCb zzf$xF4zgyJ?)!<#O&ufc=eOm64IwdF=KL5z$%aMbJ{S8s6m02lcSP9PR(_Z~oCjfj zRMaClTw0HWglPa8Za$`96z}GMYzTGxIH*EH6zsbFHVwF7tsQUO{gTkcL0Rt?Xn2d! zLS^Pt1pASBU|k^z)Q=Y41&gjmW0hECaKeQnPkxQpQ?xKzt7u~4gS1jTmy?yj%x9S8 ze;%V8w*nYsL?!8#S{g%Y^P(;>cyu;=v_9IJPiyU*{ZQT5GM<2kf44{efU`2()m?YJ zmYfJo2&cZw>fKYK#b*h5rY*n0e{DE1^VD7^L1w$Z3j#R>(5Ql68`b88COP?BInr1s zA08lG4wF#fF?kDk*>T?Tn$%bT2`zLzqyt~Y&G(T<*Tck|cYH{{G+(Xw=+LzvTbdep zSisJB)gZU(G1cdl{)BD_LPJ^)b?+L3Ob87J;4ZH0r8Ij4fC*tjxA?JWL)e4zMPzkOpbnzCrEJP9Tuljfxg z;tQ#Q_#{jaRUe?2Qj-!;DT-}6JoS`k1xMpVt%)tZ$AYW4{As^2KyuB9AEvL5ve_?1 zB>;%uP(Jj02?c(WY1j3gy(|cWpm$2U*4zk{QWA^)hYbHxS5+rkLzK;gAj4iWW3x4{ zc?^wsIyuNdB!i^=cdxp)PWQFVmgHY+Ct3ZZ4bG+HwOkFVX+WJJlHQPVJDCu5lcyMtyYNZn`6q!LPpL5K9c8n0U8`N<; zR^$?pP`*|JPQ79HO}J5xfw!!sJW7 zOu_`F{ZNr|`R9Kky_`A~&U=%m4d1mb-Fc@nK@Oco7W)N%=SV=87x-GzxmH7PJ4{x3 zOBs%l>IKjI(go2A-6I^${!xwOw*quQ9&0J(#Go&(ipfd!UNnKcPM7V=i_}VLvk*<- z`FyP>)zNa3)GXay%XrG;b=Sf%d-%^EN!^pvna^DimsZja8wVU3KodA11`h*bxYr_t z4ou^t=fxbF^ElL-Y&@QSUn5(ABQC3=@ZeX4i)`mduNX<{SJWVi*FVa!Jf>vHLlZN< z0zJ=^iPgXD2;)mM9kYH9wy#f$i{jY~sBVQXjPcqzvZHz_0sBEpz_R1qDH1=m2l|yI z2Z9AL8Tk5;-W?9cB&qpB*<@0guYI$ejm(6UfcqgO;IpewMN zf(jtmFw_sOp63-|L7=bK+-xb2^}alDjWi~T*`RN6j5l;AY|B}3pcUaGjDOH4PYxQ$K*fITV zi5L>!f+FhCn46r8>E8_eST|M38+-ceL~5PCIj_9)L$#$uRVwd#Z=X(=Zk`M#Fh#on ztQ)nlfpMp~6&y@fr?U3f)Ezjmn*My9W0|c)b_L;vsS$x0;e?UV01aJXzjAx|URRS# z87!m)4AKHN<2CF_o@n;9s(>l*Y*4HDLI)2p1-d@4e*6maA=DG?_PF-b#f6JVw3H6o zTplGHjEe;?0>Ef=~kg4iLcitq#ircX!ZH|O=O2%b|JXwWr6DKep5g_ zT&aawZxPu(pWb0AXCZ`VZ^ai_0GwtSY4NS1ysUmYf5+J$*g;(%Y&a;G`uF7~A5roW zAB!XkJL|ABxWv16(C0D2$FsI+z)Nj@A#aD0*#1C)y0^6wlaz>o)qT`5nLpH2>Z&{S z#CDd4KrZ6_8*SLqrBXEZqk=)sOj03!>5BPy=-kOt=Jw!1n43XSO=ddLeq= zNr)_v`tWiFkOg-2Btc|>XvL)}l>82HGIuYs!0&f<|2#o&-adJ;NpxW*9e)61feD`f zBKTmRy0)!_=hjG4SZHAGF}^3UW{%;!HBq14Ko@WxE61B&dq{?_GB}6HnfYh^hG=m*Qn^qb^lk^i5PK=Zx@G~jjcN2Ss26f~DFk}J5zOD{ z?jSv2q!UAPpa-lQUpQ0JCfRrg3?|;yJ;a4XY<#i znGwNDy>B17ZV|K;FRnW}s#0$(7R}#TfvFdLPCZcpcz8;`btkJo_*+tpAemS%n>^Cc$^1I=4f_}B)FpJD_Ph!{VEY;sv+ZY2cV%PUz^*t3DC+ImoFENfsT z01x9g9S?hr;hpnYM-eeulZ!j3?!2oR((MJU~7_g1ju zf%M1mWT@}mdkb#~--0Gv<^f07>avcQb|#(E&M3-(xq4twa}=a#YBX9xh;oMVgASlR za?-*aBHlXW$JVR+IAhu)av5%}g=8D%o*6-vnMAMid}Rk!P16&k!{hR~-#2 zq8i&(jBq6y`?FF^&Gsu#yY6^k*;2xgvlS47h!QK;lmOEv7#)fsohbZ~r%^xW4%sB<`8GPY*i32RS@gRxK5nf^KyilEGQTE{m>Elv?)op-7LJiMSq zUS!}tPjCDVO$bY$WG&@Bdh^ zNxOYf;yPM{XAc{aJ&RHPk)Q1q<0Capu#RF1Z+R5nw?|NN41Jh8ThyE&lq|~BFvC?| z(B9M4;&&C$oOH%stXy18fabLYkp&X3MW$El$kJRO0_<=NAPXFpA8Yp&@lwhy#i4=7 z0?kdkY^nBcr_^x>+$B^IOj- zrntlogXR*#V45$LlMEmR6D++TwP}|@aUShxlJ4`3a_4TYb{M+)2XlLWoid>;O#Pe$3 ztCcWsWyLCkVC#*q=bPOZQ1SWs=Bfw_zafVE_vFu07_gT4y8$GQxr~9^Q!8t7%cP2L zQY;}2sv~I|_ECrgC9i|Qvno)f{Fxly0^7GrOEc#Xps5b}W!2^cQIgeg*8ErxOBsGR z;1%~`%>vpWLJnb2Bq~0q2ZYZtU~x&%+ecc0dGlF1mN99Wg0;KvUUWB9yvn8z7efQT ze%Ee?VMAiTi9ie(4Tu2)FR;-NRHQ$g!ITFwg><$j*HT!myXJ0fPUUn}gZ&XZLiF(I zT5W`E0>ZvOMTQT&m;$48$T$B;2!=pRf!EHCm|#c?7~vM-0v!Q)wFoPRnlIQ)C}cZe zi26+$T&$gsN3PM8IA^9 zINEpT?< zvUkLwMfB%Ub+e~KVsn7O$j!}(#YVCZz&m@$vpMol+7QW6*jaMFQ#tFXz@PTrMI;5W z`ysTFn&`~)G<>T1O4WOD0NR0I!;n|{(9$3foEb<&G>!dEO)dttcIOQykOKB9!`IfH zJT|7MhxO80esx0Vi>R;TD9S8jMs)itFF!cq@5X(XeFF5dis(Rq!H0bOfFRJY_64JW zB>#2k)_TD{_DiuTcp-Z|9=&l7^F#`(C;%l zTxSUtX=Z`ju1Z=3H3>mk$aYN%T6_uhqRpQgH%G%JRpV4zQl4X-@a+v|%t!#AQVi&$md`rS_-ec=&!ePVz9S5~A%dL^eB4dKD zVQv=C1ZI`=AOh!)&Jbbb;l7FX=wi`{wC|}T(3OX+CWs!{m5vA*RV0;!+bSpJ68=j= zq)gKkbsv`k2Ymh*#7A7ODUNr>`UoAQdZ!SrAcKj)-4IP++31TVaNv&1635>zsUyRh zWv2x!-I!EiP9^ZkNQ+9m-cYraTCUf28N@jSIr7|#RN#g~%g=J9p>Q26p(6qL|x0P-= zw&t&VJX;|3OZoS2ee&>2KLSF0?IV0EBb1w}l&MiJAxEkODq0n>e0BbPRTjH>lgV=j zn5@I@^k6TbWMG!OL~T>QFYH9+6TByZhPhLl>CunzRb}51sFTM{+1K9se9()k^uLZu zbWbiFI*3235%+TjDj_IN5qf{ACm%zW`;c81%{Tb|$ecL0fQrT)*T{rFcA+hq)R#up z<0b)-ckvCviKz4#leDsP;jxU#yU5D%lW)oiEN0cu%y2G*8MZNnr)5?o(iTWmS6822 z6SrX1;cGas!rV0sC|i8W4$QXQH2|t0SK-`qygWwd{|v_Mby~j402yEwu4w&L_b=+x zH5Qpb2AHDIR1Y+)3P=Jm!=Zl{!th%Yr=%>p$2~%r;ZJCHzpetPEi|+y=NQ3UE9v(y z%rGH5JabP^s5dS?j=$q)2s5k>FvF641(cjcSc7L45qFbVH*bk$o+W{?wx;X5byci< zY*??oJi^W)lECEBS_gWwYuO}!RMIR#I?ps4;aKZ7y48MM6 zhVv4(vvs2l7;pcOJy$`PT^{&7tLh&dGd#N7U>*jdUHkC@2u74T0+LP5M-)WHA$01T=H#Q*>R literal 0 HcmV?d00001 diff --git a/_preview/4/_images/esgf2-us.png b/_preview/4/_images/esgf2-us.png new file mode 100644 index 0000000000000000000000000000000000000000..fad229c4ef8719a249e063105353d3b4a0fb4114 GIT binary patch literal 18651 zcmd>FWmDT<6Q#Jj6WraMLUDq-6?b=vJH_4I-QC^Y-Q5bsy}*q5s_t2r-EiIn=Gokz zK4uc7D8L@u_1j{A+#;1++2R6%w52l5TvK09QYF+xJ?%}(M`K?P0|SCr{SVrr&ORp_ z-csW%h1pC6-t6=Z@ zvqPOh|3F|JtWm$nH%-WTgM2WCK+QTuFl=E4O&YLB5^M%ce{oaVInUvI8-D@WJiUZ`evptCXNj>&Qe)TMKD!4pSmh|FOO4*TPLH zJ^R(}<#nOsr+{$EJi{N@r2jTzW$%0%y*y1{^KDcYNn``I?~fO7MI}ARKqVDIp8p$^ z!RfX|_0Q7oot6(vn|3E8t1c`DUYq-xLd6IRhIqso@!U+r-`8Ku3O)B?yZb@R(I`)} z=J)T~JiU&3s6|(ttLkdaRo*gclM#%2Z3M7kx@y^ZK7CV?n2^W`vWs7pp*kM<{wI9f zNmdowL2RXx1pnN=PAtXHX?5x=pm3U&4GkE|&`t+dJYVQ0qZUiiWI~eX%liY2MH749 z?+3TP@S?*<-Gq8n1b#mE4ZMasOUK1TXYy?_b^pEQ>3`w^uhAxKwiK}-Pb-3P`aKzd zvRy|+U2<|Wu?LBatY8VTLkd=@&9meQtKMAYFLz_$P8JN4!yi~gBV39BRR%6i3mIcD z2rpElMc}__so;kVA0cG~PV0eOP&9TMj4Qy!bAR~W^M3z@yYZ~L%iAuDJ;OW0C#=n_ zqq5v{8_f;ha)*L0qK7a5hfj+bF3eV|!J%e3JE&sl!u593GO0nDAw>$1*(+55{E%j| z7R5vk2%@2nGi}Lc^DLW9vZ9z97ujz?(CqC3CeoNPQPWLiZ8*X?BC|S5s||1fA0l^& zljUW_{P>!l!)p<*y%xwOzSy!j1KmHey}edl{dBu+mT_SBtziv`%+##nULk4SHg4y+ zt3wB=ek5QCwEdxxpAtip54+)k3O+z5xS^Vx`qFFlZ-M?sZLXXK8(yJ07d{YEsQ6$m zZFm@FR$FCfzw|583EhzuRtfp=%m5WdzyqMFL{Tv&M7VKZS{v2%5G9`UMY%Wo09BE> zIhL|1MBN}>``NUmaW)4pHrAhLJ07ls6+jiQT%aNftH5(Pej{}G6`CAMyVkrw1w>1D=3 zqMmv9Xmqf1lz?+OC)iQ-Sv~#Raowyt`8BNnQ{88MLPBRjE2ueJ&7#K1$bqc}2wS=h z-KqjMdmC5IBwRuUygbkK-yA6{?+_sumNceRf6u0Ib~?jLlfkH}Y(&*da0*Aa1)gC|sM$P)q*a280@QknsgOsCQOKWWh7bc+u%U5Y63J)N z#=pYNjWXn_*tiU)4(_U{alYcGv&z&@zw|TRlid+TIK?)PBDwxN()}s;6yWyD?ai85 zj+QJwpM;9i@Dy^*orsf&n(3!fG`+^^UWD3mo3|;JUSk(pWyT*)elkofHA-0acnSge zycTc=2S-&N-su&0Q=W)6Db57dj>|R|@xl_O@6Hbt=(I{InLK3v4y=G&DbgI(y8l9^2w@CB2cId4|8jve(Ku1?FC689tD!Lag5hx`xfB=CO7Gc-821SI^x}4YE z0X|ASC=~&pBPbAq@Nc>9_SZkVRSIOJ(mA1&z)6X{N>s(uMq@cIJid&qvWhxGDhA;s z8Z%>b7KTb7D0)kK=WzJANoIc|JbpPv%}r;0iQ1WR7U`YWO~A z6|A(Y-ScOlZEx)AF!Z*%+51%9Q2|8^CHYuN>`wFN4FBiFYl`RW9WN_#_yj6srUWup z0z?1IZANxJ5VhbZSjFGmq_loJzT7vz?$MYTZ5$@6U&f|E2m-VF5y#1GR%(=bi+VAf za!ggXk@&Pa;3N)YHUf$#d1VfKil^0(vuIKBk}Mc9#kRB+t3zZrfYFBt!?{DQ( z*zKVB{dFd&>2eyJxdCV}Vjx#)|A~t;`$1~`ep=8NN8zK$OK9rAJ3->mWfq&XnVkj{ zBT?b?5zM(Mb1Z-JV{K33xL%c_laC6e$>DJa7hP0R{5>#&(e$EYQQcZtsI+24I5#FU z?@SYs3cY-Yd6l275 zZq!mHjzH+8ev?l_-{tG@-E2Z1582p)ET)-|(Sgq7xmjHRv0==XmqIV-rTw- zlv0x+1Fno8c0yuoL4_`@QpoEdem$;86mDdTmyg{0#YubOAWE^3a|(qA)?pKD!)M9n z?zL{q2}}@mVqno3q+)YYyCyo08$(cEdt3tfo(IvdOi?d~t$*lATU|6*84)A5;?nUp zV-a9*@>#GW4wjinI2=5zEXiUbs&#%A(9Far2QR9Sk_uvu4m`+#PVQOBWtA?*H%9>U zge-An-R*^P1DleP-gQ8+M3<9~+~!3}J6t41tyvbEFw^>7{i7Nq&Og~CU^@1mDAgJ_ zh8!unj8Snf5gS(i9HtmBxQYf}%Ly$!v^g)=DmM)+Rkia+fN0%x<}^;Al>xOS6mrzm z{(kBR$Lx}-*oc(Wl#x+-P+odFk)1Wm5-O0-h3xMpr&2cPAJ>nJ02r-SqNy-^Lc2WsNX<}q}%c^vx+vQg(vHR&qs9120tWX5@i-pILKMKHe z&ZGCvja4#!v!bOqurZJ(!U8!4KT@LQtMtr9FR=O5U$4p@Z_>hPq#`iw_~-VZ#L|Bx zoXWr=@gC(-C8QOFMLhPTAafT_)Q>G`o~izA{au{jZH;mJ3XwHSteDGrn+pr0aIPb> zqTeM)sHRp;?`IkZF+~pLyaD^rCc!{CU>Ir^Hkx2)dq#oIs;eI>+K7fJ4!sYlnxuAt zL-K=zXdXIk@bBCK5m_<|9zwpXgOwv@510~ic36QqON9@U5u&TUQ zPf}-g1(J~@1Mv1A8dL@9t=iaH9e~F>Ywrejo&sYj)X_HCN6d}0ayIyT1aFd%Yy7y-vw7&D+<3(_h9r&Jc=Q6P`d><=V z=bM|W8w4)y*}7H|geg#u!CnQX^{=hlY12 zap<7ZHznC0DU`O@8fBk&9y{L@+NpiA9bDvPFm99H<1kem(rj>&y^nvTO7P{FV2B_0 zG3!O`xl5Vgbs03a(`ITYHBATb1=4FAm$?9;m;u?#VGGLSh4ZB{ff$RJ-$P9)RFXWJ z5Np*&oQu60OcuHDBCx-B(@q(it)Zsd7?M}(Z42N` zDhF}!*g(=}np9aND5+Swm-<5!3tJPKcl<25&+KXCr3d4!O%LvF=_)BVrG4HK@dcg1 zor}$uH?@B!mfT`k2(x((=C4u<<*I==?(;bz?&%q;VPh=MYn zxV5^!0-yNMqI3ABC==`8e(_xXTC?q7ERaSgj7Sl##J@`bl~4-XloTu_@(7CJIH?iN z1lYhlq?RNGGP(+YmS)9ekJt##)_;XDH9y=pRJKi8|4R*}mherAkYp(Qz}$OuGkSDw z?P<4kU4;O%16TYNQR)P-w&fzcS}f?dhhiM6Kb9$@!6D4#_iX-^j1kOuv3ELEfmORn z`UfrL?U_&^KlNrbX(&}Sn27FS+{$S#4x2zeWG=8fN$z^>cj#VK|7tyQ0dYkx8LkT+&h6goy>)hz9~yz#yPUrD9@AfX5drsgzs z;OyzZ(z;g;TZT?aIYLUGfc;HlyaWh1OYc6Gj|d(k#XVfSNFpVNWd--(17e~^L1Vcr zp^rJq-j^JUB$!SOk)=hB#wh}kNbqp>%k#<}X<=s^<0wV~I9R807>x;l_T(fQZQZUY zP?9mx%&*Y@n16%9rDgww-*4nHTKU=8`j!(W1xC`#FB2A~5&F0QQtR=}t!wqF62$ys z*kSw7*oECs`uF>8r8F%iAoV+gt)Kq>B39Noi{v?!f4^<+aZJgf#zMH!$EYy9euf~Y4}XvFI0cB|5mlz@VHR2tgG;??Fdm{nh>k@@fG4Zn$VZD zS{k!yZ?m)J3v$10!Y^o`J>`7ZJb{Cc|0;Ks1{I ztR`SrI8cL)AcGdcq0O^0itHYW_L|Nq6k!}_u*G$eW(5gu zw8c)nh|~}}C;8$&{8bM_WlY{yav%*_7UKGkBt$s2L}|WiRyll;wvZ9ER9~Zl=VIpU z6`T)*;MLu6P`U}JV&N^CJz@(I0nR^^9h#nJ5un~TI=R~Uxa>Zy!Stc`v=55y?XNc; zia|kPh^bt^vi*`@>)cfrU|gZH(L(Z?$#A6B%!6FLoUlTkYPCbZZCg2TTqV|CsdFz? zycSiBoW1;Lx0JG}$mBr6hN>b>tfDenNkh#_NG~aSwAWA^mlPP6G*ImY%F+Q~Sc89j zo-|7+wm>bN24!+VycgBM+@i|VPF0m1U5IW$-Sh)l1I#sUDtPzKHr(752$>%)7=Wt6c40Z>V`={DREF z2>$*Q>8mdqiW*`;qsYZ1g_O(TF(ac^JaMr8CZcCu68C)$sy`oZWtoZSIA%&xIkwUP zjs}A#NeP~Lwtvvs0WGkMO$a?F(tshNT?`RO`#U&EL?AhE(N0nX(-6m|j8Ox~29e93 zv|5>>R#>1&fkEaj9}X>_v@T-@0spJ zyJp})WY0+-Oe(ITs$b}JsKoopCduTAF1blK7u)U#iww52C$Q&Zo&u#)Zscr=hYw%- zo(i8TftAsJ%=yXVeQA+rTi_BIIlK%qAwdbcz~|6FD;8A zdwmC0YtQL)>g@b&KTrI*NjmyJ+EU`WGOpsbi<$IR|9*nKnTe2Cq#j9$dZ-OnW4ND> zBKV||<>_tqBQDc%kt|tbx<=+6AI z*#i9&vF^ZT#`;InDcaEH+9#7pTSk*DBEPe<-hAcjnMVf+OzJr4U{19nO z^WR9)G{pcRcX!x6IxsKkHU9(KD;yVrjrNXi-N|utR24P~@igD#xWKHLZ%Rps~~#xZ)R;D=PTcLxZ}%CvwnXUZhuEzZ+ndhLH>dH?zKXT zLyK}KQ&V1v)Zub|fXLo_=mUFkHub=(7rl>MhR2uH8|+8Q(pI<6W-5ONm(Z0pvV+&J zt)B@c-k_6y2C+&8X2YnW2#9mVBHiJV;_1DzN@Hs0(GB3?8>RZ5 zmIrU6z7N|UV4v81IFYzn?Icq|UqBFYA;%<2KKmq1OmyO_R|#pZwm(&4bienu_jzT@ zD*J@QAGs((>=A$K!sx4JNKr&&qS+S{)7tRB7Af>`nT_!xW}fFnjH=&lS(_zdgH7O+ z{f=bI4L%ejFi3oE#)Gg<(4Gl=D=$c3OyCtmqVPxfPFqRJoRLaHStJi!X z?zbJ2xW{g4q}ux`KHi;v^KOPbVlhVYr%nsb?46kNu4344rc@tt;mXsqrp;znz-6>= zfLmDWfMW3?$4Q^OUkRU$t#eyZOyUPfQ5l!fVkrKcu|Bf6>EDl`!PFX1GmuiB(3IT zL+A4Q(lB0fAnvuZV$$EKG|Yja2-sdCJ^JrZ%{uW^iTNgMx&$>=D!mvU+do?+$4rB+ z7?QWb%VnG|XYs00YODRQ9HzsKh5Y&nT~{)DUQkq;?t|FvTZqx_9 z&kurzdEOOAgj}Z9T{pm3^^rnxz?$fLq#oxkI=g=^t6rMbQQIUO>CErbku7XuaR5Z% zjCMv1jZIaZwVgTyoDy|FB&s`Pfq21kw~>wrnfA-h_f=<$J;Z+&p;r9rXsO@ZWxGie zrhtBL+r&cbybh|(1fT7}IStp~?l!M#_8)-#7ba(?n8}~kMH1e)eZ9HSlytbk;x(td z!~aTtJG2F#(!u5m&9w)=ry05a!C#Q@oa~@?Ep+J*=Xa~m7>-4Ak66JkXm`#A58b%4 zDaB)^&FEZ7Hy%)o>D$+Pc`q9<{px{$m^#*M-wTi#-G4#=2miKmX4>Ae+j|ol`j*x@ z+BxP$>sG zpb9sd@EpVXvm(7c$6hNCaszBH8m!~~@~7T`>0oTqjSkelHFB33T;irm|NIWxVeSJC zRj_`+Eq5+yl37H;Qmo2fe{2tVibom`JIHJr|4?cz$BrTqv_eee^nr24mu!=OIkXZX zX0EWM{(BqJi_AIZ$)<$U2gJ!>i_J+p8x6E;HJB42R&I-kZUw@+TCf)e6{u~Sn`yPB z=C0rVYtzJZeC)nLkwIONP#+NiV^ZbP#W?F<`u6?{mFJI<9qDb_iZ`!dmdexGNa##7P zitcgGbE!P_-%zL=Bbr^8v|hMQ_9uQ16fKW_6F}ZO6_1mj7|-D}Rzu4*r|(?x2m(n8 z7h;a0@u8uha^x}F6+R9-B5sRS_B)T}DEWIQij?@L#RZA-=M&7XSMMlm}Ob zyB>~nh}7!={wcnopTQuyK=#-A?&5c&ojkN)<#sJE+ltbaIP)lcHOKX7=yQQv<)2Ig zBNY!>01`@*Fl3^@=t(Q&D;EUIuS^lz7?{VU=dv;r)fRy4i0!BXU|llu!N9U$%QUj0 z@s2Z+uu4yX6QKZZb58Rb?YDRpj%fB9wTqEMW@~wOgl_2SH3r;E26(LM3iBp=*Yi2S zKODU$N7M#k*5X^0--4|3ozI{;GWf=i75LT-qN6@Cisq``iBQx8>tBPHfM-@T^##s_=)g8hAtM%FK>y=YMbkkMO&-}f?Riisu*|V}_ z5rfR3tGm+lYB^Skt~Q^SlPUfjV>b$#ddcGeLtMw2`ksq%SsdRmp$Mw)Ila2c;oOAl zh0JWfP&Oiq`|NC^O8%dp+EBg`h@QuI%N;evYiso~9OkoPy_yvJ;4V;>PRpsEA}4Z7 z?>$l?c{33t1s81_Oa4YeJ{{PAA4RLGaI^k{z_e7U-MtaXOtdw+AcIXF=J~RJYg|jC z@4E~0X&G;P8>6uO`04uRkG%>_fGqFf9}R{lK`zm9x~Z$i!yus?LgFpKruTY#wWZf< zkQCC)S?h7-1*U^EpkMh+H|@o~X<3>iXQ5VHY`wtY;5_5EfU;>0-^df*0u?QK(z?59ClunaST~-CYT$Ig zvEeDE!D%BwJJJ-ze#?CsJq`zRn&-OicNlX`Y+Kg(dHaDZ*EC}0%0@Q>*UX%}vgN&o zhQ8wIi0rDl)5wb`{2bg5T~LCUlfUP_N{icKfFjG+)l~GIo2K~B;Gh)`P!a9I?|v*%s?3$DNHO@C1DmOOO)Ek zP!$rXah-}SrfcxJa@fQ4Gn#JB9?1Ag|mP7x@DZ6q-Wk%g5`wEMlTcj9&i&Yo1828 zN5r4k3pK6{8hukpF6+eMHRG+k56e0^q~|?lR6|bj<`U5TPl+>TkkW=V?vLNee7bCN z>zEUkC7$8nnIw~#5j^rqQ%L1iSEmUve^}ILhf?KnXN0x*5l@?7h!$`8{h4mET1GVx zh!5<$%)(QXE9{fi!NnK+m!SOL(`Hxld*sZS8c9pgkq(R$TV?WZ*qerX&!(L5rGmM0 z2=HnPc^a$|swzE+mnuMh!^AlEser|@#LDEnDt+aNJMAj=w}OmKIn(g~_01~?k#WjC zpoeU|T6erISRdMeogsrh^9C9!cgt>nTc^b)Ll(alJK;{X6_5{OO9BLt^0-&;@be{# zxyVxsi>R_>j;Vi02GRzXVknZq4R)&1!4;fwk_`M-q#zZj%%snVv{C!Ox!6dll-QXD z%b}lt+)%Z2x;x9szgapXj6Y}ntwzQaVr0c7?Wll>ZOqz-wST~f?PJa+T;FZ2k`C%} z7R3SdLjQHTzd&qSpXMY>c9_khbjoCmG!z;8yrjx?T7Z-OUI3GVMIeJ!Yrbk*i+6LF zmXcD67OyLN6(Rq@qGhLIafqAR8q1U6D9x}%rQEj((qGum-0P1H&4?045TSR)eYIPc zy}7OR4->NY#E@>M40nG2w;gjLjt)BPMhX#Dc6-{Q3zHapRlNbWO;PcZe++nfe$?ln zPMiqr4?N&0@xSzPpym8)nM$tfkBf(?+;}H60QZ=`8?RNu6n;;rUzfVBcv9d0_lVOk zU~(kCa3Y_xoG25CEMD5uL+ipa*L_dpUCUsmHTYcvw!$vg2Ck{9u>C-e6EQ1%b?a{a z`N^j1v4-Azda`#q>{T61$h5e!^e%{BE<}j70oE$N<=!kw1k00a)Ol5FAYz*R1b)Zi zKAV^+uAuN!VpG)#lWpuiKzspf8kGz7hk4GOB! z;u$MxHqx5L)7vja#^=h0Mo+E#LIQi;$DxP0e6Nzw7=f*?e}gCuH9o2JQR{Au^_0Eo zn8RY8*4XR%bmeajGhg(Pb+JTXb()Odv84h9Z2wa+;lbRP9f;K${CuCEZ1owJZ0tzS zAeAtEvSS6T)a}fFeD|!WJt+FBJzEbsdB!tNa9HCPak!xfRp{D5f>Gia6u^lPW5qyI zQe*moUS47aM2Cu|)l^rHaT0z$84+W`jBitnXD{Zv`LeHP?}}8INtA*=KDrINUfef1 z{wmB{25WDrFg4^RQ!o3ofm$qbOoWjJl(y+Go z+^{0}nu6JgB_+Zk%GpOWvEH)QT~dYb$cnOw*Z;=&bJKe|K%Z&Ohy!s?w6oRzeObgY zX1EWQER<%{l9rSr5*I$K#l6_d+JTRiW}I9cvqhqz2Rg4sf|Sh!7y)=fbZqma6lNov zk$KLD!cp z*m$NKU*Ah^r%sbe@p<+8+*fh4?|NKRP;X}NgH$ay+ttdRwy(6(^2n^EjkD^0K=Mn& z6TB-<_4C`6Ohfw&ArsuKJAX7m8|}?OvnL%;z^W788Cj6U7Ui~fFc>jn(yJfSsYxgV zCG2ld!dkEJQsESWFy-fez_)s?BT7CN9@P2t$_%o!fE81aQ(Clan5NLID+gOCOW`=^ zNG!9(o34ThYY;%yxA(y@jj{UFYdqpGAHt$1S$yl)6bacK3E-}FwJ>0UD@2l20!FxI zSMtO<|CI;Tp$Wm9U!q#Z z9#0^P5X_~0vziO3C?@EP=xHNf)|X5G=mE&ux>Ue|t;Ud1iq;U5ju<990@-p#tBMSi z)miB1Eb4FX@9IT>hW_X2!xXec=sb*>Pdy@NZd%GsScRAq+aqY=GNHLL9WBpC|)3@qvE@va5^j=hXO) z&u-e87p?wxNhWvfKCgRp-QurMH8|`*=@_AJW4hQgdSbx)c_V9EX{g%XM4PtPnc9Yb z%{u>j{4}1uKq6a85ovI|)q-ew0yyQbXvF)XFsmVFs?Okb!i*)BP2xA71tiZIlURq1 z?*IVIikf&nPoSa=5l=P|O*!lj)2r`xF?rBgR7y_c`8l8EFuso*kvyjurO_YOY4@Mp^;QY6iNHzPk3{&yk;cr=B#(<|;X zHSV_O1>XgS)5eS=Cv(ecC&ZcLCS$NKPa}AQBPz!bi0^`@bh?he{c?Uempn-I%{7TdLkIC00v8m-HH`Z;p z;Ou17Ex0zZ{ys*73yQ|1Ngc3)b<2BhRyErF=pb8)v4i_JqpOi`jt?{EEmp+L^O4@%?q8U(i zOVh6!B^oIiQl?l$b0>|0l>olpZ|!;(K-ML8@kt-?@_CWEXFAc0D)O3SLa_F}M*Pec ztJLF4Igy@Pk-d&z$T05!kw`Rbf>XI`xTdSt`aAo}sI@d?$gDJnK9Ix!;t(6#$Bh+h zj^%E~O&0l4LQ8mFBpP2wwu8Y; z^)$%Syhle}Ew`%7?jI_B)`sSG%SFW6r;uN&>oPM{gGGlM1mk!cXanxAMm5q>scJ=P6+>2 z0%rn+%2ObRK&!}TF2k0=UDn%EwI>D+^Gm3qa0wC*8r6F3m`w+>CPK-yTGy`mu6~4B}H9TpcPjmwoHtVtP$2lP7khd zf;cp+0>YJU<_i+{?kmz_1FXUGIRdDxb$+;v^<)2e{nq&B1i1A;0;>=s2q7Nd2;F8R zwt&QD(n2anK^ghuRVslhxxm08<-i^Frk%FNGMNSYn;z~wC*EPITIo?aE1LdHw z>ar|-qj>n@R_vL)fTP*!Z11h5I{#fedd{x@z{XcsZ_PcKy_V}>w<2bY869_RwUyQ@ z+RDHE+!@uL1h`o?h#o~GUX7t{B5kADO-kdBlqwOfnp^Rp_t<55S+80=>gSs=0}Jx9<|QE1gf}C?G!8l7tK-; z$>cz*(!kPKXC6K|4w=a^l<;z{h%$?!@&?B^l`WFRb(!QMSaNO)tD9u~8Ne#Op#~#c zVGjJk)LQS%Ri(@db8k^5cyxNWXfL;&!n8)Fx_(Q}w8@uCh)$`*{4znLMcp1l0ocV@ zy31`vV<)Jvk~C6Bzd8%>EO-qX@AmvLFU2S1t^?uK?&u{a)-%$>WmYSuSP04DA-q~r zsBDkVB8n6{I(fCxJcBF!v#Uh2@R?2H7O`04HZWtfhFZF}B)g)`iz#QV`M6{rJ z*nx1!N(0Ets;Q@27`IDfE3s|M?PMFkrT0~)?eZiOz>bd;D zqoriTFIkNi;1x1zhcqanxY-!+NRr`=+qz*<= zW0;_}`PA^_*sW9yrWYk>JUIq$PoBmXKID&BS? zcU|6B`Ix;Hox$9GQ$;ua#V~yq&kjBk3Y9NX3;8mf#PCi&*35>-G_&@O6F>N>gM75* z`K{}iAuJ0UXj#zCU?_yG1C4}-?Z2MhNH9MG&ZvFXI1w= z*gO$JXp6VnqtQx$w#p($ZdBwF5X$AY{CWL(*011Hl_NHxGFoF7K4L1CAYuklc5eC$ zs;Iu&_z;O3P2{sSMc=ec@NKF_QEP`@Wq9@V;BV@3sEfB*Q!BYkfgdX~_UHj25q7CV z0j~PcJ4v5F_o*HH*@!-ausEp z8XTcYf2L)zL{30e+b?dT#m#7y| zPArel7;(U&Ho0j#zc?2)BSp#+87E-u!U3tAti)eb)J_Kwb`}&vofav%k1BBf@GM3L zr8I7VP74f4J806{P^_IY9c&*`e5NnKl^>CjB&EefTmS8_5YO4?LDp{^OTq*XOAXng zAdlibd^F}i&S{5Sbul_-34*`pS`6oY<)x0^i#m{4)2xm6ZO#Fi=__;3!d_Uxa7V03 zm0_zEpCdSKqpEpzLD?u^xdah{aD9?2jUix)Rf|xyAu?@Am|hyvnf05i8ai2{n?FI`NCM`<3GxYcjQ&j#V~9iXuPQ%M&0f<#rXVkZ z=xG>08ia?nFrL3+F!^Zgb=_P}iU1%pm9(kuZ->p;8Cp)+Zdet{j%6H=CEOG_-wKER-K?trlGghC(_o-~;=BMyn zupENGCCKApv&#$uiCh+Kw+gEyJ~S&ghS8n55wg_!?=GEUvv+cvL>V2!4c`4JKUfmU zn6>k6ARh z2HCZ$9J#2ff9%6j_3@`N$m;;aMh5MxV4FGFYLPS3- zn63G{t#0O4HG%z0ra-$vxX)(q$8{r=GX09(x@U2#$Ll{U36Wf%yPs~~wJk{8Gx*zE zWbE5E{-A7u7f@QYG+-hQEC2(isyAWwlIO_aee&?zMN=S#JV7WxGF^8dy(msggY*|BUc)D2F;uFCfXnE z)G?FaH-o!A`&JP^1`t47U~$FKfwc{9o5#%y#8yYQwJ%>hK7rn4~Qdb)IY=nH zs^J+RdVVy&RS^%eHV$8ovlYRl7VDjh%>mhB87_GNhjDZ2B?+h*5f*e-cXRdSpfn+Wq!|wt`d`2w{CfGPm&2HV|i!G z*rtFOhmKdwcs?Z`^1~%VMNH3s#|7l`wV5rw(5TXvgvHrQTa6(10H{IYDPWr(?cK!% z0mBhV?-GZ9h>-FKC?2wrZ<*h#zr=(;kZ(rkg`Ww}4l2AZt zwhLQOyqIL=@y7_&#A>5`U=ZZ*h_q8`I&0`j{HR3?THs!(*8GC?KNdr=F3OxdH{LB{ zJ4*Aht&$qf;Bo+Ln#K9Em#d~JVD}Z-og<`2%Wbl?7sf!t;b;w$G}!%LfVN^s z0_wu>62ok{jvGiX*nN71*p&Yw$ifdS>~^8$Qc?P&r+^H=b$P!K(p3862LK%B&oQ(z z76Te(5Y-|lr7#BS#a$7BhExa(Xuq;~3>F4yIw={VWv(yNq`-}V-wqeSw~(RKlF_}f z*la{3qW5jVDORkcqQv7Prj9@4FJAe(jo%y#!shqjY&%7B#0$Bh)+SgmT8x=yOcOZq zl-%({e;CyvD6O>>CyOdZoR25=qs&eR&sb5%>3|fiWQ3}0bPyTSdt8XIg}LvZJwz$H zuC~~AAAA&J{-diLkZOgS8@{l{{<{DtB=^$K!(Lo&(bw3O!pPmLsedYky(A0UVbRc1Mz=bJd>lFyg^GWxPQYTm4CbSDS0#Eu z8412jAMoUE<6B5JWXnS)UIeE2@5~^@a$jZwvqGH=0QiA}6Z=NvdJZjiLR6`QCyY$I zv|k3u_i3S`|yf$1Fk@5iuMsT&Rz@PAJ zu6;A@N>>@;zsY;@`ls#%c=TG0Rf7W?!-fwmEUHAkvV$$M42+zx8`8iO(CqlQ_X;ADIMSuNn=4Hyxm;6VmyFfs;VjE=;2mFT689O%(4oQ*MfD{`bv>4S%j#CIb96qq0^gym&cA1 zetk#_H;_+I!{T90&_AkD`4Hf<<{Uza0m%mx-0k?>@PvARfM#v_L8kejqtcud6(Jrz zE=6rgt_z{WX1D7iMu=w}d_>{ND1~bBe9w05rKA#DJH@pfof$_fPo?WHfRGcR4UjDO zHKyuc#zT^GqrKj6bZKK262=k z(8=32xKb^^?Fyy`h@NM(inIGQToi9e&M)^Ve%b z&2+J5=112MZMmk|ka=n0;Cqg{{ryH|0pM7u2p^ENXpEyRqdZ7r{tG5wA|rfYiK)>u z8K^846JRI6XjW*x4*0>R>XFQrdP3RByT`qszJ#zYb+Eo*l2BlMB^b^CBAJ z!^NJ5f41K(sqp6)`0Tp|ag2zT=*(K<@JIr!&}R{(D*eS4$Hm7{uMR)`i&!7Qy(YK< zGA{mN(DmsH@@eZ@zA?wGRoG+qX-)I&o$&qcgEodt2wqnbzW6xSmHW7&8+%(S$reZC z2nLAnm4MYV1|yd`jfS7q9am%(6NMg`R+*$g_qyx7y?2Q>Xn9_U_`om(Z@HeZr1F34 zyo?q9Yv61$8rfj_d?F`C@AS)p$q$$%1O5aiUr)>6qz8d}NgXiXDM2-dm zde!Z;@pE;dX^mb0DAxgyZ}_pqR+GX>MFXx|$JT}jQqK)31?*yEQxc6WVQ>(+mr0pIy#^f>9 zo(gRha1*F*Klr=pt{o-|_|%NNoZhx@NwqNV*x~8=wP(!%wpU~9X$E?=j)+qS9>b&N z5NpD%8ftvFkea=KEvU*t&#sUIyJueu#6GP~P?d)*T!q3X<`Bz7QAd|E*N@RPUq;tO z4w7ol8tD%eL9oG(t5dMR5RM~g%(2jq#nTXV67-VZMr`2JOEPa{|4k#0nlMWzJ*j?~ zS~-X#`nx-$DJjnWgxfQHZXaVSyouaTuL13;xG5?R*A!bHxAAU^UBgwi|N_L zu1X;FIItFwLjExPLwYiw{X|N~3ooSH1K?wcaz*rFDkVM4P+|udO}#xtmc9AZQ-{zN z{X@gPKb&ars5@)?$D2~4ni|lJ3`v}byR!7=M&yOK@K5|O8hqV++t9sHT-~xtcuBAKo9-sN9wD?wQQ}{&D(>I2i;go6V#VM*P};V%xJ-X<(~UVIteF!lt5(NbyoRf z`m1!z-gSQ%X^s16V;`9%i!|-`azoMURkc==o}BDHta5AUF|51U_)?=x&RNmHy*~+4 zO4t0qcgH=ni=Fq**j|8;`a-oZf;g0AcwU}^v4bAzb82z|>5)>Cn76pG7cZH+&Jw3n zM{ij+D>B$5=?I^&DH~Df-21VC7QE7T+Z=8kMr9dsREW(_a`jnxHCXiH3!zOVa6 zVms6|RPt#!va?GeBIUQi_NQd7?caWJN{?$*o1Dsl@T;|vk(H-|1Nzv~K&h>U(rnt2 zI4L9o{a%~nOs=uPHg|jt*jKAv>b>q*%pBUa*~Ex9YR6=z`kVKqLZ|At0Tu8lOIY22 zJp0%yHxV^Sk~KL88)u6|e9t3&PzRu`Nn(fhoG%ZvJc^Jf6trY2zFBm=;+LnpovkL+ z=>b=9*2S6fa%--4?{L#P0euX?5{Q@_x0f;^k=&V9zlL6>Zv&-V#g;w}l&q=2h!f3R z#qT(Cx>9}Y=bNA+p1=58&2(uiM^#=q)xZNEIW#zLTx#FXpu(-je=JHAk~4H@UnXi= zxdVs|lv~7v1xWhfTkGgSh}N+->@7Jxobp{YnJBluB{?bfnYek`!lV3;b|hC#GA^jm zs@m#Cyyw_?K1TF(knIqV)}wrk!- z_$@OrDmTGB_CesntLxh0LQ?>`L;C2-83lB{S&8wzPJqAll$EJhC3>#uT|k7=!-EPh k{|Dau2L&W1N;pMgv1R*g<1rR^Qc_6$ioEFf8i7vz7m_=gt^fc4 literal 0 HcmV?d00001 diff --git a/_preview/4/_images/globus-logo.png b/_preview/4/_images/globus-logo.png new file mode 100644 index 0000000000000000000000000000000000000000..2bdb508549a4e7eaba5b10ac44edf04fb4e9a3ec GIT binary patch literal 8023 zcmaiZXEYqn_dZcWh`NG^7Ijw%QKI)6CD^rCEYUXzu{vRu=rstU6TvF0TOw8st3;1Z zh_V|b1c{b^J}K1{E z-wQrMHVs-|B^G9KoA?VU90<9+D9z`!gG+8CFVYKA7WVugR|~x{%DisJyv%TXBTBK8 zo#58H8II~$46G5ExfZH25Y=C6%g%P^STei%GrQVZ?axm3&x`+am~vCGs9#;GT$kl^ z-IBff`|;rVLFH=_26Q#Kh=JXCaF{`zMR72NidQ-ezmCqq#L4d_P; zn>lbiYkI3BX-OKAQN+w>W5yo=SD!236r4||0jm}-*}RWic^XNIiqR|BMKCk4`Njs4 zqGq{Dm}m)22^RIZRKBmse3<#Nj#|T_kVVg8DW=!Ga+?*&lx+G%q5~x6XuRt$BeYWdycq z5%?T2HvrlEn2etDxa!jpGqKu7{~3Bv!h|sB_t2BEj2-1M7NJyYI7-ZFk7yT-1MooO zSb3}?;JlDHfZ7EGEk>ic_^R36s*lT&)vmye@)ijQgvUDWX?(exG0D=8`a5W`UDY!dWapsn=m+Lc;D(o>ergsD-&BRdcroi1*fG*_u z!_i|?pV@I!?X%I<2+-a=lZfTZ3I|7lbDKYvaIHM1B!X z##-qng@=x8LxqK|O9laGkXtu=Pb!vey4LxYqqglI`Oi4(zSbx08HdV0EOL$tmQKTr zGY{`g3zQ6tZv?&S_o&i9ZW3uN$ak>Hg3bE37Fv&u@VrLa%tB{(r;SQP0NGH>tCaSa zm0*A4LxREeotOv>`cxTbU!hmKlgh$VIN3CM_8xOtYNH$h5oyi zjLXvUe~p_*sIvz-Cqx?)atJDkabpaUJ*l>lesVx(wNT&1t(_tmAdwOl(CvS&H3fQ*obIxMIJk?hKw^qB~ZC7^|%X^ z6z9?Fw*Ns>fNM|EH8+mp{-d7K46m6*{%_{Iqd;inZE-_Zf(>lYpJ93KF3@cWQqIi9 zCY(8x;pjZG9|CLR65RWov+e0Ge%qBa2ZC8sUekP=`7DTN%@~i`1n`cACpc z;kPR_NN~Qr`ic0Eya4t0b-72pG`AO0Y}QxL>F&Y=MPZs)RaA^(`wDB9 zFb{Qit3b!6%LNOzno87FTuTf*i`T=)Y7Ow5La0#e%?9Os15gWULk&1s49BU_*$TF_erk(_J2+%D*NKX}Fk}7bTll(tZQm?(?v1S$b_(it%ET(J1FD5JT z83eDwAV!W5^5puK`29squshX*w`cndlNt^FzB5x&*JkU=;Gv`Q_Lw*TDkeq%k*^Uz zg=zeEgcfJr5k;}e?65&OE66QONe)DSwZz2MDk*PLiEqS`YRPSqp-!U04e@RI07&W> zj+5OdoDVhYkFy3mc9$x?huY#$*KIIUX=!-&qSE7Lk4(xgQ@)s~rV=f#kwbGynCYV< z`R)8jmkAP>1_(_u5}Dh(^7uI&BU)BAg0G{WG0CMpmN}th2{o$_`gZviPLdF4eUF^h zE?(jKD%qD#1Vv8+G1L_uA0YOu_g))<(5-2T;RA&&I=(uL7I+C3bxBEUx!dv1w);(L z&|1vHoh5IVGp$VM-r5*p>wto)mk&x}tOe{4pQpBPf;_tuP(Xz|~57io9qTdZwrt=HHR;4NcfNxRYvX)UvPGT|lEfXDy>>E&m+nlBI_ zUYNTy#wI9VPm3rR#2)at`G5g^ zgC9m)i!KyIB2dqxcj?2bs>F;H1+9}GO`em{%_s^zQpBSv+n&$O{+^|uBxHohyZ53U z+)%TF#XIlSG}~Q^1C;}L>y9aBl)oGB*e$yKfIv)96|@Uq0kW}ObPm=V9|j`5W~sHc zhQvHGiSo27BQy`V=g>qtoOP}(g=J*66~n%o?YFx2Se%U&FU_1X-3II4{q9YJ5^KxE zwAN%dn9nNX-2DBxa~-WBQd2Ho-c{NKLDPKBL0JjLdYo8vv>!L! zeE9GfQaK9c(f=6l;CF_B@ZpHD`xpVoOWkJ+0uh@UMw zpM>1;_@S(ao1$ETOa=?DbKFy8sr>`6l#Cv0zzs^C!T5!~g@E#_ZMWYx%6fD@qqWhd z#U07z$&AT_ep-O$r09I%+}Fd)%*`SPyoMA2bn?Mrnbcylr3$BiZi&Jieg33)-;06% z#?fR`u4#IAX~+KxJcgB4@PGfZRiyk__bQPN!{lSG`DWa!m*=EeyonKovH*7vZ3ri9tDDpjx9JH!zUK}ytu zq*wf06BUleBdAZE*;?0({dURu41JKTa5bk_Sk4Z7I__=gU-guU_+KwZe3v8OAqNtB2W-yI z(dYodwJ#CGqfnnOfU}z-qq9aSEn)hK%*2aFe>ydD<{%9y=bPY((t_!yTc7+x9iN@z8xX`#32}D@?WT9OCYeLfoK@)!^Y=Yl%RT2(9gxQ0JD3Uw;cu zc6dObmg)nA@7FOJU_^o!b#sU=tTBBEXVyS8_4mFMx(c)YNT8E1^QSd*t-Z%sa}f9S zotVb@%t&7TQKCwKRZr9?Jiy_0sEU-zj3AV7LnY5^jKsfSz81uy>HNCIkxfx$UWL)a zoog}u-4g?`t}nA>vwYCG-hnvTSrKs!gRo`NkwTx2Wrq(12>Wh1Z}-S4bd``t5-7QE z_9%-sTL40~Xudfty}tbL*@Y2s`7q<~FZSDCV{p^i{6B@qhXKwNpH<$=_k4O=d8{ov7)13tu zm4#oh(;{5n(A}b+s9b#<>O5H6*Q+20a$umOaJ3}pT^0@Xw{a4TY=>YtW4no)lGjs| zD_}9}ZgOH$>rvG5E7zIlao@q?Ww`OtCH)~Z{5Fens3ojTGc{@*nbq`aoWhWmjYvq& zL><-`P&;Ny9Pe~=@3fC(rj)#XJ`j99Rz-!Vsmz85gk5W@aW%I9An8z)wN>|RHlx~d zrMax-C0^W#4$b`ITCsVg<-(CbdeQYRkYpXp1%f;aY3?WxLbO8&DQ^ zlcgUVcwaytUw9UNL}Wk3%C+yR)ulM?@VCdQQXnff+4_2dUiGM~UUtWARLxE?q67^p0x>BMs>DyxZr&>?E z-S%>-1p6ZoW~>_E0Pc#*j(fA!Phexf=t<~rI*i(!P6-i%vg6q0w}*c(SVh9WVXFPo zVb1T zPo=r*GKvuxL2qrPP785svUVI!gV7gjx3i!>%TD{o36Y>$W=n4lV)=OJOo4XvWk7N~5^VJ9gd)EF(%6rxqacbzPYrUB3&-}6hbA+CjGvIY z$%>OBHW0n|D)`NgHa-wVmD%CBVq{GLD z0RDa)!Mua2kmH<({kR)TnpV`5RtvNTK&T;ejGni7axD4gz-u_&Amz%Q9JrCu2i%!M zFj|4c!o}7o%=^_bA2fIxX=An1tRC?JU6bz9^mb$9?8EtEi5KQgS;*KdiUxCZd1||! zXSn$Qujnc{kOWxs>L1I@SQ9=x0fji&{%LJ60|M)sq<%f8Ci%U9O}I-(U;|h99*IKF z8IVGgoqaOoP$CUhKFZV>nFm3xt(xB#y3G$ zt&&{oO&F2)V69Im*lHGsz(o+dcz6{8dgj2uT+mIi+X&U?el7!qcI^DhsqWrgOMH2~ zwnqO~JpB0OJk-8#>t46OnFdOAw;I}!U~^@{HDS8}e~PKvz`A=7mf zxH@aD+j+kU>wRkeavT)zt}Gcs&DDs$#})ee*V3kfNm(_l;g^FZgV;?4mCOW6g|C#^ zTyGIQ)T=95Qh!C7Fe+}o$rV$47*7J{R`i72FHDEzjE_~&%~kBbx-E2HUgcf#lA zC4?%|W13r9WhyDr=t*O5-K{gLL+c47ZON1K9Ff*U( zk;a_Jl1v1V9(z=*U>oYVd|xKYQKQu&z&H0=(eFW%nH!$yEou+M~vTBRcj(fyTnR;D!8rf(LyIJfnEqC&8OYfkcet2`AJ{f zPNr4>*{#t_ry$3TY~HwqZtssUBQ@#Y_MBq{(%^hW9m77TRB=AZlF3eKHktbv_I8f```JJ)837Pa^z_CCv+k))<#EIwYLnQ_d~U;KhMX`JMdp<;ZKp% zJIw%c+FsU1zhtxXbHw(VQNV_o!?~AIc_ZaN-tWQmg8q`I;>cyy#O%fb#XCpFibRuX z@W~*{+ffp7T6pHJCyM}x`~R%H{!b7gtDdl>_9yIe=o8wwK3!>Rno?EQ>EV3H(cPRG z(CZB{Z3a+LCZe?7NN{TBjcG*$oRkDbLGmB)K>r6M)PVn1|3Q!4r3T~H=Gjl~s4eZf z?h~T3uh=#6EHy~8u%!Ns+xZ&d0I`V#M7~C#zhT{i@(FuQuEeKxCydj_4CpSdOHhZ- z@a)o2z>$<;osCVGpFJEquw5#szDv9+a@+ZG+Ga?61SnJ_IHmd;9qv@S?HH+SK4AT} zB`tn8;d{&VvC3hg$%^YED}D^j(2Crr6*6Kn=h&8xyxL`yi{Ea zl=KuA_#m=Xk|W2rF%9tP-ItX&oI1m$rc|psGxix;Png`v6zhJn^M%DebIox5T`jKL z`ZRRP^}uR^w^v|pEV=9gYfd_nO=P=T=q@UI%=I|q46mG$@8;>&89Yk811k!{lo<_& zaA!=k`#1~mLHBuq5X)g?Q$?m;S*JyM`<%|{Vo$R)WaWX*`K?yr<%6HMdZBBoPcWG~ z?SK-!RYiYch#^u@qHTF1**b6@5>{ScN%zdMH48ZL5-V`(-X^ky4DA(&MsvzHbIg|b zRfp;LxrYuTg@01wx$e$_Ac;y7#S^?|-m0%8&2S>Y_L?=IehuYSA>Hi$+6=?~;a1UD zf#p8zBG}$`{q<&;phvS27x5S$Ax-pH(`uNL6IBeDc2DnVvgUh%e_cwX z!&~C=RfgpGt#<^_bAAl+<2H4K3_IuLzVN6#%hy#o%M)v0O9tGcS7YV!Ygn~p-Nv;i zCNB%Q0YVUaBTavy)p^7NC33dIzSruAN%Cny`M@a=Ea z-;Le_oripM=$;|Mu$(AxHZyTYA_bHg^C#$L^ljpZU4rBphG0kW!#_&xK=b>L?q@lK z_q_XfFRG$FFKUPtC1l6%5wrQg$Y~~B!GcU{BImczdc0IYPJ1f0p-5F!dNTnY>G`e` z@TQ)1Ib=)!P9p^JEXzc-(&qQ` zCk3!)2hlB8Z@9HM;GtDHZ)Ln>z-npd&jjOxQA5({56SAqOX{NQ%$|L$e^G{DK-U{R zbHmQ`w>D21txI_L(CwvALkcY1F=855^i$=RPVQk3RV6|gF-()ePihhcIH@5udo5dv zSRQMPwGAIkE;q8)+sc-j4F#@ZWdR2sUeSzHe-3Dt)Y;V1vS`0=vS>f%QM(ix)%hjJ zk`Wh-c$k==7?yc>B}d%p@Ge>Et;|adUoR1_#7;gUiodIJ)}aQJ_qz}IK102%{=FKO z2x;C9A?~i9zL-nbSy)1W@wQ5%N=vpb85B5zB&~_paxp5TO^nOCE~>86AcoJo`=<&0 zVVP?dv60{uetxwYqgm^UY5(4WoTmm*pZdRL)}`yTPtSK*yT~0n#HcDB-T>!lD1dge zv87V;j|aZ24m}cXPi4k=upi3KDEQXuu*wju2F3iYKg_8EM1th}&+byDsCqLHZN-~_ zHM{7M*s4;Q7CaMBqQsR93LLMz@Wg z+2;idx^#!oSp91Y4IcdJ%g7$-h>HEtw(C~ebw=v(Ej5ck%Iep;o7AzMZa@ zBl@9cwitZ~Iq>Uz-U^%?s0IX%`we#Tl{#~MHEng+Nd`N;fMktRrv(8vN{f*#%_DxM zKkN=hFEsC-Di7}vDFdYHp~}{4Vd=+L^8&8FV-X`vIF06TgT9cQogT8WAg>*Xk76Qs z`tF`}ORDa`Uy6UF-1`$0z;5|N@G!E3{ee;K$K}$N?Z5^leHvGGUT(nqC|&$l*GD7w6`wEf^IM;<1Q6`b zKqaHZj0H?5f=eqlWNyHDknZ5SIt$hAl$Z2smulWHI-dX5T-;P@rb9EXLVVUvSFuW1 z#il6Vm^xH0gtBWE6(mW#ZFW^!M?ffWAi-Om#-kTe7BAaXwL!p(h0HVVXAQ5nR1R8{ zo?dnPeVC8`6ZA-{WcsNEx=8xlgZabou~-i=O{;)7VyEwCDMQ=-8e84$+Mt793)6i; zIk_QmGhzF#l*tcJ6iXb|POIEb9f?)4-pOTFcmmKR>CI01RXN6?x;GFeCHDAPR(hCyj!Rf@mQj&Ug|i~i>fPSR z&l+X?L)P!e9bxfW*Tl2S@JGvAW!Uc*D)`awLAxLTpuOQUjTQ9Xq3geZxIo|j{`?y4 zDIO)G(ei^G4gtCs7)q=?s&~YjP@ny4nKqy(A`GdQD;S9ZtM`qt zY_CPt9#LbxTT|?26!P+C=aLudP9#Mw8nYaouFi)5Tm}FV+z~I7N!UK8%e!R0ZS*j8 zbUWtd(|(#Bx{s#hh+IMq`KV{xbNJ~})M*}jL@f&m6biPn;WO22DJ>Oy$x(Ch+k(%Y v<)2T+6zH6PrQi0@|K&6Pf85{sOL2$f*B^_bXGo>Y|Frtr##(h6aMb?;T~;)u literal 0 HcmV?d00001 diff --git a/_preview/4/_sources/README.md b/_preview/4/_sources/README.md new file mode 100644 index 0000000..a0d84ac --- /dev/null +++ b/_preview/4/_sources/README.md @@ -0,0 +1,83 @@ +thumbnail + +# ESGF Cookbook + +[![nightly-build](https://github.com/ProjectPythia/cookbook-template/actions/workflows/nightly-build.yaml/badge.svg)](https://github.com/ProjectPythia/cookbook-template/actions/workflows/nightly-build.yaml) +[![Binder](https://binder.projectpythia.org/badge_logo.svg)](https://binder.projectpythia.org/v2/gh/ProjectPythia/cookbook-template/main?labpath=notebooks) +[![DOI](https://zenodo.org/badge/475509405.svg)](https://zenodo.org/badge/latestdoi/475509405) + +This Project Pythia Cookbook covers ... (replace `...` with the main subject of your cookbook ... e.g., _working with radar data in Python_) + +## Motivation + +(Add a few sentences stating why this cookbook will be useful. What skills will you, "the chef", gain once you have reached the end of the cookbook?) + +## Authors + +[First Author](@first-author), [Second Author](@second-author), etc. _Acknowledge primary content authors here_ + +### Contributors + + + + + +## Structure + +(State one or more sections that will comprise the notebook. E.g., _This cookbook is broken up into two main sections - "Foundations" and "Example Workflows."_ Then, describe each section below.) + +### Section 1 ( Replace with the title of this section, e.g. "Foundations" ) + +(Add content for this section, e.g., "The foundational content includes ... ") + +### Section 2 ( Replace with the title of this section, e.g. "Example workflows" ) + +(Add content for this section, e.g., "Example workflows include ... ") + +## Running the Notebooks + +You can either run the notebook using [Binder](https://binder.projectpythia.org/) or on your local machine. + +### Running on Binder + +The simplest way to interact with a Jupyter Notebook is through +[Binder](https://binder.projectpythia.org/), which enables the execution of a +[Jupyter Book](https://jupyterbook.org) in the cloud. The details of how this works are not +important for now. All you need to know is how to launch a Pythia +Cookbooks chapter via Binder. Simply navigate your mouse to +the top right corner of the book chapter you are viewing and click +on the rocket ship icon, (see figure below), and be sure to select +“launch Binder”. After a moment you should be presented with a +notebook that you can interact with. I.e. you’ll be able to execute +and even change the example programs. You’ll see that the code cells +have no output at first, until you execute them by pressing +{kbd}`Shift`\+{kbd}`Enter`. Complete details on how to interact with +a live Jupyter notebook are described in [Getting Started with +Jupyter](https://foundations.projectpythia.org/foundations/getting-started-jupyter.html). + +### Running on Your Own Machine + +If you are interested in running this material locally on your computer, you will need to follow this workflow: + +(Replace "cookbook-example" with the title of your cookbooks) + +1. Clone the `https://github.com/ProjectPythia/cookbook-example` repository: + + ```bash + git clone https://github.com/ProjectPythia/cookbook-example.git + ``` + +1. Move into the `cookbook-example` directory + ```bash + cd cookbook-example + ``` +1. Create and activate your conda environment from the `environment.yml` file + ```bash + conda env create -f environment.yml + conda activate cookbook-example + ``` +1. Move into the `notebooks` directory and start up Jupyterlab + ```bash + cd notebooks/ + jupyter lab + ``` diff --git a/_preview/4/_sources/notebooks/complex-search.ipynb b/_preview/4/_sources/notebooks/complex-search.ipynb new file mode 100644 index 0000000..fb1d70b --- /dev/null +++ b/_preview/4/_sources/notebooks/complex-search.ipynb @@ -0,0 +1,544 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "\"ESGF" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "# Complex Searching with `intake-esgf`\n", + "\n", + "## Overview\n", + "\n", + "In this tutorial we will present an interface under design to facilitate complex searching using [intake-esgf](https://github.com/esgf2-us/intake-esgf). `intake-esgf` is a small `intake` and `intake-esm` *inspired* package under development in ESGF2. Please note that there is a name collison with an existing package in PyPI and conda. You will need to install the package from [source](https://github.com/esgf2-us/intake-esgf).\n", + "\n", + "## Prerequisites\n", + "\n", + "| Concepts | Importance | Notes |\n", + "| --- | --- | --- |\n", + "| [Install Package](https://github.com/esgf2-us/intake-esgf) | Necessary | |\n", + "| [Understanding of NetCDF](https://foundations.projectpythia.org/core/data-formats/netcdf-cf.html) | Helpful | Familiarity with metadata structure |\n", + "| Familiar with [intake-esm](https://intake-esm.readthedocs.io/en/stable/) | Helpful | Similar interface |\n", + "| [Transient climate response](https://agupubs.onlinelibrary.wiley.com/doi/10.1029/2008JD010405) | Background | |\n", + "- **Time to learn**: 30 minutes\n", + "\n", + "## Imports" + ] + }, + { + "cell_type": "code", + "execution_count": 1, + "metadata": {}, + "outputs": [], + "source": [ + "from intake_esgf import ESGFCatalog" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## Initializing the Catalog\n", + "\n", + "As with `intake-esm` we first instantiate the catalog. However, since we will populate the catalog with search results, the catalog starts empty. Internally, we query different ESGF index nodes for information about what datasets you wish to include in your analysis. As ESGF2 is actively working on an index redesign, our catlogs by default point to a Globus (ElasticSearch) based index at ALCF (Argonne Leadership Computing Facility)." + ] + }, + { + "cell_type": "code", + "execution_count": 2, + "metadata": {}, + "outputs": [ + { + "name": "stdout", + "output_type": "stream", + "text": [ + "Perform a search() to populate the catalog.\n", + "GlobusESGFIndex('anl-dev')\n" + ] + } + ], + "source": [ + "cat = ESGFCatalog()\n", + "print(cat)\n", + "for ind in cat.indices: # Which indices are included?\n", + " print(ind)" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "We also provide support for connecting to the ESGF1 Solr-based indices. You may specify a server or list or just include `True` to choose all the federated index nodes." + ] + }, + { + "cell_type": "code", + "execution_count": 3, + "metadata": {}, + "outputs": [ + { + "name": "stdout", + "output_type": "stream", + "text": [ + "GlobusESGFIndex('anl-dev')\n", + "SolrESGFIndex('esgf.ceda.ac.uk')\n", + "SolrESGFIndex('esgf-data.dkrz.de')\n", + "SolrESGFIndex('esgf-node.ipsl.upmc.fr')\n", + "SolrESGFIndex('esg-dn1.nsc.liu.se')\n", + "SolrESGFIndex('esgf-node.llnl.gov')\n", + "SolrESGFIndex('esgf.nci.org.au')\n", + "SolrESGFIndex('esgf-node.ornl.gov')\n" + ] + } + ], + "source": [ + "cat = ESGFCatalog(esgf1_indices=\"esgf-node.llnl.gov\") # include LLNL\n", + "cat = ESGFCatalog(esgf1_indices=[\"esgf-node.ornl.gov\", \"esgf.ceda.ac.uk\"]) # ORNL & CEDA\n", + "cat = ESGFCatalog(esgf1_indices=True) # all federated indices\n", + "for ind in cat.indices:\n", + " print(ind)" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## Populate the catalog\n", + "\n", + "Many times, an analysis will require several variables across multiple experiments. For example, if one were to compute the transient climate response (TCRE), you would need tempererature (`tas`) and carbon emissions from land (`nbp`) and ocean (`fgco2`) for a 1% CO2 increase experiment (`1pctCO2`) as well as the control experiment (`piControl`). If TCRE is not in your particular science, that is ok for this notebook. It is a motivating example and the specifics are less important than the search concepts. First, we perform a search in a familiar syntax." + ] + }, + { + "cell_type": "code", + "execution_count": 4, + "metadata": {}, + "outputs": [ + { + "name": "stderr", + "output_type": "stream", + "text": [ + " Searching indices: 100%|███████████████████████████████|8/8 [ 1.85s/index]\n" + ] + }, + { + "name": "stdout", + "output_type": "stream", + "text": [ + "Summary information for 399 results:\n", + "mip_era [CMIP6]\n", + "activity_id [CMIP]\n", + "institution_id [MOHC, MRI, MPI-M, NCAR, NOAA-GFDL, NCC, NIMS-...\n", + "source_id [UKESM1-0-LL, MRI-ESM2-0, MPI-ESM1-2-LR, CESM2...\n", + "experiment_id [piControl, 1pctCO2]\n", + "member_id [r1i1p1f2, r1i2p1f1, r1i1p1f1, r2i1p1f1, r3i1p...\n", + "table_id [Lmon, Omon, Amon]\n", + "variable_id [nbp, fgco2, tas]\n", + "grid_label [gn, gr1, gr]\n", + "dtype: object\n" + ] + } + ], + "source": [ + "cat.search(\n", + " experiment_id=[\"piControl\", \"1pctCO2\"],\n", + " variable_id=[\"tas\", \"fgco2\", \"nbp\"],\n", + " table_id=[\"Amon\", \"Omon\", \"Lmon\"],\n", + ")\n", + "print(cat)" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "Internally, this launches simultaneous searches that are combined locally to provide a global view of what datasets are available. While the Solr indices themselves can be searched in distributed fashion, they will not report if an index has failed to return a response. As index nodes go down from time to time, this can leave you with a false impression that you have found all the datasets of interest. By managing the searches locally, `intake-esgf` can report back to you that an index has failed and that your results may be incomplete.\n", + "\n", + "If you would like details about what `intake-esgf` is doing, look in the local cache directory (`${HOME}/.esgf/`) for a `esgf.log` file. This is a full history of everything that `intake-esgf` has searched, downloaded, or accessed. You can also look at just this session by calling `session_log()`. In this case you will see how long each index took to return a response and if any failed" + ] + }, + { + "cell_type": "code", + "execution_count": 5, + "metadata": {}, + "outputs": [ + { + "name": "stdout", + "output_type": "stream", + "text": [ + "\u001b[36;20m2023-12-06 15:51:39 \u001b[0m\u001b[36;32msearch begin\u001b[0m experiment_id=['piControl', '1pctCO2'], variable_id=['tas', 'fgco2', 'nbp'], table_id=['Amon', 'Omon', 'Lmon']\n", + "\u001b[36;20m2023-12-06 15:51:40 \u001b[0m└─GlobusESGFIndex('anl-dev') results=329 response_time=1.33 total_time=1.34\n", + "\u001b[36;20m2023-12-06 15:51:41 \u001b[0m└─SolrESGFIndex('esgf-node.ipsl.upmc.fr') response_time=1.39 total_time=1.86\n", + "\u001b[36;20m2023-12-06 15:51:41 \u001b[0m└─SolrESGFIndex('esg-dn1.nsc.liu.se') response_time=1.68 total_time=2.28\n", + "\u001b[36;20m2023-12-06 15:51:44 \u001b[0m└─SolrESGFIndex('esgf.ceda.ac.uk') response_time=1.30 total_time=5.06\n", + "\u001b[36;20m2023-12-06 15:51:45 \u001b[0m└─SolrESGFIndex('esgf.nci.org.au') response_time=3.42 total_time=6.59\n", + "\u001b[36;20m2023-12-06 15:51:46 \u001b[0m└─SolrESGFIndex('esgf-node.ornl.gov') response_time=0.78 total_time=6.76\n", + "\u001b[36;20m2023-12-06 15:51:46 \u001b[0m└─SolrESGFIndex('esgf-data.dkrz.de') response_time=1.89 total_time=7.29\n", + "\u001b[36;20m2023-12-06 15:51:54 \u001b[0m└─SolrESGFIndex('esgf-node.llnl.gov') response_time=1.83 total_time=14.77\n", + "\u001b[36;20m2023-12-06 15:51:54 \u001b[0m\u001b[36;32msearch end\u001b[0m total_time=15.26\n", + "\n" + ] + } + ], + "source": [ + "print(cat.session_log())" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "At this stage of the search you have a catalog full of possibly relevant datasets for your analysis, stored in a `pandas` dataframe. You are free to view and manipulate this dataframe to help hone these results down. It is available to you as the `df` member of the `ESGFCatalog`. You should be careful to only remove rows as internally we could use any column in the downloading of the data. Also note that we have removed the user-facing notion of *where* the data is hosted. The `id` column of this dataframe is a list of full `dataset_ids` which includes the location information. At the point when you are ready to download data, we will choose locations automatically that are fastest for you." + ] + }, + { + "cell_type": "code", + "execution_count": 6, + "metadata": {}, + "outputs": [ + { + "data": { + "text/html": [ + "

\n", + "\n", + "\n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + "
mip_eraactivity_idinstitution_idsource_idexperiment_idmember_idtable_idvariable_idgrid_labelversionid
0CMIP6CMIPMOHCUKESM1-0-LLpiControlr1i1p1f2Lmonnbpgnv20200828[CMIP6.CMIP.MOHC.UKESM1-0-LL.piControl.r1i1p1f...
1CMIP6CMIPMRIMRI-ESM2-01pctCO2r1i2p1f1Omonfgco2gnv20210311[CMIP6.CMIP.MRI.MRI-ESM2-0.1pctCO2.r1i2p1f1.Om...
2CMIP6CMIPMPI-MMPI-ESM1-2-LRpiControlr1i1p1f1Omonfgco2gnv20190710[CMIP6.CMIP.MPI-M.MPI-ESM1-2-LR.piControl.r1i1...
3CMIP6CMIPNCARCESM2-FV2piControlr1i1p1f1Amontasgnv20191120[CMIP6.CMIP.NCAR.CESM2-FV2.piControl.r1i1p1f1....
4CMIP6CMIPNOAA-GFDLGFDL-CM41pctCO2r1i1p1f1Amontasgr1v20180701[CMIP6.CMIP.NOAA-GFDL.GFDL-CM4.1pctCO2.r1i1p1f...
....................................
1304CMIP6CMIPNASA-GISSGISS-E2-1-G1pctCO2r102i1p1f1Lmonnbpgnv20190815[CMIP6.CMIP.NASA-GISS.GISS-E2-1-G.1pctCO2.r102...
1309CMIP6CMIPMRIMRI-ESM2-01pctCO2r1i2p1f1Amontasgnv20191205[CMIP6.CMIP.MRI.MRI-ESM2-0.1pctCO2.r1i2p1f1.Am...
2048CMIP6CMIPMIROCMIROC-ES2HpiControlr1i1p4f2Omonfgco2gr1v20230904[CMIP6.CMIP.MIROC.MIROC-ES2H.piControl.r1i1p4f...
2050CMIP6CMIPE3SM-ProjectE3SM-2-0-NARRM1pctCO2r1i1p1f1Amontasgrv20230427[CMIP6.CMIP.E3SM-Project.E3SM-2-0-NARRM.1pctCO...
2051CMIP6CMIPE3SM-ProjectE3SM-2-0-NARRMpiControlr1i1p1f1Amontasgrv20230505[CMIP6.CMIP.E3SM-Project.E3SM-2-0-NARRM.piCont...
\n", + "

399 rows × 11 columns

\n", + "
" + ], + "text/plain": [ + " mip_era activity_id institution_id source_id experiment_id \\\n", + "0 CMIP6 CMIP MOHC UKESM1-0-LL piControl \n", + "1 CMIP6 CMIP MRI MRI-ESM2-0 1pctCO2 \n", + "2 CMIP6 CMIP MPI-M MPI-ESM1-2-LR piControl \n", + "3 CMIP6 CMIP NCAR CESM2-FV2 piControl \n", + "4 CMIP6 CMIP NOAA-GFDL GFDL-CM4 1pctCO2 \n", + "... ... ... ... ... ... \n", + "1304 CMIP6 CMIP NASA-GISS GISS-E2-1-G 1pctCO2 \n", + "1309 CMIP6 CMIP MRI MRI-ESM2-0 1pctCO2 \n", + "2048 CMIP6 CMIP MIROC MIROC-ES2H piControl \n", + "2050 CMIP6 CMIP E3SM-Project E3SM-2-0-NARRM 1pctCO2 \n", + "2051 CMIP6 CMIP E3SM-Project E3SM-2-0-NARRM piControl \n", + "\n", + " member_id table_id variable_id grid_label version \\\n", + "0 r1i1p1f2 Lmon nbp gn v20200828 \n", + "1 r1i2p1f1 Omon fgco2 gn v20210311 \n", + "2 r1i1p1f1 Omon fgco2 gn v20190710 \n", + "3 r1i1p1f1 Amon tas gn v20191120 \n", + "4 r1i1p1f1 Amon tas gr1 v20180701 \n", + "... ... ... ... ... ... \n", + "1304 r102i1p1f1 Lmon nbp gn v20190815 \n", + "1309 r1i2p1f1 Amon tas gn v20191205 \n", + "2048 r1i1p4f2 Omon fgco2 gr1 v20230904 \n", + "2050 r1i1p1f1 Amon tas gr v20230427 \n", + "2051 r1i1p1f1 Amon tas gr v20230505 \n", + "\n", + " id \n", + "0 [CMIP6.CMIP.MOHC.UKESM1-0-LL.piControl.r1i1p1f... \n", + "1 [CMIP6.CMIP.MRI.MRI-ESM2-0.1pctCO2.r1i2p1f1.Om... \n", + "2 [CMIP6.CMIP.MPI-M.MPI-ESM1-2-LR.piControl.r1i1... \n", + "3 [CMIP6.CMIP.NCAR.CESM2-FV2.piControl.r1i1p1f1.... \n", + "4 [CMIP6.CMIP.NOAA-GFDL.GFDL-CM4.1pctCO2.r1i1p1f... \n", + "... ... \n", + "1304 [CMIP6.CMIP.NASA-GISS.GISS-E2-1-G.1pctCO2.r102... \n", + "1309 [CMIP6.CMIP.MRI.MRI-ESM2-0.1pctCO2.r1i2p1f1.Am... \n", + "2048 [CMIP6.CMIP.MIROC.MIROC-ES2H.piControl.r1i1p4f... \n", + "2050 [CMIP6.CMIP.E3SM-Project.E3SM-2-0-NARRM.1pctCO... \n", + "2051 [CMIP6.CMIP.E3SM-Project.E3SM-2-0-NARRM.piCont... \n", + "\n", + "[399 rows x 11 columns]" + ] + }, + "execution_count": 6, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "cat.df" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## Model Groups\n", + "\n", + "However, `intake-esgf` also provides you with some tools to help locate relevant data for your analysis. When conducting these kinds of analyses, we are seeking for unique combinations of a `source_id`, `member_id`, and `grid_label` that have all the variables that we need. We call these *model groups*. In an ESGF search, it is common to find a model that has, for example, a `tas` for `r1i1p1f1` but not a `fgco2`. Sorting this out is time consuming and labor intensive. So first, we provide you a function to print out all model groups with the following function." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cat.model_groups().to_frame()" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "The function `model_groups()` returns a pandas Series (converted to a dataframe here for printing) with all unique combinations of (`source_id`,`member_id`,`grid_label`) along with the dataset count for each. This helps illustrate why it can be so difficult to locate all the data relevant to a given analysis. At the time of this writing, there are 148 model groups but relatively few of them with all 6 (2 experiments and 3 variables) datasets that we need. Furthermore, you cannot rely on a model group using `r1i1p1f1` for its primary result. The results above show that UKESM does not even use `f1` at all, further complicating the process of finding results.\n", + "\n", + "In addition to this notion of *model groups*, `intake-esgf` provides you a method `remove_incomplete()` for determing which model groups you wish to keep in the current search. Internally, we will group the search results dataframe by model groups and apply a function of your design to the grouped portion of the dataframe. For example, for the current work, I could just check that there are 6 datasets in the sub-dataframe." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "def shall_i_keep_it(sub_df):\n", + " if len(sub_df) == 6:\n", + " return True\n", + " return False\n", + "\n", + "\n", + "cat.remove_incomplete(shall_i_keep_it)\n", + "cat.model_groups().to_frame()" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "You could write a much more complex check--it depends on what is relevant to your analysis. The effect is that the list of possible models with consistent results is now much more manageable. This method has the added benefit of forcing the user to be concrete about which models were included in an analysis.\n", + "\n", + "## Removing Additional Variants\n", + "\n", + "It may also be that you wish to only include a single `member_id` in your analysis. The above search shows we have a few models with multiple variants that have all 6 required datasets. To be fair to those that only have 1, you may wish to only keep the *smallest* variant. We also provide this function as part of the `ESGFCatalog` object.\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cat.remove_ensembles()\n", + "cat.model_groups().to_frame()" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## Summary\n", + "\n", + "At this point, you would be ready to use `to_dataset_dict()` to download and load all datasets into a dictionary for analysis. The point of this notebook however is to expose the search capabilities. It is our goal to make annoying and time-consuming tasks easier by providing you smart interfaces for common operations. Let us [know](https://github.com/esgf2-us/intake-esgf/issues) what else is painful for you in locating relevant data for your science." + ] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python 3 (ipykernel)", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.9.15" + } + }, + "nbformat": 4, + "nbformat_minor": 2 +} diff --git a/_preview/4/_sources/notebooks/enso-globus.ipynb b/_preview/4/_sources/notebooks/enso-globus.ipynb new file mode 100644 index 0000000..d33eeda --- /dev/null +++ b/_preview/4/_sources/notebooks/enso-globus.ipynb @@ -0,0 +1,1104 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "id": "48c69fff-ab3b-49c8-b85b-95fef1250249", + "metadata": {}, + "source": [ + "\"Globus\n", + "\"ESGF" + ] + }, + { + "cell_type": "markdown", + "id": "483dcdb6-e125-4a52-a21f-55cfe1000dea", + "metadata": {}, + "source": [ + "# ENSO Calculations using Globus Compute" + ] + }, + { + "cell_type": "markdown", + "id": "4a415308-0e9a-470c-bb68-da75b349c006", + "metadata": {}, + "source": [ + "## Overview\n", + "\n", + "In this workflow, we combine topics covered in previous Pythia Foundations and CMIP6 Cookbook content to compute the [Niño 3.4 Index](https://climatedataguide.ucar.edu/climate-data/nino-sst-indices-nino-12-3-34-4-oni-and-tni) to multiple datasets, with the primary computations occuring on a remote machine. As a refresher of what the ENSO 3.4 index is, please see the following text, which is also included in the [ENSO Xarray](https://foundations.projectpythia.org/core/xarray/enso-xarray.html) content in the Pythia Foundations content.\n", + "\n", + "> Niño 3.4 (5N-5S, 170W-120W): The Niño 3.4 anomalies may be thought of as representing the average equatorial SSTs across the Pacific from about the dateline to the South American coast. The Niño 3.4 index typically uses a 5-month running mean, and El Niño or La Niña events are defined when the Niño 3.4 SSTs exceed +/- 0.4C for a period of six months or more.\n", + "\n", + "> Niño X Index computation: a) Compute area averaged total SST from Niño X region; b) Compute monthly climatology (e.g., 1950-1979) for area averaged total SST from Niño X region, and subtract climatology from area averaged total SST time series to obtain anomalies; c) Smooth the anomalies with a 5-month running mean; d) Normalize the smoothed values by its standard deviation over the climatological period.\n", + "\n", + "![](https://www.ncdc.noaa.gov/monitoring-content/teleconnections/nino-regions.gif)\n", + "\n", + "The previous cookbook, we ran this in a single notebook locally. In this example, we aim to execute the workflow on a remote machine, with only the visualizion of the dataset occuring locally.\n", + "\n", + "The overall goal of this tutorial is to introduce the idea of functions as a service with Globus, and how this can be used to calculate ENSO indices." + ] + }, + { + "cell_type": "markdown", + "id": "2d4c6aed-a9c5-4d29-bfa3-c8e8be230567", + "metadata": {}, + "source": [ + "## Prerequisites\n", + "\n", + "| Concepts | Importance | Notes |\n", + "| --- | --- | --- |\n", + "| [Intro to Xarray](https://foundations.projectpythia.org/core/xarray/xarray-intro.html) | Necessary | |\n", + "| [hvPlot Basics](https://hvplot.holoviz.org/getting_started/hvplot.html) | Necessary | Interactive Visualization with hvPlot |\n", + "| [Understanding of NetCDF](https://foundations.projectpythia.org/core/data-formats/netcdf-cf.html) | Helpful | Familiarity with metadata structure |\n", + "| [Calculating ENSO with Xarray](https://foundations.projectpythia.org/core/xarray/enso-xarray.html) | Neccessary | Understanding of Masking and Xarray Functions |\n", + "| Dask | Helpful | |\n", + "\n", + "- **Time to learn**: 30 minutes" + ] + }, + { + "cell_type": "markdown", + "id": "7ff38f37-8f14-443f-b0c7-188baf75d1be", + "metadata": {}, + "source": [ + "## Imports" + ] + }, + { + "cell_type": "code", + "execution_count": 131, + "id": "52bcfa1a-3907-446d-b384-29e97b5c8cb9", + "metadata": { + "tags": [] + }, + "outputs": [ + { + "data": { + "application/javascript": "(function(root) {\n function now() {\n return new Date();\n }\n\n var force = true;\n var py_version = '3.1.1'.replace('rc', '-rc.');\n var is_dev = py_version.indexOf(\"+\") !== -1 || py_version.indexOf(\"-\") !== -1;\n var reloading = false;\n var Bokeh = root.Bokeh;\n var bokeh_loaded = Bokeh != null && (Bokeh.version === py_version || (Bokeh.versions !== undefined && Bokeh.versions.has(py_version)));\n\n if (typeof (root._bokeh_timeout) === \"undefined\" || force) {\n root._bokeh_timeout = Date.now() + 5000;\n root._bokeh_failed_load = false;\n }\n\n function run_callbacks() {\n try {\n root._bokeh_onload_callbacks.forEach(function(callback) {\n if (callback != null)\n callback();\n });\n } finally {\n delete root._bokeh_onload_callbacks;\n }\n console.debug(\"Bokeh: all callbacks have finished\");\n }\n\n function load_libs(css_urls, js_urls, js_modules, js_exports, callback) {\n if (css_urls == null) css_urls = [];\n if (js_urls == null) js_urls = [];\n if (js_modules == null) js_modules = [];\n if (js_exports == null) js_exports = {};\n\n root._bokeh_onload_callbacks.push(callback);\n\n if (root._bokeh_is_loading > 0) {\n console.debug(\"Bokeh: BokehJS is being loaded, scheduling callback at\", now());\n return null;\n }\n if (js_urls.length === 0 && js_modules.length === 0 && Object.keys(js_exports).length === 0) {\n run_callbacks();\n return null;\n }\n if (!reloading) {\n console.debug(\"Bokeh: BokehJS not loaded, scheduling load and callback at\", now());\n }\n\n function on_load() {\n root._bokeh_is_loading--;\n if (root._bokeh_is_loading === 0) {\n console.debug(\"Bokeh: all BokehJS libraries/stylesheets loaded\");\n run_callbacks()\n }\n }\n window._bokeh_on_load = on_load\n\n function on_error() {\n console.error(\"failed to load \" + url);\n }\n\n var skip = [];\n if (window.requirejs) {\n window.requirejs.config({'packages': {}, 'paths': {'jspanel': 'https://cdn.jsdelivr.net/npm/jspanel4@4.12.0/dist/jspanel', 'jspanel-modal': 'https://cdn.jsdelivr.net/npm/jspanel4@4.12.0/dist/extensions/modal/jspanel.modal', 'jspanel-tooltip': 'https://cdn.jsdelivr.net/npm/jspanel4@4.12.0/dist/extensions/tooltip/jspanel.tooltip', 'jspanel-hint': 'https://cdn.jsdelivr.net/npm/jspanel4@4.12.0/dist/extensions/hint/jspanel.hint', 'jspanel-layout': 'https://cdn.jsdelivr.net/npm/jspanel4@4.12.0/dist/extensions/layout/jspanel.layout', 'jspanel-contextmenu': 'https://cdn.jsdelivr.net/npm/jspanel4@4.12.0/dist/extensions/contextmenu/jspanel.contextmenu', 'jspanel-dock': 'https://cdn.jsdelivr.net/npm/jspanel4@4.12.0/dist/extensions/dock/jspanel.dock', 'gridstack': 'https://cdn.jsdelivr.net/npm/gridstack@7.2.3/dist/gridstack-all', 'notyf': 'https://cdn.jsdelivr.net/npm/notyf@3/notyf.min'}, 'shim': {'jspanel': {'exports': 'jsPanel'}, 'gridstack': {'exports': 'GridStack'}}});\n require([\"jspanel\"], function(jsPanel) {\n\twindow.jsPanel = jsPanel\n\ton_load()\n })\n require([\"jspanel-modal\"], function() {\n\ton_load()\n })\n require([\"jspanel-tooltip\"], function() {\n\ton_load()\n })\n require([\"jspanel-hint\"], function() {\n\ton_load()\n })\n require([\"jspanel-layout\"], function() {\n\ton_load()\n })\n require([\"jspanel-contextmenu\"], function() {\n\ton_load()\n })\n require([\"jspanel-dock\"], function() {\n\ton_load()\n })\n require([\"gridstack\"], function(GridStack) {\n\twindow.GridStack = GridStack\n\ton_load()\n })\n require([\"notyf\"], function() {\n\ton_load()\n })\n root._bokeh_is_loading = css_urls.length + 9;\n } else {\n root._bokeh_is_loading = css_urls.length + js_urls.length + js_modules.length + Object.keys(js_exports).length;\n }\n\n var existing_stylesheets = []\n var links = document.getElementsByTagName('link')\n for (var i = 0; i < links.length; i++) {\n var link = links[i]\n if (link.href != null) {\n\texisting_stylesheets.push(link.href)\n }\n }\n for (var i = 0; i < css_urls.length; i++) {\n var url = css_urls[i];\n if (existing_stylesheets.indexOf(url) !== -1) {\n\ton_load()\n\tcontinue;\n }\n const element = document.createElement(\"link\");\n element.onload = on_load;\n element.onerror = on_error;\n element.rel = \"stylesheet\";\n element.type = \"text/css\";\n element.href = url;\n console.debug(\"Bokeh: injecting link tag for BokehJS stylesheet: \", url);\n document.body.appendChild(element);\n } if (((window['jsPanel'] !== undefined) && (!(window['jsPanel'] instanceof HTMLElement))) || window.requirejs) {\n var urls = ['https://cdn.holoviz.org/panel/1.1.0/dist/bundled/floatpanel/jspanel4@4.12.0/dist/jspanel.js', 'https://cdn.holoviz.org/panel/1.1.0/dist/bundled/floatpanel/jspanel4@4.12.0/dist/extensions/modal/jspanel.modal.js', 'https://cdn.holoviz.org/panel/1.1.0/dist/bundled/floatpanel/jspanel4@4.12.0/dist/extensions/tooltip/jspanel.tooltip.js', 'https://cdn.holoviz.org/panel/1.1.0/dist/bundled/floatpanel/jspanel4@4.12.0/dist/extensions/hint/jspanel.hint.js', 'https://cdn.holoviz.org/panel/1.1.0/dist/bundled/floatpanel/jspanel4@4.12.0/dist/extensions/layout/jspanel.layout.js', 'https://cdn.holoviz.org/panel/1.1.0/dist/bundled/floatpanel/jspanel4@4.12.0/dist/extensions/contextmenu/jspanel.contextmenu.js', 'https://cdn.holoviz.org/panel/1.1.0/dist/bundled/floatpanel/jspanel4@4.12.0/dist/extensions/dock/jspanel.dock.js'];\n for (var i = 0; i < urls.length; i++) {\n skip.push(urls[i])\n }\n } if (((window['GridStack'] !== undefined) && (!(window['GridStack'] instanceof HTMLElement))) || window.requirejs) {\n var urls = ['https://cdn.holoviz.org/panel/1.1.0/dist/bundled/gridstack/gridstack@7.2.3/dist/gridstack-all.js'];\n for (var i = 0; i < urls.length; i++) {\n skip.push(urls[i])\n }\n } if (((window['Notyf'] !== undefined) && (!(window['Notyf'] instanceof HTMLElement))) || window.requirejs) {\n var urls = ['https://cdn.holoviz.org/panel/1.1.0/dist/bundled/notificationarea/notyf@3/notyf.min.js'];\n for (var i = 0; i < urls.length; i++) {\n skip.push(urls[i])\n }\n } var existing_scripts = []\n var scripts = document.getElementsByTagName('script')\n for (var i = 0; i < scripts.length; i++) {\n var script = scripts[i]\n if (script.src != null) {\n\texisting_scripts.push(script.src)\n }\n }\n for (var i = 0; i < js_urls.length; i++) {\n var url = js_urls[i];\n if (skip.indexOf(url) !== -1 || existing_scripts.indexOf(url) !== -1) {\n\tif (!window.requirejs) {\n\t on_load();\n\t}\n\tcontinue;\n }\n var element = document.createElement('script');\n element.onload = on_load;\n element.onerror = on_error;\n element.async = false;\n element.src = url;\n console.debug(\"Bokeh: injecting script tag for BokehJS library: \", url);\n document.head.appendChild(element);\n }\n for (var i = 0; i < js_modules.length; i++) {\n var url = js_modules[i];\n if (skip.indexOf(url) !== -1 || existing_scripts.indexOf(url) !== -1) {\n\tif (!window.requirejs) {\n\t on_load();\n\t}\n\tcontinue;\n }\n var element = document.createElement('script');\n element.onload = on_load;\n element.onerror = on_error;\n element.async = false;\n element.src = url;\n element.type = \"module\";\n console.debug(\"Bokeh: injecting script tag for BokehJS library: \", url);\n document.head.appendChild(element);\n }\n for (const name in js_exports) {\n var url = js_exports[name];\n if (skip.indexOf(url) >= 0 || root[name] != null) {\n\tif (!window.requirejs) {\n\t on_load();\n\t}\n\tcontinue;\n }\n var element = document.createElement('script');\n element.onerror = on_error;\n element.async = false;\n element.type = \"module\";\n console.debug(\"Bokeh: injecting script tag for BokehJS library: \", url);\n element.textContent = `\n import ${name} from \"${url}\"\n window.${name} = ${name}\n window._bokeh_on_load()\n `\n document.head.appendChild(element);\n }\n if (!js_urls.length && !js_modules.length) {\n on_load()\n }\n };\n\n function inject_raw_css(css) {\n const element = document.createElement(\"style\");\n element.appendChild(document.createTextNode(css));\n document.body.appendChild(element);\n }\n\n var js_urls = [\"https://cdn.bokeh.org/bokeh/release/bokeh-3.1.1.min.js\", \"https://cdn.bokeh.org/bokeh/release/bokeh-gl-3.1.1.min.js\", \"https://cdn.bokeh.org/bokeh/release/bokeh-widgets-3.1.1.min.js\", \"https://cdn.bokeh.org/bokeh/release/bokeh-tables-3.1.1.min.js\", \"https://cdn.holoviz.org/panel/1.1.0/dist/panel.min.js\"];\n var js_modules = [];\n var js_exports = {};\n var css_urls = [];\n var inline_js = [ function(Bokeh) {\n Bokeh.set_log_level(\"info\");\n },\nfunction(Bokeh) {} // ensure no trailing comma for IE\n ];\n\n function run_inline_js() {\n if ((root.Bokeh !== undefined) || (force === true)) {\n for (var i = 0; i < inline_js.length; i++) {\n inline_js[i].call(root, root.Bokeh);\n }\n // Cache old bokeh versions\n if (Bokeh != undefined && !reloading) {\n\tvar NewBokeh = root.Bokeh;\n\tif (Bokeh.versions === undefined) {\n\t Bokeh.versions = new Map();\n\t}\n\tif (NewBokeh.version !== Bokeh.version) {\n\t Bokeh.versions.set(NewBokeh.version, NewBokeh)\n\t}\n\troot.Bokeh = Bokeh;\n }} else if (Date.now() < root._bokeh_timeout) {\n setTimeout(run_inline_js, 100);\n } else if (!root._bokeh_failed_load) {\n console.log(\"Bokeh: BokehJS failed to load within specified timeout.\");\n root._bokeh_failed_load = true;\n }\n root._bokeh_is_initializing = false\n }\n\n function load_or_wait() {\n // Implement a backoff loop that tries to ensure we do not load multiple\n // versions of Bokeh and its dependencies at the same time.\n // In recent versions we use the root._bokeh_is_initializing flag\n // to determine whether there is an ongoing attempt to initialize\n // bokeh, however for backward compatibility we also try to ensure\n // that we do not start loading a newer (Panel>=1.0 and Bokeh>3) version\n // before older versions are fully initialized.\n if (root._bokeh_is_initializing && Date.now() > root._bokeh_timeout) {\n root._bokeh_is_initializing = false;\n root._bokeh_onload_callbacks = undefined;\n console.log(\"Bokeh: BokehJS was loaded multiple times but one version failed to initialize.\");\n load_or_wait();\n } else if (root._bokeh_is_initializing || (typeof root._bokeh_is_initializing === \"undefined\" && root._bokeh_onload_callbacks !== undefined)) {\n setTimeout(load_or_wait, 100);\n } else {\n Bokeh = root.Bokeh;\n bokeh_loaded = Bokeh != null && (Bokeh.version === py_version || (Bokeh.versions !== undefined && Bokeh.versions.has(py_version)));\n root._bokeh_is_initializing = true\n root._bokeh_onload_callbacks = []\n if (!reloading && (!bokeh_loaded || is_dev)) {\n\troot.Bokeh = undefined;\n }\n load_libs(css_urls, js_urls, js_modules, js_exports, function() {\n\tconsole.debug(\"Bokeh: BokehJS plotting callback run at\", now());\n\trun_inline_js();\n });\n }\n }\n // Give older versions of the autoload script a head-start to ensure\n // they initialize before we start loading newer version.\n setTimeout(load_or_wait, 100)\n}(window));", + "application/vnd.holoviews_load.v0+json": "" + }, + "metadata": {}, + "output_type": "display_data" + }, + { + "data": { + "application/javascript": "\nif ((window.PyViz === undefined) || (window.PyViz instanceof HTMLElement)) {\n window.PyViz = {comms: {}, comm_status:{}, kernels:{}, receivers: {}, plot_index: []}\n}\n\n\n function JupyterCommManager() {\n }\n\n JupyterCommManager.prototype.register_target = function(plot_id, comm_id, msg_handler) {\n if (window.comm_manager || ((window.Jupyter !== undefined) && (Jupyter.notebook.kernel != null))) {\n var comm_manager = window.comm_manager || Jupyter.notebook.kernel.comm_manager;\n comm_manager.register_target(comm_id, function(comm) {\n comm.on_msg(msg_handler);\n });\n } else if ((plot_id in window.PyViz.kernels) && (window.PyViz.kernels[plot_id])) {\n window.PyViz.kernels[plot_id].registerCommTarget(comm_id, function(comm) {\n comm.onMsg = msg_handler;\n });\n } else if (typeof google != 'undefined' && google.colab.kernel != null) {\n google.colab.kernel.comms.registerTarget(comm_id, (comm) => {\n var messages = comm.messages[Symbol.asyncIterator]();\n function processIteratorResult(result) {\n var message = result.value;\n console.log(message)\n var content = {data: message.data, comm_id};\n var buffers = []\n for (var buffer of message.buffers || []) {\n buffers.push(new DataView(buffer))\n }\n var metadata = message.metadata || {};\n var msg = {content, buffers, metadata}\n msg_handler(msg);\n return messages.next().then(processIteratorResult);\n }\n return messages.next().then(processIteratorResult);\n })\n }\n }\n\n JupyterCommManager.prototype.get_client_comm = function(plot_id, comm_id, msg_handler) {\n if (comm_id in window.PyViz.comms) {\n return window.PyViz.comms[comm_id];\n } else if (window.comm_manager || ((window.Jupyter !== undefined) && (Jupyter.notebook.kernel != null))) {\n var comm_manager = window.comm_manager || Jupyter.notebook.kernel.comm_manager;\n var comm = comm_manager.new_comm(comm_id, {}, {}, {}, comm_id);\n if (msg_handler) {\n comm.on_msg(msg_handler);\n }\n } else if ((plot_id in window.PyViz.kernels) && (window.PyViz.kernels[plot_id])) {\n var comm = window.PyViz.kernels[plot_id].connectToComm(comm_id);\n comm.open();\n if (msg_handler) {\n comm.onMsg = msg_handler;\n }\n } else if (typeof google != 'undefined' && google.colab.kernel != null) {\n var comm_promise = google.colab.kernel.comms.open(comm_id)\n comm_promise.then((comm) => {\n window.PyViz.comms[comm_id] = comm;\n if (msg_handler) {\n var messages = comm.messages[Symbol.asyncIterator]();\n function processIteratorResult(result) {\n var message = result.value;\n var content = {data: message.data};\n var metadata = message.metadata || {comm_id};\n var msg = {content, metadata}\n msg_handler(msg);\n return messages.next().then(processIteratorResult);\n }\n return messages.next().then(processIteratorResult);\n }\n }) \n var sendClosure = (data, metadata, buffers, disposeOnDone) => {\n return comm_promise.then((comm) => {\n comm.send(data, metadata, buffers, disposeOnDone);\n });\n };\n var comm = {\n send: sendClosure\n };\n }\n window.PyViz.comms[comm_id] = comm;\n return comm;\n }\n window.PyViz.comm_manager = new JupyterCommManager();\n \n\n\nvar JS_MIME_TYPE = 'application/javascript';\nvar HTML_MIME_TYPE = 'text/html';\nvar EXEC_MIME_TYPE = 'application/vnd.holoviews_exec.v0+json';\nvar CLASS_NAME = 'output';\n\n/**\n * Render data to the DOM node\n */\nfunction render(props, node) {\n var div = document.createElement(\"div\");\n var script = document.createElement(\"script\");\n node.appendChild(div);\n node.appendChild(script);\n}\n\n/**\n * Handle when a new output is added\n */\nfunction handle_add_output(event, handle) {\n var output_area = handle.output_area;\n var output = handle.output;\n if ((output.data == undefined) || (!output.data.hasOwnProperty(EXEC_MIME_TYPE))) {\n return\n }\n var id = output.metadata[EXEC_MIME_TYPE][\"id\"];\n var toinsert = output_area.element.find(\".\" + CLASS_NAME.split(' ')[0]);\n if (id !== undefined) {\n var nchildren = toinsert.length;\n var html_node = toinsert[nchildren-1].children[0];\n html_node.innerHTML = output.data[HTML_MIME_TYPE];\n var scripts = [];\n var nodelist = html_node.querySelectorAll(\"script\");\n for (var i in nodelist) {\n if (nodelist.hasOwnProperty(i)) {\n scripts.push(nodelist[i])\n }\n }\n\n scripts.forEach( function (oldScript) {\n var newScript = document.createElement(\"script\");\n var attrs = [];\n var nodemap = oldScript.attributes;\n for (var j in nodemap) {\n if (nodemap.hasOwnProperty(j)) {\n attrs.push(nodemap[j])\n }\n }\n attrs.forEach(function(attr) { newScript.setAttribute(attr.name, attr.value) });\n newScript.appendChild(document.createTextNode(oldScript.innerHTML));\n oldScript.parentNode.replaceChild(newScript, oldScript);\n });\n if (JS_MIME_TYPE in output.data) {\n toinsert[nchildren-1].children[1].textContent = output.data[JS_MIME_TYPE];\n }\n output_area._hv_plot_id = id;\n if ((window.Bokeh !== undefined) && (id in Bokeh.index)) {\n window.PyViz.plot_index[id] = Bokeh.index[id];\n } else {\n window.PyViz.plot_index[id] = null;\n }\n } else if (output.metadata[EXEC_MIME_TYPE][\"server_id\"] !== undefined) {\n var bk_div = document.createElement(\"div\");\n bk_div.innerHTML = output.data[HTML_MIME_TYPE];\n var script_attrs = bk_div.children[0].attributes;\n for (var i = 0; i < script_attrs.length; i++) {\n toinsert[toinsert.length - 1].childNodes[1].setAttribute(script_attrs[i].name, script_attrs[i].value);\n }\n // store reference to server id on output_area\n output_area._bokeh_server_id = output.metadata[EXEC_MIME_TYPE][\"server_id\"];\n }\n}\n\n/**\n * Handle when an output is cleared or removed\n */\nfunction handle_clear_output(event, handle) {\n var id = handle.cell.output_area._hv_plot_id;\n var server_id = handle.cell.output_area._bokeh_server_id;\n if (((id === undefined) || !(id in PyViz.plot_index)) && (server_id !== undefined)) { return; }\n var comm = window.PyViz.comm_manager.get_client_comm(\"hv-extension-comm\", \"hv-extension-comm\", function () {});\n if (server_id !== null) {\n comm.send({event_type: 'server_delete', 'id': server_id});\n return;\n } else if (comm !== null) {\n comm.send({event_type: 'delete', 'id': id});\n }\n delete PyViz.plot_index[id];\n if ((window.Bokeh !== undefined) & (id in window.Bokeh.index)) {\n var doc = window.Bokeh.index[id].model.document\n doc.clear();\n const i = window.Bokeh.documents.indexOf(doc);\n if (i > -1) {\n window.Bokeh.documents.splice(i, 1);\n }\n }\n}\n\n/**\n * Handle kernel restart event\n */\nfunction handle_kernel_cleanup(event, handle) {\n delete PyViz.comms[\"hv-extension-comm\"];\n window.PyViz.plot_index = {}\n}\n\n/**\n * Handle update_display_data messages\n */\nfunction handle_update_output(event, handle) {\n handle_clear_output(event, {cell: {output_area: handle.output_area}})\n handle_add_output(event, handle)\n}\n\nfunction register_renderer(events, OutputArea) {\n function append_mime(data, metadata, element) {\n // create a DOM node to render to\n var toinsert = this.create_output_subarea(\n metadata,\n CLASS_NAME,\n EXEC_MIME_TYPE\n );\n this.keyboard_manager.register_events(toinsert);\n // Render to node\n var props = {data: data, metadata: metadata[EXEC_MIME_TYPE]};\n render(props, toinsert[0]);\n element.append(toinsert);\n return toinsert\n }\n\n events.on('output_added.OutputArea', handle_add_output);\n events.on('output_updated.OutputArea', handle_update_output);\n events.on('clear_output.CodeCell', handle_clear_output);\n events.on('delete.Cell', handle_clear_output);\n events.on('kernel_ready.Kernel', handle_kernel_cleanup);\n\n OutputArea.prototype.register_mime_type(EXEC_MIME_TYPE, append_mime, {\n safe: true,\n index: 0\n });\n}\n\nif (window.Jupyter !== undefined) {\n try {\n var events = require('base/js/events');\n var OutputArea = require('notebook/js/outputarea').OutputArea;\n if (OutputArea.prototype.mime_types().indexOf(EXEC_MIME_TYPE) == -1) {\n register_renderer(events, OutputArea);\n }\n } catch(err) {\n }\n}\n", + "application/vnd.holoviews_load.v0+json": "" + }, + "metadata": {}, + "output_type": "display_data" + }, + { + "data": { + "text/html": [ + "" + ] + }, + "metadata": {}, + "output_type": "display_data" + }, + { + "data": { + "text/html": [ + "\n", + "
\n", + "\n", + "\n", + "\n", + " \n", + " \n", + "\n", + "\n", + "\n", + "\n", + "
\n" + ] + }, + "metadata": {}, + "output_type": "display_data" + } + ], + "source": [ + "import hvplot.xarray\n", + "import holoviews as hv\n", + "import numpy as np\n", + "import hvplot.xarray\n", + "import matplotlib.pyplot as plt\n", + "import cartopy.crs as ccrs\n", + "from intake_esgf import ESGFCatalog\n", + "import xarray as xr\n", + "import cf_xarray\n", + "import warnings\n", + "import os\n", + "from globus_compute_sdk import Executor, Client\n", + "warnings.filterwarnings(\"ignore\")\n", + "\n", + "hv.extension(\"bokeh\")" + ] + }, + { + "cell_type": "markdown", + "id": "252748e9-c3a4-4018-8b9b-c26c40465faf", + "metadata": {}, + "source": [ + "## Accessing our Data and Computing the ENSO 3.4 Index\n", + "As mentioned in the introduction, we are utilizing functions from the previous ENSO notebooks. In order to run these with Globus Compute, we need to comply with the following requirements\n", + "- All libraries/packages used in the function need to be installed on the globus compute endpoint\n", + "- All functions/libraries/packages need to be imported and defined within the function to execute\n", + "- The output from the function needs to serializable (ex. xarray.Dataset, numpy.array)\n", + "\n", + "Using these constraints, we setup the following function, with the key parameter being which modeling center (model) to compare. Two examples here include The National Center for Atmospheric Research (NCAR) and the Model for Interdisciplinary Research on Climate (MIROC)." + ] + }, + { + "cell_type": "code", + "execution_count": 121, + "id": "2b74d939-f87d-4a44-9e4a-6643b7d04fe7", + "metadata": { + "tags": [] + }, + "outputs": [], + "source": [ + "def run_plot_enso(model, return_path=False):\n", + " import numpy as np\n", + " import matplotlib.pyplot as plt\n", + " from intake_esgf import ESGFCatalog\n", + " import xarray as xr\n", + " import cf_xarray\n", + " import warnings\n", + " warnings.filterwarnings(\"ignore\")\n", + "\n", + " def search_esgf(institution_id, grid='gn'):\n", + "\n", + " # Search and load the ocean surface temperature (tos)\n", + " cat = ESGFCatalog()\n", + " cat.search(\n", + " activity_id=\"CMIP\",\n", + " experiment_id=\"historical\",\n", + " institution_id=institution_id,\n", + " variable_id=[\"tos\"],\n", + " member_id='r11i1p1f1',\n", + " table_id=\"Omon\",\n", + " )\n", + " try:\n", + " tos_ds = cat.to_datatree()[grid].to_dataset()\n", + " except ValueError:\n", + " tos_ds = cat.to_dataset_dict()[\"\"]\n", + "\n", + " # Search and load the ocean grid cell area\n", + " cat = ESGFCatalog()\n", + " cat.search(\n", + " activity_id=\"CMIP\",\n", + " experiment_id=\"historical\",\n", + " institution_id=institution_id,\n", + " variable_id=[\"areacello\"],\n", + " member_id='r11i1p1f1',\n", + " )\n", + " try:\n", + " area_ds = cat.to_datatree()[grid].to_dataset()\n", + " except ValueError:\n", + " area_ds = cat.to_dataset_dict()[\"\"]\n", + " return xr.merge([tos_ds, area_ds])\n", + "\n", + " def calculate_enso(ds):\n", + "\n", + " # Subset the El Nino 3.4 index region\n", + " dso = ds.where(\n", + " (ds.cf[\"latitude\"] < 5) & (ds.cf[\"latitude\"] > -5) & (ds.cf[\"longitude\"] > 190) & (ds.cf[\"longitude\"] < 240), drop=True\n", + " )\n", + "\n", + " # Calculate the monthly means\n", + " gb = dso.tos.groupby('time.month')\n", + "\n", + " # Subtract the monthly averages, returning the anomalies\n", + " tos_nino34_anom = gb - gb.mean(dim='time')\n", + "\n", + " # Determine the non-time dimensions and average using these\n", + " non_time_dims = set(tos_nino34_anom.dims)\n", + " non_time_dims.remove(ds.tos.cf[\"T\"].name)\n", + " weighted_average = tos_nino34_anom.weighted(ds[\"areacello\"]).mean(dim=list(non_time_dims))\n", + "\n", + " # Calculate the rolling average\n", + " rolling_average = weighted_average.rolling(time=5, center=True).mean()\n", + " std_dev = weighted_average.std()\n", + " return rolling_average / std_dev\n", + "\n", + " def add_enso_thresholds(da, threshold=0.4):\n", + "\n", + " # Conver the xr.DataArray into an xr.Dataset\n", + " ds = da.to_dataset()\n", + "\n", + " # Cleanup the time and use the thresholds\n", + " try:\n", + " ds[\"time\"]= ds.indexes[\"time\"].to_datetimeindex()\n", + " except:\n", + " pass\n", + " ds[\"tos_gt_04\"] = (\"time\", ds.tos.where(ds.tos >= threshold, threshold).data)\n", + " ds[\"tos_lt_04\"] = (\"time\", ds.tos.where(ds.tos <= -threshold, -threshold).data)\n", + "\n", + " # Add fields for the thresholds\n", + " ds[\"el_nino_threshold\"] = (\"time\", np.zeros_like(ds.tos) + threshold)\n", + " ds[\"la_nina_threshold\"] = (\"time\", np.zeros_like(ds.tos) - threshold)\n", + "\n", + " return ds\n", + " \n", + " ds = search_esgf(\"NCAR\")\n", + " enso_index = add_enso_thresholds(calculate_enso(ds).compute())\n", + " enso_index.attrs = ds.attrs\n", + " enso_index.attrs[\"model\"] = model\n", + "\n", + " return enso_index" + ] + }, + { + "cell_type": "markdown", + "id": "e5ad93de-5473-4579-8ee4-cadd0fbb90b2", + "metadata": {}, + "source": [ + "## Configure Globus Compute\n", + "\n", + "Now that we have our functions, we can move toward using [Globus Flows](https://www.globus.org/globus-flows-service) and [Globus Compute](https://www.globus.org/compute).\n", + "\n", + "Globus Flows is a reliable and secure platform for orchestrating and performing research data management and analysis tasks. A flow is often needed to manage data coming from instruments, e.g., image files can be moved from local storage attached to a microscope to a high-performance storage system where they may be accessed by all members of the research project.\n", + "\n", + "More examples of creating and running flows can be found on our [demo instance](https://jupyter.demo.globus.org/hub/)." + ] + }, + { + "cell_type": "markdown", + "id": "663dfed0-e099-43db-98ad-9eb5021ac69e", + "metadata": {}, + "source": [ + "### Setup a Globus Compute Endpoint\n", + "Globus Compute (GC) is a service that allows **python functions** to be sent to remote points, executed, with the output from that function returned to the user. While there are a collection of endpoints already installed, we highlight in this section the steps required to configure for yourself. This idea is also known as \"serverless\" computing, where users do not need to think about the underlying infrastructure executing the code, but rather submit functions to be run and returned.\n", + "\n", + "To start a GC endpoint at your system you need to login, [configure a conda environment](https://foundations.projectpythia.org/foundations/how-to-run-python.html#installing-and-managing-python-with-conda), and `pip install globus-compute-endpoint`.\n", + "\n", + "You can then run:\n", + "\n", + "```globus-compute-endpoint configure esgf-test```\n", + "\n", + "```globus-compute-endpoint start esgf-test```\n", + "\n", + "Note that by default your endpoint will execute tasks on the login node (if you are using a High Performance Compute System). Additional configuration is needed for the endpoint to provision compute nodes. For example, here is the documentation on configuring globus compute endpoints on the Argonne Leadership Computing Facility's Polaris system\n", + "- https://globus-compute.readthedocs.io/en/latest/endpoints.html#polaris-alcf" + ] + }, + { + "cell_type": "code", + "execution_count": 133, + "id": "fe8d9e8b-e38d-41a5-b5f6-df9916d69f83", + "metadata": { + "tags": [] + }, + "outputs": [], + "source": [ + "endpoint_id = \"b3d1d669-d49b-412e-af81-95f3368e525c\"" + ] + }, + { + "cell_type": "markdown", + "id": "ef408588-1e81-4726-892b-a9b0ad2f38cc", + "metadata": {}, + "source": [ + "### Setup an Executor to Run our Functions\n", + "Once we have our compute endpoint ID, we need to pass this to our executor, which will be used to pass our functions from our local machine to the machine we would like to compute on." + ] + }, + { + "cell_type": "code", + "execution_count": 135, + "id": "0aa43e9e-6840-4b46-9a0c-ceeef8ca7e1e", + "metadata": { + "tags": [] + }, + "outputs": [ + { + "data": { + "text/plain": [ + "Executor" + ] + }, + "execution_count": 135, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "gce = Executor(endpoint_id=endpoint_id)\n", + "gce" + ] + }, + { + "cell_type": "markdown", + "id": "4afe4cec-fca9-40ed-b20a-39061ad1d45a", + "metadata": {}, + "source": [ + "### Test our Functions\n", + "Now that we have our functions prepared, and an executor to run on, we can test them out using our endpoint!\n", + "\n", + "We pass in our function name, and the additional arguments for our functions. For example, let's look at comparing at the NCAR and MIROC modeling center's CMIP6 simulations." + ] + }, + { + "cell_type": "code", + "execution_count": 136, + "id": "664c9fd2-8822-4e34-9c2b-8558c489e487", + "metadata": { + "tags": [] + }, + "outputs": [], + "source": [ + "ncar_task = gce.submit(run_plot_enso, model='NCAR')\n", + "miroc_task = gce.submit(run_plot_enso, model='MIROC')" + ] + }, + { + "cell_type": "markdown", + "id": "ccffe7fe-f11c-4b43-9b1a-b140eb1aa8a5", + "metadata": {}, + "source": [ + "The results are started as python objects, with the resultant datasets available using `.result()`" + ] + }, + { + "cell_type": "code", + "execution_count": 137, + "id": "6c2f0f35-9847-43bb-8e4c-b42ba5060233", + "metadata": { + "tags": [] + }, + "outputs": [ + { + "data": { + "text/html": [ + "
\n", + "\n", + "\n", + "\n", + "\n", + "\n", + "\n", + "\n", + "\n", + "\n", + "\n", + "\n", + "\n", + "\n", + "\n", + "
<xarray.Dataset>\n",
+       "Dimensions:            (time: 1980)\n",
+       "Coordinates:\n",
+       "  * time               (time) datetime64[ns] 1850-01-15T13:00:00.000008 ... 2...\n",
+       "    month              (time) int64 1 2 3 4 5 6 7 8 9 ... 4 5 6 7 8 9 10 11 12\n",
+       "Data variables:\n",
+       "    tos                (time) float32 nan nan 0.06341 ... 0.7921 nan nan\n",
+       "    tos_gt_04          (time) float32 0.4 0.4 0.4 0.4 ... 0.6829 0.7921 0.4 0.4\n",
+       "    tos_lt_04          (time) float32 -0.4 -0.4 -0.4 -0.4 ... -0.4 -0.4 -0.4\n",
+       "    el_nino_threshold  (time) float32 0.4 0.4 0.4 0.4 0.4 ... 0.4 0.4 0.4 0.4\n",
+       "    la_nina_threshold  (time) float32 -0.4 -0.4 -0.4 -0.4 ... -0.4 -0.4 -0.4\n",
+       "Attributes: (12/46)\n",
+       "    Conventions:            CF-1.7 CMIP-6.2\n",
+       "    activity_id:            CMIP\n",
+       "    branch_method:          standard\n",
+       "    branch_time_in_child:   674885.0\n",
+       "    branch_time_in_parent:  219000.0\n",
+       "    case_id:                972\n",
+       "    ...                     ...\n",
+       "    table_id:               Omon\n",
+       "    tracking_id:            hdl:21.14100/b0ffb89d-095d-4533-a159-a2e1241ff138\n",
+       "    variable_id:            tos\n",
+       "    variant_info:           CMIP6 20th century experiments (1850-2014) with C...\n",
+       "    variant_label:          r11i1p1f1\n",
+       "    model:                  NCAR
" + ], + "text/plain": [ + "\n", + "Dimensions: (time: 1980)\n", + "Coordinates:\n", + " * time (time) datetime64[ns] 1850-01-15T13:00:00.000008 ... 2...\n", + " month (time) int64 1 2 3 4 5 6 7 8 9 ... 4 5 6 7 8 9 10 11 12\n", + "Data variables:\n", + " tos (time) float32 nan nan 0.06341 ... 0.7921 nan nan\n", + " tos_gt_04 (time) float32 0.4 0.4 0.4 0.4 ... 0.6829 0.7921 0.4 0.4\n", + " tos_lt_04 (time) float32 -0.4 -0.4 -0.4 -0.4 ... -0.4 -0.4 -0.4\n", + " el_nino_threshold (time) float32 0.4 0.4 0.4 0.4 0.4 ... 0.4 0.4 0.4 0.4\n", + " la_nina_threshold (time) float32 -0.4 -0.4 -0.4 -0.4 ... -0.4 -0.4 -0.4\n", + "Attributes: (12/46)\n", + " Conventions: CF-1.7 CMIP-6.2\n", + " activity_id: CMIP\n", + " branch_method: standard\n", + " branch_time_in_child: 674885.0\n", + " branch_time_in_parent: 219000.0\n", + " case_id: 972\n", + " ... ...\n", + " table_id: Omon\n", + " tracking_id: hdl:21.14100/b0ffb89d-095d-4533-a159-a2e1241ff138\n", + " variable_id: tos\n", + " variant_info: CMIP6 20th century experiments (1850-2014) with C...\n", + " variant_label: r11i1p1f1\n", + " model: NCAR" + ] + }, + "execution_count": 137, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "ncar_ds = ncar_task.result()\n", + "miroc_ds = miroc_task.result()\n", + "\n", + "ncar_ds" + ] + }, + { + "cell_type": "markdown", + "id": "f1257d1a-9712-427b-b9ce-4db644420839", + "metadata": {}, + "source": [ + "### Plot our Data\n", + "Now that we have pre-computed datasets, the last step is to visualize the output. In the other example, we stepped through how to utilize the `.hvplot` tool to create interactive displays of ENSO values. We will utilize that functionality here, wrapping into a function." + ] + }, + { + "cell_type": "code", + "execution_count": 138, + "id": "cac34be7-4faa-417c-b607-d8ee094be3e5", + "metadata": { + "tags": [] + }, + "outputs": [], + "source": [ + "def plot_enso(ds):\n", + " el_nino = ds.hvplot.area(x=\"time\", y2='tos_gt_04', y='el_nino_threshold', color='red', hover=False)\n", + " el_nino_label = hv.Text(ds.isel(time=40).time.values, 2, 'El Niño').opts(text_color='red',)\n", + "\n", + " # Create the La Niña area graphs\n", + " la_nina = ds.hvplot.area(x=\"time\", y2='tos_lt_04', y='la_nina_threshold', color='blue', hover=False)\n", + " la_nina_label = hv.Text(ds.isel(time=-40).time.values, -2, 'La Niña').opts(text_color='blue')\n", + "\n", + " # Plot a timeseries of the ENSO 3.4 index\n", + " enso = ds.tos.hvplot(x='time', line_width=0.5, color='k', xlabel='Year', ylabel='ENSO 3.4 Index')\n", + "\n", + " # Combine all the plots into a single plot\n", + " return (el_nino_label * la_nina_label * el_nino * la_nina * enso).opts(title=f'{ds.attrs[\"model\"]} {ds.attrs[\"source_id\"]} \\n Ensemble Member: {ds.attrs[\"variant_label\"]}')" + ] + }, + { + "cell_type": "markdown", + "id": "13492e2d-c32a-4bcc-b341-837d5ea91a1a", + "metadata": {}, + "source": [ + "Once we have the function, we apply to our two datasets and combine into a single column." + ] + }, + { + "cell_type": "code", + "execution_count": 139, + "id": "b6332c80-0ee9-4a4f-a277-95efc2cc8252", + "metadata": { + "tags": [] + }, + "outputs": [ + { + "data": {}, + "metadata": {}, + "output_type": "display_data" + }, + { + "data": { + "application/vnd.holoviews_exec.v0+json": "", + "text/html": [ + "
\n", + "
\n", + "
\n", + "" + ], + "text/plain": [ + ":Layout\n", + " .Overlay.I :Overlay\n", + " .Text.I :Text [x,y]\n", + " .Text.II :Text [x,y]\n", + " .Area.I :Area [time] (el_nino_threshold,tos_gt_04)\n", + " .Area.II :Area [time] (la_nina_threshold,tos_lt_04)\n", + " .Curve.I :Curve [time] (tos)\n", + " .Overlay.II :Overlay\n", + " .Text.I :Text [x,y]\n", + " .Text.II :Text [x,y]\n", + " .Area.I :Area [time] (el_nino_threshold,tos_gt_04)\n", + " .Area.II :Area [time] (la_nina_threshold,tos_lt_04)\n", + " .Curve.I :Curve [time] (tos)" + ] + }, + "execution_count": 139, + "metadata": { + "application/vnd.holoviews_exec.v0+json": { + "id": "59645fce-ca6a-4432-aa0e-77521837d618" + } + }, + "output_type": "execute_result" + } + ], + "source": [ + "(plot_enso(ncar_ds) + plot_enso(miroc_ds)).cols(1)" + ] + }, + { + "cell_type": "markdown", + "id": "b3bfceb9-124a-4d72-9d49-3ca255965e29", + "metadata": {}, + "source": [ + "## Summary\n", + "In this notebook, we applied the ENSO 3.4 index calculations to CMIP6 datasets remotely using Globus Compute and created interactive plots comparing where we see El Niño and La Niña.\n", + "\n", + "### What's next?\n", + "We will see some more advanced examples of using the CMIP6 and other data access methods as well as computations.\n", + "\n", + "## Resources and references\n", + "- [Intake-ESGF Documentation](https://github.com/nocollier/intake-esgf)\n", + "- [Globus Compute Documentation](https://www.globus.org/compute)" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "f5b2864f-6661-4aa4-8d65-8dc10c961b36", + "metadata": {}, + "outputs": [], + "source": [] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python 3 (ipykernel)", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.10.12" + } + }, + "nbformat": 4, + "nbformat_minor": 5 +} diff --git a/_preview/4/_sources/notebooks/how-to-cite.md b/_preview/4/_sources/notebooks/how-to-cite.md new file mode 100644 index 0000000..01390db --- /dev/null +++ b/_preview/4/_sources/notebooks/how-to-cite.md @@ -0,0 +1,7 @@ +# How to Cite This Cookbook + +The material in this Project Pythia Cookbook is licensed for free and open consumption and reuse. All code is served under [Apache 2.0](https://www.apache.org/licenses/LICENSE-2.0), while all non-code content is licensed under [Creative Commons BY 4.0 (CC BY 4.0)](https://creativecommons.org/licenses/by/4.0/). Effectively, this means you are free to share and adapt this material so long as you give appropriate credit to the Cookbook authors and the Project Pythia community. + +The source code for the book is [released on GitHub](https://github.com/ProjectPythia/cookbook-template) and archived on Zenodo. This DOI will always resolve to the latest release of the book source: + +[![DOI](https://zenodo.org/badge/475509405.svg)](https://zenodo.org/badge/latestdoi/475509405) diff --git a/_preview/4/_sources/notebooks/notebook-template.ipynb b/_preview/4/_sources/notebooks/notebook-template.ipynb new file mode 100644 index 0000000..dad9f26 --- /dev/null +++ b/_preview/4/_sources/notebooks/notebook-template.ipynb @@ -0,0 +1,358 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "Let's start here! If you can directly link to an image relevant to your notebook, such as [canonical logos](https://github.com/numpy/numpy/blob/main/doc/source/_static/numpylogo.svg), do so here at the top of your notebook. You can do this with Markdown syntax,\n", + "\n", + "> `![](http://link.com/to/image.png \"image alt text\")`\n", + "\n", + "or edit this cell to see raw HTML `img` demonstration. This is preferred if you need to shrink your embedded image. **Either way be sure to include `alt` text for any embedded images to make your content more accessible.**\n", + "\n", + "\"Project" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "# Project Pythia Notebook Template\n", + "\n", + "Next, title your notebook appropriately with a top-level Markdown header, `#`. Do not use this level header anywhere else in the notebook. Our book build process will use this title in the navbar, table of contents, etc. Keep it short, keep it descriptive. Follow this with a `---` cell to visually distinguish the transition to the prerequisites section." + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "---" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## Overview\n", + "If you have an introductory paragraph, lead with it here! Keep it short and tied to your material, then be sure to continue into the required list of topics below,\n", + "\n", + "1. This is a numbered list of the specific topics\n", + "1. These should map approximately to your main sections of content\n", + "1. Or each second-level, `##`, header in your notebook\n", + "1. Keep the size and scope of your notebook in check\n", + "1. And be sure to let the reader know up front the important concepts they'll be leaving with" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## Prerequisites\n", + "This section was inspired by [this template](https://github.com/alan-turing-institute/the-turing-way/blob/master/book/templates/chapter-template/chapter-landing-page.md) of the wonderful [The Turing Way](https://the-turing-way.netlify.app) Jupyter Book.\n", + "\n", + "Following your overview, tell your reader what concepts, packages, or other background information they'll **need** before learning your material. Tie this explicitly with links to other pages here in Foundations or to relevant external resources. Remove this body text, then populate the Markdown table, denoted in this cell with `|` vertical brackets, below, and fill out the information following. In this table, lay out prerequisite concepts by explicitly linking to other Foundations material or external resources, or describe generally helpful concepts.\n", + "\n", + "Label the importance of each concept explicitly as **helpful/necessary**.\n", + "\n", + "| Concepts | Importance | Notes |\n", + "| --- | --- | --- |\n", + "| [Intro to Cartopy](https://foundations.projectpythia.org/core/cartopy/cartopy.html) | Necessary | |\n", + "| [Understanding of NetCDF](https://foundations.projectpythia.org/core/data-formats/netcdf-cf.html) | Helpful | Familiarity with metadata structure |\n", + "| Project management | Helpful | |\n", + "\n", + "- **Time to learn**: estimate in minutes. For a rough idea, use 5 mins per subsection, 10 if longer; add these up for a total. Safer to round up and overestimate.\n", + "- **System requirements**:\n", + " - Populate with any system, version, or non-Python software requirements if necessary\n", + " - Otherwise use the concepts table above and the Imports section below to describe required packages as necessary\n", + " - If no extra requirements, remove the **System requirements** point altogether" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "---" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## Imports\n", + "Begin your body of content with another `---` divider before continuing into this section, then remove this body text and populate the following code cell with all necessary Python imports **up-front**:" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "import sys" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## Your first content section" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "This is where you begin your first section of material, loosely tied to your objectives stated up front. Tie together your notebook as a narrative, with interspersed Markdown text, images, and more as necessary," + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "# as well as any and all of your code cells\n", + "print(\"Hello world!\")" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### A content subsection\n", + "Divide and conquer your objectives with Markdown subsections, which will populate the helpful navbar in Jupyter Lab and here on the Jupyter Book!" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "# some subsection code\n", + "new = \"helpful information\"" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### Another content subsection\n", + "Keep up the good work! A note, *try to avoid using code comments as narrative*, and instead let them only exist as brief clarifications where necessary." + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## Your second content section\n", + "Here we can move on to our second objective, and we can demonstrate" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### Subsection to the second section\n", + "\n", + "#### a quick demonstration\n", + "\n", + "##### of further and further\n", + "\n", + "###### header levels" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "as well $m = a * t / h$ text! Similarly, you have access to other $\\LaTeX$ equation [**functionality**](https://jupyter-notebook.readthedocs.io/en/stable/examples/Notebook/Typesetting%20Equations.html) via MathJax (demo below from link),\n", + "\n", + "\\begin{align}\n", + "\\dot{x} & = \\sigma(y-x) \\\\\n", + "\\dot{y} & = \\rho x - y - xz \\\\\n", + "\\dot{z} & = -\\beta z + xy\n", + "\\end{align}" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "Check out [**any number of helpful Markdown resources**](https://www.markdownguide.org/basic-syntax/) for further customizing your notebooks and the [**Jupyter docs**](https://jupyter-notebook.readthedocs.io/en/stable/examples/Notebook/Working%20With%20Markdown%20Cells.html) for Jupyter-specific formatting information. Don't hesitate to ask questions if you have problems getting it to look *just right*." + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## Last Section\n", + "\n", + "If you're comfortable, and as we briefly used for our embedded logo up top, you can embed raw html into Jupyter Markdown cells (edit to see):" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "
\n", + "

Info

\n", + " Your relevant information here!\n", + "
" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "Feel free to copy this around and edit or play around with yourself. Some other `admonitions` you can put in:" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "
\n", + "

Success

\n", + " We got this done after all!\n", + "
" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "
\n", + "

Warning

\n", + " Be careful!\n", + "
" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "
\n", + "

Danger

\n", + " Scary stuff be here.\n", + "
" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "We also suggest checking out Jupyter Book's [brief demonstration](https://jupyterbook.org/content/metadata.html#jupyter-cell-tags) on adding cell tags to your cells in Jupyter Notebook, Lab, or manually. Using these cell tags can allow you to [customize](https://jupyterbook.org/interactive/hiding.html) how your code content is displayed and even [demonstrate errors](https://jupyterbook.org/content/execute.html#dealing-with-code-that-raises-errors) without altogether crashing our loyal army of machines!" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "---" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## Summary\n", + "Add one final `---` marking the end of your body of content, and then conclude with a brief single paragraph summarizing at a high level the key pieces that were learned and how they tied to your objectives. Look to reiterate what the most important takeaways were.\n", + "\n", + "### What's next?\n", + "Let Jupyter book tie this to the next (sequential) piece of content that people could move on to down below and in the sidebar. However, if this page uniquely enables your reader to tackle other nonsequential concepts throughout this book, or even external content, link to it here!" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## Resources and references\n", + "Finally, be rigorous in your citations and references as necessary. Give credit where credit is due. Also, feel free to link to relevant external material, further reading, documentation, etc. Then you're done! Give yourself a quick review, a high five, and send us a pull request. A few final notes:\n", + " - `Kernel > Restart Kernel and Run All Cells...` to confirm that your notebook will cleanly run from start to finish\n", + " - `Kernel > Restart Kernel and Clear All Outputs...` before committing your notebook, our machines will do the heavy lifting\n", + " - Take credit! Provide author contact information if you'd like; if so, consider adding information here at the bottom of your notebook\n", + " - Give credit! Attribute appropriate authorship for referenced code, information, images, etc.\n", + " - Only include what you're legally allowed: **no copyright infringement or plagiarism**\n", + " \n", + "Thank you for your contribution!" + ] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python 3 (ipykernel)", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.10.8" + }, + "nbdime-conflicts": { + "local_diff": [ + { + "diff": [ + { + "diff": [ + { + "key": 0, + "op": "addrange", + "valuelist": [ + "Python 3" + ] + }, + { + "key": 0, + "length": 1, + "op": "removerange" + } + ], + "key": "display_name", + "op": "patch" + } + ], + "key": "kernelspec", + "op": "patch" + } + ], + "remote_diff": [ + { + "diff": [ + { + "diff": [ + { + "key": 0, + "op": "addrange", + "valuelist": [ + "Python3" + ] + }, + { + "key": 0, + "length": 1, + "op": "removerange" + } + ], + "key": "display_name", + "op": "patch" + } + ], + "key": "kernelspec", + "op": "patch" + } + ] + }, + "toc-autonumbering": false + }, + "nbformat": 4, + "nbformat_minor": 4 +} diff --git a/_preview/4/_sphinx_design_static/design-style.4045f2051d55cab465a707391d5b2007.min.css b/_preview/4/_sphinx_design_static/design-style.4045f2051d55cab465a707391d5b2007.min.css new file mode 100644 index 0000000..3225661 --- /dev/null +++ b/_preview/4/_sphinx_design_static/design-style.4045f2051d55cab465a707391d5b2007.min.css @@ -0,0 +1 @@ +.sd-bg-primary{background-color:var(--sd-color-primary) !important}.sd-bg-text-primary{color:var(--sd-color-primary-text) !important}button.sd-bg-primary:focus,button.sd-bg-primary:hover{background-color:var(--sd-color-primary-highlight) !important}a.sd-bg-primary:focus,a.sd-bg-primary:hover{background-color:var(--sd-color-primary-highlight) !important}.sd-bg-secondary{background-color:var(--sd-color-secondary) !important}.sd-bg-text-secondary{color:var(--sd-color-secondary-text) !important}button.sd-bg-secondary:focus,button.sd-bg-secondary:hover{background-color:var(--sd-color-secondary-highlight) !important}a.sd-bg-secondary:focus,a.sd-bg-secondary:hover{background-color:var(--sd-color-secondary-highlight) !important}.sd-bg-success{background-color:var(--sd-color-success) !important}.sd-bg-text-success{color:var(--sd-color-success-text) !important}button.sd-bg-success:focus,button.sd-bg-success:hover{background-color:var(--sd-color-success-highlight) !important}a.sd-bg-success:focus,a.sd-bg-success:hover{background-color:var(--sd-color-success-highlight) !important}.sd-bg-info{background-color:var(--sd-color-info) !important}.sd-bg-text-info{color:var(--sd-color-info-text) !important}button.sd-bg-info:focus,button.sd-bg-info:hover{background-color:var(--sd-color-info-highlight) !important}a.sd-bg-info:focus,a.sd-bg-info:hover{background-color:var(--sd-color-info-highlight) !important}.sd-bg-warning{background-color:var(--sd-color-warning) !important}.sd-bg-text-warning{color:var(--sd-color-warning-text) !important}button.sd-bg-warning:focus,button.sd-bg-warning:hover{background-color:var(--sd-color-warning-highlight) !important}a.sd-bg-warning:focus,a.sd-bg-warning:hover{background-color:var(--sd-color-warning-highlight) !important}.sd-bg-danger{background-color:var(--sd-color-danger) !important}.sd-bg-text-danger{color:var(--sd-color-danger-text) !important}button.sd-bg-danger:focus,button.sd-bg-danger:hover{background-color:var(--sd-color-danger-highlight) !important}a.sd-bg-danger:focus,a.sd-bg-danger:hover{background-color:var(--sd-color-danger-highlight) !important}.sd-bg-light{background-color:var(--sd-color-light) !important}.sd-bg-text-light{color:var(--sd-color-light-text) !important}button.sd-bg-light:focus,button.sd-bg-light:hover{background-color:var(--sd-color-light-highlight) !important}a.sd-bg-light:focus,a.sd-bg-light:hover{background-color:var(--sd-color-light-highlight) !important}.sd-bg-muted{background-color:var(--sd-color-muted) !important}.sd-bg-text-muted{color:var(--sd-color-muted-text) !important}button.sd-bg-muted:focus,button.sd-bg-muted:hover{background-color:var(--sd-color-muted-highlight) !important}a.sd-bg-muted:focus,a.sd-bg-muted:hover{background-color:var(--sd-color-muted-highlight) !important}.sd-bg-dark{background-color:var(--sd-color-dark) !important}.sd-bg-text-dark{color:var(--sd-color-dark-text) !important}button.sd-bg-dark:focus,button.sd-bg-dark:hover{background-color:var(--sd-color-dark-highlight) !important}a.sd-bg-dark:focus,a.sd-bg-dark:hover{background-color:var(--sd-color-dark-highlight) !important}.sd-bg-black{background-color:var(--sd-color-black) !important}.sd-bg-text-black{color:var(--sd-color-black-text) !important}button.sd-bg-black:focus,button.sd-bg-black:hover{background-color:var(--sd-color-black-highlight) !important}a.sd-bg-black:focus,a.sd-bg-black:hover{background-color:var(--sd-color-black-highlight) !important}.sd-bg-white{background-color:var(--sd-color-white) !important}.sd-bg-text-white{color:var(--sd-color-white-text) !important}button.sd-bg-white:focus,button.sd-bg-white:hover{background-color:var(--sd-color-white-highlight) !important}a.sd-bg-white:focus,a.sd-bg-white:hover{background-color:var(--sd-color-white-highlight) !important}.sd-text-primary,.sd-text-primary>p{color:var(--sd-color-primary) !important}a.sd-text-primary:focus,a.sd-text-primary:hover{color:var(--sd-color-primary-highlight) !important}.sd-text-secondary,.sd-text-secondary>p{color:var(--sd-color-secondary) !important}a.sd-text-secondary:focus,a.sd-text-secondary:hover{color:var(--sd-color-secondary-highlight) !important}.sd-text-success,.sd-text-success>p{color:var(--sd-color-success) !important}a.sd-text-success:focus,a.sd-text-success:hover{color:var(--sd-color-success-highlight) !important}.sd-text-info,.sd-text-info>p{color:var(--sd-color-info) !important}a.sd-text-info:focus,a.sd-text-info:hover{color:var(--sd-color-info-highlight) !important}.sd-text-warning,.sd-text-warning>p{color:var(--sd-color-warning) !important}a.sd-text-warning:focus,a.sd-text-warning:hover{color:var(--sd-color-warning-highlight) !important}.sd-text-danger,.sd-text-danger>p{color:var(--sd-color-danger) !important}a.sd-text-danger:focus,a.sd-text-danger:hover{color:var(--sd-color-danger-highlight) !important}.sd-text-light,.sd-text-light>p{color:var(--sd-color-light) !important}a.sd-text-light:focus,a.sd-text-light:hover{color:var(--sd-color-light-highlight) !important}.sd-text-muted,.sd-text-muted>p{color:var(--sd-color-muted) !important}a.sd-text-muted:focus,a.sd-text-muted:hover{color:var(--sd-color-muted-highlight) !important}.sd-text-dark,.sd-text-dark>p{color:var(--sd-color-dark) !important}a.sd-text-dark:focus,a.sd-text-dark:hover{color:var(--sd-color-dark-highlight) !important}.sd-text-black,.sd-text-black>p{color:var(--sd-color-black) !important}a.sd-text-black:focus,a.sd-text-black:hover{color:var(--sd-color-black-highlight) !important}.sd-text-white,.sd-text-white>p{color:var(--sd-color-white) !important}a.sd-text-white:focus,a.sd-text-white:hover{color:var(--sd-color-white-highlight) !important}.sd-outline-primary{border-color:var(--sd-color-primary) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-primary:focus,a.sd-outline-primary:hover{border-color:var(--sd-color-primary-highlight) !important}.sd-outline-secondary{border-color:var(--sd-color-secondary) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-secondary:focus,a.sd-outline-secondary:hover{border-color:var(--sd-color-secondary-highlight) !important}.sd-outline-success{border-color:var(--sd-color-success) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-success:focus,a.sd-outline-success:hover{border-color:var(--sd-color-success-highlight) !important}.sd-outline-info{border-color:var(--sd-color-info) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-info:focus,a.sd-outline-info:hover{border-color:var(--sd-color-info-highlight) !important}.sd-outline-warning{border-color:var(--sd-color-warning) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-warning:focus,a.sd-outline-warning:hover{border-color:var(--sd-color-warning-highlight) !important}.sd-outline-danger{border-color:var(--sd-color-danger) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-danger:focus,a.sd-outline-danger:hover{border-color:var(--sd-color-danger-highlight) !important}.sd-outline-light{border-color:var(--sd-color-light) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-light:focus,a.sd-outline-light:hover{border-color:var(--sd-color-light-highlight) !important}.sd-outline-muted{border-color:var(--sd-color-muted) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-muted:focus,a.sd-outline-muted:hover{border-color:var(--sd-color-muted-highlight) !important}.sd-outline-dark{border-color:var(--sd-color-dark) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-dark:focus,a.sd-outline-dark:hover{border-color:var(--sd-color-dark-highlight) !important}.sd-outline-black{border-color:var(--sd-color-black) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-black:focus,a.sd-outline-black:hover{border-color:var(--sd-color-black-highlight) !important}.sd-outline-white{border-color:var(--sd-color-white) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-white:focus,a.sd-outline-white:hover{border-color:var(--sd-color-white-highlight) !important}.sd-bg-transparent{background-color:transparent !important}.sd-outline-transparent{border-color:transparent !important}.sd-text-transparent{color:transparent !important}.sd-p-0{padding:0 !important}.sd-pt-0,.sd-py-0{padding-top:0 !important}.sd-pr-0,.sd-px-0{padding-right:0 !important}.sd-pb-0,.sd-py-0{padding-bottom:0 !important}.sd-pl-0,.sd-px-0{padding-left:0 !important}.sd-p-1{padding:.25rem !important}.sd-pt-1,.sd-py-1{padding-top:.25rem !important}.sd-pr-1,.sd-px-1{padding-right:.25rem !important}.sd-pb-1,.sd-py-1{padding-bottom:.25rem !important}.sd-pl-1,.sd-px-1{padding-left:.25rem !important}.sd-p-2{padding:.5rem !important}.sd-pt-2,.sd-py-2{padding-top:.5rem !important}.sd-pr-2,.sd-px-2{padding-right:.5rem !important}.sd-pb-2,.sd-py-2{padding-bottom:.5rem !important}.sd-pl-2,.sd-px-2{padding-left:.5rem !important}.sd-p-3{padding:1rem !important}.sd-pt-3,.sd-py-3{padding-top:1rem !important}.sd-pr-3,.sd-px-3{padding-right:1rem !important}.sd-pb-3,.sd-py-3{padding-bottom:1rem !important}.sd-pl-3,.sd-px-3{padding-left:1rem !important}.sd-p-4{padding:1.5rem !important}.sd-pt-4,.sd-py-4{padding-top:1.5rem !important}.sd-pr-4,.sd-px-4{padding-right:1.5rem !important}.sd-pb-4,.sd-py-4{padding-bottom:1.5rem !important}.sd-pl-4,.sd-px-4{padding-left:1.5rem !important}.sd-p-5{padding:3rem !important}.sd-pt-5,.sd-py-5{padding-top:3rem !important}.sd-pr-5,.sd-px-5{padding-right:3rem !important}.sd-pb-5,.sd-py-5{padding-bottom:3rem !important}.sd-pl-5,.sd-px-5{padding-left:3rem !important}.sd-m-auto{margin:auto !important}.sd-mt-auto,.sd-my-auto{margin-top:auto !important}.sd-mr-auto,.sd-mx-auto{margin-right:auto !important}.sd-mb-auto,.sd-my-auto{margin-bottom:auto !important}.sd-ml-auto,.sd-mx-auto{margin-left:auto !important}.sd-m-0{margin:0 !important}.sd-mt-0,.sd-my-0{margin-top:0 !important}.sd-mr-0,.sd-mx-0{margin-right:0 !important}.sd-mb-0,.sd-my-0{margin-bottom:0 !important}.sd-ml-0,.sd-mx-0{margin-left:0 !important}.sd-m-1{margin:.25rem !important}.sd-mt-1,.sd-my-1{margin-top:.25rem !important}.sd-mr-1,.sd-mx-1{margin-right:.25rem !important}.sd-mb-1,.sd-my-1{margin-bottom:.25rem !important}.sd-ml-1,.sd-mx-1{margin-left:.25rem !important}.sd-m-2{margin:.5rem !important}.sd-mt-2,.sd-my-2{margin-top:.5rem !important}.sd-mr-2,.sd-mx-2{margin-right:.5rem !important}.sd-mb-2,.sd-my-2{margin-bottom:.5rem !important}.sd-ml-2,.sd-mx-2{margin-left:.5rem !important}.sd-m-3{margin:1rem !important}.sd-mt-3,.sd-my-3{margin-top:1rem !important}.sd-mr-3,.sd-mx-3{margin-right:1rem !important}.sd-mb-3,.sd-my-3{margin-bottom:1rem !important}.sd-ml-3,.sd-mx-3{margin-left:1rem !important}.sd-m-4{margin:1.5rem !important}.sd-mt-4,.sd-my-4{margin-top:1.5rem !important}.sd-mr-4,.sd-mx-4{margin-right:1.5rem !important}.sd-mb-4,.sd-my-4{margin-bottom:1.5rem !important}.sd-ml-4,.sd-mx-4{margin-left:1.5rem !important}.sd-m-5{margin:3rem !important}.sd-mt-5,.sd-my-5{margin-top:3rem !important}.sd-mr-5,.sd-mx-5{margin-right:3rem !important}.sd-mb-5,.sd-my-5{margin-bottom:3rem !important}.sd-ml-5,.sd-mx-5{margin-left:3rem !important}.sd-w-25{width:25% !important}.sd-w-50{width:50% !important}.sd-w-75{width:75% !important}.sd-w-100{width:100% !important}.sd-w-auto{width:auto !important}.sd-h-25{height:25% !important}.sd-h-50{height:50% !important}.sd-h-75{height:75% !important}.sd-h-100{height:100% !important}.sd-h-auto{height:auto !important}.sd-d-none{display:none !important}.sd-d-inline{display:inline !important}.sd-d-inline-block{display:inline-block !important}.sd-d-block{display:block !important}.sd-d-grid{display:grid !important}.sd-d-flex-row{display:-ms-flexbox !important;display:flex !important;flex-direction:row !important}.sd-d-flex-column{display:-ms-flexbox !important;display:flex !important;flex-direction:column !important}.sd-d-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}@media(min-width: 576px){.sd-d-sm-none{display:none !important}.sd-d-sm-inline{display:inline !important}.sd-d-sm-inline-block{display:inline-block !important}.sd-d-sm-block{display:block !important}.sd-d-sm-grid{display:grid !important}.sd-d-sm-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-sm-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 768px){.sd-d-md-none{display:none !important}.sd-d-md-inline{display:inline !important}.sd-d-md-inline-block{display:inline-block !important}.sd-d-md-block{display:block !important}.sd-d-md-grid{display:grid !important}.sd-d-md-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-md-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 992px){.sd-d-lg-none{display:none !important}.sd-d-lg-inline{display:inline !important}.sd-d-lg-inline-block{display:inline-block !important}.sd-d-lg-block{display:block !important}.sd-d-lg-grid{display:grid !important}.sd-d-lg-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-lg-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 1200px){.sd-d-xl-none{display:none !important}.sd-d-xl-inline{display:inline !important}.sd-d-xl-inline-block{display:inline-block !important}.sd-d-xl-block{display:block !important}.sd-d-xl-grid{display:grid !important}.sd-d-xl-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-xl-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}.sd-align-major-start{justify-content:flex-start !important}.sd-align-major-end{justify-content:flex-end !important}.sd-align-major-center{justify-content:center !important}.sd-align-major-justify{justify-content:space-between !important}.sd-align-major-spaced{justify-content:space-evenly !important}.sd-align-minor-start{align-items:flex-start !important}.sd-align-minor-end{align-items:flex-end !important}.sd-align-minor-center{align-items:center !important}.sd-align-minor-stretch{align-items:stretch !important}.sd-text-justify{text-align:justify !important}.sd-text-left{text-align:left !important}.sd-text-right{text-align:right !important}.sd-text-center{text-align:center !important}.sd-font-weight-light{font-weight:300 !important}.sd-font-weight-lighter{font-weight:lighter !important}.sd-font-weight-normal{font-weight:400 !important}.sd-font-weight-bold{font-weight:700 !important}.sd-font-weight-bolder{font-weight:bolder !important}.sd-font-italic{font-style:italic !important}.sd-text-decoration-none{text-decoration:none !important}.sd-text-lowercase{text-transform:lowercase !important}.sd-text-uppercase{text-transform:uppercase !important}.sd-text-capitalize{text-transform:capitalize !important}.sd-text-wrap{white-space:normal !important}.sd-text-nowrap{white-space:nowrap !important}.sd-text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.sd-fs-1,.sd-fs-1>p{font-size:calc(1.375rem + 1.5vw) !important;line-height:unset !important}.sd-fs-2,.sd-fs-2>p{font-size:calc(1.325rem + 0.9vw) !important;line-height:unset !important}.sd-fs-3,.sd-fs-3>p{font-size:calc(1.3rem + 0.6vw) !important;line-height:unset !important}.sd-fs-4,.sd-fs-4>p{font-size:calc(1.275rem + 0.3vw) !important;line-height:unset !important}.sd-fs-5,.sd-fs-5>p{font-size:1.25rem !important;line-height:unset !important}.sd-fs-6,.sd-fs-6>p{font-size:1rem !important;line-height:unset !important}.sd-border-0{border:0 solid !important}.sd-border-top-0{border-top:0 solid !important}.sd-border-bottom-0{border-bottom:0 solid !important}.sd-border-right-0{border-right:0 solid !important}.sd-border-left-0{border-left:0 solid !important}.sd-border-1{border:1px solid !important}.sd-border-top-1{border-top:1px solid !important}.sd-border-bottom-1{border-bottom:1px solid !important}.sd-border-right-1{border-right:1px solid !important}.sd-border-left-1{border-left:1px solid !important}.sd-border-2{border:2px solid !important}.sd-border-top-2{border-top:2px solid !important}.sd-border-bottom-2{border-bottom:2px solid !important}.sd-border-right-2{border-right:2px solid !important}.sd-border-left-2{border-left:2px solid !important}.sd-border-3{border:3px solid !important}.sd-border-top-3{border-top:3px solid !important}.sd-border-bottom-3{border-bottom:3px solid !important}.sd-border-right-3{border-right:3px solid !important}.sd-border-left-3{border-left:3px solid !important}.sd-border-4{border:4px solid !important}.sd-border-top-4{border-top:4px solid !important}.sd-border-bottom-4{border-bottom:4px solid !important}.sd-border-right-4{border-right:4px solid !important}.sd-border-left-4{border-left:4px solid !important}.sd-border-5{border:5px solid !important}.sd-border-top-5{border-top:5px solid !important}.sd-border-bottom-5{border-bottom:5px solid !important}.sd-border-right-5{border-right:5px solid !important}.sd-border-left-5{border-left:5px solid !important}.sd-rounded-0{border-radius:0 !important}.sd-rounded-1{border-radius:.2rem !important}.sd-rounded-2{border-radius:.3rem !important}.sd-rounded-3{border-radius:.5rem !important}.sd-rounded-pill{border-radius:50rem !important}.sd-rounded-circle{border-radius:50% !important}.shadow-none{box-shadow:none !important}.sd-shadow-sm{box-shadow:0 .125rem .25rem var(--sd-color-shadow) !important}.sd-shadow-md{box-shadow:0 .5rem 1rem var(--sd-color-shadow) !important}.sd-shadow-lg{box-shadow:0 1rem 3rem var(--sd-color-shadow) !important}@keyframes sd-slide-from-left{0%{transform:translateX(-100%)}100%{transform:translateX(0)}}@keyframes sd-slide-from-right{0%{transform:translateX(200%)}100%{transform:translateX(0)}}@keyframes sd-grow100{0%{transform:scale(0);opacity:.5}100%{transform:scale(1);opacity:1}}@keyframes sd-grow50{0%{transform:scale(0.5);opacity:.5}100%{transform:scale(1);opacity:1}}@keyframes sd-grow50-rot20{0%{transform:scale(0.5) rotateZ(-20deg);opacity:.5}75%{transform:scale(1) rotateZ(5deg);opacity:1}95%{transform:scale(1) rotateZ(-1deg);opacity:1}100%{transform:scale(1) rotateZ(0);opacity:1}}.sd-animate-slide-from-left{animation:1s ease-out 0s 1 normal none running sd-slide-from-left}.sd-animate-slide-from-right{animation:1s ease-out 0s 1 normal none running sd-slide-from-right}.sd-animate-grow100{animation:1s ease-out 0s 1 normal none running sd-grow100}.sd-animate-grow50{animation:1s ease-out 0s 1 normal none running sd-grow50}.sd-animate-grow50-rot20{animation:1s ease-out 0s 1 normal none running sd-grow50-rot20}.sd-badge{display:inline-block;padding:.35em .65em;font-size:.75em;font-weight:700;line-height:1;text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:.25rem}.sd-badge:empty{display:none}a.sd-badge{text-decoration:none}.sd-btn .sd-badge{position:relative;top:-1px}.sd-btn{background-color:transparent;border:1px solid transparent;border-radius:.25rem;cursor:pointer;display:inline-block;font-weight:400;font-size:1rem;line-height:1.5;padding:.375rem .75rem;text-align:center;text-decoration:none;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;vertical-align:middle;user-select:none;-moz-user-select:none;-ms-user-select:none;-webkit-user-select:none}.sd-btn:hover{text-decoration:none}@media(prefers-reduced-motion: reduce){.sd-btn{transition:none}}.sd-btn-primary,.sd-btn-outline-primary:hover,.sd-btn-outline-primary:focus{color:var(--sd-color-primary-text) !important;background-color:var(--sd-color-primary) !important;border-color:var(--sd-color-primary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-primary:hover,.sd-btn-primary:focus{color:var(--sd-color-primary-text) !important;background-color:var(--sd-color-primary-highlight) !important;border-color:var(--sd-color-primary-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-primary{color:var(--sd-color-primary) !important;border-color:var(--sd-color-primary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-secondary,.sd-btn-outline-secondary:hover,.sd-btn-outline-secondary:focus{color:var(--sd-color-secondary-text) !important;background-color:var(--sd-color-secondary) !important;border-color:var(--sd-color-secondary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-secondary:hover,.sd-btn-secondary:focus{color:var(--sd-color-secondary-text) !important;background-color:var(--sd-color-secondary-highlight) !important;border-color:var(--sd-color-secondary-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-secondary{color:var(--sd-color-secondary) !important;border-color:var(--sd-color-secondary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-success,.sd-btn-outline-success:hover,.sd-btn-outline-success:focus{color:var(--sd-color-success-text) !important;background-color:var(--sd-color-success) !important;border-color:var(--sd-color-success) !important;border-width:1px !important;border-style:solid !important}.sd-btn-success:hover,.sd-btn-success:focus{color:var(--sd-color-success-text) !important;background-color:var(--sd-color-success-highlight) !important;border-color:var(--sd-color-success-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-success{color:var(--sd-color-success) !important;border-color:var(--sd-color-success) !important;border-width:1px !important;border-style:solid !important}.sd-btn-info,.sd-btn-outline-info:hover,.sd-btn-outline-info:focus{color:var(--sd-color-info-text) !important;background-color:var(--sd-color-info) !important;border-color:var(--sd-color-info) !important;border-width:1px !important;border-style:solid !important}.sd-btn-info:hover,.sd-btn-info:focus{color:var(--sd-color-info-text) !important;background-color:var(--sd-color-info-highlight) !important;border-color:var(--sd-color-info-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-info{color:var(--sd-color-info) !important;border-color:var(--sd-color-info) !important;border-width:1px !important;border-style:solid !important}.sd-btn-warning,.sd-btn-outline-warning:hover,.sd-btn-outline-warning:focus{color:var(--sd-color-warning-text) !important;background-color:var(--sd-color-warning) !important;border-color:var(--sd-color-warning) !important;border-width:1px !important;border-style:solid !important}.sd-btn-warning:hover,.sd-btn-warning:focus{color:var(--sd-color-warning-text) !important;background-color:var(--sd-color-warning-highlight) !important;border-color:var(--sd-color-warning-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-warning{color:var(--sd-color-warning) !important;border-color:var(--sd-color-warning) !important;border-width:1px !important;border-style:solid !important}.sd-btn-danger,.sd-btn-outline-danger:hover,.sd-btn-outline-danger:focus{color:var(--sd-color-danger-text) !important;background-color:var(--sd-color-danger) !important;border-color:var(--sd-color-danger) !important;border-width:1px !important;border-style:solid !important}.sd-btn-danger:hover,.sd-btn-danger:focus{color:var(--sd-color-danger-text) !important;background-color:var(--sd-color-danger-highlight) !important;border-color:var(--sd-color-danger-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-danger{color:var(--sd-color-danger) !important;border-color:var(--sd-color-danger) !important;border-width:1px !important;border-style:solid !important}.sd-btn-light,.sd-btn-outline-light:hover,.sd-btn-outline-light:focus{color:var(--sd-color-light-text) !important;background-color:var(--sd-color-light) !important;border-color:var(--sd-color-light) !important;border-width:1px !important;border-style:solid !important}.sd-btn-light:hover,.sd-btn-light:focus{color:var(--sd-color-light-text) !important;background-color:var(--sd-color-light-highlight) !important;border-color:var(--sd-color-light-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-light{color:var(--sd-color-light) !important;border-color:var(--sd-color-light) !important;border-width:1px !important;border-style:solid !important}.sd-btn-muted,.sd-btn-outline-muted:hover,.sd-btn-outline-muted:focus{color:var(--sd-color-muted-text) !important;background-color:var(--sd-color-muted) !important;border-color:var(--sd-color-muted) !important;border-width:1px !important;border-style:solid !important}.sd-btn-muted:hover,.sd-btn-muted:focus{color:var(--sd-color-muted-text) !important;background-color:var(--sd-color-muted-highlight) !important;border-color:var(--sd-color-muted-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-muted{color:var(--sd-color-muted) !important;border-color:var(--sd-color-muted) !important;border-width:1px !important;border-style:solid !important}.sd-btn-dark,.sd-btn-outline-dark:hover,.sd-btn-outline-dark:focus{color:var(--sd-color-dark-text) !important;background-color:var(--sd-color-dark) !important;border-color:var(--sd-color-dark) !important;border-width:1px !important;border-style:solid !important}.sd-btn-dark:hover,.sd-btn-dark:focus{color:var(--sd-color-dark-text) !important;background-color:var(--sd-color-dark-highlight) !important;border-color:var(--sd-color-dark-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-dark{color:var(--sd-color-dark) !important;border-color:var(--sd-color-dark) !important;border-width:1px !important;border-style:solid !important}.sd-btn-black,.sd-btn-outline-black:hover,.sd-btn-outline-black:focus{color:var(--sd-color-black-text) !important;background-color:var(--sd-color-black) !important;border-color:var(--sd-color-black) !important;border-width:1px !important;border-style:solid !important}.sd-btn-black:hover,.sd-btn-black:focus{color:var(--sd-color-black-text) !important;background-color:var(--sd-color-black-highlight) !important;border-color:var(--sd-color-black-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-black{color:var(--sd-color-black) !important;border-color:var(--sd-color-black) !important;border-width:1px !important;border-style:solid !important}.sd-btn-white,.sd-btn-outline-white:hover,.sd-btn-outline-white:focus{color:var(--sd-color-white-text) !important;background-color:var(--sd-color-white) !important;border-color:var(--sd-color-white) !important;border-width:1px !important;border-style:solid !important}.sd-btn-white:hover,.sd-btn-white:focus{color:var(--sd-color-white-text) !important;background-color:var(--sd-color-white-highlight) !important;border-color:var(--sd-color-white-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-white{color:var(--sd-color-white) !important;border-color:var(--sd-color-white) !important;border-width:1px !important;border-style:solid !important}.sd-stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.sd-hide-link-text{font-size:0}.sd-octicon,.sd-material-icon{display:inline-block;fill:currentColor;vertical-align:middle}.sd-avatar-xs{border-radius:50%;object-fit:cover;object-position:center;width:1rem;height:1rem}.sd-avatar-sm{border-radius:50%;object-fit:cover;object-position:center;width:3rem;height:3rem}.sd-avatar-md{border-radius:50%;object-fit:cover;object-position:center;width:5rem;height:5rem}.sd-avatar-lg{border-radius:50%;object-fit:cover;object-position:center;width:7rem;height:7rem}.sd-avatar-xl{border-radius:50%;object-fit:cover;object-position:center;width:10rem;height:10rem}.sd-avatar-inherit{border-radius:50%;object-fit:cover;object-position:center;width:inherit;height:inherit}.sd-avatar-initial{border-radius:50%;object-fit:cover;object-position:center;width:initial;height:initial}.sd-card{background-clip:border-box;background-color:var(--sd-color-card-background);border:1px solid var(--sd-color-card-border);border-radius:.25rem;color:var(--sd-color-card-text);display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;min-width:0;position:relative;word-wrap:break-word}.sd-card>hr{margin-left:0;margin-right:0}.sd-card-hover:hover{border-color:var(--sd-color-card-border-hover);transform:scale(1.01)}.sd-card-body{-ms-flex:1 1 auto;flex:1 1 auto;padding:1rem 1rem}.sd-card-title{margin-bottom:.5rem}.sd-card-subtitle{margin-top:-0.25rem;margin-bottom:0}.sd-card-text:last-child{margin-bottom:0}.sd-card-link:hover{text-decoration:none}.sd-card-link+.card-link{margin-left:1rem}.sd-card-header{padding:.5rem 1rem;margin-bottom:0;background-color:var(--sd-color-card-header);border-bottom:1px solid var(--sd-color-card-border)}.sd-card-header:first-child{border-radius:calc(0.25rem - 1px) calc(0.25rem - 1px) 0 0}.sd-card-footer{padding:.5rem 1rem;background-color:var(--sd-color-card-footer);border-top:1px solid var(--sd-color-card-border)}.sd-card-footer:last-child{border-radius:0 0 calc(0.25rem - 1px) calc(0.25rem - 1px)}.sd-card-header-tabs{margin-right:-0.5rem;margin-bottom:-0.5rem;margin-left:-0.5rem;border-bottom:0}.sd-card-header-pills{margin-right:-0.5rem;margin-left:-0.5rem}.sd-card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:1rem;border-radius:calc(0.25rem - 1px)}.sd-card-img,.sd-card-img-bottom,.sd-card-img-top{width:100%}.sd-card-img,.sd-card-img-top{border-top-left-radius:calc(0.25rem - 1px);border-top-right-radius:calc(0.25rem - 1px)}.sd-card-img,.sd-card-img-bottom{border-bottom-left-radius:calc(0.25rem - 1px);border-bottom-right-radius:calc(0.25rem - 1px)}.sd-cards-carousel{width:100%;display:flex;flex-wrap:nowrap;-ms-flex-direction:row;flex-direction:row;overflow-x:hidden;scroll-snap-type:x mandatory}.sd-cards-carousel.sd-show-scrollbar{overflow-x:auto}.sd-cards-carousel:hover,.sd-cards-carousel:focus{overflow-x:auto}.sd-cards-carousel>.sd-card{flex-shrink:0;scroll-snap-align:start}.sd-cards-carousel>.sd-card:not(:last-child){margin-right:3px}.sd-card-cols-1>.sd-card{width:90%}.sd-card-cols-2>.sd-card{width:45%}.sd-card-cols-3>.sd-card{width:30%}.sd-card-cols-4>.sd-card{width:22.5%}.sd-card-cols-5>.sd-card{width:18%}.sd-card-cols-6>.sd-card{width:15%}.sd-card-cols-7>.sd-card{width:12.8571428571%}.sd-card-cols-8>.sd-card{width:11.25%}.sd-card-cols-9>.sd-card{width:10%}.sd-card-cols-10>.sd-card{width:9%}.sd-card-cols-11>.sd-card{width:8.1818181818%}.sd-card-cols-12>.sd-card{width:7.5%}.sd-container,.sd-container-fluid,.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container-xl{margin-left:auto;margin-right:auto;padding-left:var(--sd-gutter-x, 0.75rem);padding-right:var(--sd-gutter-x, 0.75rem);width:100%}@media(min-width: 576px){.sd-container-sm,.sd-container{max-width:540px}}@media(min-width: 768px){.sd-container-md,.sd-container-sm,.sd-container{max-width:720px}}@media(min-width: 992px){.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container{max-width:960px}}@media(min-width: 1200px){.sd-container-xl,.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container{max-width:1140px}}.sd-row{--sd-gutter-x: 1.5rem;--sd-gutter-y: 0;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-top:calc(var(--sd-gutter-y) * -1);margin-right:calc(var(--sd-gutter-x) * -0.5);margin-left:calc(var(--sd-gutter-x) * -0.5)}.sd-row>*{box-sizing:border-box;flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--sd-gutter-x) * 0.5);padding-left:calc(var(--sd-gutter-x) * 0.5);margin-top:var(--sd-gutter-y)}.sd-col{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-auto>*{flex:0 0 auto;width:auto}.sd-row-cols-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}@media(min-width: 576px){.sd-col-sm{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-sm-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-sm-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-sm-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-sm-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-sm-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-sm-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-sm-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-sm-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-sm-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-sm-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-sm-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-sm-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-sm-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 768px){.sd-col-md{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-md-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-md-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-md-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-md-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-md-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-md-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-md-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-md-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-md-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-md-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-md-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-md-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-md-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 992px){.sd-col-lg{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-lg-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-lg-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-lg-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-lg-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-lg-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-lg-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-lg-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-lg-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-lg-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-lg-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-lg-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-lg-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-lg-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 1200px){.sd-col-xl{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-xl-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-xl-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-xl-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-xl-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-xl-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-xl-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-xl-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-xl-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-xl-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-xl-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-xl-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-xl-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-xl-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}.sd-col-auto{flex:0 0 auto;-ms-flex:0 0 auto;width:auto}.sd-col-1{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}.sd-col-2{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-col-3{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-col-4{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-col-5{flex:0 0 auto;-ms-flex:0 0 auto;width:41.6666666667%}.sd-col-6{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-col-7{flex:0 0 auto;-ms-flex:0 0 auto;width:58.3333333333%}.sd-col-8{flex:0 0 auto;-ms-flex:0 0 auto;width:66.6666666667%}.sd-col-9{flex:0 0 auto;-ms-flex:0 0 auto;width:75%}.sd-col-10{flex:0 0 auto;-ms-flex:0 0 auto;width:83.3333333333%}.sd-col-11{flex:0 0 auto;-ms-flex:0 0 auto;width:91.6666666667%}.sd-col-12{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-g-0,.sd-gy-0{--sd-gutter-y: 0}.sd-g-0,.sd-gx-0{--sd-gutter-x: 0}.sd-g-1,.sd-gy-1{--sd-gutter-y: 0.25rem}.sd-g-1,.sd-gx-1{--sd-gutter-x: 0.25rem}.sd-g-2,.sd-gy-2{--sd-gutter-y: 0.5rem}.sd-g-2,.sd-gx-2{--sd-gutter-x: 0.5rem}.sd-g-3,.sd-gy-3{--sd-gutter-y: 1rem}.sd-g-3,.sd-gx-3{--sd-gutter-x: 1rem}.sd-g-4,.sd-gy-4{--sd-gutter-y: 1.5rem}.sd-g-4,.sd-gx-4{--sd-gutter-x: 1.5rem}.sd-g-5,.sd-gy-5{--sd-gutter-y: 3rem}.sd-g-5,.sd-gx-5{--sd-gutter-x: 3rem}@media(min-width: 576px){.sd-col-sm-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-sm-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-sm-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-sm-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-sm-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-sm-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-sm-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-sm-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-sm-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-sm-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-sm-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-sm-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-sm-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-sm-0,.sd-gy-sm-0{--sd-gutter-y: 0}.sd-g-sm-0,.sd-gx-sm-0{--sd-gutter-x: 0}.sd-g-sm-1,.sd-gy-sm-1{--sd-gutter-y: 0.25rem}.sd-g-sm-1,.sd-gx-sm-1{--sd-gutter-x: 0.25rem}.sd-g-sm-2,.sd-gy-sm-2{--sd-gutter-y: 0.5rem}.sd-g-sm-2,.sd-gx-sm-2{--sd-gutter-x: 0.5rem}.sd-g-sm-3,.sd-gy-sm-3{--sd-gutter-y: 1rem}.sd-g-sm-3,.sd-gx-sm-3{--sd-gutter-x: 1rem}.sd-g-sm-4,.sd-gy-sm-4{--sd-gutter-y: 1.5rem}.sd-g-sm-4,.sd-gx-sm-4{--sd-gutter-x: 1.5rem}.sd-g-sm-5,.sd-gy-sm-5{--sd-gutter-y: 3rem}.sd-g-sm-5,.sd-gx-sm-5{--sd-gutter-x: 3rem}}@media(min-width: 768px){.sd-col-md-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-md-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-md-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-md-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-md-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-md-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-md-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-md-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-md-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-md-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-md-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-md-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-md-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-md-0,.sd-gy-md-0{--sd-gutter-y: 0}.sd-g-md-0,.sd-gx-md-0{--sd-gutter-x: 0}.sd-g-md-1,.sd-gy-md-1{--sd-gutter-y: 0.25rem}.sd-g-md-1,.sd-gx-md-1{--sd-gutter-x: 0.25rem}.sd-g-md-2,.sd-gy-md-2{--sd-gutter-y: 0.5rem}.sd-g-md-2,.sd-gx-md-2{--sd-gutter-x: 0.5rem}.sd-g-md-3,.sd-gy-md-3{--sd-gutter-y: 1rem}.sd-g-md-3,.sd-gx-md-3{--sd-gutter-x: 1rem}.sd-g-md-4,.sd-gy-md-4{--sd-gutter-y: 1.5rem}.sd-g-md-4,.sd-gx-md-4{--sd-gutter-x: 1.5rem}.sd-g-md-5,.sd-gy-md-5{--sd-gutter-y: 3rem}.sd-g-md-5,.sd-gx-md-5{--sd-gutter-x: 3rem}}@media(min-width: 992px){.sd-col-lg-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-lg-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-lg-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-lg-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-lg-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-lg-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-lg-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-lg-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-lg-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-lg-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-lg-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-lg-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-lg-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-lg-0,.sd-gy-lg-0{--sd-gutter-y: 0}.sd-g-lg-0,.sd-gx-lg-0{--sd-gutter-x: 0}.sd-g-lg-1,.sd-gy-lg-1{--sd-gutter-y: 0.25rem}.sd-g-lg-1,.sd-gx-lg-1{--sd-gutter-x: 0.25rem}.sd-g-lg-2,.sd-gy-lg-2{--sd-gutter-y: 0.5rem}.sd-g-lg-2,.sd-gx-lg-2{--sd-gutter-x: 0.5rem}.sd-g-lg-3,.sd-gy-lg-3{--sd-gutter-y: 1rem}.sd-g-lg-3,.sd-gx-lg-3{--sd-gutter-x: 1rem}.sd-g-lg-4,.sd-gy-lg-4{--sd-gutter-y: 1.5rem}.sd-g-lg-4,.sd-gx-lg-4{--sd-gutter-x: 1.5rem}.sd-g-lg-5,.sd-gy-lg-5{--sd-gutter-y: 3rem}.sd-g-lg-5,.sd-gx-lg-5{--sd-gutter-x: 3rem}}@media(min-width: 1200px){.sd-col-xl-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-xl-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-xl-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-xl-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-xl-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-xl-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-xl-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-xl-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-xl-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-xl-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-xl-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-xl-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-xl-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-xl-0,.sd-gy-xl-0{--sd-gutter-y: 0}.sd-g-xl-0,.sd-gx-xl-0{--sd-gutter-x: 0}.sd-g-xl-1,.sd-gy-xl-1{--sd-gutter-y: 0.25rem}.sd-g-xl-1,.sd-gx-xl-1{--sd-gutter-x: 0.25rem}.sd-g-xl-2,.sd-gy-xl-2{--sd-gutter-y: 0.5rem}.sd-g-xl-2,.sd-gx-xl-2{--sd-gutter-x: 0.5rem}.sd-g-xl-3,.sd-gy-xl-3{--sd-gutter-y: 1rem}.sd-g-xl-3,.sd-gx-xl-3{--sd-gutter-x: 1rem}.sd-g-xl-4,.sd-gy-xl-4{--sd-gutter-y: 1.5rem}.sd-g-xl-4,.sd-gx-xl-4{--sd-gutter-x: 1.5rem}.sd-g-xl-5,.sd-gy-xl-5{--sd-gutter-y: 3rem}.sd-g-xl-5,.sd-gx-xl-5{--sd-gutter-x: 3rem}}.sd-flex-row-reverse{flex-direction:row-reverse !important}details.sd-dropdown{position:relative}details.sd-dropdown .sd-summary-title{font-weight:700;padding-right:3em !important;-moz-user-select:none;-ms-user-select:none;-webkit-user-select:none;user-select:none}details.sd-dropdown:hover{cursor:pointer}details.sd-dropdown .sd-summary-content{cursor:default}details.sd-dropdown summary{list-style:none;padding:1em}details.sd-dropdown summary .sd-octicon.no-title{vertical-align:middle}details.sd-dropdown[open] summary .sd-octicon.no-title{visibility:hidden}details.sd-dropdown summary::-webkit-details-marker{display:none}details.sd-dropdown summary:focus{outline:none}details.sd-dropdown .sd-summary-icon{margin-right:.5em}details.sd-dropdown .sd-summary-icon svg{opacity:.8}details.sd-dropdown summary:hover .sd-summary-up svg,details.sd-dropdown summary:hover .sd-summary-down svg{opacity:1;transform:scale(1.1)}details.sd-dropdown .sd-summary-up svg,details.sd-dropdown .sd-summary-down svg{display:block;opacity:.6}details.sd-dropdown .sd-summary-up,details.sd-dropdown .sd-summary-down{pointer-events:none;position:absolute;right:1em;top:1em}details.sd-dropdown[open]>.sd-summary-title .sd-summary-down{visibility:hidden}details.sd-dropdown:not([open])>.sd-summary-title .sd-summary-up{visibility:hidden}details.sd-dropdown:not([open]).sd-card{border:none}details.sd-dropdown:not([open])>.sd-card-header{border:1px solid var(--sd-color-card-border);border-radius:.25rem}details.sd-dropdown.sd-fade-in[open] summary~*{-moz-animation:sd-fade-in .5s ease-in-out;-webkit-animation:sd-fade-in .5s ease-in-out;animation:sd-fade-in .5s ease-in-out}details.sd-dropdown.sd-fade-in-slide-down[open] summary~*{-moz-animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out;-webkit-animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out;animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out}.sd-col>.sd-dropdown{width:100%}.sd-summary-content>.sd-tab-set:first-child{margin-top:0}@keyframes sd-fade-in{0%{opacity:0}100%{opacity:1}}@keyframes sd-slide-down{0%{transform:translate(0, -10px)}100%{transform:translate(0, 0)}}.sd-tab-set{border-radius:.125rem;display:flex;flex-wrap:wrap;margin:1em 0;position:relative}.sd-tab-set>input{opacity:0;position:absolute}.sd-tab-set>input:checked+label{border-color:var(--sd-color-tabs-underline-active);color:var(--sd-color-tabs-label-active)}.sd-tab-set>input:checked+label+.sd-tab-content{display:block}.sd-tab-set>input:not(:checked)+label:hover{color:var(--sd-color-tabs-label-hover);border-color:var(--sd-color-tabs-underline-hover)}.sd-tab-set>input:focus+label{outline-style:auto}.sd-tab-set>input:not(.focus-visible)+label{outline:none;-webkit-tap-highlight-color:transparent}.sd-tab-set>label{border-bottom:.125rem solid transparent;margin-bottom:0;color:var(--sd-color-tabs-label-inactive);border-color:var(--sd-color-tabs-underline-inactive);cursor:pointer;font-size:var(--sd-fontsize-tabs-label);font-weight:700;padding:1em 1.25em .5em;transition:color 250ms;width:auto;z-index:1}html .sd-tab-set>label:hover{color:var(--sd-color-tabs-label-active)}.sd-col>.sd-tab-set{width:100%}.sd-tab-content{box-shadow:0 -0.0625rem var(--sd-color-tabs-overline),0 .0625rem var(--sd-color-tabs-underline);display:none;order:99;padding-bottom:.75rem;padding-top:.75rem;width:100%}.sd-tab-content>:first-child{margin-top:0 !important}.sd-tab-content>:last-child{margin-bottom:0 !important}.sd-tab-content>.sd-tab-set{margin:0}.sd-sphinx-override,.sd-sphinx-override *{-moz-box-sizing:border-box;-webkit-box-sizing:border-box;box-sizing:border-box}.sd-sphinx-override p{margin-top:0}:root{--sd-color-primary: #007bff;--sd-color-secondary: #6c757d;--sd-color-success: #28a745;--sd-color-info: #17a2b8;--sd-color-warning: #f0b37e;--sd-color-danger: #dc3545;--sd-color-light: #f8f9fa;--sd-color-muted: #6c757d;--sd-color-dark: #212529;--sd-color-black: black;--sd-color-white: white;--sd-color-primary-highlight: #0069d9;--sd-color-secondary-highlight: #5c636a;--sd-color-success-highlight: #228e3b;--sd-color-info-highlight: #148a9c;--sd-color-warning-highlight: #cc986b;--sd-color-danger-highlight: #bb2d3b;--sd-color-light-highlight: #d3d4d5;--sd-color-muted-highlight: #5c636a;--sd-color-dark-highlight: #1c1f23;--sd-color-black-highlight: black;--sd-color-white-highlight: #d9d9d9;--sd-color-primary-text: #fff;--sd-color-secondary-text: #fff;--sd-color-success-text: #fff;--sd-color-info-text: #fff;--sd-color-warning-text: #212529;--sd-color-danger-text: #fff;--sd-color-light-text: #212529;--sd-color-muted-text: #fff;--sd-color-dark-text: #fff;--sd-color-black-text: #fff;--sd-color-white-text: #212529;--sd-color-shadow: rgba(0, 0, 0, 0.15);--sd-color-card-border: rgba(0, 0, 0, 0.125);--sd-color-card-border-hover: hsla(231, 99%, 66%, 1);--sd-color-card-background: transparent;--sd-color-card-text: inherit;--sd-color-card-header: transparent;--sd-color-card-footer: transparent;--sd-color-tabs-label-active: hsla(231, 99%, 66%, 1);--sd-color-tabs-label-hover: hsla(231, 99%, 66%, 1);--sd-color-tabs-label-inactive: hsl(0, 0%, 66%);--sd-color-tabs-underline-active: hsla(231, 99%, 66%, 1);--sd-color-tabs-underline-hover: rgba(178, 206, 245, 0.62);--sd-color-tabs-underline-inactive: transparent;--sd-color-tabs-overline: rgb(222, 222, 222);--sd-color-tabs-underline: rgb(222, 222, 222);--sd-fontsize-tabs-label: 1rem} diff --git a/_preview/4/_sphinx_design_static/design-tabs.js b/_preview/4/_sphinx_design_static/design-tabs.js new file mode 100644 index 0000000..36b38cf --- /dev/null +++ b/_preview/4/_sphinx_design_static/design-tabs.js @@ -0,0 +1,27 @@ +var sd_labels_by_text = {}; + +function ready() { + const li = document.getElementsByClassName("sd-tab-label"); + for (const label of li) { + syncId = label.getAttribute("data-sync-id"); + if (syncId) { + label.onclick = onLabelClick; + if (!sd_labels_by_text[syncId]) { + sd_labels_by_text[syncId] = []; + } + sd_labels_by_text[syncId].push(label); + } + } +} + +function onLabelClick() { + // Activate other inputs with the same sync id. + syncId = this.getAttribute("data-sync-id"); + for (label of sd_labels_by_text[syncId]) { + if (label === this) continue; + label.previousElementSibling.checked = true; + } + window.localStorage.setItem("sphinx-design-last-tab", syncId); +} + +document.addEventListener("DOMContentLoaded", ready, false); diff --git a/_preview/4/_static/__init__.py b/_preview/4/_static/__init__.py new file mode 100644 index 0000000..e69de29 diff --git a/_preview/4/_static/__pycache__/__init__.cpython-310.pyc b/_preview/4/_static/__pycache__/__init__.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..c7a3ba1a74d4e1de03df08b41a582ec22042a010 GIT binary patch literal 200 zcmYk0K?=e!5JgkzLWCYfupOn_BA&oa4-nF1FrjS{o3z*?c_p{r!j+Sie)#V*!|)kb z6gx(04|h!YPWV?w!-X7jf?_S(XV)j2()x!_5890g(`+qHFdA#5vr5!}b_pPz>pOC( zaDl;e;Mb^~t*g@!f{9pqA$xJd0KscxA3PoNsF5l|6wyfFoH`@tm0w@mW^`&E@SL6q H8$!;$5Q#Ly literal 0 HcmV?d00001 diff --git a/_preview/4/_static/basic.css b/_preview/4/_static/basic.css new file mode 100644 index 0000000..d54be80 --- /dev/null +++ b/_preview/4/_static/basic.css @@ -0,0 +1,906 @@ +/* + * basic.css + * ~~~~~~~~~ + * + * Sphinx stylesheet -- basic theme. + * + * :copyright: Copyright 2007-2022 by the Sphinx team, see AUTHORS. + * :license: BSD, see LICENSE for details. + * + */ + +/* -- main layout ----------------------------------------------------------- */ + +div.clearer { + clear: both; +} + +div.section::after { + display: block; + content: ''; + clear: left; +} + +/* -- relbar ---------------------------------------------------------------- */ + +div.related { + width: 100%; + font-size: 90%; +} + +div.related h3 { + display: none; +} + +div.related ul { + margin: 0; + padding: 0 0 0 10px; + list-style: none; +} + +div.related li { + display: inline; +} + +div.related li.right { + float: right; + margin-right: 5px; +} + +/* -- sidebar --------------------------------------------------------------- */ + +div.sphinxsidebarwrapper { + padding: 10px 5px 0 10px; +} + +div.sphinxsidebar { + float: left; + width: 270px; + margin-left: -100%; + font-size: 90%; + word-wrap: break-word; + overflow-wrap : break-word; +} + +div.sphinxsidebar ul { + list-style: none; +} + +div.sphinxsidebar ul ul, +div.sphinxsidebar ul.want-points { + margin-left: 20px; + list-style: square; +} + +div.sphinxsidebar ul ul { + margin-top: 0; + margin-bottom: 0; +} + +div.sphinxsidebar form { + margin-top: 10px; +} + +div.sphinxsidebar input { + border: 1px solid #98dbcc; + font-family: sans-serif; + font-size: 1em; +} + +div.sphinxsidebar #searchbox form.search { + overflow: hidden; +} + +div.sphinxsidebar #searchbox input[type="text"] { + float: left; + width: 80%; + padding: 0.25em; + box-sizing: border-box; +} + +div.sphinxsidebar #searchbox input[type="submit"] { + float: left; + width: 20%; + border-left: none; + padding: 0.25em; + box-sizing: border-box; +} + + +img { + border: 0; + max-width: 100%; +} + +/* -- search page ----------------------------------------------------------- */ + +ul.search { + margin: 10px 0 0 20px; + padding: 0; +} + +ul.search li { + padding: 5px 0 5px 20px; + background-image: url(file.png); + background-repeat: no-repeat; + background-position: 0 7px; +} + +ul.search li a { + font-weight: bold; +} + +ul.search li p.context { + color: #888; + margin: 2px 0 0 30px; + text-align: left; +} + +ul.keywordmatches li.goodmatch a { + font-weight: bold; +} + +/* -- index page ------------------------------------------------------------ */ + +table.contentstable { + width: 90%; + margin-left: auto; + margin-right: auto; +} + +table.contentstable p.biglink { + line-height: 150%; +} + +a.biglink { + font-size: 1.3em; +} + +span.linkdescr { + font-style: italic; + padding-top: 5px; + font-size: 90%; +} + +/* -- general index --------------------------------------------------------- */ + +table.indextable { + width: 100%; +} + +table.indextable td { + text-align: left; + vertical-align: top; +} + +table.indextable ul { + margin-top: 0; + margin-bottom: 0; + list-style-type: none; +} + +table.indextable > tbody > tr > td > ul { + padding-left: 0em; +} + +table.indextable tr.pcap { + height: 10px; +} + +table.indextable tr.cap { + margin-top: 10px; + background-color: #f2f2f2; +} + +img.toggler { + margin-right: 3px; + margin-top: 3px; + cursor: pointer; +} + +div.modindex-jumpbox { + border-top: 1px solid #ddd; + border-bottom: 1px solid #ddd; + margin: 1em 0 1em 0; + padding: 0.4em; +} + +div.genindex-jumpbox { + border-top: 1px solid #ddd; + border-bottom: 1px solid #ddd; + margin: 1em 0 1em 0; + padding: 0.4em; +} + +/* -- domain module index --------------------------------------------------- */ + +table.modindextable td { + padding: 2px; + border-collapse: collapse; +} + +/* -- general body styles --------------------------------------------------- */ + +div.body { + min-width: 450px; + max-width: 800px; +} + +div.body p, div.body dd, div.body li, div.body blockquote { + -moz-hyphens: auto; + -ms-hyphens: auto; + -webkit-hyphens: auto; + hyphens: auto; +} + +a.headerlink { + visibility: hidden; +} + +a.brackets:before, +span.brackets > a:before{ + content: "["; +} + +a.brackets:after, +span.brackets > a:after { + content: "]"; +} + +h1:hover > a.headerlink, +h2:hover > a.headerlink, +h3:hover > a.headerlink, +h4:hover > a.headerlink, +h5:hover > a.headerlink, +h6:hover > a.headerlink, +dt:hover > a.headerlink, +caption:hover > a.headerlink, +p.caption:hover > a.headerlink, +div.code-block-caption:hover > a.headerlink { + visibility: visible; +} + +div.body p.caption { + text-align: inherit; +} + +div.body td { + text-align: left; +} + +.first { + margin-top: 0 !important; +} + +p.rubric { + margin-top: 30px; + font-weight: bold; +} + +img.align-left, figure.align-left, .figure.align-left, object.align-left { + clear: left; + float: left; + margin-right: 1em; +} + +img.align-right, figure.align-right, .figure.align-right, object.align-right { + clear: right; + float: right; + margin-left: 1em; +} + +img.align-center, figure.align-center, .figure.align-center, object.align-center { + display: block; + margin-left: auto; + margin-right: auto; +} + +img.align-default, figure.align-default, .figure.align-default { + display: block; + margin-left: auto; + margin-right: auto; +} + +.align-left { + text-align: left; +} + +.align-center { + text-align: center; +} + +.align-default { + text-align: center; +} + +.align-right { + text-align: right; +} + +/* -- sidebars -------------------------------------------------------------- */ + +div.sidebar, +aside.sidebar { + margin: 0 0 0.5em 1em; + border: 1px solid #ddb; + padding: 7px; + background-color: #ffe; + width: 40%; + float: right; + clear: right; + overflow-x: auto; +} + +p.sidebar-title { + font-weight: bold; +} + +div.admonition, div.topic, blockquote { + clear: left; +} + +/* -- topics ---------------------------------------------------------------- */ + +div.topic { + border: 1px solid #ccc; + padding: 7px; + margin: 10px 0 10px 0; +} + +p.topic-title { + font-size: 1.1em; + font-weight: bold; + margin-top: 10px; +} + +/* -- admonitions ----------------------------------------------------------- */ + +div.admonition { + margin-top: 10px; + margin-bottom: 10px; + padding: 7px; +} + +div.admonition dt { + font-weight: bold; +} + +p.admonition-title { + margin: 0px 10px 5px 0px; + font-weight: bold; +} + +div.body p.centered { + text-align: center; + margin-top: 25px; +} + +/* -- content of sidebars/topics/admonitions -------------------------------- */ + +div.sidebar > :last-child, +aside.sidebar > :last-child, +div.topic > :last-child, +div.admonition > :last-child { + margin-bottom: 0; +} + +div.sidebar::after, +aside.sidebar::after, +div.topic::after, +div.admonition::after, +blockquote::after { + display: block; + content: ''; + clear: both; +} + +/* -- tables ---------------------------------------------------------------- */ + +table.docutils { + margin-top: 10px; + margin-bottom: 10px; + border: 0; + border-collapse: collapse; +} + +table.align-center { + margin-left: auto; + margin-right: auto; +} + +table.align-default { + margin-left: auto; + margin-right: auto; +} + +table caption span.caption-number { + font-style: italic; +} + +table caption span.caption-text { +} + +table.docutils td, table.docutils th { + padding: 1px 8px 1px 5px; + border-top: 0; + border-left: 0; + border-right: 0; + border-bottom: 1px solid #aaa; +} + +table.footnote td, table.footnote th { + border: 0 !important; +} + +th { + text-align: left; + padding-right: 5px; +} + +table.citation { + border-left: solid 1px gray; + margin-left: 1px; +} + +table.citation td { + border-bottom: none; +} + +th > :first-child, +td > :first-child { + margin-top: 0px; +} + +th > :last-child, +td > :last-child { + margin-bottom: 0px; +} + +/* -- figures --------------------------------------------------------------- */ + +div.figure, figure { + margin: 0.5em; + padding: 0.5em; +} + +div.figure p.caption, figcaption { + padding: 0.3em; +} + +div.figure p.caption span.caption-number, +figcaption span.caption-number { + font-style: italic; +} + +div.figure p.caption span.caption-text, +figcaption span.caption-text { +} + +/* -- field list styles ----------------------------------------------------- */ + +table.field-list td, table.field-list th { + border: 0 !important; +} + +.field-list ul { + margin: 0; + padding-left: 1em; +} + +.field-list p { + margin: 0; +} + +.field-name { + -moz-hyphens: manual; + -ms-hyphens: manual; + -webkit-hyphens: manual; + hyphens: manual; +} + +/* -- hlist styles ---------------------------------------------------------- */ + +table.hlist { + margin: 1em 0; +} + +table.hlist td { + vertical-align: top; +} + +/* -- object description styles --------------------------------------------- */ + +.sig { + font-family: 'Consolas', 'Menlo', 'DejaVu Sans Mono', 'Bitstream Vera Sans Mono', monospace; +} + +.sig-name, code.descname { + background-color: transparent; + font-weight: bold; +} + +.sig-name { + font-size: 1.1em; +} + +code.descname { + font-size: 1.2em; +} + +.sig-prename, code.descclassname { + background-color: transparent; +} + +.optional { + font-size: 1.3em; +} + +.sig-paren { + font-size: larger; +} + +.sig-param.n { + font-style: italic; +} + +/* C++ specific styling */ + +.sig-inline.c-texpr, +.sig-inline.cpp-texpr { + font-family: unset; +} + +.sig.c .k, .sig.c .kt, +.sig.cpp .k, .sig.cpp .kt { + color: #0033B3; +} + +.sig.c .m, +.sig.cpp .m { + color: #1750EB; +} + +.sig.c .s, .sig.c .sc, +.sig.cpp .s, .sig.cpp .sc { + color: #067D17; +} + + +/* -- other body styles ----------------------------------------------------- */ + +ol.arabic { + list-style: decimal; +} + +ol.loweralpha { + list-style: lower-alpha; +} + +ol.upperalpha { + list-style: upper-alpha; +} + +ol.lowerroman { + list-style: lower-roman; +} + +ol.upperroman { + list-style: upper-roman; +} + +:not(li) > ol > li:first-child > :first-child, +:not(li) > ul > li:first-child > :first-child { + margin-top: 0px; +} + +:not(li) > ol > li:last-child > :last-child, +:not(li) > ul > li:last-child > :last-child { + margin-bottom: 0px; +} + +ol.simple ol p, +ol.simple ul p, +ul.simple ol p, +ul.simple ul p { + margin-top: 0; +} + +ol.simple > li:not(:first-child) > p, +ul.simple > li:not(:first-child) > p { + margin-top: 0; +} + +ol.simple p, +ul.simple p { + margin-bottom: 0; +} + +dl.footnote > dt, +dl.citation > dt { + float: left; + margin-right: 0.5em; +} + +dl.footnote > dd, +dl.citation > dd { + margin-bottom: 0em; +} + +dl.footnote > dd:after, +dl.citation > dd:after { + content: ""; + clear: both; +} + +dl.field-list { + display: grid; + grid-template-columns: fit-content(30%) auto; +} + +dl.field-list > dt { + font-weight: bold; + word-break: break-word; + padding-left: 0.5em; + padding-right: 5px; +} + +dl.field-list > dt:after { + content: ":"; +} + +dl.field-list > dd { + padding-left: 0.5em; + margin-top: 0em; + margin-left: 0em; + margin-bottom: 0em; +} + +dl { + margin-bottom: 15px; +} + +dd > :first-child { + margin-top: 0px; +} + +dd ul, dd table { + margin-bottom: 10px; +} + +dd { + margin-top: 3px; + margin-bottom: 10px; + margin-left: 30px; +} + +dl > dd:last-child, +dl > dd:last-child > :last-child { + margin-bottom: 0; +} + +dt:target, span.highlighted { + background-color: #fbe54e; +} + +rect.highlighted { + fill: #fbe54e; +} + +dl.glossary dt { + font-weight: bold; + font-size: 1.1em; +} + +.versionmodified { + font-style: italic; +} + +.system-message { + background-color: #fda; + padding: 5px; + border: 3px solid red; +} + +.footnote:target { + background-color: #ffa; +} + +.line-block { + display: block; + margin-top: 1em; + margin-bottom: 1em; +} + +.line-block .line-block { + margin-top: 0; + margin-bottom: 0; + margin-left: 1.5em; +} + +.guilabel, .menuselection { + font-family: sans-serif; +} + +.accelerator { + text-decoration: underline; +} + +.classifier { + font-style: oblique; +} + +.classifier:before { + font-style: normal; + margin: 0 0.5em; + content: ":"; + display: inline-block; +} + +abbr, acronym { + border-bottom: dotted 1px; + cursor: help; +} + +/* -- code displays --------------------------------------------------------- */ + +pre { + overflow: auto; + overflow-y: hidden; /* fixes display issues on Chrome browsers */ +} + +pre, div[class*="highlight-"] { + clear: both; +} + +span.pre { + -moz-hyphens: none; + -ms-hyphens: none; + -webkit-hyphens: none; + hyphens: none; + white-space: nowrap; +} + +div[class*="highlight-"] { + margin: 1em 0; +} + +td.linenos pre { + border: 0; + background-color: transparent; + color: #aaa; +} + +table.highlighttable { + display: block; +} + +table.highlighttable tbody { + display: block; +} + +table.highlighttable tr { + display: flex; +} + +table.highlighttable td { + margin: 0; + padding: 0; +} + +table.highlighttable td.linenos { + padding-right: 0.5em; +} + +table.highlighttable td.code { + flex: 1; + overflow: hidden; +} + +.highlight .hll { + display: block; +} + +div.highlight pre, +table.highlighttable pre { + margin: 0; +} + +div.code-block-caption + div { + margin-top: 0; +} + +div.code-block-caption { + margin-top: 1em; + padding: 2px 5px; + font-size: small; +} + +div.code-block-caption code { + background-color: transparent; +} + +table.highlighttable td.linenos, +span.linenos, +div.highlight span.gp { /* gp: Generic.Prompt */ + user-select: none; + -webkit-user-select: text; /* Safari fallback only */ + -webkit-user-select: none; /* Chrome/Safari */ + -moz-user-select: none; /* Firefox */ + -ms-user-select: none; /* IE10+ */ +} + +div.code-block-caption span.caption-number { + padding: 0.1em 0.3em; + font-style: italic; +} + +div.code-block-caption span.caption-text { +} + +div.literal-block-wrapper { + margin: 1em 0; +} + +code.xref, a code { + background-color: transparent; + font-weight: bold; +} + +h1 code, h2 code, h3 code, h4 code, h5 code, h6 code { + background-color: transparent; +} + +.viewcode-link { + float: right; +} + +.viewcode-back { + float: right; + font-family: sans-serif; +} + +div.viewcode-block:target { + margin: -1px -10px; + padding: 0 10px; +} + +/* -- math display ---------------------------------------------------------- */ + +img.math { + vertical-align: middle; +} + +div.body div.math p { + text-align: center; +} + +span.eqno { + float: right; +} + +span.eqno a.headerlink { + position: absolute; + z-index: 1; +} + +div.math:hover a.headerlink { + visibility: visible; +} + +/* -- printout stylesheet --------------------------------------------------- */ + +@media print { + div.document, + div.documentwrapper, + div.bodywrapper { + margin: 0 !important; + width: 100%; + } + + div.sphinxsidebar, + div.related, + div.footer, + #top-link { + display: none; + } +} \ No newline at end of file diff --git a/_preview/4/_static/check-solid.svg b/_preview/4/_static/check-solid.svg new file mode 100644 index 0000000..92fad4b --- /dev/null +++ b/_preview/4/_static/check-solid.svg @@ -0,0 +1,4 @@ + + + + diff --git a/_preview/4/_static/clipboard.min.js b/_preview/4/_static/clipboard.min.js new file mode 100644 index 0000000..54b3c46 --- /dev/null +++ b/_preview/4/_static/clipboard.min.js @@ -0,0 +1,7 @@ +/*! + * clipboard.js v2.0.8 + * https://clipboardjs.com/ + * + * Licensed MIT © Zeno Rocha + */ +!function(t,e){"object"==typeof exports&&"object"==typeof module?module.exports=e():"function"==typeof define&&define.amd?define([],e):"object"==typeof exports?exports.ClipboardJS=e():t.ClipboardJS=e()}(this,function(){return n={686:function(t,e,n){"use strict";n.d(e,{default:function(){return o}});var e=n(279),i=n.n(e),e=n(370),u=n.n(e),e=n(817),c=n.n(e);function a(t){try{return document.execCommand(t)}catch(t){return}}var f=function(t){t=c()(t);return a("cut"),t};var l=function(t){var e,n,o,r=1 + + + + diff --git a/_preview/4/_static/copybutton.css b/_preview/4/_static/copybutton.css new file mode 100644 index 0000000..f1916ec --- /dev/null +++ b/_preview/4/_static/copybutton.css @@ -0,0 +1,94 @@ +/* Copy buttons */ +button.copybtn { + position: absolute; + display: flex; + top: .3em; + right: .3em; + width: 1.7em; + height: 1.7em; + opacity: 0; + transition: opacity 0.3s, border .3s, background-color .3s; + user-select: none; + padding: 0; + border: none; + outline: none; + border-radius: 0.4em; + /* The colors that GitHub uses */ + border: #1b1f2426 1px solid; + background-color: #f6f8fa; + color: #57606a; +} + +button.copybtn.success { + border-color: #22863a; + color: #22863a; +} + +button.copybtn svg { + stroke: currentColor; + width: 1.5em; + height: 1.5em; + padding: 0.1em; +} + +div.highlight { + position: relative; +} + +/* Show the copybutton */ +.highlight:hover button.copybtn, button.copybtn.success { + opacity: 1; +} + +.highlight button.copybtn:hover { + background-color: rgb(235, 235, 235); +} + +.highlight button.copybtn:active { + background-color: rgb(187, 187, 187); +} + +/** + * A minimal CSS-only tooltip copied from: + * https://codepen.io/mildrenben/pen/rVBrpK + * + * To use, write HTML like the following: + * + *

Short

+ */ + .o-tooltip--left { + position: relative; + } + + .o-tooltip--left:after { + opacity: 0; + visibility: hidden; + position: absolute; + content: attr(data-tooltip); + padding: .2em; + font-size: .8em; + left: -.2em; + background: grey; + color: white; + white-space: nowrap; + z-index: 2; + border-radius: 2px; + transform: translateX(-102%) translateY(0); + transition: opacity 0.2s cubic-bezier(0.64, 0.09, 0.08, 1), transform 0.2s cubic-bezier(0.64, 0.09, 0.08, 1); +} + +.o-tooltip--left:hover:after { + display: block; + opacity: 1; + visibility: visible; + transform: translateX(-100%) translateY(0); + transition: opacity 0.2s cubic-bezier(0.64, 0.09, 0.08, 1), transform 0.2s cubic-bezier(0.64, 0.09, 0.08, 1); + transition-delay: .5s; +} + +/* By default the copy button shouldn't show up when printing a page */ +@media print { + button.copybtn { + display: none; + } +} diff --git a/_preview/4/_static/copybutton.js b/_preview/4/_static/copybutton.js new file mode 100644 index 0000000..2ea7ff3 --- /dev/null +++ b/_preview/4/_static/copybutton.js @@ -0,0 +1,248 @@ +// Localization support +const messages = { + 'en': { + 'copy': 'Copy', + 'copy_to_clipboard': 'Copy to clipboard', + 'copy_success': 'Copied!', + 'copy_failure': 'Failed to copy', + }, + 'es' : { + 'copy': 'Copiar', + 'copy_to_clipboard': 'Copiar al portapapeles', + 'copy_success': '¡Copiado!', + 'copy_failure': 'Error al copiar', + }, + 'de' : { + 'copy': 'Kopieren', + 'copy_to_clipboard': 'In die Zwischenablage kopieren', + 'copy_success': 'Kopiert!', + 'copy_failure': 'Fehler beim Kopieren', + }, + 'fr' : { + 'copy': 'Copier', + 'copy_to_clipboard': 'Copier dans le presse-papier', + 'copy_success': 'Copié !', + 'copy_failure': 'Échec de la copie', + }, + 'ru': { + 'copy': 'Скопировать', + 'copy_to_clipboard': 'Скопировать в буфер', + 'copy_success': 'Скопировано!', + 'copy_failure': 'Не удалось скопировать', + }, + 'zh-CN': { + 'copy': '复制', + 'copy_to_clipboard': '复制到剪贴板', + 'copy_success': '复制成功!', + 'copy_failure': '复制失败', + }, + 'it' : { + 'copy': 'Copiare', + 'copy_to_clipboard': 'Copiato negli appunti', + 'copy_success': 'Copiato!', + 'copy_failure': 'Errore durante la copia', + } +} + +let locale = 'en' +if( document.documentElement.lang !== undefined + && messages[document.documentElement.lang] !== undefined ) { + locale = document.documentElement.lang +} + +let doc_url_root = DOCUMENTATION_OPTIONS.URL_ROOT; +if (doc_url_root == '#') { + doc_url_root = ''; +} + +/** + * SVG files for our copy buttons + */ +let iconCheck = ` + ${messages[locale]['copy_success']} + + +` + +// If the user specified their own SVG use that, otherwise use the default +let iconCopy = ``; +if (!iconCopy) { + iconCopy = ` + ${messages[locale]['copy_to_clipboard']} + + + +` +} + +/** + * Set up copy/paste for code blocks + */ + +const runWhenDOMLoaded = cb => { + if (document.readyState != 'loading') { + cb() + } else if (document.addEventListener) { + document.addEventListener('DOMContentLoaded', cb) + } else { + document.attachEvent('onreadystatechange', function() { + if (document.readyState == 'complete') cb() + }) + } +} + +const codeCellId = index => `codecell${index}` + +// Clears selected text since ClipboardJS will select the text when copying +const clearSelection = () => { + if (window.getSelection) { + window.getSelection().removeAllRanges() + } else if (document.selection) { + document.selection.empty() + } +} + +// Changes tooltip text for a moment, then changes it back +// We want the timeout of our `success` class to be a bit shorter than the +// tooltip and icon change, so that we can hide the icon before changing back. +var timeoutIcon = 2000; +var timeoutSuccessClass = 1500; + +const temporarilyChangeTooltip = (el, oldText, newText) => { + el.setAttribute('data-tooltip', newText) + el.classList.add('success') + // Remove success a little bit sooner than we change the tooltip + // So that we can use CSS to hide the copybutton first + setTimeout(() => el.classList.remove('success'), timeoutSuccessClass) + setTimeout(() => el.setAttribute('data-tooltip', oldText), timeoutIcon) +} + +// Changes the copy button icon for two seconds, then changes it back +const temporarilyChangeIcon = (el) => { + el.innerHTML = iconCheck; + setTimeout(() => {el.innerHTML = iconCopy}, timeoutIcon) +} + +const addCopyButtonToCodeCells = () => { + // If ClipboardJS hasn't loaded, wait a bit and try again. This + // happens because we load ClipboardJS asynchronously. + if (window.ClipboardJS === undefined) { + setTimeout(addCopyButtonToCodeCells, 250) + return + } + + // Add copybuttons to all of our code cells + const COPYBUTTON_SELECTOR = 'div.highlight pre'; + const codeCells = document.querySelectorAll(COPYBUTTON_SELECTOR) + codeCells.forEach((codeCell, index) => { + const id = codeCellId(index) + codeCell.setAttribute('id', id) + + const clipboardButton = id => + `` + codeCell.insertAdjacentHTML('afterend', clipboardButton(id)) + }) + +function escapeRegExp(string) { + return string.replace(/[.*+?^${}()|[\]\\]/g, '\\$&'); // $& means the whole matched string +} + +/** + * Removes excluded text from a Node. + * + * @param {Node} target Node to filter. + * @param {string} exclude CSS selector of nodes to exclude. + * @returns {DOMString} Text from `target` with text removed. + */ +function filterText(target, exclude) { + const clone = target.cloneNode(true); // clone as to not modify the live DOM + if (exclude) { + // remove excluded nodes + clone.querySelectorAll(exclude).forEach(node => node.remove()); + } + return clone.innerText; +} + +// Callback when a copy button is clicked. Will be passed the node that was clicked +// should then grab the text and replace pieces of text that shouldn't be used in output +function formatCopyText(textContent, copybuttonPromptText, isRegexp = false, onlyCopyPromptLines = true, removePrompts = true, copyEmptyLines = true, lineContinuationChar = "", hereDocDelim = "") { + var regexp; + var match; + + // Do we check for line continuation characters and "HERE-documents"? + var useLineCont = !!lineContinuationChar + var useHereDoc = !!hereDocDelim + + // create regexp to capture prompt and remaining line + if (isRegexp) { + regexp = new RegExp('^(' + copybuttonPromptText + ')(.*)') + } else { + regexp = new RegExp('^(' + escapeRegExp(copybuttonPromptText) + ')(.*)') + } + + const outputLines = []; + var promptFound = false; + var gotLineCont = false; + var gotHereDoc = false; + const lineGotPrompt = []; + for (const line of textContent.split('\n')) { + match = line.match(regexp) + if (match || gotLineCont || gotHereDoc) { + promptFound = regexp.test(line) + lineGotPrompt.push(promptFound) + if (removePrompts && promptFound) { + outputLines.push(match[2]) + } else { + outputLines.push(line) + } + gotLineCont = line.endsWith(lineContinuationChar) & useLineCont + if (line.includes(hereDocDelim) & useHereDoc) + gotHereDoc = !gotHereDoc + } else if (!onlyCopyPromptLines) { + outputLines.push(line) + } else if (copyEmptyLines && line.trim() === '') { + outputLines.push(line) + } + } + + // If no lines with the prompt were found then just use original lines + if (lineGotPrompt.some(v => v === true)) { + textContent = outputLines.join('\n'); + } + + // Remove a trailing newline to avoid auto-running when pasting + if (textContent.endsWith("\n")) { + textContent = textContent.slice(0, -1) + } + return textContent +} + + +var copyTargetText = (trigger) => { + var target = document.querySelector(trigger.attributes['data-clipboard-target'].value); + + // get filtered text + let exclude = '.linenos'; + + let text = filterText(target, exclude); + return formatCopyText(text, '', false, true, true, true, '', '') +} + + // Initialize with a callback so we can modify the text before copy + const clipboard = new ClipboardJS('.copybtn', {text: copyTargetText}) + + // Update UI with error/success messages + clipboard.on('success', event => { + clearSelection() + temporarilyChangeTooltip(event.trigger, messages[locale]['copy'], messages[locale]['copy_success']) + temporarilyChangeIcon(event.trigger) + }) + + clipboard.on('error', event => { + temporarilyChangeTooltip(event.trigger, messages[locale]['copy'], messages[locale]['copy_failure']) + }) +} + +runWhenDOMLoaded(addCopyButtonToCodeCells) \ No newline at end of file diff --git a/_preview/4/_static/copybutton_funcs.js b/_preview/4/_static/copybutton_funcs.js new file mode 100644 index 0000000..dbe1aaa --- /dev/null +++ b/_preview/4/_static/copybutton_funcs.js @@ -0,0 +1,73 @@ +function escapeRegExp(string) { + return string.replace(/[.*+?^${}()|[\]\\]/g, '\\$&'); // $& means the whole matched string +} + +/** + * Removes excluded text from a Node. + * + * @param {Node} target Node to filter. + * @param {string} exclude CSS selector of nodes to exclude. + * @returns {DOMString} Text from `target` with text removed. + */ +export function filterText(target, exclude) { + const clone = target.cloneNode(true); // clone as to not modify the live DOM + if (exclude) { + // remove excluded nodes + clone.querySelectorAll(exclude).forEach(node => node.remove()); + } + return clone.innerText; +} + +// Callback when a copy button is clicked. Will be passed the node that was clicked +// should then grab the text and replace pieces of text that shouldn't be used in output +export function formatCopyText(textContent, copybuttonPromptText, isRegexp = false, onlyCopyPromptLines = true, removePrompts = true, copyEmptyLines = true, lineContinuationChar = "", hereDocDelim = "") { + var regexp; + var match; + + // Do we check for line continuation characters and "HERE-documents"? + var useLineCont = !!lineContinuationChar + var useHereDoc = !!hereDocDelim + + // create regexp to capture prompt and remaining line + if (isRegexp) { + regexp = new RegExp('^(' + copybuttonPromptText + ')(.*)') + } else { + regexp = new RegExp('^(' + escapeRegExp(copybuttonPromptText) + ')(.*)') + } + + const outputLines = []; + var promptFound = false; + var gotLineCont = false; + var gotHereDoc = false; + const lineGotPrompt = []; + for (const line of textContent.split('\n')) { + match = line.match(regexp) + if (match || gotLineCont || gotHereDoc) { + promptFound = regexp.test(line) + lineGotPrompt.push(promptFound) + if (removePrompts && promptFound) { + outputLines.push(match[2]) + } else { + outputLines.push(line) + } + gotLineCont = line.endsWith(lineContinuationChar) & useLineCont + if (line.includes(hereDocDelim) & useHereDoc) + gotHereDoc = !gotHereDoc + } else if (!onlyCopyPromptLines) { + outputLines.push(line) + } else if (copyEmptyLines && line.trim() === '') { + outputLines.push(line) + } + } + + // If no lines with the prompt were found then just use original lines + if (lineGotPrompt.some(v => v === true)) { + textContent = outputLines.join('\n'); + } + + // Remove a trailing newline to avoid auto-running when pasting + if (textContent.endsWith("\n")) { + textContent = textContent.slice(0, -1) + } + return textContent +} diff --git a/_preview/4/_static/css/blank.css b/_preview/4/_static/css/blank.css new file mode 100644 index 0000000..8a686ec --- /dev/null +++ b/_preview/4/_static/css/blank.css @@ -0,0 +1,2 @@ +/* This file is intentionally left blank to override the stylesheet of the +parent theme via theme.conf. The parent style we import directly in theme.css */ \ No newline at end of file diff --git a/_preview/4/_static/css/index.ff1ffe594081f20da1ef19478df9384b.css b/_preview/4/_static/css/index.ff1ffe594081f20da1ef19478df9384b.css new file mode 100644 index 0000000..9b1c5d7 --- /dev/null +++ b/_preview/4/_static/css/index.ff1ffe594081f20da1ef19478df9384b.css @@ -0,0 +1,6 @@ +/*! + * Bootstrap v4.5.0 (https://getbootstrap.com/) + * Copyright 2011-2020 The Bootstrap Authors + * Copyright 2011-2020 Twitter, Inc. + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + */:root{--blue:#007bff;--indigo:#6610f2;--purple:#6f42c1;--pink:#e83e8c;--red:#dc3545;--orange:#fd7e14;--yellow:#ffc107;--green:#28a745;--teal:#20c997;--cyan:#17a2b8;--white:#fff;--gray:#6c757d;--gray-dark:#343a40;--primary:#007bff;--secondary:#6c757d;--success:#28a745;--info:#17a2b8;--warning:#ffc107;--danger:#dc3545;--light:#f8f9fa;--dark:#343a40;--breakpoint-xs:0;--breakpoint-sm:540px;--breakpoint-md:720px;--breakpoint-lg:960px;--breakpoint-xl:1200px;--font-family-sans-serif:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,"Noto Sans",sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--font-family-monospace:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace}*,:after,:before{box-sizing:border-box}html{font-family:sans-serif;line-height:1.15;-webkit-text-size-adjust:100%;-webkit-tap-highlight-color:rgba(0,0,0,0)}article,aside,figcaption,figure,footer,header,hgroup,main,nav,section{display:block}body{margin:0;font-family:-apple-system,BlinkMacSystemFont,Segoe UI,Roboto,Helvetica Neue,Arial,Noto Sans,sans-serif,Apple Color Emoji,Segoe UI Emoji,Segoe UI Symbol,Noto Color Emoji;font-size:1rem;line-height:1.5;color:#212529;text-align:left}[tabindex="-1"]:focus:not(:focus-visible){outline:0!important}hr{box-sizing:content-box;height:0;overflow:visible}h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:.5rem}p{margin-top:0;margin-bottom:1rem}abbr[data-original-title],abbr[title]{text-decoration:underline;text-decoration:underline dotted;cursor:help;border-bottom:0;text-decoration-skip-ink:none}address{font-style:normal;line-height:inherit}address,dl,ol,ul{margin-bottom:1rem}dl,ol,ul{margin-top:0}ol ol,ol ul,ul ol,ul ul{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}blockquote{margin:0 0 1rem}b,strong{font-weight:bolder}small{font-size:80%}sub,sup{position:relative;font-size:75%;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}a{color:#007bff;background-color:transparent}a:hover{color:#0056b3}a:not([href]),a:not([href]):hover{color:inherit;text-decoration:none}code,kbd,pre,samp{font-family:SFMono-Regular,Menlo,Monaco,Consolas,Liberation Mono,Courier New,monospace;font-size:1em}pre{margin-top:0;margin-bottom:1rem;overflow:auto;-ms-overflow-style:scrollbar}figure{margin:0 0 1rem}img{border-style:none}img,svg{vertical-align:middle}svg{overflow:hidden}table{border-collapse:collapse}caption{padding-top:.75rem;padding-bottom:.75rem;color:#6c757d;text-align:left;caption-side:bottom}th{text-align:inherit}label{display:inline-block;margin-bottom:.5rem}button{border-radius:0}button:focus{outline:1px dotted;outline:5px auto -webkit-focus-ring-color}button,input,optgroup,select,textarea{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button,input{overflow:visible}button,select{text-transform:none}[role=button]{cursor:pointer}select{word-wrap:normal}[type=button],[type=reset],[type=submit],button{-webkit-appearance:button}[type=button]:not(:disabled),[type=reset]:not(:disabled),[type=submit]:not(:disabled),button:not(:disabled){cursor:pointer}[type=button]::-moz-focus-inner,[type=reset]::-moz-focus-inner,[type=submit]::-moz-focus-inner,button::-moz-focus-inner{padding:0;border-style:none}input[type=checkbox],input[type=radio]{box-sizing:border-box;padding:0}textarea{overflow:auto;resize:vertical}fieldset{min-width:0;padding:0;margin:0;border:0}legend{display:block;width:100%;max-width:100%;padding:0;margin-bottom:.5rem;font-size:1.5rem;line-height:inherit;color:inherit;white-space:normal}progress{vertical-align:baseline}[type=number]::-webkit-inner-spin-button,[type=number]::-webkit-outer-spin-button{height:auto}[type=search]{outline-offset:-2px;-webkit-appearance:none}[type=search]::-webkit-search-decoration{-webkit-appearance:none}::-webkit-file-upload-button{font:inherit;-webkit-appearance:button}output{display:inline-block}summary{display:list-item;cursor:pointer}template{display:none}[hidden]{display:none!important}.h1,.h2,.h3,.h4,.h5,.h6,h1,h2,h3,h4,h5,h6{margin-bottom:.5rem;font-weight:500;line-height:1.2}.h1,h1{font-size:2.5rem}.h2,h2{font-size:2rem}.h3,h3{font-size:1.75rem}.h4,h4{font-size:1.5rem}.h5,h5{font-size:1.25rem}.h6,h6{font-size:1rem}.lead{font-size:1.25rem;font-weight:300}.display-1{font-size:6rem}.display-1,.display-2{font-weight:300;line-height:1.2}.display-2{font-size:5.5rem}.display-3{font-size:4.5rem}.display-3,.display-4{font-weight:300;line-height:1.2}.display-4{font-size:3.5rem}hr{margin-top:1rem;margin-bottom:1rem;border-top:1px solid rgba(0,0,0,.1)}.small,small{font-size:80%;font-weight:400}.mark,mark{padding:.2em;background-color:#fcf8e3}.list-inline,.list-unstyled{padding-left:0;list-style:none}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.initialism{font-size:90%;text-transform:uppercase}.blockquote{margin-bottom:1rem;font-size:1.25rem}.blockquote-footer{display:block;font-size:80%;color:#6c757d}.blockquote-footer:before{content:"\2014\00A0"}.img-fluid,.img-thumbnail{max-width:100%;height:auto}.img-thumbnail{padding:.25rem;background-color:#fff;border:1px solid #dee2e6;border-radius:.25rem}.figure{display:inline-block}.figure-img{margin-bottom:.5rem;line-height:1}.figure-caption{font-size:90%;color:#6c757d}code{font-size:87.5%;color:#e83e8c;word-wrap:break-word}a>code{color:inherit}kbd{padding:.2rem .4rem;font-size:87.5%;color:#fff;background-color:#212529;border-radius:.2rem}kbd kbd{padding:0;font-size:100%;font-weight:700}pre{display:block;font-size:87.5%;color:#212529}pre code{font-size:inherit;color:inherit;word-break:normal}.pre-scrollable{max-height:340px;overflow-y:scroll}.container{width:100%;padding-right:15px;padding-left:15px;margin-right:auto;margin-left:auto}@media (min-width:540px){.container{max-width:540px}}@media (min-width:720px){.container{max-width:720px}}@media (min-width:960px){.container{max-width:960px}}@media (min-width:1200px){.container{max-width:1400px}}.container-fluid,.container-lg,.container-md,.container-sm,.container-xl{width:100%;padding-right:15px;padding-left:15px;margin-right:auto;margin-left:auto}@media (min-width:540px){.container,.container-sm{max-width:540px}}@media (min-width:720px){.container,.container-md,.container-sm{max-width:720px}}@media (min-width:960px){.container,.container-lg,.container-md,.container-sm{max-width:960px}}@media (min-width:1200px){.container,.container-lg,.container-md,.container-sm,.container-xl{max-width:1400px}}.row{display:flex;flex-wrap:wrap;margin-right:-15px;margin-left:-15px}.no-gutters{margin-right:0;margin-left:0}.no-gutters>.col,.no-gutters>[class*=col-]{padding-right:0;padding-left:0}.col,.col-1,.col-2,.col-3,.col-4,.col-5,.col-6,.col-7,.col-8,.col-9,.col-10,.col-11,.col-12,.col-auto,.col-lg,.col-lg-1,.col-lg-2,.col-lg-3,.col-lg-4,.col-lg-5,.col-lg-6,.col-lg-7,.col-lg-8,.col-lg-9,.col-lg-10,.col-lg-11,.col-lg-12,.col-lg-auto,.col-md,.col-md-1,.col-md-2,.col-md-3,.col-md-4,.col-md-5,.col-md-6,.col-md-7,.col-md-8,.col-md-9,.col-md-10,.col-md-11,.col-md-12,.col-md-auto,.col-sm,.col-sm-1,.col-sm-2,.col-sm-3,.col-sm-4,.col-sm-5,.col-sm-6,.col-sm-7,.col-sm-8,.col-sm-9,.col-sm-10,.col-sm-11,.col-sm-12,.col-sm-auto,.col-xl,.col-xl-1,.col-xl-2,.col-xl-3,.col-xl-4,.col-xl-5,.col-xl-6,.col-xl-7,.col-xl-8,.col-xl-9,.col-xl-10,.col-xl-11,.col-xl-12,.col-xl-auto{position:relative;width:100%;padding-right:15px;padding-left:15px}.col{flex-basis:0;flex-grow:1;min-width:0;max-width:100%}.row-cols-1>*{flex:0 0 100%;max-width:100%}.row-cols-2>*{flex:0 0 50%;max-width:50%}.row-cols-3>*{flex:0 0 33.33333%;max-width:33.33333%}.row-cols-4>*{flex:0 0 25%;max-width:25%}.row-cols-5>*{flex:0 0 20%;max-width:20%}.row-cols-6>*{flex:0 0 16.66667%;max-width:16.66667%}.col-auto{flex:0 0 auto;width:auto;max-width:100%}.col-1{flex:0 0 8.33333%;max-width:8.33333%}.col-2{flex:0 0 16.66667%;max-width:16.66667%}.col-3{flex:0 0 25%;max-width:25%}.col-4{flex:0 0 33.33333%;max-width:33.33333%}.col-5{flex:0 0 41.66667%;max-width:41.66667%}.col-6{flex:0 0 50%;max-width:50%}.col-7{flex:0 0 58.33333%;max-width:58.33333%}.col-8{flex:0 0 66.66667%;max-width:66.66667%}.col-9{flex:0 0 75%;max-width:75%}.col-10{flex:0 0 83.33333%;max-width:83.33333%}.col-11{flex:0 0 91.66667%;max-width:91.66667%}.col-12{flex:0 0 100%;max-width:100%}.order-first{order:-1}.order-last{order:13}.order-0{order:0}.order-1{order:1}.order-2{order:2}.order-3{order:3}.order-4{order:4}.order-5{order:5}.order-6{order:6}.order-7{order:7}.order-8{order:8}.order-9{order:9}.order-10{order:10}.order-11{order:11}.order-12{order:12}.offset-1{margin-left:8.33333%}.offset-2{margin-left:16.66667%}.offset-3{margin-left:25%}.offset-4{margin-left:33.33333%}.offset-5{margin-left:41.66667%}.offset-6{margin-left:50%}.offset-7{margin-left:58.33333%}.offset-8{margin-left:66.66667%}.offset-9{margin-left:75%}.offset-10{margin-left:83.33333%}.offset-11{margin-left:91.66667%}@media (min-width:540px){.col-sm{flex-basis:0;flex-grow:1;min-width:0;max-width:100%}.row-cols-sm-1>*{flex:0 0 100%;max-width:100%}.row-cols-sm-2>*{flex:0 0 50%;max-width:50%}.row-cols-sm-3>*{flex:0 0 33.33333%;max-width:33.33333%}.row-cols-sm-4>*{flex:0 0 25%;max-width:25%}.row-cols-sm-5>*{flex:0 0 20%;max-width:20%}.row-cols-sm-6>*{flex:0 0 16.66667%;max-width:16.66667%}.col-sm-auto{flex:0 0 auto;width:auto;max-width:100%}.col-sm-1{flex:0 0 8.33333%;max-width:8.33333%}.col-sm-2{flex:0 0 16.66667%;max-width:16.66667%}.col-sm-3{flex:0 0 25%;max-width:25%}.col-sm-4{flex:0 0 33.33333%;max-width:33.33333%}.col-sm-5{flex:0 0 41.66667%;max-width:41.66667%}.col-sm-6{flex:0 0 50%;max-width:50%}.col-sm-7{flex:0 0 58.33333%;max-width:58.33333%}.col-sm-8{flex:0 0 66.66667%;max-width:66.66667%}.col-sm-9{flex:0 0 75%;max-width:75%}.col-sm-10{flex:0 0 83.33333%;max-width:83.33333%}.col-sm-11{flex:0 0 91.66667%;max-width:91.66667%}.col-sm-12{flex:0 0 100%;max-width:100%}.order-sm-first{order:-1}.order-sm-last{order:13}.order-sm-0{order:0}.order-sm-1{order:1}.order-sm-2{order:2}.order-sm-3{order:3}.order-sm-4{order:4}.order-sm-5{order:5}.order-sm-6{order:6}.order-sm-7{order:7}.order-sm-8{order:8}.order-sm-9{order:9}.order-sm-10{order:10}.order-sm-11{order:11}.order-sm-12{order:12}.offset-sm-0{margin-left:0}.offset-sm-1{margin-left:8.33333%}.offset-sm-2{margin-left:16.66667%}.offset-sm-3{margin-left:25%}.offset-sm-4{margin-left:33.33333%}.offset-sm-5{margin-left:41.66667%}.offset-sm-6{margin-left:50%}.offset-sm-7{margin-left:58.33333%}.offset-sm-8{margin-left:66.66667%}.offset-sm-9{margin-left:75%}.offset-sm-10{margin-left:83.33333%}.offset-sm-11{margin-left:91.66667%}}@media (min-width:720px){.col-md{flex-basis:0;flex-grow:1;min-width:0;max-width:100%}.row-cols-md-1>*{flex:0 0 100%;max-width:100%}.row-cols-md-2>*{flex:0 0 50%;max-width:50%}.row-cols-md-3>*{flex:0 0 33.33333%;max-width:33.33333%}.row-cols-md-4>*{flex:0 0 25%;max-width:25%}.row-cols-md-5>*{flex:0 0 20%;max-width:20%}.row-cols-md-6>*{flex:0 0 16.66667%;max-width:16.66667%}.col-md-auto{flex:0 0 auto;width:auto;max-width:100%}.col-md-1{flex:0 0 8.33333%;max-width:8.33333%}.col-md-2{flex:0 0 16.66667%;max-width:16.66667%}.col-md-3{flex:0 0 25%;max-width:25%}.col-md-4{flex:0 0 33.33333%;max-width:33.33333%}.col-md-5{flex:0 0 41.66667%;max-width:41.66667%}.col-md-6{flex:0 0 50%;max-width:50%}.col-md-7{flex:0 0 58.33333%;max-width:58.33333%}.col-md-8{flex:0 0 66.66667%;max-width:66.66667%}.col-md-9{flex:0 0 75%;max-width:75%}.col-md-10{flex:0 0 83.33333%;max-width:83.33333%}.col-md-11{flex:0 0 91.66667%;max-width:91.66667%}.col-md-12{flex:0 0 100%;max-width:100%}.order-md-first{order:-1}.order-md-last{order:13}.order-md-0{order:0}.order-md-1{order:1}.order-md-2{order:2}.order-md-3{order:3}.order-md-4{order:4}.order-md-5{order:5}.order-md-6{order:6}.order-md-7{order:7}.order-md-8{order:8}.order-md-9{order:9}.order-md-10{order:10}.order-md-11{order:11}.order-md-12{order:12}.offset-md-0{margin-left:0}.offset-md-1{margin-left:8.33333%}.offset-md-2{margin-left:16.66667%}.offset-md-3{margin-left:25%}.offset-md-4{margin-left:33.33333%}.offset-md-5{margin-left:41.66667%}.offset-md-6{margin-left:50%}.offset-md-7{margin-left:58.33333%}.offset-md-8{margin-left:66.66667%}.offset-md-9{margin-left:75%}.offset-md-10{margin-left:83.33333%}.offset-md-11{margin-left:91.66667%}}@media (min-width:960px){.col-lg{flex-basis:0;flex-grow:1;min-width:0;max-width:100%}.row-cols-lg-1>*{flex:0 0 100%;max-width:100%}.row-cols-lg-2>*{flex:0 0 50%;max-width:50%}.row-cols-lg-3>*{flex:0 0 33.33333%;max-width:33.33333%}.row-cols-lg-4>*{flex:0 0 25%;max-width:25%}.row-cols-lg-5>*{flex:0 0 20%;max-width:20%}.row-cols-lg-6>*{flex:0 0 16.66667%;max-width:16.66667%}.col-lg-auto{flex:0 0 auto;width:auto;max-width:100%}.col-lg-1{flex:0 0 8.33333%;max-width:8.33333%}.col-lg-2{flex:0 0 16.66667%;max-width:16.66667%}.col-lg-3{flex:0 0 25%;max-width:25%}.col-lg-4{flex:0 0 33.33333%;max-width:33.33333%}.col-lg-5{flex:0 0 41.66667%;max-width:41.66667%}.col-lg-6{flex:0 0 50%;max-width:50%}.col-lg-7{flex:0 0 58.33333%;max-width:58.33333%}.col-lg-8{flex:0 0 66.66667%;max-width:66.66667%}.col-lg-9{flex:0 0 75%;max-width:75%}.col-lg-10{flex:0 0 83.33333%;max-width:83.33333%}.col-lg-11{flex:0 0 91.66667%;max-width:91.66667%}.col-lg-12{flex:0 0 100%;max-width:100%}.order-lg-first{order:-1}.order-lg-last{order:13}.order-lg-0{order:0}.order-lg-1{order:1}.order-lg-2{order:2}.order-lg-3{order:3}.order-lg-4{order:4}.order-lg-5{order:5}.order-lg-6{order:6}.order-lg-7{order:7}.order-lg-8{order:8}.order-lg-9{order:9}.order-lg-10{order:10}.order-lg-11{order:11}.order-lg-12{order:12}.offset-lg-0{margin-left:0}.offset-lg-1{margin-left:8.33333%}.offset-lg-2{margin-left:16.66667%}.offset-lg-3{margin-left:25%}.offset-lg-4{margin-left:33.33333%}.offset-lg-5{margin-left:41.66667%}.offset-lg-6{margin-left:50%}.offset-lg-7{margin-left:58.33333%}.offset-lg-8{margin-left:66.66667%}.offset-lg-9{margin-left:75%}.offset-lg-10{margin-left:83.33333%}.offset-lg-11{margin-left:91.66667%}}@media (min-width:1200px){.col-xl{flex-basis:0;flex-grow:1;min-width:0;max-width:100%}.row-cols-xl-1>*{flex:0 0 100%;max-width:100%}.row-cols-xl-2>*{flex:0 0 50%;max-width:50%}.row-cols-xl-3>*{flex:0 0 33.33333%;max-width:33.33333%}.row-cols-xl-4>*{flex:0 0 25%;max-width:25%}.row-cols-xl-5>*{flex:0 0 20%;max-width:20%}.row-cols-xl-6>*{flex:0 0 16.66667%;max-width:16.66667%}.col-xl-auto{flex:0 0 auto;width:auto;max-width:100%}.col-xl-1{flex:0 0 8.33333%;max-width:8.33333%}.col-xl-2{flex:0 0 16.66667%;max-width:16.66667%}.col-xl-3{flex:0 0 25%;max-width:25%}.col-xl-4{flex:0 0 33.33333%;max-width:33.33333%}.col-xl-5{flex:0 0 41.66667%;max-width:41.66667%}.col-xl-6{flex:0 0 50%;max-width:50%}.col-xl-7{flex:0 0 58.33333%;max-width:58.33333%}.col-xl-8{flex:0 0 66.66667%;max-width:66.66667%}.col-xl-9{flex:0 0 75%;max-width:75%}.col-xl-10{flex:0 0 83.33333%;max-width:83.33333%}.col-xl-11{flex:0 0 91.66667%;max-width:91.66667%}.col-xl-12{flex:0 0 100%;max-width:100%}.order-xl-first{order:-1}.order-xl-last{order:13}.order-xl-0{order:0}.order-xl-1{order:1}.order-xl-2{order:2}.order-xl-3{order:3}.order-xl-4{order:4}.order-xl-5{order:5}.order-xl-6{order:6}.order-xl-7{order:7}.order-xl-8{order:8}.order-xl-9{order:9}.order-xl-10{order:10}.order-xl-11{order:11}.order-xl-12{order:12}.offset-xl-0{margin-left:0}.offset-xl-1{margin-left:8.33333%}.offset-xl-2{margin-left:16.66667%}.offset-xl-3{margin-left:25%}.offset-xl-4{margin-left:33.33333%}.offset-xl-5{margin-left:41.66667%}.offset-xl-6{margin-left:50%}.offset-xl-7{margin-left:58.33333%}.offset-xl-8{margin-left:66.66667%}.offset-xl-9{margin-left:75%}.offset-xl-10{margin-left:83.33333%}.offset-xl-11{margin-left:91.66667%}}.table{width:100%;margin-bottom:1rem;color:#212529}.table td,.table th{padding:.75rem;vertical-align:top;border-top:1px solid #dee2e6}.table thead th{vertical-align:bottom;border-bottom:2px solid #dee2e6}.table tbody+tbody{border-top:2px solid #dee2e6}.table-sm td,.table-sm th{padding:.3rem}.table-bordered,.table-bordered td,.table-bordered th{border:1px solid #dee2e6}.table-bordered thead td,.table-bordered thead th{border-bottom-width:2px}.table-borderless tbody+tbody,.table-borderless td,.table-borderless th,.table-borderless thead th{border:0}.table-striped tbody tr:nth-of-type(odd){background-color:rgba(0,0,0,.05)}.table-hover tbody tr:hover{color:#212529;background-color:rgba(0,0,0,.075)}.table-primary,.table-primary>td,.table-primary>th{background-color:#b8daff}.table-primary tbody+tbody,.table-primary td,.table-primary th,.table-primary thead th{border-color:#7abaff}.table-hover .table-primary:hover,.table-hover .table-primary:hover>td,.table-hover .table-primary:hover>th{background-color:#9fcdff}.table-secondary,.table-secondary>td,.table-secondary>th{background-color:#d6d8db}.table-secondary tbody+tbody,.table-secondary td,.table-secondary th,.table-secondary thead th{border-color:#b3b7bb}.table-hover .table-secondary:hover,.table-hover .table-secondary:hover>td,.table-hover .table-secondary:hover>th{background-color:#c8cbcf}.table-success,.table-success>td,.table-success>th{background-color:#c3e6cb}.table-success tbody+tbody,.table-success td,.table-success th,.table-success thead th{border-color:#8fd19e}.table-hover .table-success:hover,.table-hover .table-success:hover>td,.table-hover .table-success:hover>th{background-color:#b1dfbb}.table-info,.table-info>td,.table-info>th{background-color:#bee5eb}.table-info tbody+tbody,.table-info td,.table-info th,.table-info thead th{border-color:#86cfda}.table-hover .table-info:hover,.table-hover .table-info:hover>td,.table-hover .table-info:hover>th{background-color:#abdde5}.table-warning,.table-warning>td,.table-warning>th{background-color:#ffeeba}.table-warning tbody+tbody,.table-warning td,.table-warning th,.table-warning thead th{border-color:#ffdf7e}.table-hover .table-warning:hover,.table-hover .table-warning:hover>td,.table-hover .table-warning:hover>th{background-color:#ffe8a1}.table-danger,.table-danger>td,.table-danger>th{background-color:#f5c6cb}.table-danger tbody+tbody,.table-danger td,.table-danger th,.table-danger thead th{border-color:#ed969e}.table-hover .table-danger:hover,.table-hover .table-danger:hover>td,.table-hover .table-danger:hover>th{background-color:#f1b0b7}.table-light,.table-light>td,.table-light>th{background-color:#fdfdfe}.table-light tbody+tbody,.table-light td,.table-light th,.table-light thead th{border-color:#fbfcfc}.table-hover .table-light:hover,.table-hover .table-light:hover>td,.table-hover .table-light:hover>th{background-color:#ececf6}.table-dark,.table-dark>td,.table-dark>th{background-color:#c6c8ca}.table-dark tbody+tbody,.table-dark td,.table-dark th,.table-dark thead th{border-color:#95999c}.table-hover .table-dark:hover,.table-hover .table-dark:hover>td,.table-hover .table-dark:hover>th{background-color:#b9bbbe}.table-active,.table-active>td,.table-active>th,.table-hover .table-active:hover,.table-hover .table-active:hover>td,.table-hover .table-active:hover>th{background-color:rgba(0,0,0,.075)}.table .thead-dark th{color:#fff;background-color:#343a40;border-color:#454d55}.table .thead-light th{color:#495057;background-color:#e9ecef;border-color:#dee2e6}.table-dark{color:#fff;background-color:#343a40}.table-dark td,.table-dark th,.table-dark thead th{border-color:#454d55}.table-dark.table-bordered{border:0}.table-dark.table-striped tbody tr:nth-of-type(odd){background-color:hsla(0,0%,100%,.05)}.table-dark.table-hover tbody tr:hover{color:#fff;background-color:hsla(0,0%,100%,.075)}@media (max-width:539.98px){.table-responsive-sm{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch}.table-responsive-sm>.table-bordered{border:0}}@media (max-width:719.98px){.table-responsive-md{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch}.table-responsive-md>.table-bordered{border:0}}@media (max-width:959.98px){.table-responsive-lg{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch}.table-responsive-lg>.table-bordered{border:0}}@media (max-width:1199.98px){.table-responsive-xl{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch}.table-responsive-xl>.table-bordered{border:0}}.table-responsive{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch}.table-responsive>.table-bordered{border:0}.form-control{display:block;width:100%;height:calc(1.5em + .75rem + 2px);padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:#495057;background-color:#fff;background-clip:padding-box;border:1px solid #ced4da;border-radius:.25rem;transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control{transition:none}}.form-control::-ms-expand{background-color:transparent;border:0}.form-control:-moz-focusring{color:transparent;text-shadow:0 0 0 #495057}.form-control:focus{color:#495057;background-color:#fff;border-color:#80bdff;outline:0;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.form-control::placeholder{color:#6c757d;opacity:1}.form-control:disabled,.form-control[readonly]{background-color:#e9ecef;opacity:1}input[type=date].form-control,input[type=datetime-local].form-control,input[type=month].form-control,input[type=time].form-control{appearance:none}select.form-control:focus::-ms-value{color:#495057;background-color:#fff}.form-control-file,.form-control-range{display:block;width:100%}.col-form-label{padding-top:calc(.375rem + 1px);padding-bottom:calc(.375rem + 1px);margin-bottom:0;font-size:inherit;line-height:1.5}.col-form-label-lg{padding-top:calc(.5rem + 1px);padding-bottom:calc(.5rem + 1px);font-size:1.25rem;line-height:1.5}.col-form-label-sm{padding-top:calc(.25rem + 1px);padding-bottom:calc(.25rem + 1px);font-size:.875rem;line-height:1.5}.form-control-plaintext{display:block;width:100%;padding:.375rem 0;margin-bottom:0;font-size:1rem;line-height:1.5;color:#212529;background-color:transparent;border:solid transparent;border-width:1px 0}.form-control-plaintext.form-control-lg,.form-control-plaintext.form-control-sm{padding-right:0;padding-left:0}.form-control-sm{height:calc(1.5em + .5rem + 2px);padding:.25rem .5rem;font-size:.875rem;line-height:1.5;border-radius:.2rem}.form-control-lg{height:calc(1.5em + 1rem + 2px);padding:.5rem 1rem;font-size:1.25rem;line-height:1.5;border-radius:.3rem}select.form-control[multiple],select.form-control[size],textarea.form-control{height:auto}.form-group{margin-bottom:1rem}.form-text{display:block;margin-top:.25rem}.form-row{display:flex;flex-wrap:wrap;margin-right:-5px;margin-left:-5px}.form-row>.col,.form-row>[class*=col-]{padding-right:5px;padding-left:5px}.form-check{position:relative;display:block;padding-left:1.25rem}.form-check-input{position:absolute;margin-top:.3rem;margin-left:-1.25rem}.form-check-input:disabled~.form-check-label,.form-check-input[disabled]~.form-check-label{color:#6c757d}.form-check-label{margin-bottom:0}.form-check-inline{display:inline-flex;align-items:center;padding-left:0;margin-right:.75rem}.form-check-inline .form-check-input{position:static;margin-top:0;margin-right:.3125rem;margin-left:0}.valid-feedback{display:none;width:100%;margin-top:.25rem;font-size:80%;color:#28a745}.valid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;line-height:1.5;color:#fff;background-color:rgba(40,167,69,.9);border-radius:.25rem}.is-valid~.valid-feedback,.is-valid~.valid-tooltip,.was-validated :valid~.valid-feedback,.was-validated :valid~.valid-tooltip{display:block}.form-control.is-valid,.was-validated .form-control:valid{border-color:#28a745;padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' width='8' height='8'%3E%3Cpath fill='%2328a745' d='M2.3 6.73L.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3E%3C/svg%3E");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.form-control.is-valid:focus,.was-validated .form-control:valid:focus{border-color:#28a745;box-shadow:0 0 0 .2rem rgba(40,167,69,.25)}.was-validated textarea.form-control:valid,textarea.form-control.is-valid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.custom-select.is-valid,.was-validated .custom-select:valid{border-color:#28a745;padding-right:calc(.75em + 2.3125rem);background:url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' width='4' height='5'%3E%3Cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3E%3C/svg%3E") no-repeat right .75rem center/8px 10px,url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' width='8' height='8'%3E%3Cpath fill='%2328a745' d='M2.3 6.73L.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3E%3C/svg%3E") #fff no-repeat center right 1.75rem/calc(.75em + .375rem) calc(.75em + .375rem)}.custom-select.is-valid:focus,.was-validated .custom-select:valid:focus{border-color:#28a745;box-shadow:0 0 0 .2rem rgba(40,167,69,.25)}.form-check-input.is-valid~.form-check-label,.was-validated .form-check-input:valid~.form-check-label{color:#28a745}.form-check-input.is-valid~.valid-feedback,.form-check-input.is-valid~.valid-tooltip,.was-validated .form-check-input:valid~.valid-feedback,.was-validated .form-check-input:valid~.valid-tooltip{display:block}.custom-control-input.is-valid~.custom-control-label,.was-validated .custom-control-input:valid~.custom-control-label{color:#28a745}.custom-control-input.is-valid~.custom-control-label:before,.was-validated .custom-control-input:valid~.custom-control-label:before{border-color:#28a745}.custom-control-input.is-valid:checked~.custom-control-label:before,.was-validated .custom-control-input:valid:checked~.custom-control-label:before{border-color:#34ce57;background-color:#34ce57}.custom-control-input.is-valid:focus~.custom-control-label:before,.was-validated .custom-control-input:valid:focus~.custom-control-label:before{box-shadow:0 0 0 .2rem rgba(40,167,69,.25)}.custom-control-input.is-valid:focus:not(:checked)~.custom-control-label:before,.custom-file-input.is-valid~.custom-file-label,.was-validated .custom-control-input:valid:focus:not(:checked)~.custom-control-label:before,.was-validated .custom-file-input:valid~.custom-file-label{border-color:#28a745}.custom-file-input.is-valid:focus~.custom-file-label,.was-validated .custom-file-input:valid:focus~.custom-file-label{border-color:#28a745;box-shadow:0 0 0 .2rem rgba(40,167,69,.25)}.invalid-feedback{display:none;width:100%;margin-top:.25rem;font-size:80%;color:#dc3545}.invalid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;line-height:1.5;color:#fff;background-color:rgba(220,53,69,.9);border-radius:.25rem}.is-invalid~.invalid-feedback,.is-invalid~.invalid-tooltip,.was-validated :invalid~.invalid-feedback,.was-validated :invalid~.invalid-tooltip{display:block}.form-control.is-invalid,.was-validated .form-control:invalid{border-color:#dc3545;padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' width='12' height='12' fill='none' stroke='%23dc3545'%3E%3Ccircle cx='6' cy='6' r='4.5'/%3E%3Cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3E%3Ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3E%3C/svg%3E");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.form-control.is-invalid:focus,.was-validated .form-control:invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .2rem rgba(220,53,69,.25)}.was-validated textarea.form-control:invalid,textarea.form-control.is-invalid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.custom-select.is-invalid,.was-validated .custom-select:invalid{border-color:#dc3545;padding-right:calc(.75em + 2.3125rem);background:url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' width='4' height='5'%3E%3Cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3E%3C/svg%3E") no-repeat right .75rem center/8px 10px,url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' width='12' height='12' fill='none' stroke='%23dc3545'%3E%3Ccircle cx='6' cy='6' r='4.5'/%3E%3Cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3E%3Ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3E%3C/svg%3E") #fff no-repeat center right 1.75rem/calc(.75em + .375rem) calc(.75em + .375rem)}.custom-select.is-invalid:focus,.was-validated .custom-select:invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .2rem rgba(220,53,69,.25)}.form-check-input.is-invalid~.form-check-label,.was-validated .form-check-input:invalid~.form-check-label{color:#dc3545}.form-check-input.is-invalid~.invalid-feedback,.form-check-input.is-invalid~.invalid-tooltip,.was-validated .form-check-input:invalid~.invalid-feedback,.was-validated .form-check-input:invalid~.invalid-tooltip{display:block}.custom-control-input.is-invalid~.custom-control-label,.was-validated .custom-control-input:invalid~.custom-control-label{color:#dc3545}.custom-control-input.is-invalid~.custom-control-label:before,.was-validated .custom-control-input:invalid~.custom-control-label:before{border-color:#dc3545}.custom-control-input.is-invalid:checked~.custom-control-label:before,.was-validated .custom-control-input:invalid:checked~.custom-control-label:before{border-color:#e4606d;background-color:#e4606d}.custom-control-input.is-invalid:focus~.custom-control-label:before,.was-validated .custom-control-input:invalid:focus~.custom-control-label:before{box-shadow:0 0 0 .2rem rgba(220,53,69,.25)}.custom-control-input.is-invalid:focus:not(:checked)~.custom-control-label:before,.custom-file-input.is-invalid~.custom-file-label,.was-validated .custom-control-input:invalid:focus:not(:checked)~.custom-control-label:before,.was-validated .custom-file-input:invalid~.custom-file-label{border-color:#dc3545}.custom-file-input.is-invalid:focus~.custom-file-label,.was-validated .custom-file-input:invalid:focus~.custom-file-label{border-color:#dc3545;box-shadow:0 0 0 .2rem rgba(220,53,69,.25)}.form-inline{display:flex;flex-flow:row wrap;align-items:center}.form-inline .form-check{width:100%}@media (min-width:540px){.form-inline label{justify-content:center}.form-inline .form-group,.form-inline label{display:flex;align-items:center;margin-bottom:0}.form-inline .form-group{flex:0 0 auto;flex-flow:row wrap}.form-inline .form-control{display:inline-block;width:auto;vertical-align:middle}.form-inline .form-control-plaintext{display:inline-block}.form-inline .custom-select,.form-inline .input-group{width:auto}.form-inline .form-check{display:flex;align-items:center;justify-content:center;width:auto;padding-left:0}.form-inline .form-check-input{position:relative;flex-shrink:0;margin-top:0;margin-right:.25rem;margin-left:0}.form-inline .custom-control{align-items:center;justify-content:center}.form-inline .custom-control-label{margin-bottom:0}}.btn{display:inline-block;font-weight:400;color:#212529;text-align:center;vertical-align:middle;user-select:none;background-color:transparent;border:1px solid transparent;padding:.375rem .75rem;font-size:1rem;line-height:1.5;border-radius:.25rem;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.btn{transition:none}}.btn:hover{color:#212529;text-decoration:none}.btn.focus,.btn:focus{outline:0;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.btn.disabled,.btn:disabled{opacity:.65}.btn:not(:disabled):not(.disabled){cursor:pointer}a.btn.disabled,fieldset:disabled a.btn{pointer-events:none}.btn-primary{color:#fff;background-color:#007bff;border-color:#007bff}.btn-primary.focus,.btn-primary:focus,.btn-primary:hover{color:#fff;background-color:#0069d9;border-color:#0062cc}.btn-primary.focus,.btn-primary:focus{box-shadow:0 0 0 .2rem rgba(38,143,255,.5)}.btn-primary.disabled,.btn-primary:disabled{color:#fff;background-color:#007bff;border-color:#007bff}.btn-primary:not(:disabled):not(.disabled).active,.btn-primary:not(:disabled):not(.disabled):active,.show>.btn-primary.dropdown-toggle{color:#fff;background-color:#0062cc;border-color:#005cbf}.btn-primary:not(:disabled):not(.disabled).active:focus,.btn-primary:not(:disabled):not(.disabled):active:focus,.show>.btn-primary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(38,143,255,.5)}.btn-secondary{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-secondary.focus,.btn-secondary:focus,.btn-secondary:hover{color:#fff;background-color:#5a6268;border-color:#545b62}.btn-secondary.focus,.btn-secondary:focus{box-shadow:0 0 0 .2rem rgba(130,138,145,.5)}.btn-secondary.disabled,.btn-secondary:disabled{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-secondary:not(:disabled):not(.disabled).active,.btn-secondary:not(:disabled):not(.disabled):active,.show>.btn-secondary.dropdown-toggle{color:#fff;background-color:#545b62;border-color:#4e555b}.btn-secondary:not(:disabled):not(.disabled).active:focus,.btn-secondary:not(:disabled):not(.disabled):active:focus,.show>.btn-secondary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(130,138,145,.5)}.btn-success{color:#fff;background-color:#28a745;border-color:#28a745}.btn-success.focus,.btn-success:focus,.btn-success:hover{color:#fff;background-color:#218838;border-color:#1e7e34}.btn-success.focus,.btn-success:focus{box-shadow:0 0 0 .2rem rgba(72,180,97,.5)}.btn-success.disabled,.btn-success:disabled{color:#fff;background-color:#28a745;border-color:#28a745}.btn-success:not(:disabled):not(.disabled).active,.btn-success:not(:disabled):not(.disabled):active,.show>.btn-success.dropdown-toggle{color:#fff;background-color:#1e7e34;border-color:#1c7430}.btn-success:not(:disabled):not(.disabled).active:focus,.btn-success:not(:disabled):not(.disabled):active:focus,.show>.btn-success.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(72,180,97,.5)}.btn-info{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-info.focus,.btn-info:focus,.btn-info:hover{color:#fff;background-color:#138496;border-color:#117a8b}.btn-info.focus,.btn-info:focus{box-shadow:0 0 0 .2rem rgba(58,176,195,.5)}.btn-info.disabled,.btn-info:disabled{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-info:not(:disabled):not(.disabled).active,.btn-info:not(:disabled):not(.disabled):active,.show>.btn-info.dropdown-toggle{color:#fff;background-color:#117a8b;border-color:#10707f}.btn-info:not(:disabled):not(.disabled).active:focus,.btn-info:not(:disabled):not(.disabled):active:focus,.show>.btn-info.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(58,176,195,.5)}.btn-warning{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-warning.focus,.btn-warning:focus,.btn-warning:hover{color:#212529;background-color:#e0a800;border-color:#d39e00}.btn-warning.focus,.btn-warning:focus{box-shadow:0 0 0 .2rem rgba(222,170,12,.5)}.btn-warning.disabled,.btn-warning:disabled{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-warning:not(:disabled):not(.disabled).active,.btn-warning:not(:disabled):not(.disabled):active,.show>.btn-warning.dropdown-toggle{color:#212529;background-color:#d39e00;border-color:#c69500}.btn-warning:not(:disabled):not(.disabled).active:focus,.btn-warning:not(:disabled):not(.disabled):active:focus,.show>.btn-warning.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(222,170,12,.5)}.btn-danger{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-danger.focus,.btn-danger:focus,.btn-danger:hover{color:#fff;background-color:#c82333;border-color:#bd2130}.btn-danger.focus,.btn-danger:focus{box-shadow:0 0 0 .2rem rgba(225,83,97,.5)}.btn-danger.disabled,.btn-danger:disabled{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-danger:not(:disabled):not(.disabled).active,.btn-danger:not(:disabled):not(.disabled):active,.show>.btn-danger.dropdown-toggle{color:#fff;background-color:#bd2130;border-color:#b21f2d}.btn-danger:not(:disabled):not(.disabled).active:focus,.btn-danger:not(:disabled):not(.disabled):active:focus,.show>.btn-danger.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(225,83,97,.5)}.btn-light{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-light.focus,.btn-light:focus,.btn-light:hover{color:#212529;background-color:#e2e6ea;border-color:#dae0e5}.btn-light.focus,.btn-light:focus{box-shadow:0 0 0 .2rem rgba(216,217,219,.5)}.btn-light.disabled,.btn-light:disabled{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-light:not(:disabled):not(.disabled).active,.btn-light:not(:disabled):not(.disabled):active,.show>.btn-light.dropdown-toggle{color:#212529;background-color:#dae0e5;border-color:#d3d9df}.btn-light:not(:disabled):not(.disabled).active:focus,.btn-light:not(:disabled):not(.disabled):active:focus,.show>.btn-light.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(216,217,219,.5)}.btn-dark{color:#fff;background-color:#343a40;border-color:#343a40}.btn-dark.focus,.btn-dark:focus,.btn-dark:hover{color:#fff;background-color:#23272b;border-color:#1d2124}.btn-dark.focus,.btn-dark:focus{box-shadow:0 0 0 .2rem rgba(82,88,93,.5)}.btn-dark.disabled,.btn-dark:disabled{color:#fff;background-color:#343a40;border-color:#343a40}.btn-dark:not(:disabled):not(.disabled).active,.btn-dark:not(:disabled):not(.disabled):active,.show>.btn-dark.dropdown-toggle{color:#fff;background-color:#1d2124;border-color:#171a1d}.btn-dark:not(:disabled):not(.disabled).active:focus,.btn-dark:not(:disabled):not(.disabled):active:focus,.show>.btn-dark.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(82,88,93,.5)}.btn-outline-primary{color:#007bff;border-color:#007bff}.btn-outline-primary:hover{color:#fff;background-color:#007bff;border-color:#007bff}.btn-outline-primary.focus,.btn-outline-primary:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-outline-primary.disabled,.btn-outline-primary:disabled{color:#007bff;background-color:transparent}.btn-outline-primary:not(:disabled):not(.disabled).active,.btn-outline-primary:not(:disabled):not(.disabled):active,.show>.btn-outline-primary.dropdown-toggle{color:#fff;background-color:#007bff;border-color:#007bff}.btn-outline-primary:not(:disabled):not(.disabled).active:focus,.btn-outline-primary:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-primary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.btn-outline-secondary{color:#6c757d;border-color:#6c757d}.btn-outline-secondary:hover{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-outline-secondary.focus,.btn-outline-secondary:focus{box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.btn-outline-secondary.disabled,.btn-outline-secondary:disabled{color:#6c757d;background-color:transparent}.btn-outline-secondary:not(:disabled):not(.disabled).active,.btn-outline-secondary:not(:disabled):not(.disabled):active,.show>.btn-outline-secondary.dropdown-toggle{color:#fff;background-color:#6c757d;border-color:#6c757d}.btn-outline-secondary:not(:disabled):not(.disabled).active:focus,.btn-outline-secondary:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-secondary.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.btn-outline-success{color:#28a745;border-color:#28a745}.btn-outline-success:hover{color:#fff;background-color:#28a745;border-color:#28a745}.btn-outline-success.focus,.btn-outline-success:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-outline-success.disabled,.btn-outline-success:disabled{color:#28a745;background-color:transparent}.btn-outline-success:not(:disabled):not(.disabled).active,.btn-outline-success:not(:disabled):not(.disabled):active,.show>.btn-outline-success.dropdown-toggle{color:#fff;background-color:#28a745;border-color:#28a745}.btn-outline-success:not(:disabled):not(.disabled).active:focus,.btn-outline-success:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-success.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.btn-outline-info{color:#17a2b8;border-color:#17a2b8}.btn-outline-info:hover{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-outline-info.focus,.btn-outline-info:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-outline-info.disabled,.btn-outline-info:disabled{color:#17a2b8;background-color:transparent}.btn-outline-info:not(:disabled):not(.disabled).active,.btn-outline-info:not(:disabled):not(.disabled):active,.show>.btn-outline-info.dropdown-toggle{color:#fff;background-color:#17a2b8;border-color:#17a2b8}.btn-outline-info:not(:disabled):not(.disabled).active:focus,.btn-outline-info:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-info.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.btn-outline-warning{color:#ffc107;border-color:#ffc107}.btn-outline-warning:hover{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-outline-warning.focus,.btn-outline-warning:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-outline-warning.disabled,.btn-outline-warning:disabled{color:#ffc107;background-color:transparent}.btn-outline-warning:not(:disabled):not(.disabled).active,.btn-outline-warning:not(:disabled):not(.disabled):active,.show>.btn-outline-warning.dropdown-toggle{color:#212529;background-color:#ffc107;border-color:#ffc107}.btn-outline-warning:not(:disabled):not(.disabled).active:focus,.btn-outline-warning:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-warning.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.btn-outline-danger{color:#dc3545;border-color:#dc3545}.btn-outline-danger:hover{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-outline-danger.focus,.btn-outline-danger:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-outline-danger.disabled,.btn-outline-danger:disabled{color:#dc3545;background-color:transparent}.btn-outline-danger:not(:disabled):not(.disabled).active,.btn-outline-danger:not(:disabled):not(.disabled):active,.show>.btn-outline-danger.dropdown-toggle{color:#fff;background-color:#dc3545;border-color:#dc3545}.btn-outline-danger:not(:disabled):not(.disabled).active:focus,.btn-outline-danger:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-danger.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.btn-outline-light{color:#f8f9fa;border-color:#f8f9fa}.btn-outline-light:hover{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-outline-light.focus,.btn-outline-light:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-outline-light.disabled,.btn-outline-light:disabled{color:#f8f9fa;background-color:transparent}.btn-outline-light:not(:disabled):not(.disabled).active,.btn-outline-light:not(:disabled):not(.disabled):active,.show>.btn-outline-light.dropdown-toggle{color:#212529;background-color:#f8f9fa;border-color:#f8f9fa}.btn-outline-light:not(:disabled):not(.disabled).active:focus,.btn-outline-light:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-light.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.btn-outline-dark{color:#343a40;border-color:#343a40}.btn-outline-dark:hover{color:#fff;background-color:#343a40;border-color:#343a40}.btn-outline-dark.focus,.btn-outline-dark:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-outline-dark.disabled,.btn-outline-dark:disabled{color:#343a40;background-color:transparent}.btn-outline-dark:not(:disabled):not(.disabled).active,.btn-outline-dark:not(:disabled):not(.disabled):active,.show>.btn-outline-dark.dropdown-toggle{color:#fff;background-color:#343a40;border-color:#343a40}.btn-outline-dark:not(:disabled):not(.disabled).active:focus,.btn-outline-dark:not(:disabled):not(.disabled):active:focus,.show>.btn-outline-dark.dropdown-toggle:focus{box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.btn-link{font-weight:400;color:#007bff;text-decoration:none}.btn-link:hover{color:#0056b3}.btn-link.focus,.btn-link:focus,.btn-link:hover{text-decoration:underline}.btn-link.disabled,.btn-link:disabled{color:#6c757d;pointer-events:none}.btn-group-lg>.btn,.btn-lg{padding:.5rem 1rem;font-size:1.25rem;line-height:1.5;border-radius:.3rem}.btn-group-sm>.btn,.btn-sm{padding:.25rem .5rem;font-size:.875rem;line-height:1.5;border-radius:.2rem}.btn-block{display:block;width:100%}.btn-block+.btn-block{margin-top:.5rem}input[type=button].btn-block,input[type=reset].btn-block,input[type=submit].btn-block{width:100%}.fade{transition:opacity .15s linear}@media (prefers-reduced-motion:reduce){.fade{transition:none}}.fade:not(.show){opacity:0}.collapse:not(.show){display:none}.collapsing{position:relative;height:0;overflow:hidden;transition:height .35s ease}@media (prefers-reduced-motion:reduce){.collapsing{transition:none}}.dropdown,.dropleft,.dropright,.dropup{position:relative}.dropdown-toggle{white-space:nowrap}.dropdown-toggle:after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid;border-right:.3em solid transparent;border-bottom:0;border-left:.3em solid transparent}.dropdown-toggle:empty:after{margin-left:0}.dropdown-menu{position:absolute;top:100%;left:0;z-index:1000;display:none;float:left;min-width:10rem;padding:.5rem 0;margin:.125rem 0 0;font-size:1rem;color:#212529;text-align:left;list-style:none;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,.15);border-radius:.25rem}.dropdown-menu-left{right:auto;left:0}.dropdown-menu-right{right:0;left:auto}@media (min-width:540px){.dropdown-menu-sm-left{right:auto;left:0}.dropdown-menu-sm-right{right:0;left:auto}}@media (min-width:720px){.dropdown-menu-md-left{right:auto;left:0}.dropdown-menu-md-right{right:0;left:auto}}@media (min-width:960px){.dropdown-menu-lg-left{right:auto;left:0}.dropdown-menu-lg-right{right:0;left:auto}}@media (min-width:1200px){.dropdown-menu-xl-left{right:auto;left:0}.dropdown-menu-xl-right{right:0;left:auto}}.dropup .dropdown-menu{top:auto;bottom:100%;margin-top:0;margin-bottom:.125rem}.dropup .dropdown-toggle:after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:0;border-right:.3em solid transparent;border-bottom:.3em solid;border-left:.3em solid transparent}.dropup .dropdown-toggle:empty:after{margin-left:0}.dropright .dropdown-menu{top:0;right:auto;left:100%;margin-top:0;margin-left:.125rem}.dropright .dropdown-toggle:after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:0;border-bottom:.3em solid transparent;border-left:.3em solid}.dropright .dropdown-toggle:empty:after{margin-left:0}.dropright .dropdown-toggle:after{vertical-align:0}.dropleft .dropdown-menu{top:0;right:100%;left:auto;margin-top:0;margin-right:.125rem}.dropleft .dropdown-toggle:after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";display:none}.dropleft .dropdown-toggle:before{display:inline-block;margin-right:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:.3em solid;border-bottom:.3em solid transparent}.dropleft .dropdown-toggle:empty:after{margin-left:0}.dropleft .dropdown-toggle:before{vertical-align:0}.dropdown-menu[x-placement^=bottom],.dropdown-menu[x-placement^=left],.dropdown-menu[x-placement^=right],.dropdown-menu[x-placement^=top]{right:auto;bottom:auto}.dropdown-divider{height:0;margin:.5rem 0;overflow:hidden;border-top:1px solid #e9ecef}.dropdown-item{display:block;width:100%;padding:.25rem 1.5rem;clear:both;font-weight:400;color:#212529;text-align:inherit;white-space:nowrap;background-color:transparent;border:0}.dropdown-item:focus,.dropdown-item:hover{color:#16181b;text-decoration:none;background-color:#f8f9fa}.dropdown-item.active,.dropdown-item:active{color:#fff;text-decoration:none;background-color:#007bff}.dropdown-item.disabled,.dropdown-item:disabled{color:#6c757d;pointer-events:none;background-color:transparent}.dropdown-menu.show{display:block}.dropdown-header{display:block;padding:.5rem 1.5rem;margin-bottom:0;font-size:.875rem;color:#6c757d;white-space:nowrap}.dropdown-item-text{display:block;padding:.25rem 1.5rem;color:#212529}.btn-group,.btn-group-vertical{position:relative;display:inline-flex;vertical-align:middle}.btn-group-vertical>.btn,.btn-group>.btn{position:relative;flex:1 1 auto}.btn-group-vertical>.btn.active,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn:focus,.btn-group-vertical>.btn:hover,.btn-group>.btn.active,.btn-group>.btn:active,.btn-group>.btn:focus,.btn-group>.btn:hover{z-index:1}.btn-toolbar{display:flex;flex-wrap:wrap;justify-content:flex-start}.btn-toolbar .input-group{width:auto}.btn-group>.btn-group:not(:first-child),.btn-group>.btn:not(:first-child){margin-left:-1px}.btn-group>.btn-group:not(:last-child)>.btn,.btn-group>.btn:not(:last-child):not(.dropdown-toggle){border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn-group:not(:first-child)>.btn,.btn-group>.btn:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.dropdown-toggle-split{padding-right:.5625rem;padding-left:.5625rem}.dropdown-toggle-split:after,.dropright .dropdown-toggle-split:after,.dropup .dropdown-toggle-split:after{margin-left:0}.dropleft .dropdown-toggle-split:before{margin-right:0}.btn-group-sm>.btn+.dropdown-toggle-split,.btn-sm+.dropdown-toggle-split{padding-right:.375rem;padding-left:.375rem}.btn-group-lg>.btn+.dropdown-toggle-split,.btn-lg+.dropdown-toggle-split{padding-right:.75rem;padding-left:.75rem}.btn-group-vertical{flex-direction:column;align-items:flex-start;justify-content:center}.btn-group-vertical>.btn,.btn-group-vertical>.btn-group{width:100%}.btn-group-vertical>.btn-group:not(:first-child),.btn-group-vertical>.btn:not(:first-child){margin-top:-1px}.btn-group-vertical>.btn-group:not(:last-child)>.btn,.btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle){border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn-group:not(:first-child)>.btn,.btn-group-vertical>.btn:not(:first-child){border-top-left-radius:0;border-top-right-radius:0}.btn-group-toggle>.btn,.btn-group-toggle>.btn-group>.btn{margin-bottom:0}.btn-group-toggle>.btn-group>.btn input[type=checkbox],.btn-group-toggle>.btn-group>.btn input[type=radio],.btn-group-toggle>.btn input[type=checkbox],.btn-group-toggle>.btn input[type=radio]{position:absolute;clip:rect(0,0,0,0);pointer-events:none}.input-group{position:relative;display:flex;flex-wrap:wrap;align-items:stretch;width:100%}.input-group>.custom-file,.input-group>.custom-select,.input-group>.form-control,.input-group>.form-control-plaintext{position:relative;flex:1 1 auto;width:1%;min-width:0;margin-bottom:0}.input-group>.custom-file+.custom-file,.input-group>.custom-file+.custom-select,.input-group>.custom-file+.form-control,.input-group>.custom-select+.custom-file,.input-group>.custom-select+.custom-select,.input-group>.custom-select+.form-control,.input-group>.form-control+.custom-file,.input-group>.form-control+.custom-select,.input-group>.form-control+.form-control,.input-group>.form-control-plaintext+.custom-file,.input-group>.form-control-plaintext+.custom-select,.input-group>.form-control-plaintext+.form-control{margin-left:-1px}.input-group>.custom-file .custom-file-input:focus~.custom-file-label,.input-group>.custom-select:focus,.input-group>.form-control:focus{z-index:3}.input-group>.custom-file .custom-file-input:focus{z-index:4}.input-group>.custom-select:not(:last-child),.input-group>.form-control:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.custom-select:not(:first-child),.input-group>.form-control:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.input-group>.custom-file{display:flex;align-items:center}.input-group>.custom-file:not(:last-child) .custom-file-label,.input-group>.custom-file:not(:last-child) .custom-file-label:after{border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.custom-file:not(:first-child) .custom-file-label{border-top-left-radius:0;border-bottom-left-radius:0}.input-group-append,.input-group-prepend{display:flex}.input-group-append .btn,.input-group-prepend .btn{position:relative;z-index:2}.input-group-append .btn:focus,.input-group-prepend .btn:focus{z-index:3}.input-group-append .btn+.btn,.input-group-append .btn+.input-group-text,.input-group-append .input-group-text+.btn,.input-group-append .input-group-text+.input-group-text,.input-group-prepend .btn+.btn,.input-group-prepend .btn+.input-group-text,.input-group-prepend .input-group-text+.btn,.input-group-prepend .input-group-text+.input-group-text{margin-left:-1px}.input-group-prepend{margin-right:-1px}.input-group-append{margin-left:-1px}.input-group-text{display:flex;align-items:center;padding:.375rem .75rem;margin-bottom:0;font-size:1rem;font-weight:400;line-height:1.5;color:#495057;text-align:center;white-space:nowrap;background-color:#e9ecef;border:1px solid #ced4da;border-radius:.25rem}.input-group-text input[type=checkbox],.input-group-text input[type=radio]{margin-top:0}.input-group-lg>.custom-select,.input-group-lg>.form-control:not(textarea){height:calc(1.5em + 1rem + 2px)}.input-group-lg>.custom-select,.input-group-lg>.form-control,.input-group-lg>.input-group-append>.btn,.input-group-lg>.input-group-append>.input-group-text,.input-group-lg>.input-group-prepend>.btn,.input-group-lg>.input-group-prepend>.input-group-text{padding:.5rem 1rem;font-size:1.25rem;line-height:1.5;border-radius:.3rem}.input-group-sm>.custom-select,.input-group-sm>.form-control:not(textarea){height:calc(1.5em + .5rem + 2px)}.input-group-sm>.custom-select,.input-group-sm>.form-control,.input-group-sm>.input-group-append>.btn,.input-group-sm>.input-group-append>.input-group-text,.input-group-sm>.input-group-prepend>.btn,.input-group-sm>.input-group-prepend>.input-group-text{padding:.25rem .5rem;font-size:.875rem;line-height:1.5;border-radius:.2rem}.input-group-lg>.custom-select,.input-group-sm>.custom-select{padding-right:1.75rem}.input-group>.input-group-append:last-child>.btn:not(:last-child):not(.dropdown-toggle),.input-group>.input-group-append:last-child>.input-group-text:not(:last-child),.input-group>.input-group-append:not(:last-child)>.btn,.input-group>.input-group-append:not(:last-child)>.input-group-text,.input-group>.input-group-prepend>.btn,.input-group>.input-group-prepend>.input-group-text{border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.input-group-append>.btn,.input-group>.input-group-append>.input-group-text,.input-group>.input-group-prepend:first-child>.btn:not(:first-child),.input-group>.input-group-prepend:first-child>.input-group-text:not(:first-child),.input-group>.input-group-prepend:not(:first-child)>.btn,.input-group>.input-group-prepend:not(:first-child)>.input-group-text{border-top-left-radius:0;border-bottom-left-radius:0}.custom-control{position:relative;display:block;min-height:1.5rem;padding-left:1.5rem}.custom-control-inline{display:inline-flex;margin-right:1rem}.custom-control-input{position:absolute;left:0;z-index:-1;width:1rem;height:1.25rem;opacity:0}.custom-control-input:checked~.custom-control-label:before{color:#fff;border-color:#007bff;background-color:#007bff}.custom-control-input:focus~.custom-control-label:before{box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.custom-control-input:focus:not(:checked)~.custom-control-label:before{border-color:#80bdff}.custom-control-input:not(:disabled):active~.custom-control-label:before{color:#fff;background-color:#b3d7ff;border-color:#b3d7ff}.custom-control-input:disabled~.custom-control-label,.custom-control-input[disabled]~.custom-control-label{color:#6c757d}.custom-control-input:disabled~.custom-control-label:before,.custom-control-input[disabled]~.custom-control-label:before{background-color:#e9ecef}.custom-control-label{position:relative;margin-bottom:0;vertical-align:top}.custom-control-label:before{pointer-events:none;background-color:#fff;border:1px solid #adb5bd}.custom-control-label:after,.custom-control-label:before{position:absolute;top:.25rem;left:-1.5rem;display:block;width:1rem;height:1rem;content:""}.custom-control-label:after{background:no-repeat 50%/50% 50%}.custom-checkbox .custom-control-label:before{border-radius:.25rem}.custom-checkbox .custom-control-input:checked~.custom-control-label:after{background-image:url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' width='8' height='8'%3E%3Cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26l2.974 2.99L8 2.193z'/%3E%3C/svg%3E")}.custom-checkbox .custom-control-input:indeterminate~.custom-control-label:before{border-color:#007bff;background-color:#007bff}.custom-checkbox .custom-control-input:indeterminate~.custom-control-label:after{background-image:url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' width='4' height='4'%3E%3Cpath stroke='%23fff' d='M0 2h4'/%3E%3C/svg%3E")}.custom-checkbox .custom-control-input:disabled:checked~.custom-control-label:before{background-color:rgba(0,123,255,.5)}.custom-checkbox .custom-control-input:disabled:indeterminate~.custom-control-label:before{background-color:rgba(0,123,255,.5)}.custom-radio .custom-control-label:before{border-radius:50%}.custom-radio .custom-control-input:checked~.custom-control-label:after{background-image:url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' width='12' height='12' viewBox='-4 -4 8 8'%3E%3Ccircle r='3' fill='%23fff'/%3E%3C/svg%3E")}.custom-radio .custom-control-input:disabled:checked~.custom-control-label:before{background-color:rgba(0,123,255,.5)}.custom-switch{padding-left:2.25rem}.custom-switch .custom-control-label:before{left:-2.25rem;width:1.75rem;pointer-events:all;border-radius:.5rem}.custom-switch .custom-control-label:after{top:calc(.25rem + 2px);left:calc(-2.25rem + 2px);width:calc(1rem - 4px);height:calc(1rem - 4px);background-color:#adb5bd;border-radius:.5rem;transition:transform .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.custom-switch .custom-control-label:after{transition:none}}.custom-switch .custom-control-input:checked~.custom-control-label:after{background-color:#fff;transform:translateX(.75rem)}.custom-switch .custom-control-input:disabled:checked~.custom-control-label:before{background-color:rgba(0,123,255,.5)}.custom-select{display:inline-block;width:100%;height:calc(1.5em + .75rem + 2px);padding:.375rem 1.75rem .375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:#495057;vertical-align:middle;background:#fff url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' width='4' height='5'%3E%3Cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3E%3C/svg%3E") no-repeat right .75rem center/8px 10px;border:1px solid #ced4da;border-radius:.25rem;appearance:none}.custom-select:focus{border-color:#80bdff;outline:0;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.custom-select:focus::-ms-value{color:#495057;background-color:#fff}.custom-select[multiple],.custom-select[size]:not([size="1"]){height:auto;padding-right:.75rem;background-image:none}.custom-select:disabled{color:#6c757d;background-color:#e9ecef}.custom-select::-ms-expand{display:none}.custom-select:-moz-focusring{color:transparent;text-shadow:0 0 0 #495057}.custom-select-sm{height:calc(1.5em + .5rem + 2px);padding-top:.25rem;padding-bottom:.25rem;padding-left:.5rem;font-size:.875rem}.custom-select-lg{height:calc(1.5em + 1rem + 2px);padding-top:.5rem;padding-bottom:.5rem;padding-left:1rem;font-size:1.25rem}.custom-file{display:inline-block;margin-bottom:0}.custom-file,.custom-file-input{position:relative;width:100%;height:calc(1.5em + .75rem + 2px)}.custom-file-input{z-index:2;margin:0;opacity:0}.custom-file-input:focus~.custom-file-label{border-color:#80bdff;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.custom-file-input:disabled~.custom-file-label,.custom-file-input[disabled]~.custom-file-label{background-color:#e9ecef}.custom-file-input:lang(en)~.custom-file-label:after{content:"Browse"}.custom-file-input~.custom-file-label[data-browse]:after{content:attr(data-browse)}.custom-file-label{left:0;z-index:1;height:calc(1.5em + .75rem + 2px);font-weight:400;background-color:#fff;border:1px solid #ced4da;border-radius:.25rem}.custom-file-label,.custom-file-label:after{position:absolute;top:0;right:0;padding:.375rem .75rem;line-height:1.5;color:#495057}.custom-file-label:after{bottom:0;z-index:3;display:block;height:calc(1.5em + .75rem);content:"Browse";background-color:#e9ecef;border-left:inherit;border-radius:0 .25rem .25rem 0}.custom-range{width:100%;height:1.4rem;padding:0;background-color:transparent;appearance:none}.custom-range:focus{outline:none}.custom-range:focus::-webkit-slider-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(0,123,255,.25)}.custom-range:focus::-moz-range-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(0,123,255,.25)}.custom-range:focus::-ms-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(0,123,255,.25)}.custom-range::-moz-focus-outer{border:0}.custom-range::-webkit-slider-thumb{width:1rem;height:1rem;margin-top:-.25rem;background-color:#007bff;border:0;border-radius:1rem;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;appearance:none}@media (prefers-reduced-motion:reduce){.custom-range::-webkit-slider-thumb{transition:none}}.custom-range::-webkit-slider-thumb:active{background-color:#b3d7ff}.custom-range::-webkit-slider-runnable-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:#dee2e6;border-color:transparent;border-radius:1rem}.custom-range::-moz-range-thumb{width:1rem;height:1rem;background-color:#007bff;border:0;border-radius:1rem;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;appearance:none}@media (prefers-reduced-motion:reduce){.custom-range::-moz-range-thumb{transition:none}}.custom-range::-moz-range-thumb:active{background-color:#b3d7ff}.custom-range::-moz-range-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:#dee2e6;border-color:transparent;border-radius:1rem}.custom-range::-ms-thumb{width:1rem;height:1rem;margin-top:0;margin-right:.2rem;margin-left:.2rem;background-color:#007bff;border:0;border-radius:1rem;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;appearance:none}@media (prefers-reduced-motion:reduce){.custom-range::-ms-thumb{transition:none}}.custom-range::-ms-thumb:active{background-color:#b3d7ff}.custom-range::-ms-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:transparent;border-color:transparent;border-width:.5rem}.custom-range::-ms-fill-lower,.custom-range::-ms-fill-upper{background-color:#dee2e6;border-radius:1rem}.custom-range::-ms-fill-upper{margin-right:15px}.custom-range:disabled::-webkit-slider-thumb{background-color:#adb5bd}.custom-range:disabled::-webkit-slider-runnable-track{cursor:default}.custom-range:disabled::-moz-range-thumb{background-color:#adb5bd}.custom-range:disabled::-moz-range-track{cursor:default}.custom-range:disabled::-ms-thumb{background-color:#adb5bd}.custom-control-label:before,.custom-file-label,.custom-select{transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.custom-control-label:before,.custom-file-label,.custom-select{transition:none}}.nav{display:flex;flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:.5rem 1rem}.nav-link:focus,.nav-link:hover{text-decoration:none}.nav-link.disabled{color:#6c757d;pointer-events:none;cursor:default}.nav-tabs{border-bottom:1px solid #dee2e6}.nav-tabs .nav-item{margin-bottom:-1px}.nav-tabs .nav-link{border:1px solid transparent;border-top-left-radius:.25rem;border-top-right-radius:.25rem}.nav-tabs .nav-link:focus,.nav-tabs .nav-link:hover{border-color:#e9ecef #e9ecef #dee2e6}.nav-tabs .nav-link.disabled{color:#6c757d;background-color:transparent;border-color:transparent}.nav-tabs .nav-item.show .nav-link,.nav-tabs .nav-link.active{color:#495057;background-color:#fff;border-color:#dee2e6 #dee2e6 #fff}.nav-tabs .dropdown-menu{margin-top:-1px;border-top-left-radius:0;border-top-right-radius:0}.nav-pills .nav-link{border-radius:.25rem}.nav-pills .nav-link.active,.nav-pills .show>.nav-link{color:#fff;background-color:#007bff}.nav-fill .nav-item{flex:1 1 auto;text-align:center}.nav-justified .nav-item{flex-basis:0;flex-grow:1;text-align:center}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.navbar{position:relative;padding:.5rem 1rem}.navbar,.navbar .container,.navbar .container-fluid,.navbar .container-lg,.navbar .container-md,.navbar .container-sm,.navbar .container-xl{display:flex;flex-wrap:wrap;align-items:center;justify-content:space-between}.navbar-brand{display:inline-block;padding-top:.3125rem;padding-bottom:.3125rem;margin-right:1rem;font-size:1.25rem;line-height:inherit;white-space:nowrap}.navbar-brand:focus,.navbar-brand:hover{text-decoration:none}.navbar-nav{display:flex;flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .nav-link{padding-right:0;padding-left:0}.navbar-nav .dropdown-menu{position:static;float:none}.navbar-text{display:inline-block;padding-top:.5rem;padding-bottom:.5rem}.navbar-collapse{flex-basis:100%;flex-grow:1;align-items:center}.navbar-toggler{padding:.25rem .75rem;font-size:1.25rem;line-height:1;background-color:transparent;border:1px solid transparent;border-radius:.25rem}.navbar-toggler:focus,.navbar-toggler:hover{text-decoration:none}.navbar-toggler-icon{display:inline-block;width:1.5em;height:1.5em;vertical-align:middle;content:"";background:no-repeat 50%;background-size:100% 100%}@media (max-width:539.98px){.navbar-expand-sm>.container,.navbar-expand-sm>.container-fluid,.navbar-expand-sm>.container-lg,.navbar-expand-sm>.container-md,.navbar-expand-sm>.container-sm,.navbar-expand-sm>.container-xl{padding-right:0;padding-left:0}}@media (min-width:540px){.navbar-expand-sm{flex-flow:row nowrap;justify-content:flex-start}.navbar-expand-sm .navbar-nav{flex-direction:row}.navbar-expand-sm .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-sm .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-sm>.container,.navbar-expand-sm>.container-fluid,.navbar-expand-sm>.container-lg,.navbar-expand-sm>.container-md,.navbar-expand-sm>.container-sm,.navbar-expand-sm>.container-xl{flex-wrap:nowrap}.navbar-expand-sm .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-sm .navbar-toggler{display:none}}@media (max-width:719.98px){.navbar-expand-md>.container,.navbar-expand-md>.container-fluid,.navbar-expand-md>.container-lg,.navbar-expand-md>.container-md,.navbar-expand-md>.container-sm,.navbar-expand-md>.container-xl{padding-right:0;padding-left:0}}@media (min-width:720px){.navbar-expand-md{flex-flow:row nowrap;justify-content:flex-start}.navbar-expand-md .navbar-nav{flex-direction:row}.navbar-expand-md .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-md .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-md>.container,.navbar-expand-md>.container-fluid,.navbar-expand-md>.container-lg,.navbar-expand-md>.container-md,.navbar-expand-md>.container-sm,.navbar-expand-md>.container-xl{flex-wrap:nowrap}.navbar-expand-md .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-md .navbar-toggler{display:none}}@media (max-width:959.98px){.navbar-expand-lg>.container,.navbar-expand-lg>.container-fluid,.navbar-expand-lg>.container-lg,.navbar-expand-lg>.container-md,.navbar-expand-lg>.container-sm,.navbar-expand-lg>.container-xl{padding-right:0;padding-left:0}}@media (min-width:960px){.navbar-expand-lg{flex-flow:row nowrap;justify-content:flex-start}.navbar-expand-lg .navbar-nav{flex-direction:row}.navbar-expand-lg .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-lg .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-lg>.container,.navbar-expand-lg>.container-fluid,.navbar-expand-lg>.container-lg,.navbar-expand-lg>.container-md,.navbar-expand-lg>.container-sm,.navbar-expand-lg>.container-xl{flex-wrap:nowrap}.navbar-expand-lg .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-lg .navbar-toggler{display:none}}@media (max-width:1199.98px){.navbar-expand-xl>.container,.navbar-expand-xl>.container-fluid,.navbar-expand-xl>.container-lg,.navbar-expand-xl>.container-md,.navbar-expand-xl>.container-sm,.navbar-expand-xl>.container-xl{padding-right:0;padding-left:0}}@media (min-width:1200px){.navbar-expand-xl{flex-flow:row nowrap;justify-content:flex-start}.navbar-expand-xl .navbar-nav{flex-direction:row}.navbar-expand-xl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xl .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-xl>.container,.navbar-expand-xl>.container-fluid,.navbar-expand-xl>.container-lg,.navbar-expand-xl>.container-md,.navbar-expand-xl>.container-sm,.navbar-expand-xl>.container-xl{flex-wrap:nowrap}.navbar-expand-xl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xl .navbar-toggler{display:none}}.navbar-expand{flex-flow:row nowrap;justify-content:flex-start}.navbar-expand>.container,.navbar-expand>.container-fluid,.navbar-expand>.container-lg,.navbar-expand>.container-md,.navbar-expand>.container-sm,.navbar-expand>.container-xl{padding-right:0;padding-left:0}.navbar-expand .navbar-nav{flex-direction:row}.navbar-expand .navbar-nav .dropdown-menu{position:absolute}.navbar-expand .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand>.container,.navbar-expand>.container-fluid,.navbar-expand>.container-lg,.navbar-expand>.container-md,.navbar-expand>.container-sm,.navbar-expand>.container-xl{flex-wrap:nowrap}.navbar-expand .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand .navbar-toggler{display:none}.navbar-light .navbar-brand,.navbar-light .navbar-brand:focus,.navbar-light .navbar-brand:hover{color:rgba(0,0,0,.9)}.navbar-light .navbar-nav .nav-link{color:rgba(0,0,0,.5)}.navbar-light .navbar-nav .nav-link:focus,.navbar-light .navbar-nav .nav-link:hover{color:rgba(0,0,0,.7)}.navbar-light .navbar-nav .nav-link.disabled{color:rgba(0,0,0,.3)}.navbar-light .navbar-nav .active>.nav-link,.navbar-light .navbar-nav .nav-link.active,.navbar-light .navbar-nav .nav-link.show,.navbar-light .navbar-nav .show>.nav-link{color:rgba(0,0,0,.9)}.navbar-light .navbar-toggler{color:rgba(0,0,0,.5);border-color:rgba(0,0,0,.1)}.navbar-light .navbar-toggler-icon{background-image:url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' width='30' height='30'%3E%3Cpath stroke='rgba(0,0,0,0.5)' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E")}.navbar-light .navbar-text{color:rgba(0,0,0,.5)}.navbar-light .navbar-text a,.navbar-light .navbar-text a:focus,.navbar-light .navbar-text a:hover{color:rgba(0,0,0,.9)}.navbar-dark .navbar-brand,.navbar-dark .navbar-brand:focus,.navbar-dark .navbar-brand:hover{color:#fff}.navbar-dark .navbar-nav .nav-link{color:hsla(0,0%,100%,.5)}.navbar-dark .navbar-nav .nav-link:focus,.navbar-dark .navbar-nav .nav-link:hover{color:hsla(0,0%,100%,.75)}.navbar-dark .navbar-nav .nav-link.disabled{color:hsla(0,0%,100%,.25)}.navbar-dark .navbar-nav .active>.nav-link,.navbar-dark .navbar-nav .nav-link.active,.navbar-dark .navbar-nav .nav-link.show,.navbar-dark .navbar-nav .show>.nav-link{color:#fff}.navbar-dark .navbar-toggler{color:hsla(0,0%,100%,.5);border-color:hsla(0,0%,100%,.1)}.navbar-dark .navbar-toggler-icon{background-image:url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' width='30' height='30'%3E%3Cpath stroke='rgba(255,255,255,0.5)' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E")}.navbar-dark .navbar-text{color:hsla(0,0%,100%,.5)}.navbar-dark .navbar-text a,.navbar-dark .navbar-text a:focus,.navbar-dark .navbar-text a:hover{color:#fff}.card{position:relative;display:flex;flex-direction:column;min-width:0;word-wrap:break-word;background-color:#fff;background-clip:border-box;border:1px solid rgba(0,0,0,.125);border-radius:.25rem}.card>hr{margin-right:0;margin-left:0}.card>.list-group{border-top:inherit;border-bottom:inherit}.card>.list-group:first-child{border-top-width:0;border-top-left-radius:calc(.25rem - 1px);border-top-right-radius:calc(.25rem - 1px)}.card>.list-group:last-child{border-bottom-width:0;border-bottom-right-radius:calc(.25rem - 1px);border-bottom-left-radius:calc(.25rem - 1px)}.card-body{flex:1 1 auto;min-height:1px;padding:1.25rem}.card-title{margin-bottom:.75rem}.card-subtitle{margin-top:-.375rem}.card-subtitle,.card-text:last-child{margin-bottom:0}.card-link:hover{text-decoration:none}.card-link+.card-link{margin-left:1.25rem}.card-header{padding:.75rem 1.25rem;margin-bottom:0;background-color:rgba(0,0,0,.03);border-bottom:1px solid rgba(0,0,0,.125)}.card-header:first-child{border-radius:calc(.25rem - 1px) calc(.25rem - 1px) 0 0}.card-header+.list-group .list-group-item:first-child{border-top:0}.card-footer{padding:.75rem 1.25rem;background-color:rgba(0,0,0,.03);border-top:1px solid rgba(0,0,0,.125)}.card-footer:last-child{border-radius:0 0 calc(.25rem - 1px) calc(.25rem - 1px)}.card-header-tabs{margin-bottom:-.75rem;border-bottom:0}.card-header-pills,.card-header-tabs{margin-right:-.625rem;margin-left:-.625rem}.card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:1.25rem}.card-img,.card-img-bottom,.card-img-top{flex-shrink:0;width:100%}.card-img,.card-img-top{border-top-left-radius:calc(.25rem - 1px);border-top-right-radius:calc(.25rem - 1px)}.card-img,.card-img-bottom{border-bottom-right-radius:calc(.25rem - 1px);border-bottom-left-radius:calc(.25rem - 1px)}.card-deck .card{margin-bottom:15px}@media (min-width:540px){.card-deck{display:flex;flex-flow:row wrap;margin-right:-15px;margin-left:-15px}.card-deck .card{flex:1 0 0%;margin-right:15px;margin-bottom:0;margin-left:15px}}.card-group>.card{margin-bottom:15px}@media (min-width:540px){.card-group{display:flex;flex-flow:row wrap}.card-group>.card{flex:1 0 0%;margin-bottom:0}.card-group>.card+.card{margin-left:0;border-left:0}.card-group>.card:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.card-group>.card:not(:last-child) .card-header,.card-group>.card:not(:last-child) .card-img-top{border-top-right-radius:0}.card-group>.card:not(:last-child) .card-footer,.card-group>.card:not(:last-child) .card-img-bottom{border-bottom-right-radius:0}.card-group>.card:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.card-group>.card:not(:first-child) .card-header,.card-group>.card:not(:first-child) .card-img-top{border-top-left-radius:0}.card-group>.card:not(:first-child) .card-footer,.card-group>.card:not(:first-child) .card-img-bottom{border-bottom-left-radius:0}}.card-columns .card{margin-bottom:.75rem}@media (min-width:540px){.card-columns{column-count:3;column-gap:1.25rem;orphans:1;widows:1}.card-columns .card{display:inline-block;width:100%}}.accordion>.card{overflow:hidden}.accordion>.card:not(:last-of-type){border-bottom:0;border-bottom-right-radius:0;border-bottom-left-radius:0}.accordion>.card:not(:first-of-type){border-top-left-radius:0;border-top-right-radius:0}.accordion>.card>.card-header{border-radius:0;margin-bottom:-1px}.breadcrumb{flex-wrap:wrap;padding:.75rem 1rem;margin-bottom:1rem;list-style:none;background-color:#e9ecef;border-radius:.25rem}.breadcrumb,.breadcrumb-item{display:flex}.breadcrumb-item+.breadcrumb-item{padding-left:.5rem}.breadcrumb-item+.breadcrumb-item:before{display:inline-block;padding-right:.5rem;color:#6c757d;content:"/"}.breadcrumb-item+.breadcrumb-item:hover:before{text-decoration:underline;text-decoration:none}.breadcrumb-item.active{color:#6c757d}.pagination{display:flex;padding-left:0;list-style:none;border-radius:.25rem}.page-link{position:relative;display:block;padding:.5rem .75rem;margin-left:-1px;line-height:1.25;color:#007bff;background-color:#fff;border:1px solid #dee2e6}.page-link:hover{z-index:2;color:#0056b3;text-decoration:none;background-color:#e9ecef;border-color:#dee2e6}.page-link:focus{z-index:3;outline:0;box-shadow:0 0 0 .2rem rgba(0,123,255,.25)}.page-item:first-child .page-link{margin-left:0;border-top-left-radius:.25rem;border-bottom-left-radius:.25rem}.page-item:last-child .page-link{border-top-right-radius:.25rem;border-bottom-right-radius:.25rem}.page-item.active .page-link{z-index:3;color:#fff;background-color:#007bff;border-color:#007bff}.page-item.disabled .page-link{color:#6c757d;pointer-events:none;cursor:auto;background-color:#fff;border-color:#dee2e6}.pagination-lg .page-link{padding:.75rem 1.5rem;font-size:1.25rem;line-height:1.5}.pagination-lg .page-item:first-child .page-link{border-top-left-radius:.3rem;border-bottom-left-radius:.3rem}.pagination-lg .page-item:last-child .page-link{border-top-right-radius:.3rem;border-bottom-right-radius:.3rem}.pagination-sm .page-link{padding:.25rem .5rem;font-size:.875rem;line-height:1.5}.pagination-sm .page-item:first-child .page-link{border-top-left-radius:.2rem;border-bottom-left-radius:.2rem}.pagination-sm .page-item:last-child .page-link{border-top-right-radius:.2rem;border-bottom-right-radius:.2rem}.badge{display:inline-block;padding:.25em .4em;font-size:75%;font-weight:700;line-height:1;text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:.25rem;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.badge{transition:none}}a.badge:focus,a.badge:hover{text-decoration:none}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.badge-pill{padding-right:.6em;padding-left:.6em;border-radius:10rem}.badge-primary{color:#fff;background-color:#007bff}a.badge-primary:focus,a.badge-primary:hover{color:#fff;background-color:#0062cc}a.badge-primary.focus,a.badge-primary:focus{outline:0;box-shadow:0 0 0 .2rem rgba(0,123,255,.5)}.badge-secondary{color:#fff;background-color:#6c757d}a.badge-secondary:focus,a.badge-secondary:hover{color:#fff;background-color:#545b62}a.badge-secondary.focus,a.badge-secondary:focus{outline:0;box-shadow:0 0 0 .2rem rgba(108,117,125,.5)}.badge-success{color:#fff;background-color:#28a745}a.badge-success:focus,a.badge-success:hover{color:#fff;background-color:#1e7e34}a.badge-success.focus,a.badge-success:focus{outline:0;box-shadow:0 0 0 .2rem rgba(40,167,69,.5)}.badge-info{color:#fff;background-color:#17a2b8}a.badge-info:focus,a.badge-info:hover{color:#fff;background-color:#117a8b}a.badge-info.focus,a.badge-info:focus{outline:0;box-shadow:0 0 0 .2rem rgba(23,162,184,.5)}.badge-warning{color:#212529;background-color:#ffc107}a.badge-warning:focus,a.badge-warning:hover{color:#212529;background-color:#d39e00}a.badge-warning.focus,a.badge-warning:focus{outline:0;box-shadow:0 0 0 .2rem rgba(255,193,7,.5)}.badge-danger{color:#fff;background-color:#dc3545}a.badge-danger:focus,a.badge-danger:hover{color:#fff;background-color:#bd2130}a.badge-danger.focus,a.badge-danger:focus{outline:0;box-shadow:0 0 0 .2rem rgba(220,53,69,.5)}.badge-light{color:#212529;background-color:#f8f9fa}a.badge-light:focus,a.badge-light:hover{color:#212529;background-color:#dae0e5}a.badge-light.focus,a.badge-light:focus{outline:0;box-shadow:0 0 0 .2rem rgba(248,249,250,.5)}.badge-dark{color:#fff;background-color:#343a40}a.badge-dark:focus,a.badge-dark:hover{color:#fff;background-color:#1d2124}a.badge-dark.focus,a.badge-dark:focus{outline:0;box-shadow:0 0 0 .2rem rgba(52,58,64,.5)}.jumbotron{padding:2rem 1rem;margin-bottom:2rem;background-color:#e9ecef;border-radius:.3rem}@media (min-width:540px){.jumbotron{padding:4rem 2rem}}.jumbotron-fluid{padding-right:0;padding-left:0;border-radius:0}.alert{position:relative;padding:.75rem 1.25rem;margin-bottom:1rem;border:1px solid transparent;border-radius:.25rem}.alert-heading{color:inherit}.alert-link{font-weight:700}.alert-dismissible{padding-right:4rem}.alert-dismissible .close{position:absolute;top:0;right:0;padding:.75rem 1.25rem;color:inherit}.alert-primary{color:#004085;background-color:#cce5ff;border-color:#b8daff}.alert-primary hr{border-top-color:#9fcdff}.alert-primary .alert-link{color:#002752}.alert-secondary{color:#383d41;background-color:#e2e3e5;border-color:#d6d8db}.alert-secondary hr{border-top-color:#c8cbcf}.alert-secondary .alert-link{color:#202326}.alert-success{color:#155724;background-color:#d4edda;border-color:#c3e6cb}.alert-success hr{border-top-color:#b1dfbb}.alert-success .alert-link{color:#0b2e13}.alert-info{color:#0c5460;background-color:#d1ecf1;border-color:#bee5eb}.alert-info hr{border-top-color:#abdde5}.alert-info .alert-link{color:#062c33}.alert-warning{color:#856404;background-color:#fff3cd;border-color:#ffeeba}.alert-warning hr{border-top-color:#ffe8a1}.alert-warning .alert-link{color:#533f03}.alert-danger{color:#721c24;background-color:#f8d7da;border-color:#f5c6cb}.alert-danger hr{border-top-color:#f1b0b7}.alert-danger .alert-link{color:#491217}.alert-light{color:#818182;background-color:#fefefe;border-color:#fdfdfe}.alert-light hr{border-top-color:#ececf6}.alert-light .alert-link{color:#686868}.alert-dark{color:#1b1e21;background-color:#d6d8d9;border-color:#c6c8ca}.alert-dark hr{border-top-color:#b9bbbe}.alert-dark .alert-link{color:#040505}@keyframes progress-bar-stripes{0%{background-position:1rem 0}to{background-position:0 0}}.progress{height:1rem;line-height:0;font-size:.75rem;background-color:#e9ecef;border-radius:.25rem}.progress,.progress-bar{display:flex;overflow:hidden}.progress-bar{flex-direction:column;justify-content:center;color:#fff;text-align:center;white-space:nowrap;background-color:#007bff;transition:width .6s ease}@media (prefers-reduced-motion:reduce){.progress-bar{transition:none}}.progress-bar-striped{background-image:linear-gradient(45deg,hsla(0,0%,100%,.15) 25%,transparent 0,transparent 50%,hsla(0,0%,100%,.15) 0,hsla(0,0%,100%,.15) 75%,transparent 0,transparent);background-size:1rem 1rem}.progress-bar-animated{animation:progress-bar-stripes 1s linear infinite}@media (prefers-reduced-motion:reduce){.progress-bar-animated{animation:none}}.media{display:flex;align-items:flex-start}.media-body{flex:1}.list-group{display:flex;flex-direction:column;padding-left:0;margin-bottom:0;border-radius:.25rem}.list-group-item-action{width:100%;color:#495057;text-align:inherit}.list-group-item-action:focus,.list-group-item-action:hover{z-index:1;color:#495057;text-decoration:none;background-color:#f8f9fa}.list-group-item-action:active{color:#212529;background-color:#e9ecef}.list-group-item{position:relative;display:block;padding:.75rem 1.25rem;background-color:#fff;border:1px solid rgba(0,0,0,.125)}.list-group-item:first-child{border-top-left-radius:inherit;border-top-right-radius:inherit}.list-group-item:last-child{border-bottom-right-radius:inherit;border-bottom-left-radius:inherit}.list-group-item.disabled,.list-group-item:disabled{color:#6c757d;pointer-events:none;background-color:#fff}.list-group-item.active{z-index:2;color:#fff;background-color:#007bff;border-color:#007bff}.list-group-item+.list-group-item{border-top-width:0}.list-group-item+.list-group-item.active{margin-top:-1px;border-top-width:1px}.list-group-horizontal{flex-direction:row}.list-group-horizontal>.list-group-item:first-child{border-bottom-left-radius:.25rem;border-top-right-radius:0}.list-group-horizontal>.list-group-item:last-child{border-top-right-radius:.25rem;border-bottom-left-radius:0}.list-group-horizontal>.list-group-item.active{margin-top:0}.list-group-horizontal>.list-group-item+.list-group-item{border-top-width:1px;border-left-width:0}.list-group-horizontal>.list-group-item+.list-group-item.active{margin-left:-1px;border-left-width:1px}@media (min-width:540px){.list-group-horizontal-sm{flex-direction:row}.list-group-horizontal-sm>.list-group-item:first-child{border-bottom-left-radius:.25rem;border-top-right-radius:0}.list-group-horizontal-sm>.list-group-item:last-child{border-top-right-radius:.25rem;border-bottom-left-radius:0}.list-group-horizontal-sm>.list-group-item.active{margin-top:0}.list-group-horizontal-sm>.list-group-item+.list-group-item{border-top-width:1px;border-left-width:0}.list-group-horizontal-sm>.list-group-item+.list-group-item.active{margin-left:-1px;border-left-width:1px}}@media (min-width:720px){.list-group-horizontal-md{flex-direction:row}.list-group-horizontal-md>.list-group-item:first-child{border-bottom-left-radius:.25rem;border-top-right-radius:0}.list-group-horizontal-md>.list-group-item:last-child{border-top-right-radius:.25rem;border-bottom-left-radius:0}.list-group-horizontal-md>.list-group-item.active{margin-top:0}.list-group-horizontal-md>.list-group-item+.list-group-item{border-top-width:1px;border-left-width:0}.list-group-horizontal-md>.list-group-item+.list-group-item.active{margin-left:-1px;border-left-width:1px}}@media (min-width:960px){.list-group-horizontal-lg{flex-direction:row}.list-group-horizontal-lg>.list-group-item:first-child{border-bottom-left-radius:.25rem;border-top-right-radius:0}.list-group-horizontal-lg>.list-group-item:last-child{border-top-right-radius:.25rem;border-bottom-left-radius:0}.list-group-horizontal-lg>.list-group-item.active{margin-top:0}.list-group-horizontal-lg>.list-group-item+.list-group-item{border-top-width:1px;border-left-width:0}.list-group-horizontal-lg>.list-group-item+.list-group-item.active{margin-left:-1px;border-left-width:1px}}@media (min-width:1200px){.list-group-horizontal-xl{flex-direction:row}.list-group-horizontal-xl>.list-group-item:first-child{border-bottom-left-radius:.25rem;border-top-right-radius:0}.list-group-horizontal-xl>.list-group-item:last-child{border-top-right-radius:.25rem;border-bottom-left-radius:0}.list-group-horizontal-xl>.list-group-item.active{margin-top:0}.list-group-horizontal-xl>.list-group-item+.list-group-item{border-top-width:1px;border-left-width:0}.list-group-horizontal-xl>.list-group-item+.list-group-item.active{margin-left:-1px;border-left-width:1px}}.list-group-flush{border-radius:0}.list-group-flush>.list-group-item{border-width:0 0 1px}.list-group-flush>.list-group-item:last-child{border-bottom-width:0}.list-group-item-primary{color:#004085;background-color:#b8daff}.list-group-item-primary.list-group-item-action:focus,.list-group-item-primary.list-group-item-action:hover{color:#004085;background-color:#9fcdff}.list-group-item-primary.list-group-item-action.active{color:#fff;background-color:#004085;border-color:#004085}.list-group-item-secondary{color:#383d41;background-color:#d6d8db}.list-group-item-secondary.list-group-item-action:focus,.list-group-item-secondary.list-group-item-action:hover{color:#383d41;background-color:#c8cbcf}.list-group-item-secondary.list-group-item-action.active{color:#fff;background-color:#383d41;border-color:#383d41}.list-group-item-success{color:#155724;background-color:#c3e6cb}.list-group-item-success.list-group-item-action:focus,.list-group-item-success.list-group-item-action:hover{color:#155724;background-color:#b1dfbb}.list-group-item-success.list-group-item-action.active{color:#fff;background-color:#155724;border-color:#155724}.list-group-item-info{color:#0c5460;background-color:#bee5eb}.list-group-item-info.list-group-item-action:focus,.list-group-item-info.list-group-item-action:hover{color:#0c5460;background-color:#abdde5}.list-group-item-info.list-group-item-action.active{color:#fff;background-color:#0c5460;border-color:#0c5460}.list-group-item-warning{color:#856404;background-color:#ffeeba}.list-group-item-warning.list-group-item-action:focus,.list-group-item-warning.list-group-item-action:hover{color:#856404;background-color:#ffe8a1}.list-group-item-warning.list-group-item-action.active{color:#fff;background-color:#856404;border-color:#856404}.list-group-item-danger{color:#721c24;background-color:#f5c6cb}.list-group-item-danger.list-group-item-action:focus,.list-group-item-danger.list-group-item-action:hover{color:#721c24;background-color:#f1b0b7}.list-group-item-danger.list-group-item-action.active{color:#fff;background-color:#721c24;border-color:#721c24}.list-group-item-light{color:#818182;background-color:#fdfdfe}.list-group-item-light.list-group-item-action:focus,.list-group-item-light.list-group-item-action:hover{color:#818182;background-color:#ececf6}.list-group-item-light.list-group-item-action.active{color:#fff;background-color:#818182;border-color:#818182}.list-group-item-dark{color:#1b1e21;background-color:#c6c8ca}.list-group-item-dark.list-group-item-action:focus,.list-group-item-dark.list-group-item-action:hover{color:#1b1e21;background-color:#b9bbbe}.list-group-item-dark.list-group-item-action.active{color:#fff;background-color:#1b1e21;border-color:#1b1e21}.close{float:right;font-size:1.5rem;font-weight:700;line-height:1;color:#000;text-shadow:0 1px 0 #fff;opacity:.5}.close:hover{color:#000;text-decoration:none}.close:not(:disabled):not(.disabled):focus,.close:not(:disabled):not(.disabled):hover{opacity:.75}button.close{padding:0;background-color:transparent;border:0}a.close.disabled{pointer-events:none}.toast{max-width:350px;overflow:hidden;font-size:.875rem;background-color:hsla(0,0%,100%,.85);background-clip:padding-box;border:1px solid rgba(0,0,0,.1);box-shadow:0 .25rem .75rem rgba(0,0,0,.1);backdrop-filter:blur(10px);opacity:0;border-radius:.25rem}.toast:not(:last-child){margin-bottom:.75rem}.toast.showing{opacity:1}.toast.show{display:block;opacity:1}.toast.hide{display:none}.toast-header{display:flex;align-items:center;padding:.25rem .75rem;color:#6c757d;background-color:hsla(0,0%,100%,.85);background-clip:padding-box;border-bottom:1px solid rgba(0,0,0,.05)}.toast-body{padding:.75rem}.modal-open{overflow:hidden}.modal-open .modal{overflow-x:hidden;overflow-y:auto}.modal{position:fixed;top:0;left:0;z-index:1050;display:none;width:100%;height:100%;overflow:hidden;outline:0}.modal-dialog{position:relative;width:auto;margin:.5rem;pointer-events:none}.modal.fade .modal-dialog{transition:transform .3s ease-out;transform:translateY(-50px)}@media (prefers-reduced-motion:reduce){.modal.fade .modal-dialog{transition:none}}.modal.show .modal-dialog{transform:none}.modal.modal-static .modal-dialog{transform:scale(1.02)}.modal-dialog-scrollable{display:flex;max-height:calc(100% - 1rem)}.modal-dialog-scrollable .modal-content{max-height:calc(100vh - 1rem);overflow:hidden}.modal-dialog-scrollable .modal-footer,.modal-dialog-scrollable .modal-header{flex-shrink:0}.modal-dialog-scrollable .modal-body{overflow-y:auto}.modal-dialog-centered{display:flex;align-items:center;min-height:calc(100% - 1rem)}.modal-dialog-centered:before{display:block;height:calc(100vh - 1rem);height:min-content;content:""}.modal-dialog-centered.modal-dialog-scrollable{flex-direction:column;justify-content:center;height:100%}.modal-dialog-centered.modal-dialog-scrollable .modal-content{max-height:none}.modal-dialog-centered.modal-dialog-scrollable:before{content:none}.modal-content{position:relative;display:flex;flex-direction:column;width:100%;pointer-events:auto;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,.2);border-radius:.3rem;outline:0}.modal-backdrop{position:fixed;top:0;left:0;z-index:1040;width:100vw;height:100vh;background-color:#000}.modal-backdrop.fade{opacity:0}.modal-backdrop.show{opacity:.5}.modal-header{display:flex;align-items:flex-start;justify-content:space-between;padding:1rem;border-bottom:1px solid #dee2e6;border-top-left-radius:calc(.3rem - 1px);border-top-right-radius:calc(.3rem - 1px)}.modal-header .close{padding:1rem;margin:-1rem -1rem -1rem auto}.modal-title{margin-bottom:0;line-height:1.5}.modal-body{position:relative;flex:1 1 auto;padding:1rem}.modal-footer{display:flex;flex-wrap:wrap;align-items:center;justify-content:flex-end;padding:.75rem;border-top:1px solid #dee2e6;border-bottom-right-radius:calc(.3rem - 1px);border-bottom-left-radius:calc(.3rem - 1px)}.modal-footer>*{margin:.25rem}.modal-scrollbar-measure{position:absolute;top:-9999px;width:50px;height:50px;overflow:scroll}@media (min-width:540px){.modal-dialog{max-width:500px;margin:1.75rem auto}.modal-dialog-scrollable{max-height:calc(100% - 3.5rem)}.modal-dialog-scrollable .modal-content{max-height:calc(100vh - 3.5rem)}.modal-dialog-centered{min-height:calc(100% - 3.5rem)}.modal-dialog-centered:before{height:calc(100vh - 3.5rem);height:min-content}.modal-sm{max-width:300px}}@media (min-width:960px){.modal-lg,.modal-xl{max-width:800px}}@media (min-width:1200px){.modal-xl{max-width:1140px}}.tooltip{position:absolute;z-index:1070;display:block;margin:0;font-family:-apple-system,BlinkMacSystemFont,Segoe UI,Roboto,Helvetica Neue,Arial,Noto Sans,sans-serif,Apple Color Emoji,Segoe UI Emoji,Segoe UI Symbol,Noto Color Emoji;font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;word-spacing:normal;white-space:normal;line-break:auto;font-size:.875rem;word-wrap:break-word;opacity:0}.tooltip.show{opacity:.9}.tooltip .arrow{position:absolute;display:block;width:.8rem;height:.4rem}.tooltip .arrow:before{position:absolute;content:"";border-color:transparent;border-style:solid}.bs-tooltip-auto[x-placement^=top],.bs-tooltip-top{padding:.4rem 0}.bs-tooltip-auto[x-placement^=top] .arrow,.bs-tooltip-top .arrow{bottom:0}.bs-tooltip-auto[x-placement^=top] .arrow:before,.bs-tooltip-top .arrow:before{top:0;border-width:.4rem .4rem 0;border-top-color:#000}.bs-tooltip-auto[x-placement^=right],.bs-tooltip-right{padding:0 .4rem}.bs-tooltip-auto[x-placement^=right] .arrow,.bs-tooltip-right .arrow{left:0;width:.4rem;height:.8rem}.bs-tooltip-auto[x-placement^=right] .arrow:before,.bs-tooltip-right .arrow:before{right:0;border-width:.4rem .4rem .4rem 0;border-right-color:#000}.bs-tooltip-auto[x-placement^=bottom],.bs-tooltip-bottom{padding:.4rem 0}.bs-tooltip-auto[x-placement^=bottom] .arrow,.bs-tooltip-bottom .arrow{top:0}.bs-tooltip-auto[x-placement^=bottom] .arrow:before,.bs-tooltip-bottom .arrow:before{bottom:0;border-width:0 .4rem .4rem;border-bottom-color:#000}.bs-tooltip-auto[x-placement^=left],.bs-tooltip-left{padding:0 .4rem}.bs-tooltip-auto[x-placement^=left] .arrow,.bs-tooltip-left .arrow{right:0;width:.4rem;height:.8rem}.bs-tooltip-auto[x-placement^=left] .arrow:before,.bs-tooltip-left .arrow:before{left:0;border-width:.4rem 0 .4rem .4rem;border-left-color:#000}.tooltip-inner{max-width:200px;padding:.25rem .5rem;color:#fff;text-align:center;background-color:#000;border-radius:.25rem}.popover{top:0;left:0;z-index:1060;max-width:276px;font-family:-apple-system,BlinkMacSystemFont,Segoe UI,Roboto,Helvetica Neue,Arial,Noto Sans,sans-serif,Apple Color Emoji,Segoe UI Emoji,Segoe UI Symbol,Noto Color Emoji;font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;word-spacing:normal;white-space:normal;line-break:auto;font-size:.875rem;word-wrap:break-word;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,.2);border-radius:.3rem}.popover,.popover .arrow{position:absolute;display:block}.popover .arrow{width:1rem;height:.5rem;margin:0 .3rem}.popover .arrow:after,.popover .arrow:before{position:absolute;display:block;content:"";border-color:transparent;border-style:solid}.bs-popover-auto[x-placement^=top],.bs-popover-top{margin-bottom:.5rem}.bs-popover-auto[x-placement^=top]>.arrow,.bs-popover-top>.arrow{bottom:calc(-.5rem - 1px)}.bs-popover-auto[x-placement^=top]>.arrow:before,.bs-popover-top>.arrow:before{bottom:0;border-width:.5rem .5rem 0;border-top-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=top]>.arrow:after,.bs-popover-top>.arrow:after{bottom:1px;border-width:.5rem .5rem 0;border-top-color:#fff}.bs-popover-auto[x-placement^=right],.bs-popover-right{margin-left:.5rem}.bs-popover-auto[x-placement^=right]>.arrow,.bs-popover-right>.arrow{left:calc(-.5rem - 1px);width:.5rem;height:1rem;margin:.3rem 0}.bs-popover-auto[x-placement^=right]>.arrow:before,.bs-popover-right>.arrow:before{left:0;border-width:.5rem .5rem .5rem 0;border-right-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=right]>.arrow:after,.bs-popover-right>.arrow:after{left:1px;border-width:.5rem .5rem .5rem 0;border-right-color:#fff}.bs-popover-auto[x-placement^=bottom],.bs-popover-bottom{margin-top:.5rem}.bs-popover-auto[x-placement^=bottom]>.arrow,.bs-popover-bottom>.arrow{top:calc(-.5rem - 1px)}.bs-popover-auto[x-placement^=bottom]>.arrow:before,.bs-popover-bottom>.arrow:before{top:0;border-width:0 .5rem .5rem;border-bottom-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=bottom]>.arrow:after,.bs-popover-bottom>.arrow:after{top:1px;border-width:0 .5rem .5rem;border-bottom-color:#fff}.bs-popover-auto[x-placement^=bottom] .popover-header:before,.bs-popover-bottom .popover-header:before{position:absolute;top:0;left:50%;display:block;width:1rem;margin-left:-.5rem;content:"";border-bottom:1px solid #f7f7f7}.bs-popover-auto[x-placement^=left],.bs-popover-left{margin-right:.5rem}.bs-popover-auto[x-placement^=left]>.arrow,.bs-popover-left>.arrow{right:calc(-.5rem - 1px);width:.5rem;height:1rem;margin:.3rem 0}.bs-popover-auto[x-placement^=left]>.arrow:before,.bs-popover-left>.arrow:before{right:0;border-width:.5rem 0 .5rem .5rem;border-left-color:rgba(0,0,0,.25)}.bs-popover-auto[x-placement^=left]>.arrow:after,.bs-popover-left>.arrow:after{right:1px;border-width:.5rem 0 .5rem .5rem;border-left-color:#fff}.popover-header{padding:.5rem .75rem;margin-bottom:0;font-size:1rem;background-color:#f7f7f7;border-bottom:1px solid #ebebeb;border-top-left-radius:calc(.3rem - 1px);border-top-right-radius:calc(.3rem - 1px)}.popover-header:empty{display:none}.popover-body{padding:.5rem .75rem;color:#212529}.carousel{position:relative}.carousel.pointer-event{touch-action:pan-y}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-inner:after{display:block;clear:both;content:""}.carousel-item{position:relative;display:none;float:left;width:100%;margin-right:-100%;backface-visibility:hidden;transition:transform .6s ease-in-out}@media (prefers-reduced-motion:reduce){.carousel-item{transition:none}}.carousel-item-next,.carousel-item-prev,.carousel-item.active{display:block}.active.carousel-item-right,.carousel-item-next:not(.carousel-item-left){transform:translateX(100%)}.active.carousel-item-left,.carousel-item-prev:not(.carousel-item-right){transform:translateX(-100%)}.carousel-fade .carousel-item{opacity:0;transition-property:opacity;transform:none}.carousel-fade .carousel-item-next.carousel-item-left,.carousel-fade .carousel-item-prev.carousel-item-right,.carousel-fade .carousel-item.active{z-index:1;opacity:1}.carousel-fade .active.carousel-item-left,.carousel-fade .active.carousel-item-right{z-index:0;opacity:0;transition:opacity 0s .6s}@media (prefers-reduced-motion:reduce){.carousel-fade .active.carousel-item-left,.carousel-fade .active.carousel-item-right{transition:none}}.carousel-control-next,.carousel-control-prev{position:absolute;top:0;bottom:0;z-index:1;display:flex;align-items:center;justify-content:center;width:15%;color:#fff;text-align:center;opacity:.5;transition:opacity .15s ease}@media (prefers-reduced-motion:reduce){.carousel-control-next,.carousel-control-prev{transition:none}}.carousel-control-next:focus,.carousel-control-next:hover,.carousel-control-prev:focus,.carousel-control-prev:hover{color:#fff;text-decoration:none;outline:0;opacity:.9}.carousel-control-prev{left:0}.carousel-control-next{right:0}.carousel-control-next-icon,.carousel-control-prev-icon{display:inline-block;width:20px;height:20px;background:no-repeat 50%/100% 100%}.carousel-control-prev-icon{background-image:url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' width='8' height='8'%3E%3Cpath d='M5.25 0l-4 4 4 4 1.5-1.5L4.25 4l2.5-2.5L5.25 0z'/%3E%3C/svg%3E")}.carousel-control-next-icon{background-image:url("data:image/svg+xml;charset=utf-8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' width='8' height='8'%3E%3Cpath d='M2.75 0l-1.5 1.5L3.75 4l-2.5 2.5L2.75 8l4-4-4-4z'/%3E%3C/svg%3E")}.carousel-indicators{position:absolute;right:0;bottom:0;left:0;z-index:15;display:flex;justify-content:center;padding-left:0;margin-right:15%;margin-left:15%;list-style:none}.carousel-indicators li{box-sizing:content-box;flex:0 1 auto;width:30px;height:3px;margin-right:3px;margin-left:3px;text-indent:-999px;cursor:pointer;background-color:#fff;background-clip:padding-box;border-top:10px solid transparent;border-bottom:10px solid transparent;opacity:.5;transition:opacity .6s ease}@media (prefers-reduced-motion:reduce){.carousel-indicators li{transition:none}}.carousel-indicators .active{opacity:1}.carousel-caption{position:absolute;right:15%;bottom:20px;left:15%;z-index:10;padding-top:20px;padding-bottom:20px;color:#fff;text-align:center}@keyframes spinner-border{to{transform:rotate(1turn)}}.spinner-border{display:inline-block;width:2rem;height:2rem;vertical-align:text-bottom;border:.25em solid;border-right:.25em solid transparent;border-radius:50%;animation:spinner-border .75s linear infinite}.spinner-border-sm{width:1rem;height:1rem;border-width:.2em}@keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1;transform:none}}.spinner-grow{display:inline-block;width:2rem;height:2rem;vertical-align:text-bottom;background-color:currentColor;border-radius:50%;opacity:0;animation:spinner-grow .75s linear infinite}.spinner-grow-sm{width:1rem;height:1rem}.align-baseline{vertical-align:baseline!important}.align-top{vertical-align:top!important}.align-middle{vertical-align:middle!important}.align-bottom{vertical-align:bottom!important}.align-text-bottom{vertical-align:text-bottom!important}.align-text-top{vertical-align:text-top!important}.bg-primary{background-color:#007bff!important}a.bg-primary:focus,a.bg-primary:hover,button.bg-primary:focus,button.bg-primary:hover{background-color:#0062cc!important}.bg-secondary{background-color:#6c757d!important}a.bg-secondary:focus,a.bg-secondary:hover,button.bg-secondary:focus,button.bg-secondary:hover{background-color:#545b62!important}.bg-success{background-color:#28a745!important}a.bg-success:focus,a.bg-success:hover,button.bg-success:focus,button.bg-success:hover{background-color:#1e7e34!important}.bg-info{background-color:#17a2b8!important}a.bg-info:focus,a.bg-info:hover,button.bg-info:focus,button.bg-info:hover{background-color:#117a8b!important}.bg-warning{background-color:#ffc107!important}a.bg-warning:focus,a.bg-warning:hover,button.bg-warning:focus,button.bg-warning:hover{background-color:#d39e00!important}.bg-danger{background-color:#dc3545!important}a.bg-danger:focus,a.bg-danger:hover,button.bg-danger:focus,button.bg-danger:hover{background-color:#bd2130!important}.bg-light{background-color:#f8f9fa!important}a.bg-light:focus,a.bg-light:hover,button.bg-light:focus,button.bg-light:hover{background-color:#dae0e5!important}.bg-dark{background-color:#343a40!important}a.bg-dark:focus,a.bg-dark:hover,button.bg-dark:focus,button.bg-dark:hover{background-color:#1d2124!important}.bg-white{background-color:#fff!important}.bg-transparent{background-color:transparent!important}.border{border:1px solid #dee2e6!important}.border-top{border-top:1px solid #dee2e6!important}.border-right{border-right:1px solid #dee2e6!important}.border-bottom{border-bottom:1px solid #dee2e6!important}.border-left{border-left:1px solid #dee2e6!important}.border-0{border:0!important}.border-top-0{border-top:0!important}.border-right-0{border-right:0!important}.border-bottom-0{border-bottom:0!important}.border-left-0{border-left:0!important}.border-primary{border-color:#007bff!important}.border-secondary{border-color:#6c757d!important}.border-success{border-color:#28a745!important}.border-info{border-color:#17a2b8!important}.border-warning{border-color:#ffc107!important}.border-danger{border-color:#dc3545!important}.border-light{border-color:#f8f9fa!important}.border-dark{border-color:#343a40!important}.border-white{border-color:#fff!important}.rounded-sm{border-radius:.2rem!important}.rounded{border-radius:.25rem!important}.rounded-top{border-top-left-radius:.25rem!important}.rounded-right,.rounded-top{border-top-right-radius:.25rem!important}.rounded-bottom,.rounded-right{border-bottom-right-radius:.25rem!important}.rounded-bottom,.rounded-left{border-bottom-left-radius:.25rem!important}.rounded-left{border-top-left-radius:.25rem!important}.rounded-lg{border-radius:.3rem!important}.rounded-circle{border-radius:50%!important}.rounded-pill{border-radius:50rem!important}.rounded-0{border-radius:0!important}.clearfix:after{display:block;clear:both;content:""}.d-none{display:none!important}.d-inline{display:inline!important}.d-inline-block{display:inline-block!important}.d-block{display:block!important}.d-table{display:table!important}.d-table-row{display:table-row!important}.d-table-cell{display:table-cell!important}.d-flex{display:flex!important}.d-inline-flex{display:inline-flex!important}@media (min-width:540px){.d-sm-none{display:none!important}.d-sm-inline{display:inline!important}.d-sm-inline-block{display:inline-block!important}.d-sm-block{display:block!important}.d-sm-table{display:table!important}.d-sm-table-row{display:table-row!important}.d-sm-table-cell{display:table-cell!important}.d-sm-flex{display:flex!important}.d-sm-inline-flex{display:inline-flex!important}}@media (min-width:720px){.d-md-none{display:none!important}.d-md-inline{display:inline!important}.d-md-inline-block{display:inline-block!important}.d-md-block{display:block!important}.d-md-table{display:table!important}.d-md-table-row{display:table-row!important}.d-md-table-cell{display:table-cell!important}.d-md-flex{display:flex!important}.d-md-inline-flex{display:inline-flex!important}}@media (min-width:960px){.d-lg-none{display:none!important}.d-lg-inline{display:inline!important}.d-lg-inline-block{display:inline-block!important}.d-lg-block{display:block!important}.d-lg-table{display:table!important}.d-lg-table-row{display:table-row!important}.d-lg-table-cell{display:table-cell!important}.d-lg-flex{display:flex!important}.d-lg-inline-flex{display:inline-flex!important}}@media (min-width:1200px){.d-xl-none{display:none!important}.d-xl-inline{display:inline!important}.d-xl-inline-block{display:inline-block!important}.d-xl-block{display:block!important}.d-xl-table{display:table!important}.d-xl-table-row{display:table-row!important}.d-xl-table-cell{display:table-cell!important}.d-xl-flex{display:flex!important}.d-xl-inline-flex{display:inline-flex!important}}@media print{.d-print-none{display:none!important}.d-print-inline{display:inline!important}.d-print-inline-block{display:inline-block!important}.d-print-block{display:block!important}.d-print-table{display:table!important}.d-print-table-row{display:table-row!important}.d-print-table-cell{display:table-cell!important}.d-print-flex{display:flex!important}.d-print-inline-flex{display:inline-flex!important}}.embed-responsive{position:relative;display:block;width:100%;padding:0;overflow:hidden}.embed-responsive:before{display:block;content:""}.embed-responsive .embed-responsive-item,.embed-responsive embed,.embed-responsive iframe,.embed-responsive object,.embed-responsive video{position:absolute;top:0;bottom:0;left:0;width:100%;height:100%;border:0}.embed-responsive-21by9:before{padding-top:42.85714%}.embed-responsive-16by9:before{padding-top:56.25%}.embed-responsive-4by3:before{padding-top:75%}.embed-responsive-1by1:before{padding-top:100%}.flex-row{flex-direction:row!important}.flex-column{flex-direction:column!important}.flex-row-reverse{flex-direction:row-reverse!important}.flex-column-reverse{flex-direction:column-reverse!important}.flex-wrap{flex-wrap:wrap!important}.flex-nowrap{flex-wrap:nowrap!important}.flex-wrap-reverse{flex-wrap:wrap-reverse!important}.flex-fill{flex:1 1 auto!important}.flex-grow-0{flex-grow:0!important}.flex-grow-1{flex-grow:1!important}.flex-shrink-0{flex-shrink:0!important}.flex-shrink-1{flex-shrink:1!important}.justify-content-start{justify-content:flex-start!important}.justify-content-end{justify-content:flex-end!important}.justify-content-center{justify-content:center!important}.justify-content-between{justify-content:space-between!important}.justify-content-around{justify-content:space-around!important}.align-items-start{align-items:flex-start!important}.align-items-end{align-items:flex-end!important}.align-items-center{align-items:center!important}.align-items-baseline{align-items:baseline!important}.align-items-stretch{align-items:stretch!important}.align-content-start{align-content:flex-start!important}.align-content-end{align-content:flex-end!important}.align-content-center{align-content:center!important}.align-content-between{align-content:space-between!important}.align-content-around{align-content:space-around!important}.align-content-stretch{align-content:stretch!important}.align-self-auto{align-self:auto!important}.align-self-start{align-self:flex-start!important}.align-self-end{align-self:flex-end!important}.align-self-center{align-self:center!important}.align-self-baseline{align-self:baseline!important}.align-self-stretch{align-self:stretch!important}@media (min-width:540px){.flex-sm-row{flex-direction:row!important}.flex-sm-column{flex-direction:column!important}.flex-sm-row-reverse{flex-direction:row-reverse!important}.flex-sm-column-reverse{flex-direction:column-reverse!important}.flex-sm-wrap{flex-wrap:wrap!important}.flex-sm-nowrap{flex-wrap:nowrap!important}.flex-sm-wrap-reverse{flex-wrap:wrap-reverse!important}.flex-sm-fill{flex:1 1 auto!important}.flex-sm-grow-0{flex-grow:0!important}.flex-sm-grow-1{flex-grow:1!important}.flex-sm-shrink-0{flex-shrink:0!important}.flex-sm-shrink-1{flex-shrink:1!important}.justify-content-sm-start{justify-content:flex-start!important}.justify-content-sm-end{justify-content:flex-end!important}.justify-content-sm-center{justify-content:center!important}.justify-content-sm-between{justify-content:space-between!important}.justify-content-sm-around{justify-content:space-around!important}.align-items-sm-start{align-items:flex-start!important}.align-items-sm-end{align-items:flex-end!important}.align-items-sm-center{align-items:center!important}.align-items-sm-baseline{align-items:baseline!important}.align-items-sm-stretch{align-items:stretch!important}.align-content-sm-start{align-content:flex-start!important}.align-content-sm-end{align-content:flex-end!important}.align-content-sm-center{align-content:center!important}.align-content-sm-between{align-content:space-between!important}.align-content-sm-around{align-content:space-around!important}.align-content-sm-stretch{align-content:stretch!important}.align-self-sm-auto{align-self:auto!important}.align-self-sm-start{align-self:flex-start!important}.align-self-sm-end{align-self:flex-end!important}.align-self-sm-center{align-self:center!important}.align-self-sm-baseline{align-self:baseline!important}.align-self-sm-stretch{align-self:stretch!important}}@media (min-width:720px){.flex-md-row{flex-direction:row!important}.flex-md-column{flex-direction:column!important}.flex-md-row-reverse{flex-direction:row-reverse!important}.flex-md-column-reverse{flex-direction:column-reverse!important}.flex-md-wrap{flex-wrap:wrap!important}.flex-md-nowrap{flex-wrap:nowrap!important}.flex-md-wrap-reverse{flex-wrap:wrap-reverse!important}.flex-md-fill{flex:1 1 auto!important}.flex-md-grow-0{flex-grow:0!important}.flex-md-grow-1{flex-grow:1!important}.flex-md-shrink-0{flex-shrink:0!important}.flex-md-shrink-1{flex-shrink:1!important}.justify-content-md-start{justify-content:flex-start!important}.justify-content-md-end{justify-content:flex-end!important}.justify-content-md-center{justify-content:center!important}.justify-content-md-between{justify-content:space-between!important}.justify-content-md-around{justify-content:space-around!important}.align-items-md-start{align-items:flex-start!important}.align-items-md-end{align-items:flex-end!important}.align-items-md-center{align-items:center!important}.align-items-md-baseline{align-items:baseline!important}.align-items-md-stretch{align-items:stretch!important}.align-content-md-start{align-content:flex-start!important}.align-content-md-end{align-content:flex-end!important}.align-content-md-center{align-content:center!important}.align-content-md-between{align-content:space-between!important}.align-content-md-around{align-content:space-around!important}.align-content-md-stretch{align-content:stretch!important}.align-self-md-auto{align-self:auto!important}.align-self-md-start{align-self:flex-start!important}.align-self-md-end{align-self:flex-end!important}.align-self-md-center{align-self:center!important}.align-self-md-baseline{align-self:baseline!important}.align-self-md-stretch{align-self:stretch!important}}@media (min-width:960px){.flex-lg-row{flex-direction:row!important}.flex-lg-column{flex-direction:column!important}.flex-lg-row-reverse{flex-direction:row-reverse!important}.flex-lg-column-reverse{flex-direction:column-reverse!important}.flex-lg-wrap{flex-wrap:wrap!important}.flex-lg-nowrap{flex-wrap:nowrap!important}.flex-lg-wrap-reverse{flex-wrap:wrap-reverse!important}.flex-lg-fill{flex:1 1 auto!important}.flex-lg-grow-0{flex-grow:0!important}.flex-lg-grow-1{flex-grow:1!important}.flex-lg-shrink-0{flex-shrink:0!important}.flex-lg-shrink-1{flex-shrink:1!important}.justify-content-lg-start{justify-content:flex-start!important}.justify-content-lg-end{justify-content:flex-end!important}.justify-content-lg-center{justify-content:center!important}.justify-content-lg-between{justify-content:space-between!important}.justify-content-lg-around{justify-content:space-around!important}.align-items-lg-start{align-items:flex-start!important}.align-items-lg-end{align-items:flex-end!important}.align-items-lg-center{align-items:center!important}.align-items-lg-baseline{align-items:baseline!important}.align-items-lg-stretch{align-items:stretch!important}.align-content-lg-start{align-content:flex-start!important}.align-content-lg-end{align-content:flex-end!important}.align-content-lg-center{align-content:center!important}.align-content-lg-between{align-content:space-between!important}.align-content-lg-around{align-content:space-around!important}.align-content-lg-stretch{align-content:stretch!important}.align-self-lg-auto{align-self:auto!important}.align-self-lg-start{align-self:flex-start!important}.align-self-lg-end{align-self:flex-end!important}.align-self-lg-center{align-self:center!important}.align-self-lg-baseline{align-self:baseline!important}.align-self-lg-stretch{align-self:stretch!important}}@media (min-width:1200px){.flex-xl-row{flex-direction:row!important}.flex-xl-column{flex-direction:column!important}.flex-xl-row-reverse{flex-direction:row-reverse!important}.flex-xl-column-reverse{flex-direction:column-reverse!important}.flex-xl-wrap{flex-wrap:wrap!important}.flex-xl-nowrap{flex-wrap:nowrap!important}.flex-xl-wrap-reverse{flex-wrap:wrap-reverse!important}.flex-xl-fill{flex:1 1 auto!important}.flex-xl-grow-0{flex-grow:0!important}.flex-xl-grow-1{flex-grow:1!important}.flex-xl-shrink-0{flex-shrink:0!important}.flex-xl-shrink-1{flex-shrink:1!important}.justify-content-xl-start{justify-content:flex-start!important}.justify-content-xl-end{justify-content:flex-end!important}.justify-content-xl-center{justify-content:center!important}.justify-content-xl-between{justify-content:space-between!important}.justify-content-xl-around{justify-content:space-around!important}.align-items-xl-start{align-items:flex-start!important}.align-items-xl-end{align-items:flex-end!important}.align-items-xl-center{align-items:center!important}.align-items-xl-baseline{align-items:baseline!important}.align-items-xl-stretch{align-items:stretch!important}.align-content-xl-start{align-content:flex-start!important}.align-content-xl-end{align-content:flex-end!important}.align-content-xl-center{align-content:center!important}.align-content-xl-between{align-content:space-between!important}.align-content-xl-around{align-content:space-around!important}.align-content-xl-stretch{align-content:stretch!important}.align-self-xl-auto{align-self:auto!important}.align-self-xl-start{align-self:flex-start!important}.align-self-xl-end{align-self:flex-end!important}.align-self-xl-center{align-self:center!important}.align-self-xl-baseline{align-self:baseline!important}.align-self-xl-stretch{align-self:stretch!important}}.float-left{float:left!important}.float-right{float:right!important}.float-none{float:none!important}@media (min-width:540px){.float-sm-left{float:left!important}.float-sm-right{float:right!important}.float-sm-none{float:none!important}}@media (min-width:720px){.float-md-left{float:left!important}.float-md-right{float:right!important}.float-md-none{float:none!important}}@media (min-width:960px){.float-lg-left{float:left!important}.float-lg-right{float:right!important}.float-lg-none{float:none!important}}@media (min-width:1200px){.float-xl-left{float:left!important}.float-xl-right{float:right!important}.float-xl-none{float:none!important}}.user-select-all{user-select:all!important}.user-select-auto{user-select:auto!important}.user-select-none{user-select:none!important}.overflow-auto{overflow:auto!important}.overflow-hidden{overflow:hidden!important}.position-static{position:static!important}.position-relative{position:relative!important}.position-absolute{position:absolute!important}.position-fixed{position:fixed!important}.position-sticky{position:sticky!important}.fixed-top{top:0}.fixed-bottom,.fixed-top{position:fixed;right:0;left:0;z-index:1030}.fixed-bottom{bottom:0}@supports (position:sticky){.sticky-top{position:sticky;top:0;z-index:1020}}.sr-only{position:absolute;width:1px;height:1px;padding:0;margin:-1px;overflow:hidden;clip:rect(0,0,0,0);white-space:nowrap;border:0}.sr-only-focusable:active,.sr-only-focusable:focus{position:static;width:auto;height:auto;overflow:visible;clip:auto;white-space:normal}.shadow-sm{box-shadow:0 .125rem .25rem rgba(0,0,0,.075)!important}.shadow{box-shadow:0 .5rem 1rem rgba(0,0,0,.15)!important}.shadow-lg{box-shadow:0 1rem 3rem rgba(0,0,0,.175)!important}.shadow-none{box-shadow:none!important}.w-25{width:25%!important}.w-50{width:50%!important}.w-75{width:75%!important}.w-100{width:100%!important}.w-auto{width:auto!important}.h-25{height:25%!important}.h-50{height:50%!important}.h-75{height:75%!important}.h-100{height:100%!important}.h-auto{height:auto!important}.mw-100{max-width:100%!important}.mh-100{max-height:100%!important}.min-vw-100{min-width:100vw!important}.min-vh-100{min-height:100vh!important}.vw-100{width:100vw!important}.vh-100{height:100vh!important}.m-0{margin:0!important}.mt-0,.my-0{margin-top:0!important}.mr-0,.mx-0{margin-right:0!important}.mb-0,.my-0{margin-bottom:0!important}.ml-0,.mx-0{margin-left:0!important}.m-1{margin:.25rem!important}.mt-1,.my-1{margin-top:.25rem!important}.mr-1,.mx-1{margin-right:.25rem!important}.mb-1,.my-1{margin-bottom:.25rem!important}.ml-1,.mx-1{margin-left:.25rem!important}.m-2{margin:.5rem!important}.mt-2,.my-2{margin-top:.5rem!important}.mr-2,.mx-2{margin-right:.5rem!important}.mb-2,.my-2{margin-bottom:.5rem!important}.ml-2,.mx-2{margin-left:.5rem!important}.m-3{margin:1rem!important}.mt-3,.my-3{margin-top:1rem!important}.mr-3,.mx-3{margin-right:1rem!important}.mb-3,.my-3{margin-bottom:1rem!important}.ml-3,.mx-3{margin-left:1rem!important}.m-4{margin:1.5rem!important}.mt-4,.my-4{margin-top:1.5rem!important}.mr-4,.mx-4{margin-right:1.5rem!important}.mb-4,.my-4{margin-bottom:1.5rem!important}.ml-4,.mx-4{margin-left:1.5rem!important}.m-5{margin:3rem!important}.mt-5,.my-5{margin-top:3rem!important}.mr-5,.mx-5{margin-right:3rem!important}.mb-5,.my-5{margin-bottom:3rem!important}.ml-5,.mx-5{margin-left:3rem!important}.p-0{padding:0!important}.pt-0,.py-0{padding-top:0!important}.pr-0,.px-0{padding-right:0!important}.pb-0,.py-0{padding-bottom:0!important}.pl-0,.px-0{padding-left:0!important}.p-1{padding:.25rem!important}.pt-1,.py-1{padding-top:.25rem!important}.pr-1,.px-1{padding-right:.25rem!important}.pb-1,.py-1{padding-bottom:.25rem!important}.pl-1,.px-1{padding-left:.25rem!important}.p-2{padding:.5rem!important}.pt-2,.py-2{padding-top:.5rem!important}.pr-2,.px-2{padding-right:.5rem!important}.pb-2,.py-2{padding-bottom:.5rem!important}.pl-2,.px-2{padding-left:.5rem!important}.p-3{padding:1rem!important}.pt-3,.py-3{padding-top:1rem!important}.pr-3,.px-3{padding-right:1rem!important}.pb-3,.py-3{padding-bottom:1rem!important}.pl-3,.px-3{padding-left:1rem!important}.p-4{padding:1.5rem!important}.pt-4,.py-4{padding-top:1.5rem!important}.pr-4,.px-4{padding-right:1.5rem!important}.pb-4,.py-4{padding-bottom:1.5rem!important}.pl-4,.px-4{padding-left:1.5rem!important}.p-5{padding:3rem!important}.pt-5,.py-5{padding-top:3rem!important}.pr-5,.px-5{padding-right:3rem!important}.pb-5,.py-5{padding-bottom:3rem!important}.pl-5,.px-5{padding-left:3rem!important}.m-n1{margin:-.25rem!important}.mt-n1,.my-n1{margin-top:-.25rem!important}.mr-n1,.mx-n1{margin-right:-.25rem!important}.mb-n1,.my-n1{margin-bottom:-.25rem!important}.ml-n1,.mx-n1{margin-left:-.25rem!important}.m-n2{margin:-.5rem!important}.mt-n2,.my-n2{margin-top:-.5rem!important}.mr-n2,.mx-n2{margin-right:-.5rem!important}.mb-n2,.my-n2{margin-bottom:-.5rem!important}.ml-n2,.mx-n2{margin-left:-.5rem!important}.m-n3{margin:-1rem!important}.mt-n3,.my-n3{margin-top:-1rem!important}.mr-n3,.mx-n3{margin-right:-1rem!important}.mb-n3,.my-n3{margin-bottom:-1rem!important}.ml-n3,.mx-n3{margin-left:-1rem!important}.m-n4{margin:-1.5rem!important}.mt-n4,.my-n4{margin-top:-1.5rem!important}.mr-n4,.mx-n4{margin-right:-1.5rem!important}.mb-n4,.my-n4{margin-bottom:-1.5rem!important}.ml-n4,.mx-n4{margin-left:-1.5rem!important}.m-n5{margin:-3rem!important}.mt-n5,.my-n5{margin-top:-3rem!important}.mr-n5,.mx-n5{margin-right:-3rem!important}.mb-n5,.my-n5{margin-bottom:-3rem!important}.ml-n5,.mx-n5{margin-left:-3rem!important}.m-auto{margin:auto!important}.mt-auto,.my-auto{margin-top:auto!important}.mr-auto,.mx-auto{margin-right:auto!important}.mb-auto,.my-auto{margin-bottom:auto!important}.ml-auto,.mx-auto{margin-left:auto!important}@media (min-width:540px){.m-sm-0{margin:0!important}.mt-sm-0,.my-sm-0{margin-top:0!important}.mr-sm-0,.mx-sm-0{margin-right:0!important}.mb-sm-0,.my-sm-0{margin-bottom:0!important}.ml-sm-0,.mx-sm-0{margin-left:0!important}.m-sm-1{margin:.25rem!important}.mt-sm-1,.my-sm-1{margin-top:.25rem!important}.mr-sm-1,.mx-sm-1{margin-right:.25rem!important}.mb-sm-1,.my-sm-1{margin-bottom:.25rem!important}.ml-sm-1,.mx-sm-1{margin-left:.25rem!important}.m-sm-2{margin:.5rem!important}.mt-sm-2,.my-sm-2{margin-top:.5rem!important}.mr-sm-2,.mx-sm-2{margin-right:.5rem!important}.mb-sm-2,.my-sm-2{margin-bottom:.5rem!important}.ml-sm-2,.mx-sm-2{margin-left:.5rem!important}.m-sm-3{margin:1rem!important}.mt-sm-3,.my-sm-3{margin-top:1rem!important}.mr-sm-3,.mx-sm-3{margin-right:1rem!important}.mb-sm-3,.my-sm-3{margin-bottom:1rem!important}.ml-sm-3,.mx-sm-3{margin-left:1rem!important}.m-sm-4{margin:1.5rem!important}.mt-sm-4,.my-sm-4{margin-top:1.5rem!important}.mr-sm-4,.mx-sm-4{margin-right:1.5rem!important}.mb-sm-4,.my-sm-4{margin-bottom:1.5rem!important}.ml-sm-4,.mx-sm-4{margin-left:1.5rem!important}.m-sm-5{margin:3rem!important}.mt-sm-5,.my-sm-5{margin-top:3rem!important}.mr-sm-5,.mx-sm-5{margin-right:3rem!important}.mb-sm-5,.my-sm-5{margin-bottom:3rem!important}.ml-sm-5,.mx-sm-5{margin-left:3rem!important}.p-sm-0{padding:0!important}.pt-sm-0,.py-sm-0{padding-top:0!important}.pr-sm-0,.px-sm-0{padding-right:0!important}.pb-sm-0,.py-sm-0{padding-bottom:0!important}.pl-sm-0,.px-sm-0{padding-left:0!important}.p-sm-1{padding:.25rem!important}.pt-sm-1,.py-sm-1{padding-top:.25rem!important}.pr-sm-1,.px-sm-1{padding-right:.25rem!important}.pb-sm-1,.py-sm-1{padding-bottom:.25rem!important}.pl-sm-1,.px-sm-1{padding-left:.25rem!important}.p-sm-2{padding:.5rem!important}.pt-sm-2,.py-sm-2{padding-top:.5rem!important}.pr-sm-2,.px-sm-2{padding-right:.5rem!important}.pb-sm-2,.py-sm-2{padding-bottom:.5rem!important}.pl-sm-2,.px-sm-2{padding-left:.5rem!important}.p-sm-3{padding:1rem!important}.pt-sm-3,.py-sm-3{padding-top:1rem!important}.pr-sm-3,.px-sm-3{padding-right:1rem!important}.pb-sm-3,.py-sm-3{padding-bottom:1rem!important}.pl-sm-3,.px-sm-3{padding-left:1rem!important}.p-sm-4{padding:1.5rem!important}.pt-sm-4,.py-sm-4{padding-top:1.5rem!important}.pr-sm-4,.px-sm-4{padding-right:1.5rem!important}.pb-sm-4,.py-sm-4{padding-bottom:1.5rem!important}.pl-sm-4,.px-sm-4{padding-left:1.5rem!important}.p-sm-5{padding:3rem!important}.pt-sm-5,.py-sm-5{padding-top:3rem!important}.pr-sm-5,.px-sm-5{padding-right:3rem!important}.pb-sm-5,.py-sm-5{padding-bottom:3rem!important}.pl-sm-5,.px-sm-5{padding-left:3rem!important}.m-sm-n1{margin:-.25rem!important}.mt-sm-n1,.my-sm-n1{margin-top:-.25rem!important}.mr-sm-n1,.mx-sm-n1{margin-right:-.25rem!important}.mb-sm-n1,.my-sm-n1{margin-bottom:-.25rem!important}.ml-sm-n1,.mx-sm-n1{margin-left:-.25rem!important}.m-sm-n2{margin:-.5rem!important}.mt-sm-n2,.my-sm-n2{margin-top:-.5rem!important}.mr-sm-n2,.mx-sm-n2{margin-right:-.5rem!important}.mb-sm-n2,.my-sm-n2{margin-bottom:-.5rem!important}.ml-sm-n2,.mx-sm-n2{margin-left:-.5rem!important}.m-sm-n3{margin:-1rem!important}.mt-sm-n3,.my-sm-n3{margin-top:-1rem!important}.mr-sm-n3,.mx-sm-n3{margin-right:-1rem!important}.mb-sm-n3,.my-sm-n3{margin-bottom:-1rem!important}.ml-sm-n3,.mx-sm-n3{margin-left:-1rem!important}.m-sm-n4{margin:-1.5rem!important}.mt-sm-n4,.my-sm-n4{margin-top:-1.5rem!important}.mr-sm-n4,.mx-sm-n4{margin-right:-1.5rem!important}.mb-sm-n4,.my-sm-n4{margin-bottom:-1.5rem!important}.ml-sm-n4,.mx-sm-n4{margin-left:-1.5rem!important}.m-sm-n5{margin:-3rem!important}.mt-sm-n5,.my-sm-n5{margin-top:-3rem!important}.mr-sm-n5,.mx-sm-n5{margin-right:-3rem!important}.mb-sm-n5,.my-sm-n5{margin-bottom:-3rem!important}.ml-sm-n5,.mx-sm-n5{margin-left:-3rem!important}.m-sm-auto{margin:auto!important}.mt-sm-auto,.my-sm-auto{margin-top:auto!important}.mr-sm-auto,.mx-sm-auto{margin-right:auto!important}.mb-sm-auto,.my-sm-auto{margin-bottom:auto!important}.ml-sm-auto,.mx-sm-auto{margin-left:auto!important}}@media (min-width:720px){.m-md-0{margin:0!important}.mt-md-0,.my-md-0{margin-top:0!important}.mr-md-0,.mx-md-0{margin-right:0!important}.mb-md-0,.my-md-0{margin-bottom:0!important}.ml-md-0,.mx-md-0{margin-left:0!important}.m-md-1{margin:.25rem!important}.mt-md-1,.my-md-1{margin-top:.25rem!important}.mr-md-1,.mx-md-1{margin-right:.25rem!important}.mb-md-1,.my-md-1{margin-bottom:.25rem!important}.ml-md-1,.mx-md-1{margin-left:.25rem!important}.m-md-2{margin:.5rem!important}.mt-md-2,.my-md-2{margin-top:.5rem!important}.mr-md-2,.mx-md-2{margin-right:.5rem!important}.mb-md-2,.my-md-2{margin-bottom:.5rem!important}.ml-md-2,.mx-md-2{margin-left:.5rem!important}.m-md-3{margin:1rem!important}.mt-md-3,.my-md-3{margin-top:1rem!important}.mr-md-3,.mx-md-3{margin-right:1rem!important}.mb-md-3,.my-md-3{margin-bottom:1rem!important}.ml-md-3,.mx-md-3{margin-left:1rem!important}.m-md-4{margin:1.5rem!important}.mt-md-4,.my-md-4{margin-top:1.5rem!important}.mr-md-4,.mx-md-4{margin-right:1.5rem!important}.mb-md-4,.my-md-4{margin-bottom:1.5rem!important}.ml-md-4,.mx-md-4{margin-left:1.5rem!important}.m-md-5{margin:3rem!important}.mt-md-5,.my-md-5{margin-top:3rem!important}.mr-md-5,.mx-md-5{margin-right:3rem!important}.mb-md-5,.my-md-5{margin-bottom:3rem!important}.ml-md-5,.mx-md-5{margin-left:3rem!important}.p-md-0{padding:0!important}.pt-md-0,.py-md-0{padding-top:0!important}.pr-md-0,.px-md-0{padding-right:0!important}.pb-md-0,.py-md-0{padding-bottom:0!important}.pl-md-0,.px-md-0{padding-left:0!important}.p-md-1{padding:.25rem!important}.pt-md-1,.py-md-1{padding-top:.25rem!important}.pr-md-1,.px-md-1{padding-right:.25rem!important}.pb-md-1,.py-md-1{padding-bottom:.25rem!important}.pl-md-1,.px-md-1{padding-left:.25rem!important}.p-md-2{padding:.5rem!important}.pt-md-2,.py-md-2{padding-top:.5rem!important}.pr-md-2,.px-md-2{padding-right:.5rem!important}.pb-md-2,.py-md-2{padding-bottom:.5rem!important}.pl-md-2,.px-md-2{padding-left:.5rem!important}.p-md-3{padding:1rem!important}.pt-md-3,.py-md-3{padding-top:1rem!important}.pr-md-3,.px-md-3{padding-right:1rem!important}.pb-md-3,.py-md-3{padding-bottom:1rem!important}.pl-md-3,.px-md-3{padding-left:1rem!important}.p-md-4{padding:1.5rem!important}.pt-md-4,.py-md-4{padding-top:1.5rem!important}.pr-md-4,.px-md-4{padding-right:1.5rem!important}.pb-md-4,.py-md-4{padding-bottom:1.5rem!important}.pl-md-4,.px-md-4{padding-left:1.5rem!important}.p-md-5{padding:3rem!important}.pt-md-5,.py-md-5{padding-top:3rem!important}.pr-md-5,.px-md-5{padding-right:3rem!important}.pb-md-5,.py-md-5{padding-bottom:3rem!important}.pl-md-5,.px-md-5{padding-left:3rem!important}.m-md-n1{margin:-.25rem!important}.mt-md-n1,.my-md-n1{margin-top:-.25rem!important}.mr-md-n1,.mx-md-n1{margin-right:-.25rem!important}.mb-md-n1,.my-md-n1{margin-bottom:-.25rem!important}.ml-md-n1,.mx-md-n1{margin-left:-.25rem!important}.m-md-n2{margin:-.5rem!important}.mt-md-n2,.my-md-n2{margin-top:-.5rem!important}.mr-md-n2,.mx-md-n2{margin-right:-.5rem!important}.mb-md-n2,.my-md-n2{margin-bottom:-.5rem!important}.ml-md-n2,.mx-md-n2{margin-left:-.5rem!important}.m-md-n3{margin:-1rem!important}.mt-md-n3,.my-md-n3{margin-top:-1rem!important}.mr-md-n3,.mx-md-n3{margin-right:-1rem!important}.mb-md-n3,.my-md-n3{margin-bottom:-1rem!important}.ml-md-n3,.mx-md-n3{margin-left:-1rem!important}.m-md-n4{margin:-1.5rem!important}.mt-md-n4,.my-md-n4{margin-top:-1.5rem!important}.mr-md-n4,.mx-md-n4{margin-right:-1.5rem!important}.mb-md-n4,.my-md-n4{margin-bottom:-1.5rem!important}.ml-md-n4,.mx-md-n4{margin-left:-1.5rem!important}.m-md-n5{margin:-3rem!important}.mt-md-n5,.my-md-n5{margin-top:-3rem!important}.mr-md-n5,.mx-md-n5{margin-right:-3rem!important}.mb-md-n5,.my-md-n5{margin-bottom:-3rem!important}.ml-md-n5,.mx-md-n5{margin-left:-3rem!important}.m-md-auto{margin:auto!important}.mt-md-auto,.my-md-auto{margin-top:auto!important}.mr-md-auto,.mx-md-auto{margin-right:auto!important}.mb-md-auto,.my-md-auto{margin-bottom:auto!important}.ml-md-auto,.mx-md-auto{margin-left:auto!important}}@media (min-width:960px){.m-lg-0{margin:0!important}.mt-lg-0,.my-lg-0{margin-top:0!important}.mr-lg-0,.mx-lg-0{margin-right:0!important}.mb-lg-0,.my-lg-0{margin-bottom:0!important}.ml-lg-0,.mx-lg-0{margin-left:0!important}.m-lg-1{margin:.25rem!important}.mt-lg-1,.my-lg-1{margin-top:.25rem!important}.mr-lg-1,.mx-lg-1{margin-right:.25rem!important}.mb-lg-1,.my-lg-1{margin-bottom:.25rem!important}.ml-lg-1,.mx-lg-1{margin-left:.25rem!important}.m-lg-2{margin:.5rem!important}.mt-lg-2,.my-lg-2{margin-top:.5rem!important}.mr-lg-2,.mx-lg-2{margin-right:.5rem!important}.mb-lg-2,.my-lg-2{margin-bottom:.5rem!important}.ml-lg-2,.mx-lg-2{margin-left:.5rem!important}.m-lg-3{margin:1rem!important}.mt-lg-3,.my-lg-3{margin-top:1rem!important}.mr-lg-3,.mx-lg-3{margin-right:1rem!important}.mb-lg-3,.my-lg-3{margin-bottom:1rem!important}.ml-lg-3,.mx-lg-3{margin-left:1rem!important}.m-lg-4{margin:1.5rem!important}.mt-lg-4,.my-lg-4{margin-top:1.5rem!important}.mr-lg-4,.mx-lg-4{margin-right:1.5rem!important}.mb-lg-4,.my-lg-4{margin-bottom:1.5rem!important}.ml-lg-4,.mx-lg-4{margin-left:1.5rem!important}.m-lg-5{margin:3rem!important}.mt-lg-5,.my-lg-5{margin-top:3rem!important}.mr-lg-5,.mx-lg-5{margin-right:3rem!important}.mb-lg-5,.my-lg-5{margin-bottom:3rem!important}.ml-lg-5,.mx-lg-5{margin-left:3rem!important}.p-lg-0{padding:0!important}.pt-lg-0,.py-lg-0{padding-top:0!important}.pr-lg-0,.px-lg-0{padding-right:0!important}.pb-lg-0,.py-lg-0{padding-bottom:0!important}.pl-lg-0,.px-lg-0{padding-left:0!important}.p-lg-1{padding:.25rem!important}.pt-lg-1,.py-lg-1{padding-top:.25rem!important}.pr-lg-1,.px-lg-1{padding-right:.25rem!important}.pb-lg-1,.py-lg-1{padding-bottom:.25rem!important}.pl-lg-1,.px-lg-1{padding-left:.25rem!important}.p-lg-2{padding:.5rem!important}.pt-lg-2,.py-lg-2{padding-top:.5rem!important}.pr-lg-2,.px-lg-2{padding-right:.5rem!important}.pb-lg-2,.py-lg-2{padding-bottom:.5rem!important}.pl-lg-2,.px-lg-2{padding-left:.5rem!important}.p-lg-3{padding:1rem!important}.pt-lg-3,.py-lg-3{padding-top:1rem!important}.pr-lg-3,.px-lg-3{padding-right:1rem!important}.pb-lg-3,.py-lg-3{padding-bottom:1rem!important}.pl-lg-3,.px-lg-3{padding-left:1rem!important}.p-lg-4{padding:1.5rem!important}.pt-lg-4,.py-lg-4{padding-top:1.5rem!important}.pr-lg-4,.px-lg-4{padding-right:1.5rem!important}.pb-lg-4,.py-lg-4{padding-bottom:1.5rem!important}.pl-lg-4,.px-lg-4{padding-left:1.5rem!important}.p-lg-5{padding:3rem!important}.pt-lg-5,.py-lg-5{padding-top:3rem!important}.pr-lg-5,.px-lg-5{padding-right:3rem!important}.pb-lg-5,.py-lg-5{padding-bottom:3rem!important}.pl-lg-5,.px-lg-5{padding-left:3rem!important}.m-lg-n1{margin:-.25rem!important}.mt-lg-n1,.my-lg-n1{margin-top:-.25rem!important}.mr-lg-n1,.mx-lg-n1{margin-right:-.25rem!important}.mb-lg-n1,.my-lg-n1{margin-bottom:-.25rem!important}.ml-lg-n1,.mx-lg-n1{margin-left:-.25rem!important}.m-lg-n2{margin:-.5rem!important}.mt-lg-n2,.my-lg-n2{margin-top:-.5rem!important}.mr-lg-n2,.mx-lg-n2{margin-right:-.5rem!important}.mb-lg-n2,.my-lg-n2{margin-bottom:-.5rem!important}.ml-lg-n2,.mx-lg-n2{margin-left:-.5rem!important}.m-lg-n3{margin:-1rem!important}.mt-lg-n3,.my-lg-n3{margin-top:-1rem!important}.mr-lg-n3,.mx-lg-n3{margin-right:-1rem!important}.mb-lg-n3,.my-lg-n3{margin-bottom:-1rem!important}.ml-lg-n3,.mx-lg-n3{margin-left:-1rem!important}.m-lg-n4{margin:-1.5rem!important}.mt-lg-n4,.my-lg-n4{margin-top:-1.5rem!important}.mr-lg-n4,.mx-lg-n4{margin-right:-1.5rem!important}.mb-lg-n4,.my-lg-n4{margin-bottom:-1.5rem!important}.ml-lg-n4,.mx-lg-n4{margin-left:-1.5rem!important}.m-lg-n5{margin:-3rem!important}.mt-lg-n5,.my-lg-n5{margin-top:-3rem!important}.mr-lg-n5,.mx-lg-n5{margin-right:-3rem!important}.mb-lg-n5,.my-lg-n5{margin-bottom:-3rem!important}.ml-lg-n5,.mx-lg-n5{margin-left:-3rem!important}.m-lg-auto{margin:auto!important}.mt-lg-auto,.my-lg-auto{margin-top:auto!important}.mr-lg-auto,.mx-lg-auto{margin-right:auto!important}.mb-lg-auto,.my-lg-auto{margin-bottom:auto!important}.ml-lg-auto,.mx-lg-auto{margin-left:auto!important}}@media (min-width:1200px){.m-xl-0{margin:0!important}.mt-xl-0,.my-xl-0{margin-top:0!important}.mr-xl-0,.mx-xl-0{margin-right:0!important}.mb-xl-0,.my-xl-0{margin-bottom:0!important}.ml-xl-0,.mx-xl-0{margin-left:0!important}.m-xl-1{margin:.25rem!important}.mt-xl-1,.my-xl-1{margin-top:.25rem!important}.mr-xl-1,.mx-xl-1{margin-right:.25rem!important}.mb-xl-1,.my-xl-1{margin-bottom:.25rem!important}.ml-xl-1,.mx-xl-1{margin-left:.25rem!important}.m-xl-2{margin:.5rem!important}.mt-xl-2,.my-xl-2{margin-top:.5rem!important}.mr-xl-2,.mx-xl-2{margin-right:.5rem!important}.mb-xl-2,.my-xl-2{margin-bottom:.5rem!important}.ml-xl-2,.mx-xl-2{margin-left:.5rem!important}.m-xl-3{margin:1rem!important}.mt-xl-3,.my-xl-3{margin-top:1rem!important}.mr-xl-3,.mx-xl-3{margin-right:1rem!important}.mb-xl-3,.my-xl-3{margin-bottom:1rem!important}.ml-xl-3,.mx-xl-3{margin-left:1rem!important}.m-xl-4{margin:1.5rem!important}.mt-xl-4,.my-xl-4{margin-top:1.5rem!important}.mr-xl-4,.mx-xl-4{margin-right:1.5rem!important}.mb-xl-4,.my-xl-4{margin-bottom:1.5rem!important}.ml-xl-4,.mx-xl-4{margin-left:1.5rem!important}.m-xl-5{margin:3rem!important}.mt-xl-5,.my-xl-5{margin-top:3rem!important}.mr-xl-5,.mx-xl-5{margin-right:3rem!important}.mb-xl-5,.my-xl-5{margin-bottom:3rem!important}.ml-xl-5,.mx-xl-5{margin-left:3rem!important}.p-xl-0{padding:0!important}.pt-xl-0,.py-xl-0{padding-top:0!important}.pr-xl-0,.px-xl-0{padding-right:0!important}.pb-xl-0,.py-xl-0{padding-bottom:0!important}.pl-xl-0,.px-xl-0{padding-left:0!important}.p-xl-1{padding:.25rem!important}.pt-xl-1,.py-xl-1{padding-top:.25rem!important}.pr-xl-1,.px-xl-1{padding-right:.25rem!important}.pb-xl-1,.py-xl-1{padding-bottom:.25rem!important}.pl-xl-1,.px-xl-1{padding-left:.25rem!important}.p-xl-2{padding:.5rem!important}.pt-xl-2,.py-xl-2{padding-top:.5rem!important}.pr-xl-2,.px-xl-2{padding-right:.5rem!important}.pb-xl-2,.py-xl-2{padding-bottom:.5rem!important}.pl-xl-2,.px-xl-2{padding-left:.5rem!important}.p-xl-3{padding:1rem!important}.pt-xl-3,.py-xl-3{padding-top:1rem!important}.pr-xl-3,.px-xl-3{padding-right:1rem!important}.pb-xl-3,.py-xl-3{padding-bottom:1rem!important}.pl-xl-3,.px-xl-3{padding-left:1rem!important}.p-xl-4{padding:1.5rem!important}.pt-xl-4,.py-xl-4{padding-top:1.5rem!important}.pr-xl-4,.px-xl-4{padding-right:1.5rem!important}.pb-xl-4,.py-xl-4{padding-bottom:1.5rem!important}.pl-xl-4,.px-xl-4{padding-left:1.5rem!important}.p-xl-5{padding:3rem!important}.pt-xl-5,.py-xl-5{padding-top:3rem!important}.pr-xl-5,.px-xl-5{padding-right:3rem!important}.pb-xl-5,.py-xl-5{padding-bottom:3rem!important}.pl-xl-5,.px-xl-5{padding-left:3rem!important}.m-xl-n1{margin:-.25rem!important}.mt-xl-n1,.my-xl-n1{margin-top:-.25rem!important}.mr-xl-n1,.mx-xl-n1{margin-right:-.25rem!important}.mb-xl-n1,.my-xl-n1{margin-bottom:-.25rem!important}.ml-xl-n1,.mx-xl-n1{margin-left:-.25rem!important}.m-xl-n2{margin:-.5rem!important}.mt-xl-n2,.my-xl-n2{margin-top:-.5rem!important}.mr-xl-n2,.mx-xl-n2{margin-right:-.5rem!important}.mb-xl-n2,.my-xl-n2{margin-bottom:-.5rem!important}.ml-xl-n2,.mx-xl-n2{margin-left:-.5rem!important}.m-xl-n3{margin:-1rem!important}.mt-xl-n3,.my-xl-n3{margin-top:-1rem!important}.mr-xl-n3,.mx-xl-n3{margin-right:-1rem!important}.mb-xl-n3,.my-xl-n3{margin-bottom:-1rem!important}.ml-xl-n3,.mx-xl-n3{margin-left:-1rem!important}.m-xl-n4{margin:-1.5rem!important}.mt-xl-n4,.my-xl-n4{margin-top:-1.5rem!important}.mr-xl-n4,.mx-xl-n4{margin-right:-1.5rem!important}.mb-xl-n4,.my-xl-n4{margin-bottom:-1.5rem!important}.ml-xl-n4,.mx-xl-n4{margin-left:-1.5rem!important}.m-xl-n5{margin:-3rem!important}.mt-xl-n5,.my-xl-n5{margin-top:-3rem!important}.mr-xl-n5,.mx-xl-n5{margin-right:-3rem!important}.mb-xl-n5,.my-xl-n5{margin-bottom:-3rem!important}.ml-xl-n5,.mx-xl-n5{margin-left:-3rem!important}.m-xl-auto{margin:auto!important}.mt-xl-auto,.my-xl-auto{margin-top:auto!important}.mr-xl-auto,.mx-xl-auto{margin-right:auto!important}.mb-xl-auto,.my-xl-auto{margin-bottom:auto!important}.ml-xl-auto,.mx-xl-auto{margin-left:auto!important}}.stretched-link:after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;pointer-events:auto;content:"";background-color:transparent}.text-monospace{font-family:SFMono-Regular,Menlo,Monaco,Consolas,Liberation Mono,Courier New,monospace!important}.text-justify{text-align:justify!important}.text-wrap{white-space:normal!important}.text-nowrap{white-space:nowrap!important}.text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.text-left{text-align:left!important}.text-right{text-align:right!important}.text-center{text-align:center!important}@media (min-width:540px){.text-sm-left{text-align:left!important}.text-sm-right{text-align:right!important}.text-sm-center{text-align:center!important}}@media (min-width:720px){.text-md-left{text-align:left!important}.text-md-right{text-align:right!important}.text-md-center{text-align:center!important}}@media (min-width:960px){.text-lg-left{text-align:left!important}.text-lg-right{text-align:right!important}.text-lg-center{text-align:center!important}}@media (min-width:1200px){.text-xl-left{text-align:left!important}.text-xl-right{text-align:right!important}.text-xl-center{text-align:center!important}}.text-lowercase{text-transform:lowercase!important}.text-uppercase{text-transform:uppercase!important}.text-capitalize{text-transform:capitalize!important}.font-weight-light{font-weight:300!important}.font-weight-lighter{font-weight:lighter!important}.font-weight-normal{font-weight:400!important}.font-weight-bold{font-weight:700!important}.font-weight-bolder{font-weight:bolder!important}.font-italic{font-style:italic!important}.text-white{color:#fff!important}.text-primary{color:#007bff!important}a.text-primary:focus,a.text-primary:hover{color:#0056b3!important}.text-secondary{color:#6c757d!important}a.text-secondary:focus,a.text-secondary:hover{color:#494f54!important}.text-success{color:#28a745!important}a.text-success:focus,a.text-success:hover{color:#19692c!important}.text-info{color:#17a2b8!important}a.text-info:focus,a.text-info:hover{color:#0f6674!important}.text-warning{color:#ffc107!important}a.text-warning:focus,a.text-warning:hover{color:#ba8b00!important}.text-danger{color:#dc3545!important}a.text-danger:focus,a.text-danger:hover{color:#a71d2a!important}.text-light{color:#f8f9fa!important}a.text-light:focus,a.text-light:hover{color:#cbd3da!important}.text-dark{color:#343a40!important}a.text-dark:focus,a.text-dark:hover{color:#121416!important}.text-body{color:#212529!important}.text-muted{color:#6c757d!important}.text-black-50{color:rgba(0,0,0,.5)!important}.text-white-50{color:hsla(0,0%,100%,.5)!important}.text-hide{font:0/0 a;color:transparent;text-shadow:none;background-color:transparent;border:0}.text-decoration-none{text-decoration:none!important}.text-break{word-wrap:break-word!important}.text-reset{color:inherit!important}.visible{visibility:visible!important}.invisible{visibility:hidden!important}@media print{*,:after,:before{text-shadow:none!important;box-shadow:none!important}a:not(.btn){text-decoration:underline}abbr[title]:after{content:" (" attr(title) ")"}pre{white-space:pre-wrap!important}blockquote,pre{border:1px solid #adb5bd;page-break-inside:avoid}thead{display:table-header-group}img,tr{page-break-inside:avoid}h2,h3,p{orphans:3;widows:3}h2,h3{page-break-after:avoid}@page{size:a3}.container,body{min-width:960px!important}.navbar{display:none}.badge{border:1px solid #000}.table{border-collapse:collapse!important}.table td,.table th{background-color:#fff!important}.table-bordered td,.table-bordered th{border:1px solid #dee2e6!important}.table-dark{color:inherit}.table-dark tbody+tbody,.table-dark td,.table-dark th,.table-dark thead th{border-color:#dee2e6}.table .thead-dark th{color:inherit;border-color:#dee2e6}}html{font-size:var(--pst-font-size-base);scroll-padding-top:calc(var(--pst-header-height) + 12px)}body{padding-top:calc(var(--pst-header-height) + 20px);background-color:#fff;font-family:var(--pst-font-family-base);font-weight:400;line-height:1.65;color:rgba(var(--pst-color-text-base),1)}p{margin-bottom:1.15rem;font-size:1em;color:rgba(var(--pst-color-paragraph),1)}p.rubric{border-bottom:1px solid #c9c9c9}a{color:rgba(var(--pst-color-link),1);text-decoration:none}a:hover{color:rgba(var(--pst-color-link-hover),1);text-decoration:underline}a.headerlink{color:rgba(var(--pst-color-headerlink),1);font-size:.8em;padding:0 4px;text-decoration:none}a.headerlink:hover{background-color:rgba(var(--pst-color-headerlink),1);color:rgba(var(--pst-color-headerlink-hover),1)}.heading-style,h1,h2,h3,h4,h5,h6{margin:2.75rem 0 1.05rem;font-family:var(--pst-font-family-heading);font-weight:400;line-height:1.15}h1{margin-top:0;font-size:var(--pst-font-size-h1);color:rgba(var(--pst-color-h1),1)}h2{font-size:var(--pst-font-size-h2);color:rgba(var(--pst-color-h2),1)}h3{font-size:var(--pst-font-size-h3);color:rgba(var(--pst-color-h3),1)}h4{font-size:var(--pst-font-size-h4);color:rgba(var(--pst-color-h4),1)}h5{font-size:var(--pst-font-size-h5);color:rgba(var(--pst-color-h5),1)}h6{font-size:var(--pst-font-size-h6);color:rgba(var(--pst-color-h6),1)}.text_small,small{font-size:var(--pst-font-size-milli)}hr{border:0;border-top:1px solid #e5e5e5}code,kbd,pre,samp{font-family:var(--pst-font-family-monospace)}code{color:rgba(var(--pst-color-inline-code),1)}pre{margin:1.5em 0;padding:10px;background-color:rgba(var(--pst-color-preformatted-background),1);color:rgba(var(--pst-color-preformatted-text),1);line-height:1.2em;border:1px solid #c9c9c9;border-radius:.2rem;box-shadow:1px 1px 1px #d8d8d8}dd{margin-top:3px;margin-bottom:10px;margin-left:30px}.navbar{position:fixed;min-height:var(--pst-header-height);width:100%;padding:0}.navbar .container-xl{height:100%}@media (min-width:960px){.navbar #navbar-end>.navbar-end-item{display:inline-block}}.navbar-brand{position:relative;height:var(--pst-header-height);width:auto;padding:.5rem 0}.navbar-brand img{max-width:100%;height:100%;width:auto}.navbar-light{background:#fff!important;box-shadow:0 .125rem .25rem 0 rgba(0,0,0,.11)}.navbar-light .navbar-nav li a.nav-link{padding:0 .5rem;color:rgba(var(--pst-color-navbar-link),1)}.navbar-light .navbar-nav li a.nav-link:hover{color:rgba(var(--pst-color-navbar-link-hover),1)}.navbar-light .navbar-nav>.active>.nav-link{font-weight:600;color:rgba(var(--pst-color-navbar-link-active),1)}.navbar-header a{padding:0 15px}.admonition,div.admonition{margin:1.5625em auto;padding:0 .6rem .8rem;overflow:hidden;page-break-inside:avoid;border-left:.2rem solid;border-left-color:rgba(var(--pst-color-admonition-default),1);border-bottom-color:rgba(var(--pst-color-admonition-default),1);border-right-color:rgba(var(--pst-color-admonition-default),1);border-top-color:rgba(var(--pst-color-admonition-default),1);border-radius:.2rem;box-shadow:0 .2rem .5rem rgba(0,0,0,.05),0 0 .0625rem rgba(0,0,0,.1);transition:color .25s,background-color .25s,border-color .25s}.admonition :last-child,div.admonition :last-child{margin-bottom:0}.admonition p.admonition-title~*,div.admonition p.admonition-title~*{padding:0 1.4rem}.admonition>ol,.admonition>ul,div.admonition>ol,div.admonition>ul{margin-left:1em}.admonition>.admonition-title,div.admonition>.admonition-title{position:relative;margin:0 -.6rem;padding:.4rem .6rem .4rem 2rem;font-weight:700;background-color:rgba(var(--pst-color-admonition-default),.1)}.admonition>.admonition-title:before,div.admonition>.admonition-title:before{position:absolute;left:.6rem;width:1rem;height:1rem;color:rgba(var(--pst-color-admonition-default),1);font-family:Font Awesome\ 5 Free;font-weight:900;content:var(--pst-icon-admonition-default)}.admonition>.admonition-title+*,div.admonition>.admonition-title+*{margin-top:.4em}.admonition.attention,div.admonition.attention{border-color:rgba(var(--pst-color-admonition-attention),1)}.admonition.attention>.admonition-title,div.admonition.attention>.admonition-title{background-color:rgba(var(--pst-color-admonition-attention),.1)}.admonition.attention>.admonition-title:before,div.admonition.attention>.admonition-title:before{color:rgba(var(--pst-color-admonition-attention),1);content:var(--pst-icon-admonition-attention)}.admonition.caution,div.admonition.caution{border-color:rgba(var(--pst-color-admonition-caution),1)}.admonition.caution>.admonition-title,div.admonition.caution>.admonition-title{background-color:rgba(var(--pst-color-admonition-caution),.1)}.admonition.caution>.admonition-title:before,div.admonition.caution>.admonition-title:before{color:rgba(var(--pst-color-admonition-caution),1);content:var(--pst-icon-admonition-caution)}.admonition.warning,div.admonition.warning{border-color:rgba(var(--pst-color-admonition-warning),1)}.admonition.warning>.admonition-title,div.admonition.warning>.admonition-title{background-color:rgba(var(--pst-color-admonition-warning),.1)}.admonition.warning>.admonition-title:before,div.admonition.warning>.admonition-title:before{color:rgba(var(--pst-color-admonition-warning),1);content:var(--pst-icon-admonition-warning)}.admonition.danger,div.admonition.danger{border-color:rgba(var(--pst-color-admonition-danger),1)}.admonition.danger>.admonition-title,div.admonition.danger>.admonition-title{background-color:rgba(var(--pst-color-admonition-danger),.1)}.admonition.danger>.admonition-title:before,div.admonition.danger>.admonition-title:before{color:rgba(var(--pst-color-admonition-danger),1);content:var(--pst-icon-admonition-danger)}.admonition.error,div.admonition.error{border-color:rgba(var(--pst-color-admonition-error),1)}.admonition.error>.admonition-title,div.admonition.error>.admonition-title{background-color:rgba(var(--pst-color-admonition-error),.1)}.admonition.error>.admonition-title:before,div.admonition.error>.admonition-title:before{color:rgba(var(--pst-color-admonition-error),1);content:var(--pst-icon-admonition-error)}.admonition.hint,div.admonition.hint{border-color:rgba(var(--pst-color-admonition-hint),1)}.admonition.hint>.admonition-title,div.admonition.hint>.admonition-title{background-color:rgba(var(--pst-color-admonition-hint),.1)}.admonition.hint>.admonition-title:before,div.admonition.hint>.admonition-title:before{color:rgba(var(--pst-color-admonition-hint),1);content:var(--pst-icon-admonition-hint)}.admonition.tip,div.admonition.tip{border-color:rgba(var(--pst-color-admonition-tip),1)}.admonition.tip>.admonition-title,div.admonition.tip>.admonition-title{background-color:rgba(var(--pst-color-admonition-tip),.1)}.admonition.tip>.admonition-title:before,div.admonition.tip>.admonition-title:before{color:rgba(var(--pst-color-admonition-tip),1);content:var(--pst-icon-admonition-tip)}.admonition.important,div.admonition.important{border-color:rgba(var(--pst-color-admonition-important),1)}.admonition.important>.admonition-title,div.admonition.important>.admonition-title{background-color:rgba(var(--pst-color-admonition-important),.1)}.admonition.important>.admonition-title:before,div.admonition.important>.admonition-title:before{color:rgba(var(--pst-color-admonition-important),1);content:var(--pst-icon-admonition-important)}.admonition.note,div.admonition.note{border-color:rgba(var(--pst-color-admonition-note),1)}.admonition.note>.admonition-title,div.admonition.note>.admonition-title{background-color:rgba(var(--pst-color-admonition-note),.1)}.admonition.note>.admonition-title:before,div.admonition.note>.admonition-title:before{color:rgba(var(--pst-color-admonition-note),1);content:var(--pst-icon-admonition-note)}table.field-list{border-collapse:separate;border-spacing:10px;margin-left:1px}table.field-list th.field-name{padding:1px 8px 1px 5px;white-space:nowrap;background-color:#eee}table.field-list td.field-body p{font-style:italic}table.field-list td.field-body p>strong{font-style:normal}table.field-list td.field-body blockquote{border-left:none;margin:0 0 .3em;padding-left:30px}.table.autosummary td:first-child{white-space:nowrap}.sig{font-family:var(--pst-font-family-monospace)}.sig-inline.c-texpr,.sig-inline.cpp-texpr{font-family:unset}.sig.c .k,.sig.c .kt,.sig.c .m,.sig.c .s,.sig.c .sc,.sig.cpp .k,.sig.cpp .kt,.sig.cpp .m,.sig.cpp .s,.sig.cpp .sc{color:rgba(var(--pst-color-text-base),1)}.sig-name{color:rgba(var(--pst-color-inline-code),1)}blockquote{padding:0 1em;color:#6a737d;border-left:.25em solid #dfe2e5}dt.label>span.brackets:not(:only-child):before{content:"["}dt.label>span.brackets:not(:only-child):after{content:"]"}a.footnote-reference{vertical-align:super;font-size:small}div.deprecated{margin-bottom:10px;margin-top:10px;padding:7px;background-color:#f3e5e5;border:1px solid #eed3d7;border-radius:.5rem}div.deprecated p{color:#b94a48;display:inline}.topic{background-color:#eee}.seealso dd{margin-top:0;margin-bottom:0}.viewcode-back{font-family:var(--pst-font-family-base)}.viewcode-block:target{background-color:#f4debf;border-top:1px solid #ac9;border-bottom:1px solid #ac9}span.guilabel{border:1px solid #7fbbe3;background:#e7f2fa;font-size:80%;font-weight:700;border-radius:4px;padding:2.4px 6px;margin:auto 2px}footer{width:100%;border-top:1px solid #ccc;padding:10px}footer .footer-item p{margin-bottom:0}.bd-search{position:relative;padding:1rem 15px;margin-right:-15px;margin-left:-15px}.bd-search .icon{position:absolute;color:#a4a6a7;left:25px;top:25px}.bd-search input{border-radius:0;border:0;border-bottom:1px solid #e5e5e5;padding-left:35px}.bd-toc{-ms-flex-order:2;order:2;height:calc(100vh - 2rem);overflow-y:auto}@supports (position:-webkit-sticky) or (position:sticky){.bd-toc{position:-webkit-sticky;position:sticky;top:calc(var(--pst-header-height) + 20px);height:calc(100vh - 5rem);overflow-y:auto}}.bd-toc .onthispage{color:#a4a6a7}.section-nav{padding-left:0;border-left:1px solid #eee;border-bottom:none}.section-nav ul{padding-left:1rem}.toc-entry,.toc-entry a{display:block}.toc-entry a{padding:.125rem 1.5rem;color:rgba(var(--pst-color-toc-link),1)}@media (min-width:1200px){.toc-entry a{padding-right:0}}.toc-entry a:hover{color:rgba(var(--pst-color-toc-link-hover),1);text-decoration:none}.bd-sidebar{padding-top:1em}@media (min-width:720px){.bd-sidebar{border-right:1px solid rgba(0,0,0,.1)}@supports (position:-webkit-sticky) or (position:sticky){.bd-sidebar{position:-webkit-sticky;position:sticky;top:calc(var(--pst-header-height) + 20px);z-index:1000;height:calc(100vh - var(--pst-header-height) - 20px)}}}.bd-sidebar.no-sidebar{border-right:0}.bd-links{padding-top:1rem;padding-bottom:1rem;margin-right:-15px;margin-left:-15px}@media (min-width:720px){.bd-links{display:block}@supports (position:-webkit-sticky) or (position:sticky){.bd-links{max-height:calc(100vh - 11rem);overflow-y:auto}}}.bd-sidenav{display:none}.bd-content{padding-top:20px}.bd-content .section{max-width:100%}.bd-content .section table{display:block;overflow:auto}.bd-toc-link{display:block;padding:.25rem 1.5rem;font-weight:600;color:rgba(0,0,0,.65)}.bd-toc-link:hover{color:rgba(0,0,0,.85);text-decoration:none}.bd-toc-item.active{margin-bottom:1rem}.bd-toc-item.active:not(:first-child){margin-top:1rem}.bd-toc-item.active>.bd-toc-link{color:rgba(0,0,0,.85)}.bd-toc-item.active>.bd-toc-link:hover{background-color:transparent}.bd-toc-item.active>.bd-sidenav{display:block}nav.bd-links p.caption{font-size:var(--pst-sidebar-caption-font-size);text-transform:uppercase;font-weight:700;position:relative;margin-top:1.25em;margin-bottom:.5em;padding:0 1.5rem;color:rgba(var(--pst-color-sidebar-caption),1)}nav.bd-links p.caption:first-child{margin-top:0}.bd-sidebar .nav{font-size:var(--pst-sidebar-font-size)}.bd-sidebar .nav ul{list-style:none;padding:0 0 0 1.5rem}.bd-sidebar .nav li>a{display:block;padding:.25rem 1.5rem;color:rgba(var(--pst-color-sidebar-link),1)}.bd-sidebar .nav li>a:hover{color:rgba(var(--pst-color-sidebar-link-hover),1);text-decoration:none;background-color:transparent}.bd-sidebar .nav li>a.reference.external:after{font-family:Font Awesome\ 5 Free;font-weight:900;content:"\f35d";font-size:.75em;margin-left:.3em}.bd-sidebar .nav .active:hover>a,.bd-sidebar .nav .active>a{font-weight:600;color:rgba(var(--pst-color-sidebar-link-active),1)}.toc-h2{font-size:.85rem}.toc-h3{font-size:.75rem}.toc-h4{font-size:.65rem}.toc-entry>.nav-link.active{font-weight:600;color:#130654;color:rgba(var(--pst-color-toc-link-active),1);background-color:transparent;border-left:2px solid rgba(var(--pst-color-toc-link-active),1)}.nav-link:hover{border-style:none}#navbar-main-elements li.nav-item i{font-size:.7rem;padding-left:2px;vertical-align:middle}.bd-toc .nav .nav{display:none}.bd-toc .nav .nav.visible,.bd-toc .nav>.active>ul{display:block}.prev-next-area{margin:20px 0}.prev-next-area p{margin:0 .3em;line-height:1.3em}.prev-next-area i{font-size:1.2em}.prev-next-area a{display:flex;align-items:center;border:none;padding:10px;max-width:45%;overflow-x:hidden;color:rgba(0,0,0,.65);text-decoration:none}.prev-next-area a p.prev-next-title{color:rgba(var(--pst-color-link),1);font-weight:600;font-size:1.1em}.prev-next-area a:hover p.prev-next-title{text-decoration:underline}.prev-next-area a .prev-next-info{flex-direction:column;margin:0 .5em}.prev-next-area a .prev-next-info .prev-next-subtitle{text-transform:capitalize}.prev-next-area a.left-prev{float:left}.prev-next-area a.right-next{float:right}.prev-next-area a.right-next div.prev-next-info{text-align:right}.alert{padding-bottom:0}.alert-info a{color:#e83e8c}#navbar-icon-links i.fa,#navbar-icon-links i.fab,#navbar-icon-links i.far,#navbar-icon-links i.fas{vertical-align:middle;font-style:normal;font-size:1.5rem;line-height:1.25}#navbar-icon-links i.fa-github-square:before{color:#333}#navbar-icon-links i.fa-twitter-square:before{color:#55acee}#navbar-icon-links i.fa-gitlab:before{color:#548}#navbar-icon-links i.fa-bitbucket:before{color:#0052cc}.tocsection{border-left:1px solid #eee;padding:.3rem 1.5rem}.tocsection i{padding-right:.5rem}.editthispage{padding-top:2rem}.editthispage a{color:var(--pst-color-sidebar-link-active)}.xr-wrap[hidden]{display:block!important}.toctree-checkbox{position:absolute;display:none}.toctree-checkbox~ul{display:none}.toctree-checkbox~label i{transform:rotate(0deg)}.toctree-checkbox:checked~ul{display:block}.toctree-checkbox:checked~label i{transform:rotate(180deg)}.bd-sidebar li{position:relative}.bd-sidebar label{position:absolute;top:0;right:0;height:30px;width:30px;cursor:pointer;display:flex;justify-content:center;align-items:center}.bd-sidebar label:hover{background:rgba(var(--pst-color-sidebar-expander-background-hover),1)}.bd-sidebar label i{display:inline-block;font-size:.75rem;text-align:center}.bd-sidebar label i:hover{color:rgba(var(--pst-color-sidebar-link-hover),1)}.bd-sidebar li.has-children>.reference{padding-right:30px}div.doctest>div.highlight span.gp,span.linenos,table.highlighttable td.linenos{user-select:none;-webkit-user-select:text;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none}.docutils.container{padding-left:unset;padding-right:unset} \ No newline at end of file diff --git a/_preview/4/_static/css/theme.css b/_preview/4/_static/css/theme.css new file mode 100644 index 0000000..2e03fe3 --- /dev/null +++ b/_preview/4/_static/css/theme.css @@ -0,0 +1,120 @@ +/* Provided by the Sphinx base theme template at build time */ +@import "../basic.css"; + +:root { + /***************************************************************************** + * Theme config + **/ + --pst-header-height: 60px; + + /***************************************************************************** + * Font size + **/ + --pst-font-size-base: 15px; /* base font size - applied at body / html level */ + + /* heading font sizes */ + --pst-font-size-h1: 36px; + --pst-font-size-h2: 32px; + --pst-font-size-h3: 26px; + --pst-font-size-h4: 21px; + --pst-font-size-h5: 18px; + --pst-font-size-h6: 16px; + + /* smaller then heading font sizes*/ + --pst-font-size-milli: 12px; + + --pst-sidebar-font-size: .9em; + --pst-sidebar-caption-font-size: .9em; + + /***************************************************************************** + * Font family + **/ + /* These are adapted from https://systemfontstack.com/ */ + --pst-font-family-base-system: -apple-system, BlinkMacSystemFont, Segoe UI, "Helvetica Neue", + Arial, sans-serif, Apple Color Emoji, Segoe UI Emoji, Segoe UI Symbol; + --pst-font-family-monospace-system: "SFMono-Regular", Menlo, Consolas, Monaco, + Liberation Mono, Lucida Console, monospace; + + --pst-font-family-base: var(--pst-font-family-base-system); + --pst-font-family-heading: var(--pst-font-family-base); + --pst-font-family-monospace: var(--pst-font-family-monospace-system); + + /***************************************************************************** + * Color + * + * Colors are defined in rgb string way, "red, green, blue" + **/ + --pst-color-primary: 19, 6, 84; + --pst-color-success: 40, 167, 69; + --pst-color-info: 0, 123, 255; /*23, 162, 184;*/ + --pst-color-warning: 255, 193, 7; + --pst-color-danger: 220, 53, 69; + --pst-color-text-base: 51, 51, 51; + + --pst-color-h1: var(--pst-color-primary); + --pst-color-h2: var(--pst-color-primary); + --pst-color-h3: var(--pst-color-text-base); + --pst-color-h4: var(--pst-color-text-base); + --pst-color-h5: var(--pst-color-text-base); + --pst-color-h6: var(--pst-color-text-base); + --pst-color-paragraph: var(--pst-color-text-base); + --pst-color-link: 0, 91, 129; + --pst-color-link-hover: 227, 46, 0; + --pst-color-headerlink: 198, 15, 15; + --pst-color-headerlink-hover: 255, 255, 255; + --pst-color-preformatted-text: 34, 34, 34; + --pst-color-preformatted-background: 250, 250, 250; + --pst-color-inline-code: 232, 62, 140; + + --pst-color-active-navigation: 19, 6, 84; + --pst-color-navbar-link: 77, 77, 77; + --pst-color-navbar-link-hover: var(--pst-color-active-navigation); + --pst-color-navbar-link-active: var(--pst-color-active-navigation); + --pst-color-sidebar-link: 77, 77, 77; + --pst-color-sidebar-link-hover: var(--pst-color-active-navigation); + --pst-color-sidebar-link-active: var(--pst-color-active-navigation); + --pst-color-sidebar-expander-background-hover: 244, 244, 244; + --pst-color-sidebar-caption: 77, 77, 77; + --pst-color-toc-link: 119, 117, 122; + --pst-color-toc-link-hover: var(--pst-color-active-navigation); + --pst-color-toc-link-active: var(--pst-color-active-navigation); + + /***************************************************************************** + * Icon + **/ + + /* font awesome icons*/ + --pst-icon-check-circle: '\f058'; + --pst-icon-info-circle: '\f05a'; + --pst-icon-exclamation-triangle: '\f071'; + --pst-icon-exclamation-circle: '\f06a'; + --pst-icon-times-circle: '\f057'; + --pst-icon-lightbulb: '\f0eb'; + + /***************************************************************************** + * Admonitions + **/ + + --pst-color-admonition-default: var(--pst-color-info); + --pst-color-admonition-note: var(--pst-color-info); + --pst-color-admonition-attention: var(--pst-color-warning); + --pst-color-admonition-caution: var(--pst-color-warning); + --pst-color-admonition-warning: var(--pst-color-warning); + --pst-color-admonition-danger: var(--pst-color-danger); + --pst-color-admonition-error: var(--pst-color-danger); + --pst-color-admonition-hint: var(--pst-color-success); + --pst-color-admonition-tip: var(--pst-color-success); + --pst-color-admonition-important: var(--pst-color-success); + + --pst-icon-admonition-default: var(--pst-icon-info-circle); + --pst-icon-admonition-note: var(--pst-icon-info-circle); + --pst-icon-admonition-attention: var(--pst-icon-exclamation-circle); + --pst-icon-admonition-caution: var(--pst-icon-exclamation-triangle); + --pst-icon-admonition-warning: var(--pst-icon-exclamation-triangle); + --pst-icon-admonition-danger: var(--pst-icon-exclamation-triangle); + --pst-icon-admonition-error: var(--pst-icon-times-circle); + --pst-icon-admonition-hint: var(--pst-icon-lightbulb); + --pst-icon-admonition-tip: var(--pst-icon-lightbulb); + --pst-icon-admonition-important: var(--pst-icon-exclamation-circle); + +} diff --git a/_preview/4/_static/design-style.4045f2051d55cab465a707391d5b2007.min.css b/_preview/4/_static/design-style.4045f2051d55cab465a707391d5b2007.min.css new file mode 100644 index 0000000..3225661 --- /dev/null +++ b/_preview/4/_static/design-style.4045f2051d55cab465a707391d5b2007.min.css @@ -0,0 +1 @@ +.sd-bg-primary{background-color:var(--sd-color-primary) !important}.sd-bg-text-primary{color:var(--sd-color-primary-text) !important}button.sd-bg-primary:focus,button.sd-bg-primary:hover{background-color:var(--sd-color-primary-highlight) !important}a.sd-bg-primary:focus,a.sd-bg-primary:hover{background-color:var(--sd-color-primary-highlight) !important}.sd-bg-secondary{background-color:var(--sd-color-secondary) !important}.sd-bg-text-secondary{color:var(--sd-color-secondary-text) !important}button.sd-bg-secondary:focus,button.sd-bg-secondary:hover{background-color:var(--sd-color-secondary-highlight) !important}a.sd-bg-secondary:focus,a.sd-bg-secondary:hover{background-color:var(--sd-color-secondary-highlight) !important}.sd-bg-success{background-color:var(--sd-color-success) !important}.sd-bg-text-success{color:var(--sd-color-success-text) !important}button.sd-bg-success:focus,button.sd-bg-success:hover{background-color:var(--sd-color-success-highlight) !important}a.sd-bg-success:focus,a.sd-bg-success:hover{background-color:var(--sd-color-success-highlight) !important}.sd-bg-info{background-color:var(--sd-color-info) !important}.sd-bg-text-info{color:var(--sd-color-info-text) !important}button.sd-bg-info:focus,button.sd-bg-info:hover{background-color:var(--sd-color-info-highlight) !important}a.sd-bg-info:focus,a.sd-bg-info:hover{background-color:var(--sd-color-info-highlight) !important}.sd-bg-warning{background-color:var(--sd-color-warning) !important}.sd-bg-text-warning{color:var(--sd-color-warning-text) !important}button.sd-bg-warning:focus,button.sd-bg-warning:hover{background-color:var(--sd-color-warning-highlight) !important}a.sd-bg-warning:focus,a.sd-bg-warning:hover{background-color:var(--sd-color-warning-highlight) !important}.sd-bg-danger{background-color:var(--sd-color-danger) !important}.sd-bg-text-danger{color:var(--sd-color-danger-text) !important}button.sd-bg-danger:focus,button.sd-bg-danger:hover{background-color:var(--sd-color-danger-highlight) !important}a.sd-bg-danger:focus,a.sd-bg-danger:hover{background-color:var(--sd-color-danger-highlight) !important}.sd-bg-light{background-color:var(--sd-color-light) !important}.sd-bg-text-light{color:var(--sd-color-light-text) !important}button.sd-bg-light:focus,button.sd-bg-light:hover{background-color:var(--sd-color-light-highlight) !important}a.sd-bg-light:focus,a.sd-bg-light:hover{background-color:var(--sd-color-light-highlight) !important}.sd-bg-muted{background-color:var(--sd-color-muted) !important}.sd-bg-text-muted{color:var(--sd-color-muted-text) !important}button.sd-bg-muted:focus,button.sd-bg-muted:hover{background-color:var(--sd-color-muted-highlight) !important}a.sd-bg-muted:focus,a.sd-bg-muted:hover{background-color:var(--sd-color-muted-highlight) !important}.sd-bg-dark{background-color:var(--sd-color-dark) !important}.sd-bg-text-dark{color:var(--sd-color-dark-text) !important}button.sd-bg-dark:focus,button.sd-bg-dark:hover{background-color:var(--sd-color-dark-highlight) !important}a.sd-bg-dark:focus,a.sd-bg-dark:hover{background-color:var(--sd-color-dark-highlight) !important}.sd-bg-black{background-color:var(--sd-color-black) !important}.sd-bg-text-black{color:var(--sd-color-black-text) !important}button.sd-bg-black:focus,button.sd-bg-black:hover{background-color:var(--sd-color-black-highlight) !important}a.sd-bg-black:focus,a.sd-bg-black:hover{background-color:var(--sd-color-black-highlight) !important}.sd-bg-white{background-color:var(--sd-color-white) !important}.sd-bg-text-white{color:var(--sd-color-white-text) !important}button.sd-bg-white:focus,button.sd-bg-white:hover{background-color:var(--sd-color-white-highlight) !important}a.sd-bg-white:focus,a.sd-bg-white:hover{background-color:var(--sd-color-white-highlight) !important}.sd-text-primary,.sd-text-primary>p{color:var(--sd-color-primary) !important}a.sd-text-primary:focus,a.sd-text-primary:hover{color:var(--sd-color-primary-highlight) !important}.sd-text-secondary,.sd-text-secondary>p{color:var(--sd-color-secondary) !important}a.sd-text-secondary:focus,a.sd-text-secondary:hover{color:var(--sd-color-secondary-highlight) !important}.sd-text-success,.sd-text-success>p{color:var(--sd-color-success) !important}a.sd-text-success:focus,a.sd-text-success:hover{color:var(--sd-color-success-highlight) !important}.sd-text-info,.sd-text-info>p{color:var(--sd-color-info) !important}a.sd-text-info:focus,a.sd-text-info:hover{color:var(--sd-color-info-highlight) !important}.sd-text-warning,.sd-text-warning>p{color:var(--sd-color-warning) !important}a.sd-text-warning:focus,a.sd-text-warning:hover{color:var(--sd-color-warning-highlight) !important}.sd-text-danger,.sd-text-danger>p{color:var(--sd-color-danger) !important}a.sd-text-danger:focus,a.sd-text-danger:hover{color:var(--sd-color-danger-highlight) !important}.sd-text-light,.sd-text-light>p{color:var(--sd-color-light) !important}a.sd-text-light:focus,a.sd-text-light:hover{color:var(--sd-color-light-highlight) !important}.sd-text-muted,.sd-text-muted>p{color:var(--sd-color-muted) !important}a.sd-text-muted:focus,a.sd-text-muted:hover{color:var(--sd-color-muted-highlight) !important}.sd-text-dark,.sd-text-dark>p{color:var(--sd-color-dark) !important}a.sd-text-dark:focus,a.sd-text-dark:hover{color:var(--sd-color-dark-highlight) !important}.sd-text-black,.sd-text-black>p{color:var(--sd-color-black) !important}a.sd-text-black:focus,a.sd-text-black:hover{color:var(--sd-color-black-highlight) !important}.sd-text-white,.sd-text-white>p{color:var(--sd-color-white) !important}a.sd-text-white:focus,a.sd-text-white:hover{color:var(--sd-color-white-highlight) !important}.sd-outline-primary{border-color:var(--sd-color-primary) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-primary:focus,a.sd-outline-primary:hover{border-color:var(--sd-color-primary-highlight) !important}.sd-outline-secondary{border-color:var(--sd-color-secondary) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-secondary:focus,a.sd-outline-secondary:hover{border-color:var(--sd-color-secondary-highlight) !important}.sd-outline-success{border-color:var(--sd-color-success) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-success:focus,a.sd-outline-success:hover{border-color:var(--sd-color-success-highlight) !important}.sd-outline-info{border-color:var(--sd-color-info) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-info:focus,a.sd-outline-info:hover{border-color:var(--sd-color-info-highlight) !important}.sd-outline-warning{border-color:var(--sd-color-warning) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-warning:focus,a.sd-outline-warning:hover{border-color:var(--sd-color-warning-highlight) !important}.sd-outline-danger{border-color:var(--sd-color-danger) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-danger:focus,a.sd-outline-danger:hover{border-color:var(--sd-color-danger-highlight) !important}.sd-outline-light{border-color:var(--sd-color-light) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-light:focus,a.sd-outline-light:hover{border-color:var(--sd-color-light-highlight) !important}.sd-outline-muted{border-color:var(--sd-color-muted) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-muted:focus,a.sd-outline-muted:hover{border-color:var(--sd-color-muted-highlight) !important}.sd-outline-dark{border-color:var(--sd-color-dark) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-dark:focus,a.sd-outline-dark:hover{border-color:var(--sd-color-dark-highlight) !important}.sd-outline-black{border-color:var(--sd-color-black) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-black:focus,a.sd-outline-black:hover{border-color:var(--sd-color-black-highlight) !important}.sd-outline-white{border-color:var(--sd-color-white) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-white:focus,a.sd-outline-white:hover{border-color:var(--sd-color-white-highlight) !important}.sd-bg-transparent{background-color:transparent !important}.sd-outline-transparent{border-color:transparent !important}.sd-text-transparent{color:transparent !important}.sd-p-0{padding:0 !important}.sd-pt-0,.sd-py-0{padding-top:0 !important}.sd-pr-0,.sd-px-0{padding-right:0 !important}.sd-pb-0,.sd-py-0{padding-bottom:0 !important}.sd-pl-0,.sd-px-0{padding-left:0 !important}.sd-p-1{padding:.25rem !important}.sd-pt-1,.sd-py-1{padding-top:.25rem !important}.sd-pr-1,.sd-px-1{padding-right:.25rem !important}.sd-pb-1,.sd-py-1{padding-bottom:.25rem !important}.sd-pl-1,.sd-px-1{padding-left:.25rem !important}.sd-p-2{padding:.5rem !important}.sd-pt-2,.sd-py-2{padding-top:.5rem !important}.sd-pr-2,.sd-px-2{padding-right:.5rem !important}.sd-pb-2,.sd-py-2{padding-bottom:.5rem !important}.sd-pl-2,.sd-px-2{padding-left:.5rem !important}.sd-p-3{padding:1rem !important}.sd-pt-3,.sd-py-3{padding-top:1rem !important}.sd-pr-3,.sd-px-3{padding-right:1rem !important}.sd-pb-3,.sd-py-3{padding-bottom:1rem !important}.sd-pl-3,.sd-px-3{padding-left:1rem !important}.sd-p-4{padding:1.5rem !important}.sd-pt-4,.sd-py-4{padding-top:1.5rem !important}.sd-pr-4,.sd-px-4{padding-right:1.5rem !important}.sd-pb-4,.sd-py-4{padding-bottom:1.5rem !important}.sd-pl-4,.sd-px-4{padding-left:1.5rem !important}.sd-p-5{padding:3rem !important}.sd-pt-5,.sd-py-5{padding-top:3rem !important}.sd-pr-5,.sd-px-5{padding-right:3rem !important}.sd-pb-5,.sd-py-5{padding-bottom:3rem !important}.sd-pl-5,.sd-px-5{padding-left:3rem !important}.sd-m-auto{margin:auto !important}.sd-mt-auto,.sd-my-auto{margin-top:auto !important}.sd-mr-auto,.sd-mx-auto{margin-right:auto !important}.sd-mb-auto,.sd-my-auto{margin-bottom:auto !important}.sd-ml-auto,.sd-mx-auto{margin-left:auto !important}.sd-m-0{margin:0 !important}.sd-mt-0,.sd-my-0{margin-top:0 !important}.sd-mr-0,.sd-mx-0{margin-right:0 !important}.sd-mb-0,.sd-my-0{margin-bottom:0 !important}.sd-ml-0,.sd-mx-0{margin-left:0 !important}.sd-m-1{margin:.25rem !important}.sd-mt-1,.sd-my-1{margin-top:.25rem !important}.sd-mr-1,.sd-mx-1{margin-right:.25rem !important}.sd-mb-1,.sd-my-1{margin-bottom:.25rem !important}.sd-ml-1,.sd-mx-1{margin-left:.25rem !important}.sd-m-2{margin:.5rem !important}.sd-mt-2,.sd-my-2{margin-top:.5rem !important}.sd-mr-2,.sd-mx-2{margin-right:.5rem !important}.sd-mb-2,.sd-my-2{margin-bottom:.5rem !important}.sd-ml-2,.sd-mx-2{margin-left:.5rem !important}.sd-m-3{margin:1rem !important}.sd-mt-3,.sd-my-3{margin-top:1rem !important}.sd-mr-3,.sd-mx-3{margin-right:1rem !important}.sd-mb-3,.sd-my-3{margin-bottom:1rem !important}.sd-ml-3,.sd-mx-3{margin-left:1rem !important}.sd-m-4{margin:1.5rem !important}.sd-mt-4,.sd-my-4{margin-top:1.5rem !important}.sd-mr-4,.sd-mx-4{margin-right:1.5rem !important}.sd-mb-4,.sd-my-4{margin-bottom:1.5rem !important}.sd-ml-4,.sd-mx-4{margin-left:1.5rem !important}.sd-m-5{margin:3rem !important}.sd-mt-5,.sd-my-5{margin-top:3rem !important}.sd-mr-5,.sd-mx-5{margin-right:3rem !important}.sd-mb-5,.sd-my-5{margin-bottom:3rem !important}.sd-ml-5,.sd-mx-5{margin-left:3rem !important}.sd-w-25{width:25% !important}.sd-w-50{width:50% !important}.sd-w-75{width:75% !important}.sd-w-100{width:100% !important}.sd-w-auto{width:auto !important}.sd-h-25{height:25% !important}.sd-h-50{height:50% !important}.sd-h-75{height:75% !important}.sd-h-100{height:100% !important}.sd-h-auto{height:auto !important}.sd-d-none{display:none !important}.sd-d-inline{display:inline !important}.sd-d-inline-block{display:inline-block !important}.sd-d-block{display:block !important}.sd-d-grid{display:grid !important}.sd-d-flex-row{display:-ms-flexbox !important;display:flex !important;flex-direction:row !important}.sd-d-flex-column{display:-ms-flexbox !important;display:flex !important;flex-direction:column !important}.sd-d-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}@media(min-width: 576px){.sd-d-sm-none{display:none !important}.sd-d-sm-inline{display:inline !important}.sd-d-sm-inline-block{display:inline-block !important}.sd-d-sm-block{display:block !important}.sd-d-sm-grid{display:grid !important}.sd-d-sm-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-sm-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 768px){.sd-d-md-none{display:none !important}.sd-d-md-inline{display:inline !important}.sd-d-md-inline-block{display:inline-block !important}.sd-d-md-block{display:block !important}.sd-d-md-grid{display:grid !important}.sd-d-md-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-md-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 992px){.sd-d-lg-none{display:none !important}.sd-d-lg-inline{display:inline !important}.sd-d-lg-inline-block{display:inline-block !important}.sd-d-lg-block{display:block !important}.sd-d-lg-grid{display:grid !important}.sd-d-lg-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-lg-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 1200px){.sd-d-xl-none{display:none !important}.sd-d-xl-inline{display:inline !important}.sd-d-xl-inline-block{display:inline-block !important}.sd-d-xl-block{display:block !important}.sd-d-xl-grid{display:grid !important}.sd-d-xl-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-xl-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}.sd-align-major-start{justify-content:flex-start !important}.sd-align-major-end{justify-content:flex-end !important}.sd-align-major-center{justify-content:center !important}.sd-align-major-justify{justify-content:space-between !important}.sd-align-major-spaced{justify-content:space-evenly !important}.sd-align-minor-start{align-items:flex-start !important}.sd-align-minor-end{align-items:flex-end !important}.sd-align-minor-center{align-items:center !important}.sd-align-minor-stretch{align-items:stretch !important}.sd-text-justify{text-align:justify !important}.sd-text-left{text-align:left !important}.sd-text-right{text-align:right !important}.sd-text-center{text-align:center !important}.sd-font-weight-light{font-weight:300 !important}.sd-font-weight-lighter{font-weight:lighter !important}.sd-font-weight-normal{font-weight:400 !important}.sd-font-weight-bold{font-weight:700 !important}.sd-font-weight-bolder{font-weight:bolder !important}.sd-font-italic{font-style:italic !important}.sd-text-decoration-none{text-decoration:none !important}.sd-text-lowercase{text-transform:lowercase !important}.sd-text-uppercase{text-transform:uppercase !important}.sd-text-capitalize{text-transform:capitalize !important}.sd-text-wrap{white-space:normal !important}.sd-text-nowrap{white-space:nowrap !important}.sd-text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.sd-fs-1,.sd-fs-1>p{font-size:calc(1.375rem + 1.5vw) !important;line-height:unset !important}.sd-fs-2,.sd-fs-2>p{font-size:calc(1.325rem + 0.9vw) !important;line-height:unset !important}.sd-fs-3,.sd-fs-3>p{font-size:calc(1.3rem + 0.6vw) !important;line-height:unset !important}.sd-fs-4,.sd-fs-4>p{font-size:calc(1.275rem + 0.3vw) !important;line-height:unset !important}.sd-fs-5,.sd-fs-5>p{font-size:1.25rem !important;line-height:unset !important}.sd-fs-6,.sd-fs-6>p{font-size:1rem !important;line-height:unset !important}.sd-border-0{border:0 solid !important}.sd-border-top-0{border-top:0 solid !important}.sd-border-bottom-0{border-bottom:0 solid !important}.sd-border-right-0{border-right:0 solid !important}.sd-border-left-0{border-left:0 solid !important}.sd-border-1{border:1px solid !important}.sd-border-top-1{border-top:1px solid !important}.sd-border-bottom-1{border-bottom:1px solid !important}.sd-border-right-1{border-right:1px solid !important}.sd-border-left-1{border-left:1px solid !important}.sd-border-2{border:2px solid !important}.sd-border-top-2{border-top:2px solid !important}.sd-border-bottom-2{border-bottom:2px solid !important}.sd-border-right-2{border-right:2px solid !important}.sd-border-left-2{border-left:2px solid !important}.sd-border-3{border:3px solid !important}.sd-border-top-3{border-top:3px solid !important}.sd-border-bottom-3{border-bottom:3px solid !important}.sd-border-right-3{border-right:3px solid !important}.sd-border-left-3{border-left:3px solid !important}.sd-border-4{border:4px solid !important}.sd-border-top-4{border-top:4px solid !important}.sd-border-bottom-4{border-bottom:4px solid !important}.sd-border-right-4{border-right:4px solid !important}.sd-border-left-4{border-left:4px solid !important}.sd-border-5{border:5px solid !important}.sd-border-top-5{border-top:5px solid !important}.sd-border-bottom-5{border-bottom:5px solid !important}.sd-border-right-5{border-right:5px solid !important}.sd-border-left-5{border-left:5px solid !important}.sd-rounded-0{border-radius:0 !important}.sd-rounded-1{border-radius:.2rem !important}.sd-rounded-2{border-radius:.3rem !important}.sd-rounded-3{border-radius:.5rem !important}.sd-rounded-pill{border-radius:50rem !important}.sd-rounded-circle{border-radius:50% !important}.shadow-none{box-shadow:none !important}.sd-shadow-sm{box-shadow:0 .125rem .25rem var(--sd-color-shadow) !important}.sd-shadow-md{box-shadow:0 .5rem 1rem var(--sd-color-shadow) !important}.sd-shadow-lg{box-shadow:0 1rem 3rem var(--sd-color-shadow) !important}@keyframes sd-slide-from-left{0%{transform:translateX(-100%)}100%{transform:translateX(0)}}@keyframes sd-slide-from-right{0%{transform:translateX(200%)}100%{transform:translateX(0)}}@keyframes sd-grow100{0%{transform:scale(0);opacity:.5}100%{transform:scale(1);opacity:1}}@keyframes sd-grow50{0%{transform:scale(0.5);opacity:.5}100%{transform:scale(1);opacity:1}}@keyframes sd-grow50-rot20{0%{transform:scale(0.5) rotateZ(-20deg);opacity:.5}75%{transform:scale(1) rotateZ(5deg);opacity:1}95%{transform:scale(1) rotateZ(-1deg);opacity:1}100%{transform:scale(1) rotateZ(0);opacity:1}}.sd-animate-slide-from-left{animation:1s ease-out 0s 1 normal none running sd-slide-from-left}.sd-animate-slide-from-right{animation:1s ease-out 0s 1 normal none running sd-slide-from-right}.sd-animate-grow100{animation:1s ease-out 0s 1 normal none running sd-grow100}.sd-animate-grow50{animation:1s ease-out 0s 1 normal none running sd-grow50}.sd-animate-grow50-rot20{animation:1s ease-out 0s 1 normal none running sd-grow50-rot20}.sd-badge{display:inline-block;padding:.35em .65em;font-size:.75em;font-weight:700;line-height:1;text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:.25rem}.sd-badge:empty{display:none}a.sd-badge{text-decoration:none}.sd-btn .sd-badge{position:relative;top:-1px}.sd-btn{background-color:transparent;border:1px solid transparent;border-radius:.25rem;cursor:pointer;display:inline-block;font-weight:400;font-size:1rem;line-height:1.5;padding:.375rem .75rem;text-align:center;text-decoration:none;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;vertical-align:middle;user-select:none;-moz-user-select:none;-ms-user-select:none;-webkit-user-select:none}.sd-btn:hover{text-decoration:none}@media(prefers-reduced-motion: reduce){.sd-btn{transition:none}}.sd-btn-primary,.sd-btn-outline-primary:hover,.sd-btn-outline-primary:focus{color:var(--sd-color-primary-text) !important;background-color:var(--sd-color-primary) !important;border-color:var(--sd-color-primary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-primary:hover,.sd-btn-primary:focus{color:var(--sd-color-primary-text) !important;background-color:var(--sd-color-primary-highlight) !important;border-color:var(--sd-color-primary-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-primary{color:var(--sd-color-primary) !important;border-color:var(--sd-color-primary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-secondary,.sd-btn-outline-secondary:hover,.sd-btn-outline-secondary:focus{color:var(--sd-color-secondary-text) !important;background-color:var(--sd-color-secondary) !important;border-color:var(--sd-color-secondary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-secondary:hover,.sd-btn-secondary:focus{color:var(--sd-color-secondary-text) !important;background-color:var(--sd-color-secondary-highlight) !important;border-color:var(--sd-color-secondary-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-secondary{color:var(--sd-color-secondary) !important;border-color:var(--sd-color-secondary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-success,.sd-btn-outline-success:hover,.sd-btn-outline-success:focus{color:var(--sd-color-success-text) !important;background-color:var(--sd-color-success) !important;border-color:var(--sd-color-success) !important;border-width:1px !important;border-style:solid !important}.sd-btn-success:hover,.sd-btn-success:focus{color:var(--sd-color-success-text) !important;background-color:var(--sd-color-success-highlight) !important;border-color:var(--sd-color-success-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-success{color:var(--sd-color-success) !important;border-color:var(--sd-color-success) !important;border-width:1px !important;border-style:solid !important}.sd-btn-info,.sd-btn-outline-info:hover,.sd-btn-outline-info:focus{color:var(--sd-color-info-text) !important;background-color:var(--sd-color-info) !important;border-color:var(--sd-color-info) !important;border-width:1px !important;border-style:solid !important}.sd-btn-info:hover,.sd-btn-info:focus{color:var(--sd-color-info-text) !important;background-color:var(--sd-color-info-highlight) !important;border-color:var(--sd-color-info-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-info{color:var(--sd-color-info) !important;border-color:var(--sd-color-info) !important;border-width:1px !important;border-style:solid !important}.sd-btn-warning,.sd-btn-outline-warning:hover,.sd-btn-outline-warning:focus{color:var(--sd-color-warning-text) !important;background-color:var(--sd-color-warning) !important;border-color:var(--sd-color-warning) !important;border-width:1px !important;border-style:solid !important}.sd-btn-warning:hover,.sd-btn-warning:focus{color:var(--sd-color-warning-text) !important;background-color:var(--sd-color-warning-highlight) !important;border-color:var(--sd-color-warning-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-warning{color:var(--sd-color-warning) !important;border-color:var(--sd-color-warning) !important;border-width:1px !important;border-style:solid !important}.sd-btn-danger,.sd-btn-outline-danger:hover,.sd-btn-outline-danger:focus{color:var(--sd-color-danger-text) !important;background-color:var(--sd-color-danger) !important;border-color:var(--sd-color-danger) !important;border-width:1px !important;border-style:solid !important}.sd-btn-danger:hover,.sd-btn-danger:focus{color:var(--sd-color-danger-text) !important;background-color:var(--sd-color-danger-highlight) !important;border-color:var(--sd-color-danger-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-danger{color:var(--sd-color-danger) !important;border-color:var(--sd-color-danger) !important;border-width:1px !important;border-style:solid !important}.sd-btn-light,.sd-btn-outline-light:hover,.sd-btn-outline-light:focus{color:var(--sd-color-light-text) !important;background-color:var(--sd-color-light) !important;border-color:var(--sd-color-light) !important;border-width:1px !important;border-style:solid !important}.sd-btn-light:hover,.sd-btn-light:focus{color:var(--sd-color-light-text) !important;background-color:var(--sd-color-light-highlight) !important;border-color:var(--sd-color-light-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-light{color:var(--sd-color-light) !important;border-color:var(--sd-color-light) !important;border-width:1px !important;border-style:solid !important}.sd-btn-muted,.sd-btn-outline-muted:hover,.sd-btn-outline-muted:focus{color:var(--sd-color-muted-text) !important;background-color:var(--sd-color-muted) !important;border-color:var(--sd-color-muted) !important;border-width:1px !important;border-style:solid !important}.sd-btn-muted:hover,.sd-btn-muted:focus{color:var(--sd-color-muted-text) !important;background-color:var(--sd-color-muted-highlight) !important;border-color:var(--sd-color-muted-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-muted{color:var(--sd-color-muted) !important;border-color:var(--sd-color-muted) !important;border-width:1px !important;border-style:solid !important}.sd-btn-dark,.sd-btn-outline-dark:hover,.sd-btn-outline-dark:focus{color:var(--sd-color-dark-text) !important;background-color:var(--sd-color-dark) !important;border-color:var(--sd-color-dark) !important;border-width:1px !important;border-style:solid !important}.sd-btn-dark:hover,.sd-btn-dark:focus{color:var(--sd-color-dark-text) !important;background-color:var(--sd-color-dark-highlight) !important;border-color:var(--sd-color-dark-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-dark{color:var(--sd-color-dark) !important;border-color:var(--sd-color-dark) !important;border-width:1px !important;border-style:solid !important}.sd-btn-black,.sd-btn-outline-black:hover,.sd-btn-outline-black:focus{color:var(--sd-color-black-text) !important;background-color:var(--sd-color-black) !important;border-color:var(--sd-color-black) !important;border-width:1px !important;border-style:solid !important}.sd-btn-black:hover,.sd-btn-black:focus{color:var(--sd-color-black-text) !important;background-color:var(--sd-color-black-highlight) !important;border-color:var(--sd-color-black-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-black{color:var(--sd-color-black) !important;border-color:var(--sd-color-black) !important;border-width:1px !important;border-style:solid !important}.sd-btn-white,.sd-btn-outline-white:hover,.sd-btn-outline-white:focus{color:var(--sd-color-white-text) !important;background-color:var(--sd-color-white) !important;border-color:var(--sd-color-white) !important;border-width:1px !important;border-style:solid !important}.sd-btn-white:hover,.sd-btn-white:focus{color:var(--sd-color-white-text) !important;background-color:var(--sd-color-white-highlight) !important;border-color:var(--sd-color-white-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-white{color:var(--sd-color-white) !important;border-color:var(--sd-color-white) !important;border-width:1px !important;border-style:solid !important}.sd-stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.sd-hide-link-text{font-size:0}.sd-octicon,.sd-material-icon{display:inline-block;fill:currentColor;vertical-align:middle}.sd-avatar-xs{border-radius:50%;object-fit:cover;object-position:center;width:1rem;height:1rem}.sd-avatar-sm{border-radius:50%;object-fit:cover;object-position:center;width:3rem;height:3rem}.sd-avatar-md{border-radius:50%;object-fit:cover;object-position:center;width:5rem;height:5rem}.sd-avatar-lg{border-radius:50%;object-fit:cover;object-position:center;width:7rem;height:7rem}.sd-avatar-xl{border-radius:50%;object-fit:cover;object-position:center;width:10rem;height:10rem}.sd-avatar-inherit{border-radius:50%;object-fit:cover;object-position:center;width:inherit;height:inherit}.sd-avatar-initial{border-radius:50%;object-fit:cover;object-position:center;width:initial;height:initial}.sd-card{background-clip:border-box;background-color:var(--sd-color-card-background);border:1px solid var(--sd-color-card-border);border-radius:.25rem;color:var(--sd-color-card-text);display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;min-width:0;position:relative;word-wrap:break-word}.sd-card>hr{margin-left:0;margin-right:0}.sd-card-hover:hover{border-color:var(--sd-color-card-border-hover);transform:scale(1.01)}.sd-card-body{-ms-flex:1 1 auto;flex:1 1 auto;padding:1rem 1rem}.sd-card-title{margin-bottom:.5rem}.sd-card-subtitle{margin-top:-0.25rem;margin-bottom:0}.sd-card-text:last-child{margin-bottom:0}.sd-card-link:hover{text-decoration:none}.sd-card-link+.card-link{margin-left:1rem}.sd-card-header{padding:.5rem 1rem;margin-bottom:0;background-color:var(--sd-color-card-header);border-bottom:1px solid var(--sd-color-card-border)}.sd-card-header:first-child{border-radius:calc(0.25rem - 1px) calc(0.25rem - 1px) 0 0}.sd-card-footer{padding:.5rem 1rem;background-color:var(--sd-color-card-footer);border-top:1px solid var(--sd-color-card-border)}.sd-card-footer:last-child{border-radius:0 0 calc(0.25rem - 1px) calc(0.25rem - 1px)}.sd-card-header-tabs{margin-right:-0.5rem;margin-bottom:-0.5rem;margin-left:-0.5rem;border-bottom:0}.sd-card-header-pills{margin-right:-0.5rem;margin-left:-0.5rem}.sd-card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:1rem;border-radius:calc(0.25rem - 1px)}.sd-card-img,.sd-card-img-bottom,.sd-card-img-top{width:100%}.sd-card-img,.sd-card-img-top{border-top-left-radius:calc(0.25rem - 1px);border-top-right-radius:calc(0.25rem - 1px)}.sd-card-img,.sd-card-img-bottom{border-bottom-left-radius:calc(0.25rem - 1px);border-bottom-right-radius:calc(0.25rem - 1px)}.sd-cards-carousel{width:100%;display:flex;flex-wrap:nowrap;-ms-flex-direction:row;flex-direction:row;overflow-x:hidden;scroll-snap-type:x mandatory}.sd-cards-carousel.sd-show-scrollbar{overflow-x:auto}.sd-cards-carousel:hover,.sd-cards-carousel:focus{overflow-x:auto}.sd-cards-carousel>.sd-card{flex-shrink:0;scroll-snap-align:start}.sd-cards-carousel>.sd-card:not(:last-child){margin-right:3px}.sd-card-cols-1>.sd-card{width:90%}.sd-card-cols-2>.sd-card{width:45%}.sd-card-cols-3>.sd-card{width:30%}.sd-card-cols-4>.sd-card{width:22.5%}.sd-card-cols-5>.sd-card{width:18%}.sd-card-cols-6>.sd-card{width:15%}.sd-card-cols-7>.sd-card{width:12.8571428571%}.sd-card-cols-8>.sd-card{width:11.25%}.sd-card-cols-9>.sd-card{width:10%}.sd-card-cols-10>.sd-card{width:9%}.sd-card-cols-11>.sd-card{width:8.1818181818%}.sd-card-cols-12>.sd-card{width:7.5%}.sd-container,.sd-container-fluid,.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container-xl{margin-left:auto;margin-right:auto;padding-left:var(--sd-gutter-x, 0.75rem);padding-right:var(--sd-gutter-x, 0.75rem);width:100%}@media(min-width: 576px){.sd-container-sm,.sd-container{max-width:540px}}@media(min-width: 768px){.sd-container-md,.sd-container-sm,.sd-container{max-width:720px}}@media(min-width: 992px){.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container{max-width:960px}}@media(min-width: 1200px){.sd-container-xl,.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container{max-width:1140px}}.sd-row{--sd-gutter-x: 1.5rem;--sd-gutter-y: 0;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-top:calc(var(--sd-gutter-y) * -1);margin-right:calc(var(--sd-gutter-x) * -0.5);margin-left:calc(var(--sd-gutter-x) * -0.5)}.sd-row>*{box-sizing:border-box;flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--sd-gutter-x) * 0.5);padding-left:calc(var(--sd-gutter-x) * 0.5);margin-top:var(--sd-gutter-y)}.sd-col{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-auto>*{flex:0 0 auto;width:auto}.sd-row-cols-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}@media(min-width: 576px){.sd-col-sm{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-sm-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-sm-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-sm-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-sm-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-sm-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-sm-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-sm-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-sm-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-sm-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-sm-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-sm-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-sm-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-sm-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 768px){.sd-col-md{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-md-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-md-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-md-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-md-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-md-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-md-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-md-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-md-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-md-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-md-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-md-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-md-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-md-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 992px){.sd-col-lg{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-lg-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-lg-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-lg-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-lg-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-lg-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-lg-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-lg-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-lg-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-lg-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-lg-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-lg-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-lg-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-lg-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 1200px){.sd-col-xl{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-xl-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-xl-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-xl-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-xl-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-xl-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-xl-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-xl-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-xl-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-xl-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-xl-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-xl-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-xl-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-xl-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}.sd-col-auto{flex:0 0 auto;-ms-flex:0 0 auto;width:auto}.sd-col-1{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}.sd-col-2{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-col-3{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-col-4{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-col-5{flex:0 0 auto;-ms-flex:0 0 auto;width:41.6666666667%}.sd-col-6{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-col-7{flex:0 0 auto;-ms-flex:0 0 auto;width:58.3333333333%}.sd-col-8{flex:0 0 auto;-ms-flex:0 0 auto;width:66.6666666667%}.sd-col-9{flex:0 0 auto;-ms-flex:0 0 auto;width:75%}.sd-col-10{flex:0 0 auto;-ms-flex:0 0 auto;width:83.3333333333%}.sd-col-11{flex:0 0 auto;-ms-flex:0 0 auto;width:91.6666666667%}.sd-col-12{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-g-0,.sd-gy-0{--sd-gutter-y: 0}.sd-g-0,.sd-gx-0{--sd-gutter-x: 0}.sd-g-1,.sd-gy-1{--sd-gutter-y: 0.25rem}.sd-g-1,.sd-gx-1{--sd-gutter-x: 0.25rem}.sd-g-2,.sd-gy-2{--sd-gutter-y: 0.5rem}.sd-g-2,.sd-gx-2{--sd-gutter-x: 0.5rem}.sd-g-3,.sd-gy-3{--sd-gutter-y: 1rem}.sd-g-3,.sd-gx-3{--sd-gutter-x: 1rem}.sd-g-4,.sd-gy-4{--sd-gutter-y: 1.5rem}.sd-g-4,.sd-gx-4{--sd-gutter-x: 1.5rem}.sd-g-5,.sd-gy-5{--sd-gutter-y: 3rem}.sd-g-5,.sd-gx-5{--sd-gutter-x: 3rem}@media(min-width: 576px){.sd-col-sm-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-sm-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-sm-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-sm-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-sm-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-sm-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-sm-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-sm-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-sm-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-sm-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-sm-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-sm-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-sm-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-sm-0,.sd-gy-sm-0{--sd-gutter-y: 0}.sd-g-sm-0,.sd-gx-sm-0{--sd-gutter-x: 0}.sd-g-sm-1,.sd-gy-sm-1{--sd-gutter-y: 0.25rem}.sd-g-sm-1,.sd-gx-sm-1{--sd-gutter-x: 0.25rem}.sd-g-sm-2,.sd-gy-sm-2{--sd-gutter-y: 0.5rem}.sd-g-sm-2,.sd-gx-sm-2{--sd-gutter-x: 0.5rem}.sd-g-sm-3,.sd-gy-sm-3{--sd-gutter-y: 1rem}.sd-g-sm-3,.sd-gx-sm-3{--sd-gutter-x: 1rem}.sd-g-sm-4,.sd-gy-sm-4{--sd-gutter-y: 1.5rem}.sd-g-sm-4,.sd-gx-sm-4{--sd-gutter-x: 1.5rem}.sd-g-sm-5,.sd-gy-sm-5{--sd-gutter-y: 3rem}.sd-g-sm-5,.sd-gx-sm-5{--sd-gutter-x: 3rem}}@media(min-width: 768px){.sd-col-md-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-md-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-md-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-md-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-md-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-md-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-md-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-md-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-md-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-md-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-md-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-md-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-md-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-md-0,.sd-gy-md-0{--sd-gutter-y: 0}.sd-g-md-0,.sd-gx-md-0{--sd-gutter-x: 0}.sd-g-md-1,.sd-gy-md-1{--sd-gutter-y: 0.25rem}.sd-g-md-1,.sd-gx-md-1{--sd-gutter-x: 0.25rem}.sd-g-md-2,.sd-gy-md-2{--sd-gutter-y: 0.5rem}.sd-g-md-2,.sd-gx-md-2{--sd-gutter-x: 0.5rem}.sd-g-md-3,.sd-gy-md-3{--sd-gutter-y: 1rem}.sd-g-md-3,.sd-gx-md-3{--sd-gutter-x: 1rem}.sd-g-md-4,.sd-gy-md-4{--sd-gutter-y: 1.5rem}.sd-g-md-4,.sd-gx-md-4{--sd-gutter-x: 1.5rem}.sd-g-md-5,.sd-gy-md-5{--sd-gutter-y: 3rem}.sd-g-md-5,.sd-gx-md-5{--sd-gutter-x: 3rem}}@media(min-width: 992px){.sd-col-lg-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-lg-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-lg-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-lg-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-lg-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-lg-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-lg-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-lg-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-lg-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-lg-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-lg-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-lg-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-lg-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-lg-0,.sd-gy-lg-0{--sd-gutter-y: 0}.sd-g-lg-0,.sd-gx-lg-0{--sd-gutter-x: 0}.sd-g-lg-1,.sd-gy-lg-1{--sd-gutter-y: 0.25rem}.sd-g-lg-1,.sd-gx-lg-1{--sd-gutter-x: 0.25rem}.sd-g-lg-2,.sd-gy-lg-2{--sd-gutter-y: 0.5rem}.sd-g-lg-2,.sd-gx-lg-2{--sd-gutter-x: 0.5rem}.sd-g-lg-3,.sd-gy-lg-3{--sd-gutter-y: 1rem}.sd-g-lg-3,.sd-gx-lg-3{--sd-gutter-x: 1rem}.sd-g-lg-4,.sd-gy-lg-4{--sd-gutter-y: 1.5rem}.sd-g-lg-4,.sd-gx-lg-4{--sd-gutter-x: 1.5rem}.sd-g-lg-5,.sd-gy-lg-5{--sd-gutter-y: 3rem}.sd-g-lg-5,.sd-gx-lg-5{--sd-gutter-x: 3rem}}@media(min-width: 1200px){.sd-col-xl-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-xl-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-xl-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-xl-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-xl-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-xl-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-xl-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-xl-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-xl-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-xl-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-xl-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-xl-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-xl-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-xl-0,.sd-gy-xl-0{--sd-gutter-y: 0}.sd-g-xl-0,.sd-gx-xl-0{--sd-gutter-x: 0}.sd-g-xl-1,.sd-gy-xl-1{--sd-gutter-y: 0.25rem}.sd-g-xl-1,.sd-gx-xl-1{--sd-gutter-x: 0.25rem}.sd-g-xl-2,.sd-gy-xl-2{--sd-gutter-y: 0.5rem}.sd-g-xl-2,.sd-gx-xl-2{--sd-gutter-x: 0.5rem}.sd-g-xl-3,.sd-gy-xl-3{--sd-gutter-y: 1rem}.sd-g-xl-3,.sd-gx-xl-3{--sd-gutter-x: 1rem}.sd-g-xl-4,.sd-gy-xl-4{--sd-gutter-y: 1.5rem}.sd-g-xl-4,.sd-gx-xl-4{--sd-gutter-x: 1.5rem}.sd-g-xl-5,.sd-gy-xl-5{--sd-gutter-y: 3rem}.sd-g-xl-5,.sd-gx-xl-5{--sd-gutter-x: 3rem}}.sd-flex-row-reverse{flex-direction:row-reverse !important}details.sd-dropdown{position:relative}details.sd-dropdown .sd-summary-title{font-weight:700;padding-right:3em !important;-moz-user-select:none;-ms-user-select:none;-webkit-user-select:none;user-select:none}details.sd-dropdown:hover{cursor:pointer}details.sd-dropdown .sd-summary-content{cursor:default}details.sd-dropdown summary{list-style:none;padding:1em}details.sd-dropdown summary .sd-octicon.no-title{vertical-align:middle}details.sd-dropdown[open] summary .sd-octicon.no-title{visibility:hidden}details.sd-dropdown summary::-webkit-details-marker{display:none}details.sd-dropdown summary:focus{outline:none}details.sd-dropdown .sd-summary-icon{margin-right:.5em}details.sd-dropdown .sd-summary-icon svg{opacity:.8}details.sd-dropdown summary:hover .sd-summary-up svg,details.sd-dropdown summary:hover .sd-summary-down svg{opacity:1;transform:scale(1.1)}details.sd-dropdown .sd-summary-up svg,details.sd-dropdown .sd-summary-down svg{display:block;opacity:.6}details.sd-dropdown .sd-summary-up,details.sd-dropdown .sd-summary-down{pointer-events:none;position:absolute;right:1em;top:1em}details.sd-dropdown[open]>.sd-summary-title .sd-summary-down{visibility:hidden}details.sd-dropdown:not([open])>.sd-summary-title .sd-summary-up{visibility:hidden}details.sd-dropdown:not([open]).sd-card{border:none}details.sd-dropdown:not([open])>.sd-card-header{border:1px solid var(--sd-color-card-border);border-radius:.25rem}details.sd-dropdown.sd-fade-in[open] summary~*{-moz-animation:sd-fade-in .5s ease-in-out;-webkit-animation:sd-fade-in .5s ease-in-out;animation:sd-fade-in .5s ease-in-out}details.sd-dropdown.sd-fade-in-slide-down[open] summary~*{-moz-animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out;-webkit-animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out;animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out}.sd-col>.sd-dropdown{width:100%}.sd-summary-content>.sd-tab-set:first-child{margin-top:0}@keyframes sd-fade-in{0%{opacity:0}100%{opacity:1}}@keyframes sd-slide-down{0%{transform:translate(0, -10px)}100%{transform:translate(0, 0)}}.sd-tab-set{border-radius:.125rem;display:flex;flex-wrap:wrap;margin:1em 0;position:relative}.sd-tab-set>input{opacity:0;position:absolute}.sd-tab-set>input:checked+label{border-color:var(--sd-color-tabs-underline-active);color:var(--sd-color-tabs-label-active)}.sd-tab-set>input:checked+label+.sd-tab-content{display:block}.sd-tab-set>input:not(:checked)+label:hover{color:var(--sd-color-tabs-label-hover);border-color:var(--sd-color-tabs-underline-hover)}.sd-tab-set>input:focus+label{outline-style:auto}.sd-tab-set>input:not(.focus-visible)+label{outline:none;-webkit-tap-highlight-color:transparent}.sd-tab-set>label{border-bottom:.125rem solid transparent;margin-bottom:0;color:var(--sd-color-tabs-label-inactive);border-color:var(--sd-color-tabs-underline-inactive);cursor:pointer;font-size:var(--sd-fontsize-tabs-label);font-weight:700;padding:1em 1.25em .5em;transition:color 250ms;width:auto;z-index:1}html .sd-tab-set>label:hover{color:var(--sd-color-tabs-label-active)}.sd-col>.sd-tab-set{width:100%}.sd-tab-content{box-shadow:0 -0.0625rem var(--sd-color-tabs-overline),0 .0625rem var(--sd-color-tabs-underline);display:none;order:99;padding-bottom:.75rem;padding-top:.75rem;width:100%}.sd-tab-content>:first-child{margin-top:0 !important}.sd-tab-content>:last-child{margin-bottom:0 !important}.sd-tab-content>.sd-tab-set{margin:0}.sd-sphinx-override,.sd-sphinx-override *{-moz-box-sizing:border-box;-webkit-box-sizing:border-box;box-sizing:border-box}.sd-sphinx-override p{margin-top:0}:root{--sd-color-primary: #007bff;--sd-color-secondary: #6c757d;--sd-color-success: #28a745;--sd-color-info: #17a2b8;--sd-color-warning: #f0b37e;--sd-color-danger: #dc3545;--sd-color-light: #f8f9fa;--sd-color-muted: #6c757d;--sd-color-dark: #212529;--sd-color-black: black;--sd-color-white: white;--sd-color-primary-highlight: #0069d9;--sd-color-secondary-highlight: #5c636a;--sd-color-success-highlight: #228e3b;--sd-color-info-highlight: #148a9c;--sd-color-warning-highlight: #cc986b;--sd-color-danger-highlight: #bb2d3b;--sd-color-light-highlight: #d3d4d5;--sd-color-muted-highlight: #5c636a;--sd-color-dark-highlight: #1c1f23;--sd-color-black-highlight: black;--sd-color-white-highlight: #d9d9d9;--sd-color-primary-text: #fff;--sd-color-secondary-text: #fff;--sd-color-success-text: #fff;--sd-color-info-text: #fff;--sd-color-warning-text: #212529;--sd-color-danger-text: #fff;--sd-color-light-text: #212529;--sd-color-muted-text: #fff;--sd-color-dark-text: #fff;--sd-color-black-text: #fff;--sd-color-white-text: #212529;--sd-color-shadow: rgba(0, 0, 0, 0.15);--sd-color-card-border: rgba(0, 0, 0, 0.125);--sd-color-card-border-hover: hsla(231, 99%, 66%, 1);--sd-color-card-background: transparent;--sd-color-card-text: inherit;--sd-color-card-header: transparent;--sd-color-card-footer: transparent;--sd-color-tabs-label-active: hsla(231, 99%, 66%, 1);--sd-color-tabs-label-hover: hsla(231, 99%, 66%, 1);--sd-color-tabs-label-inactive: hsl(0, 0%, 66%);--sd-color-tabs-underline-active: hsla(231, 99%, 66%, 1);--sd-color-tabs-underline-hover: rgba(178, 206, 245, 0.62);--sd-color-tabs-underline-inactive: transparent;--sd-color-tabs-overline: rgb(222, 222, 222);--sd-color-tabs-underline: rgb(222, 222, 222);--sd-fontsize-tabs-label: 1rem} diff --git a/_preview/4/_static/design-tabs.js b/_preview/4/_static/design-tabs.js new file mode 100644 index 0000000..36b38cf --- /dev/null +++ b/_preview/4/_static/design-tabs.js @@ -0,0 +1,27 @@ +var sd_labels_by_text = {}; + +function ready() { + const li = document.getElementsByClassName("sd-tab-label"); + for (const label of li) { + syncId = label.getAttribute("data-sync-id"); + if (syncId) { + label.onclick = onLabelClick; + if (!sd_labels_by_text[syncId]) { + sd_labels_by_text[syncId] = []; + } + sd_labels_by_text[syncId].push(label); + } + } +} + +function onLabelClick() { + // Activate other inputs with the same sync id. + syncId = this.getAttribute("data-sync-id"); + for (label of sd_labels_by_text[syncId]) { + if (label === this) continue; + label.previousElementSibling.checked = true; + } + window.localStorage.setItem("sphinx-design-last-tab", syncId); +} + +document.addEventListener("DOMContentLoaded", ready, false); diff --git a/_preview/4/_static/doctools.js b/_preview/4/_static/doctools.js new file mode 100644 index 0000000..e1bfd70 --- /dev/null +++ b/_preview/4/_static/doctools.js @@ -0,0 +1,358 @@ +/* + * doctools.js + * ~~~~~~~~~~~ + * + * Sphinx JavaScript utilities for all documentation. + * + * :copyright: Copyright 2007-2022 by the Sphinx team, see AUTHORS. + * :license: BSD, see LICENSE for details. + * + */ + +/** + * select a different prefix for underscore + */ +$u = _.noConflict(); + +/** + * make the code below compatible with browsers without + * an installed firebug like debugger +if (!window.console || !console.firebug) { + var names = ["log", "debug", "info", "warn", "error", "assert", "dir", + "dirxml", "group", "groupEnd", "time", "timeEnd", "count", "trace", + "profile", "profileEnd"]; + window.console = {}; + for (var i = 0; i < names.length; ++i) + window.console[names[i]] = function() {}; +} + */ + +/** + * small helper function to urldecode strings + * + * See https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/decodeURIComponent#Decoding_query_parameters_from_a_URL + */ +jQuery.urldecode = function(x) { + if (!x) { + return x + } + return decodeURIComponent(x.replace(/\+/g, ' ')); +}; + +/** + * small helper function to urlencode strings + */ +jQuery.urlencode = encodeURIComponent; + +/** + * This function returns the parsed url parameters of the + * current request. Multiple values per key are supported, + * it will always return arrays of strings for the value parts. + */ +jQuery.getQueryParameters = function(s) { + if (typeof s === 'undefined') + s = document.location.search; + var parts = s.substr(s.indexOf('?') + 1).split('&'); + var result = {}; + for (var i = 0; i < parts.length; i++) { + var tmp = parts[i].split('=', 2); + var key = jQuery.urldecode(tmp[0]); + var value = jQuery.urldecode(tmp[1]); + if (key in result) + result[key].push(value); + else + result[key] = [value]; + } + return result; +}; + +/** + * highlight a given string on a jquery object by wrapping it in + * span elements with the given class name. + */ +jQuery.fn.highlightText = function(text, className) { + function highlight(node, addItems) { + if (node.nodeType === 3) { + var val = node.nodeValue; + var pos = val.toLowerCase().indexOf(text); + if (pos >= 0 && + !jQuery(node.parentNode).hasClass(className) && + !jQuery(node.parentNode).hasClass("nohighlight")) { + var span; + var isInSVG = jQuery(node).closest("body, svg, foreignObject").is("svg"); + if (isInSVG) { + span = document.createElementNS("http://www.w3.org/2000/svg", "tspan"); + } else { + span = document.createElement("span"); + span.className = className; + } + span.appendChild(document.createTextNode(val.substr(pos, text.length))); + node.parentNode.insertBefore(span, node.parentNode.insertBefore( + document.createTextNode(val.substr(pos + text.length)), + node.nextSibling)); + node.nodeValue = val.substr(0, pos); + if (isInSVG) { + var rect = document.createElementNS("http://www.w3.org/2000/svg", "rect"); + var bbox = node.parentElement.getBBox(); + rect.x.baseVal.value = bbox.x; + rect.y.baseVal.value = bbox.y; + rect.width.baseVal.value = bbox.width; + rect.height.baseVal.value = bbox.height; + rect.setAttribute('class', className); + addItems.push({ + "parent": node.parentNode, + "target": rect}); + } + } + } + else if (!jQuery(node).is("button, select, textarea")) { + jQuery.each(node.childNodes, function() { + highlight(this, addItems); + }); + } + } + var addItems = []; + var result = this.each(function() { + highlight(this, addItems); + }); + for (var i = 0; i < addItems.length; ++i) { + jQuery(addItems[i].parent).before(addItems[i].target); + } + return result; +}; + +/* + * backward compatibility for jQuery.browser + * This will be supported until firefox bug is fixed. + */ +if (!jQuery.browser) { + jQuery.uaMatch = function(ua) { + ua = ua.toLowerCase(); + + var match = /(chrome)[ \/]([\w.]+)/.exec(ua) || + /(webkit)[ \/]([\w.]+)/.exec(ua) || + /(opera)(?:.*version|)[ \/]([\w.]+)/.exec(ua) || + /(msie) ([\w.]+)/.exec(ua) || + ua.indexOf("compatible") < 0 && /(mozilla)(?:.*? rv:([\w.]+)|)/.exec(ua) || + []; + + return { + browser: match[ 1 ] || "", + version: match[ 2 ] || "0" + }; + }; + jQuery.browser = {}; + jQuery.browser[jQuery.uaMatch(navigator.userAgent).browser] = true; +} + +/** + * Small JavaScript module for the documentation. + */ +var Documentation = { + + init : function() { + this.fixFirefoxAnchorBug(); + this.highlightSearchWords(); + this.initIndexTable(); + this.initOnKeyListeners(); + }, + + /** + * i18n support + */ + TRANSLATIONS : {}, + PLURAL_EXPR : function(n) { return n === 1 ? 0 : 1; }, + LOCALE : 'unknown', + + // gettext and ngettext don't access this so that the functions + // can safely bound to a different name (_ = Documentation.gettext) + gettext : function(string) { + var translated = Documentation.TRANSLATIONS[string]; + if (typeof translated === 'undefined') + return string; + return (typeof translated === 'string') ? translated : translated[0]; + }, + + ngettext : function(singular, plural, n) { + var translated = Documentation.TRANSLATIONS[singular]; + if (typeof translated === 'undefined') + return (n == 1) ? singular : plural; + return translated[Documentation.PLURALEXPR(n)]; + }, + + addTranslations : function(catalog) { + for (var key in catalog.messages) + this.TRANSLATIONS[key] = catalog.messages[key]; + this.PLURAL_EXPR = new Function('n', 'return +(' + catalog.plural_expr + ')'); + this.LOCALE = catalog.locale; + }, + + /** + * add context elements like header anchor links + */ + addContextElements : function() { + $('div[id] > :header:first').each(function() { + $('\u00B6'). + attr('href', '#' + this.id). + attr('title', _('Permalink to this headline')). + appendTo(this); + }); + $('dt[id]').each(function() { + $('\u00B6'). + attr('href', '#' + this.id). + attr('title', _('Permalink to this definition')). + appendTo(this); + }); + }, + + /** + * workaround a firefox stupidity + * see: https://bugzilla.mozilla.org/show_bug.cgi?id=645075 + */ + fixFirefoxAnchorBug : function() { + if (document.location.hash && $.browser.mozilla) + window.setTimeout(function() { + document.location.href += ''; + }, 10); + }, + + /** + * highlight the search words provided in the url in the text + */ + highlightSearchWords : function() { + var params = $.getQueryParameters(); + var terms = (params.highlight) ? params.highlight[0].split(/\s+/) : []; + if (terms.length) { + var body = $('div.body'); + if (!body.length) { + body = $('body'); + } + window.setTimeout(function() { + $.each(terms, function() { + body.highlightText(this.toLowerCase(), 'highlighted'); + }); + }, 10); + $('

' + _('Hide Search Matches') + '

') + .appendTo($('#searchbox')); + } + }, + + /** + * init the domain index toggle buttons + */ + initIndexTable : function() { + var togglers = $('img.toggler').click(function() { + var src = $(this).attr('src'); + var idnum = $(this).attr('id').substr(7); + $('tr.cg-' + idnum).toggle(); + if (src.substr(-9) === 'minus.png') + $(this).attr('src', src.substr(0, src.length-9) + 'plus.png'); + else + $(this).attr('src', src.substr(0, src.length-8) + 'minus.png'); + }).css('display', ''); + if (DOCUMENTATION_OPTIONS.COLLAPSE_INDEX) { + togglers.click(); + } + }, + + /** + * helper function to hide the search marks again + */ + hideSearchWords : function() { + $('#searchbox .highlight-link').fadeOut(300); + $('span.highlighted').removeClass('highlighted'); + var url = new URL(window.location); + url.searchParams.delete('highlight'); + window.history.replaceState({}, '', url); + }, + + /** + * helper function to focus on search bar + */ + focusSearchBar : function() { + $('input[name=q]').first().focus(); + }, + + /** + * make the url absolute + */ + makeURL : function(relativeURL) { + return DOCUMENTATION_OPTIONS.URL_ROOT + '/' + relativeURL; + }, + + /** + * get the current relative url + */ + getCurrentURL : function() { + var path = document.location.pathname; + var parts = path.split(/\//); + $.each(DOCUMENTATION_OPTIONS.URL_ROOT.split(/\//), function() { + if (this === '..') + parts.pop(); + }); + var url = parts.join('/'); + return path.substring(url.lastIndexOf('/') + 1, path.length - 1); + }, + + initOnKeyListeners: function() { + // only install a listener if it is really needed + if (!DOCUMENTATION_OPTIONS.NAVIGATION_WITH_KEYS && + !DOCUMENTATION_OPTIONS.ENABLE_SEARCH_SHORTCUTS) + return; + + $(document).keydown(function(event) { + var activeElementType = document.activeElement.tagName; + // don't navigate when in search box, textarea, dropdown or button + if (activeElementType !== 'TEXTAREA' && activeElementType !== 'INPUT' && activeElementType !== 'SELECT' + && activeElementType !== 'BUTTON') { + if (event.altKey || event.ctrlKey || event.metaKey) + return; + + if (!event.shiftKey) { + switch (event.key) { + case 'ArrowLeft': + if (!DOCUMENTATION_OPTIONS.NAVIGATION_WITH_KEYS) + break; + var prevHref = $('link[rel="prev"]').prop('href'); + if (prevHref) { + window.location.href = prevHref; + return false; + } + break; + case 'ArrowRight': + if (!DOCUMENTATION_OPTIONS.NAVIGATION_WITH_KEYS) + break; + var nextHref = $('link[rel="next"]').prop('href'); + if (nextHref) { + window.location.href = nextHref; + return false; + } + break; + case 'Escape': + if (!DOCUMENTATION_OPTIONS.ENABLE_SEARCH_SHORTCUTS) + break; + Documentation.hideSearchWords(); + return false; + } + } + + // some keyboard layouts may need Shift to get / + switch (event.key) { + case '/': + if (!DOCUMENTATION_OPTIONS.ENABLE_SEARCH_SHORTCUTS) + break; + Documentation.focusSearchBar(); + return false; + } + } + }); + } +}; + +// quick alias for translations +_ = Documentation.gettext; + +$(document).ready(function() { + Documentation.init(); +}); diff --git a/_preview/4/_static/documentation_options.js b/_preview/4/_static/documentation_options.js new file mode 100644 index 0000000..877e3c3 --- /dev/null +++ b/_preview/4/_static/documentation_options.js @@ -0,0 +1,14 @@ +var DOCUMENTATION_OPTIONS = { + URL_ROOT: document.getElementById("documentation_options").getAttribute('data-url_root'), + VERSION: '', + LANGUAGE: 'None', + COLLAPSE_INDEX: false, + BUILDER: 'html', + FILE_SUFFIX: '.html', + LINK_SUFFIX: '.html', + HAS_SOURCE: true, + SOURCELINK_SUFFIX: '', + NAVIGATION_WITH_KEYS: true, + SHOW_SEARCH_SUMMARY: true, + ENABLE_SEARCH_SHORTCUTS: true, +}; \ No newline at end of file diff --git a/_preview/4/_static/esgf2-us.png b/_preview/4/_static/esgf2-us.png new file mode 100644 index 0000000000000000000000000000000000000000..fad229c4ef8719a249e063105353d3b4a0fb4114 GIT binary patch literal 18651 zcmd>FWmDT<6Q#Jj6WraMLUDq-6?b=vJH_4I-QC^Y-Q5bsy}*q5s_t2r-EiIn=Gokz zK4uc7D8L@u_1j{A+#;1++2R6%w52l5TvK09QYF+xJ?%}(M`K?P0|SCr{SVrr&ORp_ z-csW%h1pC6-t6=Z@ zvqPOh|3F|JtWm$nH%-WTgM2WCK+QTuFl=E4O&YLB5^M%ce{oaVInUvI8-D@WJiUZ`evptCXNj>&Qe)TMKD!4pSmh|FOO4*TPLH zJ^R(}<#nOsr+{$EJi{N@r2jTzW$%0%y*y1{^KDcYNn``I?~fO7MI}ARKqVDIp8p$^ z!RfX|_0Q7oot6(vn|3E8t1c`DUYq-xLd6IRhIqso@!U+r-`8Ku3O)B?yZb@R(I`)} z=J)T~JiU&3s6|(ttLkdaRo*gclM#%2Z3M7kx@y^ZK7CV?n2^W`vWs7pp*kM<{wI9f zNmdowL2RXx1pnN=PAtXHX?5x=pm3U&4GkE|&`t+dJYVQ0qZUiiWI~eX%liY2MH749 z?+3TP@S?*<-Gq8n1b#mE4ZMasOUK1TXYy?_b^pEQ>3`w^uhAxKwiK}-Pb-3P`aKzd zvRy|+U2<|Wu?LBatY8VTLkd=@&9meQtKMAYFLz_$P8JN4!yi~gBV39BRR%6i3mIcD z2rpElMc}__so;kVA0cG~PV0eOP&9TMj4Qy!bAR~W^M3z@yYZ~L%iAuDJ;OW0C#=n_ zqq5v{8_f;ha)*L0qK7a5hfj+bF3eV|!J%e3JE&sl!u593GO0nDAw>$1*(+55{E%j| z7R5vk2%@2nGi}Lc^DLW9vZ9z97ujz?(CqC3CeoNPQPWLiZ8*X?BC|S5s||1fA0l^& zljUW_{P>!l!)p<*y%xwOzSy!j1KmHey}edl{dBu+mT_SBtziv`%+##nULk4SHg4y+ zt3wB=ek5QCwEdxxpAtip54+)k3O+z5xS^Vx`qFFlZ-M?sZLXXK8(yJ07d{YEsQ6$m zZFm@FR$FCfzw|583EhzuRtfp=%m5WdzyqMFL{Tv&M7VKZS{v2%5G9`UMY%Wo09BE> zIhL|1MBN}>``NUmaW)4pHrAhLJ07ls6+jiQT%aNftH5(Pej{}G6`CAMyVkrw1w>1D=3 zqMmv9Xmqf1lz?+OC)iQ-Sv~#Raowyt`8BNnQ{88MLPBRjE2ueJ&7#K1$bqc}2wS=h z-KqjMdmC5IBwRuUygbkK-yA6{?+_sumNceRf6u0Ib~?jLlfkH}Y(&*da0*Aa1)gC|sM$P)q*a280@QknsgOsCQOKWWh7bc+u%U5Y63J)N z#=pYNjWXn_*tiU)4(_U{alYcGv&z&@zw|TRlid+TIK?)PBDwxN()}s;6yWyD?ai85 zj+QJwpM;9i@Dy^*orsf&n(3!fG`+^^UWD3mo3|;JUSk(pWyT*)elkofHA-0acnSge zycTc=2S-&N-su&0Q=W)6Db57dj>|R|@xl_O@6Hbt=(I{InLK3v4y=G&DbgI(y8l9^2w@CB2cId4|8jve(Ku1?FC689tD!Lag5hx`xfB=CO7Gc-821SI^x}4YE z0X|ASC=~&pBPbAq@Nc>9_SZkVRSIOJ(mA1&z)6X{N>s(uMq@cIJid&qvWhxGDhA;s z8Z%>b7KTb7D0)kK=WzJANoIc|JbpPv%}r;0iQ1WR7U`YWO~A z6|A(Y-ScOlZEx)AF!Z*%+51%9Q2|8^CHYuN>`wFN4FBiFYl`RW9WN_#_yj6srUWup z0z?1IZANxJ5VhbZSjFGmq_loJzT7vz?$MYTZ5$@6U&f|E2m-VF5y#1GR%(=bi+VAf za!ggXk@&Pa;3N)YHUf$#d1VfKil^0(vuIKBk}Mc9#kRB+t3zZrfYFBt!?{DQ( z*zKVB{dFd&>2eyJxdCV}Vjx#)|A~t;`$1~`ep=8NN8zK$OK9rAJ3->mWfq&XnVkj{ zBT?b?5zM(Mb1Z-JV{K33xL%c_laC6e$>DJa7hP0R{5>#&(e$EYQQcZtsI+24I5#FU z?@SYs3cY-Yd6l275 zZq!mHjzH+8ev?l_-{tG@-E2Z1582p)ET)-|(Sgq7xmjHRv0==XmqIV-rTw- zlv0x+1Fno8c0yuoL4_`@QpoEdem$;86mDdTmyg{0#YubOAWE^3a|(qA)?pKD!)M9n z?zL{q2}}@mVqno3q+)YYyCyo08$(cEdt3tfo(IvdOi?d~t$*lATU|6*84)A5;?nUp zV-a9*@>#GW4wjinI2=5zEXiUbs&#%A(9Far2QR9Sk_uvu4m`+#PVQOBWtA?*H%9>U zge-An-R*^P1DleP-gQ8+M3<9~+~!3}J6t41tyvbEFw^>7{i7Nq&Og~CU^@1mDAgJ_ zh8!unj8Snf5gS(i9HtmBxQYf}%Ly$!v^g)=DmM)+Rkia+fN0%x<}^;Al>xOS6mrzm z{(kBR$Lx}-*oc(Wl#x+-P+odFk)1Wm5-O0-h3xMpr&2cPAJ>nJ02r-SqNy-^Lc2WsNX<}q}%c^vx+vQg(vHR&qs9120tWX5@i-pILKMKHe z&ZGCvja4#!v!bOqurZJ(!U8!4KT@LQtMtr9FR=O5U$4p@Z_>hPq#`iw_~-VZ#L|Bx zoXWr=@gC(-C8QOFMLhPTAafT_)Q>G`o~izA{au{jZH;mJ3XwHSteDGrn+pr0aIPb> zqTeM)sHRp;?`IkZF+~pLyaD^rCc!{CU>Ir^Hkx2)dq#oIs;eI>+K7fJ4!sYlnxuAt zL-K=zXdXIk@bBCK5m_<|9zwpXgOwv@510~ic36QqON9@U5u&TUQ zPf}-g1(J~@1Mv1A8dL@9t=iaH9e~F>Ywrejo&sYj)X_HCN6d}0ayIyT1aFd%Yy7y-vw7&D+<3(_h9r&Jc=Q6P`d><=V z=bM|W8w4)y*}7H|geg#u!CnQX^{=hlY12 zap<7ZHznC0DU`O@8fBk&9y{L@+NpiA9bDvPFm99H<1kem(rj>&y^nvTO7P{FV2B_0 zG3!O`xl5Vgbs03a(`ITYHBATb1=4FAm$?9;m;u?#VGGLSh4ZB{ff$RJ-$P9)RFXWJ z5Np*&oQu60OcuHDBCx-B(@q(it)Zsd7?M}(Z42N` zDhF}!*g(=}np9aND5+Swm-<5!3tJPKcl<25&+KXCr3d4!O%LvF=_)BVrG4HK@dcg1 zor}$uH?@B!mfT`k2(x((=C4u<<*I==?(;bz?&%q;VPh=MYn zxV5^!0-yNMqI3ABC==`8e(_xXTC?q7ERaSgj7Sl##J@`bl~4-XloTu_@(7CJIH?iN z1lYhlq?RNGGP(+YmS)9ekJt##)_;XDH9y=pRJKi8|4R*}mherAkYp(Qz}$OuGkSDw z?P<4kU4;O%16TYNQR)P-w&fzcS}f?dhhiM6Kb9$@!6D4#_iX-^j1kOuv3ELEfmORn z`UfrL?U_&^KlNrbX(&}Sn27FS+{$S#4x2zeWG=8fN$z^>cj#VK|7tyQ0dYkx8LkT+&h6goy>)hz9~yz#yPUrD9@AfX5drsgzs z;OyzZ(z;g;TZT?aIYLUGfc;HlyaWh1OYc6Gj|d(k#XVfSNFpVNWd--(17e~^L1Vcr zp^rJq-j^JUB$!SOk)=hB#wh}kNbqp>%k#<}X<=s^<0wV~I9R807>x;l_T(fQZQZUY zP?9mx%&*Y@n16%9rDgww-*4nHTKU=8`j!(W1xC`#FB2A~5&F0QQtR=}t!wqF62$ys z*kSw7*oECs`uF>8r8F%iAoV+gt)Kq>B39Noi{v?!f4^<+aZJgf#zMH!$EYy9euf~Y4}XvFI0cB|5mlz@VHR2tgG;??Fdm{nh>k@@fG4Zn$VZD zS{k!yZ?m)J3v$10!Y^o`J>`7ZJb{Cc|0;Ks1{I ztR`SrI8cL)AcGdcq0O^0itHYW_L|Nq6k!}_u*G$eW(5gu zw8c)nh|~}}C;8$&{8bM_WlY{yav%*_7UKGkBt$s2L}|WiRyll;wvZ9ER9~Zl=VIpU z6`T)*;MLu6P`U}JV&N^CJz@(I0nR^^9h#nJ5un~TI=R~Uxa>Zy!Stc`v=55y?XNc; zia|kPh^bt^vi*`@>)cfrU|gZH(L(Z?$#A6B%!6FLoUlTkYPCbZZCg2TTqV|CsdFz? zycSiBoW1;Lx0JG}$mBr6hN>b>tfDenNkh#_NG~aSwAWA^mlPP6G*ImY%F+Q~Sc89j zo-|7+wm>bN24!+VycgBM+@i|VPF0m1U5IW$-Sh)l1I#sUDtPzKHr(752$>%)7=Wt6c40Z>V`={DREF z2>$*Q>8mdqiW*`;qsYZ1g_O(TF(ac^JaMr8CZcCu68C)$sy`oZWtoZSIA%&xIkwUP zjs}A#NeP~Lwtvvs0WGkMO$a?F(tshNT?`RO`#U&EL?AhE(N0nX(-6m|j8Ox~29e93 zv|5>>R#>1&fkEaj9}X>_v@T-@0spJ zyJp})WY0+-Oe(ITs$b}JsKoopCduTAF1blK7u)U#iww52C$Q&Zo&u#)Zscr=hYw%- zo(i8TftAsJ%=yXVeQA+rTi_BIIlK%qAwdbcz~|6FD;8A zdwmC0YtQL)>g@b&KTrI*NjmyJ+EU`WGOpsbi<$IR|9*nKnTe2Cq#j9$dZ-OnW4ND> zBKV||<>_tqBQDc%kt|tbx<=+6AI z*#i9&vF^ZT#`;InDcaEH+9#7pTSk*DBEPe<-hAcjnMVf+OzJr4U{19nO z^WR9)G{pcRcX!x6IxsKkHU9(KD;yVrjrNXi-N|utR24P~@igD#xWKHLZ%Rps~~#xZ)R;D=PTcLxZ}%CvwnXUZhuEzZ+ndhLH>dH?zKXT zLyK}KQ&V1v)Zub|fXLo_=mUFkHub=(7rl>MhR2uH8|+8Q(pI<6W-5ONm(Z0pvV+&J zt)B@c-k_6y2C+&8X2YnW2#9mVBHiJV;_1DzN@Hs0(GB3?8>RZ5 zmIrU6z7N|UV4v81IFYzn?Icq|UqBFYA;%<2KKmq1OmyO_R|#pZwm(&4bienu_jzT@ zD*J@QAGs((>=A$K!sx4JNKr&&qS+S{)7tRB7Af>`nT_!xW}fFnjH=&lS(_zdgH7O+ z{f=bI4L%ejFi3oE#)Gg<(4Gl=D=$c3OyCtmqVPxfPFqRJoRLaHStJi!X z?zbJ2xW{g4q}ux`KHi;v^KOPbVlhVYr%nsb?46kNu4344rc@tt;mXsqrp;znz-6>= zfLmDWfMW3?$4Q^OUkRU$t#eyZOyUPfQ5l!fVkrKcu|Bf6>EDl`!PFX1GmuiB(3IT zL+A4Q(lB0fAnvuZV$$EKG|Yja2-sdCJ^JrZ%{uW^iTNgMx&$>=D!mvU+do?+$4rB+ z7?QWb%VnG|XYs00YODRQ9HzsKh5Y&nT~{)DUQkq;?t|FvTZqx_9 z&kurzdEOOAgj}Z9T{pm3^^rnxz?$fLq#oxkI=g=^t6rMbQQIUO>CErbku7XuaR5Z% zjCMv1jZIaZwVgTyoDy|FB&s`Pfq21kw~>wrnfA-h_f=<$J;Z+&p;r9rXsO@ZWxGie zrhtBL+r&cbybh|(1fT7}IStp~?l!M#_8)-#7ba(?n8}~kMH1e)eZ9HSlytbk;x(td z!~aTtJG2F#(!u5m&9w)=ry05a!C#Q@oa~@?Ep+J*=Xa~m7>-4Ak66JkXm`#A58b%4 zDaB)^&FEZ7Hy%)o>D$+Pc`q9<{px{$m^#*M-wTi#-G4#=2miKmX4>Ae+j|ol`j*x@ z+BxP$>sG zpb9sd@EpVXvm(7c$6hNCaszBH8m!~~@~7T`>0oTqjSkelHFB33T;irm|NIWxVeSJC zRj_`+Eq5+yl37H;Qmo2fe{2tVibom`JIHJr|4?cz$BrTqv_eee^nr24mu!=OIkXZX zX0EWM{(BqJi_AIZ$)<$U2gJ!>i_J+p8x6E;HJB42R&I-kZUw@+TCf)e6{u~Sn`yPB z=C0rVYtzJZeC)nLkwIONP#+NiV^ZbP#W?F<`u6?{mFJI<9qDb_iZ`!dmdexGNa##7P zitcgGbE!P_-%zL=Bbr^8v|hMQ_9uQ16fKW_6F}ZO6_1mj7|-D}Rzu4*r|(?x2m(n8 z7h;a0@u8uha^x}F6+R9-B5sRS_B)T}DEWIQij?@L#RZA-=M&7XSMMlm}Ob zyB>~nh}7!={wcnopTQuyK=#-A?&5c&ojkN)<#sJE+ltbaIP)lcHOKX7=yQQv<)2Ig zBNY!>01`@*Fl3^@=t(Q&D;EUIuS^lz7?{VU=dv;r)fRy4i0!BXU|llu!N9U$%QUj0 z@s2Z+uu4yX6QKZZb58Rb?YDRpj%fB9wTqEMW@~wOgl_2SH3r;E26(LM3iBp=*Yi2S zKODU$N7M#k*5X^0--4|3ozI{;GWf=i75LT-qN6@Cisq``iBQx8>tBPHfM-@T^##s_=)g8hAtM%FK>y=YMbkkMO&-}f?Riisu*|V}_ z5rfR3tGm+lYB^Skt~Q^SlPUfjV>b$#ddcGeLtMw2`ksq%SsdRmp$Mw)Ila2c;oOAl zh0JWfP&Oiq`|NC^O8%dp+EBg`h@QuI%N;evYiso~9OkoPy_yvJ;4V;>PRpsEA}4Z7 z?>$l?c{33t1s81_Oa4YeJ{{PAA4RLGaI^k{z_e7U-MtaXOtdw+AcIXF=J~RJYg|jC z@4E~0X&G;P8>6uO`04uRkG%>_fGqFf9}R{lK`zm9x~Z$i!yus?LgFpKruTY#wWZf< zkQCC)S?h7-1*U^EpkMh+H|@o~X<3>iXQ5VHY`wtY;5_5EfU;>0-^df*0u?QK(z?59ClunaST~-CYT$Ig zvEeDE!D%BwJJJ-ze#?CsJq`zRn&-OicNlX`Y+Kg(dHaDZ*EC}0%0@Q>*UX%}vgN&o zhQ8wIi0rDl)5wb`{2bg5T~LCUlfUP_N{icKfFjG+)l~GIo2K~B;Gh)`P!a9I?|v*%s?3$DNHO@C1DmOOO)Ek zP!$rXah-}SrfcxJa@fQ4Gn#JB9?1Ag|mP7x@DZ6q-Wk%g5`wEMlTcj9&i&Yo1828 zN5r4k3pK6{8hukpF6+eMHRG+k56e0^q~|?lR6|bj<`U5TPl+>TkkW=V?vLNee7bCN z>zEUkC7$8nnIw~#5j^rqQ%L1iSEmUve^}ILhf?KnXN0x*5l@?7h!$`8{h4mET1GVx zh!5<$%)(QXE9{fi!NnK+m!SOL(`Hxld*sZS8c9pgkq(R$TV?WZ*qerX&!(L5rGmM0 z2=HnPc^a$|swzE+mnuMh!^AlEser|@#LDEnDt+aNJMAj=w}OmKIn(g~_01~?k#WjC zpoeU|T6erISRdMeogsrh^9C9!cgt>nTc^b)Ll(alJK;{X6_5{OO9BLt^0-&;@be{# zxyVxsi>R_>j;Vi02GRzXVknZq4R)&1!4;fwk_`M-q#zZj%%snVv{C!Ox!6dll-QXD z%b}lt+)%Z2x;x9szgapXj6Y}ntwzQaVr0c7?Wll>ZOqz-wST~f?PJa+T;FZ2k`C%} z7R3SdLjQHTzd&qSpXMY>c9_khbjoCmG!z;8yrjx?T7Z-OUI3GVMIeJ!Yrbk*i+6LF zmXcD67OyLN6(Rq@qGhLIafqAR8q1U6D9x}%rQEj((qGum-0P1H&4?045TSR)eYIPc zy}7OR4->NY#E@>M40nG2w;gjLjt)BPMhX#Dc6-{Q3zHapRlNbWO;PcZe++nfe$?ln zPMiqr4?N&0@xSzPpym8)nM$tfkBf(?+;}H60QZ=`8?RNu6n;;rUzfVBcv9d0_lVOk zU~(kCa3Y_xoG25CEMD5uL+ipa*L_dpUCUsmHTYcvw!$vg2Ck{9u>C-e6EQ1%b?a{a z`N^j1v4-Azda`#q>{T61$h5e!^e%{BE<}j70oE$N<=!kw1k00a)Ol5FAYz*R1b)Zi zKAV^+uAuN!VpG)#lWpuiKzspf8kGz7hk4GOB! z;u$MxHqx5L)7vja#^=h0Mo+E#LIQi;$DxP0e6Nzw7=f*?e}gCuH9o2JQR{Au^_0Eo zn8RY8*4XR%bmeajGhg(Pb+JTXb()Odv84h9Z2wa+;lbRP9f;K${CuCEZ1owJZ0tzS zAeAtEvSS6T)a}fFeD|!WJt+FBJzEbsdB!tNa9HCPak!xfRp{D5f>Gia6u^lPW5qyI zQe*moUS47aM2Cu|)l^rHaT0z$84+W`jBitnXD{Zv`LeHP?}}8INtA*=KDrINUfef1 z{wmB{25WDrFg4^RQ!o3ofm$qbOoWjJl(y+Go z+^{0}nu6JgB_+Zk%GpOWvEH)QT~dYb$cnOw*Z;=&bJKe|K%Z&Ohy!s?w6oRzeObgY zX1EWQER<%{l9rSr5*I$K#l6_d+JTRiW}I9cvqhqz2Rg4sf|Sh!7y)=fbZqma6lNov zk$KLD!cp z*m$NKU*Ah^r%sbe@p<+8+*fh4?|NKRP;X}NgH$ay+ttdRwy(6(^2n^EjkD^0K=Mn& z6TB-<_4C`6Ohfw&ArsuKJAX7m8|}?OvnL%;z^W788Cj6U7Ui~fFc>jn(yJfSsYxgV zCG2ld!dkEJQsESWFy-fez_)s?BT7CN9@P2t$_%o!fE81aQ(Clan5NLID+gOCOW`=^ zNG!9(o34ThYY;%yxA(y@jj{UFYdqpGAHt$1S$yl)6bacK3E-}FwJ>0UD@2l20!FxI zSMtO<|CI;Tp$Wm9U!q#Z z9#0^P5X_~0vziO3C?@EP=xHNf)|X5G=mE&ux>Ue|t;Ud1iq;U5ju<990@-p#tBMSi z)miB1Eb4FX@9IT>hW_X2!xXec=sb*>Pdy@NZd%GsScRAq+aqY=GNHLL9WBpC|)3@qvE@va5^j=hXO) z&u-e87p?wxNhWvfKCgRp-QurMH8|`*=@_AJW4hQgdSbx)c_V9EX{g%XM4PtPnc9Yb z%{u>j{4}1uKq6a85ovI|)q-ew0yyQbXvF)XFsmVFs?Okb!i*)BP2xA71tiZIlURq1 z?*IVIikf&nPoSa=5l=P|O*!lj)2r`xF?rBgR7y_c`8l8EFuso*kvyjurO_YOY4@Mp^;QY6iNHzPk3{&yk;cr=B#(<|;X zHSV_O1>XgS)5eS=Cv(ecC&ZcLCS$NKPa}AQBPz!bi0^`@bh?he{c?Uempn-I%{7TdLkIC00v8m-HH`Z;p z;Ou17Ex0zZ{ys*73yQ|1Ngc3)b<2BhRyErF=pb8)v4i_JqpOi`jt?{EEmp+L^O4@%?q8U(i zOVh6!B^oIiQl?l$b0>|0l>olpZ|!;(K-ML8@kt-?@_CWEXFAc0D)O3SLa_F}M*Pec ztJLF4Igy@Pk-d&z$T05!kw`Rbf>XI`xTdSt`aAo}sI@d?$gDJnK9Ix!;t(6#$Bh+h zj^%E~O&0l4LQ8mFBpP2wwu8Y; z^)$%Syhle}Ew`%7?jI_B)`sSG%SFW6r;uN&>oPM{gGGlM1mk!cXanxAMm5q>scJ=P6+>2 z0%rn+%2ObRK&!}TF2k0=UDn%EwI>D+^Gm3qa0wC*8r6F3m`w+>CPK-yTGy`mu6~4B}H9TpcPjmwoHtVtP$2lP7khd zf;cp+0>YJU<_i+{?kmz_1FXUGIRdDxb$+;v^<)2e{nq&B1i1A;0;>=s2q7Nd2;F8R zwt&QD(n2anK^ghuRVslhxxm08<-i^Frk%FNGMNSYn;z~wC*EPITIo?aE1LdHw z>ar|-qj>n@R_vL)fTP*!Z11h5I{#fedd{x@z{XcsZ_PcKy_V}>w<2bY869_RwUyQ@ z+RDHE+!@uL1h`o?h#o~GUX7t{B5kADO-kdBlqwOfnp^Rp_t<55S+80=>gSs=0}Jx9<|QE1gf}C?G!8l7tK-; z$>cz*(!kPKXC6K|4w=a^l<;z{h%$?!@&?B^l`WFRb(!QMSaNO)tD9u~8Ne#Op#~#c zVGjJk)LQS%Ri(@db8k^5cyxNWXfL;&!n8)Fx_(Q}w8@uCh)$`*{4znLMcp1l0ocV@ zy31`vV<)Jvk~C6Bzd8%>EO-qX@AmvLFU2S1t^?uK?&u{a)-%$>WmYSuSP04DA-q~r zsBDkVB8n6{I(fCxJcBF!v#Uh2@R?2H7O`04HZWtfhFZF}B)g)`iz#QV`M6{rJ z*nx1!N(0Ets;Q@27`IDfE3s|M?PMFkrT0~)?eZiOz>bd;D zqoriTFIkNi;1x1zhcqanxY-!+NRr`=+qz*<= zW0;_}`PA^_*sW9yrWYk>JUIq$PoBmXKID&BS? zcU|6B`Ix;Hox$9GQ$;ua#V~yq&kjBk3Y9NX3;8mf#PCi&*35>-G_&@O6F>N>gM75* z`K{}iAuJ0UXj#zCU?_yG1C4}-?Z2MhNH9MG&ZvFXI1w= z*gO$JXp6VnqtQx$w#p($ZdBwF5X$AY{CWL(*011Hl_NHxGFoF7K4L1CAYuklc5eC$ zs;Iu&_z;O3P2{sSMc=ec@NKF_QEP`@Wq9@V;BV@3sEfB*Q!BYkfgdX~_UHj25q7CV z0j~PcJ4v5F_o*HH*@!-ausEp z8XTcYf2L)zL{30e+b?dT#m#7y| zPArel7;(U&Ho0j#zc?2)BSp#+87E-u!U3tAti)eb)J_Kwb`}&vofav%k1BBf@GM3L zr8I7VP74f4J806{P^_IY9c&*`e5NnKl^>CjB&EefTmS8_5YO4?LDp{^OTq*XOAXng zAdlibd^F}i&S{5Sbul_-34*`pS`6oY<)x0^i#m{4)2xm6ZO#Fi=__;3!d_Uxa7V03 zm0_zEpCdSKqpEpzLD?u^xdah{aD9?2jUix)Rf|xyAu?@Am|hyvnf05i8ai2{n?FI`NCM`<3GxYcjQ&j#V~9iXuPQ%M&0f<#rXVkZ z=xG>08ia?nFrL3+F!^Zgb=_P}iU1%pm9(kuZ->p;8Cp)+Zdet{j%6H=CEOG_-wKER-K?trlGghC(_o-~;=BMyn zupENGCCKApv&#$uiCh+Kw+gEyJ~S&ghS8n55wg_!?=GEUvv+cvL>V2!4c`4JKUfmU zn6>k6ARh z2HCZ$9J#2ff9%6j_3@`N$m;;aMh5MxV4FGFYLPS3- zn63G{t#0O4HG%z0ra-$vxX)(q$8{r=GX09(x@U2#$Ll{U36Wf%yPs~~wJk{8Gx*zE zWbE5E{-A7u7f@QYG+-hQEC2(isyAWwlIO_aee&?zMN=S#JV7WxGF^8dy(msggY*|BUc)D2F;uFCfXnE z)G?FaH-o!A`&JP^1`t47U~$FKfwc{9o5#%y#8yYQwJ%>hK7rn4~Qdb)IY=nH zs^J+RdVVy&RS^%eHV$8ovlYRl7VDjh%>mhB87_GNhjDZ2B?+h*5f*e-cXRdSpfn+Wq!|wt`d`2w{CfGPm&2HV|i!G z*rtFOhmKdwcs?Z`^1~%VMNH3s#|7l`wV5rw(5TXvgvHrQTa6(10H{IYDPWr(?cK!% z0mBhV?-GZ9h>-FKC?2wrZ<*h#zr=(;kZ(rkg`Ww}4l2AZt zwhLQOyqIL=@y7_&#A>5`U=ZZ*h_q8`I&0`j{HR3?THs!(*8GC?KNdr=F3OxdH{LB{ zJ4*Aht&$qf;Bo+Ln#K9Em#d~JVD}Z-og<`2%Wbl?7sf!t;b;w$G}!%LfVN^s z0_wu>62ok{jvGiX*nN71*p&Yw$ifdS>~^8$Qc?P&r+^H=b$P!K(p3862LK%B&oQ(z z76Te(5Y-|lr7#BS#a$7BhExa(Xuq;~3>F4yIw={VWv(yNq`-}V-wqeSw~(RKlF_}f z*la{3qW5jVDORkcqQv7Prj9@4FJAe(jo%y#!shqjY&%7B#0$Bh)+SgmT8x=yOcOZq zl-%({e;CyvD6O>>CyOdZoR25=qs&eR&sb5%>3|fiWQ3}0bPyTSdt8XIg}LvZJwz$H zuC~~AAAA&J{-diLkZOgS8@{l{{<{DtB=^$K!(Lo&(bw3O!pPmLsedYky(A0UVbRc1Mz=bJd>lFyg^GWxPQYTm4CbSDS0#Eu z8412jAMoUE<6B5JWXnS)UIeE2@5~^@a$jZwvqGH=0QiA}6Z=NvdJZjiLR6`QCyY$I zv|k3u_i3S`|yf$1Fk@5iuMsT&Rz@PAJ zu6;A@N>>@;zsY;@`ls#%c=TG0Rf7W?!-fwmEUHAkvV$$M42+zx8`8iO(CqlQ_X;ADIMSuNn=4Hyxm;6VmyFfs;VjE=;2mFT689O%(4oQ*MfD{`bv>4S%j#CIb96qq0^gym&cA1 zetk#_H;_+I!{T90&_AkD`4Hf<<{Uza0m%mx-0k?>@PvARfM#v_L8kejqtcud6(Jrz zE=6rgt_z{WX1D7iMu=w}d_>{ND1~bBe9w05rKA#DJH@pfof$_fPo?WHfRGcR4UjDO zHKyuc#zT^GqrKj6bZKK262=k z(8=32xKb^^?Fyy`h@NM(inIGQToi9e&M)^Ve%b z&2+J5=112MZMmk|ka=n0;Cqg{{ryH|0pM7u2p^ENXpEyRqdZ7r{tG5wA|rfYiK)>u z8K^846JRI6XjW*x4*0>R>XFQrdP3RByT`qszJ#zYb+Eo*l2BlMB^b^CBAJ z!^NJ5f41K(sqp6)`0Tp|ag2zT=*(K<@JIr!&}R{(D*eS4$Hm7{uMR)`i&!7Qy(YK< zGA{mN(DmsH@@eZ@zA?wGRoG+qX-)I&o$&qcgEodt2wqnbzW6xSmHW7&8+%(S$reZC z2nLAnm4MYV1|yd`jfS7q9am%(6NMg`R+*$g_qyx7y?2Q>Xn9_U_`om(Z@HeZr1F34 zyo?q9Yv61$8rfj_d?F`C@AS)p$q$$%1O5aiUr)>6qz8d}NgXiXDM2-dm zde!Z;@pE;dX^mb0DAxgyZ}_pqR+GX>MFXx|$JT}jQqK)31?*yEQxc6WVQ>(+mr0pIy#^f>9 zo(gRha1*F*Klr=pt{o-|_|%NNoZhx@NwqNV*x~8=wP(!%wpU~9X$E?=j)+qS9>b&N z5NpD%8ftvFkea=KEvU*t&#sUIyJueu#6GP~P?d)*T!q3X<`Bz7QAd|E*N@RPUq;tO z4w7ol8tD%eL9oG(t5dMR5RM~g%(2jq#nTXV67-VZMr`2JOEPa{|4k#0nlMWzJ*j?~ zS~-X#`nx-$DJjnWgxfQHZXaVSyouaTuL13;xG5?R*A!bHxAAU^UBgwi|N_L zu1X;FIItFwLjExPLwYiw{X|N~3ooSH1K?wcaz*rFDkVM4P+|udO}#xtmc9AZQ-{zN z{X@gPKb&ars5@)?$D2~4ni|lJ3`v}byR!7=M&yOK@K5|O8hqV++t9sHT-~xtcuBAKo9-sN9wD?wQQ}{&D(>I2i;go6V#VM*P};V%xJ-X<(~UVIteF!lt5(NbyoRf z`m1!z-gSQ%X^s16V;`9%i!|-`azoMURkc==o}BDHta5AUF|51U_)?=x&RNmHy*~+4 zO4t0qcgH=ni=Fq**j|8;`a-oZf;g0AcwU}^v4bAzb82z|>5)>Cn76pG7cZH+&Jw3n zM{ij+D>B$5=?I^&DH~Df-21VC7QE7T+Z=8kMr9dsREW(_a`jnxHCXiH3!zOVa6 zVms6|RPt#!va?GeBIUQi_NQd7?caWJN{?$*o1Dsl@T;|vk(H-|1Nzv~K&h>U(rnt2 zI4L9o{a%~nOs=uPHg|jt*jKAv>b>q*%pBUa*~Ex9YR6=z`kVKqLZ|At0Tu8lOIY22 zJp0%yHxV^Sk~KL88)u6|e9t3&PzRu`Nn(fhoG%ZvJc^Jf6trY2zFBm=;+LnpovkL+ z=>b=9*2S6fa%--4?{L#P0euX?5{Q@_x0f;^k=&V9zlL6>Zv&-V#g;w}l&q=2h!f3R z#qT(Cx>9}Y=bNA+p1=58&2(uiM^#=q)xZNEIW#zLTx#FXpu(-je=JHAk~4H@UnXi= zxdVs|lv~7v1xWhfTkGgSh}N+->@7Jxobp{YnJBluB{?bfnYek`!lV3;b|hC#GA^jm zs@m#Cyyw_?K1TF(knIqV)}wrk!- z_$@OrDmTGB_CesntLxh0LQ?>`L;C2-83lB{S&8wzPJqAll$EJhC3>#uT|k7=!-EPh k{|Dau2L&W1N;pMgv1R*g<1rR^Qc_6$ioEFf8i7vz7m_=gt^fc4 literal 0 HcmV?d00001 diff --git a/_preview/4/_static/favicon.ico b/_preview/4/_static/favicon.ico new file mode 100644 index 0000000000000000000000000000000000000000..da6ac735a43fa7aa7844553824262ea48aeeb4c5 GIT binary patch literal 15086 zcmeI3_it2562~96C*5ziX#WCBd$-z?R$y|@N#vXnIU_*iumlrC&N)YsbIv)63?@gD z5m}_=2v^siI@jnijIqZa8(X&{m3!vB*RQ@+U0u~x-S)gp-Va`MwCCC=Z|OfhFSqA; zQBm=~Gke}mcP+DPx!?M)o;Soj@T+^qb@3WI;<|qR@xLaazd3T`_|?%EM>iaOawO@5 zK06$@98GZaTQGiiEt8|_jxIV%FPIa;an)h0vMVY=9K{h27K|HJx^=>X=~Q3DJFMva9bbn!*|rE zQL<;x9yxaGn6~4_jg$QO^9S(PsZ&Sx@82(vA3v7YuV2fXH*e(GvuASp^l8NpmOOd# z$l}F|<->;$@~zL+t5=2hMFKx^Fs|qyop0E%K}L)iq4IE@`^cC(cW#+9X_9p9+Es=Q z9V!ziPLy`-+R5CxbERm}qWTQa6(~?Z1`Zr3n>KAyU0l3)Q7&D&BxlZ?kzKoX$-H^< zq*}FV5yNiy8QtIx`zcX$wwl(vN?}j2QtQ;KG(poH(Jn z-@A9OT)uo+diLxo!T7O7Y!IB)t5=tsH*cyb_3PJ9=gr5DAEi~RR)Ke?6uap^G5n_g zAw!0U;qTF-hvM_=-|%0%c1`E#?c28%e@sk_+8_8^wrrVh@#o8zPmUiyF5s_GqlOs% zzJ2@ZoQahFnfnm7krewu|EEr!`oexf>EH0=2Tygk65#2jbI0>SFcv=$OSE5zFbO_DDj0~ z$A5;xU%q_#fGwgM?ElJ@E9!r4-MSU~JK76Qgr$K`Tdf(zZ_^~nU z4gIr@F#nIAVJ?|3F#AFOsg2(+2l&uEG3x2lr?ONT;Oli@gg{)h* zPGxD-sF5sKut4J}Hi?{m{MdhL>fi9w!kh76Ey_CR!Gi}%*evUSS+i!z{rmTIzTl_k z&!4YrHSlfOvL!IrgYldHVg8!^w{G1!F!p{7k@$`r=o{aSO}&5rUe2C9EBJ4G6my%k z59=iCX!!8qYCrTd{WFF(fBpFJKc7B*lGMa+I$$jDCH?#NmwWf_$=kPYRo@jWR#acg zIAL=<=btC&A3sI>3gth+-=x(Hu2IQdUcGvyYe{^pUk31-{}0B`I9mK-{g#&a(GS>Y z$zSf=xubeyjbElrnJ;XC->f|j95|r<)9fGor57VCfVQLay&I#u%-Vhnlm`t|G8kKyBN?C`zz-FT&DiwqSiR8aqe z4A?tZ@v~dEZdISfIsx6IZ{l@qY^>(ZJWo#3sZ*x_W@1XDbIQczM+V~V&Ye4fq-!4X zm|VGXN!zw;t1fHR zs-<~Wmo8ldLZ*84>ghdV3-=*x4tZ9sTBY$lE%7r(=nvbuaN&Z=Kwag+Y@1rwnFvO?ieu&%t zb$g^Se(QbUC&u;e-CKPp{?UkfSSaE?es=We(MrvmH&3&e97-085BQek5Ox^qy?+p-=rG3etA3ZOQ_HUlI zm-YwGi=q8WLN5OK2}c7lJnZzim)7Yuj@Ief^v*f0C`Uyd1sB%yy)S|ci?RpZaLm* zsdwXRE$8p-`xh-at&!!1w06zfZ{4$J65XCS{tA~K#sz7>V)iD7}-5) zIppKi6oQHC+z-Vo)HV2!k8#F=y?g5R)bYtJsO_`YMJ<`y47CGlOw`4eEnB8FwnvX1 z>7E8HH8=Lr!>yZ9Pa*eWKZ>&kwpUZQaA7?wLe9xvIrS6dBZr|*v3BiR?L+MdJnVB( zuV5TP$(qnL^v_ubWL>dhh1MG2L7vS!xkeq4x*E0VELpM$c_4dW>@Sg%b8dhdJo*VY z$Fg%5!TgICFRn7KT)9#sqHa_>|0?& z>{Wrw&)={AN|h?<_@jU1NAD&-^{J%tXWn7=)Z*ZK@ZdqULF#VkgZrGh!T$XG@d4Oh zO8GMv;DMa%v9RC39v6GWj3M_J2mAtiVVqe)N6b5XLnQdyd^8-)cgB-iG3R?Y55is+ zxTqPkztXK+H;ENtv~MwmMz@h@WbZ!xN~>x3E(e?mH1xlf!Z7~i2e-XRH_e1EO``klr_)}A7zatWQ00aJj`M`NF>XM8-a}uA$xk~JX zb9wkA_JWzq_+=ZjV7bEm4F=X5tOb(#;fw(N!sV6F^T>kkIUB)xgYkfvCy@Q7Wj_Wz zMUubaA~vzFk{B_MBQgHQ*IM3*T!~Q#-rsxueaU3_4lVx=)XmYqzXNY_zTX}F-O&_B zX_*5u=H$GZk-HWQ=z&}?HP8O@?yHV^I#S+ou4)kDN(7Kg$J68!6VETs@up4zkSIri zI)(dRv*3@zThZRvx$BrGV=V*fcB>l+^S^p7F@Oi`Vf=}GgkP01IvVeu0Ys{E2 zx`rU{wY3#ItzU2p7RG>BPmCugW(|h?>@AlnRVvZFRd65=dSDI3x`qEwV130o6W(L% z%wYcZn|CmNtc^K)0)dGs`hMrGg#P~ix$^RISR_I47Y|r1 z_CyJOe}D1){SET-^Amu_i71Lt6eYfZjRyw@I6OQAIXXHDfiX^GbOlHe=Ae4>0m)d(f|Me07*qoM6N<$f}vM^LjV8( literal 0 HcmV?d00001 diff --git a/_preview/4/_static/images/logo_binder.svg b/_preview/4/_static/images/logo_binder.svg new file mode 100644 index 0000000..45fecf7 --- /dev/null +++ b/_preview/4/_static/images/logo_binder.svg @@ -0,0 +1,19 @@ + + + + +logo + + + + + + + + diff --git a/_preview/4/_static/images/logo_colab.png b/_preview/4/_static/images/logo_colab.png new file mode 100644 index 0000000000000000000000000000000000000000..b7560ec216b2d1b6f77855525fe966c741833428 GIT binary patch literal 7601 zcmeI1^;ZuSFsz@@e&Hu|o~yU_Jn_7Cy4b4(M?f2S`owL6D#ysoM3Rsb4MX|l6hl52QIsX*kmQMmFZ6Xu|Wk1r15+E^+Er?@^MFpIE zq!=C|$Nn*F4aR@N|DPxS6E^f|7Z=H%T>vS)_|-RkkprWw zSGb9TlwheKfo{U5J)kX1$cHtEFe}Pa2Au|?^hCk%8gdI}l*ypIUsLXLMy9W|q-ZAw zJpZkmGRa|!=7CyrA#Bs2?5UdZ1^pDaji}+DimdE$JB@FrJvAIxy*3v#1-8OwO;OS$ zsv*P<%V4%?*Keca@o9}LMOs~ph)z!AU;${{23k&Gq7A@nDP{*I1HiTZ=Q*54?Bok) zp6L_4HhiE->YU6{m*{7O7j#SkBb9JPo!k8TD0H6{ zdSE-mmA!Js{}(?qh${0wB7Rx{*F=43D>?j3kU8MX&`sQJ+wHUD6eEr7j%*2x%5|a8 z*;AP<*tCQwj`Af5vvGHXF=9{cdzV2BMI@}VHgmol)^f>Ectcls5p3dW?40~ADd>ki za*q>v=nQQmGI5&BS!GU|iX9>qB9r=_Qm9t_Qwi+zWI zc%%oQ`P}{ZXk^}?+H!u2my^C#TD%=V|3pb$MXhJ07bx-^=oxj?ZSk!---?f2cs8_& z8?O{lvxMDZi7gsdvoZ2bmyLYs1!O1RMC)1Wv`9p-I(1pfww9siX;Lu>^>_Y=g+OHo zPm(N|h?h5Z>yze~wKtPBRv(mZx*A4R%bganw#OV=SE*=J^b#~(YfIcj(k=(i37PY7 zUiawSj8SKczPk-^=SwOOb%X+bRcFm+=N1r{{CA<=kbVq8cFGcLSGqM5FUxChbc&`o9$mUo4kZLh+%KP6m zDMd3SH~N5fH8J+8;bpxhi-9i}^PV(^u?zb49_c!Ow_!1w%w(RLEeXJoMU>Nnlc8sd z<;K$L<-WwC`NJ0PWzB59Pzbg|FZS-=xlaWDjM-PXIJ;r4qyFnFc_<-VDg5P=Zk0Pd z%f7GFg?FzC??rmjG^Ib<{cfE+dud-%)Ep=a8Q(Z-Fng}&CvD+JPdO)mL-$u4eH#LJ z7heze_GA*{rYAL;ejb#P;oTD_*Rgrw;)1(e;+zGN{)D)k?o$t&BGWEM!Hn}LQm1jd zf@B0+pEzI&qREI@Qr=#K;u~Fs)Saf>_1X|EQGz0D_a|>)d?IOck($^4a`v4Hc6sKV zgm7-VK|sz+(A$-L0BnhZ#qKk${svcv4#QmCcMCb>t9=e+^b49rrK@5C@-Qs{PN6H8Tb^nIy#)VA`)o~+c~m2m9bN}EcwI`-IP+fB&d^;19iX9{XvM6VYHE(fX{BIU zjMLmkl7p}TslG;@C!HvX=7hVy6cGIM{h7hxrM^q{j`Y4Ux1nI*k9MB?ToSK!Qpvy< zT~`Qofe|OBk8vza_r02Y;~+V6WKn(J{_?BR9@-`D&Q;nTEx7+j36Qk0(l3TahUki} z;O-FUuOnNVcc-Q3c?;A)ZpgKC-Sa8`{c}MNm$j))KPPdL#xR*0kxQz|V-;WZxI+?u zFB#~P=os0);b?+6$-z@yE%k*^!0x)K_!|4!L%ADpXqe`pG|8A+rht_!jZid=wb1j& zjPG_SeS*{ef!h*}~k!*;Aar3`tCeHO@>c{c>ak(x3f^w3+_zT>j)aP_hVoV4~^0L<5^eu_y z-@tf0YyH-(#5uTh`s3DIhpc^`UysO{L8JS|z=qnHFb)UqfMnC!Hu$=eiC+a;9t*X6R?Q8POFRq?_ak1&yP&YF6`@B=qySm8MJ)n*E zdS-&E$a$DMp!}+S%^(Q))m7O$Qece1ZtB+=H{**c0@XT53VGNeFhvnDVocubi6~ru z2X&(|kp)joFLfuG?i;d=&CZBQhez8i+lhV+c;_pEL6+Teo z1qclCF-EO~XWkH3u|unGI79@`+YLi}rF>PbBrn{PBKWF&S%K6N0u^DRx7qImnJ`+c z>Nu)TJyhpyJX_!XHh^82M+YgW&cxs(vQKEpL%}iK(hH=<@)j#E3_?a*JP@0=R z;O*(_2@>IjYLClnL+$PJ-5!vt6>UJ7$KHM3LlFFMxb19oFZ_fi@{fp};$@_n8driG z`=77&{Z^0#T>t%$hCqQi8M}0E4XipxikcsB$>o9M)rBJWQDY7UrgKAy|BP4kr`Nay z??T|Ajh_U=3lem-tL$_tEhB=Rqfi?bUj`u>$a-x5WxqHn6t4)Q-NQ^Bt-k!mcE0ES z4)*3-(5@V)=EloLT~ReorH252&Q&MWWc$oiSS{!xpO?VPpJFD-QN6c=<7HxnH1nH% zeiOM22U=%trq`HCXYNL#H!P!M1{?)QcIGYWO$;mCMHnpgd?*ZE&bmylPxndZ$B}ct zIfSCaCu!a^rBwLoo4gQJnU<%~!6cPP-qxJLZM#F&_gwU%?O$k?DIF6l%q_lvcs3})|Z?z(K3q9(BASQtZlw@+<5mv zrHuRbc}A4I9hLtxbS!@ju49VVt1XxpO?1&$LA;?ZANYo=SC^nMg{9BY`=cZcTaR{A@r{UB@;%H zPb6QWRuvU)J>>*0FB;9Uq|hH4C$u8T=T?sz{5%Ex)I%5W6wQmtel=rJ)Tbw#E7{Z;t3U zY9a$t=WkneF<9867^HBvLp>hs;A@H}9KEwn2t!?ITQ1vZ?fCFF(RfFYplQUymF`y4 z74MX)v7%4i_52G~fn=&qCfo}f%Gj8bd7dI^BDI?AlVN_!qWMJT#NBLs^p)e{tG?D4 z)|x9tIcLpO$-JtVj=#$1Y&GRE*-xUKd_{uxiZkqAudNRF!dph|+p41KtIf(8)c1p~ zv)f(_RGUK*j_{s!DNDET-@ekFNlnTXW_=+4t5>Qbq`aWl%F6e}e)<=0U{Lp}8twQ? z8cJ&^2hntuxcqQ~k;<29cTQz)@X@zbQN?f1q??MK&`gi2me&l@XLSxN|!? z;kRJcy-ahz{?{Aj;b0E9*MKf|Q@H!%2FhB8=t$dhTtR4^%hSctIRz;tXJPme_gd zLiJlhH^x9|I?_vaIKkgiAyrk&%Mv26OqK|av#t%u9aU2`wvZ61wo4$DW%z~d9P`5& zx2Zk{zL$Z1@bGicZ})KZzJKhZaZ+P!-p1uH9dgwUQ5u(q{HyTaprSe95WuIadBYv0 zPUJ~G+G2~n0DfE{7!{N*#1+?ql4nK8`Fr?o@j~3c(>T^^trK4t~7#7WQoVk)7KnFY{iPIQ?Qh8 z+Wy6Ol|m6pA8r4lQdt@$=Z{k}^_evzh~Vt_J$aBM!djok7rTfxt8f+KVv7GM1Awc>b%$6NDX zcl~`@-PYtGJSGIO(C^sr&BxXHz*cUJnB~X1`0$kX)@xH+qFRp1^Vpt^u3V$(w;_vf zHIi3Mb+A5@Nx^>r8g^tF%=j0o$Rhli22c4xiy2SEGE=Dk)m)mzF}VhHtiP43?%dTPKbDg+Gmq$pq6DlCZzY5@`})4DTSfgVh3B z6B#;izoI9B%{^V1qYVp<-KgZ=_(;UqyU^wT{IFPQ?YY4%;yq4cbgN`_dqp${t%ytU z!T>q+J?*26u4Ak4Jx#9uHgScR2!%5YX9%5Bu@HL^VaJ7%jj#ceYuaRZk7vMWX)jq| z-rX)3v33MqZ$qaWp!X$i1yJ*rOfjP-u6noa{n9pxzJw0P2+@UNLHS(-e>##A#9xc` zAr=;dh7~9d71L_&bj`DI@l$2 zSX@4j7tZbUYdo?rgctpAg3>Z@gv1{~grCRQUGVyTbzIJ-YZt2xF(cT)W0~l-76Lw* z<6YF%D4R$X>ZEj#!c)zMi018e@?^1%&N`zutD(OQ;X8am+pNW(YhRwy*%wrsnwb#T z>n{K;55wQE!cVF)X+X12fX<x`lE~DquFsMPRoBuzhuVdR8Gv zevya06i9>q3oJZyDGUHOP=iTbBg`AO7~BI0N8$lqEvK_=V)(Du!8=i|%_2^xqnCgh zYEho!c`8!%;N8>VD_@8NZxuyDHBlxl_=CBT5z4cft(NLsv9Wo81)VnjTne@sFAuLA zv^?3h>Rc?eDzkn@SvwCF^spU#ZJuQz6o4V90>Al2JL^>6N4y0wyg#4m?khQ$4$xa5 zlJZV5E$o~arUalDb_b7lXJs*(UA*P>jQ%3i`I8pyKN?*kY>iRE7J9GGiz^nA>aIV> zaJ}>Ecj_*#d8xFcjhy+6oRGfCr^qR6C2fGkhPUT-of7St?XBEaY>?_o$Y;IiV*<6d zlA;M(1^;P>tJxjiTQAB{T$TKPJ?7HfGON=ms6=%yai0?j-qHB-nhvKj_0=^YawDhO z&$wC;93X#RhmcNJTfn66z&E;UAFGeV6TsD61;r(%GZvUrDg2W3Y2hPsTqkinoI4PV zXDedcq+P^|`+Zqpt5*;9cKbAf6!xI4X{#P5OMaE4?*}B?BIY^Gyv0%UUq}lKO~C#Z zCRamrC=OeXKTKm|4p>}U!kLbE%NxPGuZ1-DR(wWFK@>24ca*qhEt5B*r|(Kty!Pj0 zZauh;NqoiV&&q9pT#S7@dl4JUVA|RmaH8kslFhypJ_)20*ebs^yXIQA(6mi|Wph<8 z=`?$6$QX%TaWE9DLjOgi>rciE+f(9`A4gn4&jZA)v29ug%2=CtvV-U|71pd@edT~> zTA~BLBxs`RYEh%@DuEBdVt=S~6x5VXGkg4=c(|;e@Uk2Mxd}~#h^+`jF}r@=C0+HS zJcg`@*AUj2Ymhzqb=;b}w_oSQ>VH<@k=B`!P>>u5;cpo7O#PB&IQ>AS{06fz5fsXyOt1R0^~JUdht$M7yYTxq$&$T&teFpg;y{BUxXR(00s6bHa2EU zQz~u3(zn7I;Ei{D%kc60jYvUAK^2vZcMr$(Mvo58z}?>{fBdZv&KdKaM(W*WeijQ+ z;}+j>_K=@gAG4KLl-oHs1uHl{4Iq_bV|(|n23Ml=$x+vE+w;rZ1-;Cgwa-{hvjGND zf$}y#wu81ZOPZ@Wj}WbIj4k%PEPTy)sLP0Kk0C=n2lpOrPl~et;FC1`zjD=4!5coL zUgdZMo&inr`+cr#<^beEmG){%LjzXvEJ;=`hMnEYG|VU#W^gR^?uh;u@MsY$78=09EY#xn`@9X5)nb~&t)6wi zB(Y#$oL!o_oI|#`LeD5m>ezV6;nKHq@ZYvUufb~M33Qw%6`GhEa}S@P!}T;dH@bLx zG_yiKDTq6zQz}25>oeWOXpL<9!kJrP)LQASx)Dh$MiaKmk}q7TZJjtiA`M6zv_)Sn zoW-S@(c2ebP+DQqvD-S;#gt=zlveyhax!aybe(eZtlKEO1+bZSMlogo_jupyterhubHub diff --git a/_preview/4/_static/jquery-3.5.1.js b/_preview/4/_static/jquery-3.5.1.js new file mode 100644 index 0000000..5093733 --- /dev/null +++ b/_preview/4/_static/jquery-3.5.1.js @@ -0,0 +1,10872 @@ +/*! + * jQuery JavaScript Library v3.5.1 + * https://jquery.com/ + * + * Includes Sizzle.js + * https://sizzlejs.com/ + * + * Copyright JS Foundation and other contributors + * Released under the MIT license + * https://jquery.org/license + * + * Date: 2020-05-04T22:49Z + */ +( function( global, factory ) { + + "use strict"; + + if ( typeof module === "object" && typeof module.exports === "object" ) { + + // For CommonJS and CommonJS-like environments where a proper `window` + // is present, execute the factory and get jQuery. + // For environments that do not have a `window` with a `document` + // (such as Node.js), expose a factory as module.exports. + // This accentuates the need for the creation of a real `window`. + // e.g. var jQuery = require("jquery")(window); + // See ticket #14549 for more info. + module.exports = global.document ? + factory( global, true ) : + function( w ) { + if ( !w.document ) { + throw new Error( "jQuery requires a window with a document" ); + } + return factory( w ); + }; + } else { + factory( global ); + } + +// Pass this if window is not defined yet +} )( typeof window !== "undefined" ? window : this, function( window, noGlobal ) { + +// Edge <= 12 - 13+, Firefox <=18 - 45+, IE 10 - 11, Safari 5.1 - 9+, iOS 6 - 9.1 +// throw exceptions when non-strict code (e.g., ASP.NET 4.5) accesses strict mode +// arguments.callee.caller (trac-13335). But as of jQuery 3.0 (2016), strict mode should be common +// enough that all such attempts are guarded in a try block. +"use strict"; + +var arr = []; + +var getProto = Object.getPrototypeOf; + +var slice = arr.slice; + +var flat = arr.flat ? function( array ) { + return arr.flat.call( array ); +} : function( array ) { + return arr.concat.apply( [], array ); +}; + + +var push = arr.push; + +var indexOf = arr.indexOf; + +var class2type = {}; + +var toString = class2type.toString; + +var hasOwn = class2type.hasOwnProperty; + +var fnToString = hasOwn.toString; + +var ObjectFunctionString = fnToString.call( Object ); + +var support = {}; + +var isFunction = function isFunction( obj ) { + + // Support: Chrome <=57, Firefox <=52 + // In some browsers, typeof returns "function" for HTML elements + // (i.e., `typeof document.createElement( "object" ) === "function"`). + // We don't want to classify *any* DOM node as a function. + return typeof obj === "function" && typeof obj.nodeType !== "number"; + }; + + +var isWindow = function isWindow( obj ) { + return obj != null && obj === obj.window; + }; + + +var document = window.document; + + + + var preservedScriptAttributes = { + type: true, + src: true, + nonce: true, + noModule: true + }; + + function DOMEval( code, node, doc ) { + doc = doc || document; + + var i, val, + script = doc.createElement( "script" ); + + script.text = code; + if ( node ) { + for ( i in preservedScriptAttributes ) { + + // Support: Firefox 64+, Edge 18+ + // Some browsers don't support the "nonce" property on scripts. + // On the other hand, just using `getAttribute` is not enough as + // the `nonce` attribute is reset to an empty string whenever it + // becomes browsing-context connected. + // See https://github.com/whatwg/html/issues/2369 + // See https://html.spec.whatwg.org/#nonce-attributes + // The `node.getAttribute` check was added for the sake of + // `jQuery.globalEval` so that it can fake a nonce-containing node + // via an object. + val = node[ i ] || node.getAttribute && node.getAttribute( i ); + if ( val ) { + script.setAttribute( i, val ); + } + } + } + doc.head.appendChild( script ).parentNode.removeChild( script ); + } + + +function toType( obj ) { + if ( obj == null ) { + return obj + ""; + } + + // Support: Android <=2.3 only (functionish RegExp) + return typeof obj === "object" || typeof obj === "function" ? + class2type[ toString.call( obj ) ] || "object" : + typeof obj; +} +/* global Symbol */ +// Defining this global in .eslintrc.json would create a danger of using the global +// unguarded in another place, it seems safer to define global only for this module + + + +var + version = "3.5.1", + + // Define a local copy of jQuery + jQuery = function( selector, context ) { + + // The jQuery object is actually just the init constructor 'enhanced' + // Need init if jQuery is called (just allow error to be thrown if not included) + return new jQuery.fn.init( selector, context ); + }; + +jQuery.fn = jQuery.prototype = { + + // The current version of jQuery being used + jquery: version, + + constructor: jQuery, + + // The default length of a jQuery object is 0 + length: 0, + + toArray: function() { + return slice.call( this ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + + // Return all the elements in a clean array + if ( num == null ) { + return slice.call( this ); + } + + // Return just the one element from the set + return num < 0 ? this[ num + this.length ] : this[ num ]; + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems ) { + + // Build a new jQuery matched element set + var ret = jQuery.merge( this.constructor(), elems ); + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + each: function( callback ) { + return jQuery.each( this, callback ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map( this, function( elem, i ) { + return callback.call( elem, i, elem ); + } ) ); + }, + + slice: function() { + return this.pushStack( slice.apply( this, arguments ) ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + even: function() { + return this.pushStack( jQuery.grep( this, function( _elem, i ) { + return ( i + 1 ) % 2; + } ) ); + }, + + odd: function() { + return this.pushStack( jQuery.grep( this, function( _elem, i ) { + return i % 2; + } ) ); + }, + + eq: function( i ) { + var len = this.length, + j = +i + ( i < 0 ? len : 0 ); + return this.pushStack( j >= 0 && j < len ? [ this[ j ] ] : [] ); + }, + + end: function() { + return this.prevObject || this.constructor(); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: push, + sort: arr.sort, + splice: arr.splice +}; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[ 0 ] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + + // Skip the boolean and the target + target = arguments[ i ] || {}; + i++; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !isFunction( target ) ) { + target = {}; + } + + // Extend jQuery itself if only one argument is passed + if ( i === length ) { + target = this; + i--; + } + + for ( ; i < length; i++ ) { + + // Only deal with non-null/undefined values + if ( ( options = arguments[ i ] ) != null ) { + + // Extend the base object + for ( name in options ) { + copy = options[ name ]; + + // Prevent Object.prototype pollution + // Prevent never-ending loop + if ( name === "__proto__" || target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject( copy ) || + ( copyIsArray = Array.isArray( copy ) ) ) ) { + src = target[ name ]; + + // Ensure proper type for the source value + if ( copyIsArray && !Array.isArray( src ) ) { + clone = []; + } else if ( !copyIsArray && !jQuery.isPlainObject( src ) ) { + clone = {}; + } else { + clone = src; + } + copyIsArray = false; + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend( { + + // Unique for each copy of jQuery on the page + expando: "jQuery" + ( version + Math.random() ).replace( /\D/g, "" ), + + // Assume jQuery is ready without the ready module + isReady: true, + + error: function( msg ) { + throw new Error( msg ); + }, + + noop: function() {}, + + isPlainObject: function( obj ) { + var proto, Ctor; + + // Detect obvious negatives + // Use toString instead of jQuery.type to catch host objects + if ( !obj || toString.call( obj ) !== "[object Object]" ) { + return false; + } + + proto = getProto( obj ); + + // Objects with no prototype (e.g., `Object.create( null )`) are plain + if ( !proto ) { + return true; + } + + // Objects with prototype are plain iff they were constructed by a global Object function + Ctor = hasOwn.call( proto, "constructor" ) && proto.constructor; + return typeof Ctor === "function" && fnToString.call( Ctor ) === ObjectFunctionString; + }, + + isEmptyObject: function( obj ) { + var name; + + for ( name in obj ) { + return false; + } + return true; + }, + + // Evaluates a script in a provided context; falls back to the global one + // if not specified. + globalEval: function( code, options, doc ) { + DOMEval( code, { nonce: options && options.nonce }, doc ); + }, + + each: function( obj, callback ) { + var length, i = 0; + + if ( isArrayLike( obj ) ) { + length = obj.length; + for ( ; i < length; i++ ) { + if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) { + break; + } + } + } else { + for ( i in obj ) { + if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) { + break; + } + } + } + + return obj; + }, + + // results is for internal usage only + makeArray: function( arr, results ) { + var ret = results || []; + + if ( arr != null ) { + if ( isArrayLike( Object( arr ) ) ) { + jQuery.merge( ret, + typeof arr === "string" ? + [ arr ] : arr + ); + } else { + push.call( ret, arr ); + } + } + + return ret; + }, + + inArray: function( elem, arr, i ) { + return arr == null ? -1 : indexOf.call( arr, elem, i ); + }, + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + merge: function( first, second ) { + var len = +second.length, + j = 0, + i = first.length; + + for ( ; j < len; j++ ) { + first[ i++ ] = second[ j ]; + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, invert ) { + var callbackInverse, + matches = [], + i = 0, + length = elems.length, + callbackExpect = !invert; + + // Go through the array, only saving the items + // that pass the validator function + for ( ; i < length; i++ ) { + callbackInverse = !callback( elems[ i ], i ); + if ( callbackInverse !== callbackExpect ) { + matches.push( elems[ i ] ); + } + } + + return matches; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var length, value, + i = 0, + ret = []; + + // Go through the array, translating each of the items to their new values + if ( isArrayLike( elems ) ) { + length = elems.length; + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret.push( value ); + } + } + + // Go through every key on the object, + } else { + for ( i in elems ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret.push( value ); + } + } + } + + // Flatten any nested arrays + return flat( ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // jQuery.support is not used in Core but other projects attach their + // properties to it so it needs to exist. + support: support +} ); + +if ( typeof Symbol === "function" ) { + jQuery.fn[ Symbol.iterator ] = arr[ Symbol.iterator ]; +} + +// Populate the class2type map +jQuery.each( "Boolean Number String Function Array Date RegExp Object Error Symbol".split( " " ), +function( _i, name ) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); +} ); + +function isArrayLike( obj ) { + + // Support: real iOS 8.2 only (not reproducible in simulator) + // `in` check used to prevent JIT error (gh-2145) + // hasOwn isn't used here due to false negatives + // regarding Nodelist length in IE + var length = !!obj && "length" in obj && obj.length, + type = toType( obj ); + + if ( isFunction( obj ) || isWindow( obj ) ) { + return false; + } + + return type === "array" || length === 0 || + typeof length === "number" && length > 0 && ( length - 1 ) in obj; +} +var Sizzle = +/*! + * Sizzle CSS Selector Engine v2.3.5 + * https://sizzlejs.com/ + * + * Copyright JS Foundation and other contributors + * Released under the MIT license + * https://js.foundation/ + * + * Date: 2020-03-14 + */ +( function( window ) { +var i, + support, + Expr, + getText, + isXML, + tokenize, + compile, + select, + outermostContext, + sortInput, + hasDuplicate, + + // Local document vars + setDocument, + document, + docElem, + documentIsHTML, + rbuggyQSA, + rbuggyMatches, + matches, + contains, + + // Instance-specific data + expando = "sizzle" + 1 * new Date(), + preferredDoc = window.document, + dirruns = 0, + done = 0, + classCache = createCache(), + tokenCache = createCache(), + compilerCache = createCache(), + nonnativeSelectorCache = createCache(), + sortOrder = function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + } + return 0; + }, + + // Instance methods + hasOwn = ( {} ).hasOwnProperty, + arr = [], + pop = arr.pop, + pushNative = arr.push, + push = arr.push, + slice = arr.slice, + + // Use a stripped-down indexOf as it's faster than native + // https://jsperf.com/thor-indexof-vs-for/5 + indexOf = function( list, elem ) { + var i = 0, + len = list.length; + for ( ; i < len; i++ ) { + if ( list[ i ] === elem ) { + return i; + } + } + return -1; + }, + + booleans = "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|" + + "ismap|loop|multiple|open|readonly|required|scoped", + + // Regular expressions + + // http://www.w3.org/TR/css3-selectors/#whitespace + whitespace = "[\\x20\\t\\r\\n\\f]", + + // https://www.w3.org/TR/css-syntax-3/#ident-token-diagram + identifier = "(?:\\\\[\\da-fA-F]{1,6}" + whitespace + + "?|\\\\[^\\r\\n\\f]|[\\w-]|[^\0-\\x7f])+", + + // Attribute selectors: http://www.w3.org/TR/selectors/#attribute-selectors + attributes = "\\[" + whitespace + "*(" + identifier + ")(?:" + whitespace + + + // Operator (capture 2) + "*([*^$|!~]?=)" + whitespace + + + // "Attribute values must be CSS identifiers [capture 5] + // or strings [capture 3 or capture 4]" + "*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|(" + identifier + "))|)" + + whitespace + "*\\]", + + pseudos = ":(" + identifier + ")(?:\\((" + + + // To reduce the number of selectors needing tokenize in the preFilter, prefer arguments: + // 1. quoted (capture 3; capture 4 or capture 5) + "('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|" + + + // 2. simple (capture 6) + "((?:\\\\.|[^\\\\()[\\]]|" + attributes + ")*)|" + + + // 3. anything else (capture 2) + ".*" + + ")\\)|)", + + // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter + rwhitespace = new RegExp( whitespace + "+", "g" ), + rtrim = new RegExp( "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + + whitespace + "+$", "g" ), + + rcomma = new RegExp( "^" + whitespace + "*," + whitespace + "*" ), + rcombinators = new RegExp( "^" + whitespace + "*([>+~]|" + whitespace + ")" + whitespace + + "*" ), + rdescend = new RegExp( whitespace + "|>" ), + + rpseudo = new RegExp( pseudos ), + ridentifier = new RegExp( "^" + identifier + "$" ), + + matchExpr = { + "ID": new RegExp( "^#(" + identifier + ")" ), + "CLASS": new RegExp( "^\\.(" + identifier + ")" ), + "TAG": new RegExp( "^(" + identifier + "|[*])" ), + "ATTR": new RegExp( "^" + attributes ), + "PSEUDO": new RegExp( "^" + pseudos ), + "CHILD": new RegExp( "^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + + whitespace + "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + + whitespace + "*(\\d+)|))" + whitespace + "*\\)|)", "i" ), + "bool": new RegExp( "^(?:" + booleans + ")$", "i" ), + + // For use in libraries implementing .is() + // We use this for POS matching in `select` + "needsContext": new RegExp( "^" + whitespace + + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" + whitespace + + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i" ) + }, + + rhtml = /HTML$/i, + rinputs = /^(?:input|select|textarea|button)$/i, + rheader = /^h\d$/i, + + rnative = /^[^{]+\{\s*\[native \w/, + + // Easily-parseable/retrievable ID or TAG or CLASS selectors + rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/, + + rsibling = /[+~]/, + + // CSS escapes + // http://www.w3.org/TR/CSS21/syndata.html#escaped-characters + runescape = new RegExp( "\\\\[\\da-fA-F]{1,6}" + whitespace + "?|\\\\([^\\r\\n\\f])", "g" ), + funescape = function( escape, nonHex ) { + var high = "0x" + escape.slice( 1 ) - 0x10000; + + return nonHex ? + + // Strip the backslash prefix from a non-hex escape sequence + nonHex : + + // Replace a hexadecimal escape sequence with the encoded Unicode code point + // Support: IE <=11+ + // For values outside the Basic Multilingual Plane (BMP), manually construct a + // surrogate pair + high < 0 ? + String.fromCharCode( high + 0x10000 ) : + String.fromCharCode( high >> 10 | 0xD800, high & 0x3FF | 0xDC00 ); + }, + + // CSS string/identifier serialization + // https://drafts.csswg.org/cssom/#common-serializing-idioms + rcssescape = /([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g, + fcssescape = function( ch, asCodePoint ) { + if ( asCodePoint ) { + + // U+0000 NULL becomes U+FFFD REPLACEMENT CHARACTER + if ( ch === "\0" ) { + return "\uFFFD"; + } + + // Control characters and (dependent upon position) numbers get escaped as code points + return ch.slice( 0, -1 ) + "\\" + + ch.charCodeAt( ch.length - 1 ).toString( 16 ) + " "; + } + + // Other potentially-special ASCII characters get backslash-escaped + return "\\" + ch; + }, + + // Used for iframes + // See setDocument() + // Removing the function wrapper causes a "Permission Denied" + // error in IE + unloadHandler = function() { + setDocument(); + }, + + inDisabledFieldset = addCombinator( + function( elem ) { + return elem.disabled === true && elem.nodeName.toLowerCase() === "fieldset"; + }, + { dir: "parentNode", next: "legend" } + ); + +// Optimize for push.apply( _, NodeList ) +try { + push.apply( + ( arr = slice.call( preferredDoc.childNodes ) ), + preferredDoc.childNodes + ); + + // Support: Android<4.0 + // Detect silently failing push.apply + // eslint-disable-next-line no-unused-expressions + arr[ preferredDoc.childNodes.length ].nodeType; +} catch ( e ) { + push = { apply: arr.length ? + + // Leverage slice if possible + function( target, els ) { + pushNative.apply( target, slice.call( els ) ); + } : + + // Support: IE<9 + // Otherwise append directly + function( target, els ) { + var j = target.length, + i = 0; + + // Can't trust NodeList.length + while ( ( target[ j++ ] = els[ i++ ] ) ) {} + target.length = j - 1; + } + }; +} + +function Sizzle( selector, context, results, seed ) { + var m, i, elem, nid, match, groups, newSelector, + newContext = context && context.ownerDocument, + + // nodeType defaults to 9, since context defaults to document + nodeType = context ? context.nodeType : 9; + + results = results || []; + + // Return early from calls with invalid selector or context + if ( typeof selector !== "string" || !selector || + nodeType !== 1 && nodeType !== 9 && nodeType !== 11 ) { + + return results; + } + + // Try to shortcut find operations (as opposed to filters) in HTML documents + if ( !seed ) { + setDocument( context ); + context = context || document; + + if ( documentIsHTML ) { + + // If the selector is sufficiently simple, try using a "get*By*" DOM method + // (excepting DocumentFragment context, where the methods don't exist) + if ( nodeType !== 11 && ( match = rquickExpr.exec( selector ) ) ) { + + // ID selector + if ( ( m = match[ 1 ] ) ) { + + // Document context + if ( nodeType === 9 ) { + if ( ( elem = context.getElementById( m ) ) ) { + + // Support: IE, Opera, Webkit + // TODO: identify versions + // getElementById can match elements by name instead of ID + if ( elem.id === m ) { + results.push( elem ); + return results; + } + } else { + return results; + } + + // Element context + } else { + + // Support: IE, Opera, Webkit + // TODO: identify versions + // getElementById can match elements by name instead of ID + if ( newContext && ( elem = newContext.getElementById( m ) ) && + contains( context, elem ) && + elem.id === m ) { + + results.push( elem ); + return results; + } + } + + // Type selector + } else if ( match[ 2 ] ) { + push.apply( results, context.getElementsByTagName( selector ) ); + return results; + + // Class selector + } else if ( ( m = match[ 3 ] ) && support.getElementsByClassName && + context.getElementsByClassName ) { + + push.apply( results, context.getElementsByClassName( m ) ); + return results; + } + } + + // Take advantage of querySelectorAll + if ( support.qsa && + !nonnativeSelectorCache[ selector + " " ] && + ( !rbuggyQSA || !rbuggyQSA.test( selector ) ) && + + // Support: IE 8 only + // Exclude object elements + ( nodeType !== 1 || context.nodeName.toLowerCase() !== "object" ) ) { + + newSelector = selector; + newContext = context; + + // qSA considers elements outside a scoping root when evaluating child or + // descendant combinators, which is not what we want. + // In such cases, we work around the behavior by prefixing every selector in the + // list with an ID selector referencing the scope context. + // The technique has to be used as well when a leading combinator is used + // as such selectors are not recognized by querySelectorAll. + // Thanks to Andrew Dupont for this technique. + if ( nodeType === 1 && + ( rdescend.test( selector ) || rcombinators.test( selector ) ) ) { + + // Expand context for sibling selectors + newContext = rsibling.test( selector ) && testContext( context.parentNode ) || + context; + + // We can use :scope instead of the ID hack if the browser + // supports it & if we're not changing the context. + if ( newContext !== context || !support.scope ) { + + // Capture the context ID, setting it first if necessary + if ( ( nid = context.getAttribute( "id" ) ) ) { + nid = nid.replace( rcssescape, fcssescape ); + } else { + context.setAttribute( "id", ( nid = expando ) ); + } + } + + // Prefix every selector in the list + groups = tokenize( selector ); + i = groups.length; + while ( i-- ) { + groups[ i ] = ( nid ? "#" + nid : ":scope" ) + " " + + toSelector( groups[ i ] ); + } + newSelector = groups.join( "," ); + } + + try { + push.apply( results, + newContext.querySelectorAll( newSelector ) + ); + return results; + } catch ( qsaError ) { + nonnativeSelectorCache( selector, true ); + } finally { + if ( nid === expando ) { + context.removeAttribute( "id" ); + } + } + } + } + } + + // All others + return select( selector.replace( rtrim, "$1" ), context, results, seed ); +} + +/** + * Create key-value caches of limited size + * @returns {function(string, object)} Returns the Object data after storing it on itself with + * property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength) + * deleting the oldest entry + */ +function createCache() { + var keys = []; + + function cache( key, value ) { + + // Use (key + " ") to avoid collision with native prototype properties (see Issue #157) + if ( keys.push( key + " " ) > Expr.cacheLength ) { + + // Only keep the most recent entries + delete cache[ keys.shift() ]; + } + return ( cache[ key + " " ] = value ); + } + return cache; +} + +/** + * Mark a function for special use by Sizzle + * @param {Function} fn The function to mark + */ +function markFunction( fn ) { + fn[ expando ] = true; + return fn; +} + +/** + * Support testing using an element + * @param {Function} fn Passed the created element and returns a boolean result + */ +function assert( fn ) { + var el = document.createElement( "fieldset" ); + + try { + return !!fn( el ); + } catch ( e ) { + return false; + } finally { + + // Remove from its parent by default + if ( el.parentNode ) { + el.parentNode.removeChild( el ); + } + + // release memory in IE + el = null; + } +} + +/** + * Adds the same handler for all of the specified attrs + * @param {String} attrs Pipe-separated list of attributes + * @param {Function} handler The method that will be applied + */ +function addHandle( attrs, handler ) { + var arr = attrs.split( "|" ), + i = arr.length; + + while ( i-- ) { + Expr.attrHandle[ arr[ i ] ] = handler; + } +} + +/** + * Checks document order of two siblings + * @param {Element} a + * @param {Element} b + * @returns {Number} Returns less than 0 if a precedes b, greater than 0 if a follows b + */ +function siblingCheck( a, b ) { + var cur = b && a, + diff = cur && a.nodeType === 1 && b.nodeType === 1 && + a.sourceIndex - b.sourceIndex; + + // Use IE sourceIndex if available on both nodes + if ( diff ) { + return diff; + } + + // Check if b follows a + if ( cur ) { + while ( ( cur = cur.nextSibling ) ) { + if ( cur === b ) { + return -1; + } + } + } + + return a ? 1 : -1; +} + +/** + * Returns a function to use in pseudos for input types + * @param {String} type + */ +function createInputPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === type; + }; +} + +/** + * Returns a function to use in pseudos for buttons + * @param {String} type + */ +function createButtonPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return ( name === "input" || name === "button" ) && elem.type === type; + }; +} + +/** + * Returns a function to use in pseudos for :enabled/:disabled + * @param {Boolean} disabled true for :disabled; false for :enabled + */ +function createDisabledPseudo( disabled ) { + + // Known :disabled false positives: fieldset[disabled] > legend:nth-of-type(n+2) :can-disable + return function( elem ) { + + // Only certain elements can match :enabled or :disabled + // https://html.spec.whatwg.org/multipage/scripting.html#selector-enabled + // https://html.spec.whatwg.org/multipage/scripting.html#selector-disabled + if ( "form" in elem ) { + + // Check for inherited disabledness on relevant non-disabled elements: + // * listed form-associated elements in a disabled fieldset + // https://html.spec.whatwg.org/multipage/forms.html#category-listed + // https://html.spec.whatwg.org/multipage/forms.html#concept-fe-disabled + // * option elements in a disabled optgroup + // https://html.spec.whatwg.org/multipage/forms.html#concept-option-disabled + // All such elements have a "form" property. + if ( elem.parentNode && elem.disabled === false ) { + + // Option elements defer to a parent optgroup if present + if ( "label" in elem ) { + if ( "label" in elem.parentNode ) { + return elem.parentNode.disabled === disabled; + } else { + return elem.disabled === disabled; + } + } + + // Support: IE 6 - 11 + // Use the isDisabled shortcut property to check for disabled fieldset ancestors + return elem.isDisabled === disabled || + + // Where there is no isDisabled, check manually + /* jshint -W018 */ + elem.isDisabled !== !disabled && + inDisabledFieldset( elem ) === disabled; + } + + return elem.disabled === disabled; + + // Try to winnow out elements that can't be disabled before trusting the disabled property. + // Some victims get caught in our net (label, legend, menu, track), but it shouldn't + // even exist on them, let alone have a boolean value. + } else if ( "label" in elem ) { + return elem.disabled === disabled; + } + + // Remaining elements are neither :enabled nor :disabled + return false; + }; +} + +/** + * Returns a function to use in pseudos for positionals + * @param {Function} fn + */ +function createPositionalPseudo( fn ) { + return markFunction( function( argument ) { + argument = +argument; + return markFunction( function( seed, matches ) { + var j, + matchIndexes = fn( [], seed.length, argument ), + i = matchIndexes.length; + + // Match elements found at the specified indexes + while ( i-- ) { + if ( seed[ ( j = matchIndexes[ i ] ) ] ) { + seed[ j ] = !( matches[ j ] = seed[ j ] ); + } + } + } ); + } ); +} + +/** + * Checks a node for validity as a Sizzle context + * @param {Element|Object=} context + * @returns {Element|Object|Boolean} The input node if acceptable, otherwise a falsy value + */ +function testContext( context ) { + return context && typeof context.getElementsByTagName !== "undefined" && context; +} + +// Expose support vars for convenience +support = Sizzle.support = {}; + +/** + * Detects XML nodes + * @param {Element|Object} elem An element or a document + * @returns {Boolean} True iff elem is a non-HTML XML node + */ +isXML = Sizzle.isXML = function( elem ) { + var namespace = elem.namespaceURI, + docElem = ( elem.ownerDocument || elem ).documentElement; + + // Support: IE <=8 + // Assume HTML when documentElement doesn't yet exist, such as inside loading iframes + // https://bugs.jquery.com/ticket/4833 + return !rhtml.test( namespace || docElem && docElem.nodeName || "HTML" ); +}; + +/** + * Sets document-related variables once based on the current document + * @param {Element|Object} [doc] An element or document object to use to set the document + * @returns {Object} Returns the current document + */ +setDocument = Sizzle.setDocument = function( node ) { + var hasCompare, subWindow, + doc = node ? node.ownerDocument || node : preferredDoc; + + // Return early if doc is invalid or already selected + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( doc == document || doc.nodeType !== 9 || !doc.documentElement ) { + return document; + } + + // Update global variables + document = doc; + docElem = document.documentElement; + documentIsHTML = !isXML( document ); + + // Support: IE 9 - 11+, Edge 12 - 18+ + // Accessing iframe documents after unload throws "permission denied" errors (jQuery #13936) + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( preferredDoc != document && + ( subWindow = document.defaultView ) && subWindow.top !== subWindow ) { + + // Support: IE 11, Edge + if ( subWindow.addEventListener ) { + subWindow.addEventListener( "unload", unloadHandler, false ); + + // Support: IE 9 - 10 only + } else if ( subWindow.attachEvent ) { + subWindow.attachEvent( "onunload", unloadHandler ); + } + } + + // Support: IE 8 - 11+, Edge 12 - 18+, Chrome <=16 - 25 only, Firefox <=3.6 - 31 only, + // Safari 4 - 5 only, Opera <=11.6 - 12.x only + // IE/Edge & older browsers don't support the :scope pseudo-class. + // Support: Safari 6.0 only + // Safari 6.0 supports :scope but it's an alias of :root there. + support.scope = assert( function( el ) { + docElem.appendChild( el ).appendChild( document.createElement( "div" ) ); + return typeof el.querySelectorAll !== "undefined" && + !el.querySelectorAll( ":scope fieldset div" ).length; + } ); + + /* Attributes + ---------------------------------------------------------------------- */ + + // Support: IE<8 + // Verify that getAttribute really returns attributes and not properties + // (excepting IE8 booleans) + support.attributes = assert( function( el ) { + el.className = "i"; + return !el.getAttribute( "className" ); + } ); + + /* getElement(s)By* + ---------------------------------------------------------------------- */ + + // Check if getElementsByTagName("*") returns only elements + support.getElementsByTagName = assert( function( el ) { + el.appendChild( document.createComment( "" ) ); + return !el.getElementsByTagName( "*" ).length; + } ); + + // Support: IE<9 + support.getElementsByClassName = rnative.test( document.getElementsByClassName ); + + // Support: IE<10 + // Check if getElementById returns elements by name + // The broken getElementById methods don't pick up programmatically-set names, + // so use a roundabout getElementsByName test + support.getById = assert( function( el ) { + docElem.appendChild( el ).id = expando; + return !document.getElementsByName || !document.getElementsByName( expando ).length; + } ); + + // ID filter and find + if ( support.getById ) { + Expr.filter[ "ID" ] = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + return elem.getAttribute( "id" ) === attrId; + }; + }; + Expr.find[ "ID" ] = function( id, context ) { + if ( typeof context.getElementById !== "undefined" && documentIsHTML ) { + var elem = context.getElementById( id ); + return elem ? [ elem ] : []; + } + }; + } else { + Expr.filter[ "ID" ] = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + var node = typeof elem.getAttributeNode !== "undefined" && + elem.getAttributeNode( "id" ); + return node && node.value === attrId; + }; + }; + + // Support: IE 6 - 7 only + // getElementById is not reliable as a find shortcut + Expr.find[ "ID" ] = function( id, context ) { + if ( typeof context.getElementById !== "undefined" && documentIsHTML ) { + var node, i, elems, + elem = context.getElementById( id ); + + if ( elem ) { + + // Verify the id attribute + node = elem.getAttributeNode( "id" ); + if ( node && node.value === id ) { + return [ elem ]; + } + + // Fall back on getElementsByName + elems = context.getElementsByName( id ); + i = 0; + while ( ( elem = elems[ i++ ] ) ) { + node = elem.getAttributeNode( "id" ); + if ( node && node.value === id ) { + return [ elem ]; + } + } + } + + return []; + } + }; + } + + // Tag + Expr.find[ "TAG" ] = support.getElementsByTagName ? + function( tag, context ) { + if ( typeof context.getElementsByTagName !== "undefined" ) { + return context.getElementsByTagName( tag ); + + // DocumentFragment nodes don't have gEBTN + } else if ( support.qsa ) { + return context.querySelectorAll( tag ); + } + } : + + function( tag, context ) { + var elem, + tmp = [], + i = 0, + + // By happy coincidence, a (broken) gEBTN appears on DocumentFragment nodes too + results = context.getElementsByTagName( tag ); + + // Filter out possible comments + if ( tag === "*" ) { + while ( ( elem = results[ i++ ] ) ) { + if ( elem.nodeType === 1 ) { + tmp.push( elem ); + } + } + + return tmp; + } + return results; + }; + + // Class + Expr.find[ "CLASS" ] = support.getElementsByClassName && function( className, context ) { + if ( typeof context.getElementsByClassName !== "undefined" && documentIsHTML ) { + return context.getElementsByClassName( className ); + } + }; + + /* QSA/matchesSelector + ---------------------------------------------------------------------- */ + + // QSA and matchesSelector support + + // matchesSelector(:active) reports false when true (IE9/Opera 11.5) + rbuggyMatches = []; + + // qSa(:focus) reports false when true (Chrome 21) + // We allow this because of a bug in IE8/9 that throws an error + // whenever `document.activeElement` is accessed on an iframe + // So, we allow :focus to pass through QSA all the time to avoid the IE error + // See https://bugs.jquery.com/ticket/13378 + rbuggyQSA = []; + + if ( ( support.qsa = rnative.test( document.querySelectorAll ) ) ) { + + // Build QSA regex + // Regex strategy adopted from Diego Perini + assert( function( el ) { + + var input; + + // Select is set to empty string on purpose + // This is to test IE's treatment of not explicitly + // setting a boolean content attribute, + // since its presence should be enough + // https://bugs.jquery.com/ticket/12359 + docElem.appendChild( el ).innerHTML = "" + + ""; + + // Support: IE8, Opera 11-12.16 + // Nothing should be selected when empty strings follow ^= or $= or *= + // The test attribute must be unknown in Opera but "safe" for WinRT + // https://msdn.microsoft.com/en-us/library/ie/hh465388.aspx#attribute_section + if ( el.querySelectorAll( "[msallowcapture^='']" ).length ) { + rbuggyQSA.push( "[*^$]=" + whitespace + "*(?:''|\"\")" ); + } + + // Support: IE8 + // Boolean attributes and "value" are not treated correctly + if ( !el.querySelectorAll( "[selected]" ).length ) { + rbuggyQSA.push( "\\[" + whitespace + "*(?:value|" + booleans + ")" ); + } + + // Support: Chrome<29, Android<4.4, Safari<7.0+, iOS<7.0+, PhantomJS<1.9.8+ + if ( !el.querySelectorAll( "[id~=" + expando + "-]" ).length ) { + rbuggyQSA.push( "~=" ); + } + + // Support: IE 11+, Edge 15 - 18+ + // IE 11/Edge don't find elements on a `[name='']` query in some cases. + // Adding a temporary attribute to the document before the selection works + // around the issue. + // Interestingly, IE 10 & older don't seem to have the issue. + input = document.createElement( "input" ); + input.setAttribute( "name", "" ); + el.appendChild( input ); + if ( !el.querySelectorAll( "[name='']" ).length ) { + rbuggyQSA.push( "\\[" + whitespace + "*name" + whitespace + "*=" + + whitespace + "*(?:''|\"\")" ); + } + + // Webkit/Opera - :checked should return selected option elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + // IE8 throws error here and will not see later tests + if ( !el.querySelectorAll( ":checked" ).length ) { + rbuggyQSA.push( ":checked" ); + } + + // Support: Safari 8+, iOS 8+ + // https://bugs.webkit.org/show_bug.cgi?id=136851 + // In-page `selector#id sibling-combinator selector` fails + if ( !el.querySelectorAll( "a#" + expando + "+*" ).length ) { + rbuggyQSA.push( ".#.+[+~]" ); + } + + // Support: Firefox <=3.6 - 5 only + // Old Firefox doesn't throw on a badly-escaped identifier. + el.querySelectorAll( "\\\f" ); + rbuggyQSA.push( "[\\r\\n\\f]" ); + } ); + + assert( function( el ) { + el.innerHTML = "" + + ""; + + // Support: Windows 8 Native Apps + // The type and name attributes are restricted during .innerHTML assignment + var input = document.createElement( "input" ); + input.setAttribute( "type", "hidden" ); + el.appendChild( input ).setAttribute( "name", "D" ); + + // Support: IE8 + // Enforce case-sensitivity of name attribute + if ( el.querySelectorAll( "[name=d]" ).length ) { + rbuggyQSA.push( "name" + whitespace + "*[*^$|!~]?=" ); + } + + // FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled) + // IE8 throws error here and will not see later tests + if ( el.querySelectorAll( ":enabled" ).length !== 2 ) { + rbuggyQSA.push( ":enabled", ":disabled" ); + } + + // Support: IE9-11+ + // IE's :disabled selector does not pick up the children of disabled fieldsets + docElem.appendChild( el ).disabled = true; + if ( el.querySelectorAll( ":disabled" ).length !== 2 ) { + rbuggyQSA.push( ":enabled", ":disabled" ); + } + + // Support: Opera 10 - 11 only + // Opera 10-11 does not throw on post-comma invalid pseudos + el.querySelectorAll( "*,:x" ); + rbuggyQSA.push( ",.*:" ); + } ); + } + + if ( ( support.matchesSelector = rnative.test( ( matches = docElem.matches || + docElem.webkitMatchesSelector || + docElem.mozMatchesSelector || + docElem.oMatchesSelector || + docElem.msMatchesSelector ) ) ) ) { + + assert( function( el ) { + + // Check to see if it's possible to do matchesSelector + // on a disconnected node (IE 9) + support.disconnectedMatch = matches.call( el, "*" ); + + // This should fail with an exception + // Gecko does not error, returns false instead + matches.call( el, "[s!='']:x" ); + rbuggyMatches.push( "!=", pseudos ); + } ); + } + + rbuggyQSA = rbuggyQSA.length && new RegExp( rbuggyQSA.join( "|" ) ); + rbuggyMatches = rbuggyMatches.length && new RegExp( rbuggyMatches.join( "|" ) ); + + /* Contains + ---------------------------------------------------------------------- */ + hasCompare = rnative.test( docElem.compareDocumentPosition ); + + // Element contains another + // Purposefully self-exclusive + // As in, an element does not contain itself + contains = hasCompare || rnative.test( docElem.contains ) ? + function( a, b ) { + var adown = a.nodeType === 9 ? a.documentElement : a, + bup = b && b.parentNode; + return a === bup || !!( bup && bup.nodeType === 1 && ( + adown.contains ? + adown.contains( bup ) : + a.compareDocumentPosition && a.compareDocumentPosition( bup ) & 16 + ) ); + } : + function( a, b ) { + if ( b ) { + while ( ( b = b.parentNode ) ) { + if ( b === a ) { + return true; + } + } + } + return false; + }; + + /* Sorting + ---------------------------------------------------------------------- */ + + // Document order sorting + sortOrder = hasCompare ? + function( a, b ) { + + // Flag for duplicate removal + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + // Sort on method existence if only one input has compareDocumentPosition + var compare = !a.compareDocumentPosition - !b.compareDocumentPosition; + if ( compare ) { + return compare; + } + + // Calculate position if both inputs belong to the same document + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + compare = ( a.ownerDocument || a ) == ( b.ownerDocument || b ) ? + a.compareDocumentPosition( b ) : + + // Otherwise we know they are disconnected + 1; + + // Disconnected nodes + if ( compare & 1 || + ( !support.sortDetached && b.compareDocumentPosition( a ) === compare ) ) { + + // Choose the first element that is related to our preferred document + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( a == document || a.ownerDocument == preferredDoc && + contains( preferredDoc, a ) ) { + return -1; + } + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( b == document || b.ownerDocument == preferredDoc && + contains( preferredDoc, b ) ) { + return 1; + } + + // Maintain original order + return sortInput ? + ( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) : + 0; + } + + return compare & 4 ? -1 : 1; + } : + function( a, b ) { + + // Exit early if the nodes are identical + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + var cur, + i = 0, + aup = a.parentNode, + bup = b.parentNode, + ap = [ a ], + bp = [ b ]; + + // Parentless nodes are either documents or disconnected + if ( !aup || !bup ) { + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + /* eslint-disable eqeqeq */ + return a == document ? -1 : + b == document ? 1 : + /* eslint-enable eqeqeq */ + aup ? -1 : + bup ? 1 : + sortInput ? + ( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) : + 0; + + // If the nodes are siblings, we can do a quick check + } else if ( aup === bup ) { + return siblingCheck( a, b ); + } + + // Otherwise we need full lists of their ancestors for comparison + cur = a; + while ( ( cur = cur.parentNode ) ) { + ap.unshift( cur ); + } + cur = b; + while ( ( cur = cur.parentNode ) ) { + bp.unshift( cur ); + } + + // Walk down the tree looking for a discrepancy + while ( ap[ i ] === bp[ i ] ) { + i++; + } + + return i ? + + // Do a sibling check if the nodes have a common ancestor + siblingCheck( ap[ i ], bp[ i ] ) : + + // Otherwise nodes in our document sort first + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + /* eslint-disable eqeqeq */ + ap[ i ] == preferredDoc ? -1 : + bp[ i ] == preferredDoc ? 1 : + /* eslint-enable eqeqeq */ + 0; + }; + + return document; +}; + +Sizzle.matches = function( expr, elements ) { + return Sizzle( expr, null, null, elements ); +}; + +Sizzle.matchesSelector = function( elem, expr ) { + setDocument( elem ); + + if ( support.matchesSelector && documentIsHTML && + !nonnativeSelectorCache[ expr + " " ] && + ( !rbuggyMatches || !rbuggyMatches.test( expr ) ) && + ( !rbuggyQSA || !rbuggyQSA.test( expr ) ) ) { + + try { + var ret = matches.call( elem, expr ); + + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || support.disconnectedMatch || + + // As well, disconnected nodes are said to be in a document + // fragment in IE 9 + elem.document && elem.document.nodeType !== 11 ) { + return ret; + } + } catch ( e ) { + nonnativeSelectorCache( expr, true ); + } + } + + return Sizzle( expr, document, null, [ elem ] ).length > 0; +}; + +Sizzle.contains = function( context, elem ) { + + // Set document vars if needed + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( ( context.ownerDocument || context ) != document ) { + setDocument( context ); + } + return contains( context, elem ); +}; + +Sizzle.attr = function( elem, name ) { + + // Set document vars if needed + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( ( elem.ownerDocument || elem ) != document ) { + setDocument( elem ); + } + + var fn = Expr.attrHandle[ name.toLowerCase() ], + + // Don't get fooled by Object.prototype properties (jQuery #13807) + val = fn && hasOwn.call( Expr.attrHandle, name.toLowerCase() ) ? + fn( elem, name, !documentIsHTML ) : + undefined; + + return val !== undefined ? + val : + support.attributes || !documentIsHTML ? + elem.getAttribute( name ) : + ( val = elem.getAttributeNode( name ) ) && val.specified ? + val.value : + null; +}; + +Sizzle.escape = function( sel ) { + return ( sel + "" ).replace( rcssescape, fcssescape ); +}; + +Sizzle.error = function( msg ) { + throw new Error( "Syntax error, unrecognized expression: " + msg ); +}; + +/** + * Document sorting and removing duplicates + * @param {ArrayLike} results + */ +Sizzle.uniqueSort = function( results ) { + var elem, + duplicates = [], + j = 0, + i = 0; + + // Unless we *know* we can detect duplicates, assume their presence + hasDuplicate = !support.detectDuplicates; + sortInput = !support.sortStable && results.slice( 0 ); + results.sort( sortOrder ); + + if ( hasDuplicate ) { + while ( ( elem = results[ i++ ] ) ) { + if ( elem === results[ i ] ) { + j = duplicates.push( i ); + } + } + while ( j-- ) { + results.splice( duplicates[ j ], 1 ); + } + } + + // Clear input after sorting to release objects + // See https://github.com/jquery/sizzle/pull/225 + sortInput = null; + + return results; +}; + +/** + * Utility function for retrieving the text value of an array of DOM nodes + * @param {Array|Element} elem + */ +getText = Sizzle.getText = function( elem ) { + var node, + ret = "", + i = 0, + nodeType = elem.nodeType; + + if ( !nodeType ) { + + // If no nodeType, this is expected to be an array + while ( ( node = elem[ i++ ] ) ) { + + // Do not traverse comment nodes + ret += getText( node ); + } + } else if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) { + + // Use textContent for elements + // innerText usage removed for consistency of new lines (jQuery #11153) + if ( typeof elem.textContent === "string" ) { + return elem.textContent; + } else { + + // Traverse its children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + ret += getText( elem ); + } + } + } else if ( nodeType === 3 || nodeType === 4 ) { + return elem.nodeValue; + } + + // Do not include comment or processing instruction nodes + + return ret; +}; + +Expr = Sizzle.selectors = { + + // Can be adjusted by the user + cacheLength: 50, + + createPseudo: markFunction, + + match: matchExpr, + + attrHandle: {}, + + find: {}, + + relative: { + ">": { dir: "parentNode", first: true }, + " ": { dir: "parentNode" }, + "+": { dir: "previousSibling", first: true }, + "~": { dir: "previousSibling" } + }, + + preFilter: { + "ATTR": function( match ) { + match[ 1 ] = match[ 1 ].replace( runescape, funescape ); + + // Move the given value to match[3] whether quoted or unquoted + match[ 3 ] = ( match[ 3 ] || match[ 4 ] || + match[ 5 ] || "" ).replace( runescape, funescape ); + + if ( match[ 2 ] === "~=" ) { + match[ 3 ] = " " + match[ 3 ] + " "; + } + + return match.slice( 0, 4 ); + }, + + "CHILD": function( match ) { + + /* matches from matchExpr["CHILD"] + 1 type (only|nth|...) + 2 what (child|of-type) + 3 argument (even|odd|\d*|\d*n([+-]\d+)?|...) + 4 xn-component of xn+y argument ([+-]?\d*n|) + 5 sign of xn-component + 6 x of xn-component + 7 sign of y-component + 8 y of y-component + */ + match[ 1 ] = match[ 1 ].toLowerCase(); + + if ( match[ 1 ].slice( 0, 3 ) === "nth" ) { + + // nth-* requires argument + if ( !match[ 3 ] ) { + Sizzle.error( match[ 0 ] ); + } + + // numeric x and y parameters for Expr.filter.CHILD + // remember that false/true cast respectively to 0/1 + match[ 4 ] = +( match[ 4 ] ? + match[ 5 ] + ( match[ 6 ] || 1 ) : + 2 * ( match[ 3 ] === "even" || match[ 3 ] === "odd" ) ); + match[ 5 ] = +( ( match[ 7 ] + match[ 8 ] ) || match[ 3 ] === "odd" ); + + // other types prohibit arguments + } else if ( match[ 3 ] ) { + Sizzle.error( match[ 0 ] ); + } + + return match; + }, + + "PSEUDO": function( match ) { + var excess, + unquoted = !match[ 6 ] && match[ 2 ]; + + if ( matchExpr[ "CHILD" ].test( match[ 0 ] ) ) { + return null; + } + + // Accept quoted arguments as-is + if ( match[ 3 ] ) { + match[ 2 ] = match[ 4 ] || match[ 5 ] || ""; + + // Strip excess characters from unquoted arguments + } else if ( unquoted && rpseudo.test( unquoted ) && + + // Get excess from tokenize (recursively) + ( excess = tokenize( unquoted, true ) ) && + + // advance to the next closing parenthesis + ( excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length ) ) { + + // excess is a negative index + match[ 0 ] = match[ 0 ].slice( 0, excess ); + match[ 2 ] = unquoted.slice( 0, excess ); + } + + // Return only captures needed by the pseudo filter method (type and argument) + return match.slice( 0, 3 ); + } + }, + + filter: { + + "TAG": function( nodeNameSelector ) { + var nodeName = nodeNameSelector.replace( runescape, funescape ).toLowerCase(); + return nodeNameSelector === "*" ? + function() { + return true; + } : + function( elem ) { + return elem.nodeName && elem.nodeName.toLowerCase() === nodeName; + }; + }, + + "CLASS": function( className ) { + var pattern = classCache[ className + " " ]; + + return pattern || + ( pattern = new RegExp( "(^|" + whitespace + + ")" + className + "(" + whitespace + "|$)" ) ) && classCache( + className, function( elem ) { + return pattern.test( + typeof elem.className === "string" && elem.className || + typeof elem.getAttribute !== "undefined" && + elem.getAttribute( "class" ) || + "" + ); + } ); + }, + + "ATTR": function( name, operator, check ) { + return function( elem ) { + var result = Sizzle.attr( elem, name ); + + if ( result == null ) { + return operator === "!="; + } + if ( !operator ) { + return true; + } + + result += ""; + + /* eslint-disable max-len */ + + return operator === "=" ? result === check : + operator === "!=" ? result !== check : + operator === "^=" ? check && result.indexOf( check ) === 0 : + operator === "*=" ? check && result.indexOf( check ) > -1 : + operator === "$=" ? check && result.slice( -check.length ) === check : + operator === "~=" ? ( " " + result.replace( rwhitespace, " " ) + " " ).indexOf( check ) > -1 : + operator === "|=" ? result === check || result.slice( 0, check.length + 1 ) === check + "-" : + false; + /* eslint-enable max-len */ + + }; + }, + + "CHILD": function( type, what, _argument, first, last ) { + var simple = type.slice( 0, 3 ) !== "nth", + forward = type.slice( -4 ) !== "last", + ofType = what === "of-type"; + + return first === 1 && last === 0 ? + + // Shortcut for :nth-*(n) + function( elem ) { + return !!elem.parentNode; + } : + + function( elem, _context, xml ) { + var cache, uniqueCache, outerCache, node, nodeIndex, start, + dir = simple !== forward ? "nextSibling" : "previousSibling", + parent = elem.parentNode, + name = ofType && elem.nodeName.toLowerCase(), + useCache = !xml && !ofType, + diff = false; + + if ( parent ) { + + // :(first|last|only)-(child|of-type) + if ( simple ) { + while ( dir ) { + node = elem; + while ( ( node = node[ dir ] ) ) { + if ( ofType ? + node.nodeName.toLowerCase() === name : + node.nodeType === 1 ) { + + return false; + } + } + + // Reverse direction for :only-* (if we haven't yet done so) + start = dir = type === "only" && !start && "nextSibling"; + } + return true; + } + + start = [ forward ? parent.firstChild : parent.lastChild ]; + + // non-xml :nth-child(...) stores cache data on `parent` + if ( forward && useCache ) { + + // Seek `elem` from a previously-cached index + + // ...in a gzip-friendly way + node = parent; + outerCache = node[ expando ] || ( node[ expando ] = {} ); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + ( outerCache[ node.uniqueID ] = {} ); + + cache = uniqueCache[ type ] || []; + nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ]; + diff = nodeIndex && cache[ 2 ]; + node = nodeIndex && parent.childNodes[ nodeIndex ]; + + while ( ( node = ++nodeIndex && node && node[ dir ] || + + // Fallback to seeking `elem` from the start + ( diff = nodeIndex = 0 ) || start.pop() ) ) { + + // When found, cache indexes on `parent` and break + if ( node.nodeType === 1 && ++diff && node === elem ) { + uniqueCache[ type ] = [ dirruns, nodeIndex, diff ]; + break; + } + } + + } else { + + // Use previously-cached element index if available + if ( useCache ) { + + // ...in a gzip-friendly way + node = elem; + outerCache = node[ expando ] || ( node[ expando ] = {} ); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + ( outerCache[ node.uniqueID ] = {} ); + + cache = uniqueCache[ type ] || []; + nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ]; + diff = nodeIndex; + } + + // xml :nth-child(...) + // or :nth-last-child(...) or :nth(-last)?-of-type(...) + if ( diff === false ) { + + // Use the same loop as above to seek `elem` from the start + while ( ( node = ++nodeIndex && node && node[ dir ] || + ( diff = nodeIndex = 0 ) || start.pop() ) ) { + + if ( ( ofType ? + node.nodeName.toLowerCase() === name : + node.nodeType === 1 ) && + ++diff ) { + + // Cache the index of each encountered element + if ( useCache ) { + outerCache = node[ expando ] || + ( node[ expando ] = {} ); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + ( outerCache[ node.uniqueID ] = {} ); + + uniqueCache[ type ] = [ dirruns, diff ]; + } + + if ( node === elem ) { + break; + } + } + } + } + } + + // Incorporate the offset, then check against cycle size + diff -= last; + return diff === first || ( diff % first === 0 && diff / first >= 0 ); + } + }; + }, + + "PSEUDO": function( pseudo, argument ) { + + // pseudo-class names are case-insensitive + // http://www.w3.org/TR/selectors/#pseudo-classes + // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters + // Remember that setFilters inherits from pseudos + var args, + fn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] || + Sizzle.error( "unsupported pseudo: " + pseudo ); + + // The user may use createPseudo to indicate that + // arguments are needed to create the filter function + // just as Sizzle does + if ( fn[ expando ] ) { + return fn( argument ); + } + + // But maintain support for old signatures + if ( fn.length > 1 ) { + args = [ pseudo, pseudo, "", argument ]; + return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ? + markFunction( function( seed, matches ) { + var idx, + matched = fn( seed, argument ), + i = matched.length; + while ( i-- ) { + idx = indexOf( seed, matched[ i ] ); + seed[ idx ] = !( matches[ idx ] = matched[ i ] ); + } + } ) : + function( elem ) { + return fn( elem, 0, args ); + }; + } + + return fn; + } + }, + + pseudos: { + + // Potentially complex pseudos + "not": markFunction( function( selector ) { + + // Trim the selector passed to compile + // to avoid treating leading and trailing + // spaces as combinators + var input = [], + results = [], + matcher = compile( selector.replace( rtrim, "$1" ) ); + + return matcher[ expando ] ? + markFunction( function( seed, matches, _context, xml ) { + var elem, + unmatched = matcher( seed, null, xml, [] ), + i = seed.length; + + // Match elements unmatched by `matcher` + while ( i-- ) { + if ( ( elem = unmatched[ i ] ) ) { + seed[ i ] = !( matches[ i ] = elem ); + } + } + } ) : + function( elem, _context, xml ) { + input[ 0 ] = elem; + matcher( input, null, xml, results ); + + // Don't keep the element (issue #299) + input[ 0 ] = null; + return !results.pop(); + }; + } ), + + "has": markFunction( function( selector ) { + return function( elem ) { + return Sizzle( selector, elem ).length > 0; + }; + } ), + + "contains": markFunction( function( text ) { + text = text.replace( runescape, funescape ); + return function( elem ) { + return ( elem.textContent || getText( elem ) ).indexOf( text ) > -1; + }; + } ), + + // "Whether an element is represented by a :lang() selector + // is based solely on the element's language value + // being equal to the identifier C, + // or beginning with the identifier C immediately followed by "-". + // The matching of C against the element's language value is performed case-insensitively. + // The identifier C does not have to be a valid language name." + // http://www.w3.org/TR/selectors/#lang-pseudo + "lang": markFunction( function( lang ) { + + // lang value must be a valid identifier + if ( !ridentifier.test( lang || "" ) ) { + Sizzle.error( "unsupported lang: " + lang ); + } + lang = lang.replace( runescape, funescape ).toLowerCase(); + return function( elem ) { + var elemLang; + do { + if ( ( elemLang = documentIsHTML ? + elem.lang : + elem.getAttribute( "xml:lang" ) || elem.getAttribute( "lang" ) ) ) { + + elemLang = elemLang.toLowerCase(); + return elemLang === lang || elemLang.indexOf( lang + "-" ) === 0; + } + } while ( ( elem = elem.parentNode ) && elem.nodeType === 1 ); + return false; + }; + } ), + + // Miscellaneous + "target": function( elem ) { + var hash = window.location && window.location.hash; + return hash && hash.slice( 1 ) === elem.id; + }, + + "root": function( elem ) { + return elem === docElem; + }, + + "focus": function( elem ) { + return elem === document.activeElement && + ( !document.hasFocus || document.hasFocus() ) && + !!( elem.type || elem.href || ~elem.tabIndex ); + }, + + // Boolean properties + "enabled": createDisabledPseudo( false ), + "disabled": createDisabledPseudo( true ), + + "checked": function( elem ) { + + // In CSS3, :checked should return both checked and selected elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + var nodeName = elem.nodeName.toLowerCase(); + return ( nodeName === "input" && !!elem.checked ) || + ( nodeName === "option" && !!elem.selected ); + }, + + "selected": function( elem ) { + + // Accessing this property makes selected-by-default + // options in Safari work properly + if ( elem.parentNode ) { + // eslint-disable-next-line no-unused-expressions + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + // Contents + "empty": function( elem ) { + + // http://www.w3.org/TR/selectors/#empty-pseudo + // :empty is negated by element (1) or content nodes (text: 3; cdata: 4; entity ref: 5), + // but not by others (comment: 8; processing instruction: 7; etc.) + // nodeType < 6 works because attributes (2) do not appear as children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + if ( elem.nodeType < 6 ) { + return false; + } + } + return true; + }, + + "parent": function( elem ) { + return !Expr.pseudos[ "empty" ]( elem ); + }, + + // Element/input types + "header": function( elem ) { + return rheader.test( elem.nodeName ); + }, + + "input": function( elem ) { + return rinputs.test( elem.nodeName ); + }, + + "button": function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === "button" || name === "button"; + }, + + "text": function( elem ) { + var attr; + return elem.nodeName.toLowerCase() === "input" && + elem.type === "text" && + + // Support: IE<8 + // New HTML5 attribute values (e.g., "search") appear with elem.type === "text" + ( ( attr = elem.getAttribute( "type" ) ) == null || + attr.toLowerCase() === "text" ); + }, + + // Position-in-collection + "first": createPositionalPseudo( function() { + return [ 0 ]; + } ), + + "last": createPositionalPseudo( function( _matchIndexes, length ) { + return [ length - 1 ]; + } ), + + "eq": createPositionalPseudo( function( _matchIndexes, length, argument ) { + return [ argument < 0 ? argument + length : argument ]; + } ), + + "even": createPositionalPseudo( function( matchIndexes, length ) { + var i = 0; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + } ), + + "odd": createPositionalPseudo( function( matchIndexes, length ) { + var i = 1; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + } ), + + "lt": createPositionalPseudo( function( matchIndexes, length, argument ) { + var i = argument < 0 ? + argument + length : + argument > length ? + length : + argument; + for ( ; --i >= 0; ) { + matchIndexes.push( i ); + } + return matchIndexes; + } ), + + "gt": createPositionalPseudo( function( matchIndexes, length, argument ) { + var i = argument < 0 ? argument + length : argument; + for ( ; ++i < length; ) { + matchIndexes.push( i ); + } + return matchIndexes; + } ) + } +}; + +Expr.pseudos[ "nth" ] = Expr.pseudos[ "eq" ]; + +// Add button/input type pseudos +for ( i in { radio: true, checkbox: true, file: true, password: true, image: true } ) { + Expr.pseudos[ i ] = createInputPseudo( i ); +} +for ( i in { submit: true, reset: true } ) { + Expr.pseudos[ i ] = createButtonPseudo( i ); +} + +// Easy API for creating new setFilters +function setFilters() {} +setFilters.prototype = Expr.filters = Expr.pseudos; +Expr.setFilters = new setFilters(); + +tokenize = Sizzle.tokenize = function( selector, parseOnly ) { + var matched, match, tokens, type, + soFar, groups, preFilters, + cached = tokenCache[ selector + " " ]; + + if ( cached ) { + return parseOnly ? 0 : cached.slice( 0 ); + } + + soFar = selector; + groups = []; + preFilters = Expr.preFilter; + + while ( soFar ) { + + // Comma and first run + if ( !matched || ( match = rcomma.exec( soFar ) ) ) { + if ( match ) { + + // Don't consume trailing commas as valid + soFar = soFar.slice( match[ 0 ].length ) || soFar; + } + groups.push( ( tokens = [] ) ); + } + + matched = false; + + // Combinators + if ( ( match = rcombinators.exec( soFar ) ) ) { + matched = match.shift(); + tokens.push( { + value: matched, + + // Cast descendant combinators to space + type: match[ 0 ].replace( rtrim, " " ) + } ); + soFar = soFar.slice( matched.length ); + } + + // Filters + for ( type in Expr.filter ) { + if ( ( match = matchExpr[ type ].exec( soFar ) ) && ( !preFilters[ type ] || + ( match = preFilters[ type ]( match ) ) ) ) { + matched = match.shift(); + tokens.push( { + value: matched, + type: type, + matches: match + } ); + soFar = soFar.slice( matched.length ); + } + } + + if ( !matched ) { + break; + } + } + + // Return the length of the invalid excess + // if we're just parsing + // Otherwise, throw an error or return tokens + return parseOnly ? + soFar.length : + soFar ? + Sizzle.error( selector ) : + + // Cache the tokens + tokenCache( selector, groups ).slice( 0 ); +}; + +function toSelector( tokens ) { + var i = 0, + len = tokens.length, + selector = ""; + for ( ; i < len; i++ ) { + selector += tokens[ i ].value; + } + return selector; +} + +function addCombinator( matcher, combinator, base ) { + var dir = combinator.dir, + skip = combinator.next, + key = skip || dir, + checkNonElements = base && key === "parentNode", + doneName = done++; + + return combinator.first ? + + // Check against closest ancestor/preceding element + function( elem, context, xml ) { + while ( ( elem = elem[ dir ] ) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + return matcher( elem, context, xml ); + } + } + return false; + } : + + // Check against all ancestor/preceding elements + function( elem, context, xml ) { + var oldCache, uniqueCache, outerCache, + newCache = [ dirruns, doneName ]; + + // We can't set arbitrary data on XML nodes, so they don't benefit from combinator caching + if ( xml ) { + while ( ( elem = elem[ dir ] ) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + if ( matcher( elem, context, xml ) ) { + return true; + } + } + } + } else { + while ( ( elem = elem[ dir ] ) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + outerCache = elem[ expando ] || ( elem[ expando ] = {} ); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ elem.uniqueID ] || + ( outerCache[ elem.uniqueID ] = {} ); + + if ( skip && skip === elem.nodeName.toLowerCase() ) { + elem = elem[ dir ] || elem; + } else if ( ( oldCache = uniqueCache[ key ] ) && + oldCache[ 0 ] === dirruns && oldCache[ 1 ] === doneName ) { + + // Assign to newCache so results back-propagate to previous elements + return ( newCache[ 2 ] = oldCache[ 2 ] ); + } else { + + // Reuse newcache so results back-propagate to previous elements + uniqueCache[ key ] = newCache; + + // A match means we're done; a fail means we have to keep checking + if ( ( newCache[ 2 ] = matcher( elem, context, xml ) ) ) { + return true; + } + } + } + } + } + return false; + }; +} + +function elementMatcher( matchers ) { + return matchers.length > 1 ? + function( elem, context, xml ) { + var i = matchers.length; + while ( i-- ) { + if ( !matchers[ i ]( elem, context, xml ) ) { + return false; + } + } + return true; + } : + matchers[ 0 ]; +} + +function multipleContexts( selector, contexts, results ) { + var i = 0, + len = contexts.length; + for ( ; i < len; i++ ) { + Sizzle( selector, contexts[ i ], results ); + } + return results; +} + +function condense( unmatched, map, filter, context, xml ) { + var elem, + newUnmatched = [], + i = 0, + len = unmatched.length, + mapped = map != null; + + for ( ; i < len; i++ ) { + if ( ( elem = unmatched[ i ] ) ) { + if ( !filter || filter( elem, context, xml ) ) { + newUnmatched.push( elem ); + if ( mapped ) { + map.push( i ); + } + } + } + } + + return newUnmatched; +} + +function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) { + if ( postFilter && !postFilter[ expando ] ) { + postFilter = setMatcher( postFilter ); + } + if ( postFinder && !postFinder[ expando ] ) { + postFinder = setMatcher( postFinder, postSelector ); + } + return markFunction( function( seed, results, context, xml ) { + var temp, i, elem, + preMap = [], + postMap = [], + preexisting = results.length, + + // Get initial elements from seed or context + elems = seed || multipleContexts( + selector || "*", + context.nodeType ? [ context ] : context, + [] + ), + + // Prefilter to get matcher input, preserving a map for seed-results synchronization + matcherIn = preFilter && ( seed || !selector ) ? + condense( elems, preMap, preFilter, context, xml ) : + elems, + + matcherOut = matcher ? + + // If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results, + postFinder || ( seed ? preFilter : preexisting || postFilter ) ? + + // ...intermediate processing is necessary + [] : + + // ...otherwise use results directly + results : + matcherIn; + + // Find primary matches + if ( matcher ) { + matcher( matcherIn, matcherOut, context, xml ); + } + + // Apply postFilter + if ( postFilter ) { + temp = condense( matcherOut, postMap ); + postFilter( temp, [], context, xml ); + + // Un-match failing elements by moving them back to matcherIn + i = temp.length; + while ( i-- ) { + if ( ( elem = temp[ i ] ) ) { + matcherOut[ postMap[ i ] ] = !( matcherIn[ postMap[ i ] ] = elem ); + } + } + } + + if ( seed ) { + if ( postFinder || preFilter ) { + if ( postFinder ) { + + // Get the final matcherOut by condensing this intermediate into postFinder contexts + temp = []; + i = matcherOut.length; + while ( i-- ) { + if ( ( elem = matcherOut[ i ] ) ) { + + // Restore matcherIn since elem is not yet a final match + temp.push( ( matcherIn[ i ] = elem ) ); + } + } + postFinder( null, ( matcherOut = [] ), temp, xml ); + } + + // Move matched elements from seed to results to keep them synchronized + i = matcherOut.length; + while ( i-- ) { + if ( ( elem = matcherOut[ i ] ) && + ( temp = postFinder ? indexOf( seed, elem ) : preMap[ i ] ) > -1 ) { + + seed[ temp ] = !( results[ temp ] = elem ); + } + } + } + + // Add elements to results, through postFinder if defined + } else { + matcherOut = condense( + matcherOut === results ? + matcherOut.splice( preexisting, matcherOut.length ) : + matcherOut + ); + if ( postFinder ) { + postFinder( null, results, matcherOut, xml ); + } else { + push.apply( results, matcherOut ); + } + } + } ); +} + +function matcherFromTokens( tokens ) { + var checkContext, matcher, j, + len = tokens.length, + leadingRelative = Expr.relative[ tokens[ 0 ].type ], + implicitRelative = leadingRelative || Expr.relative[ " " ], + i = leadingRelative ? 1 : 0, + + // The foundational matcher ensures that elements are reachable from top-level context(s) + matchContext = addCombinator( function( elem ) { + return elem === checkContext; + }, implicitRelative, true ), + matchAnyContext = addCombinator( function( elem ) { + return indexOf( checkContext, elem ) > -1; + }, implicitRelative, true ), + matchers = [ function( elem, context, xml ) { + var ret = ( !leadingRelative && ( xml || context !== outermostContext ) ) || ( + ( checkContext = context ).nodeType ? + matchContext( elem, context, xml ) : + matchAnyContext( elem, context, xml ) ); + + // Avoid hanging onto element (issue #299) + checkContext = null; + return ret; + } ]; + + for ( ; i < len; i++ ) { + if ( ( matcher = Expr.relative[ tokens[ i ].type ] ) ) { + matchers = [ addCombinator( elementMatcher( matchers ), matcher ) ]; + } else { + matcher = Expr.filter[ tokens[ i ].type ].apply( null, tokens[ i ].matches ); + + // Return special upon seeing a positional matcher + if ( matcher[ expando ] ) { + + // Find the next relative operator (if any) for proper handling + j = ++i; + for ( ; j < len; j++ ) { + if ( Expr.relative[ tokens[ j ].type ] ) { + break; + } + } + return setMatcher( + i > 1 && elementMatcher( matchers ), + i > 1 && toSelector( + + // If the preceding token was a descendant combinator, insert an implicit any-element `*` + tokens + .slice( 0, i - 1 ) + .concat( { value: tokens[ i - 2 ].type === " " ? "*" : "" } ) + ).replace( rtrim, "$1" ), + matcher, + i < j && matcherFromTokens( tokens.slice( i, j ) ), + j < len && matcherFromTokens( ( tokens = tokens.slice( j ) ) ), + j < len && toSelector( tokens ) + ); + } + matchers.push( matcher ); + } + } + + return elementMatcher( matchers ); +} + +function matcherFromGroupMatchers( elementMatchers, setMatchers ) { + var bySet = setMatchers.length > 0, + byElement = elementMatchers.length > 0, + superMatcher = function( seed, context, xml, results, outermost ) { + var elem, j, matcher, + matchedCount = 0, + i = "0", + unmatched = seed && [], + setMatched = [], + contextBackup = outermostContext, + + // We must always have either seed elements or outermost context + elems = seed || byElement && Expr.find[ "TAG" ]( "*", outermost ), + + // Use integer dirruns iff this is the outermost matcher + dirrunsUnique = ( dirruns += contextBackup == null ? 1 : Math.random() || 0.1 ), + len = elems.length; + + if ( outermost ) { + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + outermostContext = context == document || context || outermost; + } + + // Add elements passing elementMatchers directly to results + // Support: IE<9, Safari + // Tolerate NodeList properties (IE: "length"; Safari: ) matching elements by id + for ( ; i !== len && ( elem = elems[ i ] ) != null; i++ ) { + if ( byElement && elem ) { + j = 0; + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( !context && elem.ownerDocument != document ) { + setDocument( elem ); + xml = !documentIsHTML; + } + while ( ( matcher = elementMatchers[ j++ ] ) ) { + if ( matcher( elem, context || document, xml ) ) { + results.push( elem ); + break; + } + } + if ( outermost ) { + dirruns = dirrunsUnique; + } + } + + // Track unmatched elements for set filters + if ( bySet ) { + + // They will have gone through all possible matchers + if ( ( elem = !matcher && elem ) ) { + matchedCount--; + } + + // Lengthen the array for every element, matched or not + if ( seed ) { + unmatched.push( elem ); + } + } + } + + // `i` is now the count of elements visited above, and adding it to `matchedCount` + // makes the latter nonnegative. + matchedCount += i; + + // Apply set filters to unmatched elements + // NOTE: This can be skipped if there are no unmatched elements (i.e., `matchedCount` + // equals `i`), unless we didn't visit _any_ elements in the above loop because we have + // no element matchers and no seed. + // Incrementing an initially-string "0" `i` allows `i` to remain a string only in that + // case, which will result in a "00" `matchedCount` that differs from `i` but is also + // numerically zero. + if ( bySet && i !== matchedCount ) { + j = 0; + while ( ( matcher = setMatchers[ j++ ] ) ) { + matcher( unmatched, setMatched, context, xml ); + } + + if ( seed ) { + + // Reintegrate element matches to eliminate the need for sorting + if ( matchedCount > 0 ) { + while ( i-- ) { + if ( !( unmatched[ i ] || setMatched[ i ] ) ) { + setMatched[ i ] = pop.call( results ); + } + } + } + + // Discard index placeholder values to get only actual matches + setMatched = condense( setMatched ); + } + + // Add matches to results + push.apply( results, setMatched ); + + // Seedless set matches succeeding multiple successful matchers stipulate sorting + if ( outermost && !seed && setMatched.length > 0 && + ( matchedCount + setMatchers.length ) > 1 ) { + + Sizzle.uniqueSort( results ); + } + } + + // Override manipulation of globals by nested matchers + if ( outermost ) { + dirruns = dirrunsUnique; + outermostContext = contextBackup; + } + + return unmatched; + }; + + return bySet ? + markFunction( superMatcher ) : + superMatcher; +} + +compile = Sizzle.compile = function( selector, match /* Internal Use Only */ ) { + var i, + setMatchers = [], + elementMatchers = [], + cached = compilerCache[ selector + " " ]; + + if ( !cached ) { + + // Generate a function of recursive functions that can be used to check each element + if ( !match ) { + match = tokenize( selector ); + } + i = match.length; + while ( i-- ) { + cached = matcherFromTokens( match[ i ] ); + if ( cached[ expando ] ) { + setMatchers.push( cached ); + } else { + elementMatchers.push( cached ); + } + } + + // Cache the compiled function + cached = compilerCache( + selector, + matcherFromGroupMatchers( elementMatchers, setMatchers ) + ); + + // Save selector and tokenization + cached.selector = selector; + } + return cached; +}; + +/** + * A low-level selection function that works with Sizzle's compiled + * selector functions + * @param {String|Function} selector A selector or a pre-compiled + * selector function built with Sizzle.compile + * @param {Element} context + * @param {Array} [results] + * @param {Array} [seed] A set of elements to match against + */ +select = Sizzle.select = function( selector, context, results, seed ) { + var i, tokens, token, type, find, + compiled = typeof selector === "function" && selector, + match = !seed && tokenize( ( selector = compiled.selector || selector ) ); + + results = results || []; + + // Try to minimize operations if there is only one selector in the list and no seed + // (the latter of which guarantees us context) + if ( match.length === 1 ) { + + // Reduce context if the leading compound selector is an ID + tokens = match[ 0 ] = match[ 0 ].slice( 0 ); + if ( tokens.length > 2 && ( token = tokens[ 0 ] ).type === "ID" && + context.nodeType === 9 && documentIsHTML && Expr.relative[ tokens[ 1 ].type ] ) { + + context = ( Expr.find[ "ID" ]( token.matches[ 0 ] + .replace( runescape, funescape ), context ) || [] )[ 0 ]; + if ( !context ) { + return results; + + // Precompiled matchers will still verify ancestry, so step up a level + } else if ( compiled ) { + context = context.parentNode; + } + + selector = selector.slice( tokens.shift().value.length ); + } + + // Fetch a seed set for right-to-left matching + i = matchExpr[ "needsContext" ].test( selector ) ? 0 : tokens.length; + while ( i-- ) { + token = tokens[ i ]; + + // Abort if we hit a combinator + if ( Expr.relative[ ( type = token.type ) ] ) { + break; + } + if ( ( find = Expr.find[ type ] ) ) { + + // Search, expanding context for leading sibling combinators + if ( ( seed = find( + token.matches[ 0 ].replace( runescape, funescape ), + rsibling.test( tokens[ 0 ].type ) && testContext( context.parentNode ) || + context + ) ) ) { + + // If seed is empty or no tokens remain, we can return early + tokens.splice( i, 1 ); + selector = seed.length && toSelector( tokens ); + if ( !selector ) { + push.apply( results, seed ); + return results; + } + + break; + } + } + } + } + + // Compile and execute a filtering function if one is not provided + // Provide `match` to avoid retokenization if we modified the selector above + ( compiled || compile( selector, match ) )( + seed, + context, + !documentIsHTML, + results, + !context || rsibling.test( selector ) && testContext( context.parentNode ) || context + ); + return results; +}; + +// One-time assignments + +// Sort stability +support.sortStable = expando.split( "" ).sort( sortOrder ).join( "" ) === expando; + +// Support: Chrome 14-35+ +// Always assume duplicates if they aren't passed to the comparison function +support.detectDuplicates = !!hasDuplicate; + +// Initialize against the default document +setDocument(); + +// Support: Webkit<537.32 - Safari 6.0.3/Chrome 25 (fixed in Chrome 27) +// Detached nodes confoundingly follow *each other* +support.sortDetached = assert( function( el ) { + + // Should return 1, but returns 4 (following) + return el.compareDocumentPosition( document.createElement( "fieldset" ) ) & 1; +} ); + +// Support: IE<8 +// Prevent attribute/property "interpolation" +// https://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx +if ( !assert( function( el ) { + el.innerHTML = ""; + return el.firstChild.getAttribute( "href" ) === "#"; +} ) ) { + addHandle( "type|href|height|width", function( elem, name, isXML ) { + if ( !isXML ) { + return elem.getAttribute( name, name.toLowerCase() === "type" ? 1 : 2 ); + } + } ); +} + +// Support: IE<9 +// Use defaultValue in place of getAttribute("value") +if ( !support.attributes || !assert( function( el ) { + el.innerHTML = ""; + el.firstChild.setAttribute( "value", "" ); + return el.firstChild.getAttribute( "value" ) === ""; +} ) ) { + addHandle( "value", function( elem, _name, isXML ) { + if ( !isXML && elem.nodeName.toLowerCase() === "input" ) { + return elem.defaultValue; + } + } ); +} + +// Support: IE<9 +// Use getAttributeNode to fetch booleans when getAttribute lies +if ( !assert( function( el ) { + return el.getAttribute( "disabled" ) == null; +} ) ) { + addHandle( booleans, function( elem, name, isXML ) { + var val; + if ( !isXML ) { + return elem[ name ] === true ? name.toLowerCase() : + ( val = elem.getAttributeNode( name ) ) && val.specified ? + val.value : + null; + } + } ); +} + +return Sizzle; + +} )( window ); + + + +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; + +// Deprecated +jQuery.expr[ ":" ] = jQuery.expr.pseudos; +jQuery.uniqueSort = jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; +jQuery.escapeSelector = Sizzle.escape; + + + + +var dir = function( elem, dir, until ) { + var matched = [], + truncate = until !== undefined; + + while ( ( elem = elem[ dir ] ) && elem.nodeType !== 9 ) { + if ( elem.nodeType === 1 ) { + if ( truncate && jQuery( elem ).is( until ) ) { + break; + } + matched.push( elem ); + } + } + return matched; +}; + + +var siblings = function( n, elem ) { + var matched = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + matched.push( n ); + } + } + + return matched; +}; + + +var rneedsContext = jQuery.expr.match.needsContext; + + + +function nodeName( elem, name ) { + + return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase(); + +}; +var rsingleTag = ( /^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i ); + + + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, not ) { + if ( isFunction( qualifier ) ) { + return jQuery.grep( elements, function( elem, i ) { + return !!qualifier.call( elem, i, elem ) !== not; + } ); + } + + // Single element + if ( qualifier.nodeType ) { + return jQuery.grep( elements, function( elem ) { + return ( elem === qualifier ) !== not; + } ); + } + + // Arraylike of elements (jQuery, arguments, Array) + if ( typeof qualifier !== "string" ) { + return jQuery.grep( elements, function( elem ) { + return ( indexOf.call( qualifier, elem ) > -1 ) !== not; + } ); + } + + // Filtered directly for both simple and complex selectors + return jQuery.filter( qualifier, elements, not ); +} + +jQuery.filter = function( expr, elems, not ) { + var elem = elems[ 0 ]; + + if ( not ) { + expr = ":not(" + expr + ")"; + } + + if ( elems.length === 1 && elem.nodeType === 1 ) { + return jQuery.find.matchesSelector( elem, expr ) ? [ elem ] : []; + } + + return jQuery.find.matches( expr, jQuery.grep( elems, function( elem ) { + return elem.nodeType === 1; + } ) ); +}; + +jQuery.fn.extend( { + find: function( selector ) { + var i, ret, + len = this.length, + self = this; + + if ( typeof selector !== "string" ) { + return this.pushStack( jQuery( selector ).filter( function() { + for ( i = 0; i < len; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + } ) ); + } + + ret = this.pushStack( [] ); + + for ( i = 0; i < len; i++ ) { + jQuery.find( selector, self[ i ], ret ); + } + + return len > 1 ? jQuery.uniqueSort( ret ) : ret; + }, + filter: function( selector ) { + return this.pushStack( winnow( this, selector || [], false ) ); + }, + not: function( selector ) { + return this.pushStack( winnow( this, selector || [], true ) ); + }, + is: function( selector ) { + return !!winnow( + this, + + // If this is a positional/relative selector, check membership in the returned set + // so $("p:first").is("p:last") won't return true for a doc with two "p". + typeof selector === "string" && rneedsContext.test( selector ) ? + jQuery( selector ) : + selector || [], + false + ).length; + } +} ); + + +// Initialize a jQuery object + + +// A central reference to the root jQuery(document) +var rootjQuery, + + // A simple way to check for HTML strings + // Prioritize #id over to avoid XSS via location.hash (#9521) + // Strict HTML recognition (#11290: must start with <) + // Shortcut simple #id case for speed + rquickExpr = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/, + + init = jQuery.fn.init = function( selector, context, root ) { + var match, elem; + + // HANDLE: $(""), $(null), $(undefined), $(false) + if ( !selector ) { + return this; + } + + // Method init() accepts an alternate rootjQuery + // so migrate can support jQuery.sub (gh-2101) + root = root || rootjQuery; + + // Handle HTML strings + if ( typeof selector === "string" ) { + if ( selector[ 0 ] === "<" && + selector[ selector.length - 1 ] === ">" && + selector.length >= 3 ) { + + // Assume that strings that start and end with <> are HTML and skip the regex check + match = [ null, selector, null ]; + + } else { + match = rquickExpr.exec( selector ); + } + + // Match html or make sure no context is specified for #id + if ( match && ( match[ 1 ] || !context ) ) { + + // HANDLE: $(html) -> $(array) + if ( match[ 1 ] ) { + context = context instanceof jQuery ? context[ 0 ] : context; + + // Option to run scripts is true for back-compat + // Intentionally let the error be thrown if parseHTML is not present + jQuery.merge( this, jQuery.parseHTML( + match[ 1 ], + context && context.nodeType ? context.ownerDocument || context : document, + true + ) ); + + // HANDLE: $(html, props) + if ( rsingleTag.test( match[ 1 ] ) && jQuery.isPlainObject( context ) ) { + for ( match in context ) { + + // Properties of context are called as methods if possible + if ( isFunction( this[ match ] ) ) { + this[ match ]( context[ match ] ); + + // ...and otherwise set as attributes + } else { + this.attr( match, context[ match ] ); + } + } + } + + return this; + + // HANDLE: $(#id) + } else { + elem = document.getElementById( match[ 2 ] ); + + if ( elem ) { + + // Inject the element directly into the jQuery object + this[ 0 ] = elem; + this.length = 1; + } + return this; + } + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return ( context || root ).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor( context ).find( selector ); + } + + // HANDLE: $(DOMElement) + } else if ( selector.nodeType ) { + this[ 0 ] = selector; + this.length = 1; + return this; + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( isFunction( selector ) ) { + return root.ready !== undefined ? + root.ready( selector ) : + + // Execute immediately if ready is not present + selector( jQuery ); + } + + return jQuery.makeArray( selector, this ); + }; + +// Give the init function the jQuery prototype for later instantiation +init.prototype = jQuery.fn; + +// Initialize central reference +rootjQuery = jQuery( document ); + + +var rparentsprev = /^(?:parents|prev(?:Until|All))/, + + // Methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend( { + has: function( target ) { + var targets = jQuery( target, this ), + l = targets.length; + + return this.filter( function() { + var i = 0; + for ( ; i < l; i++ ) { + if ( jQuery.contains( this, targets[ i ] ) ) { + return true; + } + } + } ); + }, + + closest: function( selectors, context ) { + var cur, + i = 0, + l = this.length, + matched = [], + targets = typeof selectors !== "string" && jQuery( selectors ); + + // Positional selectors never match, since there's no _selection_ context + if ( !rneedsContext.test( selectors ) ) { + for ( ; i < l; i++ ) { + for ( cur = this[ i ]; cur && cur !== context; cur = cur.parentNode ) { + + // Always skip document fragments + if ( cur.nodeType < 11 && ( targets ? + targets.index( cur ) > -1 : + + // Don't pass non-elements to Sizzle + cur.nodeType === 1 && + jQuery.find.matchesSelector( cur, selectors ) ) ) { + + matched.push( cur ); + break; + } + } + } + } + + return this.pushStack( matched.length > 1 ? jQuery.uniqueSort( matched ) : matched ); + }, + + // Determine the position of an element within the set + index: function( elem ) { + + // No argument, return index in parent + if ( !elem ) { + return ( this[ 0 ] && this[ 0 ].parentNode ) ? this.first().prevAll().length : -1; + } + + // Index in selector + if ( typeof elem === "string" ) { + return indexOf.call( jQuery( elem ), this[ 0 ] ); + } + + // Locate the position of the desired element + return indexOf.call( this, + + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[ 0 ] : elem + ); + }, + + add: function( selector, context ) { + return this.pushStack( + jQuery.uniqueSort( + jQuery.merge( this.get(), jQuery( selector, context ) ) + ) + ); + }, + + addBack: function( selector ) { + return this.add( selector == null ? + this.prevObject : this.prevObject.filter( selector ) + ); + } +} ); + +function sibling( cur, dir ) { + while ( ( cur = cur[ dir ] ) && cur.nodeType !== 1 ) {} + return cur; +} + +jQuery.each( { + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, _i, until ) { + return dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return sibling( elem, "nextSibling" ); + }, + prev: function( elem ) { + return sibling( elem, "previousSibling" ); + }, + nextAll: function( elem ) { + return dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, _i, until ) { + return dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, _i, until ) { + return dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return siblings( ( elem.parentNode || {} ).firstChild, elem ); + }, + children: function( elem ) { + return siblings( elem.firstChild ); + }, + contents: function( elem ) { + if ( elem.contentDocument != null && + + // Support: IE 11+ + // elements with no `data` attribute has an object + // `contentDocument` with a `null` prototype. + getProto( elem.contentDocument ) ) { + + return elem.contentDocument; + } + + // Support: IE 9 - 11 only, iOS 7 only, Android Browser <=4.3 only + // Treat the template element as a regular one in browsers that + // don't support it. + if ( nodeName( elem, "template" ) ) { + elem = elem.content || elem; + } + + return jQuery.merge( [], elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var matched = jQuery.map( this, fn, until ); + + if ( name.slice( -5 ) !== "Until" ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + matched = jQuery.filter( selector, matched ); + } + + if ( this.length > 1 ) { + + // Remove duplicates + if ( !guaranteedUnique[ name ] ) { + jQuery.uniqueSort( matched ); + } + + // Reverse order for parents* and prev-derivatives + if ( rparentsprev.test( name ) ) { + matched.reverse(); + } + } + + return this.pushStack( matched ); + }; +} ); +var rnothtmlwhite = ( /[^\x20\t\r\n\f]+/g ); + + + +// Convert String-formatted options into Object-formatted ones +function createOptions( options ) { + var object = {}; + jQuery.each( options.match( rnothtmlwhite ) || [], function( _, flag ) { + object[ flag ] = true; + } ); + return object; +} + +/* + * Create a callback list using the following parameters: + * + * options: an optional list of space-separated options that will change how + * the callback list behaves or a more traditional option object + * + * By default a callback list will act like an event callback list and can be + * "fired" multiple times. + * + * Possible options: + * + * once: will ensure the callback list can only be fired once (like a Deferred) + * + * memory: will keep track of previous values and will call any callback added + * after the list has been fired right away with the latest "memorized" + * values (like a Deferred) + * + * unique: will ensure a callback can only be added once (no duplicate in the list) + * + * stopOnFalse: interrupt callings when a callback returns false + * + */ +jQuery.Callbacks = function( options ) { + + // Convert options from String-formatted to Object-formatted if needed + // (we check in cache first) + options = typeof options === "string" ? + createOptions( options ) : + jQuery.extend( {}, options ); + + var // Flag to know if list is currently firing + firing, + + // Last fire value for non-forgettable lists + memory, + + // Flag to know if list was already fired + fired, + + // Flag to prevent firing + locked, + + // Actual callback list + list = [], + + // Queue of execution data for repeatable lists + queue = [], + + // Index of currently firing callback (modified by add/remove as needed) + firingIndex = -1, + + // Fire callbacks + fire = function() { + + // Enforce single-firing + locked = locked || options.once; + + // Execute callbacks for all pending executions, + // respecting firingIndex overrides and runtime changes + fired = firing = true; + for ( ; queue.length; firingIndex = -1 ) { + memory = queue.shift(); + while ( ++firingIndex < list.length ) { + + // Run callback and check for early termination + if ( list[ firingIndex ].apply( memory[ 0 ], memory[ 1 ] ) === false && + options.stopOnFalse ) { + + // Jump to end and forget the data so .add doesn't re-fire + firingIndex = list.length; + memory = false; + } + } + } + + // Forget the data if we're done with it + if ( !options.memory ) { + memory = false; + } + + firing = false; + + // Clean up if we're done firing for good + if ( locked ) { + + // Keep an empty list if we have data for future add calls + if ( memory ) { + list = []; + + // Otherwise, this object is spent + } else { + list = ""; + } + } + }, + + // Actual Callbacks object + self = { + + // Add a callback or a collection of callbacks to the list + add: function() { + if ( list ) { + + // If we have memory from a past run, we should fire after adding + if ( memory && !firing ) { + firingIndex = list.length - 1; + queue.push( memory ); + } + + ( function add( args ) { + jQuery.each( args, function( _, arg ) { + if ( isFunction( arg ) ) { + if ( !options.unique || !self.has( arg ) ) { + list.push( arg ); + } + } else if ( arg && arg.length && toType( arg ) !== "string" ) { + + // Inspect recursively + add( arg ); + } + } ); + } )( arguments ); + + if ( memory && !firing ) { + fire(); + } + } + return this; + }, + + // Remove a callback from the list + remove: function() { + jQuery.each( arguments, function( _, arg ) { + var index; + while ( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) { + list.splice( index, 1 ); + + // Handle firing indexes + if ( index <= firingIndex ) { + firingIndex--; + } + } + } ); + return this; + }, + + // Check if a given callback is in the list. + // If no argument is given, return whether or not list has callbacks attached. + has: function( fn ) { + return fn ? + jQuery.inArray( fn, list ) > -1 : + list.length > 0; + }, + + // Remove all callbacks from the list + empty: function() { + if ( list ) { + list = []; + } + return this; + }, + + // Disable .fire and .add + // Abort any current/pending executions + // Clear all callbacks and values + disable: function() { + locked = queue = []; + list = memory = ""; + return this; + }, + disabled: function() { + return !list; + }, + + // Disable .fire + // Also disable .add unless we have memory (since it would have no effect) + // Abort any pending executions + lock: function() { + locked = queue = []; + if ( !memory && !firing ) { + list = memory = ""; + } + return this; + }, + locked: function() { + return !!locked; + }, + + // Call all callbacks with the given context and arguments + fireWith: function( context, args ) { + if ( !locked ) { + args = args || []; + args = [ context, args.slice ? args.slice() : args ]; + queue.push( args ); + if ( !firing ) { + fire(); + } + } + return this; + }, + + // Call all the callbacks with the given arguments + fire: function() { + self.fireWith( this, arguments ); + return this; + }, + + // To know if the callbacks have already been called at least once + fired: function() { + return !!fired; + } + }; + + return self; +}; + + +function Identity( v ) { + return v; +} +function Thrower( ex ) { + throw ex; +} + +function adoptValue( value, resolve, reject, noValue ) { + var method; + + try { + + // Check for promise aspect first to privilege synchronous behavior + if ( value && isFunction( ( method = value.promise ) ) ) { + method.call( value ).done( resolve ).fail( reject ); + + // Other thenables + } else if ( value && isFunction( ( method = value.then ) ) ) { + method.call( value, resolve, reject ); + + // Other non-thenables + } else { + + // Control `resolve` arguments by letting Array#slice cast boolean `noValue` to integer: + // * false: [ value ].slice( 0 ) => resolve( value ) + // * true: [ value ].slice( 1 ) => resolve() + resolve.apply( undefined, [ value ].slice( noValue ) ); + } + + // For Promises/A+, convert exceptions into rejections + // Since jQuery.when doesn't unwrap thenables, we can skip the extra checks appearing in + // Deferred#then to conditionally suppress rejection. + } catch ( value ) { + + // Support: Android 4.0 only + // Strict mode functions invoked without .call/.apply get global-object context + reject.apply( undefined, [ value ] ); + } +} + +jQuery.extend( { + + Deferred: function( func ) { + var tuples = [ + + // action, add listener, callbacks, + // ... .then handlers, argument index, [final state] + [ "notify", "progress", jQuery.Callbacks( "memory" ), + jQuery.Callbacks( "memory" ), 2 ], + [ "resolve", "done", jQuery.Callbacks( "once memory" ), + jQuery.Callbacks( "once memory" ), 0, "resolved" ], + [ "reject", "fail", jQuery.Callbacks( "once memory" ), + jQuery.Callbacks( "once memory" ), 1, "rejected" ] + ], + state = "pending", + promise = { + state: function() { + return state; + }, + always: function() { + deferred.done( arguments ).fail( arguments ); + return this; + }, + "catch": function( fn ) { + return promise.then( null, fn ); + }, + + // Keep pipe for back-compat + pipe: function( /* fnDone, fnFail, fnProgress */ ) { + var fns = arguments; + + return jQuery.Deferred( function( newDefer ) { + jQuery.each( tuples, function( _i, tuple ) { + + // Map tuples (progress, done, fail) to arguments (done, fail, progress) + var fn = isFunction( fns[ tuple[ 4 ] ] ) && fns[ tuple[ 4 ] ]; + + // deferred.progress(function() { bind to newDefer or newDefer.notify }) + // deferred.done(function() { bind to newDefer or newDefer.resolve }) + // deferred.fail(function() { bind to newDefer or newDefer.reject }) + deferred[ tuple[ 1 ] ]( function() { + var returned = fn && fn.apply( this, arguments ); + if ( returned && isFunction( returned.promise ) ) { + returned.promise() + .progress( newDefer.notify ) + .done( newDefer.resolve ) + .fail( newDefer.reject ); + } else { + newDefer[ tuple[ 0 ] + "With" ]( + this, + fn ? [ returned ] : arguments + ); + } + } ); + } ); + fns = null; + } ).promise(); + }, + then: function( onFulfilled, onRejected, onProgress ) { + var maxDepth = 0; + function resolve( depth, deferred, handler, special ) { + return function() { + var that = this, + args = arguments, + mightThrow = function() { + var returned, then; + + // Support: Promises/A+ section 2.3.3.3.3 + // https://promisesaplus.com/#point-59 + // Ignore double-resolution attempts + if ( depth < maxDepth ) { + return; + } + + returned = handler.apply( that, args ); + + // Support: Promises/A+ section 2.3.1 + // https://promisesaplus.com/#point-48 + if ( returned === deferred.promise() ) { + throw new TypeError( "Thenable self-resolution" ); + } + + // Support: Promises/A+ sections 2.3.3.1, 3.5 + // https://promisesaplus.com/#point-54 + // https://promisesaplus.com/#point-75 + // Retrieve `then` only once + then = returned && + + // Support: Promises/A+ section 2.3.4 + // https://promisesaplus.com/#point-64 + // Only check objects and functions for thenability + ( typeof returned === "object" || + typeof returned === "function" ) && + returned.then; + + // Handle a returned thenable + if ( isFunction( then ) ) { + + // Special processors (notify) just wait for resolution + if ( special ) { + then.call( + returned, + resolve( maxDepth, deferred, Identity, special ), + resolve( maxDepth, deferred, Thrower, special ) + ); + + // Normal processors (resolve) also hook into progress + } else { + + // ...and disregard older resolution values + maxDepth++; + + then.call( + returned, + resolve( maxDepth, deferred, Identity, special ), + resolve( maxDepth, deferred, Thrower, special ), + resolve( maxDepth, deferred, Identity, + deferred.notifyWith ) + ); + } + + // Handle all other returned values + } else { + + // Only substitute handlers pass on context + // and multiple values (non-spec behavior) + if ( handler !== Identity ) { + that = undefined; + args = [ returned ]; + } + + // Process the value(s) + // Default process is resolve + ( special || deferred.resolveWith )( that, args ); + } + }, + + // Only normal processors (resolve) catch and reject exceptions + process = special ? + mightThrow : + function() { + try { + mightThrow(); + } catch ( e ) { + + if ( jQuery.Deferred.exceptionHook ) { + jQuery.Deferred.exceptionHook( e, + process.stackTrace ); + } + + // Support: Promises/A+ section 2.3.3.3.4.1 + // https://promisesaplus.com/#point-61 + // Ignore post-resolution exceptions + if ( depth + 1 >= maxDepth ) { + + // Only substitute handlers pass on context + // and multiple values (non-spec behavior) + if ( handler !== Thrower ) { + that = undefined; + args = [ e ]; + } + + deferred.rejectWith( that, args ); + } + } + }; + + // Support: Promises/A+ section 2.3.3.3.1 + // https://promisesaplus.com/#point-57 + // Re-resolve promises immediately to dodge false rejection from + // subsequent errors + if ( depth ) { + process(); + } else { + + // Call an optional hook to record the stack, in case of exception + // since it's otherwise lost when execution goes async + if ( jQuery.Deferred.getStackHook ) { + process.stackTrace = jQuery.Deferred.getStackHook(); + } + window.setTimeout( process ); + } + }; + } + + return jQuery.Deferred( function( newDefer ) { + + // progress_handlers.add( ... ) + tuples[ 0 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onProgress ) ? + onProgress : + Identity, + newDefer.notifyWith + ) + ); + + // fulfilled_handlers.add( ... ) + tuples[ 1 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onFulfilled ) ? + onFulfilled : + Identity + ) + ); + + // rejected_handlers.add( ... ) + tuples[ 2 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onRejected ) ? + onRejected : + Thrower + ) + ); + } ).promise(); + }, + + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + return obj != null ? jQuery.extend( obj, promise ) : promise; + } + }, + deferred = {}; + + // Add list-specific methods + jQuery.each( tuples, function( i, tuple ) { + var list = tuple[ 2 ], + stateString = tuple[ 5 ]; + + // promise.progress = list.add + // promise.done = list.add + // promise.fail = list.add + promise[ tuple[ 1 ] ] = list.add; + + // Handle state + if ( stateString ) { + list.add( + function() { + + // state = "resolved" (i.e., fulfilled) + // state = "rejected" + state = stateString; + }, + + // rejected_callbacks.disable + // fulfilled_callbacks.disable + tuples[ 3 - i ][ 2 ].disable, + + // rejected_handlers.disable + // fulfilled_handlers.disable + tuples[ 3 - i ][ 3 ].disable, + + // progress_callbacks.lock + tuples[ 0 ][ 2 ].lock, + + // progress_handlers.lock + tuples[ 0 ][ 3 ].lock + ); + } + + // progress_handlers.fire + // fulfilled_handlers.fire + // rejected_handlers.fire + list.add( tuple[ 3 ].fire ); + + // deferred.notify = function() { deferred.notifyWith(...) } + // deferred.resolve = function() { deferred.resolveWith(...) } + // deferred.reject = function() { deferred.rejectWith(...) } + deferred[ tuple[ 0 ] ] = function() { + deferred[ tuple[ 0 ] + "With" ]( this === deferred ? undefined : this, arguments ); + return this; + }; + + // deferred.notifyWith = list.fireWith + // deferred.resolveWith = list.fireWith + // deferred.rejectWith = list.fireWith + deferred[ tuple[ 0 ] + "With" ] = list.fireWith; + } ); + + // Make the deferred a promise + promise.promise( deferred ); + + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + + // All done! + return deferred; + }, + + // Deferred helper + when: function( singleValue ) { + var + + // count of uncompleted subordinates + remaining = arguments.length, + + // count of unprocessed arguments + i = remaining, + + // subordinate fulfillment data + resolveContexts = Array( i ), + resolveValues = slice.call( arguments ), + + // the master Deferred + master = jQuery.Deferred(), + + // subordinate callback factory + updateFunc = function( i ) { + return function( value ) { + resolveContexts[ i ] = this; + resolveValues[ i ] = arguments.length > 1 ? slice.call( arguments ) : value; + if ( !( --remaining ) ) { + master.resolveWith( resolveContexts, resolveValues ); + } + }; + }; + + // Single- and empty arguments are adopted like Promise.resolve + if ( remaining <= 1 ) { + adoptValue( singleValue, master.done( updateFunc( i ) ).resolve, master.reject, + !remaining ); + + // Use .then() to unwrap secondary thenables (cf. gh-3000) + if ( master.state() === "pending" || + isFunction( resolveValues[ i ] && resolveValues[ i ].then ) ) { + + return master.then(); + } + } + + // Multiple arguments are aggregated like Promise.all array elements + while ( i-- ) { + adoptValue( resolveValues[ i ], updateFunc( i ), master.reject ); + } + + return master.promise(); + } +} ); + + +// These usually indicate a programmer mistake during development, +// warn about them ASAP rather than swallowing them by default. +var rerrorNames = /^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/; + +jQuery.Deferred.exceptionHook = function( error, stack ) { + + // Support: IE 8 - 9 only + // Console exists when dev tools are open, which can happen at any time + if ( window.console && window.console.warn && error && rerrorNames.test( error.name ) ) { + window.console.warn( "jQuery.Deferred exception: " + error.message, error.stack, stack ); + } +}; + + + + +jQuery.readyException = function( error ) { + window.setTimeout( function() { + throw error; + } ); +}; + + + + +// The deferred used on DOM ready +var readyList = jQuery.Deferred(); + +jQuery.fn.ready = function( fn ) { + + readyList + .then( fn ) + + // Wrap jQuery.readyException in a function so that the lookup + // happens at the time of error handling instead of callback + // registration. + .catch( function( error ) { + jQuery.readyException( error ); + } ); + + return this; +}; + +jQuery.extend( { + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Handle when the DOM is ready + ready: function( wait ) { + + // Abort if there are pending holds or we're already ready + if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) { + return; + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.resolveWith( document, [ jQuery ] ); + } +} ); + +jQuery.ready.then = readyList.then; + +// The ready event handler and self cleanup method +function completed() { + document.removeEventListener( "DOMContentLoaded", completed ); + window.removeEventListener( "load", completed ); + jQuery.ready(); +} + +// Catch cases where $(document).ready() is called +// after the browser event has already occurred. +// Support: IE <=9 - 10 only +// Older IE sometimes signals "interactive" too soon +if ( document.readyState === "complete" || + ( document.readyState !== "loading" && !document.documentElement.doScroll ) ) { + + // Handle it asynchronously to allow scripts the opportunity to delay ready + window.setTimeout( jQuery.ready ); + +} else { + + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", completed ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", completed ); +} + + + + +// Multifunctional method to get and set values of a collection +// The value/s can optionally be executed if it's a function +var access = function( elems, fn, key, value, chainable, emptyGet, raw ) { + var i = 0, + len = elems.length, + bulk = key == null; + + // Sets many values + if ( toType( key ) === "object" ) { + chainable = true; + for ( i in key ) { + access( elems, fn, i, key[ i ], true, emptyGet, raw ); + } + + // Sets one value + } else if ( value !== undefined ) { + chainable = true; + + if ( !isFunction( value ) ) { + raw = true; + } + + if ( bulk ) { + + // Bulk operations run against the entire set + if ( raw ) { + fn.call( elems, value ); + fn = null; + + // ...except when executing function values + } else { + bulk = fn; + fn = function( elem, _key, value ) { + return bulk.call( jQuery( elem ), value ); + }; + } + } + + if ( fn ) { + for ( ; i < len; i++ ) { + fn( + elems[ i ], key, raw ? + value : + value.call( elems[ i ], i, fn( elems[ i ], key ) ) + ); + } + } + } + + if ( chainable ) { + return elems; + } + + // Gets + if ( bulk ) { + return fn.call( elems ); + } + + return len ? fn( elems[ 0 ], key ) : emptyGet; +}; + + +// Matches dashed string for camelizing +var rmsPrefix = /^-ms-/, + rdashAlpha = /-([a-z])/g; + +// Used by camelCase as callback to replace() +function fcamelCase( _all, letter ) { + return letter.toUpperCase(); +} + +// Convert dashed to camelCase; used by the css and data modules +// Support: IE <=9 - 11, Edge 12 - 15 +// Microsoft forgot to hump their vendor prefix (#9572) +function camelCase( string ) { + return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); +} +var acceptData = function( owner ) { + + // Accepts only: + // - Node + // - Node.ELEMENT_NODE + // - Node.DOCUMENT_NODE + // - Object + // - Any + return owner.nodeType === 1 || owner.nodeType === 9 || !( +owner.nodeType ); +}; + + + + +function Data() { + this.expando = jQuery.expando + Data.uid++; +} + +Data.uid = 1; + +Data.prototype = { + + cache: function( owner ) { + + // Check if the owner object already has a cache + var value = owner[ this.expando ]; + + // If not, create one + if ( !value ) { + value = {}; + + // We can accept data for non-element nodes in modern browsers, + // but we should not, see #8335. + // Always return an empty object. + if ( acceptData( owner ) ) { + + // If it is a node unlikely to be stringify-ed or looped over + // use plain assignment + if ( owner.nodeType ) { + owner[ this.expando ] = value; + + // Otherwise secure it in a non-enumerable property + // configurable must be true to allow the property to be + // deleted when data is removed + } else { + Object.defineProperty( owner, this.expando, { + value: value, + configurable: true + } ); + } + } + } + + return value; + }, + set: function( owner, data, value ) { + var prop, + cache = this.cache( owner ); + + // Handle: [ owner, key, value ] args + // Always use camelCase key (gh-2257) + if ( typeof data === "string" ) { + cache[ camelCase( data ) ] = value; + + // Handle: [ owner, { properties } ] args + } else { + + // Copy the properties one-by-one to the cache object + for ( prop in data ) { + cache[ camelCase( prop ) ] = data[ prop ]; + } + } + return cache; + }, + get: function( owner, key ) { + return key === undefined ? + this.cache( owner ) : + + // Always use camelCase key (gh-2257) + owner[ this.expando ] && owner[ this.expando ][ camelCase( key ) ]; + }, + access: function( owner, key, value ) { + + // In cases where either: + // + // 1. No key was specified + // 2. A string key was specified, but no value provided + // + // Take the "read" path and allow the get method to determine + // which value to return, respectively either: + // + // 1. The entire cache object + // 2. The data stored at the key + // + if ( key === undefined || + ( ( key && typeof key === "string" ) && value === undefined ) ) { + + return this.get( owner, key ); + } + + // When the key is not a string, or both a key and value + // are specified, set or extend (existing objects) with either: + // + // 1. An object of properties + // 2. A key and value + // + this.set( owner, key, value ); + + // Since the "set" path can have two possible entry points + // return the expected data based on which path was taken[*] + return value !== undefined ? value : key; + }, + remove: function( owner, key ) { + var i, + cache = owner[ this.expando ]; + + if ( cache === undefined ) { + return; + } + + if ( key !== undefined ) { + + // Support array or space separated string of keys + if ( Array.isArray( key ) ) { + + // If key is an array of keys... + // We always set camelCase keys, so remove that. + key = key.map( camelCase ); + } else { + key = camelCase( key ); + + // If a key with the spaces exists, use it. + // Otherwise, create an array by matching non-whitespace + key = key in cache ? + [ key ] : + ( key.match( rnothtmlwhite ) || [] ); + } + + i = key.length; + + while ( i-- ) { + delete cache[ key[ i ] ]; + } + } + + // Remove the expando if there's no more data + if ( key === undefined || jQuery.isEmptyObject( cache ) ) { + + // Support: Chrome <=35 - 45 + // Webkit & Blink performance suffers when deleting properties + // from DOM nodes, so set to undefined instead + // https://bugs.chromium.org/p/chromium/issues/detail?id=378607 (bug restricted) + if ( owner.nodeType ) { + owner[ this.expando ] = undefined; + } else { + delete owner[ this.expando ]; + } + } + }, + hasData: function( owner ) { + var cache = owner[ this.expando ]; + return cache !== undefined && !jQuery.isEmptyObject( cache ); + } +}; +var dataPriv = new Data(); + +var dataUser = new Data(); + + + +// Implementation Summary +// +// 1. Enforce API surface and semantic compatibility with 1.9.x branch +// 2. Improve the module's maintainability by reducing the storage +// paths to a single mechanism. +// 3. Use the same single mechanism to support "private" and "user" data. +// 4. _Never_ expose "private" data to user code (TODO: Drop _data, _removeData) +// 5. Avoid exposing implementation details on user objects (eg. expando properties) +// 6. Provide a clear path for implementation upgrade to WeakMap in 2014 + +var rbrace = /^(?:\{[\w\W]*\}|\[[\w\W]*\])$/, + rmultiDash = /[A-Z]/g; + +function getData( data ) { + if ( data === "true" ) { + return true; + } + + if ( data === "false" ) { + return false; + } + + if ( data === "null" ) { + return null; + } + + // Only convert to a number if it doesn't change the string + if ( data === +data + "" ) { + return +data; + } + + if ( rbrace.test( data ) ) { + return JSON.parse( data ); + } + + return data; +} + +function dataAttr( elem, key, data ) { + var name; + + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + name = "data-" + key.replace( rmultiDash, "-$&" ).toLowerCase(); + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = getData( data ); + } catch ( e ) {} + + // Make sure we set the data so it isn't changed later + dataUser.set( elem, key, data ); + } else { + data = undefined; + } + } + return data; +} + +jQuery.extend( { + hasData: function( elem ) { + return dataUser.hasData( elem ) || dataPriv.hasData( elem ); + }, + + data: function( elem, name, data ) { + return dataUser.access( elem, name, data ); + }, + + removeData: function( elem, name ) { + dataUser.remove( elem, name ); + }, + + // TODO: Now that all calls to _data and _removeData have been replaced + // with direct calls to dataPriv methods, these can be deprecated. + _data: function( elem, name, data ) { + return dataPriv.access( elem, name, data ); + }, + + _removeData: function( elem, name ) { + dataPriv.remove( elem, name ); + } +} ); + +jQuery.fn.extend( { + data: function( key, value ) { + var i, name, data, + elem = this[ 0 ], + attrs = elem && elem.attributes; + + // Gets all values + if ( key === undefined ) { + if ( this.length ) { + data = dataUser.get( elem ); + + if ( elem.nodeType === 1 && !dataPriv.get( elem, "hasDataAttrs" ) ) { + i = attrs.length; + while ( i-- ) { + + // Support: IE 11 only + // The attrs elements can be null (#14894) + if ( attrs[ i ] ) { + name = attrs[ i ].name; + if ( name.indexOf( "data-" ) === 0 ) { + name = camelCase( name.slice( 5 ) ); + dataAttr( elem, name, data[ name ] ); + } + } + } + dataPriv.set( elem, "hasDataAttrs", true ); + } + } + + return data; + } + + // Sets multiple values + if ( typeof key === "object" ) { + return this.each( function() { + dataUser.set( this, key ); + } ); + } + + return access( this, function( value ) { + var data; + + // The calling jQuery object (element matches) is not empty + // (and therefore has an element appears at this[ 0 ]) and the + // `value` parameter was not undefined. An empty jQuery object + // will result in `undefined` for elem = this[ 0 ] which will + // throw an exception if an attempt to read a data cache is made. + if ( elem && value === undefined ) { + + // Attempt to get data from the cache + // The key will always be camelCased in Data + data = dataUser.get( elem, key ); + if ( data !== undefined ) { + return data; + } + + // Attempt to "discover" the data in + // HTML5 custom data-* attrs + data = dataAttr( elem, key ); + if ( data !== undefined ) { + return data; + } + + // We tried really hard, but the data doesn't exist. + return; + } + + // Set the data... + this.each( function() { + + // We always store the camelCased key + dataUser.set( this, key, value ); + } ); + }, null, value, arguments.length > 1, null, true ); + }, + + removeData: function( key ) { + return this.each( function() { + dataUser.remove( this, key ); + } ); + } +} ); + + +jQuery.extend( { + queue: function( elem, type, data ) { + var queue; + + if ( elem ) { + type = ( type || "fx" ) + "queue"; + queue = dataPriv.get( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !queue || Array.isArray( data ) ) { + queue = dataPriv.access( elem, type, jQuery.makeArray( data ) ); + } else { + queue.push( data ); + } + } + return queue || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + startLength = queue.length, + fn = queue.shift(), + hooks = jQuery._queueHooks( elem, type ), + next = function() { + jQuery.dequeue( elem, type ); + }; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + startLength--; + } + + if ( fn ) { + + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift( "inprogress" ); + } + + // Clear up the last queue stop function + delete hooks.stop; + fn.call( elem, next, hooks ); + } + + if ( !startLength && hooks ) { + hooks.empty.fire(); + } + }, + + // Not public - generate a queueHooks object, or return the current one + _queueHooks: function( elem, type ) { + var key = type + "queueHooks"; + return dataPriv.get( elem, key ) || dataPriv.access( elem, key, { + empty: jQuery.Callbacks( "once memory" ).add( function() { + dataPriv.remove( elem, [ type + "queue", key ] ); + } ) + } ); + } +} ); + +jQuery.fn.extend( { + queue: function( type, data ) { + var setter = 2; + + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + setter--; + } + + if ( arguments.length < setter ) { + return jQuery.queue( this[ 0 ], type ); + } + + return data === undefined ? + this : + this.each( function() { + var queue = jQuery.queue( this, type, data ); + + // Ensure a hooks for this queue + jQuery._queueHooks( this, type ); + + if ( type === "fx" && queue[ 0 ] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + } ); + }, + dequeue: function( type ) { + return this.each( function() { + jQuery.dequeue( this, type ); + } ); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, obj ) { + var tmp, + count = 1, + defer = jQuery.Deferred(), + elements = this, + i = this.length, + resolve = function() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + }; + + if ( typeof type !== "string" ) { + obj = type; + type = undefined; + } + type = type || "fx"; + + while ( i-- ) { + tmp = dataPriv.get( elements[ i ], type + "queueHooks" ); + if ( tmp && tmp.empty ) { + count++; + tmp.empty.add( resolve ); + } + } + resolve(); + return defer.promise( obj ); + } +} ); +var pnum = ( /[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/ ).source; + +var rcssNum = new RegExp( "^(?:([+-])=|)(" + pnum + ")([a-z%]*)$", "i" ); + + +var cssExpand = [ "Top", "Right", "Bottom", "Left" ]; + +var documentElement = document.documentElement; + + + + var isAttached = function( elem ) { + return jQuery.contains( elem.ownerDocument, elem ); + }, + composed = { composed: true }; + + // Support: IE 9 - 11+, Edge 12 - 18+, iOS 10.0 - 10.2 only + // Check attachment across shadow DOM boundaries when possible (gh-3504) + // Support: iOS 10.0-10.2 only + // Early iOS 10 versions support `attachShadow` but not `getRootNode`, + // leading to errors. We need to check for `getRootNode`. + if ( documentElement.getRootNode ) { + isAttached = function( elem ) { + return jQuery.contains( elem.ownerDocument, elem ) || + elem.getRootNode( composed ) === elem.ownerDocument; + }; + } +var isHiddenWithinTree = function( elem, el ) { + + // isHiddenWithinTree might be called from jQuery#filter function; + // in that case, element will be second argument + elem = el || elem; + + // Inline style trumps all + return elem.style.display === "none" || + elem.style.display === "" && + + // Otherwise, check computed style + // Support: Firefox <=43 - 45 + // Disconnected elements can have computed display: none, so first confirm that elem is + // in the document. + isAttached( elem ) && + + jQuery.css( elem, "display" ) === "none"; + }; + + + +function adjustCSS( elem, prop, valueParts, tween ) { + var adjusted, scale, + maxIterations = 20, + currentValue = tween ? + function() { + return tween.cur(); + } : + function() { + return jQuery.css( elem, prop, "" ); + }, + initial = currentValue(), + unit = valueParts && valueParts[ 3 ] || ( jQuery.cssNumber[ prop ] ? "" : "px" ), + + // Starting value computation is required for potential unit mismatches + initialInUnit = elem.nodeType && + ( jQuery.cssNumber[ prop ] || unit !== "px" && +initial ) && + rcssNum.exec( jQuery.css( elem, prop ) ); + + if ( initialInUnit && initialInUnit[ 3 ] !== unit ) { + + // Support: Firefox <=54 + // Halve the iteration target value to prevent interference from CSS upper bounds (gh-2144) + initial = initial / 2; + + // Trust units reported by jQuery.css + unit = unit || initialInUnit[ 3 ]; + + // Iteratively approximate from a nonzero starting point + initialInUnit = +initial || 1; + + while ( maxIterations-- ) { + + // Evaluate and update our best guess (doubling guesses that zero out). + // Finish if the scale equals or crosses 1 (making the old*new product non-positive). + jQuery.style( elem, prop, initialInUnit + unit ); + if ( ( 1 - scale ) * ( 1 - ( scale = currentValue() / initial || 0.5 ) ) <= 0 ) { + maxIterations = 0; + } + initialInUnit = initialInUnit / scale; + + } + + initialInUnit = initialInUnit * 2; + jQuery.style( elem, prop, initialInUnit + unit ); + + // Make sure we update the tween properties later on + valueParts = valueParts || []; + } + + if ( valueParts ) { + initialInUnit = +initialInUnit || +initial || 0; + + // Apply relative offset (+=/-=) if specified + adjusted = valueParts[ 1 ] ? + initialInUnit + ( valueParts[ 1 ] + 1 ) * valueParts[ 2 ] : + +valueParts[ 2 ]; + if ( tween ) { + tween.unit = unit; + tween.start = initialInUnit; + tween.end = adjusted; + } + } + return adjusted; +} + + +var defaultDisplayMap = {}; + +function getDefaultDisplay( elem ) { + var temp, + doc = elem.ownerDocument, + nodeName = elem.nodeName, + display = defaultDisplayMap[ nodeName ]; + + if ( display ) { + return display; + } + + temp = doc.body.appendChild( doc.createElement( nodeName ) ); + display = jQuery.css( temp, "display" ); + + temp.parentNode.removeChild( temp ); + + if ( display === "none" ) { + display = "block"; + } + defaultDisplayMap[ nodeName ] = display; + + return display; +} + +function showHide( elements, show ) { + var display, elem, + values = [], + index = 0, + length = elements.length; + + // Determine new display value for elements that need to change + for ( ; index < length; index++ ) { + elem = elements[ index ]; + if ( !elem.style ) { + continue; + } + + display = elem.style.display; + if ( show ) { + + // Since we force visibility upon cascade-hidden elements, an immediate (and slow) + // check is required in this first loop unless we have a nonempty display value (either + // inline or about-to-be-restored) + if ( display === "none" ) { + values[ index ] = dataPriv.get( elem, "display" ) || null; + if ( !values[ index ] ) { + elem.style.display = ""; + } + } + if ( elem.style.display === "" && isHiddenWithinTree( elem ) ) { + values[ index ] = getDefaultDisplay( elem ); + } + } else { + if ( display !== "none" ) { + values[ index ] = "none"; + + // Remember what we're overwriting + dataPriv.set( elem, "display", display ); + } + } + } + + // Set the display of the elements in a second loop to avoid constant reflow + for ( index = 0; index < length; index++ ) { + if ( values[ index ] != null ) { + elements[ index ].style.display = values[ index ]; + } + } + + return elements; +} + +jQuery.fn.extend( { + show: function() { + return showHide( this, true ); + }, + hide: function() { + return showHide( this ); + }, + toggle: function( state ) { + if ( typeof state === "boolean" ) { + return state ? this.show() : this.hide(); + } + + return this.each( function() { + if ( isHiddenWithinTree( this ) ) { + jQuery( this ).show(); + } else { + jQuery( this ).hide(); + } + } ); + } +} ); +var rcheckableType = ( /^(?:checkbox|radio)$/i ); + +var rtagName = ( /<([a-z][^\/\0>\x20\t\r\n\f]*)/i ); + +var rscriptType = ( /^$|^module$|\/(?:java|ecma)script/i ); + + + +( function() { + var fragment = document.createDocumentFragment(), + div = fragment.appendChild( document.createElement( "div" ) ), + input = document.createElement( "input" ); + + // Support: Android 4.0 - 4.3 only + // Check state lost if the name is set (#11217) + // Support: Windows Web Apps (WWA) + // `name` and `type` must use .setAttribute for WWA (#14901) + input.setAttribute( "type", "radio" ); + input.setAttribute( "checked", "checked" ); + input.setAttribute( "name", "t" ); + + div.appendChild( input ); + + // Support: Android <=4.1 only + // Older WebKit doesn't clone checked state correctly in fragments + support.checkClone = div.cloneNode( true ).cloneNode( true ).lastChild.checked; + + // Support: IE <=11 only + // Make sure textarea (and checkbox) defaultValue is properly cloned + div.innerHTML = ""; + support.noCloneChecked = !!div.cloneNode( true ).lastChild.defaultValue; + + // Support: IE <=9 only + // IE <=9 replaces "; + support.option = !!div.lastChild; +} )(); + + +// We have to close these tags to support XHTML (#13200) +var wrapMap = { + + // XHTML parsers do not magically insert elements in the + // same way that tag soup parsers do. So we cannot shorten + // this by omitting or other required elements. + thead: [ 1, "", "
" ], + col: [ 2, "", "
" ], + tr: [ 2, "", "
" ], + td: [ 3, "", "
" ], + + _default: [ 0, "", "" ] +}; + +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + +// Support: IE <=9 only +if ( !support.option ) { + wrapMap.optgroup = wrapMap.option = [ 1, "" ]; +} + + +function getAll( context, tag ) { + + // Support: IE <=9 - 11 only + // Use typeof to avoid zero-argument method invocation on host objects (#15151) + var ret; + + if ( typeof context.getElementsByTagName !== "undefined" ) { + ret = context.getElementsByTagName( tag || "*" ); + + } else if ( typeof context.querySelectorAll !== "undefined" ) { + ret = context.querySelectorAll( tag || "*" ); + + } else { + ret = []; + } + + if ( tag === undefined || tag && nodeName( context, tag ) ) { + return jQuery.merge( [ context ], ret ); + } + + return ret; +} + + +// Mark scripts as having already been evaluated +function setGlobalEval( elems, refElements ) { + var i = 0, + l = elems.length; + + for ( ; i < l; i++ ) { + dataPriv.set( + elems[ i ], + "globalEval", + !refElements || dataPriv.get( refElements[ i ], "globalEval" ) + ); + } +} + + +var rhtml = /<|&#?\w+;/; + +function buildFragment( elems, context, scripts, selection, ignored ) { + var elem, tmp, tag, wrap, attached, j, + fragment = context.createDocumentFragment(), + nodes = [], + i = 0, + l = elems.length; + + for ( ; i < l; i++ ) { + elem = elems[ i ]; + + if ( elem || elem === 0 ) { + + // Add nodes directly + if ( toType( elem ) === "object" ) { + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( nodes, elem.nodeType ? [ elem ] : elem ); + + // Convert non-html into a text node + } else if ( !rhtml.test( elem ) ) { + nodes.push( context.createTextNode( elem ) ); + + // Convert html into DOM nodes + } else { + tmp = tmp || fragment.appendChild( context.createElement( "div" ) ); + + // Deserialize a standard representation + tag = ( rtagName.exec( elem ) || [ "", "" ] )[ 1 ].toLowerCase(); + wrap = wrapMap[ tag ] || wrapMap._default; + tmp.innerHTML = wrap[ 1 ] + jQuery.htmlPrefilter( elem ) + wrap[ 2 ]; + + // Descend through wrappers to the right content + j = wrap[ 0 ]; + while ( j-- ) { + tmp = tmp.lastChild; + } + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( nodes, tmp.childNodes ); + + // Remember the top-level container + tmp = fragment.firstChild; + + // Ensure the created nodes are orphaned (#12392) + tmp.textContent = ""; + } + } + } + + // Remove wrapper from fragment + fragment.textContent = ""; + + i = 0; + while ( ( elem = nodes[ i++ ] ) ) { + + // Skip elements already in the context collection (trac-4087) + if ( selection && jQuery.inArray( elem, selection ) > -1 ) { + if ( ignored ) { + ignored.push( elem ); + } + continue; + } + + attached = isAttached( elem ); + + // Append to fragment + tmp = getAll( fragment.appendChild( elem ), "script" ); + + // Preserve script evaluation history + if ( attached ) { + setGlobalEval( tmp ); + } + + // Capture executables + if ( scripts ) { + j = 0; + while ( ( elem = tmp[ j++ ] ) ) { + if ( rscriptType.test( elem.type || "" ) ) { + scripts.push( elem ); + } + } + } + } + + return fragment; +} + + +var + rkeyEvent = /^key/, + rmouseEvent = /^(?:mouse|pointer|contextmenu|drag|drop)|click/, + rtypenamespace = /^([^.]*)(?:\.(.+)|)/; + +function returnTrue() { + return true; +} + +function returnFalse() { + return false; +} + +// Support: IE <=9 - 11+ +// focus() and blur() are asynchronous, except when they are no-op. +// So expect focus to be synchronous when the element is already active, +// and blur to be synchronous when the element is not already active. +// (focus and blur are always synchronous in other supported browsers, +// this just defines when we can count on it). +function expectSync( elem, type ) { + return ( elem === safeActiveElement() ) === ( type === "focus" ); +} + +// Support: IE <=9 only +// Accessing document.activeElement can throw unexpectedly +// https://bugs.jquery.com/ticket/13393 +function safeActiveElement() { + try { + return document.activeElement; + } catch ( err ) { } +} + +function on( elem, types, selector, data, fn, one ) { + var origFn, type; + + // Types can be a map of types/handlers + if ( typeof types === "object" ) { + + // ( types-Object, selector, data ) + if ( typeof selector !== "string" ) { + + // ( types-Object, data ) + data = data || selector; + selector = undefined; + } + for ( type in types ) { + on( elem, type, selector, data, types[ type ], one ); + } + return elem; + } + + if ( data == null && fn == null ) { + + // ( types, fn ) + fn = selector; + data = selector = undefined; + } else if ( fn == null ) { + if ( typeof selector === "string" ) { + + // ( types, selector, fn ) + fn = data; + data = undefined; + } else { + + // ( types, data, fn ) + fn = data; + data = selector; + selector = undefined; + } + } + if ( fn === false ) { + fn = returnFalse; + } else if ( !fn ) { + return elem; + } + + if ( one === 1 ) { + origFn = fn; + fn = function( event ) { + + // Can use an empty set, since event contains the info + jQuery().off( event ); + return origFn.apply( this, arguments ); + }; + + // Use same guid so caller can remove using origFn + fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ ); + } + return elem.each( function() { + jQuery.event.add( this, types, fn, data, selector ); + } ); +} + +/* + * Helper functions for managing events -- not part of the public interface. + * Props to Dean Edwards' addEvent library for many of the ideas. + */ +jQuery.event = { + + global: {}, + + add: function( elem, types, handler, data, selector ) { + + var handleObjIn, eventHandle, tmp, + events, t, handleObj, + special, handlers, type, namespaces, origType, + elemData = dataPriv.get( elem ); + + // Only attach events to objects that accept data + if ( !acceptData( elem ) ) { + return; + } + + // Caller can pass in an object of custom data in lieu of the handler + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + selector = handleObjIn.selector; + } + + // Ensure that invalid selectors throw exceptions at attach time + // Evaluate against documentElement in case elem is a non-element node (e.g., document) + if ( selector ) { + jQuery.find.matchesSelector( documentElement, selector ); + } + + // Make sure that the handler has a unique ID, used to find/remove it later + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure and main handler, if this is the first + if ( !( events = elemData.events ) ) { + events = elemData.events = Object.create( null ); + } + if ( !( eventHandle = elemData.handle ) ) { + eventHandle = elemData.handle = function( e ) { + + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== "undefined" && jQuery.event.triggered !== e.type ? + jQuery.event.dispatch.apply( elem, arguments ) : undefined; + }; + } + + // Handle multiple events separated by a space + types = ( types || "" ).match( rnothtmlwhite ) || [ "" ]; + t = types.length; + while ( t-- ) { + tmp = rtypenamespace.exec( types[ t ] ) || []; + type = origType = tmp[ 1 ]; + namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort(); + + // There *must* be a type, no attaching namespace-only handlers + if ( !type ) { + continue; + } + + // If event changes its type, use the special event handlers for the changed type + special = jQuery.event.special[ type ] || {}; + + // If selector defined, determine special event api type, otherwise given type + type = ( selector ? special.delegateType : special.bindType ) || type; + + // Update special based on newly reset type + special = jQuery.event.special[ type ] || {}; + + // handleObj is passed to all event handlers + handleObj = jQuery.extend( { + type: type, + origType: origType, + data: data, + handler: handler, + guid: handler.guid, + selector: selector, + needsContext: selector && jQuery.expr.match.needsContext.test( selector ), + namespace: namespaces.join( "." ) + }, handleObjIn ); + + // Init the event handler queue if we're the first + if ( !( handlers = events[ type ] ) ) { + handlers = events[ type ] = []; + handlers.delegateCount = 0; + + // Only use addEventListener if the special events handler returns false + if ( !special.setup || + special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add to the element's handler list, delegates in front + if ( selector ) { + handlers.splice( handlers.delegateCount++, 0, handleObj ); + } else { + handlers.push( handleObj ); + } + + // Keep track of which events have ever been used, for event optimization + jQuery.event.global[ type ] = true; + } + + }, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, selector, mappedTypes ) { + + var j, origCount, tmp, + events, t, handleObj, + special, handlers, type, namespaces, origType, + elemData = dataPriv.hasData( elem ) && dataPriv.get( elem ); + + if ( !elemData || !( events = elemData.events ) ) { + return; + } + + // Once for each type.namespace in types; type may be omitted + types = ( types || "" ).match( rnothtmlwhite ) || [ "" ]; + t = types.length; + while ( t-- ) { + tmp = rtypenamespace.exec( types[ t ] ) || []; + type = origType = tmp[ 1 ]; + namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort(); + + // Unbind all events (on this namespace, if provided) for the element + if ( !type ) { + for ( type in events ) { + jQuery.event.remove( elem, type + types[ t ], handler, selector, true ); + } + continue; + } + + special = jQuery.event.special[ type ] || {}; + type = ( selector ? special.delegateType : special.bindType ) || type; + handlers = events[ type ] || []; + tmp = tmp[ 2 ] && + new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ); + + // Remove matching events + origCount = j = handlers.length; + while ( j-- ) { + handleObj = handlers[ j ]; + + if ( ( mappedTypes || origType === handleObj.origType ) && + ( !handler || handler.guid === handleObj.guid ) && + ( !tmp || tmp.test( handleObj.namespace ) ) && + ( !selector || selector === handleObj.selector || + selector === "**" && handleObj.selector ) ) { + handlers.splice( j, 1 ); + + if ( handleObj.selector ) { + handlers.delegateCount--; + } + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + } + + // Remove generic event handler if we removed something and no more handlers exist + // (avoids potential for endless recursion during removal of special event handlers) + if ( origCount && !handlers.length ) { + if ( !special.teardown || + special.teardown.call( elem, namespaces, elemData.handle ) === false ) { + + jQuery.removeEvent( elem, type, elemData.handle ); + } + + delete events[ type ]; + } + } + + // Remove data and the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + dataPriv.remove( elem, "handle events" ); + } + }, + + dispatch: function( nativeEvent ) { + + var i, j, ret, matched, handleObj, handlerQueue, + args = new Array( arguments.length ), + + // Make a writable jQuery.Event from the native event object + event = jQuery.event.fix( nativeEvent ), + + handlers = ( + dataPriv.get( this, "events" ) || Object.create( null ) + )[ event.type ] || [], + special = jQuery.event.special[ event.type ] || {}; + + // Use the fix-ed jQuery.Event rather than the (read-only) native event + args[ 0 ] = event; + + for ( i = 1; i < arguments.length; i++ ) { + args[ i ] = arguments[ i ]; + } + + event.delegateTarget = this; + + // Call the preDispatch hook for the mapped type, and let it bail if desired + if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) { + return; + } + + // Determine handlers + handlerQueue = jQuery.event.handlers.call( this, event, handlers ); + + // Run delegates first; they may want to stop propagation beneath us + i = 0; + while ( ( matched = handlerQueue[ i++ ] ) && !event.isPropagationStopped() ) { + event.currentTarget = matched.elem; + + j = 0; + while ( ( handleObj = matched.handlers[ j++ ] ) && + !event.isImmediatePropagationStopped() ) { + + // If the event is namespaced, then each handler is only invoked if it is + // specially universal or its namespaces are a superset of the event's. + if ( !event.rnamespace || handleObj.namespace === false || + event.rnamespace.test( handleObj.namespace ) ) { + + event.handleObj = handleObj; + event.data = handleObj.data; + + ret = ( ( jQuery.event.special[ handleObj.origType ] || {} ).handle || + handleObj.handler ).apply( matched.elem, args ); + + if ( ret !== undefined ) { + if ( ( event.result = ret ) === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + } + } + } + + // Call the postDispatch hook for the mapped type + if ( special.postDispatch ) { + special.postDispatch.call( this, event ); + } + + return event.result; + }, + + handlers: function( event, handlers ) { + var i, handleObj, sel, matchedHandlers, matchedSelectors, + handlerQueue = [], + delegateCount = handlers.delegateCount, + cur = event.target; + + // Find delegate handlers + if ( delegateCount && + + // Support: IE <=9 + // Black-hole SVG instance trees (trac-13180) + cur.nodeType && + + // Support: Firefox <=42 + // Suppress spec-violating clicks indicating a non-primary pointer button (trac-3861) + // https://www.w3.org/TR/DOM-Level-3-Events/#event-type-click + // Support: IE 11 only + // ...but not arrow key "clicks" of radio inputs, which can have `button` -1 (gh-2343) + !( event.type === "click" && event.button >= 1 ) ) { + + for ( ; cur !== this; cur = cur.parentNode || this ) { + + // Don't check non-elements (#13208) + // Don't process clicks on disabled elements (#6911, #8165, #11382, #11764) + if ( cur.nodeType === 1 && !( event.type === "click" && cur.disabled === true ) ) { + matchedHandlers = []; + matchedSelectors = {}; + for ( i = 0; i < delegateCount; i++ ) { + handleObj = handlers[ i ]; + + // Don't conflict with Object.prototype properties (#13203) + sel = handleObj.selector + " "; + + if ( matchedSelectors[ sel ] === undefined ) { + matchedSelectors[ sel ] = handleObj.needsContext ? + jQuery( sel, this ).index( cur ) > -1 : + jQuery.find( sel, this, null, [ cur ] ).length; + } + if ( matchedSelectors[ sel ] ) { + matchedHandlers.push( handleObj ); + } + } + if ( matchedHandlers.length ) { + handlerQueue.push( { elem: cur, handlers: matchedHandlers } ); + } + } + } + } + + // Add the remaining (directly-bound) handlers + cur = this; + if ( delegateCount < handlers.length ) { + handlerQueue.push( { elem: cur, handlers: handlers.slice( delegateCount ) } ); + } + + return handlerQueue; + }, + + addProp: function( name, hook ) { + Object.defineProperty( jQuery.Event.prototype, name, { + enumerable: true, + configurable: true, + + get: isFunction( hook ) ? + function() { + if ( this.originalEvent ) { + return hook( this.originalEvent ); + } + } : + function() { + if ( this.originalEvent ) { + return this.originalEvent[ name ]; + } + }, + + set: function( value ) { + Object.defineProperty( this, name, { + enumerable: true, + configurable: true, + writable: true, + value: value + } ); + } + } ); + }, + + fix: function( originalEvent ) { + return originalEvent[ jQuery.expando ] ? + originalEvent : + new jQuery.Event( originalEvent ); + }, + + special: { + load: { + + // Prevent triggered image.load events from bubbling to window.load + noBubble: true + }, + click: { + + // Utilize native event to ensure correct state for checkable inputs + setup: function( data ) { + + // For mutual compressibility with _default, replace `this` access with a local var. + // `|| data` is dead code meant only to preserve the variable through minification. + var el = this || data; + + // Claim the first handler + if ( rcheckableType.test( el.type ) && + el.click && nodeName( el, "input" ) ) { + + // dataPriv.set( el, "click", ... ) + leverageNative( el, "click", returnTrue ); + } + + // Return false to allow normal processing in the caller + return false; + }, + trigger: function( data ) { + + // For mutual compressibility with _default, replace `this` access with a local var. + // `|| data` is dead code meant only to preserve the variable through minification. + var el = this || data; + + // Force setup before triggering a click + if ( rcheckableType.test( el.type ) && + el.click && nodeName( el, "input" ) ) { + + leverageNative( el, "click" ); + } + + // Return non-false to allow normal event-path propagation + return true; + }, + + // For cross-browser consistency, suppress native .click() on links + // Also prevent it if we're currently inside a leveraged native-event stack + _default: function( event ) { + var target = event.target; + return rcheckableType.test( target.type ) && + target.click && nodeName( target, "input" ) && + dataPriv.get( target, "click" ) || + nodeName( target, "a" ); + } + }, + + beforeunload: { + postDispatch: function( event ) { + + // Support: Firefox 20+ + // Firefox doesn't alert if the returnValue field is not set. + if ( event.result !== undefined && event.originalEvent ) { + event.originalEvent.returnValue = event.result; + } + } + } + } +}; + +// Ensure the presence of an event listener that handles manually-triggered +// synthetic events by interrupting progress until reinvoked in response to +// *native* events that it fires directly, ensuring that state changes have +// already occurred before other listeners are invoked. +function leverageNative( el, type, expectSync ) { + + // Missing expectSync indicates a trigger call, which must force setup through jQuery.event.add + if ( !expectSync ) { + if ( dataPriv.get( el, type ) === undefined ) { + jQuery.event.add( el, type, returnTrue ); + } + return; + } + + // Register the controller as a special universal handler for all event namespaces + dataPriv.set( el, type, false ); + jQuery.event.add( el, type, { + namespace: false, + handler: function( event ) { + var notAsync, result, + saved = dataPriv.get( this, type ); + + if ( ( event.isTrigger & 1 ) && this[ type ] ) { + + // Interrupt processing of the outer synthetic .trigger()ed event + // Saved data should be false in such cases, but might be a leftover capture object + // from an async native handler (gh-4350) + if ( !saved.length ) { + + // Store arguments for use when handling the inner native event + // There will always be at least one argument (an event object), so this array + // will not be confused with a leftover capture object. + saved = slice.call( arguments ); + dataPriv.set( this, type, saved ); + + // Trigger the native event and capture its result + // Support: IE <=9 - 11+ + // focus() and blur() are asynchronous + notAsync = expectSync( this, type ); + this[ type ](); + result = dataPriv.get( this, type ); + if ( saved !== result || notAsync ) { + dataPriv.set( this, type, false ); + } else { + result = {}; + } + if ( saved !== result ) { + + // Cancel the outer synthetic event + event.stopImmediatePropagation(); + event.preventDefault(); + return result.value; + } + + // If this is an inner synthetic event for an event with a bubbling surrogate + // (focus or blur), assume that the surrogate already propagated from triggering the + // native event and prevent that from happening again here. + // This technically gets the ordering wrong w.r.t. to `.trigger()` (in which the + // bubbling surrogate propagates *after* the non-bubbling base), but that seems + // less bad than duplication. + } else if ( ( jQuery.event.special[ type ] || {} ).delegateType ) { + event.stopPropagation(); + } + + // If this is a native event triggered above, everything is now in order + // Fire an inner synthetic event with the original arguments + } else if ( saved.length ) { + + // ...and capture the result + dataPriv.set( this, type, { + value: jQuery.event.trigger( + + // Support: IE <=9 - 11+ + // Extend with the prototype to reset the above stopImmediatePropagation() + jQuery.extend( saved[ 0 ], jQuery.Event.prototype ), + saved.slice( 1 ), + this + ) + } ); + + // Abort handling of the native event + event.stopImmediatePropagation(); + } + } + } ); +} + +jQuery.removeEvent = function( elem, type, handle ) { + + // This "if" is needed for plain objects + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle ); + } +}; + +jQuery.Event = function( src, props ) { + + // Allow instantiation without the 'new' keyword + if ( !( this instanceof jQuery.Event ) ) { + return new jQuery.Event( src, props ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = src.defaultPrevented || + src.defaultPrevented === undefined && + + // Support: Android <=2.3 only + src.returnValue === false ? + returnTrue : + returnFalse; + + // Create target properties + // Support: Safari <=6 - 7 only + // Target should not be a text node (#504, #13143) + this.target = ( src.target && src.target.nodeType === 3 ) ? + src.target.parentNode : + src.target; + + this.currentTarget = src.currentTarget; + this.relatedTarget = src.relatedTarget; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if ( props ) { + jQuery.extend( this, props ); + } + + // Create a timestamp if incoming event doesn't have one + this.timeStamp = src && src.timeStamp || Date.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// https://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + constructor: jQuery.Event, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse, + isSimulated: false, + + preventDefault: function() { + var e = this.originalEvent; + + this.isDefaultPrevented = returnTrue; + + if ( e && !this.isSimulated ) { + e.preventDefault(); + } + }, + stopPropagation: function() { + var e = this.originalEvent; + + this.isPropagationStopped = returnTrue; + + if ( e && !this.isSimulated ) { + e.stopPropagation(); + } + }, + stopImmediatePropagation: function() { + var e = this.originalEvent; + + this.isImmediatePropagationStopped = returnTrue; + + if ( e && !this.isSimulated ) { + e.stopImmediatePropagation(); + } + + this.stopPropagation(); + } +}; + +// Includes all common event props including KeyEvent and MouseEvent specific props +jQuery.each( { + altKey: true, + bubbles: true, + cancelable: true, + changedTouches: true, + ctrlKey: true, + detail: true, + eventPhase: true, + metaKey: true, + pageX: true, + pageY: true, + shiftKey: true, + view: true, + "char": true, + code: true, + charCode: true, + key: true, + keyCode: true, + button: true, + buttons: true, + clientX: true, + clientY: true, + offsetX: true, + offsetY: true, + pointerId: true, + pointerType: true, + screenX: true, + screenY: true, + targetTouches: true, + toElement: true, + touches: true, + + which: function( event ) { + var button = event.button; + + // Add which for key events + if ( event.which == null && rkeyEvent.test( event.type ) ) { + return event.charCode != null ? event.charCode : event.keyCode; + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + if ( !event.which && button !== undefined && rmouseEvent.test( event.type ) ) { + if ( button & 1 ) { + return 1; + } + + if ( button & 2 ) { + return 3; + } + + if ( button & 4 ) { + return 2; + } + + return 0; + } + + return event.which; + } +}, jQuery.event.addProp ); + +jQuery.each( { focus: "focusin", blur: "focusout" }, function( type, delegateType ) { + jQuery.event.special[ type ] = { + + // Utilize native event if possible so blur/focus sequence is correct + setup: function() { + + // Claim the first handler + // dataPriv.set( this, "focus", ... ) + // dataPriv.set( this, "blur", ... ) + leverageNative( this, type, expectSync ); + + // Return false to allow normal processing in the caller + return false; + }, + trigger: function() { + + // Force setup before trigger + leverageNative( this, type ); + + // Return non-false to allow normal event-path propagation + return true; + }, + + delegateType: delegateType + }; +} ); + +// Create mouseenter/leave events using mouseover/out and event-time checks +// so that event delegation works in jQuery. +// Do the same for pointerenter/pointerleave and pointerover/pointerout +// +// Support: Safari 7 only +// Safari sends mouseenter too often; see: +// https://bugs.chromium.org/p/chromium/issues/detail?id=470258 +// for the description of the bug (it existed in older Chrome versions as well). +jQuery.each( { + mouseenter: "mouseover", + mouseleave: "mouseout", + pointerenter: "pointerover", + pointerleave: "pointerout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + delegateType: fix, + bindType: fix, + + handle: function( event ) { + var ret, + target = this, + related = event.relatedTarget, + handleObj = event.handleObj; + + // For mouseenter/leave call the handler if related is outside the target. + // NB: No relatedTarget if the mouse left/entered the browser window + if ( !related || ( related !== target && !jQuery.contains( target, related ) ) ) { + event.type = handleObj.origType; + ret = handleObj.handler.apply( this, arguments ); + event.type = fix; + } + return ret; + } + }; +} ); + +jQuery.fn.extend( { + + on: function( types, selector, data, fn ) { + return on( this, types, selector, data, fn ); + }, + one: function( types, selector, data, fn ) { + return on( this, types, selector, data, fn, 1 ); + }, + off: function( types, selector, fn ) { + var handleObj, type; + if ( types && types.preventDefault && types.handleObj ) { + + // ( event ) dispatched jQuery.Event + handleObj = types.handleObj; + jQuery( types.delegateTarget ).off( + handleObj.namespace ? + handleObj.origType + "." + handleObj.namespace : + handleObj.origType, + handleObj.selector, + handleObj.handler + ); + return this; + } + if ( typeof types === "object" ) { + + // ( types-object [, selector] ) + for ( type in types ) { + this.off( type, selector, types[ type ] ); + } + return this; + } + if ( selector === false || typeof selector === "function" ) { + + // ( types [, fn] ) + fn = selector; + selector = undefined; + } + if ( fn === false ) { + fn = returnFalse; + } + return this.each( function() { + jQuery.event.remove( this, types, fn, selector ); + } ); + } +} ); + + +var + + // Support: IE <=10 - 11, Edge 12 - 13 only + // In IE/Edge using regex groups here causes severe slowdowns. + // See https://connect.microsoft.com/IE/feedback/details/1736512/ + rnoInnerhtml = /\s*$/g; + +// Prefer a tbody over its parent table for containing new rows +function manipulationTarget( elem, content ) { + if ( nodeName( elem, "table" ) && + nodeName( content.nodeType !== 11 ? content : content.firstChild, "tr" ) ) { + + return jQuery( elem ).children( "tbody" )[ 0 ] || elem; + } + + return elem; +} + +// Replace/restore the type attribute of script elements for safe DOM manipulation +function disableScript( elem ) { + elem.type = ( elem.getAttribute( "type" ) !== null ) + "/" + elem.type; + return elem; +} +function restoreScript( elem ) { + if ( ( elem.type || "" ).slice( 0, 5 ) === "true/" ) { + elem.type = elem.type.slice( 5 ); + } else { + elem.removeAttribute( "type" ); + } + + return elem; +} + +function cloneCopyEvent( src, dest ) { + var i, l, type, pdataOld, udataOld, udataCur, events; + + if ( dest.nodeType !== 1 ) { + return; + } + + // 1. Copy private data: events, handlers, etc. + if ( dataPriv.hasData( src ) ) { + pdataOld = dataPriv.get( src ); + events = pdataOld.events; + + if ( events ) { + dataPriv.remove( dest, "handle events" ); + + for ( type in events ) { + for ( i = 0, l = events[ type ].length; i < l; i++ ) { + jQuery.event.add( dest, type, events[ type ][ i ] ); + } + } + } + } + + // 2. Copy user data + if ( dataUser.hasData( src ) ) { + udataOld = dataUser.access( src ); + udataCur = jQuery.extend( {}, udataOld ); + + dataUser.set( dest, udataCur ); + } +} + +// Fix IE bugs, see support tests +function fixInput( src, dest ) { + var nodeName = dest.nodeName.toLowerCase(); + + // Fails to persist the checked state of a cloned checkbox or radio button. + if ( nodeName === "input" && rcheckableType.test( src.type ) ) { + dest.checked = src.checked; + + // Fails to return the selected option to the default selected state when cloning options + } else if ( nodeName === "input" || nodeName === "textarea" ) { + dest.defaultValue = src.defaultValue; + } +} + +function domManip( collection, args, callback, ignored ) { + + // Flatten any nested arrays + args = flat( args ); + + var fragment, first, scripts, hasScripts, node, doc, + i = 0, + l = collection.length, + iNoClone = l - 1, + value = args[ 0 ], + valueIsFunction = isFunction( value ); + + // We can't cloneNode fragments that contain checked, in WebKit + if ( valueIsFunction || + ( l > 1 && typeof value === "string" && + !support.checkClone && rchecked.test( value ) ) ) { + return collection.each( function( index ) { + var self = collection.eq( index ); + if ( valueIsFunction ) { + args[ 0 ] = value.call( this, index, self.html() ); + } + domManip( self, args, callback, ignored ); + } ); + } + + if ( l ) { + fragment = buildFragment( args, collection[ 0 ].ownerDocument, false, collection, ignored ); + first = fragment.firstChild; + + if ( fragment.childNodes.length === 1 ) { + fragment = first; + } + + // Require either new content or an interest in ignored elements to invoke the callback + if ( first || ignored ) { + scripts = jQuery.map( getAll( fragment, "script" ), disableScript ); + hasScripts = scripts.length; + + // Use the original fragment for the last item + // instead of the first because it can end up + // being emptied incorrectly in certain situations (#8070). + for ( ; i < l; i++ ) { + node = fragment; + + if ( i !== iNoClone ) { + node = jQuery.clone( node, true, true ); + + // Keep references to cloned scripts for later restoration + if ( hasScripts ) { + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( scripts, getAll( node, "script" ) ); + } + } + + callback.call( collection[ i ], node, i ); + } + + if ( hasScripts ) { + doc = scripts[ scripts.length - 1 ].ownerDocument; + + // Reenable scripts + jQuery.map( scripts, restoreScript ); + + // Evaluate executable scripts on first document insertion + for ( i = 0; i < hasScripts; i++ ) { + node = scripts[ i ]; + if ( rscriptType.test( node.type || "" ) && + !dataPriv.access( node, "globalEval" ) && + jQuery.contains( doc, node ) ) { + + if ( node.src && ( node.type || "" ).toLowerCase() !== "module" ) { + + // Optional AJAX dependency, but won't run scripts if not present + if ( jQuery._evalUrl && !node.noModule ) { + jQuery._evalUrl( node.src, { + nonce: node.nonce || node.getAttribute( "nonce" ) + }, doc ); + } + } else { + DOMEval( node.textContent.replace( rcleanScript, "" ), node, doc ); + } + } + } + } + } + } + + return collection; +} + +function remove( elem, selector, keepData ) { + var node, + nodes = selector ? jQuery.filter( selector, elem ) : elem, + i = 0; + + for ( ; ( node = nodes[ i ] ) != null; i++ ) { + if ( !keepData && node.nodeType === 1 ) { + jQuery.cleanData( getAll( node ) ); + } + + if ( node.parentNode ) { + if ( keepData && isAttached( node ) ) { + setGlobalEval( getAll( node, "script" ) ); + } + node.parentNode.removeChild( node ); + } + } + + return elem; +} + +jQuery.extend( { + htmlPrefilter: function( html ) { + return html; + }, + + clone: function( elem, dataAndEvents, deepDataAndEvents ) { + var i, l, srcElements, destElements, + clone = elem.cloneNode( true ), + inPage = isAttached( elem ); + + // Fix IE cloning issues + if ( !support.noCloneChecked && ( elem.nodeType === 1 || elem.nodeType === 11 ) && + !jQuery.isXMLDoc( elem ) ) { + + // We eschew Sizzle here for performance reasons: https://jsperf.com/getall-vs-sizzle/2 + destElements = getAll( clone ); + srcElements = getAll( elem ); + + for ( i = 0, l = srcElements.length; i < l; i++ ) { + fixInput( srcElements[ i ], destElements[ i ] ); + } + } + + // Copy the events from the original to the clone + if ( dataAndEvents ) { + if ( deepDataAndEvents ) { + srcElements = srcElements || getAll( elem ); + destElements = destElements || getAll( clone ); + + for ( i = 0, l = srcElements.length; i < l; i++ ) { + cloneCopyEvent( srcElements[ i ], destElements[ i ] ); + } + } else { + cloneCopyEvent( elem, clone ); + } + } + + // Preserve script evaluation history + destElements = getAll( clone, "script" ); + if ( destElements.length > 0 ) { + setGlobalEval( destElements, !inPage && getAll( elem, "script" ) ); + } + + // Return the cloned set + return clone; + }, + + cleanData: function( elems ) { + var data, elem, type, + special = jQuery.event.special, + i = 0; + + for ( ; ( elem = elems[ i ] ) !== undefined; i++ ) { + if ( acceptData( elem ) ) { + if ( ( data = elem[ dataPriv.expando ] ) ) { + if ( data.events ) { + for ( type in data.events ) { + if ( special[ type ] ) { + jQuery.event.remove( elem, type ); + + // This is a shortcut to avoid jQuery.event.remove's overhead + } else { + jQuery.removeEvent( elem, type, data.handle ); + } + } + } + + // Support: Chrome <=35 - 45+ + // Assign undefined instead of using delete, see Data#remove + elem[ dataPriv.expando ] = undefined; + } + if ( elem[ dataUser.expando ] ) { + + // Support: Chrome <=35 - 45+ + // Assign undefined instead of using delete, see Data#remove + elem[ dataUser.expando ] = undefined; + } + } + } + } +} ); + +jQuery.fn.extend( { + detach: function( selector ) { + return remove( this, selector, true ); + }, + + remove: function( selector ) { + return remove( this, selector ); + }, + + text: function( value ) { + return access( this, function( value ) { + return value === undefined ? + jQuery.text( this ) : + this.empty().each( function() { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + this.textContent = value; + } + } ); + }, null, value, arguments.length ); + }, + + append: function() { + return domManip( this, arguments, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + var target = manipulationTarget( this, elem ); + target.appendChild( elem ); + } + } ); + }, + + prepend: function() { + return domManip( this, arguments, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + var target = manipulationTarget( this, elem ); + target.insertBefore( elem, target.firstChild ); + } + } ); + }, + + before: function() { + return domManip( this, arguments, function( elem ) { + if ( this.parentNode ) { + this.parentNode.insertBefore( elem, this ); + } + } ); + }, + + after: function() { + return domManip( this, arguments, function( elem ) { + if ( this.parentNode ) { + this.parentNode.insertBefore( elem, this.nextSibling ); + } + } ); + }, + + empty: function() { + var elem, + i = 0; + + for ( ; ( elem = this[ i ] ) != null; i++ ) { + if ( elem.nodeType === 1 ) { + + // Prevent memory leaks + jQuery.cleanData( getAll( elem, false ) ); + + // Remove any remaining nodes + elem.textContent = ""; + } + } + + return this; + }, + + clone: function( dataAndEvents, deepDataAndEvents ) { + dataAndEvents = dataAndEvents == null ? false : dataAndEvents; + deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents; + + return this.map( function() { + return jQuery.clone( this, dataAndEvents, deepDataAndEvents ); + } ); + }, + + html: function( value ) { + return access( this, function( value ) { + var elem = this[ 0 ] || {}, + i = 0, + l = this.length; + + if ( value === undefined && elem.nodeType === 1 ) { + return elem.innerHTML; + } + + // See if we can take a shortcut and just use innerHTML + if ( typeof value === "string" && !rnoInnerhtml.test( value ) && + !wrapMap[ ( rtagName.exec( value ) || [ "", "" ] )[ 1 ].toLowerCase() ] ) { + + value = jQuery.htmlPrefilter( value ); + + try { + for ( ; i < l; i++ ) { + elem = this[ i ] || {}; + + // Remove element nodes and prevent memory leaks + if ( elem.nodeType === 1 ) { + jQuery.cleanData( getAll( elem, false ) ); + elem.innerHTML = value; + } + } + + elem = 0; + + // If using innerHTML throws an exception, use the fallback method + } catch ( e ) {} + } + + if ( elem ) { + this.empty().append( value ); + } + }, null, value, arguments.length ); + }, + + replaceWith: function() { + var ignored = []; + + // Make the changes, replacing each non-ignored context element with the new content + return domManip( this, arguments, function( elem ) { + var parent = this.parentNode; + + if ( jQuery.inArray( this, ignored ) < 0 ) { + jQuery.cleanData( getAll( this ) ); + if ( parent ) { + parent.replaceChild( elem, this ); + } + } + + // Force callback invocation + }, ignored ); + } +} ); + +jQuery.each( { + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function( name, original ) { + jQuery.fn[ name ] = function( selector ) { + var elems, + ret = [], + insert = jQuery( selector ), + last = insert.length - 1, + i = 0; + + for ( ; i <= last; i++ ) { + elems = i === last ? this : this.clone( true ); + jQuery( insert[ i ] )[ original ]( elems ); + + // Support: Android <=4.0 only, PhantomJS 1 only + // .get() because push.apply(_, arraylike) throws on ancient WebKit + push.apply( ret, elems.get() ); + } + + return this.pushStack( ret ); + }; +} ); +var rnumnonpx = new RegExp( "^(" + pnum + ")(?!px)[a-z%]+$", "i" ); + +var getStyles = function( elem ) { + + // Support: IE <=11 only, Firefox <=30 (#15098, #14150) + // IE throws on elements created in popups + // FF meanwhile throws on frame elements through "defaultView.getComputedStyle" + var view = elem.ownerDocument.defaultView; + + if ( !view || !view.opener ) { + view = window; + } + + return view.getComputedStyle( elem ); + }; + +var swap = function( elem, options, callback ) { + var ret, name, + old = {}; + + // Remember the old values, and insert the new ones + for ( name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + ret = callback.call( elem ); + + // Revert the old values + for ( name in options ) { + elem.style[ name ] = old[ name ]; + } + + return ret; +}; + + +var rboxStyle = new RegExp( cssExpand.join( "|" ), "i" ); + + + +( function() { + + // Executing both pixelPosition & boxSizingReliable tests require only one layout + // so they're executed at the same time to save the second computation. + function computeStyleTests() { + + // This is a singleton, we need to execute it only once + if ( !div ) { + return; + } + + container.style.cssText = "position:absolute;left:-11111px;width:60px;" + + "margin-top:1px;padding:0;border:0"; + div.style.cssText = + "position:relative;display:block;box-sizing:border-box;overflow:scroll;" + + "margin:auto;border:1px;padding:1px;" + + "width:60%;top:1%"; + documentElement.appendChild( container ).appendChild( div ); + + var divStyle = window.getComputedStyle( div ); + pixelPositionVal = divStyle.top !== "1%"; + + // Support: Android 4.0 - 4.3 only, Firefox <=3 - 44 + reliableMarginLeftVal = roundPixelMeasures( divStyle.marginLeft ) === 12; + + // Support: Android 4.0 - 4.3 only, Safari <=9.1 - 10.1, iOS <=7.0 - 9.3 + // Some styles come back with percentage values, even though they shouldn't + div.style.right = "60%"; + pixelBoxStylesVal = roundPixelMeasures( divStyle.right ) === 36; + + // Support: IE 9 - 11 only + // Detect misreporting of content dimensions for box-sizing:border-box elements + boxSizingReliableVal = roundPixelMeasures( divStyle.width ) === 36; + + // Support: IE 9 only + // Detect overflow:scroll screwiness (gh-3699) + // Support: Chrome <=64 + // Don't get tricked when zoom affects offsetWidth (gh-4029) + div.style.position = "absolute"; + scrollboxSizeVal = roundPixelMeasures( div.offsetWidth / 3 ) === 12; + + documentElement.removeChild( container ); + + // Nullify the div so it wouldn't be stored in the memory and + // it will also be a sign that checks already performed + div = null; + } + + function roundPixelMeasures( measure ) { + return Math.round( parseFloat( measure ) ); + } + + var pixelPositionVal, boxSizingReliableVal, scrollboxSizeVal, pixelBoxStylesVal, + reliableTrDimensionsVal, reliableMarginLeftVal, + container = document.createElement( "div" ), + div = document.createElement( "div" ); + + // Finish early in limited (non-browser) environments + if ( !div.style ) { + return; + } + + // Support: IE <=9 - 11 only + // Style of cloned element affects source element cloned (#8908) + div.style.backgroundClip = "content-box"; + div.cloneNode( true ).style.backgroundClip = ""; + support.clearCloneStyle = div.style.backgroundClip === "content-box"; + + jQuery.extend( support, { + boxSizingReliable: function() { + computeStyleTests(); + return boxSizingReliableVal; + }, + pixelBoxStyles: function() { + computeStyleTests(); + return pixelBoxStylesVal; + }, + pixelPosition: function() { + computeStyleTests(); + return pixelPositionVal; + }, + reliableMarginLeft: function() { + computeStyleTests(); + return reliableMarginLeftVal; + }, + scrollboxSize: function() { + computeStyleTests(); + return scrollboxSizeVal; + }, + + // Support: IE 9 - 11+, Edge 15 - 18+ + // IE/Edge misreport `getComputedStyle` of table rows with width/height + // set in CSS while `offset*` properties report correct values. + // Behavior in IE 9 is more subtle than in newer versions & it passes + // some versions of this test; make sure not to make it pass there! + reliableTrDimensions: function() { + var table, tr, trChild, trStyle; + if ( reliableTrDimensionsVal == null ) { + table = document.createElement( "table" ); + tr = document.createElement( "tr" ); + trChild = document.createElement( "div" ); + + table.style.cssText = "position:absolute;left:-11111px"; + tr.style.height = "1px"; + trChild.style.height = "9px"; + + documentElement + .appendChild( table ) + .appendChild( tr ) + .appendChild( trChild ); + + trStyle = window.getComputedStyle( tr ); + reliableTrDimensionsVal = parseInt( trStyle.height ) > 3; + + documentElement.removeChild( table ); + } + return reliableTrDimensionsVal; + } + } ); +} )(); + + +function curCSS( elem, name, computed ) { + var width, minWidth, maxWidth, ret, + + // Support: Firefox 51+ + // Retrieving style before computed somehow + // fixes an issue with getting wrong values + // on detached elements + style = elem.style; + + computed = computed || getStyles( elem ); + + // getPropertyValue is needed for: + // .css('filter') (IE 9 only, #12537) + // .css('--customProperty) (#3144) + if ( computed ) { + ret = computed.getPropertyValue( name ) || computed[ name ]; + + if ( ret === "" && !isAttached( elem ) ) { + ret = jQuery.style( elem, name ); + } + + // A tribute to the "awesome hack by Dean Edwards" + // Android Browser returns percentage for some values, + // but width seems to be reliably pixels. + // This is against the CSSOM draft spec: + // https://drafts.csswg.org/cssom/#resolved-values + if ( !support.pixelBoxStyles() && rnumnonpx.test( ret ) && rboxStyle.test( name ) ) { + + // Remember the original values + width = style.width; + minWidth = style.minWidth; + maxWidth = style.maxWidth; + + // Put in the new values to get a computed value out + style.minWidth = style.maxWidth = style.width = ret; + ret = computed.width; + + // Revert the changed values + style.width = width; + style.minWidth = minWidth; + style.maxWidth = maxWidth; + } + } + + return ret !== undefined ? + + // Support: IE <=9 - 11 only + // IE returns zIndex value as an integer. + ret + "" : + ret; +} + + +function addGetHookIf( conditionFn, hookFn ) { + + // Define the hook, we'll check on the first run if it's really needed. + return { + get: function() { + if ( conditionFn() ) { + + // Hook not needed (or it's not possible to use it due + // to missing dependency), remove it. + delete this.get; + return; + } + + // Hook needed; redefine it so that the support test is not executed again. + return ( this.get = hookFn ).apply( this, arguments ); + } + }; +} + + +var cssPrefixes = [ "Webkit", "Moz", "ms" ], + emptyStyle = document.createElement( "div" ).style, + vendorProps = {}; + +// Return a vendor-prefixed property or undefined +function vendorPropName( name ) { + + // Check for vendor prefixed names + var capName = name[ 0 ].toUpperCase() + name.slice( 1 ), + i = cssPrefixes.length; + + while ( i-- ) { + name = cssPrefixes[ i ] + capName; + if ( name in emptyStyle ) { + return name; + } + } +} + +// Return a potentially-mapped jQuery.cssProps or vendor prefixed property +function finalPropName( name ) { + var final = jQuery.cssProps[ name ] || vendorProps[ name ]; + + if ( final ) { + return final; + } + if ( name in emptyStyle ) { + return name; + } + return vendorProps[ name ] = vendorPropName( name ) || name; +} + + +var + + // Swappable if display is none or starts with table + // except "table", "table-cell", or "table-caption" + // See here for display values: https://developer.mozilla.org/en-US/docs/CSS/display + rdisplayswap = /^(none|table(?!-c[ea]).+)/, + rcustomProp = /^--/, + cssShow = { position: "absolute", visibility: "hidden", display: "block" }, + cssNormalTransform = { + letterSpacing: "0", + fontWeight: "400" + }; + +function setPositiveNumber( _elem, value, subtract ) { + + // Any relative (+/-) values have already been + // normalized at this point + var matches = rcssNum.exec( value ); + return matches ? + + // Guard against undefined "subtract", e.g., when used as in cssHooks + Math.max( 0, matches[ 2 ] - ( subtract || 0 ) ) + ( matches[ 3 ] || "px" ) : + value; +} + +function boxModelAdjustment( elem, dimension, box, isBorderBox, styles, computedVal ) { + var i = dimension === "width" ? 1 : 0, + extra = 0, + delta = 0; + + // Adjustment may not be necessary + if ( box === ( isBorderBox ? "border" : "content" ) ) { + return 0; + } + + for ( ; i < 4; i += 2 ) { + + // Both box models exclude margin + if ( box === "margin" ) { + delta += jQuery.css( elem, box + cssExpand[ i ], true, styles ); + } + + // If we get here with a content-box, we're seeking "padding" or "border" or "margin" + if ( !isBorderBox ) { + + // Add padding + delta += jQuery.css( elem, "padding" + cssExpand[ i ], true, styles ); + + // For "border" or "margin", add border + if ( box !== "padding" ) { + delta += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + + // But still keep track of it otherwise + } else { + extra += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + } + + // If we get here with a border-box (content + padding + border), we're seeking "content" or + // "padding" or "margin" + } else { + + // For "content", subtract padding + if ( box === "content" ) { + delta -= jQuery.css( elem, "padding" + cssExpand[ i ], true, styles ); + } + + // For "content" or "padding", subtract border + if ( box !== "margin" ) { + delta -= jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + } + } + } + + // Account for positive content-box scroll gutter when requested by providing computedVal + if ( !isBorderBox && computedVal >= 0 ) { + + // offsetWidth/offsetHeight is a rounded sum of content, padding, scroll gutter, and border + // Assuming integer scroll gutter, subtract the rest and round down + delta += Math.max( 0, Math.ceil( + elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] - + computedVal - + delta - + extra - + 0.5 + + // If offsetWidth/offsetHeight is unknown, then we can't determine content-box scroll gutter + // Use an explicit zero to avoid NaN (gh-3964) + ) ) || 0; + } + + return delta; +} + +function getWidthOrHeight( elem, dimension, extra ) { + + // Start with computed style + var styles = getStyles( elem ), + + // To avoid forcing a reflow, only fetch boxSizing if we need it (gh-4322). + // Fake content-box until we know it's needed to know the true value. + boxSizingNeeded = !support.boxSizingReliable() || extra, + isBorderBox = boxSizingNeeded && + jQuery.css( elem, "boxSizing", false, styles ) === "border-box", + valueIsBorderBox = isBorderBox, + + val = curCSS( elem, dimension, styles ), + offsetProp = "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ); + + // Support: Firefox <=54 + // Return a confounding non-pixel value or feign ignorance, as appropriate. + if ( rnumnonpx.test( val ) ) { + if ( !extra ) { + return val; + } + val = "auto"; + } + + + // Support: IE 9 - 11 only + // Use offsetWidth/offsetHeight for when box sizing is unreliable. + // In those cases, the computed value can be trusted to be border-box. + if ( ( !support.boxSizingReliable() && isBorderBox || + + // Support: IE 10 - 11+, Edge 15 - 18+ + // IE/Edge misreport `getComputedStyle` of table rows with width/height + // set in CSS while `offset*` properties report correct values. + // Interestingly, in some cases IE 9 doesn't suffer from this issue. + !support.reliableTrDimensions() && nodeName( elem, "tr" ) || + + // Fall back to offsetWidth/offsetHeight when value is "auto" + // This happens for inline elements with no explicit setting (gh-3571) + val === "auto" || + + // Support: Android <=4.1 - 4.3 only + // Also use offsetWidth/offsetHeight for misreported inline dimensions (gh-3602) + !parseFloat( val ) && jQuery.css( elem, "display", false, styles ) === "inline" ) && + + // Make sure the element is visible & connected + elem.getClientRects().length ) { + + isBorderBox = jQuery.css( elem, "boxSizing", false, styles ) === "border-box"; + + // Where available, offsetWidth/offsetHeight approximate border box dimensions. + // Where not available (e.g., SVG), assume unreliable box-sizing and interpret the + // retrieved value as a content box dimension. + valueIsBorderBox = offsetProp in elem; + if ( valueIsBorderBox ) { + val = elem[ offsetProp ]; + } + } + + // Normalize "" and auto + val = parseFloat( val ) || 0; + + // Adjust for the element's box model + return ( val + + boxModelAdjustment( + elem, + dimension, + extra || ( isBorderBox ? "border" : "content" ), + valueIsBorderBox, + styles, + + // Provide the current computed size to request scroll gutter calculation (gh-3589) + val + ) + ) + "px"; +} + +jQuery.extend( { + + // Add in style property hooks for overriding the default + // behavior of getting and setting a style property + cssHooks: { + opacity: { + get: function( elem, computed ) { + if ( computed ) { + + // We should always get a number back from opacity + var ret = curCSS( elem, "opacity" ); + return ret === "" ? "1" : ret; + } + } + } + }, + + // Don't automatically add "px" to these possibly-unitless properties + cssNumber: { + "animationIterationCount": true, + "columnCount": true, + "fillOpacity": true, + "flexGrow": true, + "flexShrink": true, + "fontWeight": true, + "gridArea": true, + "gridColumn": true, + "gridColumnEnd": true, + "gridColumnStart": true, + "gridRow": true, + "gridRowEnd": true, + "gridRowStart": true, + "lineHeight": true, + "opacity": true, + "order": true, + "orphans": true, + "widows": true, + "zIndex": true, + "zoom": true + }, + + // Add in properties whose names you wish to fix before + // setting or getting the value + cssProps: {}, + + // Get and set the style property on a DOM Node + style: function( elem, name, value, extra ) { + + // Don't set styles on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { + return; + } + + // Make sure that we're working with the right name + var ret, type, hooks, + origName = camelCase( name ), + isCustomProp = rcustomProp.test( name ), + style = elem.style; + + // Make sure that we're working with the right name. We don't + // want to query the value if it is a CSS custom property + // since they are user-defined. + if ( !isCustomProp ) { + name = finalPropName( origName ); + } + + // Gets hook for the prefixed version, then unprefixed version + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // Check if we're setting a value + if ( value !== undefined ) { + type = typeof value; + + // Convert "+=" or "-=" to relative numbers (#7345) + if ( type === "string" && ( ret = rcssNum.exec( value ) ) && ret[ 1 ] ) { + value = adjustCSS( elem, name, ret ); + + // Fixes bug #9237 + type = "number"; + } + + // Make sure that null and NaN values aren't set (#7116) + if ( value == null || value !== value ) { + return; + } + + // If a number was passed in, add the unit (except for certain CSS properties) + // The isCustomProp check can be removed in jQuery 4.0 when we only auto-append + // "px" to a few hardcoded values. + if ( type === "number" && !isCustomProp ) { + value += ret && ret[ 3 ] || ( jQuery.cssNumber[ origName ] ? "" : "px" ); + } + + // background-* props affect original clone's values + if ( !support.clearCloneStyle && value === "" && name.indexOf( "background" ) === 0 ) { + style[ name ] = "inherit"; + } + + // If a hook was provided, use that value, otherwise just set the specified value + if ( !hooks || !( "set" in hooks ) || + ( value = hooks.set( elem, value, extra ) ) !== undefined ) { + + if ( isCustomProp ) { + style.setProperty( name, value ); + } else { + style[ name ] = value; + } + } + + } else { + + // If a hook was provided get the non-computed value from there + if ( hooks && "get" in hooks && + ( ret = hooks.get( elem, false, extra ) ) !== undefined ) { + + return ret; + } + + // Otherwise just get the value from the style object + return style[ name ]; + } + }, + + css: function( elem, name, extra, styles ) { + var val, num, hooks, + origName = camelCase( name ), + isCustomProp = rcustomProp.test( name ); + + // Make sure that we're working with the right name. We don't + // want to modify the value if it is a CSS custom property + // since they are user-defined. + if ( !isCustomProp ) { + name = finalPropName( origName ); + } + + // Try prefixed name followed by the unprefixed name + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // If a hook was provided get the computed value from there + if ( hooks && "get" in hooks ) { + val = hooks.get( elem, true, extra ); + } + + // Otherwise, if a way to get the computed value exists, use that + if ( val === undefined ) { + val = curCSS( elem, name, styles ); + } + + // Convert "normal" to computed value + if ( val === "normal" && name in cssNormalTransform ) { + val = cssNormalTransform[ name ]; + } + + // Make numeric if forced or a qualifier was provided and val looks numeric + if ( extra === "" || extra ) { + num = parseFloat( val ); + return extra === true || isFinite( num ) ? num || 0 : val; + } + + return val; + } +} ); + +jQuery.each( [ "height", "width" ], function( _i, dimension ) { + jQuery.cssHooks[ dimension ] = { + get: function( elem, computed, extra ) { + if ( computed ) { + + // Certain elements can have dimension info if we invisibly show them + // but it must have a current display style that would benefit + return rdisplayswap.test( jQuery.css( elem, "display" ) ) && + + // Support: Safari 8+ + // Table columns in Safari have non-zero offsetWidth & zero + // getBoundingClientRect().width unless display is changed. + // Support: IE <=11 only + // Running getBoundingClientRect on a disconnected node + // in IE throws an error. + ( !elem.getClientRects().length || !elem.getBoundingClientRect().width ) ? + swap( elem, cssShow, function() { + return getWidthOrHeight( elem, dimension, extra ); + } ) : + getWidthOrHeight( elem, dimension, extra ); + } + }, + + set: function( elem, value, extra ) { + var matches, + styles = getStyles( elem ), + + // Only read styles.position if the test has a chance to fail + // to avoid forcing a reflow. + scrollboxSizeBuggy = !support.scrollboxSize() && + styles.position === "absolute", + + // To avoid forcing a reflow, only fetch boxSizing if we need it (gh-3991) + boxSizingNeeded = scrollboxSizeBuggy || extra, + isBorderBox = boxSizingNeeded && + jQuery.css( elem, "boxSizing", false, styles ) === "border-box", + subtract = extra ? + boxModelAdjustment( + elem, + dimension, + extra, + isBorderBox, + styles + ) : + 0; + + // Account for unreliable border-box dimensions by comparing offset* to computed and + // faking a content-box to get border and padding (gh-3699) + if ( isBorderBox && scrollboxSizeBuggy ) { + subtract -= Math.ceil( + elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] - + parseFloat( styles[ dimension ] ) - + boxModelAdjustment( elem, dimension, "border", false, styles ) - + 0.5 + ); + } + + // Convert to pixels if value adjustment is needed + if ( subtract && ( matches = rcssNum.exec( value ) ) && + ( matches[ 3 ] || "px" ) !== "px" ) { + + elem.style[ dimension ] = value; + value = jQuery.css( elem, dimension ); + } + + return setPositiveNumber( elem, value, subtract ); + } + }; +} ); + +jQuery.cssHooks.marginLeft = addGetHookIf( support.reliableMarginLeft, + function( elem, computed ) { + if ( computed ) { + return ( parseFloat( curCSS( elem, "marginLeft" ) ) || + elem.getBoundingClientRect().left - + swap( elem, { marginLeft: 0 }, function() { + return elem.getBoundingClientRect().left; + } ) + ) + "px"; + } + } +); + +// These hooks are used by animate to expand properties +jQuery.each( { + margin: "", + padding: "", + border: "Width" +}, function( prefix, suffix ) { + jQuery.cssHooks[ prefix + suffix ] = { + expand: function( value ) { + var i = 0, + expanded = {}, + + // Assumes a single number if not a string + parts = typeof value === "string" ? value.split( " " ) : [ value ]; + + for ( ; i < 4; i++ ) { + expanded[ prefix + cssExpand[ i ] + suffix ] = + parts[ i ] || parts[ i - 2 ] || parts[ 0 ]; + } + + return expanded; + } + }; + + if ( prefix !== "margin" ) { + jQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber; + } +} ); + +jQuery.fn.extend( { + css: function( name, value ) { + return access( this, function( elem, name, value ) { + var styles, len, + map = {}, + i = 0; + + if ( Array.isArray( name ) ) { + styles = getStyles( elem ); + len = name.length; + + for ( ; i < len; i++ ) { + map[ name[ i ] ] = jQuery.css( elem, name[ i ], false, styles ); + } + + return map; + } + + return value !== undefined ? + jQuery.style( elem, name, value ) : + jQuery.css( elem, name ); + }, name, value, arguments.length > 1 ); + } +} ); + + +function Tween( elem, options, prop, end, easing ) { + return new Tween.prototype.init( elem, options, prop, end, easing ); +} +jQuery.Tween = Tween; + +Tween.prototype = { + constructor: Tween, + init: function( elem, options, prop, end, easing, unit ) { + this.elem = elem; + this.prop = prop; + this.easing = easing || jQuery.easing._default; + this.options = options; + this.start = this.now = this.cur(); + this.end = end; + this.unit = unit || ( jQuery.cssNumber[ prop ] ? "" : "px" ); + }, + cur: function() { + var hooks = Tween.propHooks[ this.prop ]; + + return hooks && hooks.get ? + hooks.get( this ) : + Tween.propHooks._default.get( this ); + }, + run: function( percent ) { + var eased, + hooks = Tween.propHooks[ this.prop ]; + + if ( this.options.duration ) { + this.pos = eased = jQuery.easing[ this.easing ]( + percent, this.options.duration * percent, 0, 1, this.options.duration + ); + } else { + this.pos = eased = percent; + } + this.now = ( this.end - this.start ) * eased + this.start; + + if ( this.options.step ) { + this.options.step.call( this.elem, this.now, this ); + } + + if ( hooks && hooks.set ) { + hooks.set( this ); + } else { + Tween.propHooks._default.set( this ); + } + return this; + } +}; + +Tween.prototype.init.prototype = Tween.prototype; + +Tween.propHooks = { + _default: { + get: function( tween ) { + var result; + + // Use a property on the element directly when it is not a DOM element, + // or when there is no matching style property that exists. + if ( tween.elem.nodeType !== 1 || + tween.elem[ tween.prop ] != null && tween.elem.style[ tween.prop ] == null ) { + return tween.elem[ tween.prop ]; + } + + // Passing an empty string as a 3rd parameter to .css will automatically + // attempt a parseFloat and fallback to a string if the parse fails. + // Simple values such as "10px" are parsed to Float; + // complex values such as "rotate(1rad)" are returned as-is. + result = jQuery.css( tween.elem, tween.prop, "" ); + + // Empty strings, null, undefined and "auto" are converted to 0. + return !result || result === "auto" ? 0 : result; + }, + set: function( tween ) { + + // Use step hook for back compat. + // Use cssHook if its there. + // Use .style if available and use plain properties where available. + if ( jQuery.fx.step[ tween.prop ] ) { + jQuery.fx.step[ tween.prop ]( tween ); + } else if ( tween.elem.nodeType === 1 && ( + jQuery.cssHooks[ tween.prop ] || + tween.elem.style[ finalPropName( tween.prop ) ] != null ) ) { + jQuery.style( tween.elem, tween.prop, tween.now + tween.unit ); + } else { + tween.elem[ tween.prop ] = tween.now; + } + } + } +}; + +// Support: IE <=9 only +// Panic based approach to setting things on disconnected nodes +Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = { + set: function( tween ) { + if ( tween.elem.nodeType && tween.elem.parentNode ) { + tween.elem[ tween.prop ] = tween.now; + } + } +}; + +jQuery.easing = { + linear: function( p ) { + return p; + }, + swing: function( p ) { + return 0.5 - Math.cos( p * Math.PI ) / 2; + }, + _default: "swing" +}; + +jQuery.fx = Tween.prototype.init; + +// Back compat <1.8 extension point +jQuery.fx.step = {}; + + + + +var + fxNow, inProgress, + rfxtypes = /^(?:toggle|show|hide)$/, + rrun = /queueHooks$/; + +function schedule() { + if ( inProgress ) { + if ( document.hidden === false && window.requestAnimationFrame ) { + window.requestAnimationFrame( schedule ); + } else { + window.setTimeout( schedule, jQuery.fx.interval ); + } + + jQuery.fx.tick(); + } +} + +// Animations created synchronously will run synchronously +function createFxNow() { + window.setTimeout( function() { + fxNow = undefined; + } ); + return ( fxNow = Date.now() ); +} + +// Generate parameters to create a standard animation +function genFx( type, includeWidth ) { + var which, + i = 0, + attrs = { height: type }; + + // If we include width, step value is 1 to do all cssExpand values, + // otherwise step value is 2 to skip over Left and Right + includeWidth = includeWidth ? 1 : 0; + for ( ; i < 4; i += 2 - includeWidth ) { + which = cssExpand[ i ]; + attrs[ "margin" + which ] = attrs[ "padding" + which ] = type; + } + + if ( includeWidth ) { + attrs.opacity = attrs.width = type; + } + + return attrs; +} + +function createTween( value, prop, animation ) { + var tween, + collection = ( Animation.tweeners[ prop ] || [] ).concat( Animation.tweeners[ "*" ] ), + index = 0, + length = collection.length; + for ( ; index < length; index++ ) { + if ( ( tween = collection[ index ].call( animation, prop, value ) ) ) { + + // We're done with this property + return tween; + } + } +} + +function defaultPrefilter( elem, props, opts ) { + var prop, value, toggle, hooks, oldfire, propTween, restoreDisplay, display, + isBox = "width" in props || "height" in props, + anim = this, + orig = {}, + style = elem.style, + hidden = elem.nodeType && isHiddenWithinTree( elem ), + dataShow = dataPriv.get( elem, "fxshow" ); + + // Queue-skipping animations hijack the fx hooks + if ( !opts.queue ) { + hooks = jQuery._queueHooks( elem, "fx" ); + if ( hooks.unqueued == null ) { + hooks.unqueued = 0; + oldfire = hooks.empty.fire; + hooks.empty.fire = function() { + if ( !hooks.unqueued ) { + oldfire(); + } + }; + } + hooks.unqueued++; + + anim.always( function() { + + // Ensure the complete handler is called before this completes + anim.always( function() { + hooks.unqueued--; + if ( !jQuery.queue( elem, "fx" ).length ) { + hooks.empty.fire(); + } + } ); + } ); + } + + // Detect show/hide animations + for ( prop in props ) { + value = props[ prop ]; + if ( rfxtypes.test( value ) ) { + delete props[ prop ]; + toggle = toggle || value === "toggle"; + if ( value === ( hidden ? "hide" : "show" ) ) { + + // Pretend to be hidden if this is a "show" and + // there is still data from a stopped show/hide + if ( value === "show" && dataShow && dataShow[ prop ] !== undefined ) { + hidden = true; + + // Ignore all other no-op show/hide data + } else { + continue; + } + } + orig[ prop ] = dataShow && dataShow[ prop ] || jQuery.style( elem, prop ); + } + } + + // Bail out if this is a no-op like .hide().hide() + propTween = !jQuery.isEmptyObject( props ); + if ( !propTween && jQuery.isEmptyObject( orig ) ) { + return; + } + + // Restrict "overflow" and "display" styles during box animations + if ( isBox && elem.nodeType === 1 ) { + + // Support: IE <=9 - 11, Edge 12 - 15 + // Record all 3 overflow attributes because IE does not infer the shorthand + // from identically-valued overflowX and overflowY and Edge just mirrors + // the overflowX value there. + opts.overflow = [ style.overflow, style.overflowX, style.overflowY ]; + + // Identify a display type, preferring old show/hide data over the CSS cascade + restoreDisplay = dataShow && dataShow.display; + if ( restoreDisplay == null ) { + restoreDisplay = dataPriv.get( elem, "display" ); + } + display = jQuery.css( elem, "display" ); + if ( display === "none" ) { + if ( restoreDisplay ) { + display = restoreDisplay; + } else { + + // Get nonempty value(s) by temporarily forcing visibility + showHide( [ elem ], true ); + restoreDisplay = elem.style.display || restoreDisplay; + display = jQuery.css( elem, "display" ); + showHide( [ elem ] ); + } + } + + // Animate inline elements as inline-block + if ( display === "inline" || display === "inline-block" && restoreDisplay != null ) { + if ( jQuery.css( elem, "float" ) === "none" ) { + + // Restore the original display value at the end of pure show/hide animations + if ( !propTween ) { + anim.done( function() { + style.display = restoreDisplay; + } ); + if ( restoreDisplay == null ) { + display = style.display; + restoreDisplay = display === "none" ? "" : display; + } + } + style.display = "inline-block"; + } + } + } + + if ( opts.overflow ) { + style.overflow = "hidden"; + anim.always( function() { + style.overflow = opts.overflow[ 0 ]; + style.overflowX = opts.overflow[ 1 ]; + style.overflowY = opts.overflow[ 2 ]; + } ); + } + + // Implement show/hide animations + propTween = false; + for ( prop in orig ) { + + // General show/hide setup for this element animation + if ( !propTween ) { + if ( dataShow ) { + if ( "hidden" in dataShow ) { + hidden = dataShow.hidden; + } + } else { + dataShow = dataPriv.access( elem, "fxshow", { display: restoreDisplay } ); + } + + // Store hidden/visible for toggle so `.stop().toggle()` "reverses" + if ( toggle ) { + dataShow.hidden = !hidden; + } + + // Show elements before animating them + if ( hidden ) { + showHide( [ elem ], true ); + } + + /* eslint-disable no-loop-func */ + + anim.done( function() { + + /* eslint-enable no-loop-func */ + + // The final step of a "hide" animation is actually hiding the element + if ( !hidden ) { + showHide( [ elem ] ); + } + dataPriv.remove( elem, "fxshow" ); + for ( prop in orig ) { + jQuery.style( elem, prop, orig[ prop ] ); + } + } ); + } + + // Per-property setup + propTween = createTween( hidden ? dataShow[ prop ] : 0, prop, anim ); + if ( !( prop in dataShow ) ) { + dataShow[ prop ] = propTween.start; + if ( hidden ) { + propTween.end = propTween.start; + propTween.start = 0; + } + } + } +} + +function propFilter( props, specialEasing ) { + var index, name, easing, value, hooks; + + // camelCase, specialEasing and expand cssHook pass + for ( index in props ) { + name = camelCase( index ); + easing = specialEasing[ name ]; + value = props[ index ]; + if ( Array.isArray( value ) ) { + easing = value[ 1 ]; + value = props[ index ] = value[ 0 ]; + } + + if ( index !== name ) { + props[ name ] = value; + delete props[ index ]; + } + + hooks = jQuery.cssHooks[ name ]; + if ( hooks && "expand" in hooks ) { + value = hooks.expand( value ); + delete props[ name ]; + + // Not quite $.extend, this won't overwrite existing keys. + // Reusing 'index' because we have the correct "name" + for ( index in value ) { + if ( !( index in props ) ) { + props[ index ] = value[ index ]; + specialEasing[ index ] = easing; + } + } + } else { + specialEasing[ name ] = easing; + } + } +} + +function Animation( elem, properties, options ) { + var result, + stopped, + index = 0, + length = Animation.prefilters.length, + deferred = jQuery.Deferred().always( function() { + + // Don't match elem in the :animated selector + delete tick.elem; + } ), + tick = function() { + if ( stopped ) { + return false; + } + var currentTime = fxNow || createFxNow(), + remaining = Math.max( 0, animation.startTime + animation.duration - currentTime ), + + // Support: Android 2.3 only + // Archaic crash bug won't allow us to use `1 - ( 0.5 || 0 )` (#12497) + temp = remaining / animation.duration || 0, + percent = 1 - temp, + index = 0, + length = animation.tweens.length; + + for ( ; index < length; index++ ) { + animation.tweens[ index ].run( percent ); + } + + deferred.notifyWith( elem, [ animation, percent, remaining ] ); + + // If there's more to do, yield + if ( percent < 1 && length ) { + return remaining; + } + + // If this was an empty animation, synthesize a final progress notification + if ( !length ) { + deferred.notifyWith( elem, [ animation, 1, 0 ] ); + } + + // Resolve the animation and report its conclusion + deferred.resolveWith( elem, [ animation ] ); + return false; + }, + animation = deferred.promise( { + elem: elem, + props: jQuery.extend( {}, properties ), + opts: jQuery.extend( true, { + specialEasing: {}, + easing: jQuery.easing._default + }, options ), + originalProperties: properties, + originalOptions: options, + startTime: fxNow || createFxNow(), + duration: options.duration, + tweens: [], + createTween: function( prop, end ) { + var tween = jQuery.Tween( elem, animation.opts, prop, end, + animation.opts.specialEasing[ prop ] || animation.opts.easing ); + animation.tweens.push( tween ); + return tween; + }, + stop: function( gotoEnd ) { + var index = 0, + + // If we are going to the end, we want to run all the tweens + // otherwise we skip this part + length = gotoEnd ? animation.tweens.length : 0; + if ( stopped ) { + return this; + } + stopped = true; + for ( ; index < length; index++ ) { + animation.tweens[ index ].run( 1 ); + } + + // Resolve when we played the last frame; otherwise, reject + if ( gotoEnd ) { + deferred.notifyWith( elem, [ animation, 1, 0 ] ); + deferred.resolveWith( elem, [ animation, gotoEnd ] ); + } else { + deferred.rejectWith( elem, [ animation, gotoEnd ] ); + } + return this; + } + } ), + props = animation.props; + + propFilter( props, animation.opts.specialEasing ); + + for ( ; index < length; index++ ) { + result = Animation.prefilters[ index ].call( animation, elem, props, animation.opts ); + if ( result ) { + if ( isFunction( result.stop ) ) { + jQuery._queueHooks( animation.elem, animation.opts.queue ).stop = + result.stop.bind( result ); + } + return result; + } + } + + jQuery.map( props, createTween, animation ); + + if ( isFunction( animation.opts.start ) ) { + animation.opts.start.call( elem, animation ); + } + + // Attach callbacks from options + animation + .progress( animation.opts.progress ) + .done( animation.opts.done, animation.opts.complete ) + .fail( animation.opts.fail ) + .always( animation.opts.always ); + + jQuery.fx.timer( + jQuery.extend( tick, { + elem: elem, + anim: animation, + queue: animation.opts.queue + } ) + ); + + return animation; +} + +jQuery.Animation = jQuery.extend( Animation, { + + tweeners: { + "*": [ function( prop, value ) { + var tween = this.createTween( prop, value ); + adjustCSS( tween.elem, prop, rcssNum.exec( value ), tween ); + return tween; + } ] + }, + + tweener: function( props, callback ) { + if ( isFunction( props ) ) { + callback = props; + props = [ "*" ]; + } else { + props = props.match( rnothtmlwhite ); + } + + var prop, + index = 0, + length = props.length; + + for ( ; index < length; index++ ) { + prop = props[ index ]; + Animation.tweeners[ prop ] = Animation.tweeners[ prop ] || []; + Animation.tweeners[ prop ].unshift( callback ); + } + }, + + prefilters: [ defaultPrefilter ], + + prefilter: function( callback, prepend ) { + if ( prepend ) { + Animation.prefilters.unshift( callback ); + } else { + Animation.prefilters.push( callback ); + } + } +} ); + +jQuery.speed = function( speed, easing, fn ) { + var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : { + complete: fn || !fn && easing || + isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !isFunction( easing ) && easing + }; + + // Go to the end state if fx are off + if ( jQuery.fx.off ) { + opt.duration = 0; + + } else { + if ( typeof opt.duration !== "number" ) { + if ( opt.duration in jQuery.fx.speeds ) { + opt.duration = jQuery.fx.speeds[ opt.duration ]; + + } else { + opt.duration = jQuery.fx.speeds._default; + } + } + } + + // Normalize opt.queue - true/undefined/null -> "fx" + if ( opt.queue == null || opt.queue === true ) { + opt.queue = "fx"; + } + + // Queueing + opt.old = opt.complete; + + opt.complete = function() { + if ( isFunction( opt.old ) ) { + opt.old.call( this ); + } + + if ( opt.queue ) { + jQuery.dequeue( this, opt.queue ); + } + }; + + return opt; +}; + +jQuery.fn.extend( { + fadeTo: function( speed, to, easing, callback ) { + + // Show any hidden elements after setting opacity to 0 + return this.filter( isHiddenWithinTree ).css( "opacity", 0 ).show() + + // Animate to the value specified + .end().animate( { opacity: to }, speed, easing, callback ); + }, + animate: function( prop, speed, easing, callback ) { + var empty = jQuery.isEmptyObject( prop ), + optall = jQuery.speed( speed, easing, callback ), + doAnimation = function() { + + // Operate on a copy of prop so per-property easing won't be lost + var anim = Animation( this, jQuery.extend( {}, prop ), optall ); + + // Empty animations, or finishing resolves immediately + if ( empty || dataPriv.get( this, "finish" ) ) { + anim.stop( true ); + } + }; + doAnimation.finish = doAnimation; + + return empty || optall.queue === false ? + this.each( doAnimation ) : + this.queue( optall.queue, doAnimation ); + }, + stop: function( type, clearQueue, gotoEnd ) { + var stopQueue = function( hooks ) { + var stop = hooks.stop; + delete hooks.stop; + stop( gotoEnd ); + }; + + if ( typeof type !== "string" ) { + gotoEnd = clearQueue; + clearQueue = type; + type = undefined; + } + if ( clearQueue ) { + this.queue( type || "fx", [] ); + } + + return this.each( function() { + var dequeue = true, + index = type != null && type + "queueHooks", + timers = jQuery.timers, + data = dataPriv.get( this ); + + if ( index ) { + if ( data[ index ] && data[ index ].stop ) { + stopQueue( data[ index ] ); + } + } else { + for ( index in data ) { + if ( data[ index ] && data[ index ].stop && rrun.test( index ) ) { + stopQueue( data[ index ] ); + } + } + } + + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && + ( type == null || timers[ index ].queue === type ) ) { + + timers[ index ].anim.stop( gotoEnd ); + dequeue = false; + timers.splice( index, 1 ); + } + } + + // Start the next in the queue if the last step wasn't forced. + // Timers currently will call their complete callbacks, which + // will dequeue but only if they were gotoEnd. + if ( dequeue || !gotoEnd ) { + jQuery.dequeue( this, type ); + } + } ); + }, + finish: function( type ) { + if ( type !== false ) { + type = type || "fx"; + } + return this.each( function() { + var index, + data = dataPriv.get( this ), + queue = data[ type + "queue" ], + hooks = data[ type + "queueHooks" ], + timers = jQuery.timers, + length = queue ? queue.length : 0; + + // Enable finishing flag on private data + data.finish = true; + + // Empty the queue first + jQuery.queue( this, type, [] ); + + if ( hooks && hooks.stop ) { + hooks.stop.call( this, true ); + } + + // Look for any active animations, and finish them + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && timers[ index ].queue === type ) { + timers[ index ].anim.stop( true ); + timers.splice( index, 1 ); + } + } + + // Look for any animations in the old queue and finish them + for ( index = 0; index < length; index++ ) { + if ( queue[ index ] && queue[ index ].finish ) { + queue[ index ].finish.call( this ); + } + } + + // Turn off finishing flag + delete data.finish; + } ); + } +} ); + +jQuery.each( [ "toggle", "show", "hide" ], function( _i, name ) { + var cssFn = jQuery.fn[ name ]; + jQuery.fn[ name ] = function( speed, easing, callback ) { + return speed == null || typeof speed === "boolean" ? + cssFn.apply( this, arguments ) : + this.animate( genFx( name, true ), speed, easing, callback ); + }; +} ); + +// Generate shortcuts for custom animations +jQuery.each( { + slideDown: genFx( "show" ), + slideUp: genFx( "hide" ), + slideToggle: genFx( "toggle" ), + fadeIn: { opacity: "show" }, + fadeOut: { opacity: "hide" }, + fadeToggle: { opacity: "toggle" } +}, function( name, props ) { + jQuery.fn[ name ] = function( speed, easing, callback ) { + return this.animate( props, speed, easing, callback ); + }; +} ); + +jQuery.timers = []; +jQuery.fx.tick = function() { + var timer, + i = 0, + timers = jQuery.timers; + + fxNow = Date.now(); + + for ( ; i < timers.length; i++ ) { + timer = timers[ i ]; + + // Run the timer and safely remove it when done (allowing for external removal) + if ( !timer() && timers[ i ] === timer ) { + timers.splice( i--, 1 ); + } + } + + if ( !timers.length ) { + jQuery.fx.stop(); + } + fxNow = undefined; +}; + +jQuery.fx.timer = function( timer ) { + jQuery.timers.push( timer ); + jQuery.fx.start(); +}; + +jQuery.fx.interval = 13; +jQuery.fx.start = function() { + if ( inProgress ) { + return; + } + + inProgress = true; + schedule(); +}; + +jQuery.fx.stop = function() { + inProgress = null; +}; + +jQuery.fx.speeds = { + slow: 600, + fast: 200, + + // Default speed + _default: 400 +}; + + +// Based off of the plugin by Clint Helfers, with permission. +// https://web.archive.org/web/20100324014747/http://blindsignals.com/index.php/2009/07/jquery-delay/ +jQuery.fn.delay = function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time; + type = type || "fx"; + + return this.queue( type, function( next, hooks ) { + var timeout = window.setTimeout( next, time ); + hooks.stop = function() { + window.clearTimeout( timeout ); + }; + } ); +}; + + +( function() { + var input = document.createElement( "input" ), + select = document.createElement( "select" ), + opt = select.appendChild( document.createElement( "option" ) ); + + input.type = "checkbox"; + + // Support: Android <=4.3 only + // Default value for a checkbox should be "on" + support.checkOn = input.value !== ""; + + // Support: IE <=11 only + // Must access selectedIndex to make default options select + support.optSelected = opt.selected; + + // Support: IE <=11 only + // An input loses its value after becoming a radio + input = document.createElement( "input" ); + input.value = "t"; + input.type = "radio"; + support.radioValue = input.value === "t"; +} )(); + + +var boolHook, + attrHandle = jQuery.expr.attrHandle; + +jQuery.fn.extend( { + attr: function( name, value ) { + return access( this, jQuery.attr, name, value, arguments.length > 1 ); + }, + + removeAttr: function( name ) { + return this.each( function() { + jQuery.removeAttr( this, name ); + } ); + } +} ); + +jQuery.extend( { + attr: function( elem, name, value ) { + var ret, hooks, + nType = elem.nodeType; + + // Don't get/set attributes on text, comment and attribute nodes + if ( nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + // Fallback to prop when attributes are not supported + if ( typeof elem.getAttribute === "undefined" ) { + return jQuery.prop( elem, name, value ); + } + + // Attribute hooks are determined by the lowercase version + // Grab necessary hook if one is defined + if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) { + hooks = jQuery.attrHooks[ name.toLowerCase() ] || + ( jQuery.expr.match.bool.test( name ) ? boolHook : undefined ); + } + + if ( value !== undefined ) { + if ( value === null ) { + jQuery.removeAttr( elem, name ); + return; + } + + if ( hooks && "set" in hooks && + ( ret = hooks.set( elem, value, name ) ) !== undefined ) { + return ret; + } + + elem.setAttribute( name, value + "" ); + return value; + } + + if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) { + return ret; + } + + ret = jQuery.find.attr( elem, name ); + + // Non-existent attributes return null, we normalize to undefined + return ret == null ? undefined : ret; + }, + + attrHooks: { + type: { + set: function( elem, value ) { + if ( !support.radioValue && value === "radio" && + nodeName( elem, "input" ) ) { + var val = elem.value; + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; + } + } + } + }, + + removeAttr: function( elem, value ) { + var name, + i = 0, + + // Attribute names can contain non-HTML whitespace characters + // https://html.spec.whatwg.org/multipage/syntax.html#attributes-2 + attrNames = value && value.match( rnothtmlwhite ); + + if ( attrNames && elem.nodeType === 1 ) { + while ( ( name = attrNames[ i++ ] ) ) { + elem.removeAttribute( name ); + } + } + } +} ); + +// Hooks for boolean attributes +boolHook = { + set: function( elem, value, name ) { + if ( value === false ) { + + // Remove boolean attributes when set to false + jQuery.removeAttr( elem, name ); + } else { + elem.setAttribute( name, name ); + } + return name; + } +}; + +jQuery.each( jQuery.expr.match.bool.source.match( /\w+/g ), function( _i, name ) { + var getter = attrHandle[ name ] || jQuery.find.attr; + + attrHandle[ name ] = function( elem, name, isXML ) { + var ret, handle, + lowercaseName = name.toLowerCase(); + + if ( !isXML ) { + + // Avoid an infinite loop by temporarily removing this function from the getter + handle = attrHandle[ lowercaseName ]; + attrHandle[ lowercaseName ] = ret; + ret = getter( elem, name, isXML ) != null ? + lowercaseName : + null; + attrHandle[ lowercaseName ] = handle; + } + return ret; + }; +} ); + + + + +var rfocusable = /^(?:input|select|textarea|button)$/i, + rclickable = /^(?:a|area)$/i; + +jQuery.fn.extend( { + prop: function( name, value ) { + return access( this, jQuery.prop, name, value, arguments.length > 1 ); + }, + + removeProp: function( name ) { + return this.each( function() { + delete this[ jQuery.propFix[ name ] || name ]; + } ); + } +} ); + +jQuery.extend( { + prop: function( elem, name, value ) { + var ret, hooks, + nType = elem.nodeType; + + // Don't get/set properties on text, comment and attribute nodes + if ( nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) { + + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } + + if ( value !== undefined ) { + if ( hooks && "set" in hooks && + ( ret = hooks.set( elem, value, name ) ) !== undefined ) { + return ret; + } + + return ( elem[ name ] = value ); + } + + if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) { + return ret; + } + + return elem[ name ]; + }, + + propHooks: { + tabIndex: { + get: function( elem ) { + + // Support: IE <=9 - 11 only + // elem.tabIndex doesn't always return the + // correct value when it hasn't been explicitly set + // https://web.archive.org/web/20141116233347/http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + // Use proper attribute retrieval(#12072) + var tabindex = jQuery.find.attr( elem, "tabindex" ); + + if ( tabindex ) { + return parseInt( tabindex, 10 ); + } + + if ( + rfocusable.test( elem.nodeName ) || + rclickable.test( elem.nodeName ) && + elem.href + ) { + return 0; + } + + return -1; + } + } + }, + + propFix: { + "for": "htmlFor", + "class": "className" + } +} ); + +// Support: IE <=11 only +// Accessing the selectedIndex property +// forces the browser to respect setting selected +// on the option +// The getter ensures a default option is selected +// when in an optgroup +// eslint rule "no-unused-expressions" is disabled for this code +// since it considers such accessions noop +if ( !support.optSelected ) { + jQuery.propHooks.selected = { + get: function( elem ) { + + /* eslint no-unused-expressions: "off" */ + + var parent = elem.parentNode; + if ( parent && parent.parentNode ) { + parent.parentNode.selectedIndex; + } + return null; + }, + set: function( elem ) { + + /* eslint no-unused-expressions: "off" */ + + var parent = elem.parentNode; + if ( parent ) { + parent.selectedIndex; + + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + } + }; +} + +jQuery.each( [ + "tabIndex", + "readOnly", + "maxLength", + "cellSpacing", + "cellPadding", + "rowSpan", + "colSpan", + "useMap", + "frameBorder", + "contentEditable" +], function() { + jQuery.propFix[ this.toLowerCase() ] = this; +} ); + + + + + // Strip and collapse whitespace according to HTML spec + // https://infra.spec.whatwg.org/#strip-and-collapse-ascii-whitespace + function stripAndCollapse( value ) { + var tokens = value.match( rnothtmlwhite ) || []; + return tokens.join( " " ); + } + + +function getClass( elem ) { + return elem.getAttribute && elem.getAttribute( "class" ) || ""; +} + +function classesToArray( value ) { + if ( Array.isArray( value ) ) { + return value; + } + if ( typeof value === "string" ) { + return value.match( rnothtmlwhite ) || []; + } + return []; +} + +jQuery.fn.extend( { + addClass: function( value ) { + var classes, elem, cur, curValue, clazz, j, finalValue, + i = 0; + + if ( isFunction( value ) ) { + return this.each( function( j ) { + jQuery( this ).addClass( value.call( this, j, getClass( this ) ) ); + } ); + } + + classes = classesToArray( value ); + + if ( classes.length ) { + while ( ( elem = this[ i++ ] ) ) { + curValue = getClass( elem ); + cur = elem.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " ); + + if ( cur ) { + j = 0; + while ( ( clazz = classes[ j++ ] ) ) { + if ( cur.indexOf( " " + clazz + " " ) < 0 ) { + cur += clazz + " "; + } + } + + // Only assign if different to avoid unneeded rendering. + finalValue = stripAndCollapse( cur ); + if ( curValue !== finalValue ) { + elem.setAttribute( "class", finalValue ); + } + } + } + } + + return this; + }, + + removeClass: function( value ) { + var classes, elem, cur, curValue, clazz, j, finalValue, + i = 0; + + if ( isFunction( value ) ) { + return this.each( function( j ) { + jQuery( this ).removeClass( value.call( this, j, getClass( this ) ) ); + } ); + } + + if ( !arguments.length ) { + return this.attr( "class", "" ); + } + + classes = classesToArray( value ); + + if ( classes.length ) { + while ( ( elem = this[ i++ ] ) ) { + curValue = getClass( elem ); + + // This expression is here for better compressibility (see addClass) + cur = elem.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " ); + + if ( cur ) { + j = 0; + while ( ( clazz = classes[ j++ ] ) ) { + + // Remove *all* instances + while ( cur.indexOf( " " + clazz + " " ) > -1 ) { + cur = cur.replace( " " + clazz + " ", " " ); + } + } + + // Only assign if different to avoid unneeded rendering. + finalValue = stripAndCollapse( cur ); + if ( curValue !== finalValue ) { + elem.setAttribute( "class", finalValue ); + } + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isValidValue = type === "string" || Array.isArray( value ); + + if ( typeof stateVal === "boolean" && isValidValue ) { + return stateVal ? this.addClass( value ) : this.removeClass( value ); + } + + if ( isFunction( value ) ) { + return this.each( function( i ) { + jQuery( this ).toggleClass( + value.call( this, i, getClass( this ), stateVal ), + stateVal + ); + } ); + } + + return this.each( function() { + var className, i, self, classNames; + + if ( isValidValue ) { + + // Toggle individual class names + i = 0; + self = jQuery( this ); + classNames = classesToArray( value ); + + while ( ( className = classNames[ i++ ] ) ) { + + // Check each className given, space separated list + if ( self.hasClass( className ) ) { + self.removeClass( className ); + } else { + self.addClass( className ); + } + } + + // Toggle whole class name + } else if ( value === undefined || type === "boolean" ) { + className = getClass( this ); + if ( className ) { + + // Store className if set + dataPriv.set( this, "__className__", className ); + } + + // If the element has a class name or if we're passed `false`, + // then remove the whole classname (if there was one, the above saved it). + // Otherwise bring back whatever was previously saved (if anything), + // falling back to the empty string if nothing was stored. + if ( this.setAttribute ) { + this.setAttribute( "class", + className || value === false ? + "" : + dataPriv.get( this, "__className__" ) || "" + ); + } + } + } ); + }, + + hasClass: function( selector ) { + var className, elem, + i = 0; + + className = " " + selector + " "; + while ( ( elem = this[ i++ ] ) ) { + if ( elem.nodeType === 1 && + ( " " + stripAndCollapse( getClass( elem ) ) + " " ).indexOf( className ) > -1 ) { + return true; + } + } + + return false; + } +} ); + + + + +var rreturn = /\r/g; + +jQuery.fn.extend( { + val: function( value ) { + var hooks, ret, valueIsFunction, + elem = this[ 0 ]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.type ] || + jQuery.valHooks[ elem.nodeName.toLowerCase() ]; + + if ( hooks && + "get" in hooks && + ( ret = hooks.get( elem, "value" ) ) !== undefined + ) { + return ret; + } + + ret = elem.value; + + // Handle most common string cases + if ( typeof ret === "string" ) { + return ret.replace( rreturn, "" ); + } + + // Handle cases where value is null/undef or number + return ret == null ? "" : ret; + } + + return; + } + + valueIsFunction = isFunction( value ); + + return this.each( function( i ) { + var val; + + if ( this.nodeType !== 1 ) { + return; + } + + if ( valueIsFunction ) { + val = value.call( this, i, jQuery( this ).val() ); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + + } else if ( typeof val === "number" ) { + val += ""; + + } else if ( Array.isArray( val ) ) { + val = jQuery.map( val, function( value ) { + return value == null ? "" : value + ""; + } ); + } + + hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ]; + + // If set returns undefined, fall back to normal setting + if ( !hooks || !( "set" in hooks ) || hooks.set( this, val, "value" ) === undefined ) { + this.value = val; + } + } ); + } +} ); + +jQuery.extend( { + valHooks: { + option: { + get: function( elem ) { + + var val = jQuery.find.attr( elem, "value" ); + return val != null ? + val : + + // Support: IE <=10 - 11 only + // option.text throws exceptions (#14686, #14858) + // Strip and collapse whitespace + // https://html.spec.whatwg.org/#strip-and-collapse-whitespace + stripAndCollapse( jQuery.text( elem ) ); + } + }, + select: { + get: function( elem ) { + var value, option, i, + options = elem.options, + index = elem.selectedIndex, + one = elem.type === "select-one", + values = one ? null : [], + max = one ? index + 1 : options.length; + + if ( index < 0 ) { + i = max; + + } else { + i = one ? index : 0; + } + + // Loop through all the selected options + for ( ; i < max; i++ ) { + option = options[ i ]; + + // Support: IE <=9 only + // IE8-9 doesn't update selected after form reset (#2551) + if ( ( option.selected || i === index ) && + + // Don't return options that are disabled or in a disabled optgroup + !option.disabled && + ( !option.parentNode.disabled || + !nodeName( option.parentNode, "optgroup" ) ) ) { + + // Get the specific value for the option + value = jQuery( option ).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + return values; + }, + + set: function( elem, value ) { + var optionSet, option, + options = elem.options, + values = jQuery.makeArray( value ), + i = options.length; + + while ( i-- ) { + option = options[ i ]; + + /* eslint-disable no-cond-assign */ + + if ( option.selected = + jQuery.inArray( jQuery.valHooks.option.get( option ), values ) > -1 + ) { + optionSet = true; + } + + /* eslint-enable no-cond-assign */ + } + + // Force browsers to behave consistently when non-matching value is set + if ( !optionSet ) { + elem.selectedIndex = -1; + } + return values; + } + } + } +} ); + +// Radios and checkboxes getter/setter +jQuery.each( [ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + set: function( elem, value ) { + if ( Array.isArray( value ) ) { + return ( elem.checked = jQuery.inArray( jQuery( elem ).val(), value ) > -1 ); + } + } + }; + if ( !support.checkOn ) { + jQuery.valHooks[ this ].get = function( elem ) { + return elem.getAttribute( "value" ) === null ? "on" : elem.value; + }; + } +} ); + + + + +// Return jQuery for attributes-only inclusion + + +support.focusin = "onfocusin" in window; + + +var rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, + stopPropagationCallback = function( e ) { + e.stopPropagation(); + }; + +jQuery.extend( jQuery.event, { + + trigger: function( event, data, elem, onlyHandlers ) { + + var i, cur, tmp, bubbleType, ontype, handle, special, lastElement, + eventPath = [ elem || document ], + type = hasOwn.call( event, "type" ) ? event.type : event, + namespaces = hasOwn.call( event, "namespace" ) ? event.namespace.split( "." ) : []; + + cur = lastElement = tmp = elem = elem || document; + + // Don't do events on text and comment nodes + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + // focus/blur morphs to focusin/out; ensure we're not firing them right now + if ( rfocusMorph.test( type + jQuery.event.triggered ) ) { + return; + } + + if ( type.indexOf( "." ) > -1 ) { + + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split( "." ); + type = namespaces.shift(); + namespaces.sort(); + } + ontype = type.indexOf( ":" ) < 0 && "on" + type; + + // Caller can pass in a jQuery.Event object, Object, or just an event type string + event = event[ jQuery.expando ] ? + event : + new jQuery.Event( type, typeof event === "object" && event ); + + // Trigger bitmask: & 1 for native handlers; & 2 for jQuery (always true) + event.isTrigger = onlyHandlers ? 2 : 3; + event.namespace = namespaces.join( "." ); + event.rnamespace = event.namespace ? + new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ) : + null; + + // Clean up the event in case it is being reused + event.result = undefined; + if ( !event.target ) { + event.target = elem; + } + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data == null ? + [ event ] : + jQuery.makeArray( data, [ event ] ); + + // Allow special events to draw outside the lines + special = jQuery.event.special[ type ] || {}; + if ( !onlyHandlers && special.trigger && special.trigger.apply( elem, data ) === false ) { + return; + } + + // Determine event propagation path in advance, per W3C events spec (#9951) + // Bubble up to document, then to window; watch for a global ownerDocument var (#9724) + if ( !onlyHandlers && !special.noBubble && !isWindow( elem ) ) { + + bubbleType = special.delegateType || type; + if ( !rfocusMorph.test( bubbleType + type ) ) { + cur = cur.parentNode; + } + for ( ; cur; cur = cur.parentNode ) { + eventPath.push( cur ); + tmp = cur; + } + + // Only add window if we got to document (e.g., not plain obj or detached DOM) + if ( tmp === ( elem.ownerDocument || document ) ) { + eventPath.push( tmp.defaultView || tmp.parentWindow || window ); + } + } + + // Fire handlers on the event path + i = 0; + while ( ( cur = eventPath[ i++ ] ) && !event.isPropagationStopped() ) { + lastElement = cur; + event.type = i > 1 ? + bubbleType : + special.bindType || type; + + // jQuery handler + handle = ( + dataPriv.get( cur, "events" ) || Object.create( null ) + )[ event.type ] && + dataPriv.get( cur, "handle" ); + if ( handle ) { + handle.apply( cur, data ); + } + + // Native handler + handle = ontype && cur[ ontype ]; + if ( handle && handle.apply && acceptData( cur ) ) { + event.result = handle.apply( cur, data ); + if ( event.result === false ) { + event.preventDefault(); + } + } + } + event.type = type; + + // If nobody prevented the default action, do it now + if ( !onlyHandlers && !event.isDefaultPrevented() ) { + + if ( ( !special._default || + special._default.apply( eventPath.pop(), data ) === false ) && + acceptData( elem ) ) { + + // Call a native DOM method on the target with the same name as the event. + // Don't do default actions on window, that's where global variables be (#6170) + if ( ontype && isFunction( elem[ type ] ) && !isWindow( elem ) ) { + + // Don't re-trigger an onFOO event when we call its FOO() method + tmp = elem[ ontype ]; + + if ( tmp ) { + elem[ ontype ] = null; + } + + // Prevent re-triggering of the same event, since we already bubbled it above + jQuery.event.triggered = type; + + if ( event.isPropagationStopped() ) { + lastElement.addEventListener( type, stopPropagationCallback ); + } + + elem[ type ](); + + if ( event.isPropagationStopped() ) { + lastElement.removeEventListener( type, stopPropagationCallback ); + } + + jQuery.event.triggered = undefined; + + if ( tmp ) { + elem[ ontype ] = tmp; + } + } + } + } + + return event.result; + }, + + // Piggyback on a donor event to simulate a different one + // Used only for `focus(in | out)` events + simulate: function( type, elem, event ) { + var e = jQuery.extend( + new jQuery.Event(), + event, + { + type: type, + isSimulated: true + } + ); + + jQuery.event.trigger( e, null, elem ); + } + +} ); + +jQuery.fn.extend( { + + trigger: function( type, data ) { + return this.each( function() { + jQuery.event.trigger( type, data, this ); + } ); + }, + triggerHandler: function( type, data ) { + var elem = this[ 0 ]; + if ( elem ) { + return jQuery.event.trigger( type, data, elem, true ); + } + } +} ); + + +// Support: Firefox <=44 +// Firefox doesn't have focus(in | out) events +// Related ticket - https://bugzilla.mozilla.org/show_bug.cgi?id=687787 +// +// Support: Chrome <=48 - 49, Safari <=9.0 - 9.1 +// focus(in | out) events fire after focus & blur events, +// which is spec violation - http://www.w3.org/TR/DOM-Level-3-Events/#events-focusevent-event-order +// Related ticket - https://bugs.chromium.org/p/chromium/issues/detail?id=449857 +if ( !support.focusin ) { + jQuery.each( { focus: "focusin", blur: "focusout" }, function( orig, fix ) { + + // Attach a single capturing handler on the document while someone wants focusin/focusout + var handler = function( event ) { + jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ) ); + }; + + jQuery.event.special[ fix ] = { + setup: function() { + + // Handle: regular nodes (via `this.ownerDocument`), window + // (via `this.document`) & document (via `this`). + var doc = this.ownerDocument || this.document || this, + attaches = dataPriv.access( doc, fix ); + + if ( !attaches ) { + doc.addEventListener( orig, handler, true ); + } + dataPriv.access( doc, fix, ( attaches || 0 ) + 1 ); + }, + teardown: function() { + var doc = this.ownerDocument || this.document || this, + attaches = dataPriv.access( doc, fix ) - 1; + + if ( !attaches ) { + doc.removeEventListener( orig, handler, true ); + dataPriv.remove( doc, fix ); + + } else { + dataPriv.access( doc, fix, attaches ); + } + } + }; + } ); +} +var location = window.location; + +var nonce = { guid: Date.now() }; + +var rquery = ( /\?/ ); + + + +// Cross-browser xml parsing +jQuery.parseXML = function( data ) { + var xml; + if ( !data || typeof data !== "string" ) { + return null; + } + + // Support: IE 9 - 11 only + // IE throws on parseFromString with invalid input. + try { + xml = ( new window.DOMParser() ).parseFromString( data, "text/xml" ); + } catch ( e ) { + xml = undefined; + } + + if ( !xml || xml.getElementsByTagName( "parsererror" ).length ) { + jQuery.error( "Invalid XML: " + data ); + } + return xml; +}; + + +var + rbracket = /\[\]$/, + rCRLF = /\r?\n/g, + rsubmitterTypes = /^(?:submit|button|image|reset|file)$/i, + rsubmittable = /^(?:input|select|textarea|keygen)/i; + +function buildParams( prefix, obj, traditional, add ) { + var name; + + if ( Array.isArray( obj ) ) { + + // Serialize array item. + jQuery.each( obj, function( i, v ) { + if ( traditional || rbracket.test( prefix ) ) { + + // Treat each array item as a scalar. + add( prefix, v ); + + } else { + + // Item is non-scalar (array or object), encode its numeric index. + buildParams( + prefix + "[" + ( typeof v === "object" && v != null ? i : "" ) + "]", + v, + traditional, + add + ); + } + } ); + + } else if ( !traditional && toType( obj ) === "object" ) { + + // Serialize object item. + for ( name in obj ) { + buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add ); + } + + } else { + + // Serialize scalar item. + add( prefix, obj ); + } +} + +// Serialize an array of form elements or a set of +// key/values into a query string +jQuery.param = function( a, traditional ) { + var prefix, + s = [], + add = function( key, valueOrFunction ) { + + // If value is a function, invoke it and use its return value + var value = isFunction( valueOrFunction ) ? + valueOrFunction() : + valueOrFunction; + + s[ s.length ] = encodeURIComponent( key ) + "=" + + encodeURIComponent( value == null ? "" : value ); + }; + + if ( a == null ) { + return ""; + } + + // If an array was passed in, assume that it is an array of form elements. + if ( Array.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) { + + // Serialize the form elements + jQuery.each( a, function() { + add( this.name, this.value ); + } ); + + } else { + + // If traditional, encode the "old" way (the way 1.3.2 or older + // did it), otherwise encode params recursively. + for ( prefix in a ) { + buildParams( prefix, a[ prefix ], traditional, add ); + } + } + + // Return the resulting serialization + return s.join( "&" ); +}; + +jQuery.fn.extend( { + serialize: function() { + return jQuery.param( this.serializeArray() ); + }, + serializeArray: function() { + return this.map( function() { + + // Can add propHook for "elements" to filter or add form elements + var elements = jQuery.prop( this, "elements" ); + return elements ? jQuery.makeArray( elements ) : this; + } ) + .filter( function() { + var type = this.type; + + // Use .is( ":disabled" ) so that fieldset[disabled] works + return this.name && !jQuery( this ).is( ":disabled" ) && + rsubmittable.test( this.nodeName ) && !rsubmitterTypes.test( type ) && + ( this.checked || !rcheckableType.test( type ) ); + } ) + .map( function( _i, elem ) { + var val = jQuery( this ).val(); + + if ( val == null ) { + return null; + } + + if ( Array.isArray( val ) ) { + return jQuery.map( val, function( val ) { + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + } ); + } + + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + } ).get(); + } +} ); + + +var + r20 = /%20/g, + rhash = /#.*$/, + rantiCache = /([?&])_=[^&]*/, + rheaders = /^(.*?):[ \t]*([^\r\n]*)$/mg, + + // #7653, #8125, #8152: local protocol detection + rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/, + rnoContent = /^(?:GET|HEAD)$/, + rprotocol = /^\/\//, + + /* Prefilters + * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example) + * 2) These are called: + * - BEFORE asking for a transport + * - AFTER param serialization (s.data is a string if s.processData is true) + * 3) key is the dataType + * 4) the catchall symbol "*" can be used + * 5) execution will start with transport dataType and THEN continue down to "*" if needed + */ + prefilters = {}, + + /* Transports bindings + * 1) key is the dataType + * 2) the catchall symbol "*" can be used + * 3) selection will start with transport dataType and THEN go to "*" if needed + */ + transports = {}, + + // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression + allTypes = "*/".concat( "*" ), + + // Anchor tag for parsing the document origin + originAnchor = document.createElement( "a" ); + originAnchor.href = location.href; + +// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport +function addToPrefiltersOrTransports( structure ) { + + // dataTypeExpression is optional and defaults to "*" + return function( dataTypeExpression, func ) { + + if ( typeof dataTypeExpression !== "string" ) { + func = dataTypeExpression; + dataTypeExpression = "*"; + } + + var dataType, + i = 0, + dataTypes = dataTypeExpression.toLowerCase().match( rnothtmlwhite ) || []; + + if ( isFunction( func ) ) { + + // For each dataType in the dataTypeExpression + while ( ( dataType = dataTypes[ i++ ] ) ) { + + // Prepend if requested + if ( dataType[ 0 ] === "+" ) { + dataType = dataType.slice( 1 ) || "*"; + ( structure[ dataType ] = structure[ dataType ] || [] ).unshift( func ); + + // Otherwise append + } else { + ( structure[ dataType ] = structure[ dataType ] || [] ).push( func ); + } + } + } + }; +} + +// Base inspection function for prefilters and transports +function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR ) { + + var inspected = {}, + seekingTransport = ( structure === transports ); + + function inspect( dataType ) { + var selected; + inspected[ dataType ] = true; + jQuery.each( structure[ dataType ] || [], function( _, prefilterOrFactory ) { + var dataTypeOrTransport = prefilterOrFactory( options, originalOptions, jqXHR ); + if ( typeof dataTypeOrTransport === "string" && + !seekingTransport && !inspected[ dataTypeOrTransport ] ) { + + options.dataTypes.unshift( dataTypeOrTransport ); + inspect( dataTypeOrTransport ); + return false; + } else if ( seekingTransport ) { + return !( selected = dataTypeOrTransport ); + } + } ); + return selected; + } + + return inspect( options.dataTypes[ 0 ] ) || !inspected[ "*" ] && inspect( "*" ); +} + +// A special extend for ajax options +// that takes "flat" options (not to be deep extended) +// Fixes #9887 +function ajaxExtend( target, src ) { + var key, deep, + flatOptions = jQuery.ajaxSettings.flatOptions || {}; + + for ( key in src ) { + if ( src[ key ] !== undefined ) { + ( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ]; + } + } + if ( deep ) { + jQuery.extend( true, target, deep ); + } + + return target; +} + +/* Handles responses to an ajax request: + * - finds the right dataType (mediates between content-type and expected dataType) + * - returns the corresponding response + */ +function ajaxHandleResponses( s, jqXHR, responses ) { + + var ct, type, finalDataType, firstDataType, + contents = s.contents, + dataTypes = s.dataTypes; + + // Remove auto dataType and get content-type in the process + while ( dataTypes[ 0 ] === "*" ) { + dataTypes.shift(); + if ( ct === undefined ) { + ct = s.mimeType || jqXHR.getResponseHeader( "Content-Type" ); + } + } + + // Check if we're dealing with a known content-type + if ( ct ) { + for ( type in contents ) { + if ( contents[ type ] && contents[ type ].test( ct ) ) { + dataTypes.unshift( type ); + break; + } + } + } + + // Check to see if we have a response for the expected dataType + if ( dataTypes[ 0 ] in responses ) { + finalDataType = dataTypes[ 0 ]; + } else { + + // Try convertible dataTypes + for ( type in responses ) { + if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[ 0 ] ] ) { + finalDataType = type; + break; + } + if ( !firstDataType ) { + firstDataType = type; + } + } + + // Or just use first one + finalDataType = finalDataType || firstDataType; + } + + // If we found a dataType + // We add the dataType to the list if needed + // and return the corresponding response + if ( finalDataType ) { + if ( finalDataType !== dataTypes[ 0 ] ) { + dataTypes.unshift( finalDataType ); + } + return responses[ finalDataType ]; + } +} + +/* Chain conversions given the request and the original response + * Also sets the responseXXX fields on the jqXHR instance + */ +function ajaxConvert( s, response, jqXHR, isSuccess ) { + var conv2, current, conv, tmp, prev, + converters = {}, + + // Work with a copy of dataTypes in case we need to modify it for conversion + dataTypes = s.dataTypes.slice(); + + // Create converters map with lowercased keys + if ( dataTypes[ 1 ] ) { + for ( conv in s.converters ) { + converters[ conv.toLowerCase() ] = s.converters[ conv ]; + } + } + + current = dataTypes.shift(); + + // Convert to each sequential dataType + while ( current ) { + + if ( s.responseFields[ current ] ) { + jqXHR[ s.responseFields[ current ] ] = response; + } + + // Apply the dataFilter if provided + if ( !prev && isSuccess && s.dataFilter ) { + response = s.dataFilter( response, s.dataType ); + } + + prev = current; + current = dataTypes.shift(); + + if ( current ) { + + // There's only work to do if current dataType is non-auto + if ( current === "*" ) { + + current = prev; + + // Convert response if prev dataType is non-auto and differs from current + } else if ( prev !== "*" && prev !== current ) { + + // Seek a direct converter + conv = converters[ prev + " " + current ] || converters[ "* " + current ]; + + // If none found, seek a pair + if ( !conv ) { + for ( conv2 in converters ) { + + // If conv2 outputs current + tmp = conv2.split( " " ); + if ( tmp[ 1 ] === current ) { + + // If prev can be converted to accepted input + conv = converters[ prev + " " + tmp[ 0 ] ] || + converters[ "* " + tmp[ 0 ] ]; + if ( conv ) { + + // Condense equivalence converters + if ( conv === true ) { + conv = converters[ conv2 ]; + + // Otherwise, insert the intermediate dataType + } else if ( converters[ conv2 ] !== true ) { + current = tmp[ 0 ]; + dataTypes.unshift( tmp[ 1 ] ); + } + break; + } + } + } + } + + // Apply converter (if not an equivalence) + if ( conv !== true ) { + + // Unless errors are allowed to bubble, catch and return them + if ( conv && s.throws ) { + response = conv( response ); + } else { + try { + response = conv( response ); + } catch ( e ) { + return { + state: "parsererror", + error: conv ? e : "No conversion from " + prev + " to " + current + }; + } + } + } + } + } + } + + return { state: "success", data: response }; +} + +jQuery.extend( { + + // Counter for holding the number of active queries + active: 0, + + // Last-Modified header cache for next request + lastModified: {}, + etag: {}, + + ajaxSettings: { + url: location.href, + type: "GET", + isLocal: rlocalProtocol.test( location.protocol ), + global: true, + processData: true, + async: true, + contentType: "application/x-www-form-urlencoded; charset=UTF-8", + + /* + timeout: 0, + data: null, + dataType: null, + username: null, + password: null, + cache: null, + throws: false, + traditional: false, + headers: {}, + */ + + accepts: { + "*": allTypes, + text: "text/plain", + html: "text/html", + xml: "application/xml, text/xml", + json: "application/json, text/javascript" + }, + + contents: { + xml: /\bxml\b/, + html: /\bhtml/, + json: /\bjson\b/ + }, + + responseFields: { + xml: "responseXML", + text: "responseText", + json: "responseJSON" + }, + + // Data converters + // Keys separate source (or catchall "*") and destination types with a single space + converters: { + + // Convert anything to text + "* text": String, + + // Text to html (true = no transformation) + "text html": true, + + // Evaluate text as a json expression + "text json": JSON.parse, + + // Parse text as xml + "text xml": jQuery.parseXML + }, + + // For options that shouldn't be deep extended: + // you can add your own custom options here if + // and when you create one that shouldn't be + // deep extended (see ajaxExtend) + flatOptions: { + url: true, + context: true + } + }, + + // Creates a full fledged settings object into target + // with both ajaxSettings and settings fields. + // If target is omitted, writes into ajaxSettings. + ajaxSetup: function( target, settings ) { + return settings ? + + // Building a settings object + ajaxExtend( ajaxExtend( target, jQuery.ajaxSettings ), settings ) : + + // Extending ajaxSettings + ajaxExtend( jQuery.ajaxSettings, target ); + }, + + ajaxPrefilter: addToPrefiltersOrTransports( prefilters ), + ajaxTransport: addToPrefiltersOrTransports( transports ), + + // Main method + ajax: function( url, options ) { + + // If url is an object, simulate pre-1.5 signature + if ( typeof url === "object" ) { + options = url; + url = undefined; + } + + // Force options to be an object + options = options || {}; + + var transport, + + // URL without anti-cache param + cacheURL, + + // Response headers + responseHeadersString, + responseHeaders, + + // timeout handle + timeoutTimer, + + // Url cleanup var + urlAnchor, + + // Request state (becomes false upon send and true upon completion) + completed, + + // To know if global events are to be dispatched + fireGlobals, + + // Loop variable + i, + + // uncached part of the url + uncached, + + // Create the final options object + s = jQuery.ajaxSetup( {}, options ), + + // Callbacks context + callbackContext = s.context || s, + + // Context for global events is callbackContext if it is a DOM node or jQuery collection + globalEventContext = s.context && + ( callbackContext.nodeType || callbackContext.jquery ) ? + jQuery( callbackContext ) : + jQuery.event, + + // Deferreds + deferred = jQuery.Deferred(), + completeDeferred = jQuery.Callbacks( "once memory" ), + + // Status-dependent callbacks + statusCode = s.statusCode || {}, + + // Headers (they are sent all at once) + requestHeaders = {}, + requestHeadersNames = {}, + + // Default abort message + strAbort = "canceled", + + // Fake xhr + jqXHR = { + readyState: 0, + + // Builds headers hashtable if needed + getResponseHeader: function( key ) { + var match; + if ( completed ) { + if ( !responseHeaders ) { + responseHeaders = {}; + while ( ( match = rheaders.exec( responseHeadersString ) ) ) { + responseHeaders[ match[ 1 ].toLowerCase() + " " ] = + ( responseHeaders[ match[ 1 ].toLowerCase() + " " ] || [] ) + .concat( match[ 2 ] ); + } + } + match = responseHeaders[ key.toLowerCase() + " " ]; + } + return match == null ? null : match.join( ", " ); + }, + + // Raw string + getAllResponseHeaders: function() { + return completed ? responseHeadersString : null; + }, + + // Caches the header + setRequestHeader: function( name, value ) { + if ( completed == null ) { + name = requestHeadersNames[ name.toLowerCase() ] = + requestHeadersNames[ name.toLowerCase() ] || name; + requestHeaders[ name ] = value; + } + return this; + }, + + // Overrides response content-type header + overrideMimeType: function( type ) { + if ( completed == null ) { + s.mimeType = type; + } + return this; + }, + + // Status-dependent callbacks + statusCode: function( map ) { + var code; + if ( map ) { + if ( completed ) { + + // Execute the appropriate callbacks + jqXHR.always( map[ jqXHR.status ] ); + } else { + + // Lazy-add the new callbacks in a way that preserves old ones + for ( code in map ) { + statusCode[ code ] = [ statusCode[ code ], map[ code ] ]; + } + } + } + return this; + }, + + // Cancel the request + abort: function( statusText ) { + var finalText = statusText || strAbort; + if ( transport ) { + transport.abort( finalText ); + } + done( 0, finalText ); + return this; + } + }; + + // Attach deferreds + deferred.promise( jqXHR ); + + // Add protocol if not provided (prefilters might expect it) + // Handle falsy url in the settings object (#10093: consistency with old signature) + // We also use the url parameter if available + s.url = ( ( url || s.url || location.href ) + "" ) + .replace( rprotocol, location.protocol + "//" ); + + // Alias method option to type as per ticket #12004 + s.type = options.method || options.type || s.method || s.type; + + // Extract dataTypes list + s.dataTypes = ( s.dataType || "*" ).toLowerCase().match( rnothtmlwhite ) || [ "" ]; + + // A cross-domain request is in order when the origin doesn't match the current origin. + if ( s.crossDomain == null ) { + urlAnchor = document.createElement( "a" ); + + // Support: IE <=8 - 11, Edge 12 - 15 + // IE throws exception on accessing the href property if url is malformed, + // e.g. http://example.com:80x/ + try { + urlAnchor.href = s.url; + + // Support: IE <=8 - 11 only + // Anchor's host property isn't correctly set when s.url is relative + urlAnchor.href = urlAnchor.href; + s.crossDomain = originAnchor.protocol + "//" + originAnchor.host !== + urlAnchor.protocol + "//" + urlAnchor.host; + } catch ( e ) { + + // If there is an error parsing the URL, assume it is crossDomain, + // it can be rejected by the transport if it is invalid + s.crossDomain = true; + } + } + + // Convert data if not already a string + if ( s.data && s.processData && typeof s.data !== "string" ) { + s.data = jQuery.param( s.data, s.traditional ); + } + + // Apply prefilters + inspectPrefiltersOrTransports( prefilters, s, options, jqXHR ); + + // If request was aborted inside a prefilter, stop there + if ( completed ) { + return jqXHR; + } + + // We can fire global events as of now if asked to + // Don't fire events if jQuery.event is undefined in an AMD-usage scenario (#15118) + fireGlobals = jQuery.event && s.global; + + // Watch for a new set of requests + if ( fireGlobals && jQuery.active++ === 0 ) { + jQuery.event.trigger( "ajaxStart" ); + } + + // Uppercase the type + s.type = s.type.toUpperCase(); + + // Determine if request has content + s.hasContent = !rnoContent.test( s.type ); + + // Save the URL in case we're toying with the If-Modified-Since + // and/or If-None-Match header later on + // Remove hash to simplify url manipulation + cacheURL = s.url.replace( rhash, "" ); + + // More options handling for requests with no content + if ( !s.hasContent ) { + + // Remember the hash so we can put it back + uncached = s.url.slice( cacheURL.length ); + + // If data is available and should be processed, append data to url + if ( s.data && ( s.processData || typeof s.data === "string" ) ) { + cacheURL += ( rquery.test( cacheURL ) ? "&" : "?" ) + s.data; + + // #9682: remove data so that it's not used in an eventual retry + delete s.data; + } + + // Add or update anti-cache param if needed + if ( s.cache === false ) { + cacheURL = cacheURL.replace( rantiCache, "$1" ); + uncached = ( rquery.test( cacheURL ) ? "&" : "?" ) + "_=" + ( nonce.guid++ ) + + uncached; + } + + // Put hash and anti-cache on the URL that will be requested (gh-1732) + s.url = cacheURL + uncached; + + // Change '%20' to '+' if this is encoded form body content (gh-2658) + } else if ( s.data && s.processData && + ( s.contentType || "" ).indexOf( "application/x-www-form-urlencoded" ) === 0 ) { + s.data = s.data.replace( r20, "+" ); + } + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + if ( jQuery.lastModified[ cacheURL ] ) { + jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ cacheURL ] ); + } + if ( jQuery.etag[ cacheURL ] ) { + jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ cacheURL ] ); + } + } + + // Set the correct header, if data is being sent + if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) { + jqXHR.setRequestHeader( "Content-Type", s.contentType ); + } + + // Set the Accepts header for the server, depending on the dataType + jqXHR.setRequestHeader( + "Accept", + s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[ 0 ] ] ? + s.accepts[ s.dataTypes[ 0 ] ] + + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) : + s.accepts[ "*" ] + ); + + // Check for headers option + for ( i in s.headers ) { + jqXHR.setRequestHeader( i, s.headers[ i ] ); + } + + // Allow custom headers/mimetypes and early abort + if ( s.beforeSend && + ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || completed ) ) { + + // Abort if not done already and return + return jqXHR.abort(); + } + + // Aborting is no longer a cancellation + strAbort = "abort"; + + // Install callbacks on deferreds + completeDeferred.add( s.complete ); + jqXHR.done( s.success ); + jqXHR.fail( s.error ); + + // Get transport + transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR ); + + // If no transport, we auto-abort + if ( !transport ) { + done( -1, "No Transport" ); + } else { + jqXHR.readyState = 1; + + // Send global event + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] ); + } + + // If request was aborted inside ajaxSend, stop there + if ( completed ) { + return jqXHR; + } + + // Timeout + if ( s.async && s.timeout > 0 ) { + timeoutTimer = window.setTimeout( function() { + jqXHR.abort( "timeout" ); + }, s.timeout ); + } + + try { + completed = false; + transport.send( requestHeaders, done ); + } catch ( e ) { + + // Rethrow post-completion exceptions + if ( completed ) { + throw e; + } + + // Propagate others as results + done( -1, e ); + } + } + + // Callback for when everything is done + function done( status, nativeStatusText, responses, headers ) { + var isSuccess, success, error, response, modified, + statusText = nativeStatusText; + + // Ignore repeat invocations + if ( completed ) { + return; + } + + completed = true; + + // Clear timeout if it exists + if ( timeoutTimer ) { + window.clearTimeout( timeoutTimer ); + } + + // Dereference transport for early garbage collection + // (no matter how long the jqXHR object will be used) + transport = undefined; + + // Cache response headers + responseHeadersString = headers || ""; + + // Set readyState + jqXHR.readyState = status > 0 ? 4 : 0; + + // Determine if successful + isSuccess = status >= 200 && status < 300 || status === 304; + + // Get response data + if ( responses ) { + response = ajaxHandleResponses( s, jqXHR, responses ); + } + + // Use a noop converter for missing script + if ( !isSuccess && jQuery.inArray( "script", s.dataTypes ) > -1 ) { + s.converters[ "text script" ] = function() {}; + } + + // Convert no matter what (that way responseXXX fields are always set) + response = ajaxConvert( s, response, jqXHR, isSuccess ); + + // If successful, handle type chaining + if ( isSuccess ) { + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + modified = jqXHR.getResponseHeader( "Last-Modified" ); + if ( modified ) { + jQuery.lastModified[ cacheURL ] = modified; + } + modified = jqXHR.getResponseHeader( "etag" ); + if ( modified ) { + jQuery.etag[ cacheURL ] = modified; + } + } + + // if no content + if ( status === 204 || s.type === "HEAD" ) { + statusText = "nocontent"; + + // if not modified + } else if ( status === 304 ) { + statusText = "notmodified"; + + // If we have data, let's convert it + } else { + statusText = response.state; + success = response.data; + error = response.error; + isSuccess = !error; + } + } else { + + // Extract error from statusText and normalize for non-aborts + error = statusText; + if ( status || !statusText ) { + statusText = "error"; + if ( status < 0 ) { + status = 0; + } + } + } + + // Set data for the fake xhr object + jqXHR.status = status; + jqXHR.statusText = ( nativeStatusText || statusText ) + ""; + + // Success/Error + if ( isSuccess ) { + deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] ); + } else { + deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] ); + } + + // Status-dependent callbacks + jqXHR.statusCode( statusCode ); + statusCode = undefined; + + if ( fireGlobals ) { + globalEventContext.trigger( isSuccess ? "ajaxSuccess" : "ajaxError", + [ jqXHR, s, isSuccess ? success : error ] ); + } + + // Complete + completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] ); + + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] ); + + // Handle the global AJAX counter + if ( !( --jQuery.active ) ) { + jQuery.event.trigger( "ajaxStop" ); + } + } + } + + return jqXHR; + }, + + getJSON: function( url, data, callback ) { + return jQuery.get( url, data, callback, "json" ); + }, + + getScript: function( url, callback ) { + return jQuery.get( url, undefined, callback, "script" ); + } +} ); + +jQuery.each( [ "get", "post" ], function( _i, method ) { + jQuery[ method ] = function( url, data, callback, type ) { + + // Shift arguments if data argument was omitted + if ( isFunction( data ) ) { + type = type || callback; + callback = data; + data = undefined; + } + + // The url can be an options object (which then must have .url) + return jQuery.ajax( jQuery.extend( { + url: url, + type: method, + dataType: type, + data: data, + success: callback + }, jQuery.isPlainObject( url ) && url ) ); + }; +} ); + +jQuery.ajaxPrefilter( function( s ) { + var i; + for ( i in s.headers ) { + if ( i.toLowerCase() === "content-type" ) { + s.contentType = s.headers[ i ] || ""; + } + } +} ); + + +jQuery._evalUrl = function( url, options, doc ) { + return jQuery.ajax( { + url: url, + + // Make this explicit, since user can override this through ajaxSetup (#11264) + type: "GET", + dataType: "script", + cache: true, + async: false, + global: false, + + // Only evaluate the response if it is successful (gh-4126) + // dataFilter is not invoked for failure responses, so using it instead + // of the default converter is kludgy but it works. + converters: { + "text script": function() {} + }, + dataFilter: function( response ) { + jQuery.globalEval( response, options, doc ); + } + } ); +}; + + +jQuery.fn.extend( { + wrapAll: function( html ) { + var wrap; + + if ( this[ 0 ] ) { + if ( isFunction( html ) ) { + html = html.call( this[ 0 ] ); + } + + // The elements to wrap the target around + wrap = jQuery( html, this[ 0 ].ownerDocument ).eq( 0 ).clone( true ); + + if ( this[ 0 ].parentNode ) { + wrap.insertBefore( this[ 0 ] ); + } + + wrap.map( function() { + var elem = this; + + while ( elem.firstElementChild ) { + elem = elem.firstElementChild; + } + + return elem; + } ).append( this ); + } + + return this; + }, + + wrapInner: function( html ) { + if ( isFunction( html ) ) { + return this.each( function( i ) { + jQuery( this ).wrapInner( html.call( this, i ) ); + } ); + } + + return this.each( function() { + var self = jQuery( this ), + contents = self.contents(); + + if ( contents.length ) { + contents.wrapAll( html ); + + } else { + self.append( html ); + } + } ); + }, + + wrap: function( html ) { + var htmlIsFunction = isFunction( html ); + + return this.each( function( i ) { + jQuery( this ).wrapAll( htmlIsFunction ? html.call( this, i ) : html ); + } ); + }, + + unwrap: function( selector ) { + this.parent( selector ).not( "body" ).each( function() { + jQuery( this ).replaceWith( this.childNodes ); + } ); + return this; + } +} ); + + +jQuery.expr.pseudos.hidden = function( elem ) { + return !jQuery.expr.pseudos.visible( elem ); +}; +jQuery.expr.pseudos.visible = function( elem ) { + return !!( elem.offsetWidth || elem.offsetHeight || elem.getClientRects().length ); +}; + + + + +jQuery.ajaxSettings.xhr = function() { + try { + return new window.XMLHttpRequest(); + } catch ( e ) {} +}; + +var xhrSuccessStatus = { + + // File protocol always yields status code 0, assume 200 + 0: 200, + + // Support: IE <=9 only + // #1450: sometimes IE returns 1223 when it should be 204 + 1223: 204 + }, + xhrSupported = jQuery.ajaxSettings.xhr(); + +support.cors = !!xhrSupported && ( "withCredentials" in xhrSupported ); +support.ajax = xhrSupported = !!xhrSupported; + +jQuery.ajaxTransport( function( options ) { + var callback, errorCallback; + + // Cross domain only allowed if supported through XMLHttpRequest + if ( support.cors || xhrSupported && !options.crossDomain ) { + return { + send: function( headers, complete ) { + var i, + xhr = options.xhr(); + + xhr.open( + options.type, + options.url, + options.async, + options.username, + options.password + ); + + // Apply custom fields if provided + if ( options.xhrFields ) { + for ( i in options.xhrFields ) { + xhr[ i ] = options.xhrFields[ i ]; + } + } + + // Override mime type if needed + if ( options.mimeType && xhr.overrideMimeType ) { + xhr.overrideMimeType( options.mimeType ); + } + + // X-Requested-With header + // For cross-domain requests, seeing as conditions for a preflight are + // akin to a jigsaw puzzle, we simply never set it to be sure. + // (it can always be set on a per-request basis or even using ajaxSetup) + // For same-domain requests, won't change header if already provided. + if ( !options.crossDomain && !headers[ "X-Requested-With" ] ) { + headers[ "X-Requested-With" ] = "XMLHttpRequest"; + } + + // Set headers + for ( i in headers ) { + xhr.setRequestHeader( i, headers[ i ] ); + } + + // Callback + callback = function( type ) { + return function() { + if ( callback ) { + callback = errorCallback = xhr.onload = + xhr.onerror = xhr.onabort = xhr.ontimeout = + xhr.onreadystatechange = null; + + if ( type === "abort" ) { + xhr.abort(); + } else if ( type === "error" ) { + + // Support: IE <=9 only + // On a manual native abort, IE9 throws + // errors on any property access that is not readyState + if ( typeof xhr.status !== "number" ) { + complete( 0, "error" ); + } else { + complete( + + // File: protocol always yields status 0; see #8605, #14207 + xhr.status, + xhr.statusText + ); + } + } else { + complete( + xhrSuccessStatus[ xhr.status ] || xhr.status, + xhr.statusText, + + // Support: IE <=9 only + // IE9 has no XHR2 but throws on binary (trac-11426) + // For XHR2 non-text, let the caller handle it (gh-2498) + ( xhr.responseType || "text" ) !== "text" || + typeof xhr.responseText !== "string" ? + { binary: xhr.response } : + { text: xhr.responseText }, + xhr.getAllResponseHeaders() + ); + } + } + }; + }; + + // Listen to events + xhr.onload = callback(); + errorCallback = xhr.onerror = xhr.ontimeout = callback( "error" ); + + // Support: IE 9 only + // Use onreadystatechange to replace onabort + // to handle uncaught aborts + if ( xhr.onabort !== undefined ) { + xhr.onabort = errorCallback; + } else { + xhr.onreadystatechange = function() { + + // Check readyState before timeout as it changes + if ( xhr.readyState === 4 ) { + + // Allow onerror to be called first, + // but that will not handle a native abort + // Also, save errorCallback to a variable + // as xhr.onerror cannot be accessed + window.setTimeout( function() { + if ( callback ) { + errorCallback(); + } + } ); + } + }; + } + + // Create the abort callback + callback = callback( "abort" ); + + try { + + // Do send the request (this may raise an exception) + xhr.send( options.hasContent && options.data || null ); + } catch ( e ) { + + // #14683: Only rethrow if this hasn't been notified as an error yet + if ( callback ) { + throw e; + } + } + }, + + abort: function() { + if ( callback ) { + callback(); + } + } + }; + } +} ); + + + + +// Prevent auto-execution of scripts when no explicit dataType was provided (See gh-2432) +jQuery.ajaxPrefilter( function( s ) { + if ( s.crossDomain ) { + s.contents.script = false; + } +} ); + +// Install script dataType +jQuery.ajaxSetup( { + accepts: { + script: "text/javascript, application/javascript, " + + "application/ecmascript, application/x-ecmascript" + }, + contents: { + script: /\b(?:java|ecma)script\b/ + }, + converters: { + "text script": function( text ) { + jQuery.globalEval( text ); + return text; + } + } +} ); + +// Handle cache's special case and crossDomain +jQuery.ajaxPrefilter( "script", function( s ) { + if ( s.cache === undefined ) { + s.cache = false; + } + if ( s.crossDomain ) { + s.type = "GET"; + } +} ); + +// Bind script tag hack transport +jQuery.ajaxTransport( "script", function( s ) { + + // This transport only deals with cross domain or forced-by-attrs requests + if ( s.crossDomain || s.scriptAttrs ) { + var script, callback; + return { + send: function( _, complete ) { + script = jQuery( " +{% endmacro %} \ No newline at end of file diff --git a/_preview/4/genindex.html b/_preview/4/genindex.html new file mode 100644 index 0000000..2b1019c --- /dev/null +++ b/_preview/4/genindex.html @@ -0,0 +1,342 @@ + + + + + + + + Index — ESGF Cookbook + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+
+ + + + + +
+
+
+
+ + + + + + +
+ +
+ + + +
+
+ + + + + + + +
+ + +
+ +
+
+
+
+
+ +
+ + +

Index

+ +
+ +
+ + +
+ +
+
+
+
+
+ +
+
+ + + +
+
+ +
+ +
+
+
+
+ NCAR +
+
+ Unidata +
+
+ UAlbany +
+
+
+
+
+ +
+ +
+ +
+
+
+
+

+ © 2023. + + By the ESGF Community. + + Last updated on 7 December 2023. +

+
+
+
+
+ +
+ +
+ +
+
+ + \ No newline at end of file diff --git a/_preview/4/index.html b/_preview/4/index.html new file mode 100644 index 0000000..960bb69 --- /dev/null +++ b/_preview/4/index.html @@ -0,0 +1 @@ + diff --git a/_preview/4/notebooks/complex-search.html b/_preview/4/notebooks/complex-search.html new file mode 100644 index 0000000..d6fe08d --- /dev/null +++ b/_preview/4/notebooks/complex-search.html @@ -0,0 +1,839 @@ + + + + + + + + Complex Searching with intake-esgf — ESGF Cookbook + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+
+ + + + + +
+
+
+
+ + + + +
+ + +
+ + + + + + +
+
+ + + +
+ +
+ + + +
+
+ + + + + + + +
+ +
+ + + + + + + + +
+
+ +
+ + +
+ +
+ On this page +
+ +
+
+
+
+
+ +
+ +

ESGF logo

+
+

Complex Searching with intake-esgf

+
+

Overview

+

In this tutorial we will present an interface under design to facilitate complex searching using intake-esgf. intake-esgf is a small intake and intake-esm inspired package under development in ESGF2. Please note that there is a name collison with an existing package in PyPI and conda. You will need to install the package from source.

+
+
+

Prerequisites

+ + + + + + + + + + + + + + + + + + + + + + + + + +

Concepts

Importance

Notes

Install Package

Necessary

Understanding of NetCDF

Helpful

Familiarity with metadata structure

Familiar with intake-esm

Helpful

Similar interface

Transient climate response

Background

+
    +

  • Time to learn: 30 minutes

    • +
+
+
+

Imports

+
+
+
from intake_esgf import ESGFCatalog
+
+
+
+
+
+
+

Initializing the Catalog

+

As with intake-esm we first instantiate the catalog. However, since we will populate the catalog with search results, the catalog starts empty. Internally, we query different ESGF index nodes for information about what datasets you wish to include in your analysis. As ESGF2 is actively working on an index redesign, our catlogs by default point to a Globus (ElasticSearch) based index at ALCF (Argonne Leadership Computing Facility).

+
+
+
cat = ESGFCatalog()
+print(cat)
+for ind in cat.indices: # Which indices are included?
+    print(ind)
+
+
+
+
+
Perform a search() to populate the catalog.
+GlobusESGFIndex('anl-dev')
+
+
+
+
+

We also provide support for connecting to the ESGF1 Solr-based indices. You may specify a server or list or just include True to choose all the federated index nodes.

+
+
+
cat = ESGFCatalog(esgf1_indices="esgf-node.llnl.gov")  # include LLNL
+cat = ESGFCatalog(esgf1_indices=["esgf-node.ornl.gov", "esgf.ceda.ac.uk"])  # ORNL & CEDA
+cat = ESGFCatalog(esgf1_indices=True)  # all federated indices
+for ind in cat.indices:
+    print(ind)
+
+
+
+
+
GlobusESGFIndex('anl-dev')
+SolrESGFIndex('esgf.ceda.ac.uk')
+SolrESGFIndex('esgf-data.dkrz.de')
+SolrESGFIndex('esgf-node.ipsl.upmc.fr')
+SolrESGFIndex('esg-dn1.nsc.liu.se')
+SolrESGFIndex('esgf-node.llnl.gov')
+SolrESGFIndex('esgf.nci.org.au')
+SolrESGFIndex('esgf-node.ornl.gov')
+
+
+
+
+
+
+

Populate the catalog

+

Many times, an analysis will require several variables across multiple experiments. For example, if one were to compute the transient climate response (TCRE), you would need tempererature (tas) and carbon emissions from land (nbp) and ocean (fgco2) for a 1% CO2 increase experiment (1pctCO2) as well as the control experiment (piControl). If TCRE is not in your particular science, that is ok for this notebook. It is a motivating example and the specifics are less important than the search concepts. First, we perform a search in a familiar syntax.

+
+
+
cat.search(
+    experiment_id=["piControl", "1pctCO2"],
+    variable_id=["tas", "fgco2", "nbp"],
+    table_id=["Amon", "Omon", "Lmon"],
+)
+print(cat)
+
+
+
+
+
   Searching indices: 100%|███████████████████████████████|8/8 [    1.85s/index]
+
+
+
Summary information for 399 results:
+mip_era                                                     [CMIP6]
+activity_id                                                  [CMIP]
+institution_id    [MOHC, MRI, MPI-M, NCAR, NOAA-GFDL, NCC, NIMS-...
+source_id         [UKESM1-0-LL, MRI-ESM2-0, MPI-ESM1-2-LR, CESM2...
+experiment_id                                  [piControl, 1pctCO2]
+member_id         [r1i1p1f2, r1i2p1f1, r1i1p1f1, r2i1p1f1, r3i1p...
+table_id                                         [Lmon, Omon, Amon]
+variable_id                                       [nbp, fgco2, tas]
+grid_label                                            [gn, gr1, gr]
+dtype: object
+
+
+
+
+

Internally, this launches simultaneous searches that are combined locally to provide a global view of what datasets are available. While the Solr indices themselves can be searched in distributed fashion, they will not report if an index has failed to return a response. As index nodes go down from time to time, this can leave you with a false impression that you have found all the datasets of interest. By managing the searches locally, intake-esgf can report back to you that an index has failed and that your results may be incomplete.

+

If you would like details about what intake-esgf is doing, look in the local cache directory (${HOME}/.esgf/) for a esgf.log file. This is a full history of everything that intake-esgf has searched, downloaded, or accessed. You can also look at just this session by calling session_log(). In this case you will see how long each index took to return a response and if any failed

+
+
+
print(cat.session_log())
+
+
+
+
+
2023-12-06 15:51:39 search begin experiment_id=['piControl', '1pctCO2'], variable_id=['tas', 'fgco2', 'nbp'], table_id=['Amon', 'Omon', 'Lmon']
+2023-12-06 15:51:40 └─GlobusESGFIndex('anl-dev') results=329 response_time=1.33 total_time=1.34
+2023-12-06 15:51:41 └─SolrESGFIndex('esgf-node.ipsl.upmc.fr') response_time=1.39 total_time=1.86
+2023-12-06 15:51:41 └─SolrESGFIndex('esg-dn1.nsc.liu.se') response_time=1.68 total_time=2.28
+2023-12-06 15:51:44 └─SolrESGFIndex('esgf.ceda.ac.uk') response_time=1.30 total_time=5.06
+2023-12-06 15:51:45 └─SolrESGFIndex('esgf.nci.org.au') response_time=3.42 total_time=6.59
+2023-12-06 15:51:46 └─SolrESGFIndex('esgf-node.ornl.gov') response_time=0.78 total_time=6.76
+2023-12-06 15:51:46 └─SolrESGFIndex('esgf-data.dkrz.de') response_time=1.89 total_time=7.29
+2023-12-06 15:51:54 └─SolrESGFIndex('esgf-node.llnl.gov') response_time=1.83 total_time=14.77
+2023-12-06 15:51:54 search end total_time=15.26
+
+
+
+
+

At this stage of the search you have a catalog full of possibly relevant datasets for your analysis, stored in a pandas dataframe. You are free to view and manipulate this dataframe to help hone these results down. It is available to you as the df member of the ESGFCatalog. You should be careful to only remove rows as internally we could use any column in the downloading of the data. Also note that we have removed the user-facing notion of where the data is hosted. The id column of this dataframe is a list of full dataset_ids which includes the location information. At the point when you are ready to download data, we will choose locations automatically that are fastest for you.

+
+
+
cat.df
+
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
mip_eraactivity_idinstitution_idsource_idexperiment_idmember_idtable_idvariable_idgrid_labelversionid
0CMIP6CMIPMOHCUKESM1-0-LLpiControlr1i1p1f2Lmonnbpgnv20200828[CMIP6.CMIP.MOHC.UKESM1-0-LL.piControl.r1i1p1f...
1CMIP6CMIPMRIMRI-ESM2-01pctCO2r1i2p1f1Omonfgco2gnv20210311[CMIP6.CMIP.MRI.MRI-ESM2-0.1pctCO2.r1i2p1f1.Om...
2CMIP6CMIPMPI-MMPI-ESM1-2-LRpiControlr1i1p1f1Omonfgco2gnv20190710[CMIP6.CMIP.MPI-M.MPI-ESM1-2-LR.piControl.r1i1...
3CMIP6CMIPNCARCESM2-FV2piControlr1i1p1f1Amontasgnv20191120[CMIP6.CMIP.NCAR.CESM2-FV2.piControl.r1i1p1f1....
4CMIP6CMIPNOAA-GFDLGFDL-CM41pctCO2r1i1p1f1Amontasgr1v20180701[CMIP6.CMIP.NOAA-GFDL.GFDL-CM4.1pctCO2.r1i1p1f...
....................................
1304CMIP6CMIPNASA-GISSGISS-E2-1-G1pctCO2r102i1p1f1Lmonnbpgnv20190815[CMIP6.CMIP.NASA-GISS.GISS-E2-1-G.1pctCO2.r102...
1309CMIP6CMIPMRIMRI-ESM2-01pctCO2r1i2p1f1Amontasgnv20191205[CMIP6.CMIP.MRI.MRI-ESM2-0.1pctCO2.r1i2p1f1.Am...
2048CMIP6CMIPMIROCMIROC-ES2HpiControlr1i1p4f2Omonfgco2gr1v20230904[CMIP6.CMIP.MIROC.MIROC-ES2H.piControl.r1i1p4f...
2050CMIP6CMIPE3SM-ProjectE3SM-2-0-NARRM1pctCO2r1i1p1f1Amontasgrv20230427[CMIP6.CMIP.E3SM-Project.E3SM-2-0-NARRM.1pctCO...
2051CMIP6CMIPE3SM-ProjectE3SM-2-0-NARRMpiControlr1i1p1f1Amontasgrv20230505[CMIP6.CMIP.E3SM-Project.E3SM-2-0-NARRM.piCont...
+

399 rows × 11 columns

+
+
+
+
+

Model Groups

+

However, intake-esgf also provides you with some tools to help locate relevant data for your analysis. When conducting these kinds of analyses, we are seeking for unique combinations of a source_id, member_id, and grid_label that have all the variables that we need. We call these model groups. In an ESGF search, it is common to find a model that has, for example, a tas for r1i1p1f1 but not a fgco2. Sorting this out is time consuming and labor intensive. So first, we provide you a function to print out all model groups with the following function.

+
+
+
cat.model_groups().to_frame()
+
+
+
+
+

The function model_groups() returns a pandas Series (converted to a dataframe here for printing) with all unique combinations of (source_id,member_id,grid_label) along with the dataset count for each. This helps illustrate why it can be so difficult to locate all the data relevant to a given analysis. At the time of this writing, there are 148 model groups but relatively few of them with all 6 (2 experiments and 3 variables) datasets that we need. Furthermore, you cannot rely on a model group using r1i1p1f1 for its primary result. The results above show that UKESM does not even use f1 at all, further complicating the process of finding results.

+

In addition to this notion of model groups, intake-esgf provides you a method remove_incomplete() for determing which model groups you wish to keep in the current search. Internally, we will group the search results dataframe by model groups and apply a function of your design to the grouped portion of the dataframe. For example, for the current work, I could just check that there are 6 datasets in the sub-dataframe.

+
+
+
def shall_i_keep_it(sub_df):
+    if len(sub_df) == 6:
+        return True
+    return False
+
+
+cat.remove_incomplete(shall_i_keep_it)
+cat.model_groups().to_frame()
+
+
+
+
+

You could write a much more complex check–it depends on what is relevant to your analysis. The effect is that the list of possible models with consistent results is now much more manageable. This method has the added benefit of forcing the user to be concrete about which models were included in an analysis.

+
+
+

Removing Additional Variants

+

It may also be that you wish to only include a single member_id in your analysis. The above search shows we have a few models with multiple variants that have all 6 required datasets. To be fair to those that only have 1, you may wish to only keep the smallest variant. We also provide this function as part of the ESGFCatalog object.

+
+
+
cat.remove_ensembles()
+cat.model_groups().to_frame()
+
+
+
+
+
+
+

Summary

+

At this point, you would be ready to use to_dataset_dict() to download and load all datasets into a dictionary for analysis. The point of this notebook however is to expose the search capabilities. It is our goal to make annoying and time-consuming tasks easier by providing you smart interfaces for common operations. Let us know what else is painful for you in locating relevant data for your science.

+
+
+ + + + +
+ +
+
+
+
+
+ +
+
+ + + +
+
+ +
+ +
+
+
+
+ NCAR +
+
+ Unidata +
+
+ UAlbany +
+
+
+
+
+ +
+ +
+ +
+
+
+
+

+ © 2023. + + By the ESGF Community. + + Last updated on 7 December 2023. +

+
+
+
+
+ +
+ +
+ +
+
+ + \ No newline at end of file diff --git a/_preview/4/notebooks/enso-globus.html b/_preview/4/notebooks/enso-globus.html new file mode 100644 index 0000000..1535421 --- /dev/null +++ b/_preview/4/notebooks/enso-globus.html @@ -0,0 +1,1856 @@ + + + + + + + + ENSO Calculations using Globus Compute — ESGF Cookbook + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+
+ + + + + +
+
+
+
+ + + + +
+ + +
+ + + + + + +
+
+ + + +
+ +
+ + + +
+
+ + + + + + + +
+ +
+ + + + + + + + +
+
+ +
+ + +
+ +
+ On this page +
+ +
+
+
+
+
+ +
+ +

Globus logo +ESGF logo

+
+

ENSO Calculations using Globus Compute

+
+

Overview

+

In this workflow, we combine topics covered in previous Pythia Foundations and CMIP6 Cookbook content to compute the Niño 3.4 Index to multiple datasets, with the primary computations occuring on a remote machine. As a refresher of what the ENSO 3.4 index is, please see the following text, which is also included in the ENSO Xarray content in the Pythia Foundations content.

+
+

Niño 3.4 (5N-5S, 170W-120W): The Niño 3.4 anomalies may be thought of as representing the average equatorial SSTs across the Pacific from about the dateline to the South American coast. The Niño 3.4 index typically uses a 5-month running mean, and El Niño or La Niña events are defined when the Niño 3.4 SSTs exceed +/- 0.4C for a period of six months or more.

+
+
+

Niño X Index computation: a) Compute area averaged total SST from Niño X region; b) Compute monthly climatology (e.g., 1950-1979) for area averaged total SST from Niño X region, and subtract climatology from area averaged total SST time series to obtain anomalies; c) Smooth the anomalies with a 5-month running mean; d) Normalize the smoothed values by its standard deviation over the climatological period.

+
+

+

The previous cookbook, we ran this in a single notebook locally. In this example, we aim to execute the workflow on a remote machine, with only the visualizion of the dataset occuring locally.

+

The overall goal of this tutorial is to introduce the idea of functions as a service with Globus, and how this can be used to calculate ENSO indices.

+
+
+

Prerequisites

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

Concepts

Importance

Notes

Intro to Xarray

Necessary

hvPlot Basics

Necessary

Interactive Visualization with hvPlot

Understanding of NetCDF

Helpful

Familiarity with metadata structure

Calculating ENSO with Xarray

Neccessary

Understanding of Masking and Xarray Functions

Dask

Helpful

+
    +

  • Time to learn: 30 minutes

    • +
+
+
+

Imports

+
+
+
import hvplot.xarray
+import holoviews as hv
+import numpy as np
+import hvplot.xarray
+import matplotlib.pyplot as plt
+import cartopy.crs as ccrs
+from intake_esgf import ESGFCatalog
+import xarray as xr
+import cf_xarray
+import warnings
+import os
+from globus_compute_sdk import Executor, Client
+warnings.filterwarnings("ignore")
+
+hv.extension("bokeh")
+
+
+
+
+
+
+ + + + + + + + + +
+
+
+
+
+

Accessing our Data and Computing the ENSO 3.4 Index

+

As mentioned in the introduction, we are utilizing functions from the previous ENSO notebooks. In order to run these with Globus Compute, we need to comply with the following requirements

+
    +

  • All libraries/packages used in the function need to be installed on the globus compute endpoint

    • +

  • All functions/libraries/packages need to be imported and defined within the function to execute

    • +

  • The output from the function needs to serializable (ex. xarray.Dataset, numpy.array)

    • +
+

Using these constraints, we setup the following function, with the key parameter being which modeling center (model) to compare. Two examples here include The National Center for Atmospheric Research (NCAR) and the Model for Interdisciplinary Research on Climate (MIROC).

+
+
+
def run_plot_enso(model, return_path=False):
+    import numpy as np
+    import matplotlib.pyplot as plt
+    from intake_esgf import ESGFCatalog
+    import xarray as xr
+    import cf_xarray
+    import warnings
+    warnings.filterwarnings("ignore")
+
+    def search_esgf(institution_id, grid='gn'):
+
+        # Search and load the ocean surface temperature (tos)
+        cat = ESGFCatalog()
+        cat.search(
+            activity_id="CMIP",
+            experiment_id="historical",
+            institution_id=institution_id,
+            variable_id=["tos"],
+            member_id='r11i1p1f1',
+            table_id="Omon",
+        )
+        try:
+            tos_ds = cat.to_datatree()[grid].to_dataset()
+        except ValueError:
+            tos_ds = cat.to_dataset_dict()[""]
+
+        # Search and load the ocean grid cell area
+        cat = ESGFCatalog()
+        cat.search(
+            activity_id="CMIP",
+            experiment_id="historical",
+            institution_id=institution_id,
+            variable_id=["areacello"],
+            member_id='r11i1p1f1',
+        )
+        try:
+            area_ds = cat.to_datatree()[grid].to_dataset()
+        except ValueError:
+            area_ds = cat.to_dataset_dict()[""]
+        return xr.merge([tos_ds, area_ds])
+
+    def calculate_enso(ds):
+
+        # Subset the El Nino 3.4 index region
+        dso = ds.where(
+        (ds.cf["latitude"] < 5) & (ds.cf["latitude"] > -5) & (ds.cf["longitude"] > 190) & (ds.cf["longitude"] < 240), drop=True
+        )
+
+        # Calculate the monthly means
+        gb = dso.tos.groupby('time.month')
+
+        # Subtract the monthly averages, returning the anomalies
+        tos_nino34_anom = gb - gb.mean(dim='time')
+
+        # Determine the non-time dimensions and average using these
+        non_time_dims = set(tos_nino34_anom.dims)
+        non_time_dims.remove(ds.tos.cf["T"].name)
+        weighted_average = tos_nino34_anom.weighted(ds["areacello"]).mean(dim=list(non_time_dims))
+
+        # Calculate the rolling average
+        rolling_average = weighted_average.rolling(time=5, center=True).mean()
+        std_dev = weighted_average.std()
+        return rolling_average / std_dev
+
+    def add_enso_thresholds(da, threshold=0.4):
+
+        # Conver the xr.DataArray into an xr.Dataset
+        ds = da.to_dataset()
+
+        # Cleanup the time and use the thresholds
+        try:
+            ds["time"]= ds.indexes["time"].to_datetimeindex()
+        except:
+            pass
+        ds["tos_gt_04"] = ("time", ds.tos.where(ds.tos >= threshold, threshold).data)
+        ds["tos_lt_04"] = ("time", ds.tos.where(ds.tos <= -threshold, -threshold).data)
+
+        # Add fields for the thresholds
+        ds["el_nino_threshold"] = ("time", np.zeros_like(ds.tos) + threshold)
+        ds["la_nina_threshold"] = ("time", np.zeros_like(ds.tos) - threshold)
+
+        return ds
+    
+    ds = search_esgf("NCAR")
+    enso_index = add_enso_thresholds(calculate_enso(ds).compute())
+    enso_index.attrs = ds.attrs
+    enso_index.attrs["model"] = model
+
+    return enso_index
+
+
+
+
+
+
+

Configure Globus Compute

+

Now that we have our functions, we can move toward using Globus Flows and Globus Compute.

+

Globus Flows is a reliable and secure platform for orchestrating and performing research data management and analysis tasks. A flow is often needed to manage data coming from instruments, e.g., image files can be moved from local storage attached to a microscope to a high-performance storage system where they may be accessed by all members of the research project.

+

More examples of creating and running flows can be found on our demo instance.

+
+

Setup a Globus Compute Endpoint

+

Globus Compute (GC) is a service that allows python functions to be sent to remote points, executed, with the output from that function returned to the user. While there are a collection of endpoints already installed, we highlight in this section the steps required to configure for yourself. This idea is also known as “serverless” computing, where users do not need to think about the underlying infrastructure executing the code, but rather submit functions to be run and returned.

+

To start a GC endpoint at your system you need to login, configure a conda environment, and pip install globus-compute-endpoint.

+

You can then run:

+

globus-compute-endpoint configure esgf-test

+

globus-compute-endpoint start esgf-test

+

Note that by default your endpoint will execute tasks on the login node (if you are using a High Performance Compute System). Additional configuration is needed for the endpoint to provision compute nodes. For example, here is the documentation on configuring globus compute endpoints on the Argonne Leadership Computing Facility’s Polaris system

+
    +

  • https://globus-compute.readthedocs.io/en/latest/endpoints.html#polaris-alcf

    • +
+
+
+
endpoint_id = "b3d1d669-d49b-412e-af81-95f3368e525c"
+
+
+
+
+
+
+

Setup an Executor to Run our Functions

+

Once we have our compute endpoint ID, we need to pass this to our executor, which will be used to pass our functions from our local machine to the machine we would like to compute on.

+
+
+
gce = Executor(endpoint_id=endpoint_id)
+gce
+
+
+
+
+
Executor<ep_id:b3d1d669-d49b-412e-af81-95f3368e525c; tg_id:None; bs:128>
+
+
+
+
+
+
+

Test our Functions

+

Now that we have our functions prepared, and an executor to run on, we can test them out using our endpoint!

+

We pass in our function name, and the additional arguments for our functions. For example, let’s look at comparing at the NCAR and MIROC modeling center’s CMIP6 simulations.

+
+
+
ncar_task = gce.submit(run_plot_enso, model='NCAR')
+miroc_task = gce.submit(run_plot_enso, model='MIROC')
+
+
+
+
+

The results are started as python objects, with the resultant datasets available using .result()

+
+
+
ncar_ds = ncar_task.result()
+miroc_ds = miroc_task.result()
+
+ncar_ds
+
+
+
+
+
+ + + + + + + + + + + + + + +
<xarray.Dataset>
+Dimensions:            (time: 1980)
+Coordinates:
+  * time               (time) datetime64[ns] 1850-01-15T13:00:00.000008 ... 2...
+    month              (time) int64 1 2 3 4 5 6 7 8 9 ... 4 5 6 7 8 9 10 11 12
+Data variables:
+    tos                (time) float32 nan nan 0.06341 ... 0.7921 nan nan
+    tos_gt_04          (time) float32 0.4 0.4 0.4 0.4 ... 0.6829 0.7921 0.4 0.4
+    tos_lt_04          (time) float32 -0.4 -0.4 -0.4 -0.4 ... -0.4 -0.4 -0.4
+    el_nino_threshold  (time) float32 0.4 0.4 0.4 0.4 0.4 ... 0.4 0.4 0.4 0.4
+    la_nina_threshold  (time) float32 -0.4 -0.4 -0.4 -0.4 ... -0.4 -0.4 -0.4
+Attributes: (12/46)
+    Conventions:            CF-1.7 CMIP-6.2
+    activity_id:            CMIP
+    branch_method:          standard
+    branch_time_in_child:   674885.0
+    branch_time_in_parent:  219000.0
+    case_id:                972
+    ...                     ...
+    table_id:               Omon
+    tracking_id:            hdl:21.14100/b0ffb89d-095d-4533-a159-a2e1241ff138
+    variable_id:            tos
+    variant_info:           CMIP6 20th century experiments (1850-2014) with C...
+    variant_label:          r11i1p1f1
+    model:                  NCAR
+
+
+
+

Plot our Data

+

Now that we have pre-computed datasets, the last step is to visualize the output. In the other example, we stepped through how to utilize the .hvplot tool to create interactive displays of ENSO values. We will utilize that functionality here, wrapping into a function.

+
+
+
def plot_enso(ds):
+    el_nino = ds.hvplot.area(x="time", y2='tos_gt_04', y='el_nino_threshold', color='red', hover=False)
+    el_nino_label = hv.Text(ds.isel(time=40).time.values, 2, 'El Niño').opts(text_color='red',)
+
+    # Create the La Niña area graphs
+    la_nina = ds.hvplot.area(x="time", y2='tos_lt_04', y='la_nina_threshold', color='blue', hover=False)
+    la_nina_label = hv.Text(ds.isel(time=-40).time.values, -2, 'La Niña').opts(text_color='blue')
+
+    # Plot a timeseries of the ENSO 3.4 index
+    enso = ds.tos.hvplot(x='time', line_width=0.5, color='k', xlabel='Year', ylabel='ENSO 3.4 Index')
+
+    # Combine all the plots into a single plot
+    return (el_nino_label * la_nina_label * el_nino * la_nina * enso).opts(title=f'{ds.attrs["model"]} {ds.attrs["source_id"]} \n Ensemble Member: {ds.attrs["variant_label"]}')
+
+
+
+
+

Once we have the function, we apply to our two datasets and combine into a single column.

+
+
+
(plot_enso(ncar_ds) + plot_enso(miroc_ds)).cols(1)
+
+
+
+
+
+
+
+
+
+
+
+
+

Summary

+

In this notebook, we applied the ENSO 3.4 index calculations to CMIP6 datasets remotely using Globus Compute and created interactive plots comparing where we see El Niño and La Niña.

+
+

What’s next?

+

We will see some more advanced examples of using the CMIP6 and other data access methods as well as computations.

+
+
+
+

Resources and references

+ +
+
+ + + + +
+ +
+ + +
+

previous

+

How to Cite This Cookbook

+
+ +
+
+
+
+ +
+
+ + + +
+
+ +
+ +
+
+
+
+ NCAR +
+
+ Unidata +
+
+ UAlbany +
+
+
+
+
+ +
+ +
+ +
+
+
+
+

+ © 2023. + + By the ESGF Community. + + Last updated on 7 December 2023. +

+
+
+
+
+ +
+ +
+ +
+
+ + \ No newline at end of file diff --git a/_preview/4/notebooks/how-to-cite.html b/_preview/4/notebooks/how-to-cite.html new file mode 100644 index 0000000..d9fae75 --- /dev/null +++ b/_preview/4/notebooks/how-to-cite.html @@ -0,0 +1,396 @@ + + + + + + + + How to Cite This Cookbook — ESGF Cookbook + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+
+ + + + + +
+
+
+
+ + + + +
+ + +
+ + + + + + +
+
+ + + +
+ +
+ + + +
+
+ + + + + + + +
+ + +
+ +
+
+
+
+
+ +
+ +
+

How to Cite This Cookbook

+

The material in this Project Pythia Cookbook is licensed for free and open consumption and reuse. All code is served under Apache 2.0, while all non-code content is licensed under Creative Commons BY 4.0 (CC BY 4.0). Effectively, this means you are free to share and adapt this material so long as you give appropriate credit to the Cookbook authors and the Project Pythia community.

+

The source code for the book is released on GitHub and archived on Zenodo. This DOI will always resolve to the latest release of the book source:

+

DOI

+
+ + + + +
+ +
+ + +
+

previous

+

ESGF Cookbook

+
+ + +
+

next

+

ENSO Calculations using Globus Compute

+
+ + +
+
+
+
+ +
+
+ + + +
+
+ +
+ +
+
+
+
+ NCAR +
+
+ Unidata +
+
+ UAlbany +
+
+
+
+
+ +
+ +
+ +
+
+
+
+

+ © 2023. + + By the ESGF Community. + + Last updated on 7 December 2023. +

+
+
+
+
+ +
+ +
+ +
+
+ + \ No newline at end of file diff --git a/_preview/4/notebooks/notebook-template.html b/_preview/4/notebooks/notebook-template.html new file mode 100644 index 0000000..ec8701b --- /dev/null +++ b/_preview/4/notebooks/notebook-template.html @@ -0,0 +1,661 @@ + + + + + + + + Project Pythia Notebook Template — ESGF Cookbook + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+
+ + + + + +
+
+
+
+ + + + +
+ + +
+ + + + + + +
+
+ + + +
+ +
+ + + +
+
+ + + + + + + +
+ +
+ + + + + + + + +
+
+ +
+ + +
+ +
+ On this page +
+ +
+
+
+
+
+ +
+ +

Let’s start here! If you can directly link to an image relevant to your notebook, such as canonical logos, do so here at the top of your notebook. You can do this with Markdown syntax,

+
+

![<image title>](http://link.com/to/image.png "image alt text")

+
+

or edit this cell to see raw HTML img demonstration. This is preferred if you need to shrink your embedded image. Either way be sure to include alt text for any embedded images to make your content more accessible.

+

Project Pythia Logo

+
+

Project Pythia Notebook Template

+

Next, title your notebook appropriately with a top-level Markdown header, #. Do not use this level header anywhere else in the notebook. Our book build process will use this title in the navbar, table of contents, etc. Keep it short, keep it descriptive. Follow this with a --- cell to visually distinguish the transition to the prerequisites section.

+
+
+

Overview

+

If you have an introductory paragraph, lead with it here! Keep it short and tied to your material, then be sure to continue into the required list of topics below,

+
    +

  1. This is a numbered list of the specific topics

    2. +

  2. These should map approximately to your main sections of content

    3. +

  3. Or each second-level, ##, header in your notebook

    4. +

  4. Keep the size and scope of your notebook in check

    5. +

  5. And be sure to let the reader know up front the important concepts they’ll be leaving with

    6. +
+
+
+

Prerequisites

+

This section was inspired by this template of the wonderful The Turing Way Jupyter Book.

+

Following your overview, tell your reader what concepts, packages, or other background information they’ll need before learning your material. Tie this explicitly with links to other pages here in Foundations or to relevant external resources. Remove this body text, then populate the Markdown table, denoted in this cell with | vertical brackets, below, and fill out the information following. In this table, lay out prerequisite concepts by explicitly linking to other Foundations material or external resources, or describe generally helpful concepts.

+

Label the importance of each concept explicitly as helpful/necessary.

+ + + + + + + + + + + + + + + + + + + + + +

Concepts

Importance

Notes

Intro to Cartopy

Necessary

Understanding of NetCDF

Helpful

Familiarity with metadata structure

Project management

Helpful

+
    +

  • Time to learn: estimate in minutes. For a rough idea, use 5 mins per subsection, 10 if longer; add these up for a total. Safer to round up and overestimate.

    • +

  • System requirements:

    +
      +

    • Populate with any system, version, or non-Python software requirements if necessary

      • +

    • Otherwise use the concepts table above and the Imports section below to describe required packages as necessary

      • +

    • If no extra requirements, remove the System requirements point altogether

      • +
    +
    • +
+
+
+
+

Imports

+

Begin your body of content with another --- divider before continuing into this section, then remove this body text and populate the following code cell with all necessary Python imports up-front:

+
+
+
import sys
+
+
+
+
+
+
+

Your first content section

+

This is where you begin your first section of material, loosely tied to your objectives stated up front. Tie together your notebook as a narrative, with interspersed Markdown text, images, and more as necessary,

+
+
+
# as well as any and all of your code cells
+print("Hello world!")
+
+
+
+
+
+

A content subsection

+

Divide and conquer your objectives with Markdown subsections, which will populate the helpful navbar in Jupyter Lab and here on the Jupyter Book!

+
+
+
# some subsection code
+new = "helpful information"
+
+
+
+
+
+
+

Another content subsection

+

Keep up the good work! A note, try to avoid using code comments as narrative, and instead let them only exist as brief clarifications where necessary.

+
+
+
+

Your second content section

+

Here we can move on to our second objective, and we can demonstrate

+
+

Subsection to the second section

+
+

a quick demonstration

+
+
of further and further
+
+
header levels
+

as well \(m = a * t / h\) text! Similarly, you have access to other \(\LaTeX\) equation functionality via MathJax (demo below from link),

+
+()\[\begin{align} +\dot{x} & = \sigma(y-x) \\ +\dot{y} & = \rho x - y - xz \\ +\dot{z} & = -\beta z + xy +\end{align}\]
+

Check out any number of helpful Markdown resources for further customizing your notebooks and the Jupyter docs for Jupyter-specific formatting information. Don’t hesitate to ask questions if you have problems getting it to look just right.

+
+
+
+
+
+
+

Last Section

+

If you’re comfortable, and as we briefly used for our embedded logo up top, you can embed raw html into Jupyter Markdown cells (edit to see):

+
+

Info

+

Your relevant information here!

+
+

Feel free to copy this around and edit or play around with yourself. Some other admonitions you can put in:

+
+

Success

+

We got this done after all!

+
+
+

Warning

+

Be careful!

+
+
+

Danger

+

Scary stuff be here.

+
+

We also suggest checking out Jupyter Book’s brief demonstration on adding cell tags to your cells in Jupyter Notebook, Lab, or manually. Using these cell tags can allow you to customize how your code content is displayed and even demonstrate errors without altogether crashing our loyal army of machines!

+
+
+
+

Summary

+

Add one final --- marking the end of your body of content, and then conclude with a brief single paragraph summarizing at a high level the key pieces that were learned and how they tied to your objectives. Look to reiterate what the most important takeaways were.

+
+

What’s next?

+

Let Jupyter book tie this to the next (sequential) piece of content that people could move on to down below and in the sidebar. However, if this page uniquely enables your reader to tackle other nonsequential concepts throughout this book, or even external content, link to it here!

+
+
+
+

Resources and references

+

Finally, be rigorous in your citations and references as necessary. Give credit where credit is due. Also, feel free to link to relevant external material, further reading, documentation, etc. Then you’re done! Give yourself a quick review, a high five, and send us a pull request. A few final notes:

+
    +

  • Kernel > Restart Kernel and Run All Cells... to confirm that your notebook will cleanly run from start to finish

    • +

  • Kernel > Restart Kernel and Clear All Outputs... before committing your notebook, our machines will do the heavy lifting

    • +

  • Take credit! Provide author contact information if you’d like; if so, consider adding information here at the bottom of your notebook

    • +

  • Give credit! Attribute appropriate authorship for referenced code, information, images, etc.

    • +

  • Only include what you’re legally allowed: no copyright infringement or plagiarism

    • +
+

Thank you for your contribution!

+
+
+ + + + +
+ +
+
+
+
+
+ +
+
+ + + +
+
+ +
+ +
+
+
+
+ NCAR +
+
+ Unidata +
+
+ UAlbany +
+
+
+
+
+ +
+ +
+ +
+
+
+
+

+ © 2023. + + By the ESGF Community. + + Last updated on 7 December 2023. +

+
+
+
+
+ +
+ +
+ +
+
+ + \ No newline at end of file diff --git a/_preview/4/objects.inv b/_preview/4/objects.inv new file mode 100644 index 0000000000000000000000000000000000000000..160d3a729a99ccfeed8ab2d93f8217287a8a72c0 GIT binary patch literal 379 zcmV->0fhb|AX9K?X>NERX>N99Zgg*Qc_4OWa&u{KZXhxWBOp+6Z)#;@bUGkVd30!R zZVDqHR%LQ?X>V>iAPOTORA^-&a%F8{X>Md?av*PJAarPHb0B7EY-J#6b0A}HZE$jB zb8}^6Aa!$TZf78RY-wUH3V7OukwI>QFc3xeoMJBER^4`2QJQv<6op*Cm??H*JW)J| zpFs&$71Ep*+`v(7T + + + + + + Search — ESGF Cookbook + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+
+ + + + + +
+
+
+
+ + + + + + +
+ +
+ + + +
+
+ + + + + + + +
+ + +
+ +
+
+
+
+
+ +
+ +

Search

+ + + + +

+ Searching for multiple words only shows matches that contain + all words. +

+ + +
+ + + +
+ + + +
+ +
+ + +
+ +
+
+
+
+
+ +
+
+ + + +
+
+ +
+ +
+
+
+
+ NCAR +
+
+ Unidata +
+
+ UAlbany +
+
+
+
+
+ +
+ +
+ +
+
+
+
+

+ © 2023. + + By the ESGF Community. + + Last updated on 7 December 2023. +

+
+
+
+
+ +
+ +
+ +
+
+ + \ No newline at end of file diff --git a/_preview/4/searchindex.js b/_preview/4/searchindex.js new file mode 100644 index 0000000..967e334 --- /dev/null +++ b/_preview/4/searchindex.js @@ -0,0 +1 @@ +Search.setIndex({docnames:["README","notebooks/complex-search","notebooks/enso-globus","notebooks/how-to-cite","notebooks/notebook-template"],envversion:{"sphinx.domains.c":2,"sphinx.domains.changeset":1,"sphinx.domains.citation":1,"sphinx.domains.cpp":5,"sphinx.domains.index":1,"sphinx.domains.javascript":2,"sphinx.domains.math":2,"sphinx.domains.python":3,"sphinx.domains.rst":2,"sphinx.domains.std":2,"sphinx.ext.intersphinx":1,sphinx:56},filenames:["README.md","notebooks/complex-search.ipynb","notebooks/enso-globus.ipynb","notebooks/how-to-cite.md","notebooks/notebook-template.ipynb"],objects:{},objnames:{},objtypes:{},terms:{"0":[1,2,3],"00":2,"000000000":2,"000008":2,"000008000":2,"0001":2,"00parent_variant_label":2,"01":2,"011contact":2,"02":2,"02t03":2,"03":2,"04":2,"05":2,"06":[1,2],"06341":2,"06341499":2,"07":2,"08":2,"09":2,"095d":2,"09zdata_specs_vers":2,"0branch_time_in_par":2,"0case_id":2,"0m":1,"1":[1,2],"10":[2,4],"100":[1,2],"11":[1,2],"11realm":2,"12":[1,2],"120w":2,"128":2,"12arrai":2,"13":2,"1304":1,"1309":1,"14":[1,2],"14100":2,"148":1,"14t00":2,"15":[1,2],"15t00":2,"15t12":2,"15t13":2,"170w":2,"1850":2,"190":2,"192":2,"1950":2,"1979":2,"1980":2,"1980coordin":2,"1frequenc":2,"1institut":2,"1pctco":1,"1pctco2":1,"1product":2,"2":[1,2,3],"2014":2,"2017":2,"2019":2,"2048":1,"2050":1,"2051":1,"20m2023":1,"20th":2,"21":2,"219000":2,"240":2,"25":2,"26":1,"28":1,"288":2,"29":[1,2],"29experi":2,"2activity_id":2,"3":1,"30":[1,2],"32":2,"320x384":2,"329":1,"32msearch":1,"33":1,"34":1,"36":1,"384x320":2,"39":1,"399":1,"4":[1,3],"40":[1,2],"41":1,"412e":2,"42":1,"44":1,"45":1,"4533":2,"46":[1,2],"4arrai":2,"4c":2,"5":[1,2,4],"5065":2,"51":1,"54":1,"59":1,"5n":2,"5s":2,"6":[1,2],"60":2,"674885":2,"68":1,"6829":2,"7":[1,2],"76":1,"77":1,"78":1,"79205155":2,"7921":2,"8":[1,2],"80305":2,"83":1,"85":1,"86":1,"89":1,"9":2,"95f3368e525c":2,"972":2,"972cesm_casenam":2,"9x1":2,"case":1,"default":[1,2],"do":[1,2,4],"final":4,"function":[1,4],"import":0,"long":[1,3],"new":4,"ni\u00f1a":2,"ni\u00f1o":2,"return":[1,2],"short":4,"transient":1,"true":[1,2],"try":[2,4],"while":[1,2,3],A:2,And:4,As:[1,2],At:1,BY:3,Be:4,By:1,For:[1,2,4],If:[0,1,4],In:[1,2,4],It:1,Or:4,The:[0,1,2,3,4],Then:[0,4],These:4,To:[1,2],a159:2,a2e1241ff138:2,a2e1241ff138variable_id:2,abl:0,about:[1,2],abov:[1,4],ac:1,access:[1,4],acknowledg:[0,2],across:[1,2],activ:[0,1],activity_id:[1,2],ad:[1,4],adapt:3,add:[0,2,4],add_enso_threshold:2,addit:2,admonit:4,advanc:2,aerosol:2,af81:2,after:[0,4],aim:2,alcf:[1,2],align:4,all:[0,1,2,3,4],allow:[2,4],along:1,alreadi:2,also:[1,2,4],alt:4,altogeth:4,alwai:3,am:1,american:2,amon:1,an:[1,4],analys:1,analysi:[1,2],ani:[1,2,4],anl:1,annoi:1,anomali:2,anywher:4,aogcm:2,apach:3,appli:[1,2],appropri:[3,4],approxim:4,ar:[0,1,2,3],archiv:3,area:2,area_d:2,areacello:2,areacelloforcing_index:2,argonn:[1,2],argument:2,aris:2,armi:4,around:4,arrai:2,ask:4,atmoschem:2,atmospher:2,attach:2,attr:2,attribut:[2,4],au:1,author:[3,4],authorship:4,automat:1,avail:[1,2],averag:2,avoid:4,b0ffb89d:2,b3d1d669:2,b:2,back:1,background:[1,4],base:1,basic:2,befor:[2,4],begin:[1,4],being:2,below:[0,4],benefit:1,beta:4,bgcsub_experi:2,bhist:2,biogeochemistri:2,blue:2,bodi:4,bokeh:2,book:[0,3,4],bottom:4,boulder:2,bracket:4,branch:2,branch_method:2,branch_time_in_child:2,branch_time_in_par:2,brief:4,briefli:4,broken:0,bs:2,build:4,c:2,cach:1,calculate_enso:2,call:1,cam6:2,can:[0,1,2,4],cannot:1,canon:4,capabl:1,carbon:1,care:[1,4],cartopi:[2,4],case_id:2,cat:[1,2],catlog:1,cc:3,ccr:2,cd:0,ceda:1,cell:[0,2,4],center:2,centuri:2,cesm2:[1,2],cesm2parent_time_unit:2,cesm2source_typ:2,cesm_cmip6:2,cf:2,cf_xarrai:2,chang:[0,2],chapter:0,check:[1,4],chef:0,choos:1,cice5:2,cism2:2,citat:[2,4],clarif:4,cleanli:4,cleanup:2,clear:4,click:0,client:2,climat:[1,2],climatolog:2,clm5:2,clone:0,cloud:0,cm4:1,cmip6:[1,2],cmip6model_doi_url:2,cmip6parent_source_id:2,cmip:[1,2],cmipbranch_method:2,cmipparent_experiment_id:2,co2:1,co:2,coast:2,code:[0,2,3,4],col:2,collect:2,collison:1,color:2,column:[1,2],com:[0,4],combin:[1,2],come:2,comfort:4,comment:4,commit:4,common:[1,2,3],commun:3,compar:2,complet:0,compli:2,complic:1,compris:0,comput:[0,1],concept:[1,2,4],conclud:4,concret:1,conda:[0,1,2],condit:2,conduct:1,confirm:4,connect:1,conquer:4,consid:4,consist:[1,2],constraint:2,consult:2,consum:1,consumpt:3,contact:4,content:[0,2,3],continu:4,contribut:4,control:[1,2],convent:2,conver:2,convert:1,cookbook:2,coordin:2,copi:4,copyright:4,corner:0,could:[1,4],count:1,coupl:2,cover:[0,2],cr:2,crash:4,creat:[0,2],creativ:[2,3],creativecommon:2,credit:[3,4],current:1,custom:4,d49b:2,d67h1h0vnominal_resolut:2,d:[2,4],da:2,dai:2,dask:2,data:[0,1],dataarrai:2,datafram:1,dataset:[1,2],dataset_id:1,datasetdimens:2,datelin:2,datetime64:2,datetimeindex:2,de:1,def:[1,2],defin:2,demo:[2,4],denot:4,depend:1,describ:[0,4],descript:4,design:1,detail:[0,1],determ:1,determin:2,dev:1,develop:1,deviat:2,df:1,dictionari:1,differ:1,difficult:1,dim:2,dimens:2,directli:4,directori:[0,1],displac:2,displai:[2,4],distinguish:4,distribut:1,divid:4,dkrz:1,dn1:1,doc:[2,4],document:[2,4],doe:1,doi:[2,3],don:4,done:4,dot:4,down:[1,4],download:1,drive:2,drop:2,ds:2,dso:2,dtype:[1,2],due:4,dynam:2,e21:2,e2:1,e3sm:1,e:2,each:[0,1,4],earli:2,easier:1,edit:4,educreation_d:2,effect:[1,3],either:[0,2,4],el:2,el_nino:2,el_nino_label:2,el_nino_threshold:2,elasticsearch:1,els:[1,4],emb:4,embed:4,emiss:1,empti:1,en:2,enabl:[0,4],encourag:2,end:[0,1,2,4],endpoint_id:2,enough:2,ensembl:2,enso_index:2,ensur:2,enter:0,env:0,environ:[0,2],ep_id:2,equat:4,equatori:2,error:4,es2h:1,es:2,esg:1,esgf1:1,esgf1_indic:1,esgf2:1,esgf:2,esgfcatalog:[1,2],esm1:1,esm2:1,esm:1,estim:4,etc:[0,4],even:[0,1,4],event:2,everyth:1,evolv:2,ex:2,exampl:[1,2],exce:2,except:2,exclud:2,execut:[0,2],exist:[1,4],experi:[1,2],experiment_id:[1,2],explicitli:4,expos:1,express:2,extens:2,extent:2,extern:4,extra:4,f09_g17:2,f1:1,f:[0,2],face:1,facil:[1,2],facilit:1,fail:1,fair:1,fals:[1,2],familiar:[1,2,4],fashion:1,fastest:1,feder:1,feel:4,few:[0,1,4],fgco2:1,field:2,figur:0,file:[0,1,2],fill:4,filterwarn:2,find:1,finish:4,finit:2,first:[0,1],fit:2,five:4,float320:2,float32:2,float32nan:2,flow:2,follow:[0,1,2,4],forc:1,format:4,found:[1,2],foundat:[2,4],fr:1,free:[1,3,4],freq:2,from:[0,1,2,4],front:4,full:1,fullest:2,further:[1,2],further_info_url:2,furtherinfo:2,furthermor:1,fv2:1,g:[1,2],gain:0,gb:2,gc:2,gce:2,gener:4,get:[0,4],gfdl:1,giss:1,git:0,github:[0,3],give:[3,4],given:1,global:[1,2],globu:1,globus_compute_sdk:2,globusesgfindex:1,gn:[1,2],gninitialization_index:2,go:1,goal:[1,2],good:4,got:4,gov:[1,2],govern:2,gr1:1,gr:1,graph:2,grid:2,grid_label:[1,2],group:2,groupbi:2,gt:2,gx1v7:2,h:4,ha:1,have:[0,1,2,4],hdl:2,heavi:4,hello:4,help:[1,2,4],here:[0,1,2,4],hesit:4,high:[2,4],highlight:2,histor:2,histori:1,historicalexternal_vari:2,holoview:2,home:1,hone:1,host:1,hover:2,how:[0,1,2,4],howev:[1,4],html:[2,4],http:[0,2,4],hv:2,hvplot:2,i:[0,1],ic:2,icon:0,id:[1,2],idea:[2,4],ignor:2,illustr:1,imag:[2,4],img:4,impli:2,impos:2,impress:1,includ:[0,1,2,4],incomplet:1,increas:1,ind:1,index:1,indic:[1,2],industri:2,inform:[1,2,4],infrastructur:2,infring:4,initialis:2,inspir:[1,4],instal:[1,2],instanc:2,instanti:1,instead:4,institution_id:[1,2],instrument:2,int641:2,int64:2,intak:2,intake_esgf:[1,2],intens:1,interact:[0,2],interdisciplinari:2,interest:[0,1],interfac:1,intern:[1,2],interspers:4,intro:[2,4],introduc:2,introduct:2,introductori:4,io:2,ipsl:1,isel:2,its:[1,2],jupyt:[0,4],jupyterlab:0,just:[1,4],k:2,keep:[1,4],kei:[2,4],kernel:4,kind:1,kmparent_activity_id:2,know:[0,1,4],known:2,la:2,la_nina:2,la_nina_label:2,la_nina_threshold:2,lab:[0,4],label:4,labor:1,laboratori:2,lai:4,land:[1,2],landic:2,last:2,latest:[2,3],latex:4,latitud:2,latxlon:2,launch:[0,1],law:2,lead:4,leadership:[1,2],learn:[1,2,4],least:2,leav:[1,4],legal:4,len:1,length:2,less:1,let:[1,2,4],level:2,liabil:2,librari:2,licens:[2,3],lift:4,like:[1,2,4],limit:2,line_width:2,link:4,list:[1,2,4],liu:1,live:0,ll:[0,1,4],llnl:[1,2],lmon:1,load:[1,2],local:[0,1,2],locat:1,log:1,login:2,logo:4,longer:4,longitud:2,look:[1,2,4],loos:4,loyal:4,lr:1,lt:2,m:[1,2,4],machin:[2,4],mai:[1,2],main:[0,4],make:[1,2,4],mam4:2,manag:[1,2,4],mani:1,manipul:1,manual:4,map:4,marbl:2,mark:4,markdown:4,mask:2,materi:[0,3,4],mathjax:4,matplotlib:2,mb:2,mean:[2,3],member:[1,2],member_id:[1,2],mention:2,merchant:2,merg:2,mesa:2,metadata:[1,2,4],method:[1,2],microscop:2,min:4,minut:[1,2,4],mip_era:[1,2],miroc:[1,2],miroc_d:2,miroc_task:2,model:2,model_group:1,mohc:1,moment:0,monfurther_info_url:2,month:2,monthli:2,more:[0,1,2,4],most:4,motiv:1,mous:0,move:[0,2,4],mpi:1,mri:1,much:1,multipl:[1,2],n:2,name:[1,2],nan:2,nanarrai:2,narr:4,narrm:1,nasa:1,nation:2,nativ:2,navbar:4,navig:0,nbp:1,ncar:[1,2],ncar_d:2,ncar_task:2,ncarlicens:2,ncarxarrai:2,ncc:1,nci:1,neccessari:2,necessari:[1,2,4],need:[0,1,2,4],neglig:2,netcdf:[1,2,4],nim:1,nino:2,noaa:1,node:[1,2],non:[2,3,4],non_time_dim:2,none:2,nonesub_experiment_id:2,nonetable_id:2,nonsequenti:4,normal:2,note:[1,2,4],notebook:[1,2],notion:1,now:[0,1,2],np:2,ns:2,nsc:1,number:4,numpi:2,object:[1,2,4],observ:2,obtain:2,occur:2,ocean:[1,2],oceansourc:2,ocnbgchem:2,often:2,ok:1,om:1,omon:[1,2],omontracking_id:2,onc:[0,2],one:[0,1,2,4],onli:[1,2,4],open:3,oper:1,opt:2,orchestr:2,order:2,org:[1,2],ornl:1,os:2,other:[2,4],otherwis:4,our:[1,4],out:[1,2,4],output:[0,2,4],outputrealization_index:2,over:2,overal:2,overestim:4,pacif:2,packag:[1,2,4],page:4,pain:1,panda:1,paragraph:4,paramet:2,part:1,particular:[1,2],pass:2,past:2,pcmdi:2,peopl:4,per:4,perform:[1,2],period:2,permit:2,perturb:2,picont:1,picontrol:1,picontrolparent_mip_era:2,piec:4,pip:2,plagiar:4,plai:4,platform:2,pleas:[1,2],plot_enso:2,plt:2,png:4,point:[1,2,4],polari:2,pole:2,pop2:2,popul:4,portion:1,possibl:1,pre:2,prefer:4,prepar:2,present:[0,1],press:0,previou:2,primari:[0,1,2],print:[1,4],problem:4,process:[1,4],produc:2,program:0,project:[0,1,2,3],projectpythia:0,proper:2,provid:[1,2,4],provis:2,pull:4,purpos:2,put:4,pypi:1,pyplot:2,pythia:[0,2,3],python:[0,2,4],queri:1,question:4,r102:1,r102i1p1f1:1,r11i1p1f1:2,r11i1p1f1grid:2,r11i1p1f1model:2,r1i1:1,r1i1p1f1:1,r1i1p1f1physics_index:2,r1i1p1f2:1,r1i1p1f:1,r1i1p4f2:1,r1i1p4f:1,r1i2p1f1:1,r2i1p1f1:1,r3i1p:1,radar:0,ran:2,rather:2,raw:4,re:4,reach:0,read:4,reader:4,readi:1,readthedoc:2,recent:2,record:2,red:2,redesign:1,referenc:4,refresh:2,region:2,reiter:4,rel:1,releas:3,relev:[1,4],reli:1,reliabl:2,remot:2,remov:[2,4],remove_ensembl:1,remove_incomplet:1,report:1,repositori:0,repres:2,request:[2,4],requir:[1,2,4],research:2,resolv:3,respons:1,response_tim:1,restart:4,result:[1,2],return_path:2,reus:3,review:4,rho:4,right:[0,4],rigor:4,rocket:0,roll:2,rolling_averag:2,rough:4,round:4,row:1,run:4,run_plot_enso:2,safer:4,same:2,scari:4,scienc:1,scope:4,se:1,sea:2,sea_ic:2,search:2,search_esgf:2,second:0,section:2,secur:2,see:[0,1,2,4],seek:1,select:0,send:4,sent:2,sentenc:0,sequenti:4,seri:[1,2],serializ:2,serv:3,server:1,serverless:2,servic:2,session:1,session_log:1,set:2,sever:1,shall_i_keep_it:1,share:3,sharealik:2,shift:0,ship:0,should:[0,1,2,4],show:1,shrink:4,sidebar:4,sigma:4,similar:1,similarli:4,simplest:0,simpli:0,simul:2,simultan:1,sinc:[1,2],singl:[1,2,4],six:2,size:4,skill:0,small:1,smallest:1,smart:1,smooth:2,so:[1,3,4],softwar:4,solr:1,solresgfindex:1,some:[1,2,4],sort:1,sourc:[1,3],source_id:[1,2],south:2,specif:[1,4],specifi:1,sst:2,stage:1,standard:2,standardbranch_time_in_child:2,start:[0,1,2,4],state:[0,4],std:2,std_dev:2,step:2,storag:2,store:1,strongli:2,structur:[1,2,4],stuff:4,sub:1,sub_df:1,subject:0,submit:2,subset:2,subtract:2,suggest:4,summar:4,suppli:2,support:1,sure:[0,4],surfac:2,sy:4,syntax:[1,4],system:[2,4],t:[2,4],ta:1,tabl:[2,4],table_id:[1,2],tackl:4,tag:4,take:4,takeawai:4,task:[1,2],tcre:1,tell:4,temperatur:2,tempereratur:1,term:2,termsofus:2,text:[2,4],text_color:2,tg_id:2,than:1,thank:4,thei:[1,2,4],them:[0,1,2,4],themselv:1,thi:[1,2,4],think:2,those:1,thought:2,three:2,threshold:2,through:[0,2],throughout:4,ti:4,tie:4,time:[1,2,4],timepandasindexpandasindex:2,timeseri:2,titl:[2,4],to_dataset:2,to_dataset_dict:[1,2],to_datatre:2,to_datetimeindex:2,to_fram:1,togeth:4,took:1,tool:[1,2],top:[0,2,4],topic:[2,4],tos:2,tos_d:2,tos_gt_04:2,tos_lt_04:2,tos_nino34_anom:2,tosvariant_info:2,total:[2,4],total_tim:1,toward:2,tracking_id:2,transit:4,ture:4,tutori:[1,2],two:[0,2],typic:2,ucar:2,uk:1,ukesm1:1,ukesm:1,under:[1,2,3],underli:2,understand:[1,2,4],uniqu:[1,4],until:0,up:[0,4],upmc:1,us:[0,1,4],usainstitution_id:2,user:[1,2],util:2,v20180701:1,v20190710:1,v20190815:1,v20191120:1,v20191205:1,v20200828:1,v20210311:1,v20230427:1,v20230505:1,v20230904:1,valu:2,valueerror:2,variabl:[1,2],variable_id:[1,2],variant_info:2,variant_label:2,version:[1,4],vertic:4,via:[0,2,4],view:[0,1],visual:[2,4],visualizion:2,volum:2,wa:4,wai:[0,4],warn:2,warranti:2,we:[1,2,4],weight:2,weighted_averag:2,well:[1,2,4],were:[1,4],what:[0,1],when:[1,2],where:[1,2,4],which:[0,1,2,4],why:[0,1],wish:1,within:2,without:4,wonder:4,work:[0,1,4],workflow:2,world:4,would:[1,2],wrap:2,write:1,x27:2,x:[2,4],xarrai:2,xlabel:2,xr:2,xy:4,xz:4,y2:2,y:[2,4],year:2,ylabel:2,yml:0,you:[0,1,2,3,4],your:[1,2],yourself:[2,4],z:4,zenodo:3,zeros_lik:2},titles:["ESGF Cookbook","Complex Searching with intake-esgf","ENSO Calculations using Globus Compute","How to Cite This Cookbook","Project Pythia Notebook Template"],titleterms:{"1":0,"2":0,"3":2,"4":2,"function":2,"import":[1,2,4],A:4,access:2,addit:1,an:2,anoth:4,author:0,binder:0,calcul:2,catalog:1,cite:3,complex:1,comput:2,configur:2,content:4,contributor:0,cookbook:[0,3],danger:4,data:2,demonstr:4,e:0,endpoint:2,enso:2,esgf:[0,1],exampl:0,executor:2,first:4,foundat:0,further:4,g:0,globu:2,group:1,header:4,how:3,index:2,info:4,initi:1,intak:1,last:4,level:4,machin:0,model:1,motiv:0,next:[2,4],notebook:[0,4],our:2,overview:[1,2,4],own:0,plot:2,popul:1,prerequisit:[1,2,4],project:4,pythia:4,quick:4,refer:[2,4],remov:1,replac:0,resourc:[2,4],run:[0,2],s:[2,4],search:1,second:4,section:[0,4],setup:2,structur:0,subsect:4,success:4,summari:[1,2,4],templat:4,test:2,thi:[0,3],titl:0,us:2,variant:1,warn:4,what:[2,4],workflow:0,your:[0,4]}}) \ No newline at end of file