-
Notifications
You must be signed in to change notification settings - Fork 0
/
EU_REACH.txt
151 lines (151 loc) · 79.7 KB
/
EU_REACH.txt
1
2
3
4
5
6
7
8
9
10
11
12
13
14
15
16
17
18
19
20
21
22
23
24
25
26
27
28
29
30
31
32
33
34
35
36
37
38
39
40
41
42
43
44
45
46
47
48
49
50
51
52
53
54
55
56
57
58
59
60
61
62
63
64
65
66
67
68
69
70
71
72
73
74
75
76
77
78
79
80
81
82
83
84
85
86
87
88
89
90
91
92
93
94
95
96
97
98
99
100
101
102
103
104
105
106
107
108
109
110
111
112
113
114
115
116
117
118
119
120
121
122
123
124
125
126
127
128
129
130
131
132
133
134
135
136
137
138
139
140
141
142
143
144
145
146
147
148
149
150
151
ID CAS_No Chemical_Name Chemical_Name_Cirpy TSCA_Name VT_KR_NZ_Name Chemical_Name_Scifinder Chemical_Name_SMILECAS Chemical_Name_Reaxys Chemical_Name_OECD_QSAR Chemical_Name_Final Chemical_Name_Final_Source UVCB_TSCA UVCB_SciFinder UVCB_Final UVCB_Final_Source UVCB&Polymers Metals Organometallics Polymers Processes Mixtures Biological InChIKey_Dashboard_all InChIKey_Cirpy InChIKey_Dashboard InChIKey_Reaxys InChIKey_SMILES InChIKey_Scifinder InChIKey_Comparison InChIKey_Final InChIKey_Final_Source InChI_Dashboard InChI_Scifinder InChI_Cirpy InChI_Final InChI_Final_Source SMILES_OECD_QSAR SMILES_Cirpy SMILES_Pubchem SMILES_ClassyFire SMILES_Final SMILES_Final_Source Alternate_CAS_No Deleted_CAS_No Classyfired Pigments Trade_Name ClassyFired_new Fluoro Bromo Chloro Iodo
149363 66455-17-2 Alcohols, C9-11 Alcohols, C9-11 Alcohols, (C=9-11) Alcohols, C9-11 Alcohols, C9-11 Alcohols, C9-11 Alcohols, C9-11 SciFinder 0 1 1 US TSCA 0 0 0 0 0 1 0 MWKFXSUHUHTGQN-UHFFFAOYSA-N ZWRUINPWMLAQRD-UHFFFAOYSA-N InChIKey=MWKFXSUHUHTGQN-UHFFFAOYSA-N MWKFXSUHUHTGQN-UHFFFAOYSA-N Cirpy InChI=1S/C10H22O/c1-2-3-4-5-6-7-8-9-10-11/h11H,2-10H2,1H3 InChI=1S/C10H22O/c1-2-3-4-5-6-7-8-9-10-11/h11H,2-10H2,1H3 Cirpy CCCCCCCCCO CCCCCCCCCCO CCCCCCCCCO QSAR 0 0 1 0 0 1 0 0 0 0
64545 196965-91-0 2,6,7-Trioxabicyclo[2.2.2]octane, 4-ethyl-, 1-C5-9-alkyl derivs. 2,6,7-Trioxabicyclo[2.2.2]octane, 4-ethyl-, 1-C5-9-alkyl derivs. 2,6,7-Trioxabicyclo[2.2.2]octane, 4-ethyl-, 1-C5-9-alkyl derivs. US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
162612 68604-38-6 Fatty acids, C16-18 and C18-unsatd., hexaesters with dipentaerythritol Fatty acids, C16-18 and C18-unsatd., hexaesters with dipentaerythritol Fatty acids, (C=16-18) and (C=18)-unsatd., hexaesters with dipentaerythritol Fatty acids, C16-18 and C18-unsatd., hexaesters with dipentaerythritol Fatty acids, C16-18 and C18-unsatd., hexaesters with dipentaerythritol US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
39772 1415316-96-9 Fatty acids, sunflower-oil, conjugated, maleated, reation products with diethanolamine, maleated tall-oil fatty acids and triethanolamine Fatty acids, sunflower-oil, conjugated, maleated, reation products with diethanolamine, maleated tall-oil fatty acids and triethanolamine SciFinder 0 1 1 SciFinder 0 0 0 0 1 1 1 0 0 0 0 0 0 0 0 0 0
214398 91079-24-2 Oils, vegetable, sulfated, ammonium salts Oils, vegetable, sulfated, ammonium salts VT_KR_NZ 0 0 1 From Name 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
214278 91053-33-7 Juniper, Juniperus mexicana, ext., isomerized, acetylated Juniper, Juniperus mexicana, ext., isomerized, acetylated;Juniper, juniperus mexicana, extract, isomerized, acetylated Juniper, Juniperus mexicana, ext., isomerized, acetylated SciFinder 0 1 1 SciFinder 0 0 0 0 1 0 1 0 0 0 0 0 0 0 0 0 0
2619 101631-14-5 Distillates (petroleum), heavy steam-cracked Distillates(petroleum),heavysteamcracked Distillates (petroleum), heavy steam-cracked VT_KR_NZ 0 0 1 From Name 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
160968 68515-47-9 C13-Rich di-C11-14-branched alkyl phthalates 1,2-Benzenedicarboxylic acid, di-C11-14-branched alkyl esters, C13-rich 1,2-Benzenedicarboxylic acid di(C=11-14)-branched alkyl esters, (C=13)-rich 1,2-Benzenedicarboxylic acid, di-C11-14-branched alkyl esters, C13-rich 1,2-Benzenedicarboxylic acid, di-C11-14-branched alkyl esters, C13-rich 1,2-Benzenedicarboxylic acid, di-C11-14-branched alkyl esters, C13-rich US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 BCSGAWBQJHXXSE-UHFFFAOYSA-N HUDJFYUZVAFMTJ-UHFFFAOYSA-N BCSGAWBQJHXXSE-UHFFFAOYSA-N Cirpy InChI=1S/C34H58O4/c1-29(2)23-17-13-9-5-7-11-15-21-27-37-33(35)31-25-19-20-26-32(31)34(36)38-28-22-16-12-8-6-10-14-18-24-30(3)4/h19-20,25-26,29-30H,5-18,21-24,27-28H2,1-4H3 InChI=1S/C34H58O4/c1-29(2)23-17-13-9-5-7-11-15-21-27-37-33(35)31-25-19-20-26-32(31)34(36)38-28-22-16-12-8-6-10-14-18-24-30(3)4/h19-20,25-26,29-30H,5-18,21-24,27-28H2,1-4H3 Cirpy CC(C)(C)CCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCCC(C)(C)C CC(C)CCCCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCCCCC(C)C CC(C)(C)CCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCCC(C)(C)C QSAR 0 0 1 0 0 1 0 0 0 0
198495 84776-83-0 Resin acids and Rosin acids, esters with trimethylolpropane Resin acids and Rosin acids, esters with trimethylolpropane Resin acids and Rosin acids, esters with trimethylolpropane Resin acids and Rosin acids, esters with trimethylolpropane US TSCA 0 0 1 US TSCA 0 0 0 1 0 1 0 0 0 0 0 0 0 0 0 0 0
190054 8002-41-3 Oils, laurel Oils, laurel Oils, laurel Oils, laurel Oils, laurel US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 CYUUZGXOQDCCGH-UHFFFAOYSA-N CYUUZGXOQDCCGH-UHFFFAOYSA-N OECD QSAR CCCCCCCCCCCCOC(=O)CCCCCCCCCCC CCCCCCCCCCCCOC(=O)CCCCCCCCCCC CCCCCCCCCCCCOC(=O)CCCCCCCCCCC CCCCCCCCCCCCOC(=O)CCCCCCCCCCC OECD QSAR 0 0 1 0 0 1 0 0 0 0
146280 65036-46-6 7-Benzothiazolesulfonic acid, 2-[4-[(hexahydro-2,4,6-trioxo-5-pyrimidinyl)azo]phenyl]-6-methyl-, compd. with 2,2',2''-nitrilotris[ethanol] (1:1) 7-Benzothiazolesulfonic acid, 2-[4-[2-(hexahydro-2,4,6-trioxo-5-pyrimidinyl)diazenyl]phenyl]-6-methyl-, compd. with 2,2',2''-nitrilotris[ethanol] (1:1) 2-[4-[(Hexahydro-2,4,6-trioxo-5-pyrimidyl)azo]phenyl]-6-methylbenzothiazole-7-sulfonic acid compound with 2,2',2''-nitrilotris[ethanol] (1:1) 7-Benzothiazolesulfonic acid, 2-[4-[(hexahydro-2,4,6-trioxo-5-pyrimidinyl)azo]phenyl]-6-methyl-, compd. with 2,2',2''-n 7-Benzothiazolesulfonic acid, 2-[4-[(hexahydro-2,4,6-trioxo-5-pyrimidinyl)azo]phenyl]-6-methyl-, compd. with 2,2�,2��-nitrilotris[ethanol] (1:1) 7-Benzothiazolesulfonic acid, 2-[4-[2-(hexahydro-2,4,6-trioxo-5-pyrimidinyl)diazenyl]phenyl]-6-methyl-, compd. with 2,2',2''-nitrilotris[ethanol] (1:1) US TSCA 0 0 0 US TSCA 0 0 0 0 0 1 0 AZHSURPXVDEIHG-UHFFFAOYSA-N AZHSURPXVDEIHG-UHFFFAOYSA-N APIDSQKETXQPQW-UHFFFAOYSA-N AZHSURPXVDEIHG-UHFFFAOYSA-N Dashboard InChI=1S/C18H13N5O6S2.C6H15NO3/c1-8-2-7-11-13(14(8)31(27,28)29)30-17(19-11)9-3-5-10(6-4-9)22-23-12-15(24)20-18(26)21-16(12)25;8-4-1-7(2-5-9)3-6-10/h2-7,12H,1H3,(H,27,28,29)(H2,20,21,24,25,26);8-10H,1-6H2 InChI=1S/C18H13N5O6S2.C6H15NO3/c1-8-2-7-11-13(14(8)31(27,28)29)30-17(19-11)9-3-5-10(6-4-9)22-23-12-15(24)20-18(26)21-16(12)25;8-4-1-7(2-5-9)3-6-10/h2-7,12H,1H3,(H,27,28,29)(H2,20,21,24,25,26);8-10H,1-6H2 InChI=1S/C18H13N5O6S2.C6H15NO3/c1-8-2-7-11-13(14(8)31(27,28)29)30-17(19-11)9-3-5-10(6-4-9)22-23-12-15(24)20-18(26)21-16(12)25;8-4-1-7(2-5-9)3-6-10/h2-7,12H,1H3,(H,27,28,29)(H2,20,21,24,25,26);8-10H,1-6H2 Cirpy Cc1ccc2nc(sc2c1S(O)(=O)=O)-c1ccc(cc1)N=NC1C(=O)NC(=O)NC1=O OCCN(CCO)CCO.CC1=C(C2=C(C=C1)N=C(S2)C1=CC=C(C=C1)N=NC1C(=O)NC(=O)NC1=O)S(O)(=O)=O Cc1ccc2nc(sc2c1S(O)(=O)=O)-c1ccc(cc1)N=NC1C(=O)NC(=O)NC1=O QSAR 0 0 1 0 0 1 0 0 0 0
162653 68604-84-2 dimethyl (2E,34E)-hexatriaconta-2,34-dienedioate Fatty acids, C18-unsatd., dimers, Me esters Fatty acids, (C=18)-unsatd., dimers, Me esters Fatty acids, C18-unsatd., dimers, Me esters Fatty acids, C18-unsatd., dimers, Me esters;Fatty acids, C18-unsatd., dimers, methyl esters Fatty acids, C18-unsatd., dimers, Me esters US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 HAYSMLFXRQFQTR-LBYUQGKWSA-N HAYSMLFXRQFQTR-LBYUQGKWSA-N Cirpy InChI=1S/C38H70O4/c1-41-37(39)35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38(40)42-2/h33-36H,3-32H2,1-2H3/b35-33+,36-34+ InChI=1S/C38H70O4/c1-41-37(39)35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38(40)42-2/h33-36H,3-32H2,1-2H3/b35-33+,36-34+ Cirpy COC(=O)\C=C\CCCCCCCCCCCCCCCCCCCCCCCCCCCCCC\C=C\C(=O)OC COC(=O)\C=C\CCCCCCCCCCCCCCCCCCCCCCCCCCCCCC\C=C\C(=O)OC ClassyFire 0 0 1 0 0 1 0 0 0 0
39107 1402434-48-3 Morpholine, 4-C12-14-alkyl derivs. Morpholine, 4-C12-14-alkyl derivs. SciFinder 0 1 1 SciFinder 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
210707 90244-88-5 Bulnesia sarmienti, ext., sapond. Bulnesia sarmienti, ext., sapond.;Bulnesia sarmienti, extract, saponified Bulnesia sarmienti, ext., sapond. VT_KR_NZ 0 0 1 From Name 0 0 0 0 1 0 1 0 0 0 0 0 0 0 0 0 0
157538 68308-19-0 Fatty acids, C6-19-branched, copper(2+) salts Fatty acids, C6-19-branched, copper(2+) salts Fatty acids, (C=6-19)-branched, copper(2+) salts Fatty acids, C6-19-branched, copper(2+) salts Fatty acids, C6-19-branched, copper(2++) salts Fatty acids, C6-19-branched, copper(2+) salts US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 BNTQGVHBWQQJDR-UHFFFAOYSA-L BNTQGVHBWQQJDR-UHFFFAOYSA-L OECD QSAR CCCC(C)CC(C)CC(C)C(=O)O[Cu]OC(=O)C(C)CC(C)CC(C)CCC CCCC(C)CC(C)CC(C)C(=O)O[Cu]OC(=O)C(C)CC(C)CC(C)CCC CCCC(C)CC(C)CC(C)C(=O)O[Cu]OC(=O)C(C)CC(C)CC(C)CCC OECD QSAR 0 0 1 0 0 1 0 0 0 0
231971 97489-15-1 C14-17-sec-alkanesulfonic acid sodium salts Sulfonic acids, C14-17-sec-alkane, sodium salts C14-17-sec-alkanesulfonic acid sodium salts Dashboard 0 0 1 From Name 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
200320 85116-81-0 Fatty acids, C14-18 and C16-18-unsatd., esters with neopentyl glycol Fatty acids, C14-18 and C16-18-unsatd., esters with neopentyl glycol SciFinder 0 1 1 SciFinder 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
163176 68610-51-5 Poly(dicyclopentadiene-co-p-cresol) Phenol, 4-methyl-, reaction products with dicyclopentadiene and isobutylene 4-Methylphenol reaction products with dicyclopentadiene and isobutylene Phenol, 4-methyl-, reaction products with dicyclopentadiene and isobutylene Phenol,_4-methyl-,_reaction_products_with_dicyclopentadiene_and_isobutylene" Phenol, 4-methyl-, reaction products with dicyclopentadiene and isobutylene US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 UQQYHXZNSYZMEN-UHFFFAOYSA-N UQQYHXZNSYZMEN-UHFFFAOYSA-N UQQYHXZNSYZMEN-UHFFFAOYSA-N Cirpy InChI=1S/C10H12.C7H8O.C4H8/c1-2-9-7-4-5-8(6-7)10(9)3-1;1-6-2-4-7(8)5-3-6;1-4(2)3/h1-2,4-5,7-10H,3,6H2;2-5,8H,1H3;1H2,2-3H3 InChI=1S/C10H12.C7H8O.C4H8/c1-2-9-7-4-5-8(6-7)10(9)3-1;1-6-2-4-7(8)5-3-6;1-4(2)3/h1-2,4-5,7-10H,3,6H2;2-5,8H,1H3;1H2,2-3H3 Cirpy CC(C)=C.C1C=CC2C3CC(C=C3)C12.Cc1ccc(O)cc1 CC(C)=C.CC1=CC=C(O)C=C1.C1C=CC2C3CC(C=C3)C12 CC(C)=C.C1C=CC2C3CC(C=C3)C12.Cc1ccc(O)cc1 QSAR 0 0 1 0 0 1 0 0 0 0
199936 85049-37-2 Fatty acids, C16-18 and C18-unsatd., 2-ethylhexyl esters Fatty acids, (C=16-18) and (C=18)-unsatd., 2-ethylhexyl esters Fatty acids, C16-18 and C18-unsatd., 2-ethylhexyl esters Fatty acids, C16-18 and C18-unsatd., 2-ethylhexyl esters Dashboard 0 0 1 From Name 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
216285 91770-57-9 Residual oils (petroleum), catalytic dewaxed Residualoils(petroleum),catalyticdewaxed,ifthey contain> 3% w/wDMSOextract Residual oils (petroleum), catalytic dewaxed VT_KR_NZ 0 0 1 From Name 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
178084 72403-67-9 3(or 4)-(4-Methylpenten-3-yl)cyclohex-3-ene-1-methyl acetate 3-Cyclohexene-1-methanol, 3(or 4)-(4-methyl-3-penten-1-yl)-, 1-acetate 3-Cyclohexene-1-methanol, 3(or 4)-(4-methyl-3-pentenyl)-, acetate 3-Cyclohexene-1-methanol, 3(or *4)-(4-methyl-3-pentenyl)-,acetate [3-(4-methylpent-3-en-1-yl)cyclohex-3-en-1-yl]methyl acetate;3(or 4)-(4-Methylpenten-3-yl)cyclohex-3-ene-1-methyl acetate;3-Cyclohexene-1-methanol, 3(or 4)-(4-methyl-3-penten-1-yl)-, 1-acetate;3-Cyclohexene-1-methanol, 3(or 4)-(4-methyl-3-pentenyl)-, acetate 3-Cyclohexene-1-methanol, 3(or 4)-(4-methyl-3-penten-1-yl)-, 1-acetate US TSCA 0 0 0 US TSCA 0 0 0 0 0 1 0 IIUKCYITROTKFB-UHFFFAOYSA-N IIUKCYITROTKFB-HNNXBMFYSA-N IIUKCYITROTKFB-UHFFFAOYSA-N IIUKCYITROTKFB-UHFFFAOYSA-N IIUKCYITROTKFB-UHFFFAOYSA-N Dashboard InChI=1S/C15H24O2/c1-12(2)6-4-7-14-8-5-9-15(10-14)11-17-13(3)16/h6,8,15H,4-5,7,9-11H2,1-3H3 InChI=1S/C15H24O2/c1-12(2)6-4-7-14-8-5-9-15(10-14)11-17-13(3)16/h6,8,15H,4-5,7,9-11H2,1-3H3/t15-/m0/s1 InChI=1S/C15H24O2/c1-12(2)6-4-7-14-8-5-9-15(10-14)11-17-13(3)16/h6,8,15H,4-5,7,9-11H2,1-3H3/t15-/m0/s1 Cirpy CC(=O)OCC1CCC=C(CCC=C(C)C)C1 CC(C)=CCCC1=CCCC(COC(C)=O)C1 CC(=O)OCC1CCC=C(CCC=C(C)C)C1 QSAR 0 0 1 0 0 1 0 0 0 0
223097 93924-33-5 Gas oils, paraffinic gas oil A Gasoils,paraffinic,exceptifthefullrefining historyisknownanditcanbeshownthatthe substancefromwhichitis producedisnota carcinogen Gas oils, paraffinic VT_KR_NZ 0 0 1 From Name 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
40670 1428547-35-6 Fatty acids, C16-18, compds. with C16-18-alkyl amines Fatty acids, C16-18, compds. with C16-18-alkyl amines SciFinder 0 1 1 SciFinder 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
214289 91053-44-0 Leach residues, cadmium cake Leach residues, cadmium cake SciFinder 0 1 1 SciFinder 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
163078 68609-44-9 Gadolinium oxide sulfide (Gd2O2S), ytterbium-doped Gadolinium oxide sulfide (Gd2O2S), ytterbium-doped Gadolinium oxide sulfide (Gd2O2S), ytterbium-doped Gadolinium oxide sulfide (Gd2O2S), ytterbium-doped Gadolinium oxide sulfide (Gd2O2S), ytterbium-doped US TSCA 0 0 1 US TSCA 0 1 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0
32965 132983-41-6 Naphthalene reaction products with tetradecene Naphthalene reaction products with tetradecene VT_KR_NZ 0 0 1 From Name 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
137571 61790-19-0 Fats and Glyceridic oils, vegetable, sulfated Fats and Glyceridic oils, vegetable, sulfated Sulfated vegetable oils Fats and Glyceridic oils, vegetable, sulfated;Oils, vegetable, sulfated Fats and Glyceridic oils, vegetable, sulfated US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 1 0 0 0 0 0 0 0 0 0 0
166059 68919-79-9 Fatty acids, tall-oil, reaction products with triethylenetetramine Fatty acids, tall-oil, reaction products with triethylenetetramine Fatty acids, tall oil reaction products with triethylenetetramine Fatty acids, tall-oil, reaction products with triethylenetetramine Fatty acids, tall oil, reaction products with triethylenetetramine;Fatty acids, tall-oil, reaction products with triethylenetetramine Fatty acids, tall-oil, reaction products with triethylenetetramine US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 WQTPDIMWAXFYPL-UHFFFAOYSA-N WQTPDIMWAXFYPL-UHFFFAOYSA-N OECD QSAR CCCCCCCCC=CCCCCCCCC(=O)NCCNCCNCCN CCCCCCCCC=CCCCCCCCC(=O)NCCNCCNCCN CCCCCCCCC=CCCCCCCCC(=O)NCCNCCNCCN CCCCCCCCC=CCCCCCCCC(=O)NCCNCCNCCN OECD QSAR 0 0 1 0 0 1 0 0 0 0
158808 68412-14-6 2-(2-aminoethylamino)ethanol; octadecanoic acid; urea Octadecanoic acid, reaction products with 2-[(2-aminoethyl)amino]ethanol and urea Octadecanoic acid, reaction products with 2-[(2-aminoethyl)amino]ethanol and urea Octadecanoic acid, reaction products with 2-[(2-aminoethyl)amino]ethanol and urea Octadecanoic acid, reaction products with 2-[(2-aminoethyl)amino]ethanol and urea US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 NSDUCABVIZJQPD-UHFFFAOYSA-N YSAXDRPILZYKJB-UHFFFAOYSA-N NSDUCABVIZJQPD-UHFFFAOYSA-N Cirpy InChI=1S/C18H36O2.C4H12N2O.CH4N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;5-1-2-6-3-4-7;2-1(3)4/h2-17H2,1H3,(H,19,20);6-7H,1-5H2;(H4,2,3,4) InChI=1S/C18H36O2.C4H12N2O.CH4N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;5-1-2-6-3-4-7;2-1(3)4/h2-17H2,1H3,(H,19,20);6-7H,1-5H2;(H4,2,3,4) Cirpy CCCCCCCCCCCCCCCCCC1=NCCN1CCOC(N)=O NC(N)=O.NCCNCCO.CCCCCCCCCCCCCCCCCC(O)=O CCCCCCCCCCCCCCCCCC1=NCCN1CCOC(N)=O QSAR 0 0 1 0 0 1 0 0 0 0
145838 64742-91-2 Distillates, petroleum, steam-cracked Distillates (petroleum), steam-cracked Distillates (petroleum), steam-cracked Distillates (petroleum), steam-cracked Distillates (petroleum), steam-cracked;Distillates, petroleum, steam cracked Distillates (petroleum), steam-cracked US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 UFWIBTONFRDIAS-UHFFFAOYSA-N UFWIBTONFRDIAS-UHFFFAOYSA-N OECD QSAR c1ccc2ccccc2c1 c1ccc2ccccc2c1 C1=CC2=CC=CC=C2C=C1 c1ccc2ccccc2c1 OECD QSAR 0 0 1 0 0 1 0 0 0 0
214835 911674-82-3 Castor-oil, hydrogenated, N,N'-[1,3-phenylenebis(methylene)]bis-amides Castor-oil, hydrogenated, N,N'-[1,3-phenylenebis(methylene)]bis-amides VT_KR_NZ 0 0 1 From Name 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
160215 68477-50-9 Distillates (petroleum), polymd. steam-cracked petroleum distillates, C5-12 fraction Distillates (petroleum), polymd. steam-cracked petroleum distillates, C5-12 fraction Distillates (petroleum), polymd. steam-cracked petroleum distillates, (C=5-12) fraction Distillates (petroleum), polymd. steam-cracked petroleum distillates, C5-12 fraction US TSCA 0 0 1 US TSCA 0 0 0 1 1 1 0 0 0 0 0 0 0 0 0 0 0
137460 61788-85-0 Polyoxyethylene hydrogenated castor oil 60 Castor oil, hydrogenated, ethoxylated Castor oil, hydrogenated, ethoxylated Ethoxylated hydrogenated castor oil Castor oil, hydrogenated, ethoxylated CREMOPHOR CO 40 Castor oil, hydrogenated, ethoxylated Ethoxylated hydrogenated castor oil SciFinder 0 1 1 US TSCA 0 0 0 1 1 0 0 YMXCUWFLUCDGNV-UHFFFAOYSA-N YMXCUWFLUCDGNV-UHFFFAOYSA-N OECD QSAR CCCCCCC(O)CC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCC(CCCCCC)OCCOCCOCCOCCOCCO)OC(=O)CCCCCCCC=CCC(O)CCCCCC CCCCCCC(O)CC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCC(CCCCCC)OCCOCCOCCOCCOCCO)OC(=O)CCCCCCCC=CCC(O)CCCCCC CCCCCCC(O)CC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCC(CCCCCC)OCCOCCOCCOCCOCCO)OC(=O)CCCCCCCC=CCC(O)CCCCCC OECD QSAR 0 0 1 0 0 1 0 0 0 0
181609 738587-10-5 5-[(2-hydroxy-3,7-disulfo-1-naphthalenyl)azo]-1H-1,2,4-triazole-3-carboxylate sodium complexes nickel 5-[(2-hydroxy-3,7-disulfo-1-naphthalenyl)azo]-1H-1,2,4-triazole-3-carboxylate sodium complexes nickel VT_KR_NZ 0 0 1 From Name 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
9263 1079258-99-3 Phosphonic acid, P-(3-silylpropyl)-, Si,Si,Si-tris(mixed ethoxy and methoxy) derivs., mixed Et and Me diesters Phosphonic acid, P-(3-silylpropyl)-, Si,Si,Si-tris(mixed ethoxy and methoxy) derivs., mixed Et and Me diesters SciFinder 0 1 1 SciFinder 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
154703 68081-77-6 Benzene, polypropene derivs. Benzene, polypropene derivs. Benzene, polypropene derivs. Benzene, polypropene derivatives;Benzene, polypropene derivs. Benzene, polypropene derivs. US TSCA 0 0 1 US TSCA 0 0 0 1 1 1 0 0 0 0 0 0 0 0 0 0 0
145834 64742-87-6 Gas oils, petroleum, hydrodesulfurized light vacuum Gas oils (petroleum), hydrodesulfurized light vacuum Gas oils (petroleum), hydrodesulfurized light vacuum Gas oils (petroleum), hydrodesulfurized light vacuum Gas oils (petroleum), hydrodesulfurized light vacuum;Gas oils, petroleum, hydrodesulfurized, light vacuum Gas oils (petroleum), hydrodesulfurized light vacuum US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 NDJKXXJCMXVBJW-UHFFFAOYSA-N NDJKXXJCMXVBJW-UHFFFAOYSA-N OECD QSAR CCCCCCCCCCCCCCCCC CCCCCCCCCCCCCCCCC CCCCCCCCCCCCCCCCC CCCCCCCCCCCCCCCCC OECD QSAR 0 0 1 0 0 1 0 0 0 0
162494 68603-11-2 Hydrocarbon waxes, petroleum, oxidized, Me esters, calcium salts Hydrocarbon waxes (petroleum), oxidized, Me esters, calcium salts Hydrocarbon waxes (petroleum), oxidized, Me esters, calcium salts Hydrocarbon waxes (petroleum), oxidized, Me esters, calcium salts;Hydrocarbon waxes, petroleum, oxidized, Me esters, calcium salts Hydrocarbon waxes (petroleum), oxidized, Me esters, calcium salts US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
51326 161907-77-3 Ethanol, 2-butoxy-, manufacture of, by-products from Ethanol, 2-butoxy-, manufacture of, by-products from VT_KR_NZ 0 0 1 From Name 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
199827 85029-82-9 Soybean oil, maleated, ester with triethanolamine Soybean oil, maleated, ester with triethanolamine Soybean oil, maleated, ester with triethanolamine Soybean oil, maleated, ester with triethanolamine Soybean oil, maleated, ester with triethanolamine US TSCA 0 0 1 US TSCA 0 0 0 0 1 0 1 0 0 0 0 0 0 0 0 0 0
219682 93333-79-0 Ashes (residues), plant Ashes (residues), plant SciFinder 0 1 1 SciFinder 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
167790 68990-02-3 Resin acids and Rosin acids, hydrogenated, sodium salts Resin acids and Rosin acids, hydrogenated, sodium salts Resin acids and Rosin acids, hydrogenated, sodium salts Resin acids and Rosin acids, hydrogenated, sodium salts Resin acids and Rosin acids, hydrogenated, sodium salts US TSCA 0 0 1 US TSCA 0 0 0 1 1 1 0 0 0 0 0 0 0 0 0 0 0
204138 85940-25-6 Phenol, 4-(9H-carbazol-3-ylamino)-, reaction products with sodium sulfide (Na2(Sx)) and sulfur, leuco deriv. Phenol, 4-(9H-carbazol-3-ylamino)-, reaction products with sodium sulfide (Na2(Sx)) and sulfur, leuco deriv. Phenol, 4-(9H-carbazol-3-ylamino)-, reaction products with sodium sulfide (Na2(Sx)) and sulfur, leuco deriv. SciFinder 0 1 1 SciFinder 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
216874 91995-50-5 Distillates (petroleum), naphtha steam cracking-derived, hydrotreated light arom. Distillates (petroleum), naphtha steam cracking-derived, hydrotreated light arom. Distillates (petroleum), naphtha steam cracking-derived, hydrotreated light arom. VT_KR_NZ 0 0 1 From Name 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
216046 91744-27-3 Glycerides, castor oil mono-, di- and tri- Glycerides, castor-oil mono-, di- and tri- Glycerides, castor-oil mono-, di- and tri- Glycerides, castor oil mono-, di- and tri- VT_KR_NZ 0 0 1 From Name 0 0 0 0 0 1 0 HDIFHQMREAYYJW-UHFFFAOYSA-N HDIFHQMREAYYJW-UHFFFAOYSA-N OECD QSAR CCCCCCC(O)CC=CCCCCCCCC(=O)OCC(O)CO CCCCCCC(O)CC=CCCCCCCCC(=O)OCC(O)CO CCCCCCC(O)CC=CCCCCCCCC(=O)OCC(O)CO CCCCCCC(O)CC=CCCCCCCCC(=O)OCC(O)CO OECD QSAR 0 0 1 0 0 1 0 0 0 0
148300 65996-79-4 Solvent naphtha, coal Solvent naphtha (coal) Solvent naphtha (coal) Solvent naphtha (coal);Solvent naphtha, coal Solvent naphtha (coal) US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
113720 488791-14-6 7-[(4,6-Dichloro-1,3,5-triazin-2-yl)amino]-4-hydroxy-3-[(4-methoxy-2-sulfophenyl)azo]-2-naphthalenesulfonic acid, disodium salt reaction products with 2-[[3-(ethylamino)phenyl]sulfonyl]ethyl hydrogen sulfate, sodium salts 7-[(4,6-Dichloro-1,3,5-triazin-2-yl)amino]-4-hydroxy-3-[(4-methoxy-2-sulfophenyl)azo]-2-naphthalenesulfonic acid, disodium salt reaction products with 2-[[3-(ethylamino)phenyl]sulfonyl]ethyl hydrogen sulfate, sodium salts VT_KR_NZ 0 0 1 From Name 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 1 0
156552 68188-19-2 Paraffin waxes and Hydrocarbon waxes, chloro, chlorosulfonated Paraffin waxes and Hydrocarbon waxes, chloro, chlorosulfonated Paraffin waxes and Hydrocarbon waxes, chloro, sulfochlorinated Paraffin waxes and Hydrocarbon waxes, chloro, chlorosulfonated Paraffin waxes and hydrocarbon waxes, chlorinated, sulfochlorinated;Paraffin waxes and Hydrocarbon waxes, chloro, chlorosulfonated Paraffin waxes and Hydrocarbon waxes, chloro, chlorosulfonated US TSCA 0 0 1 US TSCA 0 0 0 0 1 0 0 KJHOCPSIJORQTG-UHFFFAOYSA-N KJHOCPSIJORQTG-UHFFFAOYSA-N OECD QSAR CCCCCCCCCCCCCCCCCCCCCCCCC(Cl)CS(O)(=O)=O CCCCCCCCCCCCCCCCCCCCCCCCC(Cl)CS(O)(=O)=O CCCCCCCCCCCCCCCCCCCCCCCCC(Cl)CS(O)(=O)=O OECD QSAR 0 0 1 0 0 1 0 0 1 0
112901 477-29-2 N-[1,2,10-trimethoxy-9-oxo-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6,7-dihydro-5H-benzo[d]heptalen-7-yl]acetamide colchicoside;Colchicosideanditsderivatives;N-{3-[(4-deoxypentopyranosyl)oxy]-1,2,10-trimethoxy-9-oxo-5,6,7,9-tetrahydrobenzo[a]heptalen-7-yl}acetamide colchicoside;Colchicosideanditsderivatives;N-{3-[(4-deoxypentopyranosyl)oxy]-1,2,10-trimethoxy-9-oxo-5,6,7,9-tetrahydrobenzo[a]heptalen-7-yl}acetamide OECD QSAR 0 0 1 From Name 0 0 0 0 1 0 0 UXAFRQPVHYZDED-UHFFFAOYSA-N MPEUGFWOBIRQGE-UHFFFAOYSA-N UXAFRQPVHYZDED-UHFFFAOYSA-N Cirpy InChI=1S/C27H33NO11/c1-12(30)28-16-7-5-13-9-19(38-27-24(34)23(33)22(32)20(11-29)39-27)25(36-3)26(37-4)21(13)14-6-8-18(35-2)17(31)10-15(14)16/h6,8-10,16,20,22-24,27,29,32-34H,5,7,11H2,1-4H3,(H,28,30) InChI=1S/C27H33NO11/c1-12(30)28-16-7-5-13-9-19(38-27-24(34)23(33)22(32)20(11-29)39-27)25(36-3)26(37-4)21(13)14-6-8-18(35-2)17(31)10-15(14)16/h6,8-10,16,20,22-24,27,29,32-34H,5,7,11H2,1-4H3,(H,28,30) Cirpy COC1=CC=C2C(=CC1=O)C(CCc1cc(OC3OCCC(O)C3O)c(OC)c(OC)c21)NC(C)=O COC1=C(OC2OC(CO)C(O)C(O)C2O)C=C2CCC(NC(C)=O)C3=CC(=O)C(OC)=CC=C3C2=C1OC COC1=CC=C2C(=CC1=O)C(CCc1cc(OC3OCCC(O)C3O)c(OC)c(OC)c21)NC(C)=O QSAR 0 0 1 0 0 1 0 0 0 0
43370 1473386-36-5 2-Propenoic acid, heptadecyl ester, branched 2-Propenoic acid, heptadecyl ester, branched 2-Propenoic acid, heptadecyl ester, branched 2-Propenoic acid, heptadecyl ester, branched US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
151392 67701-28-4 Glycerides, C8-18 and C18-unsatd. Glycerides, C8-18 and C18-unsatd. Glycerides, (C=8-18) and (C=18)-unsatd. Glycerides, C8-18 and C18-unsatd.;Glycerides, C8-18 and C18-unsaturated Glycerides, C8-18 and C18-unsatd. US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
17806 1190630-03-5 Ethene, homopolymer, oxidized, hydrolyzed, distn. residues, from C16-18 alcs. manuf. Ethene, homopolymer, oxidized, hydrolyzed, distn. residues, from C16-18 alcs. manuf. VT_KR_NZ 0 0 1 From Name 0 0 0 1 1 1 0 0 0 0 0 0 0 0 0 0 0
145798 64742-49-0 Naphtha, petroleum, hydrotreated light Naphtha (petroleum), hydrotreated light Naphtha (petroleum), hydrotreated light Naphtha (petroleum), hydrotreated light Naphtha (petroleum), hydrotreated light;Naphtha, petroleum, hydrotreated light Naphtha (petroleum), hydrotreated light US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 IMNFDUFMRHMDMM-UHFFFAOYSA-N IMNFDUFMRHMDMM-UHFFFAOYSA-N OECD QSAR CCCCCCC CCCCCCC CCCCCCC CCCCCCC OECD QSAR 0 0 1 0 0 1 0 0 0 0
190789 8031-44-5 Lanolin, hydrogenated Hydrogenated lanolin Lanolin, hydrogenated Lanolin, hydrogenated Lanolin, hydrogenated US TSCA 0 0 1 US TSCA 0 0 0 0 1 0 0 QIQXTHQIDYTFRH-UHFFFAOYSA-N QIQXTHQIDYTFRH-UHFFFAOYSA-N OECD QSAR CCCCCCCCCCCCCCCCCC(O)=O CCCCCCCCCCCCCCCCCC(O)=O CCCCCCCCCCCCCCCCCC(O)=O CCCCCCCCCCCCCCCCCC(O)=O OECD QSAR 0 0 1 0 0 1 0 0 0 0
232541 97675-24-6 Benzene, C9-13-alkyl derivs., distn. residues, sulfonated, calcium salts Benzene, C9-13-alkyl derivs., distn. residues, sulfonated, calcium salts;Benzene, C9-13-alkyl derivs., distn. residues, sulfonated, calciumsalts Benzene, C9-13-alkyl derivs., distn. residues, sulfonated, calcium salts SciFinder 0 1 1 SciFinder 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
190502 8016-78-2 Oils, spike Oils, spike Oils, spike Oils, spike Oils, spike Oils, spike US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 WEEGYLXZBRQIMU-UHFFFAOYSA-N WEEGYLXZBRQIMU-UHFFFAOYSA-N OECD QSAR CC12CCC(CC1)C(C)(C)O2 CC12CCC(CC1)C(C)(C)O2 CC12CCC(CC1)C(C)(C)O2 OECD QSAR 0 0 1 0 0 1 0 0 0 0
204360 85995-91-1 Alkyl iodides, C8-14, gamma-mu-perfluoro Alkyl iodides, (C=8-14), γ-ω-perfluoro Alkyl iodides, C8-14, gamma-mu-perfluoro Dashboard 0 0 0 0 0 0 0 0 1 0 0 0 0 0 0 0 1 0 0 0
207222 883233-91-8 1-Tetradecene polymer with 1-dodecene, distn. residues, hydrogenated, C=36∼84 fraction 1-Tetradecene, polymer with 1-dodecene, distn. residues, hydrogenated, C36-84 fraction 1-Tetradecene polymer with 1-dodecene, distn. residues, hydrogenated, C=36∼84 fraction VT_KR_NZ 0 0 1 From Name 0 0 0 1 1 1 0 0 0 0 0 0 0 0 0 0 0
160200 68477-35-0 Distillates, petroleum, C3-6, piperylene-rich Distillates (petroleum), C3-6, piperylene-rich Distillates (petroleum), (C=3-6) piperylene-rich Distillates (petroleum), C3-6, piperylene-rich Distillates (petroleum), C3-6, piperylene-rich;Distillates, petroleum, C3-6, piperylene rich Distillates (petroleum), C3-6, piperylene-rich US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 PMJHHCWVYXUKFD-UHFFFAOYSA-N PMJHHCWVYXUKFD-UHFFFAOYSA-N OECD QSAR CC=CC=C CC=CC=C CC=CC=C CC=CC=C OECD QSAR 0 0 1 0 0 1 0 0 0 0
145734 64741-82-8 Distillates, petroleum, light thermal cracked Distillates (petroleum), light thermal cracked Distillates (petroleum), light thermal cracked Distillates (petroleum), light thermal cracked Distillates (petroleum), light thermal cracked;Distillates, petroleum, light thermal cracked Distillates (petroleum), light thermal cracked US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 NNBZCPXTIHJBJL-UHFFFAOYSA-N NNBZCPXTIHJBJL-UHFFFAOYSA-N OECD QSAR C1CCC2CCCCC2C1 C1CCC2CCCCC2C1 C1CCC2CCCCC2C1 C1CCC2CCCCC2C1 OECD QSAR 0 0 1 0 0 1 0 0 0 0
154709 68081-84-5 Oxirane, mono[(C10-16-alkyloxy)methyl] derivs. Oxirane, 2-[(C10-16-alkyloxy)methyl] derivs. Oxirane, mono[(alkyl(C=10-16)oxy)methyl] derivs. Oxirane, mono[(C10-16-alkyloxy)methyl] derivs. Oxirane, mono[(C10-16-alkyloxy)methyl] derivatives;Oxirane, mono[(C10-16-alkyloxy)methyl] derivs. Oxirane, 2-[(C10-16-alkyloxy)methyl] derivs. US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 NPKKFQUHBHQTSH-UHFFFAOYSA-N NPKKFQUHBHQTSH-UHFFFAOYSA-N OECD QSAR CCCCCCCCCCOCC1CO1 CCCCCCCCCCOCC1CO1 CCCCCCCCCCOCC1CO1 CCCCCCCCCCOCC1CO1 OECD QSAR 0 0 1 0 0 1 0 0 0 0
217216 92062-33-4 Tar bases, coal, picoline fraction Tar bases, coal, picoline fraction Tar bases, coal, picoline fraction Dashboard 0 0 1 From Name 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
217075 92045-23-3 Hydrocarbons, (C=4), steam-cracker distillate Hydrocarbons, C4, steam-cracker distillate;Hydrocarbons,C4,steamcrackerdistillate,if they contain> 0,1%w/wButadiene Hydrocarbons, (C=4), steam-cracker distillate VT_KR_NZ 0 0 1 From Name 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
145706 64741-54-4 Naphtha, petroleum, heavy catalytic cracked Naphtha (petroleum), heavy catalytic cracked Naphtha (petroleum), heavy catalytic cracked Naphtha (petroleum), heavy catalytic cracked Naphtha (petroleum), heavy catalytic cracked;Naphtha, petroleum, heavy catalytic cracked Naphtha (petroleum), heavy catalytic cracked US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 KWKAKUADMBZCLK-UHFFFAOYSA-N KWKAKUADMBZCLK-UHFFFAOYSA-N OECD QSAR CCCCCCC=C CCCCCCC=C CCCCCCC=C CCCCCCC=C OECD QSAR 0 0 1 0 0 1 0 0 0 0
160053 68475-79-6 Distillates, petroleum, catalytic reformed depentanizer Distillates (petroleum), catalytic reformed depentanizer Distillates (petroleum), catalytic reformed depentanizer Distillates (petroleum), catalytic reformed depentanizer Distillates (petroleum), catalytic reformed depentanizer;Distillates, petroleum, catalytic reformed depentanizer Distillates (petroleum), catalytic reformed depentanizer US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 IJDNQMDRQITEOD-UHFFFAOYSA-N IJDNQMDRQITEOD-UHFFFAOYSA-N OECD QSAR CCCC CCCC CCCC CCCC OECD QSAR 0 0 1 0 0 1 0 0 0 0
204466 86014-76-8 disodium; 2-amino-4,6-dinitrophenol; 4-hydroxy-5-[(2E)-2-(2-hydroxy-4-oxo-1-cyclohexa-2,5-dienylidene)hydrazinyl]naphthalene-2,7-disulfonate; iron; 4-nitroaniline Iron, complexes with diazotized 2-amino-4,6-dinitrophenol coupled with diazotized 4-nitrobenzenamine and 4-[2-(2,4-dihydroxyphenyl)diazenyl]-5-hydroxy-2,7-naphthalenedisulfonic acid, sodium salts Iron, complexes with diazotized 2-amino-4,6-dinitrophenol coupled with diazotized 4-nitrobenzenamine and 4-[(2,4-dihydroxyphenyl)azo]-5-hydroxy-2,7-naphthalenedisulfonic acid, sodium salts Iron, complexes with diazotized 2-amino-4,6-dinitrophenol coupled with diazotized 4-nitrobenzenamine and 4-[(2,4-dihydroxyphenyl)azo]-5-hydroxy-2,7-naphthalenedisulfonic acid, sodium salts Iron, complexes with diazotized 2-amino-4,6-dinitrophenol coupled with diazotized 4-nitrobenzenamine and 4-[2-(2,4-dihydroxyphenyl)diazenyl]-5-hydroxy-2,7-naphthalenedisulfonic acid, sodium salts US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 VKGDLXPXGUTJRE-JEZQZZQZSA-L VOJYHLXIBFZMEV-UHFFFAOYSA-N VKGDLXPXGUTJRE-JEZQZZQZSA-L Cirpy InChI=1S/C16H12N2O9S2.C6H5N3O5.C6H6N2O2.Fe.2Na/c19-9-1-2-12(14(20)5-9)17-18-13-6-10(28(22,23)24)3-8-4-11(29(25,26)27)7-15(21)16(8)13;7-4-1-3(8(11)12)2-5(6(4)10)9(13)14;7-5-1-3-6(4-2-5)8(9)10;;;/h1-7,18,20-21H,(H,22,23,24)(H,25,26,27);1-2,10H,7H2;1-4H,7H2;;;/q;;;;2*+1/p-2/b17-12+;;;;; InChI=1S/C16H12N2O9S2.C6H5N3O5.C6H6N2O2.Fe.2Na/c19-9-1-2-12(14(20)5-9)17-18-13-6-10(28(22,23)24)3-8-4-11(29(25,26)27)7-15(21)16(8)13;7-4-1-3(8(11)12)2-5(6(4)10)9(13)14;7-5-1-3-6(4-2-5)8(9)10;;;/h1-7,18,20-21H,(H,22,23,24)(H,25,26,27);1-2,10H,7H2;1-4H,7H2;;;/q;;;;2*+1/p-2/b17-12+;;;;; Cirpy Oc1ccc(O)c(c1)N=Nc1cc(c(N=Nc2ccc(cc2N=Nc2cc(cc(c2O)[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O)c2cc(cc(O)c12)S(O)(=O)=O)S(O)(=O)=O [Na+].[Na+].[Fe].NC1=CC=C(C=C1)[N+]([O-])=O.NC1=CC(=CC(=C1O)[N+]([O-])=O)[N+]([O-])=O.OC1=CC(=O)C=C\C1=N/NC1=C2C(O)=CC(=CC2=CC(=C1)S([O-])(=O)=O)S([O-])(=O)=O Oc1ccc(O)c(c1)N=Nc1cc(c(N=Nc2ccc(cc2N=Nc2cc(cc(c2O)[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O)c2cc(cc(O)c12)S(O)(=O)=O)S(O)(=O)=O QSAR 0 0 1 0 0 1 0 0 0 0
233841 98171-53-0 Butanoic acid, 4-amino-4-oxosulfo-, N-coco alkyl derivs., monosodium salts, compds. with triethanolamine Butanoic acid, 4-amino-4-oxosulfo-, N-coco alkyl derivs., monosodium salts, compds. with triethanolamine Butanoic acid, 4-amino-4-oxosulfo-, N-coco alkyl derivs., monosodium salts, compds. with triethanolamine Butanoic acid, 4-amino-4-oxosulfo-, N-coco alkyl derivs., monosodium salts, compds. with triethanolamine Butanoic acid, 4-amino-4-oxosulfo-, N-coco alkyl derivs., monosodium salts, compds. with triethanolamine Butanoic acid, 4-amino-4-oxosulfo-, N-coco alkyl derivs., monosodium salts, compds. with triethanolamine US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 FFHMAACTRKRMFS-UHFFFAOYSA-M FFHMAACTRKRMFS-UHFFFAOYSA-M OECD QSAR OCC[N+H](CCO)CCO.CCCCCCCCCCCCNC(CCC([O-])=O)OS(=O)(=O)O[Na] OCC[NH+](CCO)CCO.CCCCCCCCCCCCNC(CCC([O-])=O)OS(=O)(=O)O[Na] OCC[N+H](CCO)CCO.CCCCCCCCCCCCNC(CCC([O-])=O)OS(=O)(=O)O[Na] OECD QSAR 0 0 1 0 0 1 0 0 0 0
190486 8016-38-4 Oils, neroli Oils, neroli; Oil of orange blossom, Oil of orange flowers Oils, neroli Oils, neroli Oils, neroli US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 XMGQYMWWDOXHJM-UHFFFAOYSA-N XMGQYMWWDOXHJM-UHFFFAOYSA-N OECD QSAR CC(=C)C1CCC(C)=CC1 CC(=C)C1CCC(=CC1)C CC(=C)C1CCC(C)=CC1 CC(=C)C1CCC(C)=CC1 OECD QSAR 0 0 1 0 0 1 0 0 0 0
3132 102110-14-5 Hydrocarbons, (C=3-6), (C=5)-rich, steamcracked naphtha -;Hydrocarbons, C3-6, C5-rich, steam-cracked naphtha Hydrocarbons, (C=3-6), (C=5)-rich, steamcracked naphtha VT_KR_NZ 0 0 1 From Name 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
204928 863782-35-8 2-Oxetanone, 3-(C6-16 and C16-unsatd. alkyl) 4-(C7-17 and C17-unsatd. alkylidene) derivs. 2-Oxetanone, 3-(C6-16 and C16-unsatd. alkyl) 4-(C7-17 and C17-unsatd. alkylidene) derivs. 2-Oxetanone, 3-(C6-16 and C16-unsatd. alkyl) 4-(C7-17 and C17-unsatd. alkylidene) derivs. 2-Oxetanone, 3-(C6-16 and C16-unsatd. alkyl) 4-(C7-17 and C17-unsatd. alkylidene) derivs. 2-Oxetanone, 3-(C6-16 and C16-unsatd. alkyl) 4-(C7-17 and C17-unsatd. alkylidene) derivs. US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
416 100208-66-0 1,3-Benzenediamine, 4-methyl-, reaction products with 4-nitrobenzenamine, p-phenylenediamine and sodium sulfide (Na2(Sx)) 1,3-Benzenediamine, 4-methyl-, reaction products with 4-nitrobenzenamine, p-phenylenediamine and sodium sulfide (Na2(Sx)) SciFinder 0 1 1 SciFinder 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
205596 869466-88-6 Jojoba oil, hydrogenated Jojoba oil, hydrogenated SciFinder 0 1 1 SciFinder 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0
189412 79617-97-3 Benzeneacetic acid, α-hydroxy-, (αR)-, compd. with (1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-1-naphthalenamine (1:1) Benzeneacetic acid, α-hydroxy-, (αR)-, compd. with (1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-1-naphthalenamine (1:1) SciFinder 0 0 1 From Name 0 0 0 0 0 1 0 InChIKey=PKXMFQSWZRRSRR-MELCVFKASA-N PKXMFQSWZRRSRR-MELCVFKASA-N Scifinder CN[C@H]1CC[C@@H](c2ccc(Cl)c(Cl)c2)c3ccccc13.O[C@@H](C(O)=O)c4ccccc4 O[C@@H](C(O)=O)C1=CC=CC=C1.CN[C@H]1CC[C@@H](C2=CC(Cl)=C(Cl)C=C2)C2=CC=CC=C12 CN[C@H]1CC[C@@H](c2ccc(Cl)c(Cl)c2)c3ccccc13.O[C@@H](C(O)=O)c4ccccc4 Cirpy 0 0 1 0 0 1 0 0 1 0
160045 68475-70-7 Aromatic hydrocarbons, C6-8, naphtha-raffinate pyrolyzate-derived Aromatic hydrocarbons, C6-8, naphtha-raffinate pyrolyzate-derived Aromatic hydrocarbons, C6-8, naphtha-raffinate pyrolyzate-derived Aromatic hydrocarbons, C6-8, naphtha-raffinate pyrolyzate-derived Aromatic hydrocarbons, C6-8, naphtha raffinate pyrolyzate derived;Aromatic hydrocarbons, C6-8, naphtha-raffinate pyrolyzate-derived Aromatic hydrocarbons, C6-8, naphtha-raffinate pyrolyzate-derived US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 UHOVQNZJYSORNB-UHFFFAOYSA-N UHOVQNZJYSORNB-UHFFFAOYSA-N OECD QSAR c1ccccc1 c1ccccc1 C1=CC=CC=C1 c1ccccc1 OECD QSAR 0 0 1 0 0 1 0 0 0 0
158703 68411-07-4 Copper, .beta.-resorcylate salicylate lead complexes Copper, .beta.-resorcylate salicylate lead complexes Copper, .beta.-resorcylate salicylate lead complexes;Copper, ?-resorcylate salicylate lead complexes Copper, .beta.-resorcylate salicylate lead complexes US TSCA 0 0 1 US TSCA 0 0 1 0 0 1 0 0 0 0 0 0 0 0 0 0 0
158693 68410-97-9 Distillates, petroleum, light distillate hydrotreating process, low-boiling Distillates (petroleum), light distillate hydrotreating process, low-boiling Distillates (petroleum), light distillate hydrotreating process, low-boiling Distillates (petroleum), light distillate hydrotreating process, low-boiling Distillates (petroleum), light distillate hydrotreating process, low-boiling;Distillates, petroleum, light distillate hydrotreating process, low boiling Distillates (petroleum), light distillate hydrotreating process, low-boiling US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 IMNFDUFMRHMDMM-UHFFFAOYSA-N IMNFDUFMRHMDMM-UHFFFAOYSA-N OECD QSAR CCCCCCC CCCCCCC CCCCCCC CCCCCCC OECD QSAR 0 0 1 0 0 1 0 0 0 0
145729 64741-77-1 Distillates, petroleum, light hydrocracked Distillates (petroleum), light hydrocracked Distillates (petroleum), light hydrocracked Distillates (petroleum), light hydrocracked Distillates (petroleum), light hydrocracked;Distillates, petroleum, light hydrocracked Distillates (petroleum), light hydrocracked US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 SNRUBQQJIBEYMU-UHFFFAOYSA-N SNRUBQQJIBEYMU-UHFFFAOYSA-N OECD QSAR CCCCCCCCCCCC CCCCCCCCCCCC CCCCCCCCCCCC CCCCCCCCCCCC OECD QSAR 0 0 1 0 0 1 0 0 0 0
199330 84962-27-6 Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, hydrogen bis[3-[(4,5-dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)azo]-2-hydroxy-5-nitrobenzenesulfonato(3-)]chromate(3-), compd. with 3-[(2-ethylhexyl)oxy]-1-propanamine Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, hydrogen bis[3-[(4,5-dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)azo]-2-hydroxy-5-nitrobenzenesulfonato(3-)]chromate(3-), compd. with 3-[(2-ethylhexyl)oxy]-1-propanamine;Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, hydrogen bis[3-[(4,5-dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)azo]-2-hydroxy-5-nitrobenzenesulfonato(3-)]chromate(3-), compound with 3-[(2-ethylhexyl)oxy]-1-propanamine Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, hydrogen bis[3-[(4,5-dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)azo]-2-hydroxy-5-nitrobenzenesulfonato(3-)]chromate(3-), compd. with 3-[(2-ethylhexyl)oxy]-1-propanamine VT_KR_NZ 0 0 1 From Name 0 0 0 0 0 1 0 ODNOGBAUZCKNQO-UHFFFAOYSA-N ODNOGBAUZCKNQO-UHFFFAOYSA-N OECD QSAR CCN(CC)C1C=CC2C(Oc3cc(ccc3C=2c2ccccc2C(O)=O)N(CC)CC)C=1 CCN(CC)C1=CC2Oc3cc(ccc3C(=C2C=C1)c4ccccc4C(O)=O)N(CC)CC CCN(CC)C1=CC2OC3=C(C=CC(=C3)N(CC)CC)C(=C2C=C1)C1=CC=CC=C1C(O)=O CCN(CC)C1C=CC2C(Oc3cc(ccc3C=2c2ccccc2C(O)=O)N(CC)CC)C=1 OECD QSAR 0 0 1 0 0 1 0 0 0 0
46906 154518-38-4 Phosphoric acid, C11-14-isoalkyl esters, C13-rich Phosphoric acid, C11-14-isoalkyl esters, C13-rich Phosphoric acid, C11-14-isoalkyl esters, C13-rich Phosphoric acid, C11-14-isoalkyl esters, C13-rich US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
163126 68609-96-1 Alkyl (C8,C10) glycidyl ether Oxirane, 2-[(C8-10-alkyloxy)methyl] derivs. Oxirane, mono[(alkyl(C=8-10)oxy)methyl] derivs. Oxirane, mono[(C8-10-alkyloxy)methyl] derivs. Oxirane, mono[(C8-10-alkyloxy)methyl] derivs. Oxirane, 2-[(C8-10-alkyloxy)methyl] derivs. US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 KEKXMAURKVLACV-UHFFFAOYSA-N HRWYHCYGVIJOEC-UHFFFAOYSA-N KEKXMAURKVLACV-UHFFFAOYSA-N Cirpy InChI=1S/C12H24O2/c1-2-3-4-5-6-7-8-9-13-10-12-11-14-12/h12H,2-11H2,1H3 InChI=1S/C12H24O2/c1-2-3-4-5-6-7-8-9-13-10-12-11-14-12/h12H,2-11H2,1H3 Cirpy CCCCCCCCOCC1CO1 CCCCCCCCCOCC1CO1 CCCCCCCCOCC1CO1 QSAR 0 0 1 0 0 1 0 0 0 0
203554 85736-59-0 Naphthenic acids, bismuth salts Naphthenic acids, bismuth salts Naphthenic acids bismuth salts Naphthenic acids, bismuth salts Naphthenic acids, bismuth salts Naphthenic acids, bismuth salts US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 RSVMFOVKWFLESC-UHFFFAOYSA-L RSVMFOVKWFLESC-UHFFFAOYSA-L OECD QSAR O=C(CC1CCCC1)O[Bi]OC(=O)CC1CCCC1 O=C(CC1CCCC1)O[Bi]OC(=O)CC1CCCC1 O=C(CC1CCCC1)O[Bi]OC(=O)CC1CCCC1 OECD QSAR 0 0 1 0 0 1 0 0 0 0
46613 153965-54-9 Isononanoic acid, mixed esters with 2-ethylhexanoic acid and pentaerythritol Isononanoic acid, mixed esters with 2-ethylhexanoic acid and pentaerythritol SciFinder 0 1 1 SciFinder 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
223075 93924-11-9 Alkenes, C24-28 alpha- Alkenes, C24-28 .alpha.- Alkenes, (C=24-28) α- Alkenes, C24-28 .alpha.- Alkenes, C24-28 .alpha.- Alkenes, C24-28 .alpha.- US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 OMXANELYEWRDAW-UHFFFAOYSA-N ZDLBWMYNYNATIW-UHFFFAOYSA-N OMXANELYEWRDAW-UHFFFAOYSA-N Cirpy InChI=1S/C26H52/c1-3-5-7-9-11-13-15-17-19-21-23-25-26-24-22-20-18-16-14-12-10-8-6-4-2/h3H,1,4-26H2,2H3 InChI=1S/C26H52/c1-3-5-7-9-11-13-15-17-19-21-23-25-26-24-22-20-18-16-14-12-10-8-6-4-2/h3H,1,4-26H2,2H3 Cirpy CCCCCCCCCCCCCCCCCCCCCCC=C CCCCCCCCCCCCCCCCCCCCCCCCC=C CCCCCCCCCCCCCCCCCCCCCCC=C QSAR 0 0 1 0 0 1 0 0 0 0
149651 66587-56-2 Alcohols, C7-9 Alcohols, C7-9 Dashboard 0 0 1 From Name 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
160106 68476-32-4 Fuel oil, residues-straight-run gas oils, high-sulfur Fuel oil, residues-straight-run gas oils, high-sulfur Fuel oil, residues-straight-run gas oils, high-sulfur Fueloil,residuesstraightrungasoils,highsulfur Fuel oil, residues-straight-run gas oils, high-sulfur US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
163127 68609-97-2 C12-14-Alkyl glycidyl ether Oxirane, 2-[(C12-14-alkyloxy)methyl] derivs. Oxirane, mono[(alkyl(C=12-14)oxy)methyl] derivs. OXIRANE, MONO((C12-C14-ALKYLOXY)METHYL) DERIVS. Oxirane, mono[(C12-14-alkyloxy)methyl] derivatives;Oxirane, mono[(C12-14-alkyloxy)methyl] derivs. Oxirane, 2-[(C12-14-alkyloxy)methyl] derivs. US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 ZCZCZLVSKGCRTD-UHFFFAOYSA-N ZCZCZLVSKGCRTD-UHFFFAOYSA-N OECD QSAR CCCCCCCCCCCCCOCC1CO1 CCCCCCCCCCCCCOCC1CO1 CCCCCCCCCCCCCOCC1CO1 CCCCCCCCCCCCCOCC1CO1 OECD QSAR 0 0 1 0 0 1 0 0 0 0
199850 85030-08-6 Dodecanedioic acid, compound with 2,2',2''-nitrilotriethanol (1:2) Dodecanedioic acid compound with 2,2',2''-nitrilotriethanol (1:2) dodecanedioic acid - 2,2',2''-nitrilotriethanol (1:2);Dodecanedioic acid, compound with 2,2',2''-nitrilotriethanol (1:2) Dodecanedioic acid, compound with 2,2',2''-nitrilotriethanol (1:2) Dashboard 0 0 0 0 0 0 0 0 1 0 ONJCEWDYMQEPNH-UHFFFAOYSA-N ONJCEWDYMQEPNH-UHFFFAOYSA-N ONJCEWDYMQEPNH-UHFFFAOYSA-N ONJCEWDYMQEPNH-UHFFFAOYSA-N Dashboard InChI=1S/C12H22O4.2C6H15NO3/c13-11(14)9-7-5-3-1-2-4-6-8-10-12(15)16;2*8-4-1-7(2-5-9)3-6-10/h1-10H2,(H,13,14)(H,15,16);2*8-10H,1-6H2 InChI=1S/C12H22O4.2C6H15NO3/c13-11(14)9-7-5-3-1-2-4-6-8-10-12(15)16;2*8-4-1-7(2-5-9)3-6-10/h1-10H2,(H,13,14)(H,15,16);2*8-10H,1-6H2 Dashboard OCCN(CCO)CCO.OCCN(CCO)CCO.OC(=O)CCCCCCCCCCC(O)=O OCCN(CCO)CCO.OCCN(CCO)CCO.OC(=O)CCCCCCCCCCC(O)=O OCCN(CCO)CCO.OCCN(CCO)CCO.OC(=O)CCCCCCCCCCC(O)=O QSAR 0 0 1 0 0 1 0 0 0 0
145795 64742-46-7 Distillates, petroleum, hydrotreated middle Distillates (petroleum), hydrotreated middle Distillates (petroleum), hydrotreated middle Distillates (petroleum), hydrotreated middle Diesel 2; mixture of; boiling range: 127-415 deg C, aromatic content: 31.3 wt percent, aromatics >4 ring: 0.208 wt percent Distillates (petroleum), hydrotreated middle;Distillates, petroleum, hydrotreated middle Distillates (petroleum), hydrotreated middle US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 YCOZIPAWZNQLMR-UHFFFAOYSA-N YCOZIPAWZNQLMR-UHFFFAOYSA-N OECD QSAR CCCCCCCCCCCCCCC CCCCCCCCCCCCCCC CCCCCCCCCCCCCCC CCCCCCCCCCCCCCC OECD QSAR 0 0 1 0 0 1 0 0 0 0
163007 68608-66-2 Acetic acid, 2-chloro-, sodium salt (1:1), reaction products with 4,5-dihydro-2-undecyl-1H-imidazole-1-ethanol and sodium hydroxide Acetic acid, 2-chloro-, sodium salt (1:1), reaction products with 4,5-dihydro-2-undecyl-1H-imidazole-1-ethanol and sodium hydroxide Sodium chloroacetate reaction products with 4,5-dihydro -2-undecyl-1H-imidazole-1-ethanol and sodium hydroxide Acetic acid, chloro-, sodium salt, reaction products with 4,5-dihydro-2-undecyl-1H-imidazole-1-ethanol and sodium hydro Acetic acid, 2-chloro-, sodium salt (1:1), reaction products with 4,5-dihydro-2-undecyl-1H-imidazole-1-ethanol and sodium hydroxide;Acetic acid, chloro-, sodium salt, reaction products with 4,5-dihydro-2-undecyl-1H-imidazole-1-ethanol and sodium hydroxide Acetic acid, 2-chloro-, sodium salt (1:1), reaction products with 4,5-dihydro-2-undecyl-1H-imidazole-1-ethanol and sodium hydroxide US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 1 0
196354 84144-89-8 Leach residues, molybdenum roasted ore, ammonium Leach residues, molybdenum roasted ore, ammonium SciFinder 0 1 1 SciFinder 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
214041 91050-89-4 Fatty acids, (C=8-10), triesters with trimethylolpropane 91050-89-4;Fatty acids, C8-10, triesters with trimethylolpropane Fatty acids, (C=8-10), triesters with trimethylolpropane VT_KR_NZ 0 0 1 From Name 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
40018 1419212-77-3 Amides, mixed C16-18 and C18-unsatd. branched and linear and tall-oil fatty, N,N'-(iminodi-2,1-ethanediyl)bis-, maleated Amides, mixed C16-18 and C18-unsatd. branched and linear and tall-oil fatty, N,N'-(iminodi-2,1-ethanediyl)bis-, maleated SciFinder 0 1 1 SciFinder 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
215361 91648-65-6 1,3,4-Thiadiazolidine-2,5-dithione, reaction products with hydrogen peroxide and tert-nonanethiol 1,3,4-Thiadiazolidine-2,5-dithione, reaction products with hydrogen peroxide and tert-nonanethiol VT_KR_NZ 0 0 1 From Name 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
47982 156558-98-4 Fatty acids, C6-12, mixed tetraesters with heptanoic acid, pentaerythritol, 3,5,5-trimethylhexanoic acid and valeric acid Fatty acids, C6-12, mixed tetraesters with heptanoic acid, pentaerythritol, 3,5,5-trimethylhexanoic acid and valeric acid SciFinder 0 1 1 SciFinder 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
219400 93164-85-3 Amines, C20-22-alkyldimethyl Amines, C20-22-alkyldimethyl SciFinder 0 1 1 SciFinder 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
82607 27262-39-1 Butanedioic acid, 2,3-bis(benzoyloxy)-, (2R,3R)-, compd. with (2S)-N-(2,6-dimethylphenyl)-2-piperidinecarboxamide (1:2) Butanedioic acid, 2,3-bis(benzoyloxy)-, (2R,3R)-, compd. with (2S)-N-(2,6-dimethylphenyl)-2-piperidinecarboxamide (1:2) SciFinder 0 0 1 From Name 0 0 0 0 0 1 0 InChIKey=CZNXJEWQIPSLGB-GAFBKUOOSA-N CZNXJEWQIPSLGB-GAFBKUOOSA-N Scifinder CC1=C(C(=CC=C1)C)NC(=O)[C@@H]2CCCCN2.CC1=C(C(=CC=C1)C)NC(=O)[C@@H]2CCCCN2.C1=CC=C(C=C1)C(=O)O[C@H]([C@H](C(=O)O)OC(=O)C2=CC=CC=C2)C(=O)O CC1=CC=CC(C)=C1NC(=O)[C@@H]1CCCCN1.CC1=CC=CC(C)=C1NC(=O)[C@@H]1CCCCN1.OC(=O)[C@H](OC(=O)C1=CC=CC=C1)[C@@H](OC(=O)C1=CC=CC=C1)C(O)=O CC1=C(C(=CC=C1)C)NC(=O)[C@@H]2CCCCN2.CC1=C(C(=CC=C1)C)NC(=O)[C@@H]2CCCCN2.C1=CC=C(C=C1)C(=O)O[C@H]([C@H](C(=O)O)OC(=O)C2=CC=CC=C2)C(=O)O Pubchem 0 0 1 0 0 1 0 0 0 0
145709 64741-57-7 Gas oils, petroleum, heavy vacuum Gas oils (petroleum), heavy vacuum Gas oils (petroleum), heavy vacuum Gas oils (petroleum), heavy vacuum Gas oils (petroleum), heavy vacuum;Gas oils, petroleum, heavy vacuum Gas oils (petroleum), heavy vacuum US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 FMMWHPNWAFZXNH-UHFFFAOYSA-N FMMWHPNWAFZXNH-UHFFFAOYSA-N OECD QSAR c1ccc2c(c1)cc1ccc3cccc4ccc2c1c34 c1ccc2c(c1)cc3ccc4cccc5ccc2c3c45 C1=CC=C2C(=C1)C=C1C=CC3=C4C(C=CC2=C14)=CC=C3 c1ccc2c(c1)cc1ccc3cccc4ccc2c1c34 OECD QSAR 0 0 1 0 0 1 0 0 0 0
155843 68140-41-0 2-amino-2-methylpropan-1-ol; (Z)-octadec-9-enoic acid 9-Octadecenoic acid (9Z)-, compd. with 2-amino-2-methyl-1-propanol (1:1) 9-Octadecenoic acid (9Z)-, compd. with 2-amino-2-methyl-1-propanol (1:1) 9-Octadecenoic acid (Z)-, compd. with 2-amino-2-methyl-1-propanol (1:1) 9-Octadecenoic acid (Z)-, compd. with 2-amino-2-methyl-1-propanol (1:1) 9-Octadecenoic acid (9Z)-, compd. with 2-amino-2-methyl-1-propanol (1:1) US TSCA 0 0 0 US TSCA 0 0 0 0 0 1 0 WCDXNKJYIXSLTE-KVVVOXFISA-N ZQPPMHVWECSIRJ-UHFFFAOYSA-N WCDXNKJYIXSLTE-KVVVOXFISA-N Cirpy InChI=1S/C18H34O2.C4H11NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4(2,5)3-6/h9-10H,2-8,11-17H2,1H3,(H,19,20);6H,3,5H2,1-2H3/b10-9-; InChI=1S/C18H34O2.C4H11NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4(2,5)3-6/h9-10H,2-8,11-17H2,1H3,(H,19,20);6H,3,5H2,1-2H3/b10-9-; Cirpy CCCCCCCCC=CCCCCCCCC(O)=O CC(C)(N)CO.CCCCCCCC\C=C/CCCCCCCC(O)=O CCCCCCCCC=CCCCCCCCC(O)=O QSAR 0 0 1 0 0 1 0 0 0 0
193231 82640-07-1 disodium; 3-amino-4-methoxybenzenesulfonate; copper; 3-hydroxyphenolate; 4-nitrobenzene-1,3-diamine Copper, complexes with diazotized 4-nitro-1,3-benzenediamine coupled with diazotized sodium 3-amino-4-methoxybenzenesulfonate (1:1) and resorcinol, sodium salts Copper, complexes with diazotized 3-amino-4-methoxybenzenesulfonic acid monosodium salt coupled with diazotized 4-nitro-1,3-benzenediamine and resorcinol, sodium salts;Copper, complexes with diazotized 4-nitro-1,3-benzenediamine coupled with diazotized sodium 3-amino-4-methoxybenzenesulfonate (1:1) and resorcinol, sodium salts Copper, complexes with diazotized 4-nitro-1,3-benzenediamine coupled with diazotized sodium 3-amino-4-methoxybenzenesulfonate (1:1) and resorcinol, sodium salts US TSCA 0 0 1 US TSCA 0 0 1 0 0 1 0 HJDUSPQCBUUNBC-UHFFFAOYSA-L HJDUSPQCBUUNBC-UHFFFAOYSA-L Cirpy InChI=1S/C7H9NO4S.C6H7N3O2.C6H6O2.Cu.2Na/c1-12-7-3-2-5(4-6(7)8)13(9,10)11;7-4-1-2-6(9(10)11)5(8)3-4;7-5-2-1-3-6(8)4-5;;;/h2-4H,8H2,1H3,(H,9,10,11);1-3H,7-8H2;1-4,7-8H;;;/q;;;;2*+1/p-2 InChI=1S/C7H9NO4S.C6H7N3O2.C6H6O2.Cu.2Na/c1-12-7-3-2-5(4-6(7)8)13(9,10)11;7-4-1-2-6(9(10)11)5(8)3-4;7-5-2-1-3-6(8)4-5;;;/h2-4H,8H2,1H3,(H,9,10,11);1-3H,7-8H2;1-4,7-8H;;;/q;;;;2*+1/p-2 Cirpy [Na+].[Na+].[Cu].OC1=CC=CC([O-])=C1.NC1=CC(N)=C(C=C1)[N+]([O-])=O.COC1=C(N)C=C(C=C1)S([O-])(=O)=O [Na+].[Na+].[Cu].OC1=CC=CC([O-])=C1.NC1=CC(N)=C(C=C1)[N+]([O-])=O.COC1=C(N)C=C(C=C1)S([O-])(=O)=O ClassyFire 0 0 1 0 0 1 0 0 0 0
153890 68002-88-0 (C16-C22)Alkylcarboxylic acid Fatty acids, C16-22 Fatty acids, (C=16-22) Fatty acids, C16-22 Fatty acids, C16-22 Fatty acids, C16-22 US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 ISYWECDDZWTKFF-UHFFFAOYSA-N QIQXTHQIDYTFRH-UHFFFAOYSA-N ISYWECDDZWTKFF-UHFFFAOYSA-N Cirpy InChI=1S/C19H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21/h2-18H2,1H3,(H,20,21) InChI=1S/C19H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21/h2-18H2,1H3,(H,20,21) Cirpy CCCCCCCCCCCCCCCCCC(O)=O CCCCCCCCCCCCCCCCCCC(O)=O CCCCCCCCCCCCCCCCCC(O)=O QSAR 0 0 1 0 0 1 0 0 0 0
170805 70225-05-7 1,2,4-Benzenetricarboxylic acid, branched tridecyl isodecyl 1,2,4-Benzenetricarboxylic acid, mixed branched tridecyl and isodecyl esters 1,2,4-Benzenetricarboxylic acid branched tridecyl isodecyl esters 1,2,4-Benzenetricarboxylic acid, mixed branched tridecyl and isodecyl esters 1,2,4-Benzenetricarboxylic acid, branched tridecyl isodecylesters;1,2,4-Benzenetricarboxylic acid, mixed branched tridecyl and isodecyl esters 1,2,4-Benzenetricarboxylic acid, mixed branched tridecyl and isodecyl esters US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 YNKHAYUWCVQHBA-UHFFFAOYSA-N WMSOLRJCRUXYJX-UHFFFAOYSA-N YNKHAYUWCVQHBA-UHFFFAOYSA-N Dashboard InChI=1S/C42H72O6/c1-6-7-8-9-10-11-12-13-14-19-24-31-46-40(43)37-29-30-38(41(44)47-32-25-20-15-17-22-27-35(2)3)39(34-37)42(45)48-33-26-21-16-18-23-28-36(4)5/h29-30,34-36H,6-28,31-33H2,1-5H3 InChI=1S/C42H72O6/c1-6-7-8-9-10-11-12-13-14-19-24-31-46-40(43)37-29-30-38(41(44)47-32-25-20-15-17-22-27-35(2)3)39(34-37)42(45)48-33-26-21-16-18-23-28-36(4)5/h29-30,34-36H,6-28,31-33H2,1-5H3 Dashboard CCCCCCCCCCCCCOC(=O)c1ccc(C(=O)OC(C)CCCCCCCC)c(c1)C(=O)OC(C)CCCCCCCC CCCCCCCCCCCCCOC(=O)C1=CC(C(=O)OCCCCCCCC(C)C)=C(C=C1)C(=O)OCCCCCCCC(C)C CCCCCCCCCCCCCOC(=O)c1ccc(C(=O)OC(C)CCCCCCCC)c(c1)C(=O)OC(C)CCCCCCCC QSAR 0 0 1 0 0 1 0 0 0 0
190302 8008-31-9 Oils, mandarin Oils, mandarin Oils, mandarin Mandarin oil;Oils, mandarin Oils, mandarin US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 XMGQYMWWDOXHJM-UHFFFAOYSA-N XMGQYMWWDOXHJM-UHFFFAOYSA-N OECD QSAR CC(=C)C1CCC(C)=CC1 CC(=C)C1CCC(=CC1)C CC(=C)C1CCC(C)=CC1 CC(=C)C1CCC(C)=CC1 OECD QSAR 0 0 1 0 0 1 0 0 0 0
165994 68919-10-8 Gases, petroleum, straight-run stabilizer off Gases (petroleum), straight-run stabilizer off Gases (petroleum), straight-run stabilizer off Gases (petroleum), straight-run stabilizer off Gases (petroleum), straight-run stabilizer off;Gases(petroleum),straightrunstabiliseroff,ifthey contain> 0,1% w/wButadiene;Gases, petroleum, straight run stabilizer off;Gases, petroleum, straight-run stabilizer off Gases (petroleum), straight-run stabilizer off US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 ATUOYWHBWRKTHZ-UHFFFAOYSA-N ATUOYWHBWRKTHZ-UHFFFAOYSA-N OECD QSAR CCC CCC CCC CCC OECD QSAR 0 0 1 0 0 1 0 0 0 0
157025 68227-46-3 2-Ethylhexyl ((3-((2-(dimethylamino)ethoxy)carbonyl)amino)-4-methylphenyl)carbamate, 2-hydroxy-propanoic acid salt Propanoic acid, 2-hydroxy-, compd. with 2-ethylhexyl N-[3-[[[2-(dimethylamino)ethoxy]carbonyl]amino]-4-methylphenyl]carbamate (1:1) 2-Hydroxypropanoic acid compd. with 3-[2-(dimethylamino)ethyl]-1-(2-ethylhexyl)(4-methyl-1,3-phenylene)bis[carbamate] (1:1) Propanoic acid, 2-hydroxy-, compd. with 3-[2-(dimethylamino)ethyl] 1-(2-ethylhexyl) (4-methyl-1,3-phenylene)bis[carbama 5-{[(2-ethylhexyl)carbamoyl]oxy}-2-methylphenyl [2-(dimethylamino)ethyl]carbamate (non-preferred name);Propanoic acid, 2-hydroxy-, compd. with 3-[2-(dimethylamino)ethyl] 1-(2-ethylhexyl) (4-methyl-1,3-phenylene)bis[carbamate] (1:1) Propanoic acid, 2-hydroxy-, compd. with 2-ethylhexyl N-[3-[[[2-(dimethylamino)ethoxy]carbonyl]amino]-4-methylphenyl]carbamate (1:1) US TSCA 0 0 0 US TSCA 0 0 0 0 0 1 0 HYNJGJWCXRMUIG-UHFFFAOYSA-N HYNJGJWCXRMUIG-UHFFFAOYSA-N FDGYTWXOPXMQGC-UHFFFAOYSA-N HYNJGJWCXRMUIG-UHFFFAOYSA-N Dashboard InChI=1S/C21H35N3O4.C3H6O3/c1-6-8-9-17(7-2)15-28-20(25)22-18-11-10-16(3)19(14-18)23-21(26)27-13-12-24(4)5;1-2(4)3(5)6/h10-11,14,17H,6-9,12-13,15H2,1-5H3,(H,22,25)(H,23,26);2,4H,1H3,(H,5,6) InChI=1S/C21H35N3O4.C3H6O3/c1-6-8-9-17(7-2)15-28-20(25)22-18-11-10-16(3)19(14-18)23-21(26)27-13-12-24(4)5;1-2(4)3(5)6/h10-11,14,17H,6-9,12-13,15H2,1-5H3,(H,22,25)(H,23,26);2,4H,1H3,(H,5,6) InChI=1S/C21H35N3O4.C3H6O3/c1-6-8-9-17(7-2)15-28-20(25)22-18-11-10-16(3)19(14-18)23-21(26)27-13-12-24(4)5;1-2(4)3(5)6/h10-11,14,17H,6-9,12-13,15H2,1-5H3,(H,22,25)(H,23,26);2,4H,1H3,(H,5,6) Cirpy CCCCC(CC)CNC(=O)Oc1ccc(C)c(OC(=O)NCCN(C)C)c1 CC(O)C(O)=O.CCCCC(CC)COC(=O)NC1=CC(NC(=O)OCCN(C)C)=C(C)C=C1 CCCCC(CC)CNC(=O)Oc1ccc(C)c(OC(=O)NCCN(C)C)c1 QSAR 0 0 1 0 0 1 0 0 0 0
162387 68585-78-4 Titanate(3-), [P,P-dioctyl diphosphato(2-)-.kappa.O'']bis[P,P-dioctyl diphosphato(2-)-.kappa.O'',.kappa.O''''](2-propanolato)-, hydrogen (1:3), branched and linear Trihydrogen tris[P,P-dioctyl diphosphato(2-)-O'',O''''](propan-2-olato)titanate(3-), branched and linear; Isopropyl tri(dioctyl pyrophosphato)titannate Titanate(3-), tris[P,P-dioctyl diphosphato(2-)-O��,O����](2-propanolato)-, trihydrogen, branched and linear;Titanate(3-), tris[P,P-dioctyl diphosphato(2-)-O'',O''''](2-propanolato)-, trihydrogen, branched and linear Titanate(3-), [P,P-dioctyl diphosphato(2-)-.kappa.O'']bis[P,P-dioctyl diphosphato(2-)-.kappa.O'',.kappa.O''''](2-propanolato)-, hydrogen (1:3), branched and linear US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 UMHKOAYRTRADAT-UHFFFAOYSA-N UMHKOAYRTRADAT-UHFFFAOYSA-N OECD QSAR CCCCCCCCOP(O)(=O)OP(O)(=O)OCCCCCCCC CCCCCCCCO[P](O)(=O)O[P](O)(=O)OCCCCCCCC CCCCCCCCOP(O)(=O)OP(O)(=O)OCCCCCCCC CCCCCCCCOP(O)(=O)OP(O)(=O)OCCCCCCCC OECD QSAR 0 0 1 0 0 1 0 0 0 0
166145 68920-66-1 Alcohols, C16-18 and C18-unsatd., ethoxylated Alcohols, C16-18 and C18-unsatd., ethoxylated Unsatd. (C=18) and (C=16-18) ethoxylated alcohols Alcohols, C16-18 and C18-unsatd., ethoxylated Alcohols, C16-18 and C18-unsatd., ethoxylated;Alcohols, C16-18 and C18-unsaturated, ethoxylated Alcohols, C16-18 and C18-unsatd., ethoxylated US TSCA 0 0 1 US TSCA 0 0 0 1 1 1 0 WBCCOWHDSAVXAO-AATRIKPKSA-N SWEFXDINXVCCPL-UHFFFAOYSA-N WBCCOWHDSAVXAO-AATRIKPKSA-N Cirpy InChI=1S/C20H40O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-4-2/h5-6H,3-4,7-20H2,1-2H3/b6-5+ InChI=1S/C20H40O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-4-2/h5-6H,3-4,7-20H2,1-2H3/b6-5+ Cirpy CCC=CCCCCCCCCCCCCCCOCCOCCOCCOCCOCCO CCOCCCCCCCCCCCCCC\C=C\CC CCC=CCCCCCCCCCCCCCCOCCOCCOCCOCCOCCO QSAR 0 0 1 0 0 1 0 0 0 0
76337 249630-78-2 6(or 7)-Ethylideneoctahydro-5,8-methano-2H-1-benzopyran-2-one 6(or 7)-Ethylideneoctahydro-5,8-methano-2H-1-benzopyran-2-one VT_KR_NZ 0 0 1 From Name 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
155503 68132-46-7 Fatty acids, tall-oil, compds. with triethanolamine Fatty acids, tall-oil, compds. with triethanolamine Fatty acids, tall oil compds. with triethanolamine Fatty acids, tall-oil, compds. with triethanolamine Fatty acids, tall-oil, compds. with triethanolamine Fatty acids, tall-oil, compds. with triethanolamine US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 ICLYJLBTOGPLMC-UHFFFAOYSA-N ICLYJLBTOGPLMC-UHFFFAOYSA-N OECD QSAR OCC[N+H](CCO)CCO.CCCCCCCCC=CCCCCCCCC([O-])=O CCCCCCCCC=CCCCCCCCC(O)=O.OCCN(CCO)CCO OCCN(CCO)CCO.CCCCCCCCC=CCCCCCCCC(O)=O OCC[N+H](CCO)CCO.CCCCCCCCC=CCCCCCCCC([O-])=O OECD QSAR 0 0 1 0 0 1 0 0 0 0
48528 157707-43-2 Alcohols, C8-18, ethoxylated Alcohols, C8-18, ethoxylated SciFinder 0 1 1 SciFinder 0 0 0 1 1 1 0 0 0 0 0 0 0 0 0 0 0
145805 64742-56-9 Distillates, petroleum, solvent-dewaxed light paraffinic Distillates (petroleum), solvent-dewaxed light paraffinic Distillates (petroleum), solvent-dewaxed light paraffinic Distillates (petroleum), solvent-dewaxed light paraffinic Distillates (petroleum), solvent-dewaxed light paraffinic;Distillates, petroleum, solvent dewaxed light paraffinic Distillates (petroleum), solvent-dewaxed light paraffinic US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 FMMWHPNWAFZXNH-UHFFFAOYSA-N FMMWHPNWAFZXNH-UHFFFAOYSA-N OECD QSAR c1ccc2c(c1)cc1ccc3cccc4ccc2c1c34 c1ccc2c(c1)cc3ccc4cccc5ccc2c3c45 C1=CC=C2C(=C1)C=C1C=CC3=C4C(C=CC2=C14)=CC=C3 c1ccc2c(c1)cc1ccc3cccc4ccc2c1c34 OECD QSAR 0 0 1 0 0 1 0 0 0 0
174566 71487-01-9 Quaternary ammonium compounds, dicoco alkyldimethyl, nitrites Quaternary ammonium compounds, dicoco alkyldimethyl, nitrites Quaternary ammonium compounds, dicoco alkyldimethyl, nitrites Quaternary ammonium compounds, dicoco alkyldimethyl, nitrites Quaternary ammonium compounds, dicoco alkyldimethyl, nitrites Quaternary ammonium compounds, dicoco alkyldimethyl, nitrites US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 BGEWTAMQKQEHCF-UHFFFAOYSA-M BGEWTAMQKQEHCF-UHFFFAOYSA-M OECD QSAR [O-]N=O.CCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCC CCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCC.[O-]N=O [O-]N=O.CCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCC [O-]N=O.CCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCC OECD QSAR 0 0 1 0 0 1 0 0 0 0
138775 61990-51-0 4-acetamidobenzoic acid; 1-dimethylaminopropan-2-ol 4-acetamidobenzoic acid, compound with 1-(dimethylamino)propan-2-ol (1:1) 4-acetamidobenzoic acid, compound with 1-(dimethylamino)propan-2-ol (1:1) OECD QSAR 0 0 0 0 0 0 0 0 1 0 FJFQBKRMSCKTSE-UHFFFAOYSA-N FJFQBKRMSCKTSE-UHFFFAOYSA-N FJFQBKRMSCKTSE-UHFFFAOYSA-N Cirpy InChI=1S/C9H9NO3.C5H13NO/c1-6(11)10-8-4-2-7(3-5-8)9(12)13;1-5(7)4-6(2)3/h2-5H,1H3,(H,10,11)(H,12,13);5,7H,4H2,1-3H3 InChI=1S/C9H9NO3.C5H13NO/c1-6(11)10-8-4-2-7(3-5-8)9(12)13;1-5(7)4-6(2)3/h2-5H,1H3,(H,10,11)(H,12,13);5,7H,4H2,1-3H3 Cirpy CC(O)CN(C)C.CC(=O)Nc1ccc(cc1)C(O)=O CC(O)CN(C)C.CC(=O)NC1=CC=C(C=C1)C(O)=O CC(O)CN(C)C.CC(=O)Nc1ccc(cc1)C(O)=O QSAR 0 0 1 0 0 1 0 0 0 0
160252 68477-90-7 Gases, petroleum, depropanizer dry, propene-rich Gases (petroleum), depropanizer dry, propene-rich Gases (petroleum), depropanizer dry, propene-rich Gases (petroleum), depropanizer dry, propene-rich Gases (petroleum), depropanizer dry, propene-rich;Gases(petroleum),depropaniserdry,propenerich,ifthey contain> 0,1%w/w Butadiene;Gases, petroleum, depropanizer dry, propene rich;Gases, petroleum, depropanizer dry, propene-rich Gases (petroleum), depropanizer dry, propene-rich US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 QQONPFPTGQHPMA-UHFFFAOYSA-N QQONPFPTGQHPMA-UHFFFAOYSA-N OECD QSAR CC=C CC=C CC=C CC=C OECD QSAR 0 0 1 0 0 1 0 0 0 0
217064 92045-12-0 Foots oil (petroleum), hydrotreated Footsoil(petroleum),hydrotreated,ifit contains>3%w/wDMSOextract Foots oil (petroleum), hydrotreated VT_KR_NZ 0 0 1 From Name 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
160969 68515-48-0 DINP branched 1,2-Benzenedicarboxylic acid, di-C8-10-branched alkyl esters, C9-rich Diisononyl phthalate 1,2-Benzenedicarboxylic acid, di-C8-10-branched alkyl esters, C9-rich 1,2-Benzenedicarboxylic acid, di-C8-10-branched alkyl esters, C9-rich 1,2-Benzenedicarboxylic acid, di-C8-10-branched alkyl esters, C9-rich US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 HBGGXOJOCNVPFY-UHFFFAOYSA-N DROMNWUQASBTFM-UHFFFAOYSA-N HBGGXOJOCNVPFY-UHFFFAOYSA-N Cirpy InChI=1S/C26H42O4/c1-21(2)15-9-5-7-13-19-29-25(27)23-17-11-12-18-24(23)26(28)30-20-14-8-6-10-16-22(3)4/h11-12,17-18,21-22H,5-10,13-16,19-20H2,1-4H3 InChI=1S/C26H42O4/c1-21(2)15-9-5-7-13-19-29-25(27)23-17-11-12-18-24(23)26(28)30-20-14-8-6-10-16-22(3)4/h11-12,17-18,21-22H,5-10,13-16,19-20H2,1-4H3 Cirpy CCCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCCC CC(C)CCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCC(C)C CCCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCCC QSAR 0 0 1 0 0 1 0 0 0 0
210339 90170-43-7 .beta.-Alanine, N-(2-carboxyethyl)-, N-coco alkyl derivs., disodium salts .beta.-Alanine, N-(2-carboxyethyl)-, N-coco alkyl derivs., disodium salts VT_KR_NZ 0 0 1 From Name 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
211506 90387-74-9 Glycine, N-coco acyl derivs., sodium salts Glycine, N-coco acyl derivs., sodium salts Glycine, N-coco acyl derivs., sodium salts VT_KR_NZ 0 0 1 From Name 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
14914 115100-55-5 Iron, complexes with diazotized 3-aminobenzenesulfonic acid coupled with diazotized 2-amino-5-nitrobenzenesulfonic acid, diazotized 2-[(4-aminophenyl)amino]-5-nitrobenzenesulfonic acid and 4-[2-(2-hydroxy-3,5-dinitrophenyl)diazenyl]-1,3-benzenediol, sodium salts Iron, complexes with diazotized 3-aminobenzenesulfonic acid coupled with diazotized 2-amino-5-nitrobenzenesulfonic acid, diazotized 2-[(4-aminophenyl)amino]-5-nitrobenzenesulfonic acid and 4-[(2-hydroxy-3,5-dinitrophenyl)azo]-1,3-benzenediol, sodium salts Iron, complexes with diazotized 3-aminobenzenesulfonic acid coupled with diazotized 2-amino-5-nitrobenzenesulfonic acid, diazotized 2-[(4-aminophenyl)amino]-5-nitrobenzenesulfonic acid and 4-[2-(2-hydroxy-3,5-dinitrophenyl)diazenyl]-1,3-benzenediol, sodium salts US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 VCLNFHGKMLASLG-UHFFFAOYSA-N VCLNFHGKMLASLG-UHFFFAOYSA-N OECD QSAR Oc1cc(O)c(cc1N=Nc1ccc(Nc2c(cc(cc2S(O)(=O)=O)[N+]([O-])=O)N=Nc2c(cc(cc2S(O)(=O)=O)[N+]([O-])=O)N=Nc2cccc(c2)S(O)(=O)=O)cc1)N=Nc1cc(cc(c1O)[N+]([O-])=O)[N+]([O-])=O Oc1cc(O)c(cc1N=Nc1ccc(Nc2c(cc(cc2S(O)(=O)=O)[N+]([O-])=O)N=Nc2c(cc(cc2S(O)(=O)=O)[N+]([O-])=O)N=Nc2cccc(c2)S(O)(=O)=O)cc1)N=Nc1cc(cc(c1O)[N+]([O-])=O)[N+]([O-])=O Oc1cc(O)c(cc1N=Nc1ccc(Nc2c(cc(cc2S(O)(=O)=O)[N+]([O-])=O)N=Nc2c(cc(cc2S(O)(=O)=O)[N+]([O-])=O)N=Nc2cccc(c2)S(O)(=O)=O)cc1)N=Nc1cc(cc(c1O)[N+]([O-])=O)[N+]([O-])=O OECD QSAR 0 0 1 0 0 1 0 0 0 0
200332 85116-93-4 Fatty acids, C16-18, esters with pentaerythritol Fatty acids, C16-18, esters with pentaerythritol Fatty acids, (C=16-18), esters with pentaerythritol Fatty acids, C16-18, esters with pentaerythritol Fatty acids, C16-18, esters with pentaerythritol US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
214585 91081-13-9 Rape oil, reaction products with diethylenetriamine Rape oil, reaction products with diethylenetriamine SciFinder 0 1 1 SciFinder 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
166845 68953-70-8 Oxirane, reaction products with ammonia, distn. residues Oxirane, reaction products with ammonia, distn. residues Oxirane, reaction products with ammonia, distn. residues Oxirane, reaction products with ammonia, distn. residues Oxirane, reaction products with ammonia, distillation residues;Oxirane, reaction products with ammonia, distn. residues Oxirane, reaction products with ammonia, distn. residues US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 HFGWIQJWHMUPCR-UHFFFAOYSA-N GSEJCLTVZPLZKY-UHFFFAOYSA-N HFGWIQJWHMUPCR-UHFFFAOYSA-N Cirpy InChI=1S/C2H4O.H3N/c1-2-3-1;/h1-2H2;1H3 InChI=1S/C2H4O.H3N/c1-2-3-1;/h1-2H2;1H3 Cirpy OCCN(CCO)CCO N.C1CO1 OCCN(CCO)CCO QSAR 0 0 1 0 0 1 0 0 0 0
160305 68478-46-6 boron(+3) cation; 2-(butoxymethyl)oxirane; phenylmethanamine; trifluoride Boron, (benzenemethanamine)trifluoro-, (T-4)-, reaction products with Bu glycidyl ether Boron, (T-4)-(benzenemethanamine)trifluoro- reaction products with Bu glycidyl ether Boron, (benzenemethanamine)trifluoro-, (T-4)-, reaction products with Bu glycidyl ether;Boron, (benzenemethanamine)trifluoro-, (T-4)-, reaction products with butyl glycidyl ether Boron, (benzenemethanamine)trifluoro-, (T-4)-, reaction products with Bu glycidyl ether US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 WGNQQFSCOSSLIS-UHFFFAOYSA-K WGNQQFSCOSSLIS-UHFFFAOYSA-K Cirpy InChI=1S/C7H9N.C7H14O2.B.3FH/c8-6-7-4-2-1-3-5-7;1-2-3-4-8-5-7-6-9-7;;;;/h1-5H,6,8H2;7H,2-6H2,1H3;;3*1H/q;;+3;;;/p-3 InChI=1S/C7H9N.C7H14O2.B.3FH/c8-6-7-4-2-1-3-5-7;1-2-3-4-8-5-7-6-9-7;;;;/h1-5H,6,8H2;7H,2-6H2,1H3;;3*1H/q;;+3;;;/p-3 Cirpy [B+3].[F-].[F-].[F-].NCC1=CC=CC=C1.CCCCOCC1CO1 [B+3].[F-].[F-].[F-].NCC1=CC=CC=C1.CCCCOCC1CO1 ClassyFire 0 0 1 0 0 1 1 0 0 0
154160 68037-01-4 1-Decene, homopolymer, hydrogenated 1-Decene, homopolymer, hydrogenated 1-Decene, homopolymer, hydrogenated 1-Decene, homopolymer, hydrogenated;68037-01-4;Dec-1-ene, homopolymer, hydrogenated Dec-1-ene, oligomers, hydrogenated;None available;Reaction products of 1-decene, hydrogenated 1-Decene, homopolymer, hydrogenated US TSCA 0 0 1 US TSCA 0 0 0 1 1 0 0 AFFLGGQVNFXPEV-UHFFFAOYSA-N AFFLGGQVNFXPEV-UHFFFAOYSA-N Cirpy CCCCCCCCC=C CCCCCCCCC=C CCCCCCCCC=C Cirpy 0 0 1 0 0 1 0 0 0 0
176385 71888-93-2 Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, 4-[2-(5-chloro-2-hydroxyphenyl)diazenyl]-4,5-dihydro-3-methyl-1-phenyl-3H-pyrazol-3-one 4,5-dihydro-4-[2-(2-hydroxy-5-nitrophenyl)diazenyl]-3-methyl-1-phenyl-3H-pyrazol-3-one 3-[2-[1-[[(2-ethylhexyl)amino]carbonyl]-2-oxopropyl]diazenyl]-2-hydroxy-5-nitrobenzoate cobaltate complexes Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, 4-[(5-chloro-2-hydroxyphenyl)azo]-4,5-dihydro-3-methyl-1-phenyl-3H-pyrazol-3-one 4,5-dihydro-4-[(2-hydroxy-5-nitrophenyl)azo]-3-methyl-1-phenyl-3H-pyrazol-3-one 3-[[1-[[(2-ethylhexyl)amino]carbonyl]-2-oxopropyl]azo]-2-hydroxy-5-nitrobenzoate cobaltate complexes Ethanaminium, N-[9-(2-carboxyphenyl)-6-(diethylamino)-3H-xanthen-3-ylidene]-N-ethyl-, 4-[(5-chloro-2-hydroxyphenyl)azo]-4,5-dihydro-3-methyl-1-phenyl-3H-pyrazol-3-one 4,5-dihydro-4-[(2-hydroxy-5-nitrophenyl)azo]-3-methyl-1-phenyl-3H-pyrazol-3-one 3-[[1-[[(2-ethylhexyl)amino]carbonyl]-2-oxopropyl]azo]-2-hydroxy-5-nitrobenzoate cobaltate complexes;Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, 4-[(5-chloro-2-hydroxyphenyl)azo]-4,5-dihydro-3-methyl-1-phenyl-3H-pyrazol-3-one 4,5-dihydro-4-[(2-hydroxy-5-nitrophenyl)azo]-3-methyl-1-phenyl-3H-pyrazol-3-one 3-[[1-[[(2-ethylhexyl)amino]carbonyl]-2-oxopropyl]azo]-2-hydroxy-5-nitrobenzoate cobaltate complexes;Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, 4-[2-(5-chloro-2-hydroxyphenyl)diazenyl]-4,5-dihydro-3-methyl-1-phenyl-3H-pyrazol-3-one 4,5-dihydro-4-[2-(2-hydroxy-5-nitrophenyl)diazenyl]-3-methyl-1-phenyl-3H-pyrazol-3-one 3-[2-[1-[[(2-ethylhexyl)amino]carbonyl]-2-oxopropyl]diazenyl]-2-hydroxy-5-nitrobenzoate cobaltate complexes Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, 4-[2-(5-chloro-2-hydroxyphenyl)diazenyl]-4,5-dihydro-3-methyl-1-phenyl-3H-pyrazol-3-one 4,5-dihydro-4-[2-(2-hydroxy-5-nitrophenyl)diazenyl]-3-methyl-1-phenyl-3H-pyrazol-3-one 3-[2-[1-[[(2-ethylhexyl)amino]carbonyl]-2-oxopropyl]diazenyl]-2-hydroxy-5-nitrobenzoate cobaltate complexes US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 1 0
168187 69012-32-4 Slags, phosphorus-manufg. Slags, phosphorus-manufg. Slags, phosphorus-manufg. Slags, phosphorus-manufg. US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
13634 113163-37-4 D-Glucitol, mixed esters with diethylene glycol and phthalic acid, propoxylated D-Glucitol, mixed esters with diethylene glycol and phthalic acid, propoxylated SciFinder 0 1 1 SciFinder 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
166224 68921-51-7 2-Butenedioic acid (2E)-, di-C12-18-alkyl esters 2-Butenedioic acid (2E)-, di-C12-18-alkyl esters (E)-2-Butenedioic acid dialkyl(C=12-18) esters 2-Butenedioic acid (E)-, di-C12-18-alkyl esters 2-Butenedioic acid (2E)-, di-C12-18-alkyl esters;2-Butenedioic acid (E)-, di-C12-18-alkyl esters 2-Butenedioic acid (2E)-, di-C12-18-alkyl esters US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 CUKXIDNDOQQWQN-QVIHXGFCSA-N CUKXIDNDOQQWQN-QVIHXGFCSA-N Cirpy InChI=1S/C34H64O4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-31-37-33(35)29-30-34(36)38-32-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h29-30H,3-28,31-32H2,1-2H3/b30-29+ InChI=1S/C34H64O4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-31-37-33(35)29-30-34(36)38-32-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h29-30H,3-28,31-32H2,1-2H3/b30-29+ Cirpy CCCCCCCCCCCCCCCOC(=O)\C=C\C(=O)OCCCCCCCCCCCCCCC CCCCCCCCCCCCCCCOC(=O)\C=C\C(=O)OCCCCCCCCCCCCCCC ClassyFire 0 0 1 0 0 1 0 0 0 0
163291 68611-71-2 Zinc sulfide (ZnS), silver chloride-doped Zinc sulfide (ZnS), silver chloride-doped Zinc sulfide (ZnS), silver chloride-doped Zinc sulfide (ZnS), silver chloride doped;Zinc sulfide (ZnS), silver chloride-doped Zinc sulfide (ZnS), silver chloride-doped US TSCA 0 0 1 US TSCA 0 1 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0
122491 53988-10-6 2-Mercaptomethylbenzimidazole 2H-Benzimidazole-2-thione, 1,3-dihydro-4(or 5)-methyl- 1,3-Dihydro-4(or 5)-methyl-2H-benzimidazole-2-thione 2H-Benzimidazole-2-thione, 1,3-dihydro-4(or 5)-methyl- 2H-Benzimidazole-2-thione, 1,3-dihydro-4(or 5)-methyl- 2H-Benzimidazole-2-thione, 1,3-dihydro-4(or 5)-methyl- US TSCA 0 0 0 US TSCA 0 0 0 0 0 1 0 UDQCDDZBBZNIFA-UHFFFAOYSA-N CWIYBOJLSWJGKV-UHFFFAOYSA-N UDQCDDZBBZNIFA-UHFFFAOYSA-N Cirpy InChI=1S/C8H8N2S/c1-5-3-2-4-6-7(5)10-8(11)9-6/h2-4H,1H3,(H2,9,10,11) InChI=1S/C8H8N2S/c1-5-3-2-4-6-7(5)10-8(11)9-6/h2-4H,1H3,(H2,9,10,11) Cirpy Cc1ccc2NC(=S)Nc2c1 CC1=C2NC(=S)NC2=CC=C1 Cc1ccc2NC(=S)Nc2c1 QSAR 0 0 1 0 0 1 0 0 0 0
190300 8008-20-6 Kerosine Kerosine (petroleum) Kerosine; Kerosene Kerosine (petroleum) Diesel 1; mixture of; boiling range: 124-312 deg C, aromatic content: 20.3 wt percent Kerosine (petroleum);Kerosine, petroleum Kerosine (petroleum) US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 SNRUBQQJIBEYMU-UHFFFAOYSA-N SNRUBQQJIBEYMU-UHFFFAOYSA-N OECD QSAR CCCCCCCCCCCC CCCCCCCCCCCC CCCCCCCCCCCC CCCCCCCCCCCC OECD QSAR 0 0 1 0 0 1 0 0 0 0
216891 91995-68-5 Extracts (petroleum), catalytic reformed light naphtha solvent Extracts (petroleum), catalytic reformed light naphtha solvent Extracts (petroleum), catalytic reformed light naphtha solvent VT_KR_NZ 0 0 1 From Name 0 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0
215867 91722-14-4 Soybean oil, epoxidized, acrylate Soybean oil, epoxidized, acrylate Soybean oil, epoxidized, acrylate C63H108O15;Not applicable;Not available for this UVCB;Reaction product of soybean oil, epoxidized and prop-2-enoic acid;Soybean oil, epoxidized, acrylate Soybean oil, epoxidized, acrylate US TSCA 0 0 1 US TSCA 0 0 0 0 1 0 1 0 0 0 0 0 0 0 0 0 0
2264 101316-66-9 Hydrocarbons, (C=6-8), hydrogenated sorption-dearomatized, toluene raffination Hydrocarbons, (C=6-8), hydrogenated sorption-dearomatized, toluene raffination VT_KR_NZ 0 0 1 From Name 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
105984 404362-22-7 1,3-Benzenedimethanamine, N-(2-phenylethyl) derivs. 1,3-Benzenedimethanamine, N-(2-phenylethyl) derivs. 1,3-Benzenedimethanamine, N-(2-phenylethyl) derivs. 1,3-Benzenedimethanamine, N-(2-phenylethyl) derivs. 1,3-Benzenedimethanamine, N-(2-phenylethyl) derivs. US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
85466 288094-79-1 1,1'-Bis[4-(alkyl(C=10~13)phenyl]iodonium hexafluoroantimonate(1-) 1,1'-Bis[4-(alkyl(C=10~13)phenyl]iodonium hexafluoroantimonate(1-) VT_KR_NZ 0 0 0 0 0 0 0 0 1 0 0 0 0 0 0 0 1 0 0 1
137671 61791-42-2 Sodium methyl cocoyl taurate Ethanesulfonic acid, 2-(methylamino)-, N-coco acyl derivs., sodium salts 2-(Methylamino)ethanesulfonic acid, N-coco acyl derivs., sodium salts Ethanesulfonic acid, 2-(methylamino)-, N-coco acyl derivs.,sodium salts Ethanesulfonic acid, 2-(methylamino)-, N-coco acyl derivatives, sodium salts;Ethanesulfonic acid, 2-(methylamino)-, N-coco acyl derivs., sodium salts Ethanesulfonic acid, 2-(methylamino)-, N-coco acyl derivs., sodium salts US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 KKDONKAYVYTWGY-UHFFFAOYSA-M CAVXVRQDZKMZDB-UHFFFAOYSA-M KKDONKAYVYTWGY-UHFFFAOYSA-M Cirpy InChI=1S/C3H9NO3S.Na/c1-4-2-3-8(5,6)7;/h4H,2-3H2,1H3,(H,5,6,7);/q;+1/p-1 InChI=1S/C3H9NO3S.Na/c1-4-2-3-8(5,6)7;/h4H,2-3H2,1H3,(H,5,6,7);/q;+1/p-1 Cirpy CCCCCCCCCCCC(=O)N(C)CCS(=O)(=O)O[Na] [Na+].CNCCS([O-])(=O)=O CCCCCCCCCCCC(=O)N(C)CCS(=O)(=O)O[Na] QSAR 0 0 1 0 0 1 0 0 0 0
190450 8015-73-4 Basil oil Oils, basil Oils, basil Oils, basil Thymus vulgaris, thyme, essential oil, Artibal, Sabinanigo, Spain Basil oil;Oils, basil Oils, basil US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 WEEGYLXZBRQIMU-UHFFFAOYSA-N WEEGYLXZBRQIMU-UHFFFAOYSA-N OECD QSAR CC12CCC(CC1)C(C)(C)O2 CC12CCC(CC1)C(C)(C)O2 CC12CCC(CC1)C(C)(C)O2 OECD QSAR 0 0 1 0 0 1 0 0 0 0
170317 70024-75-8 Decanoic acid, mixed esters with heptanoic acid, neopentyl glycol and octanoic acid Decanoic acid, mixed esters with heptanoic acid, neopentyl glycol and octanoic acid Decanoic acid, mixed esters with heptanoic acid, neopentyl glycol and octanoic acid Decanoic acid, mixed esters with heptanoic acid, neopentyl glycol and octanoic acid Decanoic acid, mixed esters with heptanoic acid, neopentyl glycol and octanoic acid US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 DMLCWDJJRZQNOT-UHFFFAOYSA-N DMLCWDJJRZQNOT-UHFFFAOYSA-N DMLCWDJJRZQNOT-UHFFFAOYSA-N Cirpy InChI=1S/C10H20O2.C8H16O2.C7H14O2.C5H12O2/c1-2-3-4-5-6-7-8-9-10(11)12;1-2-3-4-5-6-7-8(9)10;1-2-3-4-5-6-7(8)9;1-5(2,3-6)4-7/h2-9H2,1H3,(H,11,12);2-7H2,1H3,(H,9,10);2-6H2,1H3,(H,8,9);6-7H,3-4H2,1-2H3 InChI=1S/C10H20O2.C8H16O2.C7H14O2.C5H12O2/c1-2-3-4-5-6-7-8-9-10(11)12;1-2-3-4-5-6-7-8(9)10;1-2-3-4-5-6-7(8)9;1-5(2,3-6)4-7/h2-9H2,1H3,(H,11,12);2-7H2,1H3,(H,9,10);2-6H2,1H3,(H,8,9);6-7H,3-4H2,1-2H3 Cirpy CC(C)(CO)CO.CCCCCCCCCC(O)=O.CCCCCCC(O)=O.CCCCCCCC(O)=O CC(C)(CO)CO.CCCCCCC(O)=O.CCCCCCCC(O)=O.CCCCCCCCCC(O)=O CC(C)(CO)CO.CCCCCCCCCC(O)=O.CCCCCCC(O)=O.CCCCCCCC(O)=O QSAR 0 0 1 0 0 1 0 0 0 0
158362 68391-05-9 Quaternary ammonium compounds, di-C12-18-alkyldimethyl, chlorides Quaternary ammonium compounds, di-C12-18-alkyldimethyl, chlorides Quaternary ammonium compds. di(C=12-18) alkyldimethyl, chlorides Quaternary ammonium compounds, di-C12-18-alkyldimethyl, chlorides Quaternary ammonium compounds, di-C12-18-alkyldimethyl, chlorides Quaternary ammonium compounds, di-C12-18-alkyldimethyl, chlorides US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 RSHHCURRBLAGFA-UHFFFAOYSA-M RSHHCURRBLAGFA-UHFFFAOYSA-M Cirpy Cl-].CCCCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCCCC [Cl-].CCCCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCCCC Cl-].CCCCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCCCC Cirpy 0 0 1 0 0 1 0 0 0 0
226223 94166-87-7 Aluminum, benzoate C16-18-fatty acids complexes Aluminum, benzoate C16-18-fatty acids complexes Aluminum, benzoate C16-18-fatty acids complexes SMILECAS 0 0 1 From Name 0 0 1 0 0 1 0 GFZNJBXWENBRPD-UHFFFAOYSA-K GFZNJBXWENBRPD-UHFFFAOYSA-K OECD QSAR CCCCCCCCCCCCCCCCCC(=O)O[Al](OC(=O)CCCCCCCCCCCCCCC)OC(=O)c1ccccc1 CCCCCCCCCCCCCCCCCC(=O)O[Al](OC(=O)CCCCCCCCCCCCCCC)OC(=O)c1ccccc1 CCCCCCCCCCCCCCCCCC(=O)O[Al](OC(=O)CCCCCCCCCCCCCCC)OC(=O)c1ccccc1 OECD QSAR 0 0 1 0 0 1 0 0 0 0
145842 64742-95-6 Light aromatic solvent naphtha (petroleum) Solvent naphtha (petroleum), light arom. Solvent naphtha (petroleum), light arom. Solvent naphtha (petroleum), light arom. Solvent naphtha (petroleum), light arom.;Solvent naphtha, petroleum, light aromatic Solvent naphtha (petroleum), light arom. US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 UFWIBTONFRDIAS-UHFFFAOYSA-N UFWIBTONFRDIAS-UHFFFAOYSA-N OECD QSAR c1ccc2ccccc2c1 c1ccc2ccccc2c1 C1=CC2=CC=CC=C2C=C1 c1ccc2ccccc2c1 OECD QSAR 0 0 1 0 0 1 0 0 0 0
145721 64741-69-1 Naphtha, petroleum, light hydrocracked Naphtha (petroleum), light hydrocracked Naphtha (petroleum), light hydrocracked Naphtha (petroleum), light hydrocracked Naphtha (petroleum), light hydrocracked;Naphtha, petroleum, light hydrocracked Naphtha (petroleum), light hydrocracked US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 IMNFDUFMRHMDMM-UHFFFAOYSA-N IMNFDUFMRHMDMM-UHFFFAOYSA-N OECD QSAR CCCCCCC CCCCCCC CCCCCCC CCCCCCC OECD QSAR 0 0 1 0 0 1 0 0 0 0
155476 68132-19-4 Polyphosphoric acids, compds. with ethoxylated coco alkylamines Polyphosphoric acids, compds. with ethoxylated coco alkylamines polyphosphoric acids, compds. with ethoxylated coco alkylamines Polyphosphoric acids, compds. with ethoxylated coco alkylamines US TSCA 0 0 1 US TSCA 0 0 0 1 1 1 0 0 0 0 0 0 0 0 0 0 0
178217 72480-18-3 Phenol, 4,4'-(1-methylethylidene)bis-, polymer with 2-(chloromethyl)oxirane, reaction products with ethylenediamine Phenol, 4,4'-(1-methylethylidene)bis-, polymer with 2-(chloromethyl)oxirane, reaction products with ethylenediamine 4,4'-(1-Methylethylidene)bisphenol polymer with (chloromethyl)oxirane, reaction products with ethylenediamine 4,4'-Isopropylidenediphenol, oligomeric reaction products with 1-chloro-2,3-epoxypropane, reaction products with ethylenediamine;Phenol, 4,4'-(1-methylethylidene)bis-, polymer with (chloromethyl)oxirane, reaction products with ethylenediamine;Phenol, 4,4'-(1-methylethylidene)bis-, polymer with 2-(chloromethyl)oxirane, reaction products with ethylenediamine Phenol, 4,4'-(1-methylethylidene)bis-, polymer with 2-(chloromethyl)oxirane, reaction products with ethylenediamine US TSCA 0 0 1 US TSCA 0 0 0 1 1 1 0 0 0 0 0 0 0 0 0 1 0
223083 93924-19-7 Ashes (residues), cenospheres Ashes (residues), cenospheres VT_KR_NZ 0 0 1 From Name 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
160218 68477-53-2 Distillates, petroleum, steam-cracked, C5-12 fraction Distillates (petroleum), steam-cracked, C5-12 fraction Distillates (petroleum), steam-cracked, (C=5-12) fraction Distillates (petroleum), steam-cracked, C5-12 fraction US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
229642 95465-91-1 Hydrocarbons, C4, butane conc., n-butene-contg. Hydrocarbons, C4, butane conc., n-butene-contg. Hydrocarbons, C4, butane conc., n-butene-contg. SciFinder 0 1 1 SciFinder 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
163021 68608-82-2 Benzene, ethylenated, by-products from Benzene, ethylenated, by-products from Benzene, ethylenated, by-products from Benzene, ethylenated, by-products from Benzene, ethylenated, by-products from Benzene, ethylenated, by-products from US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 KVNYFPKFSJIPBJ-UHFFFAOYSA-N KVNYFPKFSJIPBJ-UHFFFAOYSA-N OECD QSAR CCc1ccccc1CC CCc1ccccc1CC CCc1ccccc1CC CCc1ccccc1CC OECD QSAR 0 0 1 0 0 1 0 0 0 0
2265 101316-67-0 Hydrocarbons, (C=6)-rich, hydrotreated light naphtha distillates, solvent-refined Hydrocarbons, (C=6)-rich, hydrotreated light naphtha distillates, solvent-refined VT_KR_NZ 0 0 1 From Name 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
183258 74869-22-0 Lubricating oils Lubricating oils Lubricating oils Lubricating oils VT_KR_NZ 0 0 1 From Name 0 0 0 0 0 1 0 GGYKPYDKXLHNTI-UHFFFAOYSA-N GGYKPYDKXLHNTI-UHFFFAOYSA-N OECD QSAR CCC(C)CCCC(C)CCCC(C)CCCC(C)C CCC(C)CCCC(C)CCCC(C)CCCC(C)C CCC(C)CCCC(C)CCCC(C)CCCC(C)C CCC(C)CCCC(C)CCCC(C)CCCC(C)C OECD QSAR 0 0 1 0 0 1 0 0 0 0