From c85a6a298718e76ebf2f6e6f6e868440e699b55b Mon Sep 17 00:00:00 2001 From: Jed Cunningham Date: Tue, 18 Jun 2024 18:18:37 -0600 Subject: [PATCH] Add documentation for Apache Airflow Helm Chart 1.14.0 --- docs-archive/helm-chart/1.14.0/.buildinfo | 4 + .../helm-chart/1.14.0/_images/helm-logo.svg | 28 + .../adding-connections-and-variables.rst.txt | 85 + .../_sources/airflow-configuration.rst.txt | 41 + .../_sources/customizing-workers.rst.txt | 68 + .../_sources/extending-the-chart.rst.txt | 124 + .../helm-chart/1.14.0/_sources/index.rst.txt | 186 + ...installing-helm-chart-from-sources.rst.txt | 129 + .../helm-chart/1.14.0/_sources/keda.rst.txt | 71 + .../1.14.0/_sources/manage-dags-files.rst.txt | 277 + .../1.14.0/_sources/manage-logs.rst.txt | 92 + .../1.14.0/_sources/parameters-ref.rst.txt | 63 + .../1.14.0/_sources/production-guide.rst.txt | 577 + .../1.14.0/_sources/quick-start.rst.txt | 224 + .../1.14.0/_sources/release_notes.rst.txt | 23 + .../setting-resources-for-containers.rst.txt | 70 + .../using-additional-containers.rst.txt | 64 + ...e.1e8bd061cd6da7fc9cf755528e8ffc24.min.css | 1 + .../_sphinx_design_static/design-tabs.js | 27 + .../_static/_gen/css/main-custom.min.css | 1 + .../1.14.0/_static/_gen/css/main.min.css | 7 + .../helm-chart/1.14.0/_static/_gen/js/docs.js | 1 + .../_sphinx_javascript_frameworks_compat.js | 134 + .../helm-chart/1.14.0/_static/basic.css | 899 ++ .../helm-chart/1.14.0/_static/check-solid.svg | 4 + .../1.14.0/_static/clipboard.min.js | 7 + .../helm-chart/1.14.0/_static/copy-button.svg | 5 + .../helm-chart/1.14.0/_static/copybutton.css | 94 + .../helm-chart/1.14.0/_static/copybutton.js | 248 + .../1.14.0/_static/copybutton_funcs.js | 73 + .../helm-chart/1.14.0/_static/custom.css | 33 + ...e.1e8bd061cd6da7fc9cf755528e8ffc24.min.css | 1 + .../helm-chart/1.14.0/_static/design-tabs.js | 27 + .../helm-chart/1.14.0/_static/doctools.js | 156 + .../1.14.0/_static/documentation_options.js | 14 + .../helm-chart/1.14.0/_static/file.png | Bin 0 -> 286 bytes .../1.14.0/_static/gh-jira-links.js | 34 + .../helm-chart/1.14.0/_static/jquery-3.6.0.js | 10881 ++++++++++++++++ .../helm-chart/1.14.0/_static/jquery.js | 2 + .../helm-chart/1.14.0/_static/js/globaltoc.js | 24 + .../1.14.0/_static/language_data.js | 199 + .../helm-chart/1.14.0/_static/minus.png | Bin 0 -> 90 bytes .../helm-chart/1.14.0/_static/pin_32.png | Bin 0 -> 1201 bytes .../helm-chart/1.14.0/_static/plus.png | Bin 0 -> 90 bytes .../helm-chart/1.14.0/_static/pygments.css | 75 + .../helm-chart/1.14.0/_static/searchtools.js | 566 + .../1.14.0/_static/sphinx_highlight.js | 144 + .../1.14.0/_static/underscore-1.13.1.js | 2042 +++ .../helm-chart/1.14.0/_static/underscore.js | 6 + .../adding-connections-and-variables.html | 924 ++ .../1.14.0/airflow-configuration.html | 874 ++ docs-archive/helm-chart/1.14.0/changelog.html | 1 + .../1.14.0/customizing-workers.html | 905 ++ .../1.14.0/extending-the-chart.html | 960 ++ docs-archive/helm-chart/1.14.0/genindex.html | 846 ++ docs-archive/helm-chart/1.14.0/index.html | 987 ++ .../installing-helm-chart-from-sources.html | 945 ++ docs-archive/helm-chart/1.14.0/keda.html | 900 ++ .../helm-chart/1.14.0/manage-dags-files.html | 1104 ++ .../helm-chart/1.14.0/manage-logs.html | 935 ++ docs-archive/helm-chart/1.14.0/objects.inv | Bin 0 -> 904 bytes ...e.1e8bd061cd6da7fc9cf755528e8ffc24.min.css | 1 + .../_sphinx_design_static/design-tabs.js | 27 + .../helm-chart/1.14.0/parameters-ref.html | 5516 ++++++++ .../helm-chart/1.14.0/production-guide.html | 1470 +++ .../helm-chart/1.14.0/quick-start.html | 1094 ++ .../helm-chart/1.14.0/release_notes.html | 2556 ++++ docs-archive/helm-chart/1.14.0/search.html | 875 ++ docs-archive/helm-chart/1.14.0/searchindex.js | 1 + .../setting-resources-for-containers.html | 914 ++ docs-archive/helm-chart/1.14.0/updating.html | 1 + .../1.14.0/using-additional-containers.html | 906 ++ docs-archive/helm-chart/stable.txt | 2 +- landing-pages/site/static/index.yaml | 157 +- 74 files changed, 40729 insertions(+), 3 deletions(-) create mode 100644 docs-archive/helm-chart/1.14.0/.buildinfo create mode 100644 docs-archive/helm-chart/1.14.0/_images/helm-logo.svg create mode 100644 docs-archive/helm-chart/1.14.0/_sources/adding-connections-and-variables.rst.txt create mode 100644 docs-archive/helm-chart/1.14.0/_sources/airflow-configuration.rst.txt create mode 100644 docs-archive/helm-chart/1.14.0/_sources/customizing-workers.rst.txt create mode 100644 docs-archive/helm-chart/1.14.0/_sources/extending-the-chart.rst.txt create mode 100644 docs-archive/helm-chart/1.14.0/_sources/index.rst.txt create mode 100644 docs-archive/helm-chart/1.14.0/_sources/installing-helm-chart-from-sources.rst.txt create mode 100644 docs-archive/helm-chart/1.14.0/_sources/keda.rst.txt create mode 100644 docs-archive/helm-chart/1.14.0/_sources/manage-dags-files.rst.txt create mode 100644 docs-archive/helm-chart/1.14.0/_sources/manage-logs.rst.txt create mode 100644 docs-archive/helm-chart/1.14.0/_sources/parameters-ref.rst.txt create mode 100644 docs-archive/helm-chart/1.14.0/_sources/production-guide.rst.txt create mode 100644 docs-archive/helm-chart/1.14.0/_sources/quick-start.rst.txt create mode 100644 docs-archive/helm-chart/1.14.0/_sources/release_notes.rst.txt create mode 100644 docs-archive/helm-chart/1.14.0/_sources/setting-resources-for-containers.rst.txt create mode 100644 docs-archive/helm-chart/1.14.0/_sources/using-additional-containers.rst.txt create mode 100644 docs-archive/helm-chart/1.14.0/_sphinx_design_static/design-style.1e8bd061cd6da7fc9cf755528e8ffc24.min.css create mode 100644 docs-archive/helm-chart/1.14.0/_sphinx_design_static/design-tabs.js create mode 100644 docs-archive/helm-chart/1.14.0/_static/_gen/css/main-custom.min.css create mode 100644 docs-archive/helm-chart/1.14.0/_static/_gen/css/main.min.css create mode 100644 docs-archive/helm-chart/1.14.0/_static/_gen/js/docs.js create mode 100644 docs-archive/helm-chart/1.14.0/_static/_sphinx_javascript_frameworks_compat.js create mode 100644 docs-archive/helm-chart/1.14.0/_static/basic.css create mode 100644 docs-archive/helm-chart/1.14.0/_static/check-solid.svg create mode 100644 docs-archive/helm-chart/1.14.0/_static/clipboard.min.js create mode 100644 docs-archive/helm-chart/1.14.0/_static/copy-button.svg create mode 100644 docs-archive/helm-chart/1.14.0/_static/copybutton.css create mode 100644 docs-archive/helm-chart/1.14.0/_static/copybutton.js create mode 100644 docs-archive/helm-chart/1.14.0/_static/copybutton_funcs.js create mode 100644 docs-archive/helm-chart/1.14.0/_static/custom.css create mode 100644 docs-archive/helm-chart/1.14.0/_static/design-style.1e8bd061cd6da7fc9cf755528e8ffc24.min.css create mode 100644 docs-archive/helm-chart/1.14.0/_static/design-tabs.js create mode 100644 docs-archive/helm-chart/1.14.0/_static/doctools.js create mode 100644 docs-archive/helm-chart/1.14.0/_static/documentation_options.js create mode 100644 docs-archive/helm-chart/1.14.0/_static/file.png create mode 100644 docs-archive/helm-chart/1.14.0/_static/gh-jira-links.js create mode 100644 docs-archive/helm-chart/1.14.0/_static/jquery-3.6.0.js create mode 100644 docs-archive/helm-chart/1.14.0/_static/jquery.js create mode 100644 docs-archive/helm-chart/1.14.0/_static/js/globaltoc.js create mode 100644 docs-archive/helm-chart/1.14.0/_static/language_data.js create mode 100644 docs-archive/helm-chart/1.14.0/_static/minus.png create mode 100644 docs-archive/helm-chart/1.14.0/_static/pin_32.png create mode 100644 docs-archive/helm-chart/1.14.0/_static/plus.png create mode 100644 docs-archive/helm-chart/1.14.0/_static/pygments.css create mode 100644 docs-archive/helm-chart/1.14.0/_static/searchtools.js create mode 100644 docs-archive/helm-chart/1.14.0/_static/sphinx_highlight.js create mode 100644 docs-archive/helm-chart/1.14.0/_static/underscore-1.13.1.js create mode 100644 docs-archive/helm-chart/1.14.0/_static/underscore.js create mode 100644 docs-archive/helm-chart/1.14.0/adding-connections-and-variables.html create mode 100644 docs-archive/helm-chart/1.14.0/airflow-configuration.html create mode 100644 docs-archive/helm-chart/1.14.0/changelog.html create mode 100644 docs-archive/helm-chart/1.14.0/customizing-workers.html create mode 100644 docs-archive/helm-chart/1.14.0/extending-the-chart.html create mode 100644 docs-archive/helm-chart/1.14.0/genindex.html create mode 100644 docs-archive/helm-chart/1.14.0/index.html create mode 100644 docs-archive/helm-chart/1.14.0/installing-helm-chart-from-sources.html create mode 100644 docs-archive/helm-chart/1.14.0/keda.html create mode 100644 docs-archive/helm-chart/1.14.0/manage-dags-files.html create mode 100644 docs-archive/helm-chart/1.14.0/manage-logs.html create mode 100644 docs-archive/helm-chart/1.14.0/objects.inv create mode 100644 docs-archive/helm-chart/1.14.0/output-spelling-results-helm-chart/_sphinx_design_static/design-style.1e8bd061cd6da7fc9cf755528e8ffc24.min.css create mode 100644 docs-archive/helm-chart/1.14.0/output-spelling-results-helm-chart/_sphinx_design_static/design-tabs.js create mode 100644 docs-archive/helm-chart/1.14.0/parameters-ref.html create mode 100644 docs-archive/helm-chart/1.14.0/production-guide.html create mode 100644 docs-archive/helm-chart/1.14.0/quick-start.html create mode 100644 docs-archive/helm-chart/1.14.0/release_notes.html create mode 100644 docs-archive/helm-chart/1.14.0/search.html create mode 100644 docs-archive/helm-chart/1.14.0/searchindex.js create mode 100644 docs-archive/helm-chart/1.14.0/setting-resources-for-containers.html create mode 100644 docs-archive/helm-chart/1.14.0/updating.html create mode 100644 docs-archive/helm-chart/1.14.0/using-additional-containers.html diff --git a/docs-archive/helm-chart/1.14.0/.buildinfo b/docs-archive/helm-chart/1.14.0/.buildinfo new file mode 100644 index 00000000000..c09c2416303 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/.buildinfo @@ -0,0 +1,4 @@ +# Sphinx build info version 1 +# This file hashes the configuration used when building these files. When it is not found, a full rebuild will be done. +config: 056258ab2cdd715d555b535014a5087c +tags: 645f666f9bcd5a90fca523b33c5a78b7 diff --git a/docs-archive/helm-chart/1.14.0/_images/helm-logo.svg b/docs-archive/helm-chart/1.14.0/_images/helm-logo.svg new file mode 100644 index 00000000000..1e2db8a2e6e --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_images/helm-logo.svg @@ -0,0 +1,28 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/docs-archive/helm-chart/1.14.0/_sources/adding-connections-and-variables.rst.txt b/docs-archive/helm-chart/1.14.0/_sources/adding-connections-and-variables.rst.txt new file mode 100644 index 00000000000..65e0e9c4b6c --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_sources/adding-connections-and-variables.rst.txt @@ -0,0 +1,85 @@ + .. Licensed to the Apache Software Foundation (ASF) under one + or more contributor license agreements. See the NOTICE file + distributed with this work for additional information + regarding copyright ownership. The ASF licenses this file + to you under the Apache License, Version 2.0 (the + "License"); you may not use this file except in compliance + with the License. You may obtain a copy of the License at + + .. http://www.apache.org/licenses/LICENSE-2.0 + + .. Unless required by applicable law or agreed to in writing, + software distributed under the License is distributed on an + "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY + KIND, either express or implied. See the License for the + specific language governing permissions and limitations + under the License. + + +Adding Connections, Variables and Environment Variables +======================================================= + +You can programmatically add Connections, Variables and arbitrary Environment Variables to your +Airflow deployment using the Helm chart. + + +Connections and Sensitive Environment Variables +----------------------------------------------- +Under the ``secret`` and ``extraSecret`` sections of the ``values.yaml`` you can pass connection strings and sensitive +environment variables into Airflow using the Helm chart. To illustrate, lets create a yaml file called ``override.yaml`` +to override values under these sections of the ``values.yaml`` file. + +.. code-block:: yaml + + # override.yaml + + secret: + - envName: "AIRFLOW_CONN_GCP" + secretName: "my-airflow-connections" + secretKey: "AIRFLOW_CONN_GCP" + - envName: "my-env" + secretName: "my-secret-name" + secretKey: "my-secret-key" + + extraSecrets: + my-airflow-connections: + data: | + AIRFLOW_CONN_GCP: 'base64_encoded_gcp_conn_string' + my-secret-name: + stringData: | + my-secret-key: my-secret + + +Variables +--------- +Airflow supports Variables which enable users to craft dynamic DAGs. You can set Variables in Airflow in three ways - UI, +command line, and within your DAG file. See :doc:`apache-airflow:howto/variable` for more. + +With the Helm chart, you can also inject environment variables into Airflow. So in the example ``override.yaml`` file, +we can override values of interest in the ``env`` section of the ``values.yaml`` file. + +.. code-block:: yaml + + env: + - name: "AIRFLOW_VAR_KEY" + value: "value_1" + - name: "AIRFLOW_VAR_ANOTHER_KEY" + value: "value_2" + + +You can also utilize ``extraEnv`` and ``extraEnvFrom`` if you need the name or value to be templated. + +.. code-block:: yaml + + extraEnv: | + - name: AIRFLOW_VAR_HELM_RELEASE_NAME + value: '{{ .Release.Name }}' + + extraEnvFrom: | + - configMapRef: + name: '{{ .Release.Name }}-airflow-variables' + + extraConfigMaps: + '{{ .Release.Name }}-airflow-variables': + data: | + AIRFLOW_VAR_HELLO_MESSAGE: "Hi!" diff --git a/docs-archive/helm-chart/1.14.0/_sources/airflow-configuration.rst.txt b/docs-archive/helm-chart/1.14.0/_sources/airflow-configuration.rst.txt new file mode 100644 index 00000000000..97aae726c13 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_sources/airflow-configuration.rst.txt @@ -0,0 +1,41 @@ + .. Licensed to the Apache Software Foundation (ASF) under one + or more contributor license agreements. See the NOTICE file + distributed with this work for additional information + regarding copyright ownership. The ASF licenses this file + to you under the Apache License, Version 2.0 (the + "License"); you may not use this file except in compliance + with the License. You may obtain a copy of the License at + + .. http://www.apache.org/licenses/LICENSE-2.0 + + .. Unless required by applicable law or agreed to in writing, + software distributed under the License is distributed on an + "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY + KIND, either express or implied. See the License for the + specific language governing permissions and limitations + under the License. + +Configuring Airflow +------------------- + +The chart allows for setting arbitrary Airflow configuration in values under the ``config`` key. +Some of the defaults in the chart differ from those of core Airflow and can be found in +`values.yaml `__. + +As an example of setting arbitrary configuration, the following yaml demonstrates how one would +allow webserver users to view the config from within the UI: + +.. code-block:: yaml + + config: + webserver: + expose_config: 'True' # by default this is 'False' + +Generally speaking, it is useful to familiarize oneself with the Airflow +configuration prior to installing and deploying the service. + +.. note:: + + The recommended way to load example DAGs using the official Docker image and chart is to configure the ``AIRFLOW__CORE__LOAD_EXAMPLES`` environment variable + in ``extraEnv`` (see :doc:`Parameters reference `). The official Docker image has ``AIRFLOW__CORE__LOAD_EXAMPLES=False`` + set within the image, so you need to override it with an environment variable when deploying the chart in order for the examples to be present. diff --git a/docs-archive/helm-chart/1.14.0/_sources/customizing-workers.rst.txt b/docs-archive/helm-chart/1.14.0/_sources/customizing-workers.rst.txt new file mode 100644 index 00000000000..8c934bd319f --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_sources/customizing-workers.rst.txt @@ -0,0 +1,68 @@ + .. Licensed to the Apache Software Foundation (ASF) under one + or more contributor license agreements. See the NOTICE file + distributed with this work for additional information + regarding copyright ownership. The ASF licenses this file + to you under the Apache License, Version 2.0 (the + "License"); you may not use this file except in compliance + with the License. You may obtain a copy of the License at + + .. http://www.apache.org/licenses/LICENSE-2.0 + + .. Unless required by applicable law or agreed to in writing, + software distributed under the License is distributed on an + "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY + KIND, either express or implied. See the License for the + specific language governing permissions and limitations + under the License. + +Customizing Workers +=================== + +Both ``CeleryExecutor`` and ``KubernetesExecutor`` workers can be highly customized with the :ref:`workers parameters `. +For example, to set resources on workers: + +.. code-block:: yaml + + workers: + resources: + requests: + cpu: 1 + limits: + cpu: 1 + +See :ref:`workers parameters ` for a complete list. + +One notable exception for ``KubernetesExecutor`` is that the default anti-affinity applied to ``CeleryExecutor`` workers to spread them across nodes +is not applied to ``KubernetesExecutor`` workers, as there is no reason to spread out per-task workers. + +Custom ``pod_template_file`` +---------------------------- + +With ``KubernetesExecutor`` or ``CeleryKubernetesExecutor`` you can also provide a complete ``pod_template_file`` to configure Kubernetes workers. +This may be useful if you need different configuration between worker types for ``CeleryKubernetesExecutor`` +or if you need to customize something not possible with :ref:`workers parameters ` alone. + +As an example, let's say you want to set ``priorityClassName`` on your workers: + +.. note:: + + The following example is NOT functional, but meant to be illustrative of how you can provide a custom ``pod_template_file``. + You're better off starting with the `default pod_template_file`_ instead. + +.. _default pod_template_file: https://github.com/apache/airflow/blob/main/chart/files/pod-template-file.kubernetes-helm-yaml + +.. code-block:: yaml + + podTemplate: | + apiVersion: v1 + kind: Pod + metadata: + name: placeholder-name + labels: + tier: airflow + component: worker + release: {{ .Release.Name }} + spec: + priorityClassName: high-priority + containers: + - name: base diff --git a/docs-archive/helm-chart/1.14.0/_sources/extending-the-chart.rst.txt b/docs-archive/helm-chart/1.14.0/_sources/extending-the-chart.rst.txt new file mode 100644 index 00000000000..209b6db4d40 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_sources/extending-the-chart.rst.txt @@ -0,0 +1,124 @@ + .. Licensed to the Apache Software Foundation (ASF) under one + or more contributor license agreements. See the NOTICE file + distributed with this work for additional information + regarding copyright ownership. The ASF licenses this file + to you under the Apache License, Version 2.0 (the + "License"); you may not use this file except in compliance + with the License. You may obtain a copy of the License at + + .. http://www.apache.org/licenses/LICENSE-2.0 + + .. Unless required by applicable law or agreed to in writing, + software distributed under the License is distributed on an + "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY + KIND, either express or implied. See the License for the + specific language governing permissions and limitations + under the License. + +Extending the Chart +------------------- + +In some cases, you will want to deploy your custom templates (e.g. maintenance CronJobs you want to add) +together with the Airflow chart installation. +However, sometimes those templates are not directly related to the Airflow chart, +thus should not be added to the chart. + +Instead, you can easily extend the chart and create a custom chart with your custom templates that +depends on the Airflow chart. +When you'll install your custom chart, the Airflow chart will also be installed. + +You can extend the official Airflow chart by applying the following steps. + +Create your custom Chart +''''''''''''''''''''''''' + +First, you will need to create you own chart directory. You can do it by running the following command: + +.. code-block:: bash + + helm create my-custom-chart + + +This command will create a directory called ``my-custom-chart`` with the following structure: + +.. code-block:: + + my-custom-chart/ + ├── .helmignore + ├── Chart.yaml + ├── values.yaml + ├── charts/ + └── templates/ + └── tests/ + +Add Airflow chart as dependency +''''''''''''''''''''''''''''''' + +Second, you will need to add the Airflow chart as dependency to your chart. +This will give you the ability to add your custom templates without the need to modify the Airflow chart itself. +In order to add the Airflow chart as a dependency (often called ``subcharts``) to your chart, +add the following lines to your ``Chart.yaml`` file: + +.. code-block:: + + dependencies: + - name: airflow + version: 1.11.0 + repository: https://airflow.apache.org + +.. note:: + + Make sure you have already added the Airflow repo locally by running: ``helm repo add apache-airflow https://airflow.apache.org``. + +.. tip:: + + You can also use the name of the repo instead of the URL by replacing + ``https://airflow.apache.org`` with ``"@apache-airflow"``. + +Adding the Airflow chart as a dependency means that it will be deployed together with your custom chart. +You can disable the installation of Airflow by adding the ``condition`` field to the ``dependencies`` section. +For example: + +.. code-block:: + + dependencies: + - name: airflow + version: 1.11.0 + repository: https://airflow.apache.org + condition: airflow.enabled + +This will check if the value of ``airflow.enabled`` inside your ``values.yaml`` is ``true``. +If it is, the Airflow chart will be deployed together with your custom chart. +Otherwise, only your templates will be deployed. + +Download the Airflow Chart +'''''''''''''''''''''''''' + +Third, after you have specified the Airflow chart inside the ``dependencies`` section in ``Chart.yaml`` file, +you can download the Airflow chart by running the following command: + +.. code-block:: + + helm dependency build + +.. note:: + + Make sure you are inside the directory which contains the ``Chart.yaml`` file. + +The chart will be downloaded and saved inside the ``charts/`` directory. + +Overriding default values +'''''''''''''''''''''''''' + +When you add a chart as a subchart to your chart, +you have the ability to override the default values of the subchart in your ``values.yaml``. +This is useful when your chart needs a specific configuration for your custom chart. +E.g. if you want that the Airflow chart be installed with the ``KubernetesExecutor``, +you can do it by adding the following section to your ``values.yaml``: + +.. code-block:: + + airflow: + executor: KubernetesExecutor + +You can override as many values as you like. diff --git a/docs-archive/helm-chart/1.14.0/_sources/index.rst.txt b/docs-archive/helm-chart/1.14.0/_sources/index.rst.txt new file mode 100644 index 00000000000..ff9073bf37b --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_sources/index.rst.txt @@ -0,0 +1,186 @@ + .. Licensed to the Apache Software Foundation (ASF) under one + or more contributor license agreements. See the NOTICE file + distributed with this work for additional information + regarding copyright ownership. The ASF licenses this file + to you under the Apache License, Version 2.0 (the + "License"); you may not use this file except in compliance + with the License. You may obtain a copy of the License at + + .. http://www.apache.org/licenses/LICENSE-2.0 + + .. Unless required by applicable law or agreed to in writing, + software distributed under the License is distributed on an + "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY + KIND, either express or implied. See the License for the + specific language governing permissions and limitations + under the License. + +.. image:: /img/helm-logo.svg + :width: 100 + :class: no-scaled-link + +Helm Chart for Apache Airflow +============================= + +.. toctree:: + :hidden: + + Home + quick-start + airflow-configuration + adding-connections-and-variables + manage-dags-files + manage-logs + setting-resources-for-containers + keda + using-additional-containers + customizing-workers + Installing from sources + Extending the Chart + +.. toctree:: + :hidden: + :caption: Guides + + production-guide + +.. toctree:: + :hidden: + :caption: References + + Parameters + release_notes + + +This chart will bootstrap an `Airflow `__ +deployment on a `Kubernetes `__ cluster using the +`Helm `__ package manager. + +Requirements +------------ + +- Kubernetes 1.26+ cluster +- Helm 3.0+ +- PV provisioner support in the underlying infrastructure (optionally) + +Features +-------- + +* Supported executors: ``LocalExecutor``, ``CeleryExecutor``, ``KubernetesExecutor``, ``LocalKubernetesExecutor``, ``CeleryKubernetesExecutor`` +* Supported Airflow version: ``1.10+``, ``2.0+`` +* Supported database backend: ``PostgreSQL``, ``MySQL`` +* Autoscaling for ``CeleryExecutor`` provided by KEDA +* ``PostgreSQL`` and ``PgBouncer`` with a battle-tested configuration +* Monitoring: + + * StatsD/Prometheus metrics for Airflow + * Prometheus metrics for PgBouncer + * Flower +* Automatic database migration after a new deployment +* Administrator account creation during deployment +* Kerberos secure configuration +* One-command deployment for any type of executor. You don't need to provide other services e.g. Redis/Database to test the Airflow. + +Installing the Chart +-------------------- + +To install this chart using Helm 3, run the following commands: + +.. code-block:: bash + + helm repo add apache-airflow https://airflow.apache.org + helm upgrade --install airflow apache-airflow/airflow --namespace airflow --create-namespace + +The command deploys Airflow on the Kubernetes cluster in the default configuration. The :doc:`parameters-ref` +section lists the parameters that can be configured during installation. + + +.. tip:: List all releases using ``helm list``. + +Upgrading the Chart +------------------- + +To upgrade the chart with the release name ``airflow``: + +.. code-block:: bash + + helm upgrade airflow apache-airflow/airflow --namespace airflow + +.. note:: + To upgrade to a new version of the chart, run ``helm repo update`` first. + +Uninstalling the Chart +---------------------- + +To uninstall/delete the ``airflow`` deployment: + +.. code-block:: bash + + helm delete airflow --namespace airflow + +The command removes all the Kubernetes components associated with the chart and deletes the release. + +.. note:: + Some kubernetes resources created by the chart `helm hooks `__ might be left in the namespace after executing ``helm uninstall``, for example, ``brokerUrlSecret`` or ``fernetKeySecret``. + +Installing the Chart with Argo CD, Flux, Rancher or Terraform +------------------------------------------------------------- + +When installing the chart using Argo CD, Flux, Rancher or Terraform, you MUST set the four following values, or your application +will not start as the migrations will not be run: + +.. code-block:: yaml + + createUserJob: + useHelmHooks: false + applyCustomEnv: false + migrateDatabaseJob: + useHelmHooks: false + applyCustomEnv: false + +This is so these CI/CD services can perform updates without issues and preserve the immutability of Kubernetes Job manifests. + +This also applies if you install the chart using ``--wait`` in your ``helm install`` command. + +.. note:: + While deploying this Helm chart with Argo, you might encounter issues with database migrations not running automatically on upgrade. + +To run database migrations with Argo CD automatically, you will need to add: + +.. code-block:: yaml + + migrateDatabaseJob: + jobAnnotations: + "argocd.argoproj.io/hook": Sync + +This will run database migrations every time there is a ``Sync`` event in Argo CD. While it is not ideal to run the migrations on every sync, it is a trade-off that allows them to be run automatically. + +If you use the Celery(Kubernetes)Executor with the built-in Redis, it is recommended that you set up a static Redis password either by supplying ``redis.passwordSecretName`` and ``data.brokerUrlSecretName`` or ``redis.password``. + + +Naming Conventions +------------------ + +For new installations it is highly recommended to start using standard naming conventions. +It is not enabled by default as this may cause unexpected behaviours on existing installations. However you can enable it using ``useStandardNaming``: + +.. code-block:: yaml + + useStandardNaming: true + +For existing installations, all your resources will be recreated with a new name and helm will delete previous resources. + +This won't delete existing PVCs for logs used by StatefulSets/Deployments, but it will recreate them with brand new PVCs. +If you do want to preserve logs history you'll need to manually copy the data of these volumes into the new volumes after +deployment. Depending on what storage backend/class you're using this procedure may vary. If you don't mind starting +with fresh logs/redis volumes, you can just delete the old persistent volume claims, for example: + +.. code-block:: bash + + kubectl delete pvc -n airflow logs-gta-triggerer-0 + kubectl delete pvc -n airflow logs-gta-worker-0 + kubectl delete pvc -n airflow redis-db-gta-redis-0 + +.. note:: + + If you do not change ``useStandardNaming`` or ``fullnameOverride`` after upgrade, you can proceed as usual and no unexpected behaviours will be presented. diff --git a/docs-archive/helm-chart/1.14.0/_sources/installing-helm-chart-from-sources.rst.txt b/docs-archive/helm-chart/1.14.0/_sources/installing-helm-chart-from-sources.rst.txt new file mode 100644 index 00000000000..63f00b4e9e1 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_sources/installing-helm-chart-from-sources.rst.txt @@ -0,0 +1,129 @@ + .. Licensed to the Apache Software Foundation (ASF) under one + or more contributor license agreements. See the NOTICE file + distributed with this work for additional information + regarding copyright ownership. The ASF licenses this file + to you under the Apache License, Version 2.0 (the + "License"); you may not use this file except in compliance + with the License. You may obtain a copy of the License at + + .. http://www.apache.org/licenses/LICENSE-2.0 + + .. Unless required by applicable law or agreed to in writing, + software distributed under the License is distributed on an + "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY + KIND, either express or implied. See the License for the + specific language governing permissions and limitations + under the License. + +Installing Helm Chart from sources +---------------------------------- + +Released packages +''''''''''''''''' + +.. jinja:: official_download_page + + This page describes downloading and verifying ``Apache Airflow Official Helm Chart`` version + ``{{ package_version}}`` using officially released source packages. You can also install the chart + directly from the ``airflow.apache.org`` repo as described in + `Installing the chart `_. + You can choose different version of the chart by selecting different version from the drop-down at + the top-left of the page. + + +The sources and packages released are the "official" sources of installation that you can use if +you want to verify the origin of the packages and want to verify checksums and signatures of the packages. +The packages are available via the +`Official Apache Software Foundations Downloads `_ + +The downloads are available at: + +.. jinja:: official_download_page + + * `Sources package <{{ closer_lua_url }}/{{ package_version }}/airflow-chart-{{ package_version }}-source.tar.gz>`__ (`asc <{{ base_url }}/{{ package_version }}/airflow-chart-{{ package_version }}-source.tar.gz.asc>`__, `sha512 <{{ base_url }}/{{ package_version }}/airflow-chart-{{ package_version }}-source.tar.gz.sha512>`__) + * `Installable package <{{ closer_lua_url }}/{{ package_version }}/airflow-{{ package_version }}.tgz>`__ (`asc <{{ base_url }}/{{ package_version }}/airflow-{{ package_version }}.tgz.asc>`__, `sha512 <{{ base_url }}/{{ package_version }}/airflow-{{ package_version }}.tgz.sha512>`__) + +If you want to install from the source code, you can download from the sources link above, it will contain +a ``INSTALL`` file containing details on how you can build and install the chart. + +Release integrity +''''''''''''''''' + +`PGP signatures KEYS `_ + +It is essential that you verify the integrity of the downloaded files using the PGP or SHA signatures. +The PGP signatures can be verified using GPG or PGP. Please download the KEYS as well as the asc +signature files for relevant distribution. It is recommended to get these files from the +main distribution directory and not from the mirrors. + +.. code-block:: bash + + gpg -i KEYS + +or + +.. code-block:: bash + + pgpk -a KEYS + +or + +.. code-block:: bash + + pgp -ka KEYS + +To verify the binaries/sources you can download the relevant asc files for it from main +distribution directory and follow the below guide. + +.. code-block:: bash + + gpg --verify airflow-********.asc airflow-********* + +or + +.. code-block:: bash + + pgpv airflow-********.asc + +or + +.. code-block:: bash + + pgp airflow-********.asc + +Example: + +.. jinja:: official_download_page + + .. code-block:: console + :substitutions: + + $ gpg --verify airflow-{{ package_version }}.tgz.asc airflow-{{ package_version }}.tgz + gpg: Signature made Sat 11 Sep 12:49:54 2021 BST + gpg: using RSA key CDE15C6E4D3A8EC4ECF4BA4B6674E08AD7DE406F + gpg: issuer "kaxilnaik@apache.org" + gpg: Good signature from "Kaxil Naik " [unknown] + gpg: aka "Kaxil Naik " [unknown] + gpg: WARNING: The key's User ID is not certified with a trusted signature! + gpg: There is no indication that the signature belongs to the owner. + Primary key fingerprint: CDE1 5C6E 4D3A 8EC4 ECF4 BA4B 6674 E08A D7DE 406F + + The "Good signature from ..." is indication that the signatures are correct. + Do not worry about the "not certified with a trusted signature" warning. Most of the certificates used + by release managers are self signed, that's why you get this warning. By importing the server in the + previous step and importing it via ID from ``KEYS`` page, you know that this is a valid Key already. + + For SHA512 sum check, download the relevant ``sha512`` and run the following: + + .. code-block:: bash + + shasum -a 512 airflow-******** | diff - airflow-********.sha512 + + The ``SHASUM`` of the file should match the one provided in ``.sha512`` file. + + Example: + + .. code-block:: bash + :substitutions: + + shasum -a 512 airflow-{{ package_version }}.tgz | diff - airflow-{{ package_version }}.tgz.sha512 diff --git a/docs-archive/helm-chart/1.14.0/_sources/keda.rst.txt b/docs-archive/helm-chart/1.14.0/_sources/keda.rst.txt new file mode 100644 index 00000000000..de17ecaff40 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_sources/keda.rst.txt @@ -0,0 +1,71 @@ + .. Licensed to the Apache Software Foundation (ASF) under one + or more contributor license agreements. See the NOTICE file + distributed with this work for additional information + regarding copyright ownership. The ASF licenses this file + to you under the Apache License, Version 2.0 (the + "License"); you may not use this file except in compliance + with the License. You may obtain a copy of the License at + + .. http://www.apache.org/licenses/LICENSE-2.0 + + .. Unless required by applicable law or agreed to in writing, + software distributed under the License is distributed on an + "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY + KIND, either express or implied. See the License for the + specific language governing permissions and limitations + under the License. + +Autoscaling with KEDA +--------------------- + +*This feature is still experimental.* + +KEDA stands for Kubernetes Event Driven Autoscaling. +`KEDA `__ is a custom controller that +allows users to create custom bindings to the Kubernetes `Horizontal Pod +Autoscaler `__. +The autoscaler will adjust the number of active Celery workers based on the number +of tasks in ``queued`` or ``running`` state. + +.. code-block:: bash + + helm repo add kedacore https://kedacore.github.io/charts + + helm repo update + + kubectl create namespace keda + + helm install keda kedacore/keda \ + --namespace keda \ + --version "v2.0.0" + +Enable for the airflow instance by setting ``workers.keda.enabled=true`` in your +helm command or in the ``values.yaml``. + +.. code-block:: bash + + kubectl create namespace airflow + helm repo add apache-airflow https://airflow.apache.org + helm install airflow apache-airflow/airflow \ + --namespace airflow \ + --set executor=CeleryExecutor \ + --set workers.keda.enabled=true + +A ``ScaledObject`` and an ``hpa`` will be created in the airflow namespace. + +KEDA will derive the desired number of Celery workers by querying +Airflow metadata database: + +.. code-block:: none + + SELECT + ceil(COUNT(*)::decimal / {{ .Values.config.celery.worker_concurrency }}) + FROM task_instance + WHERE state='running' OR state='queued' + +.. note:: + + Set Celery worker concurrency through the Helm value + ``config.celery.worker_concurrency`` (i.e. instead of airflow.cfg or + environment variables) so that the KEDA trigger will be consistent with + the worker concurrency setting. diff --git a/docs-archive/helm-chart/1.14.0/_sources/manage-dags-files.rst.txt b/docs-archive/helm-chart/1.14.0/_sources/manage-dags-files.rst.txt new file mode 100644 index 00000000000..9d74c2c852a --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_sources/manage-dags-files.rst.txt @@ -0,0 +1,277 @@ + .. Licensed to the Apache Software Foundation (ASF) under one + or more contributor license agreements. See the NOTICE file + distributed with this work for additional information + regarding copyright ownership. The ASF licenses this file + to you under the Apache License, Version 2.0 (the + "License"); you may not use this file except in compliance + with the License. You may obtain a copy of the License at + + .. http://www.apache.org/licenses/LICENSE-2.0 + + .. Unless required by applicable law or agreed to in writing, + software distributed under the License is distributed on an + "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY + KIND, either express or implied. See the License for the + specific language governing permissions and limitations + under the License. + + +Manage DAGs files +================= + +When you create new or modify existing DAG files, it is necessary to deploy them into the environment. This section will describe some basic techniques you can use. + +Bake DAGs in Docker image +------------------------- + +With this approach, you include your dag files and related code in the airflow image. + +This method requires redeploying the services in the helm chart with the new docker image in order to deploy the new DAG code. This can work well particularly if DAG code is not expected to change frequently. + +.. code-block:: bash + + docker build --pull --tag "my-company/airflow:8a0da78" . -f - <`_ for details), and specify it using ``--set registry.secretName``: + + +.. code-block:: bash + + helm upgrade --install airflow apache-airflow/airflow \ + --set images.airflow.repository=my-company/airflow \ + --set images.airflow.tag=8a0da78 \ + --set images.airflow.pullPolicy=Always \ + --set registry.secretName=gitlab-registry-credentials + +Using Git-sync +-------------- + +Mounting DAGs using Git-Sync sidecar with Persistence enabled +............................................................. + +This option will use a Persistent Volume Claim with an access mode of ``ReadWriteMany``. +The scheduler pod will sync DAGs from a git repository onto the PVC every configured number of +seconds. The other pods will read the synced DAGs. Not all volume plugins have support for +``ReadWriteMany`` access mode. +Refer `Persistent Volume Access Modes `__ +for details. + +.. code-block:: bash + + helm upgrade --install airflow apache-airflow/airflow \ + --set dags.persistence.enabled=true \ + --set dags.gitSync.enabled=true + # you can also override the other persistence or gitSync values + # by setting the dags.persistence.* and dags.gitSync.* values + # Please refer to values.yaml for details + + +Mounting DAGs using Git-Sync sidecar without Persistence +........................................................ + +This option will use an always running Git-Sync sidecar on every scheduler, webserver (if ``airflowVersion < 2.0.0``) +and worker pods. +The Git-Sync sidecar containers will sync DAGs from a git repository every configured number of +seconds. If you are using the ``KubernetesExecutor``, Git-sync will run as an init container on your worker pods. + +.. code-block:: bash + + helm upgrade --install airflow apache-airflow/airflow \ + --set dags.persistence.enabled=false \ + --set dags.gitSync.enabled=true + # you can also override the other gitSync values + # by setting the dags.gitSync.* values + # Refer values.yaml for details + +When using ``apache-airflow >= 2.0.0``, :ref:`DAG Serialization ` is enabled by default, +hence Webserver does not need access to DAG files, so ``git-sync`` sidecar is not run on Webserver. + +Notes for combining git-sync and persistence +............................................ + +While using both git-sync and persistence for DAGs is possible, it is generally not recommended unless the +deployment manager carefully considered the trade-offs it brings. There are cases when git-sync without +persistence has other trade-offs (for example delays in synchronization of DAGS vs. rate-limiting of Git +servers) that can often be mitigated (for example by sending signals to git-sync containers via web-hooks +when new commits are pushed to the repository) but there might be cases where you still might want to choose +git-sync and Persistence together, but as a Deployment Manager you should be aware of some consequences it has. + +git-sync solution is primarily designed to be used for local, POSIX-compliant volumes to checkout Git +repositories into. Part of the process of synchronization of commits from git-sync involves checking out +new version of files in a freshly created folder and swapping symbolic links to the new folder, after the +checkout is complete. This is done to ensure that the whole DAGs folder is consistent at all times. The way +git-sync works with symbolic-link swaps, makes sure that Parsing the DAGs always work on a consistent +(single-commit-based) set of files in the whole DAG folder. + +This approach, however might have undesirable side effects when the folder that git-sync works on is not +a local volume, but is a persistent volume (so effectively a networked, distributed volume). Depending on +the technology behind the persistent volumes might handle git-sync approach differently and with non-obvious +consequences. There are a lot of persistence solutions available for various K8S installations and each of +them has different characteristics, so you need to carefully test and monitor your filesystem to make sure +those undesired side effects do not affect you. Those effects might change over time or depend on parameters +like how often the files are being scanned by the Dag File Processor, the number and complexity of your +DAGs, how remote and how distributed your persistent volumes are, how many IOPS you allocate for some of +the filesystem (usually highly paid feature of such filesystems is how many IOPS you can get) and many other +factors. + +The way git-sync works with symbolic links swapping generally causes a linear growth of the throughput and +potential delays in synchronization. The networking traffic from checkouts comes in bursts and the bursts +are linearly proportional to the number and size of files you have in the repository, makes it vulnerable +to pretty sudden and unexpected demand increase. Most of the persistence solution work "good enough" for +smaller/shorter burst of traffic, but when they outgrow certain thresholds, you need to upgrade the +networking to a much more capable and expensive options. This is difficult to control and impossible to +mitigate, so you might be suddenly faced with situation to pay a lot more for IOPS/persistence option to +keep your DAGs sufficiently synchronized to avoid inconsistencies and delays in synchronization. + +The side-effects that you might observe: + +* burst of networking/communication at the moment when new commit is checked out (because of the quick + succession of deleting old files, creating new files, symbolic link swapping. +* temporary lack of consistency between files in DAG folders while DAGS are being synced (because of delays + in distributing changes to individual files for various nodes in the cluster) +* visible drops of performance of the persistence solution when your DAG number grows, drops that might + amplify the side effects described above. +* some of persistence solutions might lack filesystem functionality that git-sync needs to perform the sync + (for example changing permissions or creating symbolic links). While those can often be mitigated it is + only recommended to use git-sync with fully POSIX-filesystem compliant persistence filesystems. + +General recommendation to use git-sync with local volumes only, and if you want to also use persistence, you +need to make sure that the persistence solution you use is POSIX-compliant and you monitor the side-effects +it might have. + +Synchronizing multiple Git repositories with git-sync +..................................................... + +Airflow git-sync integration in the Helm Chart, does not allow to configure multiple repositories to be +synchronized at the same time. The DAG folder must come from single git repository. However it is possible +to use `submodules `_ to create an "umbrella" repository +that you can use to bring a number of git repositories checked out together (with ``--submodules recursive`` +option). There are success stories of Airflow users using such approach with 100s of repositories put +together as submodules via such "umbrella" repo approach. When you choose this solution, however, +you need to work out the way how to ling the submodules, when to updated the umbrella repo when "submodule" +repository change and work out versioning approach and automate it. This might be as simple as always +using latest versions of all the submodule repositories, or as complex as managing versioning of shared +libraries, DAGs and code across multiple teams and doing that following your release process. + +An example of such complex approach can found in this +`Manage DAGs at scale `_ presentation from the Airflow +Summit. + + +Mounting DAGs from an externally populated PVC +---------------------------------------------- + +In this approach, Airflow will read the DAGs from a PVC which has ``ReadOnlyMany`` or ``ReadWriteMany`` access mode. You will have to ensure that the PVC is populated/updated with the required DAGs (this won't be handled by the chart). You pass in the name of the volume claim to the chart: + +.. code-block:: bash + + helm upgrade --install airflow apache-airflow/airflow \ + --set dags.persistence.enabled=true \ + --set dags.persistence.existingClaim=my-volume-claim \ + --set dags.gitSync.enabled=false + +Mounting DAGs from a private GitHub repo using Git-Sync sidecar +--------------------------------------------------------------- +Create a private repo on GitHub if you have not created one already. + +Then create your ssh keys: + +.. code-block:: bash + + ssh-keygen -t rsa -b 4096 -C "your_email@example.com" + +Add the public key to your private repo (under ``Settings > Deploy keys``). + +You have to convert the private ssh key to a base64 string. You can convert the private ssh key file like so: + +.. code-block:: bash + + base64 -w 0 > temp.txt + +Then copy the string from the ``temp.txt`` file. You'll add it to your ``override-values.yaml`` next. + +In this example, you will create a yaml file called ``override-values.yaml`` to override values in the +``values.yaml`` file, instead of using ``--set``: + +.. code-block:: yaml + + dags: + gitSync: + enabled: true + repo: git@github.com:/.git + branch: + subPath: "" + sshKeySecret: airflow-ssh-secret + extraSecrets: + airflow-ssh-secret: + data: | + gitSshKey: '' + +Don't forget to copy in your private key base64 string. + +Finally, from the context of your Airflow Helm chart directory, you can install Airflow: + +.. code-block:: bash + + helm upgrade --install airflow apache-airflow/airflow -f override-values.yaml + +If you have done everything correctly, Git-Sync will pick up the changes you make to the DAGs +in your private GitHub repo. + +You should take this a step further and set ``dags.gitSync.knownHosts`` so you are not susceptible to man-in-the-middle +attacks. This process is documented in the :ref:`production guide `. diff --git a/docs-archive/helm-chart/1.14.0/_sources/manage-logs.rst.txt b/docs-archive/helm-chart/1.14.0/_sources/manage-logs.rst.txt new file mode 100644 index 00000000000..f996ba531ca --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_sources/manage-logs.rst.txt @@ -0,0 +1,92 @@ + .. Licensed to the Apache Software Foundation (ASF) under one + or more contributor license agreements. See the NOTICE file + distributed with this work for additional information + regarding copyright ownership. The ASF licenses this file + to you under the Apache License, Version 2.0 (the + "License"); you may not use this file except in compliance + with the License. You may obtain a copy of the License at + + .. http://www.apache.org/licenses/LICENSE-2.0 + + .. Unless required by applicable law or agreed to in writing, + software distributed under the License is distributed on an + "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY + KIND, either express or implied. See the License for the + specific language governing permissions and limitations + under the License. + +Manage logs +================= + +You have a number of options when it comes to managing your Airflow logs. + +No persistence +----------------- + +With this option, Airflow will log locally to each pod. As such, the logs will only be available during the lifetime of the pod. + +.. code-block:: bash + + helm upgrade --install airflow apache-airflow/airflow \ + --set logs.persistence.enabled=false + # --set workers.persistence.enabled=false (also needed if using ``CeleryExecutor``) + +Celery worker log persistence +----------------------------- + +If you are using ``CeleryExecutor``, workers persist logs by default to a volume claim created with a ``volumeClaimTemplate``. + +You can modify the template: + +.. code-block:: bash + + helm upgrade --install airflow apache-airflow/airflow \ + --set executor=CeleryExecutor \ + --set workers.persistence.size=10Gi + +Note with this option only task logs are persisted, unlike when log persistence is enabled which will also persist scheduler logs. + +Log persistence enabled +----------------------- + +This option will provision a ``PersistentVolumeClaim`` with an access mode of ``ReadWriteMany``. Each component of Airflow will +then log onto the same volume. + +Not all volume plugins have support for ``ReadWriteMany`` access mode. +Refer `Persistent Volume Access Modes `__ +for details. + +.. code-block:: bash + + helm upgrade --install airflow apache-airflow/airflow \ + --set logs.persistence.enabled=true + # you can also override the other persistence + # by setting the logs.persistence.* values + # Please refer to values.yaml for details + +Externally provisioned PVC +-------------------------- + +In this approach, Airflow will log to an existing ``ReadWriteMany`` PVC. You pass in the name of the volume claim to the chart. + +.. code-block:: bash + + helm upgrade --install airflow apache-airflow/airflow \ + --set logs.persistence.enabled=true \ + --set logs.persistence.existingClaim=my-volume-claim + +Note that the volume will need to be writable by the Airflow user. The easiest way is to ensure GID ``0`` has write permission. +More information can be found in the :ref:`Docker image entrypoint documentation `. + +Elasticsearch +------------- + +If your cluster forwards logs to Elasticsearch, you can configure Airflow to retrieve task logs from it. +See the :doc:`Elasticsearch providers guide ` for more details. + +.. code-block:: bash + + helm upgrade --install airflow apache-airflow/airflow \ + --set elasticsearch.enabled=true \ + --set elasticsearch.secretName=my-es-secret + # Other choices exist. Please refer to values.yaml for details. diff --git a/docs-archive/helm-chart/1.14.0/_sources/parameters-ref.rst.txt b/docs-archive/helm-chart/1.14.0/_sources/parameters-ref.rst.txt new file mode 100644 index 00000000000..337c5b9484c --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_sources/parameters-ref.rst.txt @@ -0,0 +1,63 @@ + .. Licensed to the Apache Software Foundation (ASF) under one + or more contributor license agreements. See the NOTICE file + distributed with this work for additional information + regarding copyright ownership. The ASF licenses this file + to you under the Apache License, Version 2.0 (the + "License"); you may not use this file except in compliance + with the License. You may obtain a copy of the License at + + .. http://www.apache.org/licenses/LICENSE-2.0 + + .. Unless required by applicable law or agreed to in writing, + software distributed under the License is distributed on an + "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY + KIND, either express or implied. See the License for the + specific language governing permissions and limitations + under the License. + +Parameters reference +==================== + +The following tables lists the configurable parameters of the Airflow chart and their default values. + +.. jinja:: params_ctx + + {% for section in sections %} + + .. _parameters:{{ section["name"] }}: + + {{ section["name"] }} + {{ "=" * (section["name"]|length + 2) }} + + .. list-table:: + :widths: 15 10 30 + :header-rows: 1 + + * - Parameter + - Description + - Default + + {% for param in section["params"] %} + * - ``{{ param["name"] }}`` + - {{ param["description"] }} + - ``{{ param["default"] }}`` + {% if param["examples"] %} + Examples: + + .. code-block:: yaml + + {{ param["examples"] | indent(width=10) }} + + {% endif %} + {% endfor %} + + {% endfor %} + + +Specify each parameter using the ``--set key=value[,key=value]`` argument to ``helm install``. For example, + +.. code-block:: bash + + helm install my-release apache-airflow/airflow \ + --set executor=CeleryExecutor \ + --set enablePodLaunching=false . diff --git a/docs-archive/helm-chart/1.14.0/_sources/production-guide.rst.txt b/docs-archive/helm-chart/1.14.0/_sources/production-guide.rst.txt new file mode 100644 index 00000000000..ee1fc2308be --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_sources/production-guide.rst.txt @@ -0,0 +1,577 @@ + .. Licensed to the Apache Software Foundation (ASF) under one + or more contributor license agreements. See the NOTICE file + distributed with this work for additional information + regarding copyright ownership. The ASF licenses this file + to you under the Apache License, Version 2.0 (the + "License"); you may not use this file except in compliance + with the License. You may obtain a copy of the License at + + .. http://www.apache.org/licenses/LICENSE-2.0 + + .. Unless required by applicable law or agreed to in writing, + software distributed under the License is distributed on an + "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY + KIND, either express or implied. See the License for the + specific language governing permissions and limitations + under the License. + +Production Guide +================ + +The following are things to consider when using this Helm chart in a production environment. + +Database +-------- + +It is advised to set up an external database for the Airflow metastore. The default Helm chart deploys a +Postgres database running in a container. For production usage, a database running on a dedicated machine or +leveraging a cloud provider's database service such as AWS RDS should be used because the embedded Postgres +lacks stability, monitoring and persistence features that you need for a production database. It is only there to +make it easier to test the Helm Chart in a "standalone" version but you might experience data loss when you +are using it. Supported databases and versions can be found at :doc:`Set up a Database Backend `. + + +.. note:: + + When using the helm chart, you do not need to initialize the db with ``airflow db migrate`` + as outlined in :doc:`Set up a Database Backend `. + +First disable Postgres so the chart won't deploy its own Postgres container: + +.. code-block:: yaml + + postgresql: + enabled: false + +To provide the database credentials to Airflow, you have 2 options - in your values file or in a Kubernetes Secret. + +Values file +^^^^^^^^^^^ + +This is the simpler options, as the chart will create a Kubernetes Secret for you. However, keep in mind your credentials will be in your values file. + +.. code-block:: yaml + + data: + metadataConnection: + user: + pass: + protocol: postgresql + host: + port: 5432 + db: + + +Kubernetes Secret +^^^^^^^^^^^^^^^^^ + +You can also store the credentials in a Kubernetes Secret you create. Note that +special characters in the username/password must be URL encoded. + +.. code-block:: bash + + kubectl create secret generic mydatabase --from-literal=connection=postgresql://user:pass@host:5432/db + +Finally, configure the chart to use the secret you created: + +.. code-block:: yaml + + data: + metadataSecretName: mydatabase + +.. warning:: + If you use ``CeleryExecutor`` and Airflow version < ``2.4``, keep in mind that ``resultBackendSecretName`` expects a url that starts with ``db+postgresql://``, while ``metadataSecretName`` expects ``postgresql://`` and won't work with ``db+postgresql://``. You'll need to create separate secrets with the correct scheme. For Airflow version >= ``2.4`` it is possible to omit the result backend secret, as Airflow will use ``sql_alchemy_conn`` (specified in ``metadataSecret``) with a db+ scheme prefix by default. + +.. _production-guide:pgbouncer: + +PgBouncer +--------- + +If you are using PostgreSQL as your database, you will likely want to enable `PgBouncer `_ as well. +Airflow can open a lot of database connections due to its distributed nature and using a connection pooler can significantly +reduce the number of open connections on the database. + +.. code-block:: yaml + + pgbouncer: + enabled: true + +Depending on the size of your Airflow instance, you may want to adjust the following as well (defaults are shown): + +.. code-block:: yaml + + pgbouncer: + # The maximum number of connections to PgBouncer + maxClientConn: 100 + # The maximum number of server connections to the metadata database from PgBouncer + metadataPoolSize: 10 + # The maximum number of server connections to the result backend database from PgBouncer + resultBackendPoolSize: 5 + +Webserver Secret Key +-------------------- + +You should set a static webserver secret key when deploying with this chart as it will help ensure +your Airflow components only restart when necessary. + +.. warning:: + You should use a different secret key for every instance you run, as this key is used to sign + session cookies and perform other security related functions! + +First, generate a strong secret key: + +.. code-block:: bash + + python3 -c 'import secrets; print(secrets.token_hex(16))' + +Now add the secret to your values file: + +.. code-block:: yaml + + webserverSecretKey: + +Alternatively, create a Kubernetes Secret and use ``webserverSecretKeySecretName``: + +.. code-block:: yaml + + webserverSecretKeySecretName: my-webserver-secret + # where the random key is under `webserver-secret-key` in the k8s Secret + +Example to create a Kubernetes Secret from ``kubectl``: + +.. code-block:: bash + + kubectl create secret generic my-webserver-secret --from-literal="webserver-secret-key=$(python3 -c 'import secrets; print(secrets.token_hex(16))')" + +The webserver key is also used to authorize requests to Celery workers when logs are retrieved. The token +generated using the secret key has a short expiry time though - make sure that time on ALL the machines +that you run airflow components on is synchronized (for example using ntpd) otherwise you might get +"forbidden" errors when the logs are accessed. + +Eviction configuration +---------------------- +When running Airflow along with the `Kubernetes Cluster Autoscaler `_, it is important to configure whether pods can be safely evicted. +This setting can be configured in the Airflow chart at different levels: + +.. code-block:: yaml + + workers: + safeToEvict: true + scheduler: + safeToEvict: true + webserver: + safeToEvict: true + +When using ``KubernetesExecutor``, ``workers.safeToEvict`` should be set to ``false`` to avoid them being removed before finishing. + +Extending and customizing Airflow Image +--------------------------------------- + +The Apache Airflow community, releases Docker Images which are ``reference images`` for Apache Airflow. +However, Airflow has more than 60 community managed providers (installable via extras) and some of the +default extras/providers installed are not used by everyone, sometimes others extras/providers +are needed, sometimes (very often actually) you need to add your own custom dependencies, +packages or even custom providers, or add custom tools and binaries that are needed in +your deployment. + +In Kubernetes and Docker terms this means that you need another image with your specific requirements. +This is why you should learn how to build your own ``Docker`` (or more properly ``Container``) image. + +Typical scenarios where you would like to use your custom image: + +* Adding ``apt`` packages +* Adding ``PyPI`` packages +* Adding binary resources necessary for your deployment +* Adding custom tools needed in your deployment + +See `Building the image `_ for more +details on how you can extend and customize the Airflow image. + +Managing DAG Files +------------------ + +See :doc:`manage-dags-files`. + +.. _production-guide:knownhosts: + +knownHosts +^^^^^^^^^^ + +If you are using ``dags.gitSync.sshKeySecret``, you should also set ``dags.gitSync.knownHosts``. Here we will show the process +for GitHub, but the same can be done for any provider: + +Grab GitHub's public key: + +.. code-block:: bash + + ssh-keyscan -t rsa github.com > github_public_key + +Next, print the fingerprint for the public key: + +.. code-block:: bash + + ssh-keygen -lf github_public_key + +Compare that output with `GitHub's SSH key fingerprints `_. + +They match, right? Good. Now, add the public key to your values. It'll look something like this: + +.. code-block:: yaml + + dags: + gitSync: + knownHosts: | + github.com ssh-rsa AAAA...1/wsjk= + + +External Scheduler +^^^^^^^^^^^^^^^^^^ + +To use an external Scheduler instance: + +.. code-block:: yaml + + scheduler: + enabled: false + +Ensure that your external webserver/scheduler is connected to the same redis host. This will ensure the scheduler is aware of the workers deployed in the helm-chart. + +Accessing the Airflow UI +------------------------ + +How you access the Airflow UI will depend on your environment; however, the chart does support various options: + +External Webserver +^^^^^^^^^^^^^^^^^^ + +To use an external Webserver: + +.. code-block:: yaml + + webserver: + enabled: false + +Ensure that your external webserver/scheduler is connected to the same redis host. This will ensure the scheduler is aware of the workers deployed in the helm-chart. + +Ingress +^^^^^^^ + +You can create and configure ``Ingress`` objects. See the :ref:`Ingress chart parameters `. +For more information on ``Ingress``, see the +`Kubernetes Ingress documentation `_. + +LoadBalancer Service +^^^^^^^^^^^^^^^^^^^^ + +You can change the Service type for the webserver to be ``LoadBalancer``, and set any necessary annotations: + +.. code-block:: yaml + + webserver: + service: + type: LoadBalancer + +For more information on ``LoadBalancer`` Services, see the `Kubernetes LoadBalancer Service Documentation +`_. + +Logging +------- + +Depending on your choice of executor, task logs may not work out of the box. All logging choices can be found +at :doc:`manage-logs`. + +Metrics +------- + +The chart can support sending metrics to an existing StatsD instance or provide a Prometheus endpoint. + +Prometheus +^^^^^^^^^^ + +The metrics endpoint is available at ``svc/{{ .Release.Name }}-statsd:9102/metrics``. + +External StatsD +^^^^^^^^^^^^^^^ + +To use an external StatsD instance: + +.. code-block:: yaml + + statsd: + enabled: false + config: + metrics: # or 'scheduler' for Airflow 1 + statsd_on: true + statsd_host: ... + statsd_port: ... + +Datadog +^^^^^^^ +If you are using a Datadog agent in your environment, this will enable Airflow to export metrics to the Datadog agent. + +.. code-block:: yaml + + statsd: + enabled: false + config: + metrics: # or 'scheduler' for Airflow 1 + statsd_on: true + statsd_port: 8125 + extraEnv: |- + - name: AIRFLOW__METRICS__STATSD_HOST + valueFrom: + fieldRef: + fieldPath: status.hostIP + +Celery Backend +-------------- + +If you are using ``CeleryExecutor`` or ``CeleryKubernetesExecutor``, you can bring your own Celery backend. + +By default, the chart will deploy Redis. However, you can use any supported Celery backend instead: + +.. code-block:: yaml + + redis: + enabled: false + data: + brokerUrl: redis://redis-user:password@redis-host:6379/0 + +For more information about setting up a Celery broker, refer to the +exhaustive `Celery documentation on the topic `_. + +Security Context Constraints +----------------------------- + +A ``Security Context Constraint`` (SCC) is a OpenShift construct that works as a RBAC rule; however, it targets Pods instead of users. +When defining a SCC, one can control actions and resources a POD can perform or access during startup and runtime. + +The SCCs are split into different levels or categories with the ``restricted`` SCC being the default one assigned to Pods. +When deploying Airflow to OpenShift, one can leverage the SCCs and allow the Pods to start containers utilizing the ``anyuid`` SCC. + +In order to enable the usage of SCCs, one must set the parameter :ref:`rbac.createSCCRoleBinding ` to ``true`` as shown below: + +.. code-block:: yaml + + rbac: + create: true + createSCCRoleBinding: true + +In this chart, SCCs are bound to the Pods via RoleBindings meaning that the option ``rbac.create`` must also be set to ``true`` in order to fully enable the SCC usage. + +For more information about SCCs and what can be achieved with this construct, please refer to `Managing security context constraints `_. + +Security Context +---------------- + +In Kubernetes a ``securityContext`` can be used to define user ids, group ids and capabilities such as running a container in privileged mode. + +When deploying an application to Kubernetes, it is recommended to give the least privilege to containers so as +to reduce access and protect the host where the container is running. + +In the Airflow Helm chart, the ``securityContext`` can be configured in several ways: + + * :ref:`uid ` (configures the global uid or RunAsUser) + * :ref:`gid ` (configures the global gid or fsGroup) + * :ref:`securityContexts ` (same as ``uid`` but allows for setting all `Pod securityContext options `_ and `Container securityContext options `_) + +The same way one can configure the global :ref:`securityContexts `, it is also possible to configure different values for specific workloads by setting their local ``securityContexts`` as follows: + +.. code-block:: yaml + + workers: + securityContexts: + pod: + runAsUser: 5000 + fsGroup: 0 + containers: + allowPrivilegeEscalation: false + + +In the example above, the workers Pod ``securityContexts`` will be set to ``runAsUser: 5000`` and ``fsGroup: 0``. The containers pod will be set to ``allowPrivilegeEscalation: false``. + +As one can see, the local setting will take precedence over the global setting when defined. The following explains the precedence rule for ``securityContexts`` options in this chart: + +.. code-block:: yaml + + uid: 40000 + gid: 0 + + securityContexts: + pod: + runAsUser: 50000 + fsGroup: 0 + + workers: + securityContexts: + pod: + runAsUser: 1001 + fsGroup: 0 + +This will generate the following worker deployment: + +.. code-block:: yaml + + kind: StatefulSet + apiVersion: apps/v1 + metadata: + name: airflow-worker + spec: + serviceName: airflow-worker + template: + spec: + securityContext: # As the securityContexts was defined in ``workers``, its value will take priority + runAsUser: 1001 + fsGroup: 0 + +If we remove both the ``securityContexts`` and ``workers.securityContexts`` from the example above, the output will be the following: + +.. code-block:: yaml + + uid: 40000 + gid: 0 + + securityContexts: {} + + workers: + securityContexts: {} + +This will generate the following worker deployment: + +.. code-block:: yaml + + kind: StatefulSet + apiVersion: apps/v1 + metadata: + name: airflow-worker + spec: + serviceName: airflow-worker + template: + spec: + securityContext: + runAsUser: 40000 # As the securityContext was not defined in ``workers`` or ``podSecurity``, the value from uid will be used + fsGroup: 0 # As the securityContext was not defined in ``workers`` or ``podSecurity``, the value from gid will be used + initContainers: + - name: wait-for-airflow-migrations + ... + containers: + - name: worker + ... + +And finally if we set ``securityContexts`` but not ``workers.securityContexts``: + +.. code-block:: yaml + + uid: 40000 + gid: 0 + + securityContexts: + pod: + runAsUser: 50000 + fsGroup: 0 + + workers: + securityContexts: {} + +This will generate the following worker deployment: + +.. code-block:: yaml + + kind: StatefulSet + apiVersion: apps/v1 + metadata: + name: airflow-worker + spec: + serviceName: airflow-worker + template: + spec: + securityContext: # As the securityContexts was not defined in ``workers``, the values from securityContexts will take priority + runAsUser: 50000 + fsGroup: 0 + initContainers: + - name: wait-for-airflow-migrations + ... + containers: + - name: worker + ... + +Built-in secrets and environment variables +------------------------------------------ + +The Helm Chart by default uses Kubernetes Secrets to store secrets that are needed by Airflow. +The contents of those secrets are by default turned into environment variables that are read by +Airflow (some of the environment variables have several variants to support older versions of Airflow). + +By default, the secret names are determined from the Release Name used when the Helm Chart is deployed, +but you can also use a different secret to set the variables or disable using secrets +entirely and rely on environment variables (specifically if you want to use ``_CMD`` or ``__SECRET`` variant +of the environment variable. + +However, Airflow supports other variants of setting secret configuration - you can specify a system +command to retrieve and automatically rotate the secret (by defining variable with ``_CMD`` suffix) or +to retrieve a variable from secret backed (by defining the variable with ``_SECRET`` suffix). + +If the ``>`` is set, it takes precedence over the ``_CMD`` and ``_SECRET`` variant, so +if you want to set one of the ``_CMD`` or ``_SECRET`` variants, you MUST disable the built in +variables retrieved from Kubernetes secrets, by setting ``.Values.enableBuiltInSecretEnvVars.`` +to false. + +For example in order to use a command to retrieve the DB connection you should (in your ``values.yaml`` +file) specify: + +.. code-block:: yaml + + extraEnv: + AIRFLOW_CONN_AIRFLOW_DB_CMD: "/usr/local/bin/retrieve_connection_url" + enableBuiltInSecretEnvVars: + AIRFLOW_CONN_AIRFLOW_DB: false + +Here is the full list of secrets that can be disabled and replaced by ``_CMD`` and ``_SECRET`` variants: + ++-------------------------------------------------------+------------------------------------------+--------------------------------------------------+ +| Default secret name if secret name not specified | Use a different Kubernetes Secret | Airflow Environment Variable | ++=======================================================+==========================================+==================================================+ +| ``-airflow-metadata`` | ``.Values.data.metadataSecretName`` | | ``AIRFLOW_CONN_AIRFLOW_DB`` | +| | | | ``AIRFLOW__DATABASE__SQL_ALCHEMY_CONN`` | ++-------------------------------------------------------+------------------------------------------+--------------------------------------------------+ +| ``-fernet-key`` | ``.Values.fernetKeySecretName`` | ``AIRFLOW__CORE__FERNET_KEY`` | ++-------------------------------------------------------+------------------------------------------+--------------------------------------------------+ +| ``-webserver-secret-key`` | ``.Values.webserverSecretKeySecretName`` | ``AIRFLOW__WEBSERVER__SECRET_KEY`` | ++-------------------------------------------------------+------------------------------------------+--------------------------------------------------+ +| ``-airflow-result-backend`` | ``.Values.data.resultBackendSecretName`` | | ``AIRFLOW__CELERY__CELERY_RESULT_BACKEND`` | +| | | | ``AIRFLOW__CELERY__RESULT_BACKEND`` | ++-------------------------------------------------------+------------------------------------------+--------------------------------------------------+ +| ``-airflow-brokerUrl`` | ``.Values.data.brokerUrlSecretName`` | ``AIRFLOW__CELERY__BROKER_URL`` | ++-------------------------------------------------------+------------------------------------------+--------------------------------------------------+ +| ``-elasticsearch`` | ``.Values.elasticsearch.secretName`` | | ``AIRFLOW__ELASTICSEARCH__HOST`` | +| | | | ``AIRFLOW__ELASTICSEARCH__ELASTICSEARCH_HOST`` | ++-------------------------------------------------------+------------------------------------------+--------------------------------------------------+ + +There are also a number of secrets, which names are also determined from the release name, that do not need to +be disabled. This is because either they do not follow the ``_CMD`` or ``_SECRET`` pattern, are variables +which do not start with ``AIRFLOW__``, or they do not have a corresponding variable. + +There is also one ``_AIRFLOW__*`` variable, ``AIRFLOW__CELERY__FLOWER_BASIC_AUTH``, that does not need to be disabled, +even if you want set the ``_CMD`` and ``_SECRET`` variant. This variable is not set by default. It is only set +when ``.Values.flower.secretName`` is set or when ``.Values.flower.user`` and ``.Values.flower.password`` +are set. So if you do not set any of the ``.Values.flower.*`` variables, you can freely configure +flower Basic Auth using the ``_CMD`` or ``_SECRET`` variant without disabling the basic variant. + ++-------------------------------------------------------+------------------------------------------+------------------------------------------------+ +| Default secret name if secret name not specified | Use a different Kubernetes Secret | Airflow Environment Variable | ++=======================================================+==========================================+================================================+ +| ``-redis-password`` | ``.Values.redis.passwordSecretName`` | ``REDIS_PASSWORD`` | ++-------------------------------------------------------+------------------------------------------+------------------------------------------------+ +| ``-pgbouncer-config`` | ``.Values.pgbouncer.configSecretName`` | | ++-------------------------------------------------------+------------------------------------------+------------------------------------------------+ +| ``-pgbouncer-certificates`` | | | ++-------------------------------------------------------+------------------------------------------+------------------------------------------------+ +| ``-registry`` | ``.Values.registry.secretName`` | | ++-------------------------------------------------------+------------------------------------------+------------------------------------------------+ +| ``-kerberos-keytab`` | | | ++-------------------------------------------------------+------------------------------------------+------------------------------------------------+ +| ``-flower`` | ``.Values.flower.secretName`` | ``AIRFLOW__CELERY__FLOWER_BASIC_AUTH`` | ++-------------------------------------------------------+------------------------------------------+------------------------------------------------+ + +You can read more about advanced ways of setting configuration variables in the +:doc:`apache-airflow:howto/set-config`. diff --git a/docs-archive/helm-chart/1.14.0/_sources/quick-start.rst.txt b/docs-archive/helm-chart/1.14.0/_sources/quick-start.rst.txt new file mode 100644 index 00000000000..df8239917ee --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_sources/quick-start.rst.txt @@ -0,0 +1,224 @@ + .. Licensed to the Apache Software Foundation (ASF) under one + or more contributor license agreements. See the NOTICE file + distributed with this work for additional information + regarding copyright ownership. The ASF licenses this file + to you under the Apache License, Version 2.0 (the + "License"); you may not use this file except in compliance + with the License. You may obtain a copy of the License at + + .. http://www.apache.org/licenses/LICENSE-2.0 + + .. Unless required by applicable law or agreed to in writing, + software distributed under the License is distributed on an + "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY + KIND, either express or implied. See the License for the + specific language governing permissions and limitations + under the License. + +Quick start with kind +===================== + +This article will show you how to install Airflow using Helm Chart on `Kind `__ + +Install kind, and create a cluster +---------------------------------- + +We recommend testing with Kubernetes 1.20+, example: + +.. code-block:: bash + + kind create cluster --image kindest/node:v1.21.1 + +Confirm it's up: + +.. code-block:: bash + + kubectl cluster-info --context kind-kind + +Add Airflow Helm Stable Repo +---------------------------- + +.. code-block:: bash + + helm repo add apache-airflow https://airflow.apache.org + helm repo update + +Create namespace +---------------- + +.. code-block:: bash + + export NAMESPACE=example-namespace + kubectl create namespace $NAMESPACE + +Install the chart +----------------- + +.. code-block:: bash + + export RELEASE_NAME=example-release + helm install $RELEASE_NAME apache-airflow/airflow --namespace $NAMESPACE + +Use the following code to install the chart with Example DAGs: + +.. code-block:: bash + + export NAMESPACE=example-namespace + helm install $RELEASE_NAME apache-airflow/airflow \ + --namespace $NAMESPACE \ + --set-string "env[0].name=AIRFLOW__CORE__LOAD_EXAMPLES" \ + --set-string "env[0].value=True" + +It may take a few minutes. Confirm the pods are up: + +.. code-block:: bash + + kubectl get pods --namespace $NAMESPACE + helm list --namespace $NAMESPACE + +Run the following command +to port-forward the Airflow UI to http://localhost:8080/ to confirm +Airflow is working. + +.. code-block:: bash + + kubectl port-forward svc/$RELEASE_NAME-webserver 8080:8080 --namespace $NAMESPACE + +Extending Airflow Image +----------------------- + +The Apache Airflow community, releases Docker Images which are ``reference images`` for Apache Airflow. +However, when you try it out you want to add your own DAGs, custom dependencies, +packages, or even custom providers. + +.. note:: + Creating custom images means that you need to maintain also a level of automation as you need to re-create the images + when either the packages you want to install or Airflow is upgraded. Please do not forget about keeping these scripts. + Also keep in mind, that in cases when you run pure Python tasks, you can use the + `Python Virtualenv functions `_ + which will dynamically source and install python dependencies during runtime. With Airflow 2.8.0 Virtualenvs can also be cached. + +The best way to achieve it, is to build your own, custom image. + +Adding DAGs to your image +......................... + +1. Create a project + + .. code-block:: bash + + mkdir my-airflow-project && cd my-airflow-project + mkdir dags # put dags here + cat < Dockerfile + FROM apache/airflow + COPY . . + EOM + + +2. Then build the image: + + .. code-block:: bash + + docker build --pull --tag my-dags:0.0.1 . + + +3. Load the image into kind: + + .. code-block:: bash + + kind load docker-image my-dags:0.0.1 + +4. Upgrade Helm deployment: + + .. code-block:: bash + + helm upgrade $RELEASE_NAME apache-airflow/airflow --namespace $NAMESPACE \ + --set images.airflow.repository=my-dags \ + --set images.airflow.tag=0.0.1 + +Adding ``apt`` packages to your image +..................................... + +Example below adds ``vim`` apt package. + +1. Create a project + + .. code-block:: bash + + mkdir my-airflow-project && cd my-airflow-project + cat < Dockerfile + FROM apache/airflow + USER root + RUN apt-get update \ + && apt-get install -y --no-install-recommends \ + vim \ + && apt-get autoremove -yqq --purge \ + && apt-get clean \ + && rm -rf /var/lib/apt/lists/* + USER airflow + EOM + + +2. Then build the image: + + .. code-block:: bash + + docker build --pull --tag my-image:0.0.1 . + + +3. Load the image into kind: + + .. code-block:: bash + + kind load docker-image my-image:0.0.1 + +4. Upgrade Helm deployment: + + .. code-block:: bash + + helm upgrade $RELEASE_NAME apache-airflow/airflow --namespace $NAMESPACE \ + --set images.airflow.repository=my-image \ + --set images.airflow.tag=0.0.1 + +Adding ``PyPI`` packages to your image +...................................... + +Example below adds ``lxml`` PyPI package. + +1. Create a project + + .. code-block:: bash + + mkdir my-airflow-project && cd my-airflow-project + cat < Dockerfile + FROM apache/airflow + RUN pip install --no-cache-dir lxml + EOM + + +2. Then build the image: + + .. code-block:: bash + + docker build --pull --tag my-image:0.0.1 . + + +3. Load the image into kind: + + .. code-block:: bash + + kind load docker-image my-image:0.0.1 + +4. Upgrade Helm deployment: + + .. code-block:: bash + + helm upgrade $RELEASE_NAME apache-airflow/airflow --namespace $NAMESPACE \ + --set images.airflow.repository=my-image \ + --set images.airflow.tag=0.0.1 + +Further extending and customizing the image +........................................... + +See `Building the image `_ for more +details on how you can extend and customize the Airflow image. diff --git a/docs-archive/helm-chart/1.14.0/_sources/release_notes.rst.txt b/docs-archive/helm-chart/1.14.0/_sources/release_notes.rst.txt new file mode 100644 index 00000000000..66a19993867 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_sources/release_notes.rst.txt @@ -0,0 +1,23 @@ + .. Licensed to the Apache Software Foundation (ASF) under one + or more contributor license agreements. See the NOTICE file + distributed with this work for additional information + regarding copyright ownership. The ASF licenses this file + to you under the Apache License, Version 2.0 (the + "License"); you may not use this file except in compliance + with the License. You may obtain a copy of the License at + + .. http://www.apache.org/licenses/LICENSE-2.0 + + .. Unless required by applicable law or agreed to in writing, + software distributed under the License is distributed on an + "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY + KIND, either express or implied. See the License for the + specific language governing permissions and limitations + under the License. + + + +Release Notes +============= + +.. include:: ../../chart/RELEASE_NOTES.rst diff --git a/docs-archive/helm-chart/1.14.0/_sources/setting-resources-for-containers.rst.txt b/docs-archive/helm-chart/1.14.0/_sources/setting-resources-for-containers.rst.txt new file mode 100644 index 00000000000..bdc6b9d1370 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_sources/setting-resources-for-containers.rst.txt @@ -0,0 +1,70 @@ + .. Licensed to the Apache Software Foundation (ASF) under one + or more contributor license agreements. See the NOTICE file + distributed with this work for additional information + regarding copyright ownership. The ASF licenses this file + to you under the Apache License, Version 2.0 (the + "License"); you may not use this file except in compliance + with the License. You may obtain a copy of the License at + + .. http://www.apache.org/licenses/LICENSE-2.0 + + .. Unless required by applicable law or agreed to in writing, + software distributed under the License is distributed on an + "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY + KIND, either express or implied. See the License for the + specific language governing permissions and limitations + under the License. + +Setting resources for containers +-------------------------------- + +It is possible to set `resources `__ for the Containers managed by the chart. You can define different resources for various Airflow k8s Containers. By default the resources are not set. + +.. note:: + The k8s scheduler can use resources to decide which node to place the Pod on. Since a Pod resource request/limit is the sum of the resource requests/limits for each Container in the Pod, it is advised to specify resources for each Container in the Pod. + +Possible Containers where resources can be configured include: + +* Main Airflow Containers and their sidecars. You can add the resources for these Containers through the following parameters: + + * ``workers.resources`` + * ``workers.logGroomerSidecar.resources`` + * ``workers.kerberosSidecar.resources`` + * ``workers.kerberosInitContainer.resources`` + * ``scheduler.resources`` + * ``scheduler.logGroomerSidecar.resources`` + * ``dags.gitSync.resources`` + * ``webserver.resources`` + * ``flower.resources`` + * ``dagProcessor.resources`` + * ``dagProcessor.logGroomerSidecar.resources`` + * ``triggerer.resources`` + * ``triggerer.logGroomerSidecar.resources`` + +* Containers used for Airflow k8s jobs or cron jobs. You can add the resources for these Containers through the following parameters: + + * ``cleanup.resources`` + * ``createUserJob.resources`` + * ``migrateDatabaseJob.resources`` + +* Other containers that can be deployed by the chart. You can add the resources for these Containers through the following parameters: + + * ``statsd.resources`` + * ``pgbouncer.resources`` + * ``pgbouncer.metricsExporterSidecar.resources`` + * ``redis.resources`` + + +For example, specifying resources for worker Kerberos sidecar: + +.. code-block:: yaml + + workers: + kerberosSidecar: + resources: + limits: + cpu: 200m + memory: 256Mi + requests: + cpu: 100m + memory: 128Mi diff --git a/docs-archive/helm-chart/1.14.0/_sources/using-additional-containers.rst.txt b/docs-archive/helm-chart/1.14.0/_sources/using-additional-containers.rst.txt new file mode 100644 index 00000000000..4c3b6d6f829 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_sources/using-additional-containers.rst.txt @@ -0,0 +1,64 @@ + .. Licensed to the Apache Software Foundation (ASF) under one + or more contributor license agreements. See the NOTICE file + distributed with this work for additional information + regarding copyright ownership. The ASF licenses this file + to you under the Apache License, Version 2.0 (the + "License"); you may not use this file except in compliance + with the License. You may obtain a copy of the License at + + .. http://www.apache.org/licenses/LICENSE-2.0 + + .. Unless required by applicable law or agreed to in writing, + software distributed under the License is distributed on an + "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY + KIND, either express or implied. See the License for the + specific language governing permissions and limitations + under the License. + +Using additional containers +=========================== + +Sidecar Containers +------------------ + +If you want to deploy your own sidecar container, you can add it through the ``extraContainers`` parameter. +You can define different containers for the scheduler, webserver, worker, triggerer, DAG processor, flower, create user Job and migrate database Job Pods. + +For example, sidecars that sync DAGs from object storage. + +.. code-block:: yaml + + scheduler: + extraContainers: + - name: s3-sync + image: my-company/s3-sync:latest + imagePullPolicy: Always + workers: + extraContainers: + - name: s3-sync + image: my-company/s3-sync:latest + imagePullPolicy: Always + +.. note:: + + If you use ``workers.extraContainers`` with ``KubernetesExecutor``, you are responsible for signaling + sidecars to exit when the main container finishes so Airflow can continue the worker shutdown process! + + +Init Containers +--------------- + +You can also deploy extra init containers through the ``extraInitContainers`` parameter. +You can define different containers for the scheduler, webserver, worker, triggerer and DAG processor pods. + +For example, an init container that just says hello: + +.. code-block:: yaml + + scheduler: + extraInitContainers: + - name: hello + image: debian + args: + - echo + - hello diff --git a/docs-archive/helm-chart/1.14.0/_sphinx_design_static/design-style.1e8bd061cd6da7fc9cf755528e8ffc24.min.css b/docs-archive/helm-chart/1.14.0/_sphinx_design_static/design-style.1e8bd061cd6da7fc9cf755528e8ffc24.min.css new file mode 100644 index 00000000000..eb19f698afc --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_sphinx_design_static/design-style.1e8bd061cd6da7fc9cf755528e8ffc24.min.css @@ -0,0 +1 @@ +.sd-bg-primary{background-color:var(--sd-color-primary) !important}.sd-bg-text-primary{color:var(--sd-color-primary-text) !important}button.sd-bg-primary:focus,button.sd-bg-primary:hover{background-color:var(--sd-color-primary-highlight) !important}a.sd-bg-primary:focus,a.sd-bg-primary:hover{background-color:var(--sd-color-primary-highlight) !important}.sd-bg-secondary{background-color:var(--sd-color-secondary) !important}.sd-bg-text-secondary{color:var(--sd-color-secondary-text) !important}button.sd-bg-secondary:focus,button.sd-bg-secondary:hover{background-color:var(--sd-color-secondary-highlight) !important}a.sd-bg-secondary:focus,a.sd-bg-secondary:hover{background-color:var(--sd-color-secondary-highlight) !important}.sd-bg-success{background-color:var(--sd-color-success) !important}.sd-bg-text-success{color:var(--sd-color-success-text) !important}button.sd-bg-success:focus,button.sd-bg-success:hover{background-color:var(--sd-color-success-highlight) !important}a.sd-bg-success:focus,a.sd-bg-success:hover{background-color:var(--sd-color-success-highlight) !important}.sd-bg-info{background-color:var(--sd-color-info) !important}.sd-bg-text-info{color:var(--sd-color-info-text) !important}button.sd-bg-info:focus,button.sd-bg-info:hover{background-color:var(--sd-color-info-highlight) !important}a.sd-bg-info:focus,a.sd-bg-info:hover{background-color:var(--sd-color-info-highlight) !important}.sd-bg-warning{background-color:var(--sd-color-warning) !important}.sd-bg-text-warning{color:var(--sd-color-warning-text) !important}button.sd-bg-warning:focus,button.sd-bg-warning:hover{background-color:var(--sd-color-warning-highlight) !important}a.sd-bg-warning:focus,a.sd-bg-warning:hover{background-color:var(--sd-color-warning-highlight) !important}.sd-bg-danger{background-color:var(--sd-color-danger) !important}.sd-bg-text-danger{color:var(--sd-color-danger-text) !important}button.sd-bg-danger:focus,button.sd-bg-danger:hover{background-color:var(--sd-color-danger-highlight) !important}a.sd-bg-danger:focus,a.sd-bg-danger:hover{background-color:var(--sd-color-danger-highlight) !important}.sd-bg-light{background-color:var(--sd-color-light) !important}.sd-bg-text-light{color:var(--sd-color-light-text) !important}button.sd-bg-light:focus,button.sd-bg-light:hover{background-color:var(--sd-color-light-highlight) !important}a.sd-bg-light:focus,a.sd-bg-light:hover{background-color:var(--sd-color-light-highlight) !important}.sd-bg-muted{background-color:var(--sd-color-muted) !important}.sd-bg-text-muted{color:var(--sd-color-muted-text) !important}button.sd-bg-muted:focus,button.sd-bg-muted:hover{background-color:var(--sd-color-muted-highlight) !important}a.sd-bg-muted:focus,a.sd-bg-muted:hover{background-color:var(--sd-color-muted-highlight) !important}.sd-bg-dark{background-color:var(--sd-color-dark) !important}.sd-bg-text-dark{color:var(--sd-color-dark-text) !important}button.sd-bg-dark:focus,button.sd-bg-dark:hover{background-color:var(--sd-color-dark-highlight) !important}a.sd-bg-dark:focus,a.sd-bg-dark:hover{background-color:var(--sd-color-dark-highlight) !important}.sd-bg-black{background-color:var(--sd-color-black) !important}.sd-bg-text-black{color:var(--sd-color-black-text) !important}button.sd-bg-black:focus,button.sd-bg-black:hover{background-color:var(--sd-color-black-highlight) !important}a.sd-bg-black:focus,a.sd-bg-black:hover{background-color:var(--sd-color-black-highlight) !important}.sd-bg-white{background-color:var(--sd-color-white) !important}.sd-bg-text-white{color:var(--sd-color-white-text) !important}button.sd-bg-white:focus,button.sd-bg-white:hover{background-color:var(--sd-color-white-highlight) !important}a.sd-bg-white:focus,a.sd-bg-white:hover{background-color:var(--sd-color-white-highlight) !important}.sd-text-primary,.sd-text-primary>p{color:var(--sd-color-primary) !important}a.sd-text-primary:focus,a.sd-text-primary:hover{color:var(--sd-color-primary-highlight) !important}.sd-text-secondary,.sd-text-secondary>p{color:var(--sd-color-secondary) !important}a.sd-text-secondary:focus,a.sd-text-secondary:hover{color:var(--sd-color-secondary-highlight) !important}.sd-text-success,.sd-text-success>p{color:var(--sd-color-success) !important}a.sd-text-success:focus,a.sd-text-success:hover{color:var(--sd-color-success-highlight) !important}.sd-text-info,.sd-text-info>p{color:var(--sd-color-info) !important}a.sd-text-info:focus,a.sd-text-info:hover{color:var(--sd-color-info-highlight) !important}.sd-text-warning,.sd-text-warning>p{color:var(--sd-color-warning) !important}a.sd-text-warning:focus,a.sd-text-warning:hover{color:var(--sd-color-warning-highlight) !important}.sd-text-danger,.sd-text-danger>p{color:var(--sd-color-danger) !important}a.sd-text-danger:focus,a.sd-text-danger:hover{color:var(--sd-color-danger-highlight) !important}.sd-text-light,.sd-text-light>p{color:var(--sd-color-light) !important}a.sd-text-light:focus,a.sd-text-light:hover{color:var(--sd-color-light-highlight) !important}.sd-text-muted,.sd-text-muted>p{color:var(--sd-color-muted) !important}a.sd-text-muted:focus,a.sd-text-muted:hover{color:var(--sd-color-muted-highlight) !important}.sd-text-dark,.sd-text-dark>p{color:var(--sd-color-dark) !important}a.sd-text-dark:focus,a.sd-text-dark:hover{color:var(--sd-color-dark-highlight) !important}.sd-text-black,.sd-text-black>p{color:var(--sd-color-black) !important}a.sd-text-black:focus,a.sd-text-black:hover{color:var(--sd-color-black-highlight) !important}.sd-text-white,.sd-text-white>p{color:var(--sd-color-white) !important}a.sd-text-white:focus,a.sd-text-white:hover{color:var(--sd-color-white-highlight) !important}.sd-outline-primary{border-color:var(--sd-color-primary) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-primary:focus,a.sd-outline-primary:hover{border-color:var(--sd-color-primary-highlight) !important}.sd-outline-secondary{border-color:var(--sd-color-secondary) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-secondary:focus,a.sd-outline-secondary:hover{border-color:var(--sd-color-secondary-highlight) !important}.sd-outline-success{border-color:var(--sd-color-success) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-success:focus,a.sd-outline-success:hover{border-color:var(--sd-color-success-highlight) !important}.sd-outline-info{border-color:var(--sd-color-info) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-info:focus,a.sd-outline-info:hover{border-color:var(--sd-color-info-highlight) !important}.sd-outline-warning{border-color:var(--sd-color-warning) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-warning:focus,a.sd-outline-warning:hover{border-color:var(--sd-color-warning-highlight) !important}.sd-outline-danger{border-color:var(--sd-color-danger) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-danger:focus,a.sd-outline-danger:hover{border-color:var(--sd-color-danger-highlight) !important}.sd-outline-light{border-color:var(--sd-color-light) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-light:focus,a.sd-outline-light:hover{border-color:var(--sd-color-light-highlight) !important}.sd-outline-muted{border-color:var(--sd-color-muted) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-muted:focus,a.sd-outline-muted:hover{border-color:var(--sd-color-muted-highlight) !important}.sd-outline-dark{border-color:var(--sd-color-dark) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-dark:focus,a.sd-outline-dark:hover{border-color:var(--sd-color-dark-highlight) !important}.sd-outline-black{border-color:var(--sd-color-black) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-black:focus,a.sd-outline-black:hover{border-color:var(--sd-color-black-highlight) !important}.sd-outline-white{border-color:var(--sd-color-white) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-white:focus,a.sd-outline-white:hover{border-color:var(--sd-color-white-highlight) !important}.sd-bg-transparent{background-color:transparent !important}.sd-outline-transparent{border-color:transparent !important}.sd-text-transparent{color:transparent !important}.sd-p-0{padding:0 !important}.sd-pt-0,.sd-py-0{padding-top:0 !important}.sd-pr-0,.sd-px-0{padding-right:0 !important}.sd-pb-0,.sd-py-0{padding-bottom:0 !important}.sd-pl-0,.sd-px-0{padding-left:0 !important}.sd-p-1{padding:.25rem !important}.sd-pt-1,.sd-py-1{padding-top:.25rem !important}.sd-pr-1,.sd-px-1{padding-right:.25rem !important}.sd-pb-1,.sd-py-1{padding-bottom:.25rem !important}.sd-pl-1,.sd-px-1{padding-left:.25rem !important}.sd-p-2{padding:.5rem !important}.sd-pt-2,.sd-py-2{padding-top:.5rem !important}.sd-pr-2,.sd-px-2{padding-right:.5rem !important}.sd-pb-2,.sd-py-2{padding-bottom:.5rem !important}.sd-pl-2,.sd-px-2{padding-left:.5rem !important}.sd-p-3{padding:1rem !important}.sd-pt-3,.sd-py-3{padding-top:1rem !important}.sd-pr-3,.sd-px-3{padding-right:1rem !important}.sd-pb-3,.sd-py-3{padding-bottom:1rem !important}.sd-pl-3,.sd-px-3{padding-left:1rem !important}.sd-p-4{padding:1.5rem !important}.sd-pt-4,.sd-py-4{padding-top:1.5rem !important}.sd-pr-4,.sd-px-4{padding-right:1.5rem !important}.sd-pb-4,.sd-py-4{padding-bottom:1.5rem !important}.sd-pl-4,.sd-px-4{padding-left:1.5rem !important}.sd-p-5{padding:3rem !important}.sd-pt-5,.sd-py-5{padding-top:3rem !important}.sd-pr-5,.sd-px-5{padding-right:3rem !important}.sd-pb-5,.sd-py-5{padding-bottom:3rem !important}.sd-pl-5,.sd-px-5{padding-left:3rem !important}.sd-m-auto{margin:auto !important}.sd-mt-auto,.sd-my-auto{margin-top:auto !important}.sd-mr-auto,.sd-mx-auto{margin-right:auto !important}.sd-mb-auto,.sd-my-auto{margin-bottom:auto !important}.sd-ml-auto,.sd-mx-auto{margin-left:auto !important}.sd-m-0{margin:0 !important}.sd-mt-0,.sd-my-0{margin-top:0 !important}.sd-mr-0,.sd-mx-0{margin-right:0 !important}.sd-mb-0,.sd-my-0{margin-bottom:0 !important}.sd-ml-0,.sd-mx-0{margin-left:0 !important}.sd-m-1{margin:.25rem !important}.sd-mt-1,.sd-my-1{margin-top:.25rem !important}.sd-mr-1,.sd-mx-1{margin-right:.25rem !important}.sd-mb-1,.sd-my-1{margin-bottom:.25rem !important}.sd-ml-1,.sd-mx-1{margin-left:.25rem !important}.sd-m-2{margin:.5rem !important}.sd-mt-2,.sd-my-2{margin-top:.5rem !important}.sd-mr-2,.sd-mx-2{margin-right:.5rem !important}.sd-mb-2,.sd-my-2{margin-bottom:.5rem !important}.sd-ml-2,.sd-mx-2{margin-left:.5rem !important}.sd-m-3{margin:1rem !important}.sd-mt-3,.sd-my-3{margin-top:1rem !important}.sd-mr-3,.sd-mx-3{margin-right:1rem !important}.sd-mb-3,.sd-my-3{margin-bottom:1rem !important}.sd-ml-3,.sd-mx-3{margin-left:1rem !important}.sd-m-4{margin:1.5rem !important}.sd-mt-4,.sd-my-4{margin-top:1.5rem !important}.sd-mr-4,.sd-mx-4{margin-right:1.5rem !important}.sd-mb-4,.sd-my-4{margin-bottom:1.5rem !important}.sd-ml-4,.sd-mx-4{margin-left:1.5rem !important}.sd-m-5{margin:3rem !important}.sd-mt-5,.sd-my-5{margin-top:3rem !important}.sd-mr-5,.sd-mx-5{margin-right:3rem !important}.sd-mb-5,.sd-my-5{margin-bottom:3rem !important}.sd-ml-5,.sd-mx-5{margin-left:3rem !important}.sd-w-25{width:25% !important}.sd-w-50{width:50% !important}.sd-w-75{width:75% !important}.sd-w-100{width:100% !important}.sd-w-auto{width:auto !important}.sd-h-25{height:25% !important}.sd-h-50{height:50% !important}.sd-h-75{height:75% !important}.sd-h-100{height:100% !important}.sd-h-auto{height:auto !important}.sd-d-none{display:none !important}.sd-d-inline{display:inline !important}.sd-d-inline-block{display:inline-block !important}.sd-d-block{display:block !important}.sd-d-grid{display:grid !important}.sd-d-flex-row{display:-ms-flexbox !important;display:flex !important;flex-direction:row !important}.sd-d-flex-column{display:-ms-flexbox !important;display:flex !important;flex-direction:column !important}.sd-d-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}@media(min-width: 576px){.sd-d-sm-none{display:none !important}.sd-d-sm-inline{display:inline !important}.sd-d-sm-inline-block{display:inline-block !important}.sd-d-sm-block{display:block !important}.sd-d-sm-grid{display:grid !important}.sd-d-sm-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-sm-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 768px){.sd-d-md-none{display:none !important}.sd-d-md-inline{display:inline !important}.sd-d-md-inline-block{display:inline-block !important}.sd-d-md-block{display:block !important}.sd-d-md-grid{display:grid !important}.sd-d-md-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-md-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 992px){.sd-d-lg-none{display:none !important}.sd-d-lg-inline{display:inline !important}.sd-d-lg-inline-block{display:inline-block !important}.sd-d-lg-block{display:block !important}.sd-d-lg-grid{display:grid !important}.sd-d-lg-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-lg-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 1200px){.sd-d-xl-none{display:none !important}.sd-d-xl-inline{display:inline !important}.sd-d-xl-inline-block{display:inline-block !important}.sd-d-xl-block{display:block !important}.sd-d-xl-grid{display:grid !important}.sd-d-xl-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-xl-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}.sd-align-major-start{justify-content:flex-start !important}.sd-align-major-end{justify-content:flex-end !important}.sd-align-major-center{justify-content:center !important}.sd-align-major-justify{justify-content:space-between !important}.sd-align-major-spaced{justify-content:space-evenly !important}.sd-align-minor-start{align-items:flex-start !important}.sd-align-minor-end{align-items:flex-end !important}.sd-align-minor-center{align-items:center !important}.sd-align-minor-stretch{align-items:stretch !important}.sd-text-justify{text-align:justify !important}.sd-text-left{text-align:left !important}.sd-text-right{text-align:right !important}.sd-text-center{text-align:center !important}.sd-font-weight-light{font-weight:300 !important}.sd-font-weight-lighter{font-weight:lighter !important}.sd-font-weight-normal{font-weight:400 !important}.sd-font-weight-bold{font-weight:700 !important}.sd-font-weight-bolder{font-weight:bolder !important}.sd-font-italic{font-style:italic !important}.sd-text-decoration-none{text-decoration:none !important}.sd-text-lowercase{text-transform:lowercase !important}.sd-text-uppercase{text-transform:uppercase !important}.sd-text-capitalize{text-transform:capitalize !important}.sd-text-wrap{white-space:normal !important}.sd-text-nowrap{white-space:nowrap !important}.sd-text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.sd-fs-1,.sd-fs-1>p{font-size:calc(1.375rem + 1.5vw) !important;line-height:unset !important}.sd-fs-2,.sd-fs-2>p{font-size:calc(1.325rem + 0.9vw) !important;line-height:unset !important}.sd-fs-3,.sd-fs-3>p{font-size:calc(1.3rem + 0.6vw) !important;line-height:unset !important}.sd-fs-4,.sd-fs-4>p{font-size:calc(1.275rem + 0.3vw) !important;line-height:unset !important}.sd-fs-5,.sd-fs-5>p{font-size:1.25rem !important;line-height:unset !important}.sd-fs-6,.sd-fs-6>p{font-size:1rem !important;line-height:unset !important}.sd-border-0{border:0 solid !important}.sd-border-top-0{border-top:0 solid !important}.sd-border-bottom-0{border-bottom:0 solid !important}.sd-border-right-0{border-right:0 solid !important}.sd-border-left-0{border-left:0 solid !important}.sd-border-1{border:1px solid !important}.sd-border-top-1{border-top:1px solid !important}.sd-border-bottom-1{border-bottom:1px solid !important}.sd-border-right-1{border-right:1px solid !important}.sd-border-left-1{border-left:1px solid !important}.sd-border-2{border:2px solid !important}.sd-border-top-2{border-top:2px solid !important}.sd-border-bottom-2{border-bottom:2px solid !important}.sd-border-right-2{border-right:2px solid !important}.sd-border-left-2{border-left:2px solid !important}.sd-border-3{border:3px solid !important}.sd-border-top-3{border-top:3px solid !important}.sd-border-bottom-3{border-bottom:3px solid !important}.sd-border-right-3{border-right:3px solid !important}.sd-border-left-3{border-left:3px solid !important}.sd-border-4{border:4px solid !important}.sd-border-top-4{border-top:4px solid !important}.sd-border-bottom-4{border-bottom:4px solid !important}.sd-border-right-4{border-right:4px solid !important}.sd-border-left-4{border-left:4px solid !important}.sd-border-5{border:5px solid !important}.sd-border-top-5{border-top:5px solid !important}.sd-border-bottom-5{border-bottom:5px solid !important}.sd-border-right-5{border-right:5px solid !important}.sd-border-left-5{border-left:5px solid !important}.sd-rounded-0{border-radius:0 !important}.sd-rounded-1{border-radius:.2rem !important}.sd-rounded-2{border-radius:.3rem !important}.sd-rounded-3{border-radius:.5rem !important}.sd-rounded-pill{border-radius:50rem !important}.sd-rounded-circle{border-radius:50% !important}.shadow-none{box-shadow:none !important}.sd-shadow-sm{box-shadow:0 .125rem .25rem var(--sd-color-shadow) !important}.sd-shadow-md{box-shadow:0 .5rem 1rem var(--sd-color-shadow) !important}.sd-shadow-lg{box-shadow:0 1rem 3rem var(--sd-color-shadow) !important}@keyframes sd-slide-from-left{0%{transform:translateX(-100%)}100%{transform:translateX(0)}}@keyframes sd-slide-from-right{0%{transform:translateX(200%)}100%{transform:translateX(0)}}@keyframes sd-grow100{0%{transform:scale(0);opacity:.5}100%{transform:scale(1);opacity:1}}@keyframes sd-grow50{0%{transform:scale(0.5);opacity:.5}100%{transform:scale(1);opacity:1}}@keyframes sd-grow50-rot20{0%{transform:scale(0.5) rotateZ(-20deg);opacity:.5}75%{transform:scale(1) rotateZ(5deg);opacity:1}95%{transform:scale(1) rotateZ(-1deg);opacity:1}100%{transform:scale(1) rotateZ(0);opacity:1}}.sd-animate-slide-from-left{animation:1s ease-out 0s 1 normal none running sd-slide-from-left}.sd-animate-slide-from-right{animation:1s ease-out 0s 1 normal none running sd-slide-from-right}.sd-animate-grow100{animation:1s ease-out 0s 1 normal none running sd-grow100}.sd-animate-grow50{animation:1s ease-out 0s 1 normal none running sd-grow50}.sd-animate-grow50-rot20{animation:1s ease-out 0s 1 normal none running sd-grow50-rot20}.sd-badge{display:inline-block;padding:.35em .65em;font-size:.75em;font-weight:700;line-height:1;text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:.25rem}.sd-badge:empty{display:none}a.sd-badge{text-decoration:none}.sd-btn .sd-badge{position:relative;top:-1px}.sd-btn{background-color:transparent;border:1px solid transparent;border-radius:.25rem;cursor:pointer;display:inline-block;font-weight:400;font-size:1rem;line-height:1.5;padding:.375rem .75rem;text-align:center;text-decoration:none;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;vertical-align:middle;user-select:none;-moz-user-select:none;-ms-user-select:none;-webkit-user-select:none}.sd-btn:hover{text-decoration:none}@media(prefers-reduced-motion: reduce){.sd-btn{transition:none}}.sd-btn-primary,.sd-btn-outline-primary:hover,.sd-btn-outline-primary:focus{color:var(--sd-color-primary-text) !important;background-color:var(--sd-color-primary) !important;border-color:var(--sd-color-primary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-primary:hover,.sd-btn-primary:focus{color:var(--sd-color-primary-text) !important;background-color:var(--sd-color-primary-highlight) !important;border-color:var(--sd-color-primary-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-primary{color:var(--sd-color-primary) !important;border-color:var(--sd-color-primary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-secondary,.sd-btn-outline-secondary:hover,.sd-btn-outline-secondary:focus{color:var(--sd-color-secondary-text) !important;background-color:var(--sd-color-secondary) !important;border-color:var(--sd-color-secondary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-secondary:hover,.sd-btn-secondary:focus{color:var(--sd-color-secondary-text) !important;background-color:var(--sd-color-secondary-highlight) !important;border-color:var(--sd-color-secondary-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-secondary{color:var(--sd-color-secondary) !important;border-color:var(--sd-color-secondary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-success,.sd-btn-outline-success:hover,.sd-btn-outline-success:focus{color:var(--sd-color-success-text) !important;background-color:var(--sd-color-success) !important;border-color:var(--sd-color-success) !important;border-width:1px !important;border-style:solid !important}.sd-btn-success:hover,.sd-btn-success:focus{color:var(--sd-color-success-text) !important;background-color:var(--sd-color-success-highlight) !important;border-color:var(--sd-color-success-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-success{color:var(--sd-color-success) !important;border-color:var(--sd-color-success) !important;border-width:1px !important;border-style:solid !important}.sd-btn-info,.sd-btn-outline-info:hover,.sd-btn-outline-info:focus{color:var(--sd-color-info-text) !important;background-color:var(--sd-color-info) !important;border-color:var(--sd-color-info) !important;border-width:1px !important;border-style:solid !important}.sd-btn-info:hover,.sd-btn-info:focus{color:var(--sd-color-info-text) !important;background-color:var(--sd-color-info-highlight) !important;border-color:var(--sd-color-info-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-info{color:var(--sd-color-info) !important;border-color:var(--sd-color-info) !important;border-width:1px !important;border-style:solid !important}.sd-btn-warning,.sd-btn-outline-warning:hover,.sd-btn-outline-warning:focus{color:var(--sd-color-warning-text) !important;background-color:var(--sd-color-warning) !important;border-color:var(--sd-color-warning) !important;border-width:1px !important;border-style:solid !important}.sd-btn-warning:hover,.sd-btn-warning:focus{color:var(--sd-color-warning-text) !important;background-color:var(--sd-color-warning-highlight) !important;border-color:var(--sd-color-warning-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-warning{color:var(--sd-color-warning) !important;border-color:var(--sd-color-warning) !important;border-width:1px !important;border-style:solid !important}.sd-btn-danger,.sd-btn-outline-danger:hover,.sd-btn-outline-danger:focus{color:var(--sd-color-danger-text) !important;background-color:var(--sd-color-danger) !important;border-color:var(--sd-color-danger) !important;border-width:1px !important;border-style:solid !important}.sd-btn-danger:hover,.sd-btn-danger:focus{color:var(--sd-color-danger-text) !important;background-color:var(--sd-color-danger-highlight) !important;border-color:var(--sd-color-danger-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-danger{color:var(--sd-color-danger) !important;border-color:var(--sd-color-danger) !important;border-width:1px !important;border-style:solid !important}.sd-btn-light,.sd-btn-outline-light:hover,.sd-btn-outline-light:focus{color:var(--sd-color-light-text) !important;background-color:var(--sd-color-light) !important;border-color:var(--sd-color-light) !important;border-width:1px !important;border-style:solid !important}.sd-btn-light:hover,.sd-btn-light:focus{color:var(--sd-color-light-text) !important;background-color:var(--sd-color-light-highlight) !important;border-color:var(--sd-color-light-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-light{color:var(--sd-color-light) !important;border-color:var(--sd-color-light) !important;border-width:1px !important;border-style:solid !important}.sd-btn-muted,.sd-btn-outline-muted:hover,.sd-btn-outline-muted:focus{color:var(--sd-color-muted-text) !important;background-color:var(--sd-color-muted) !important;border-color:var(--sd-color-muted) !important;border-width:1px !important;border-style:solid !important}.sd-btn-muted:hover,.sd-btn-muted:focus{color:var(--sd-color-muted-text) !important;background-color:var(--sd-color-muted-highlight) !important;border-color:var(--sd-color-muted-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-muted{color:var(--sd-color-muted) !important;border-color:var(--sd-color-muted) !important;border-width:1px !important;border-style:solid !important}.sd-btn-dark,.sd-btn-outline-dark:hover,.sd-btn-outline-dark:focus{color:var(--sd-color-dark-text) !important;background-color:var(--sd-color-dark) !important;border-color:var(--sd-color-dark) !important;border-width:1px !important;border-style:solid !important}.sd-btn-dark:hover,.sd-btn-dark:focus{color:var(--sd-color-dark-text) !important;background-color:var(--sd-color-dark-highlight) !important;border-color:var(--sd-color-dark-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-dark{color:var(--sd-color-dark) !important;border-color:var(--sd-color-dark) !important;border-width:1px !important;border-style:solid !important}.sd-btn-black,.sd-btn-outline-black:hover,.sd-btn-outline-black:focus{color:var(--sd-color-black-text) !important;background-color:var(--sd-color-black) !important;border-color:var(--sd-color-black) !important;border-width:1px !important;border-style:solid !important}.sd-btn-black:hover,.sd-btn-black:focus{color:var(--sd-color-black-text) !important;background-color:var(--sd-color-black-highlight) !important;border-color:var(--sd-color-black-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-black{color:var(--sd-color-black) !important;border-color:var(--sd-color-black) !important;border-width:1px !important;border-style:solid !important}.sd-btn-white,.sd-btn-outline-white:hover,.sd-btn-outline-white:focus{color:var(--sd-color-white-text) !important;background-color:var(--sd-color-white) !important;border-color:var(--sd-color-white) !important;border-width:1px !important;border-style:solid !important}.sd-btn-white:hover,.sd-btn-white:focus{color:var(--sd-color-white-text) !important;background-color:var(--sd-color-white-highlight) !important;border-color:var(--sd-color-white-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-white{color:var(--sd-color-white) !important;border-color:var(--sd-color-white) !important;border-width:1px !important;border-style:solid !important}.sd-stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.sd-hide-link-text{font-size:0}.sd-octicon,.sd-material-icon{display:inline-block;fill:currentColor;vertical-align:middle}.sd-avatar-xs{border-radius:50%;object-fit:cover;object-position:center;width:1rem;height:1rem}.sd-avatar-sm{border-radius:50%;object-fit:cover;object-position:center;width:3rem;height:3rem}.sd-avatar-md{border-radius:50%;object-fit:cover;object-position:center;width:5rem;height:5rem}.sd-avatar-lg{border-radius:50%;object-fit:cover;object-position:center;width:7rem;height:7rem}.sd-avatar-xl{border-radius:50%;object-fit:cover;object-position:center;width:10rem;height:10rem}.sd-avatar-inherit{border-radius:50%;object-fit:cover;object-position:center;width:inherit;height:inherit}.sd-avatar-initial{border-radius:50%;object-fit:cover;object-position:center;width:initial;height:initial}.sd-card{background-clip:border-box;background-color:var(--sd-color-card-background);border:1px solid var(--sd-color-card-border);border-radius:.25rem;color:var(--sd-color-card-text);display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;min-width:0;position:relative;word-wrap:break-word}.sd-card>hr{margin-left:0;margin-right:0}.sd-card-hover:hover{border-color:var(--sd-color-card-border-hover);transform:scale(1.01)}.sd-card-body{-ms-flex:1 1 auto;flex:1 1 auto;padding:1rem 1rem}.sd-card-title{margin-bottom:.5rem}.sd-card-subtitle{margin-top:-0.25rem;margin-bottom:0}.sd-card-text:last-child{margin-bottom:0}.sd-card-link:hover{text-decoration:none}.sd-card-link+.card-link{margin-left:1rem}.sd-card-header{padding:.5rem 1rem;margin-bottom:0;background-color:var(--sd-color-card-header);border-bottom:1px solid var(--sd-color-card-border)}.sd-card-header:first-child{border-radius:calc(0.25rem - 1px) calc(0.25rem - 1px) 0 0}.sd-card-footer{padding:.5rem 1rem;background-color:var(--sd-color-card-footer);border-top:1px solid var(--sd-color-card-border)}.sd-card-footer:last-child{border-radius:0 0 calc(0.25rem - 1px) calc(0.25rem - 1px)}.sd-card-header-tabs{margin-right:-0.5rem;margin-bottom:-0.5rem;margin-left:-0.5rem;border-bottom:0}.sd-card-header-pills{margin-right:-0.5rem;margin-left:-0.5rem}.sd-card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:1rem;border-radius:calc(0.25rem - 1px)}.sd-card-img,.sd-card-img-bottom,.sd-card-img-top{width:100%}.sd-card-img,.sd-card-img-top{border-top-left-radius:calc(0.25rem - 1px);border-top-right-radius:calc(0.25rem - 1px)}.sd-card-img,.sd-card-img-bottom{border-bottom-left-radius:calc(0.25rem - 1px);border-bottom-right-radius:calc(0.25rem - 1px)}.sd-cards-carousel{width:100%;display:flex;flex-wrap:nowrap;-ms-flex-direction:row;flex-direction:row;overflow-x:hidden;scroll-snap-type:x mandatory}.sd-cards-carousel.sd-show-scrollbar{overflow-x:auto}.sd-cards-carousel:hover,.sd-cards-carousel:focus{overflow-x:auto}.sd-cards-carousel>.sd-card{flex-shrink:0;scroll-snap-align:start}.sd-cards-carousel>.sd-card:not(:last-child){margin-right:3px}.sd-card-cols-1>.sd-card{width:90%}.sd-card-cols-2>.sd-card{width:45%}.sd-card-cols-3>.sd-card{width:30%}.sd-card-cols-4>.sd-card{width:22.5%}.sd-card-cols-5>.sd-card{width:18%}.sd-card-cols-6>.sd-card{width:15%}.sd-card-cols-7>.sd-card{width:12.8571428571%}.sd-card-cols-8>.sd-card{width:11.25%}.sd-card-cols-9>.sd-card{width:10%}.sd-card-cols-10>.sd-card{width:9%}.sd-card-cols-11>.sd-card{width:8.1818181818%}.sd-card-cols-12>.sd-card{width:7.5%}.sd-container,.sd-container-fluid,.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container-xl{margin-left:auto;margin-right:auto;padding-left:var(--sd-gutter-x, 0.75rem);padding-right:var(--sd-gutter-x, 0.75rem);width:100%}@media(min-width: 576px){.sd-container-sm,.sd-container{max-width:540px}}@media(min-width: 768px){.sd-container-md,.sd-container-sm,.sd-container{max-width:720px}}@media(min-width: 992px){.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container{max-width:960px}}@media(min-width: 1200px){.sd-container-xl,.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container{max-width:1140px}}.sd-row{--sd-gutter-x: 1.5rem;--sd-gutter-y: 0;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-top:calc(var(--sd-gutter-y) * -1);margin-right:calc(var(--sd-gutter-x) * -0.5);margin-left:calc(var(--sd-gutter-x) * -0.5)}.sd-row>*{box-sizing:border-box;flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--sd-gutter-x) * 0.5);padding-left:calc(var(--sd-gutter-x) * 0.5);margin-top:var(--sd-gutter-y)}.sd-col{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-auto>*{flex:0 0 auto;width:auto}.sd-row-cols-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}@media(min-width: 576px){.sd-col-sm{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-sm-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-sm-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-sm-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-sm-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-sm-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-sm-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-sm-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-sm-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-sm-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-sm-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-sm-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-sm-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-sm-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 768px){.sd-col-md{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-md-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-md-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-md-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-md-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-md-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-md-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-md-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-md-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-md-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-md-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-md-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-md-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-md-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 992px){.sd-col-lg{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-lg-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-lg-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-lg-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-lg-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-lg-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-lg-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-lg-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-lg-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-lg-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-lg-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-lg-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-lg-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-lg-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 1200px){.sd-col-xl{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-xl-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-xl-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-xl-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-xl-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-xl-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-xl-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-xl-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-xl-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-xl-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-xl-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-xl-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-xl-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-xl-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}.sd-col-auto{flex:0 0 auto;-ms-flex:0 0 auto;width:auto}.sd-col-1{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}.sd-col-2{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-col-3{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-col-4{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-col-5{flex:0 0 auto;-ms-flex:0 0 auto;width:41.6666666667%}.sd-col-6{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-col-7{flex:0 0 auto;-ms-flex:0 0 auto;width:58.3333333333%}.sd-col-8{flex:0 0 auto;-ms-flex:0 0 auto;width:66.6666666667%}.sd-col-9{flex:0 0 auto;-ms-flex:0 0 auto;width:75%}.sd-col-10{flex:0 0 auto;-ms-flex:0 0 auto;width:83.3333333333%}.sd-col-11{flex:0 0 auto;-ms-flex:0 0 auto;width:91.6666666667%}.sd-col-12{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-g-0,.sd-gy-0{--sd-gutter-y: 0}.sd-g-0,.sd-gx-0{--sd-gutter-x: 0}.sd-g-1,.sd-gy-1{--sd-gutter-y: 0.25rem}.sd-g-1,.sd-gx-1{--sd-gutter-x: 0.25rem}.sd-g-2,.sd-gy-2{--sd-gutter-y: 0.5rem}.sd-g-2,.sd-gx-2{--sd-gutter-x: 0.5rem}.sd-g-3,.sd-gy-3{--sd-gutter-y: 1rem}.sd-g-3,.sd-gx-3{--sd-gutter-x: 1rem}.sd-g-4,.sd-gy-4{--sd-gutter-y: 1.5rem}.sd-g-4,.sd-gx-4{--sd-gutter-x: 1.5rem}.sd-g-5,.sd-gy-5{--sd-gutter-y: 3rem}.sd-g-5,.sd-gx-5{--sd-gutter-x: 3rem}@media(min-width: 576px){.sd-col-sm-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-sm-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-sm-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-sm-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-sm-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-sm-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-sm-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-sm-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-sm-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-sm-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-sm-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-sm-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-sm-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-sm-0,.sd-gy-sm-0{--sd-gutter-y: 0}.sd-g-sm-0,.sd-gx-sm-0{--sd-gutter-x: 0}.sd-g-sm-1,.sd-gy-sm-1{--sd-gutter-y: 0.25rem}.sd-g-sm-1,.sd-gx-sm-1{--sd-gutter-x: 0.25rem}.sd-g-sm-2,.sd-gy-sm-2{--sd-gutter-y: 0.5rem}.sd-g-sm-2,.sd-gx-sm-2{--sd-gutter-x: 0.5rem}.sd-g-sm-3,.sd-gy-sm-3{--sd-gutter-y: 1rem}.sd-g-sm-3,.sd-gx-sm-3{--sd-gutter-x: 1rem}.sd-g-sm-4,.sd-gy-sm-4{--sd-gutter-y: 1.5rem}.sd-g-sm-4,.sd-gx-sm-4{--sd-gutter-x: 1.5rem}.sd-g-sm-5,.sd-gy-sm-5{--sd-gutter-y: 3rem}.sd-g-sm-5,.sd-gx-sm-5{--sd-gutter-x: 3rem}}@media(min-width: 768px){.sd-col-md-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-md-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-md-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-md-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-md-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-md-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-md-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-md-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-md-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-md-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-md-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-md-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-md-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-md-0,.sd-gy-md-0{--sd-gutter-y: 0}.sd-g-md-0,.sd-gx-md-0{--sd-gutter-x: 0}.sd-g-md-1,.sd-gy-md-1{--sd-gutter-y: 0.25rem}.sd-g-md-1,.sd-gx-md-1{--sd-gutter-x: 0.25rem}.sd-g-md-2,.sd-gy-md-2{--sd-gutter-y: 0.5rem}.sd-g-md-2,.sd-gx-md-2{--sd-gutter-x: 0.5rem}.sd-g-md-3,.sd-gy-md-3{--sd-gutter-y: 1rem}.sd-g-md-3,.sd-gx-md-3{--sd-gutter-x: 1rem}.sd-g-md-4,.sd-gy-md-4{--sd-gutter-y: 1.5rem}.sd-g-md-4,.sd-gx-md-4{--sd-gutter-x: 1.5rem}.sd-g-md-5,.sd-gy-md-5{--sd-gutter-y: 3rem}.sd-g-md-5,.sd-gx-md-5{--sd-gutter-x: 3rem}}@media(min-width: 992px){.sd-col-lg-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-lg-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-lg-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-lg-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-lg-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-lg-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-lg-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-lg-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-lg-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-lg-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-lg-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-lg-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-lg-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-lg-0,.sd-gy-lg-0{--sd-gutter-y: 0}.sd-g-lg-0,.sd-gx-lg-0{--sd-gutter-x: 0}.sd-g-lg-1,.sd-gy-lg-1{--sd-gutter-y: 0.25rem}.sd-g-lg-1,.sd-gx-lg-1{--sd-gutter-x: 0.25rem}.sd-g-lg-2,.sd-gy-lg-2{--sd-gutter-y: 0.5rem}.sd-g-lg-2,.sd-gx-lg-2{--sd-gutter-x: 0.5rem}.sd-g-lg-3,.sd-gy-lg-3{--sd-gutter-y: 1rem}.sd-g-lg-3,.sd-gx-lg-3{--sd-gutter-x: 1rem}.sd-g-lg-4,.sd-gy-lg-4{--sd-gutter-y: 1.5rem}.sd-g-lg-4,.sd-gx-lg-4{--sd-gutter-x: 1.5rem}.sd-g-lg-5,.sd-gy-lg-5{--sd-gutter-y: 3rem}.sd-g-lg-5,.sd-gx-lg-5{--sd-gutter-x: 3rem}}@media(min-width: 1200px){.sd-col-xl-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-xl-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-xl-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-xl-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-xl-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-xl-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-xl-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-xl-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-xl-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-xl-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-xl-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-xl-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-xl-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-xl-0,.sd-gy-xl-0{--sd-gutter-y: 0}.sd-g-xl-0,.sd-gx-xl-0{--sd-gutter-x: 0}.sd-g-xl-1,.sd-gy-xl-1{--sd-gutter-y: 0.25rem}.sd-g-xl-1,.sd-gx-xl-1{--sd-gutter-x: 0.25rem}.sd-g-xl-2,.sd-gy-xl-2{--sd-gutter-y: 0.5rem}.sd-g-xl-2,.sd-gx-xl-2{--sd-gutter-x: 0.5rem}.sd-g-xl-3,.sd-gy-xl-3{--sd-gutter-y: 1rem}.sd-g-xl-3,.sd-gx-xl-3{--sd-gutter-x: 1rem}.sd-g-xl-4,.sd-gy-xl-4{--sd-gutter-y: 1.5rem}.sd-g-xl-4,.sd-gx-xl-4{--sd-gutter-x: 1.5rem}.sd-g-xl-5,.sd-gy-xl-5{--sd-gutter-y: 3rem}.sd-g-xl-5,.sd-gx-xl-5{--sd-gutter-x: 3rem}}.sd-flex-row-reverse{flex-direction:row-reverse !important}details.sd-dropdown{position:relative}details.sd-dropdown .sd-summary-title{font-weight:700;padding-right:3em !important;-moz-user-select:none;-ms-user-select:none;-webkit-user-select:none;user-select:none}details.sd-dropdown:hover{cursor:pointer}details.sd-dropdown .sd-summary-content{cursor:default}details.sd-dropdown summary{list-style:none;padding:1em}details.sd-dropdown summary .sd-octicon.no-title{vertical-align:middle}details.sd-dropdown[open] summary .sd-octicon.no-title{visibility:hidden}details.sd-dropdown summary::-webkit-details-marker{display:none}details.sd-dropdown summary:focus{outline:none}details.sd-dropdown .sd-summary-icon{margin-right:.5em}details.sd-dropdown .sd-summary-icon svg{opacity:.8}details.sd-dropdown summary:hover .sd-summary-up svg,details.sd-dropdown summary:hover .sd-summary-down svg{opacity:1;transform:scale(1.1)}details.sd-dropdown .sd-summary-up svg,details.sd-dropdown .sd-summary-down svg{display:block;opacity:.6}details.sd-dropdown .sd-summary-up,details.sd-dropdown .sd-summary-down{pointer-events:none;position:absolute;right:1em;top:1em}details.sd-dropdown[open]>.sd-summary-title .sd-summary-down{visibility:hidden}details.sd-dropdown:not([open])>.sd-summary-title .sd-summary-up{visibility:hidden}details.sd-dropdown:not([open]).sd-card{border:none}details.sd-dropdown:not([open])>.sd-card-header{border:1px solid var(--sd-color-card-border);border-radius:.25rem}details.sd-dropdown.sd-fade-in[open] summary~*{-moz-animation:sd-fade-in .5s ease-in-out;-webkit-animation:sd-fade-in .5s ease-in-out;animation:sd-fade-in .5s ease-in-out}details.sd-dropdown.sd-fade-in-slide-down[open] summary~*{-moz-animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out;-webkit-animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out;animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out}.sd-col>.sd-dropdown{width:100%}.sd-summary-content>.sd-tab-set:first-child{margin-top:0}@keyframes sd-fade-in{0%{opacity:0}100%{opacity:1}}@keyframes sd-slide-down{0%{transform:translate(0, -10px)}100%{transform:translate(0, 0)}}.sd-tab-set{border-radius:.125rem;display:flex;flex-wrap:wrap;margin:1em 0;position:relative}.sd-tab-set>input{opacity:0;position:absolute}.sd-tab-set>input:checked+label{border-color:var(--sd-color-tabs-underline-active);color:var(--sd-color-tabs-label-active)}.sd-tab-set>input:checked+label+.sd-tab-content{display:block}.sd-tab-set>input:not(:checked)+label:hover{color:var(--sd-color-tabs-label-hover);border-color:var(--sd-color-tabs-underline-hover)}.sd-tab-set>input:focus+label{outline-style:auto}.sd-tab-set>input:not(.focus-visible)+label{outline:none;-webkit-tap-highlight-color:transparent}.sd-tab-set>label{border-bottom:.125rem solid transparent;margin-bottom:0;color:var(--sd-color-tabs-label-inactive);border-color:var(--sd-color-tabs-underline-inactive);cursor:pointer;font-size:var(--sd-fontsize-tabs-label);font-weight:700;padding:1em 1.25em .5em;transition:color 250ms;width:auto;z-index:1}html .sd-tab-set>label:hover{color:var(--sd-color-tabs-label-active)}.sd-col>.sd-tab-set{width:100%}.sd-tab-content{box-shadow:0 -0.0625rem var(--sd-color-tabs-overline),0 .0625rem var(--sd-color-tabs-underline);display:none;order:99;padding-bottom:.75rem;padding-top:.75rem;width:100%}.sd-tab-content>:first-child{margin-top:0 !important}.sd-tab-content>:last-child{margin-bottom:0 !important}.sd-tab-content>.sd-tab-set{margin:0}.sd-sphinx-override,.sd-sphinx-override *{-moz-box-sizing:border-box;-webkit-box-sizing:border-box;box-sizing:border-box}.sd-sphinx-override p{margin-top:0}:root{--sd-color-primary: #0071bc;--sd-color-secondary: #6c757d;--sd-color-success: #28a745;--sd-color-info: #17a2b8;--sd-color-warning: #f0b37e;--sd-color-danger: #dc3545;--sd-color-light: #f8f9fa;--sd-color-muted: #6c757d;--sd-color-dark: #212529;--sd-color-black: black;--sd-color-white: white;--sd-color-primary-highlight: #0060a0;--sd-color-secondary-highlight: #5c636a;--sd-color-success-highlight: #228e3b;--sd-color-info-highlight: #148a9c;--sd-color-warning-highlight: #cc986b;--sd-color-danger-highlight: #bb2d3b;--sd-color-light-highlight: #d3d4d5;--sd-color-muted-highlight: #5c636a;--sd-color-dark-highlight: #1c1f23;--sd-color-black-highlight: black;--sd-color-white-highlight: #d9d9d9;--sd-color-primary-text: #fff;--sd-color-secondary-text: #fff;--sd-color-success-text: #fff;--sd-color-info-text: #fff;--sd-color-warning-text: #212529;--sd-color-danger-text: #fff;--sd-color-light-text: #212529;--sd-color-muted-text: #fff;--sd-color-dark-text: #fff;--sd-color-black-text: #fff;--sd-color-white-text: #212529;--sd-color-shadow: rgba(0, 0, 0, 0.15);--sd-color-card-border: rgba(0, 0, 0, 0.125);--sd-color-card-border-hover: hsla(231, 99%, 66%, 1);--sd-color-card-background: transparent;--sd-color-card-text: inherit;--sd-color-card-header: transparent;--sd-color-card-footer: transparent;--sd-color-tabs-label-active: hsla(231, 99%, 66%, 1);--sd-color-tabs-label-hover: hsla(231, 99%, 66%, 1);--sd-color-tabs-label-inactive: hsl(0, 0%, 66%);--sd-color-tabs-underline-active: hsla(231, 99%, 66%, 1);--sd-color-tabs-underline-hover: rgba(178, 206, 245, 0.62);--sd-color-tabs-underline-inactive: transparent;--sd-color-tabs-overline: rgb(222, 222, 222);--sd-color-tabs-underline: rgb(222, 222, 222);--sd-fontsize-tabs-label: 1rem} diff --git a/docs-archive/helm-chart/1.14.0/_sphinx_design_static/design-tabs.js b/docs-archive/helm-chart/1.14.0/_sphinx_design_static/design-tabs.js new file mode 100644 index 00000000000..36b38cf0d91 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_sphinx_design_static/design-tabs.js @@ -0,0 +1,27 @@ +var sd_labels_by_text = {}; + +function ready() { + const li = document.getElementsByClassName("sd-tab-label"); + for (const label of li) { + syncId = label.getAttribute("data-sync-id"); + if (syncId) { + label.onclick = onLabelClick; + if (!sd_labels_by_text[syncId]) { + sd_labels_by_text[syncId] = []; + } + sd_labels_by_text[syncId].push(label); + } + } +} + +function onLabelClick() { + // Activate other inputs with the same sync id. + syncId = this.getAttribute("data-sync-id"); + for (label of sd_labels_by_text[syncId]) { + if (label === this) continue; + label.previousElementSibling.checked = true; + } + window.localStorage.setItem("sphinx-design-last-tab", syncId); +} + +document.addEventListener("DOMContentLoaded", ready, false); diff --git a/docs-archive/helm-chart/1.14.0/_static/_gen/css/main-custom.min.css b/docs-archive/helm-chart/1.14.0/_static/_gen/css/main-custom.min.css new file mode 100644 index 00000000000..46f1de59325 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_static/_gen/css/main-custom.min.css @@ -0,0 +1 @@ +@charset "UTF-8";@import "https://fonts.googleapis.com/css?family=Rubik:500&display=swap";@import "https://fonts.googleapis.com/css?family=Roboto:400,400i,500,700&display=swap";@import "https://fonts.googleapis.com/css?family=Roboto+Mono:400,700&display=swap";.header__large--cerulean-blue{font-family:rubik,sans-serif;font-weight:500;font-size:72px;line-height:1.17;color:#017cee}.header__large--shamrock{font-family:rubik,sans-serif;font-weight:500;font-size:72px;line-height:1.17;color:#00ad46}.header__large--bright-sky-blue{font-family:rubik,sans-serif;font-weight:500;font-size:72px;line-height:1.17;color:#0cb6ff}.header__large--melon{font-family:rubik,sans-serif;font-weight:500;font-size:72px;line-height:1.17;color:#ff7557}.header__large--vermillion{font-family:rubik,sans-serif;font-weight:500;font-size:72px;line-height:1.17;color:#e43921}.header__large--aqua{font-family:rubik,sans-serif;font-weight:500;font-size:72px;line-height:1.17;color:#11e1ee}.header__large--shamrock-green{font-family:rubik,sans-serif;font-weight:500;font-size:72px;line-height:1.17;color:#04d659}.header__large--aqua-blue{font-family:rubik,sans-serif;font-weight:500;font-size:72px;line-height:1.17;color:#00c7d4}.header__large--white{font-family:rubik,sans-serif;font-weight:500;font-size:72px;line-height:1.17;color:#fff}.header__large--brownish-grey{font-family:rubik,sans-serif;font-weight:500;font-size:72px;line-height:1.17;color:#707070}.header__large--very-light-pink{font-family:rubik,sans-serif;font-weight:500;font-size:72px;line-height:1.17;color:#cbcbcb}.header__large--slate-grey{font-family:rubik,sans-serif;font-weight:500;font-size:72px;line-height:1.17;color:#636365}.header__large--greyish-brown,#header-canvas .text-area--header{font-family:rubik,sans-serif;font-weight:500;font-size:72px;line-height:1.17;color:#51504f}.header__medium--cerulean-blue{font-family:rubik,sans-serif;font-weight:500;font-size:60px;line-height:1.23;color:#017cee}.header__medium--shamrock{font-family:rubik,sans-serif;font-weight:500;font-size:60px;line-height:1.23;color:#00ad46}.header__medium--bright-sky-blue{font-family:rubik,sans-serif;font-weight:500;font-size:60px;line-height:1.23;color:#0cb6ff}.header__medium--melon{font-family:rubik,sans-serif;font-weight:500;font-size:60px;line-height:1.23;color:#ff7557}.header__medium--vermillion{font-family:rubik,sans-serif;font-weight:500;font-size:60px;line-height:1.23;color:#e43921}.header__medium--aqua{font-family:rubik,sans-serif;font-weight:500;font-size:60px;line-height:1.23;color:#11e1ee}.header__medium--shamrock-green{font-family:rubik,sans-serif;font-weight:500;font-size:60px;line-height:1.23;color:#04d659}.header__medium--aqua-blue{font-family:rubik,sans-serif;font-weight:500;font-size:60px;line-height:1.23;color:#00c7d4}.header__medium--white{font-family:rubik,sans-serif;font-weight:500;font-size:60px;line-height:1.23;color:#fff}.header__medium--brownish-grey{font-family:rubik,sans-serif;font-weight:500;font-size:60px;line-height:1.23;color:#707070}.header__medium--very-light-pink{font-family:rubik,sans-serif;font-weight:500;font-size:60px;line-height:1.23;color:#cbcbcb}.header__medium--slate-grey{font-family:rubik,sans-serif;font-weight:500;font-size:60px;line-height:1.23;color:#636365}.header__medium--greyish-brown,.page-header{font-family:rubik,sans-serif;font-weight:500;font-size:60px;line-height:1.23;color:#51504f}.header__small--cerulean-blue{font-family:rubik,sans-serif;font-weight:500;font-size:48px;line-height:1.25;color:#017cee}.header__small--shamrock{font-family:rubik,sans-serif;font-weight:500;font-size:48px;line-height:1.25;color:#00ad46}.header__small--bright-sky-blue{font-family:rubik,sans-serif;font-weight:500;font-size:48px;line-height:1.25;color:#0cb6ff}.header__small--melon{font-family:rubik,sans-serif;font-weight:500;font-size:48px;line-height:1.25;color:#ff7557}.header__small--vermillion{font-family:rubik,sans-serif;font-weight:500;font-size:48px;line-height:1.25;color:#e43921}.header__small--aqua{font-family:rubik,sans-serif;font-weight:500;font-size:48px;line-height:1.25;color:#11e1ee}.header__small--shamrock-green{font-family:rubik,sans-serif;font-weight:500;font-size:48px;line-height:1.25;color:#04d659}.header__small--aqua-blue{font-family:rubik,sans-serif;font-weight:500;font-size:48px;line-height:1.25;color:#00c7d4}.header__small--white{font-family:rubik,sans-serif;font-weight:500;font-size:48px;line-height:1.25;color:#fff}.header__small--brownish-grey{font-family:rubik,sans-serif;font-weight:500;font-size:48px;line-height:1.25;color:#707070}.header__small--very-light-pink{font-family:rubik,sans-serif;font-weight:500;font-size:48px;line-height:1.25;color:#cbcbcb}.header__small--slate-grey{font-family:rubik,sans-serif;font-weight:500;font-size:48px;line-height:1.25;color:#636365}.header__small--greyish-brown,.blogpost-content__metadata--title,.community--header-join,.community--committers-header{font-family:rubik,sans-serif;font-weight:500;font-size:48px;line-height:1.25;color:#51504f}.header__xsmall--cerulean-blue{font-family:rubik,sans-serif;font-weight:500;font-size:36px;line-height:1.22;color:#017cee}.header__xsmall--shamrock{font-family:rubik,sans-serif;font-weight:500;font-size:36px;line-height:1.22;color:#00ad46}.header__xsmall--bright-sky-blue{font-family:rubik,sans-serif;font-weight:500;font-size:36px;line-height:1.22;color:#0cb6ff}.header__xsmall--melon{font-family:rubik,sans-serif;font-weight:500;font-size:36px;line-height:1.22;color:#ff7557}.header__xsmall--vermillion{font-family:rubik,sans-serif;font-weight:500;font-size:36px;line-height:1.22;color:#e43921}.header__xsmall--aqua{font-family:rubik,sans-serif;font-weight:500;font-size:36px;line-height:1.22;color:#11e1ee}.header__xsmall--shamrock-green{font-family:rubik,sans-serif;font-weight:500;font-size:36px;line-height:1.22;color:#04d659}.header__xsmall--aqua-blue{font-family:rubik,sans-serif;font-weight:500;font-size:36px;line-height:1.22;color:#00c7d4}.header__xsmall--white{font-family:rubik,sans-serif;font-weight:500;font-size:36px;line-height:1.22;color:#fff}.header__xsmall--brownish-grey{font-family:rubik,sans-serif;font-weight:500;font-size:36px;line-height:1.22;color:#707070}.header__xsmall--very-light-pink{font-family:rubik,sans-serif;font-weight:500;font-size:36px;line-height:1.22;color:#cbcbcb}.header__xsmall--slate-grey{font-family:rubik,sans-serif;font-weight:500;font-size:36px;line-height:1.22;color:#636365}.header__xsmall--greyish-brown,.feature-item--header,.text-with-icon-item--header{font-family:rubik,sans-serif;font-weight:500;font-size:36px;line-height:1.22;color:#51504f}.subtitle__large--cerulean-blue,.box-event__meetup--location{font-family:roboto,sans-serif;font-weight:500;font-size:24px;line-height:1.5;color:#017cee}.subtitle__large--shamrock{font-family:roboto,sans-serif;font-weight:500;font-size:24px;line-height:1.5;color:#00ad46}.subtitle__large--bright-sky-blue{font-family:roboto,sans-serif;font-weight:500;font-size:24px;line-height:1.5;color:#0cb6ff}.subtitle__large--melon{font-family:roboto,sans-serif;font-weight:500;font-size:24px;line-height:1.5;color:#ff7557}.subtitle__large--vermillion{font-family:roboto,sans-serif;font-weight:500;font-size:24px;line-height:1.5;color:#e43921}.subtitle__large--aqua{font-family:roboto,sans-serif;font-weight:500;font-size:24px;line-height:1.5;color:#11e1ee}.subtitle__large--shamrock-green{font-family:roboto,sans-serif;font-weight:500;font-size:24px;line-height:1.5;color:#04d659}.subtitle__large--aqua-blue{font-family:roboto,sans-serif;font-weight:500;font-size:24px;line-height:1.5;color:#00c7d4}.subtitle__large--white{font-family:roboto,sans-serif;font-weight:500;font-size:24px;line-height:1.5;color:#fff}.subtitle__large--brownish-grey,.quote--text,.page-subtitle,.blogpost-content__metadata--description,#header-canvas .text-area--subheader{font-family:roboto,sans-serif;font-weight:500;font-size:24px;line-height:1.5;color:#707070}.subtitle__large--very-light-pink{font-family:roboto,sans-serif;font-weight:500;font-size:24px;line-height:1.5;color:#cbcbcb}.subtitle__large--slate-grey{font-family:roboto,sans-serif;font-weight:500;font-size:24px;line-height:1.5;color:#636365}.subtitle__large--greyish-brown,.box-event__blogpost--header,.markdown-content h1,.markdown-content h2,.markdown-content h3,.markdown-content h4,.markdown-content h5{font-family:roboto,sans-serif;font-weight:500;font-size:24px;line-height:1.5;color:#51504f}.subtitle__medium--cerulean-blue,ol.counter-blue li::before{font-family:roboto,sans-serif;font-weight:500;font-size:18px;line-height:1.33;color:#017cee}.subtitle__medium--shamrock{font-family:roboto,sans-serif;font-weight:500;font-size:18px;line-height:1.33;color:#00ad46}.subtitle__medium--bright-sky-blue{font-family:roboto,sans-serif;font-weight:500;font-size:18px;line-height:1.33;color:#0cb6ff}.subtitle__medium--melon{font-family:roboto,sans-serif;font-weight:500;font-size:18px;line-height:1.33;color:#ff7557}.subtitle__medium--vermillion{font-family:roboto,sans-serif;font-weight:500;font-size:18px;line-height:1.33;color:#e43921}.subtitle__medium--aqua{font-family:roboto,sans-serif;font-weight:500;font-size:18px;line-height:1.33;color:#11e1ee}.subtitle__medium--shamrock-green{font-family:roboto,sans-serif;font-weight:500;font-size:18px;line-height:1.33;color:#04d659}.subtitle__medium--aqua-blue{font-family:roboto,sans-serif;font-weight:500;font-size:18px;line-height:1.33;color:#00c7d4}.subtitle__medium--white{font-family:roboto,sans-serif;font-weight:500;font-size:18px;line-height:1.33;color:#fff}.subtitle__medium--brownish-grey,.box-event__integration--name{font-family:roboto,sans-serif;font-weight:500;font-size:18px;line-height:1.33;color:#707070}.subtitle__medium--very-light-pink{font-family:roboto,sans-serif;font-weight:500;font-size:18px;line-height:1.33;color:#cbcbcb}.subtitle__medium--slate-grey{font-family:roboto,sans-serif;font-weight:500;font-size:18px;line-height:1.33;color:#636365}.subtitle__medium--greyish-brown,.roadmap .td-sidebar nav>ul>li>a{font-family:roboto,sans-serif;font-weight:500;font-size:18px;line-height:1.33;color:#51504f}.bodytext__medium--cerulean-blue,.box-event__blogpost--author,.box-event__meetup--next-meetup,.tag,.new-entry--link,.blogpost-content__metadata--author{font-family:roboto,sans-serif;font-weight:400;font-size:16px;line-height:1.63;color:#017cee}.bodytext__medium--shamrock{font-family:roboto,sans-serif;font-weight:400;font-size:16px;line-height:1.63;color:#00ad46}.bodytext__medium--bright-sky-blue{font-family:roboto,sans-serif;font-weight:400;font-size:16px;line-height:1.63;color:#0cb6ff}.bodytext__medium--melon{font-family:roboto,sans-serif;font-weight:400;font-size:16px;line-height:1.63;color:#ff7557}.bodytext__medium--vermillion{font-family:roboto,sans-serif;font-weight:400;font-size:16px;line-height:1.63;color:#e43921}.bodytext__medium--aqua{font-family:roboto,sans-serif;font-weight:400;font-size:16px;line-height:1.63;color:#11e1ee}.bodytext__medium--shamrock-green{font-family:roboto,sans-serif;font-weight:400;font-size:16px;line-height:1.63;color:#04d659}.bodytext__medium--aqua-blue{font-family:roboto,sans-serif;font-weight:400;font-size:16px;line-height:1.63;color:#00c7d4}.bodytext__medium--white,footer .footer-section span{font-family:roboto,sans-serif;font-weight:400;font-size:16px;line-height:1.63;color:#fff}.bodytext__medium--brownish-grey,ol.counter-blue li,ul.ticks-blue li,.box-event__blogpost--description,.box-event__blogpost--date,.box-event__case-study--quote,.box-event__meetup--members,.markdown-content p,.markdown-content span,.feature-item--text,.text-with-icon-item--text,.video-list__item .video-list__item--title,.blogpost-content__metadata--date,.install--description,.roadmap .breadcrumb-item a,.roadmap .td-sidebar li>a,.sidebar__version-selector a{font-family:roboto,sans-serif;font-weight:400;font-size:16px;line-height:1.63;color:#707070}.bodytext__medium--very-light-pink{font-family:roboto,sans-serif;font-weight:400;font-size:16px;line-height:1.63;color:#cbcbcb}.bodytext__medium--slate-grey{font-family:roboto,sans-serif;font-weight:400;font-size:16px;line-height:1.63;color:#636365}.bodytext__medium--greyish-brown,.box-event__committer--nick,.quote--author,.list-link,.install__accordions-content--header,.navbar__text-link{font-family:roboto,sans-serif;font-weight:400;font-size:16px;line-height:1.63;color:#51504f}.bodytext__mobile--cerulean-blue{font-family:roboto,sans-serif;font-weight:400;font-size:14px;line-height:1.57;color:#017cee}.bodytext__mobile--shamrock{font-family:roboto,sans-serif;font-weight:400;font-size:14px;line-height:1.57;color:#00ad46}.bodytext__mobile--bright-sky-blue{font-family:roboto,sans-serif;font-weight:400;font-size:14px;line-height:1.57;color:#0cb6ff}.bodytext__mobile--melon{font-family:roboto,sans-serif;font-weight:400;font-size:14px;line-height:1.57;color:#ff7557}.bodytext__mobile--vermillion{font-family:roboto,sans-serif;font-weight:400;font-size:14px;line-height:1.57;color:#e43921}.bodytext__mobile--aqua{font-family:roboto,sans-serif;font-weight:400;font-size:14px;line-height:1.57;color:#11e1ee}.bodytext__mobile--shamrock-green{font-family:roboto,sans-serif;font-weight:400;font-size:14px;line-height:1.57;color:#04d659}.bodytext__mobile--aqua-blue{font-family:roboto,sans-serif;font-weight:400;font-size:14px;line-height:1.57;color:#00c7d4}.bodytext__mobile--white{font-family:roboto,sans-serif;font-weight:400;font-size:14px;line-height:1.57;color:#fff}.bodytext__mobile--brownish-grey{font-family:roboto,sans-serif;font-weight:400;font-size:14px;line-height:1.57;color:#707070}.bodytext__mobile--very-light-pink{font-family:roboto,sans-serif;font-weight:400;font-size:14px;line-height:1.57;color:#cbcbcb}.bodytext__mobile--slate-grey{font-family:roboto,sans-serif;font-weight:400;font-size:14px;line-height:1.57;color:#636365}.bodytext__mobile--greyish-brown{font-family:roboto,sans-serif;font-weight:400;font-size:14px;line-height:1.57;color:#51504f}.bodytext__small--cerulean-blue{font-family:roboto,sans-serif;font-weight:400;font-size:12px;line-height:1.33;color:#017cee}.bodytext__small--shamrock{font-family:roboto,sans-serif;font-weight:400;font-size:12px;line-height:1.33;color:#00ad46}.bodytext__small--bright-sky-blue{font-family:roboto,sans-serif;font-weight:400;font-size:12px;line-height:1.33;color:#0cb6ff}.bodytext__small--melon{font-family:roboto,sans-serif;font-weight:400;font-size:12px;line-height:1.33;color:#ff7557}.bodytext__small--vermillion{font-family:roboto,sans-serif;font-weight:400;font-size:12px;line-height:1.33;color:#e43921}.bodytext__small--aqua{font-family:roboto,sans-serif;font-weight:400;font-size:12px;line-height:1.33;color:#11e1ee}.bodytext__small--shamrock-green{font-family:roboto,sans-serif;font-weight:400;font-size:12px;line-height:1.33;color:#04d659}.bodytext__small--aqua-blue{font-family:roboto,sans-serif;font-weight:400;font-size:12px;line-height:1.33;color:#00c7d4}.bodytext__small--white{font-family:roboto,sans-serif;font-weight:400;font-size:12px;line-height:1.33;color:#fff}.bodytext__small--brownish-grey{font-family:roboto,sans-serif;font-weight:400;font-size:12px;line-height:1.33;color:#707070}.bodytext__small--very-light-pink{font-family:roboto,sans-serif;font-weight:400;font-size:12px;line-height:1.33;color:#cbcbcb}.bodytext__small--slate-grey{font-family:roboto,sans-serif;font-weight:400;font-size:12px;line-height:1.33;color:#636365}.bodytext__small--greyish-brown{font-family:roboto,sans-serif;font-weight:400;font-size:12px;line-height:1.33;color:#51504f}.bodytext__xsmall--cerulean-blue{font-family:roboto,sans-serif;font-weight:400;font-size:10px;line-height:2.6;color:#017cee}.bodytext__xsmall--shamrock{font-family:roboto,sans-serif;font-weight:400;font-size:10px;line-height:2.6;color:#00ad46}.bodytext__xsmall--bright-sky-blue{font-family:roboto,sans-serif;font-weight:400;font-size:10px;line-height:2.6;color:#0cb6ff}.bodytext__xsmall--melon{font-family:roboto,sans-serif;font-weight:400;font-size:10px;line-height:2.6;color:#ff7557}.bodytext__xsmall--vermillion{font-family:roboto,sans-serif;font-weight:400;font-size:10px;line-height:2.6;color:#e43921}.bodytext__xsmall--aqua{font-family:roboto,sans-serif;font-weight:400;font-size:10px;line-height:2.6;color:#11e1ee}.bodytext__xsmall--shamrock-green{font-family:roboto,sans-serif;font-weight:400;font-size:10px;line-height:2.6;color:#04d659}.bodytext__xsmall--aqua-blue{font-family:roboto,sans-serif;font-weight:400;font-size:10px;line-height:2.6;color:#00c7d4}.bodytext__xsmall--white{font-family:roboto,sans-serif;font-weight:400;font-size:10px;line-height:2.6;color:#fff}.bodytext__xsmall--brownish-grey{font-family:roboto,sans-serif;font-weight:400;font-size:10px;line-height:2.6;color:#707070}.bodytext__xsmall--very-light-pink{font-family:roboto,sans-serif;font-weight:400;font-size:10px;line-height:2.6;color:#cbcbcb}.bodytext__xsmall--slate-grey{font-family:roboto,sans-serif;font-weight:400;font-size:10px;line-height:2.6;color:#636365}.bodytext__xsmall--greyish-brown{font-family:roboto,sans-serif;font-weight:400;font-size:10px;line-height:2.6;color:#51504f}.monotext--cerulean-blue{font-family:roboto mono,monospace;color:#017cee;font-size:14px;line-height:1.71}.monotext--shamrock{font-family:roboto mono,monospace;color:#00ad46;font-size:14px;line-height:1.71}.monotext--bright-sky-blue{font-family:roboto mono,monospace;color:#0cb6ff;font-size:14px;line-height:1.71}.monotext--melon{font-family:roboto mono,monospace;color:#ff7557;font-size:14px;line-height:1.71}.monotext--vermillion{font-family:roboto mono,monospace;color:#e43921;font-size:14px;line-height:1.71}.monotext--aqua{font-family:roboto mono,monospace;color:#11e1ee;font-size:14px;line-height:1.71}.monotext--shamrock-green{font-family:roboto mono,monospace;color:#04d659;font-size:14px;line-height:1.71}.monotext--aqua-blue{font-family:roboto mono,monospace;color:#00c7d4;font-size:14px;line-height:1.71}.monotext--white{font-family:roboto mono,monospace;color:#fff;font-size:14px;line-height:1.71}.monotext--brownish-grey,.markdown-content pre span,pre span{font-family:roboto mono,monospace;color:#707070;font-size:14px;line-height:1.71}.monotext--very-light-pink{font-family:roboto mono,monospace;color:#cbcbcb;font-size:14px;line-height:1.71}.monotext--slate-grey{font-family:roboto mono,monospace;color:#636365;font-size:14px;line-height:1.71}.monotext--greyish-brown{font-family:roboto mono,monospace;color:#51504f;font-size:14px;line-height:1.71}.font-weight-normal{font-weight:400!important}.font-weight-500{font-weight:500!important}.font-weight-bold{font-weight:700!important}details.accordion{padding:40px 30px;border-bottom:solid 1px #cbcbcb;-webkit-transition:ease 1s;-o-transition:ease 1s;transition:ease 1s}details.accordion:first-of-type{border-top:solid 1px #cbcbcb}details.accordion summary{position:relative;display:block;outline:none}details.accordion summary::-webkit-details-marker{display:none}details.accordion .accordion__summary-content{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;max-width:750px;margin-right:40px}details.accordion .accordion__summary-content--icon{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center;width:60px;margin-right:42px}details.accordion .accordion__summary-content--header{margin-bottom:20px}details.accordion .accordion__arrow{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;position:absolute;width:36px;height:36px;top:0;right:0;-webkit-box-pack:center;-webkit-justify-content:center;-ms-flex-pack:center;justify-content:center;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center;border:solid 1px #017cee;border-radius:50%}details.accordion .accordion__arrow svg{-webkit-transition:ease-out .2s;-o-transition:ease-out .2s;transition:ease-out .2s}details.accordion[open] .accordion__arrow svg{-webkit-transform:rotate(180deg);-ms-transform:rotate(180deg);-o-transform:rotate(180deg);transform:rotate(180deg)}details.accordion .accordion__content{margin-top:30px;margin-right:36px}details.accordion .accordion__content.indented{margin-left:102px}@media(max-width:1280px){details.accordion{padding:30px 0}details.accordion .accordion__summary-content--icon{-webkit-box-align:unset;-webkit-align-items:unset;-ms-flex-align:unset;align-items:unset;margin-right:20px;margin-top:28px}details.accordion .accordion__arrow{width:28px;height:28px;top:5px}details.accordion .accordion__content.indented{margin-left:80px}details.accordion .accordion__content ol.counter-blue{margin-left:-38px!important}}button{cursor:pointer;border:1px solid;border-radius:5px;padding:9px 29px;-webkit-transition:all ease-out .2s;-o-transition:all ease-out .2s;transition:all ease-out .2s}button:disabled{cursor:not-allowed}button.btn-filled{border-color:#017cee;background-color:#017cee}button.btn-filled:hover{border-color:#0cb6ff;background-color:#0cb6ff}button.btn-with-icon{padding:14px 20px}button.btn-with-icon svg{height:30px;width:auto;padding-right:15px}button.btn-with-icon span{display:inline-block;line-height:30px;vertical-align:middle}button.btn-hollow{background-color:#fff}button.btn-hollow.btn-blue{color:#017cee;border-color:#017cee}button.btn-hollow.btn-blue:disabled{color:#cbcbcb;border-color:#cbcbcb}button.btn-hollow.btn-blue:hover:enabled{color:#fff;background-color:#017cee}button.btn-hollow.btn-brown{border-color:#cbcbcb}button.btn-hollow.btn-brown:hover{background-color:#51504f;border-color:#51504f}button.btn-hollow.btn-brown:hover span{color:#fff}button.btn-hollow.btn-brown:hover svg path{fill:#fff}button.with-box-shadow{-webkit-box-shadow:0 2px 6px 0 rgba(0,0,0,.12);box-shadow:0 2px 6px 0 rgba(0,0,0,.12)}@media(max-width:1280px){button{padding:4px 17px}}ol.counter-blue,ul.ticks-blue{list-style:none;margin-bottom:0}ol.counter-blue li,ul.ticks-blue li{position:relative;padding-left:10px}ol.counter-blue li::before,ul.ticks-blue li::before{position:absolute;border:solid 1px #017cee;border-radius:50%}ol.counter-blue{counter-reset:custom-counter;padding-left:-webkit-calc(26px + 2px);padding-left:calc(26px + 2px)}ol.counter-blue li{counter-increment:custom-counter;margin-bottom:25px}ol.counter-blue li::before{content:counter(custom-counter);-webkit-box-sizing:content-box;-moz-box-sizing:content-box;box-sizing:content-box;top:-2px;left:-webkit-calc(-1 * 26px);left:calc(-1 * 26px);width:26px;height:26px;text-align:center;line-height:26px}ul.ticks-blue{padding-left:-webkit-calc(24px + 2px);padding-left:calc(24px + 2px)}ul.ticks-blue li{margin-bottom:22px}ul.ticks-blue li::before{content:"";left:-webkit-calc(-1 * 24px);left:calc(-1 * 24px);width:24px;height:24px;background-position:50%;background-repeat:no-repeat;background-image:url(/images/tick.svg)}.list-items{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-flex-wrap:wrap;-ms-flex-wrap:wrap;flex-wrap:wrap;margin:-20px;-webkit-box-align:stretch;-webkit-align-items:stretch;-ms-flex-align:stretch;align-items:stretch}@media(max-width:1280px){.list-items{margin:auto;max-width:580px}}@media(max-width:640px){.list-items{-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center}}.list-item{width:25%;padding:20px}@media(min-width:1920px){.list-item{width:20%}}@media(max-width:1280px){.list-item{padding:10px;width:50%}}@media(max-width:640px){.list-item{width:100%}}.list-item--wide{width:50%}@media(max-width:1280px){.list-item--wide{width:100%}}.card{border:solid 1px #cbcbcb;border-radius:5px;padding:30px 10px;height:100%}.box-event{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center}.box-event__blogpost{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;-webkit-box-flex:1;-webkit-flex:1;-ms-flex:1;flex:1;padding:0 20px}.box-event__blogpost--metadata{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-flex-wrap:wrap;-ms-flex-wrap:wrap;flex-wrap:wrap;-webkit-box-pack:justify;-webkit-justify-content:space-between;-ms-flex-pack:justify;justify-content:space-between;margin-bottom:20px}.box-event__blogpost--header{margin-bottom:4px}.box-event__blogpost--author{font-weight:500}.box-event__blogpost--description{margin-bottom:20px}.box-event__case-study{padding:18px 18px 0;-webkit-box-pack:justify;-webkit-justify-content:space-between;-ms-flex-pack:justify;justify-content:space-between}.box-event__case-study--logo{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;height:60px;width:100%;-webkit-box-pack:center;-webkit-justify-content:center;-ms-flex-pack:center;justify-content:center;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center}.box-event__case-study--logo svg,.box-event__case-study--logo img{max-height:100%;max-width:100%}.box-event__case-study--quote{font-style:italic;margin:30px 0 20px;text-align:center}.box-event__case-study--quote::before{content:"“"}.box-event__case-study--quote::after{content:"”"}.box-event__committer--nick{font-weight:500;margin-top:12px}.box-event__committer--social-media-container{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-flex-wrap:wrap;-ms-flex-wrap:wrap;flex-wrap:wrap;-webkit-box-pack:center;-webkit-justify-content:center;-ms-flex-pack:center;justify-content:center}.box-event__committer--social-media-icon{margin:0 6px}.box-event__meetup--location{margin-bottom:10px;text-align:center}.box-event__meetup--members{margin-bottom:30px}.box-event__meetup--members span{vertical-align:middle}.box-event__meetup--next-meetup{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;-webkit-box-pack:center;-webkit-justify-content:center;-ms-flex-pack:center;justify-content:center;min-height:52px;margin-bottom:20px;text-align:center}.box-event__integration{height:208px;-webkit-box-pack:center;-webkit-justify-content:center;-ms-flex-pack:center;justify-content:center}.box-event__integration--logo{margin:auto 0;-webkit-filter:grayscale(1);filter:grayscale(1);opacity:.6;max-width:100%;max-height:100%}.box-event__integration--name{font-weight:700;text-align:center}.box-event__integration:hover .box-event__integration--logo{-webkit-filter:none;filter:none;opacity:1}.box-event.hoverable-icon svg,.box-event.hoverable-icon img{-webkit-filter:grayscale(1);filter:grayscale(1);opacity:.6;-webkit-transition:all .2s;-o-transition:all .2s;transition:all .2s}.box-event.hoverable-icon:hover svg,.box-event.hoverable-icon:hover img{-webkit-filter:none;filter:none;opacity:1}@media(max-width:640px){.box-event__blogpost--metadata{-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column}.box-event__blogpost--date{margin-top:17px}}.avatar{border-radius:50%;width:80px;height:80px}.quote{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;border-bottom:solid 1px #cbcbcb;padding:0 78px 60px}.quote--text{text-align:center;font-weight:400}.quote--text::before{content:"“"}.quote--text::after{content:"”"}.quote--author{text-align:center;font-weight:500;margin-bottom:32px}.quote--logo{max-height:140px;margin:0 auto}@media(max-width:640px){.quote{padding:0 0 40px}}.pager{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;width:100%;-webkit-box-pack:justify;-webkit-justify-content:space-between;-ms-flex-pack:justify;justify-content:space-between;margin-top:60px}.case-study-page{max-width:790px!important;margin:60px auto 0}@media(max-width:640px){.case-study-page{margin-top:40px}}.markdown-content h1,.markdown-content h2,.markdown-content h3,.markdown-content h4,.markdown-content h5{margin-top:40px;margin-bottom:20px}.markdown-content p,.markdown-content span{margin-bottom:30px;margin-top:20px}.markdown-content img{width:100%}.markdown-content table{border-collapse:collapse;width:100%}.markdown-content th{background:#ccc}.markdown-content th,.markdown-content td{border:1px solid #ccc;padding:8px}.markdown-content tr:nth-child(even){background:#efefef}.markdown-content tr:hover{background:#d1d1d1}.markdown-content li{color:#707070}.base-layout{padding:123px 0 40px}.base-layout--button{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;position:-webkit-sticky;position:sticky;width:-webkit-fit-content;width:-moz-fit-content;width:fit-content;margin-left:auto;margin-right:40px;bottom:40px;-webkit-box-pack:end;-webkit-justify-content:flex-end;-ms-flex-pack:end;justify-content:flex-end;z-index:1}@media(max-width:1280px){.base-layout{padding:76px 0 60px}.base-layout--button{display:none}}.page-header{text-align:center;margin-bottom:16px}@media(max-width:1280px){.page-header{font-size:36px!important;line-height:1.22!important}}.page-subtitle{text-align:center;font-weight:400!important;margin-bottom:80px}@media(max-width:1280px){.page-subtitle{font-family:roboto,sans-serif!important;font-size:16px!important;line-height:1.63!important;margin-bottom:30px}}.container{margin-top:44px;max-width:1200px}@media(min-width:1920px){.container{max-width:1510px}}@media(max-width:1280px){.container>*{max-width:630px;margin-left:auto;margin-right:auto}.container .no-width-restriction{max-width:none}}@media(max-width:640px){.container>*{max-width:306px}}.container-fluid{padding-left:20px;padding-right:20px}.show-more-button{width:-webkit-fit-content;width:-moz-fit-content;width:fit-content;margin:60px auto 0}@media(max-width:1280px){.show-more-button{margin-top:30px}}@media(max-width:1280px){.desktop-only{display:none}}@media(min-width:calc(1280px + 1px)){.no-desktop{display:none}}@media(min-width:calc(640px + 1px)){.mobile-only{display:none}}.features-list{margin:76px auto 100px;max-width:720px;display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-flex-wrap:wrap;-ms-flex-wrap:wrap;flex-wrap:wrap;-webkit-box-pack:justify;-webkit-justify-content:space-between;-ms-flex-pack:justify;justify-content:space-between}@media(min-width:1920px){.features-list{max-width:unset;-webkit-box-pack:center;-webkit-justify-content:center;-ms-flex-pack:center;justify-content:center;margin-top:0}}@media(max-width:640px){.features-list{margin-top:0}}.feature-item{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;margin:44px auto 0}.feature-item--icon-box{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;max-width:150px;width:100%;height:-webkit-fit-content;height:-moz-fit-content;height:fit-content;-webkit-box-pack:center;-webkit-justify-content:center;-ms-flex-pack:center;justify-content:center;margin-top:18px}.feature-item--text-box{margin-left:60px}@media(min-width:1920px),(max-width:1280px){.feature-item{-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column}.feature-item--icon-box{margin-top:0;margin-bottom:20px;max-width:unset}.feature-item--text-box{margin-left:0;text-align:center}}@media(min-width:1920px){.feature-item{margin-top:60px;max-width:392px;margin-left:40px;margin-right:40px}}@media(max-width:1280px){.feature-item{margin-top:40px;max-width:260px}.feature-item svg{height:60px;width:auto}.feature-item--header{font-family:roboto,sans-serif!important;font-size:24px!important;line-height:1.5!important}.feature-item--text{font-size:14px!important;line-height:1.57!important}}.text-with-icon-list{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-flex-wrap:wrap;-ms-flex-wrap:wrap;flex-wrap:wrap;max-width:940px;margin:0 auto 100px;-webkit-box-pack:justify;-webkit-justify-content:space-between;-ms-flex-pack:justify;justify-content:space-between}.text-with-icon-item{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;max-width:410px;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center;margin-top:54px}.text-with-icon-item svg{height:100px}.text-with-icon-item--header{text-align:center;margin-top:23px}.text-with-icon-item--text{text-align:center}@media(min-width:1920px){.text-with-icon-list{max-width:unset}.text-with-icon-item{max-width:305px}}@media(max-width:1280px){.text-with-icon-item{margin-top:30px;max-width:276px}.text-with-icon-item svg{width:70px;height:70px}.text-with-icon-item--header{font-family:roboto,sans-serif;font-size:24px;line-height:1.5;margin-top:16px}.text-with-icon-item--text{font-size:14px;line-height:1.57}}@media(max-width:640px){.text-with-icon-list{-webkit-box-pack:center;-webkit-justify-content:center;-ms-flex-pack:center;justify-content:center}}.video-section{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;border:solid 1px #cbcbcb;padding:40px}@media(max-width:1280px){.video-section{-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;max-width:560px;margin:0 auto;padding:20px}}.video-wrapper{-webkit-box-flex:1;-webkit-flex:1;-ms-flex:1;flex:1}.video-wrapper .video-container{display:none}.video-wrapper .video-container:last-child{display:block}.video-wrapper .anchor{position:fixed}.video-wrapper .anchor:target+.video-container{display:block}.video-wrapper .anchor:target+.video-container~.video-container{display:none}.video-list-wrapper{overflow-y:auto;max-height:403px;max-width:370px;width:100%;margin-left:40px}@media(max-width:1280px){.video-list-wrapper{max-width:unset;margin-left:0}}.video-list-wrapper::-webkit-scrollbar{-webkit-appearance:none}.video-list-wrapper::-webkit-scrollbar-thumb{border-radius:8px;border:2px solid #fff;background-color:rgba(0,0,0,.5)}.video-list-wrapper::-webkit-scrollbar:vertical{width:9px}.video-list{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:reverse;-webkit-flex-direction:column-reverse;-ms-flex-direction:column-reverse;flex-direction:column-reverse;-webkit-box-pack:end;-webkit-justify-content:flex-end;-ms-flex-pack:end;justify-content:flex-end}.video-list__item{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center;border-bottom:solid 1px #cbcbcb;padding:16px 0}.video-list__item .video-list__item--title{margin-left:9px;vertical-align:middle}.video-list__item--icon-container{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex}.video-list__item:hover .video-list__item--title,.video-list__item.active .video-list__item--title{font-weight:500}.video-list__item:hover svg path,.video-list__item.active svg path{fill:#707070;stroke:none}.tag{display:block;background-color:rgba(1,124,238,.25);padding:1px 15px;border-radius:5px;-webkit-transition:.2s;-o-transition:.2s;transition:.2s;margin:7px}.tag.active,.tag:hover{background-color:#017cee;color:#fff}.tags-container{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-pack:center;-webkit-justify-content:center;-ms-flex-pack:center;justify-content:center;-webkit-flex-wrap:wrap;-ms-flex-wrap:wrap;flex-wrap:wrap;width:-webkit-fit-content;width:-moz-fit-content;width:fit-content;margin:-7px}@media(max-width:640px){.tags-container{-webkit-box-pack:center;-webkit-justify-content:center;-ms-flex-pack:center;justify-content:center;margin-bottom:7px}}.all-tags-container{margin:30px 0}.blog__list-items-wrapper{max-width:1200px;margin:30px auto 0}@media(max-width:1280px){.blog__list-items-wrapper{max-width:580px}}.new-entry{margin-bottom:20px}.new-entry--link{font-weight:500}@media(max-width:1280px){.new-entry{margin-bottom:10px;padding-left:10px}}.blogpost-content{max-width:790px;margin:0 auto}.blogpost-content--header-wrapper{border-bottom:solid 1px #cbcbcb}.blogpost-content__metadata--container{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-flex-wrap:wrap;-ms-flex-wrap:wrap;flex-wrap:wrap;-webkit-box-pack:justify;-webkit-justify-content:space-between;-ms-flex-pack:justify;justify-content:space-between;margin-bottom:30px}.blogpost-content__metadata--title{margin-bottom:20px}.blogpost-content__metadata--author{font-weight:500;margin-bottom:30px;margin-right:17px}.blogpost-content__metadata--social-media-icon{margin-right:7px}.blogpost-content__metadata--description{font-weight:400;margin-bottom:30px}.blogpost-content__metadata--date{margin-top:17px}@media(max-width:640px){.blogpost-content__metadata--container{-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;margin-bottom:19px}.blogpost-content__metadata--title{font-family:roboto,sans-serif!important;font-size:24px!important;line-height:1.5!important;max-width:272px;margin-bottom:13px}.blogpost-content__metadata--author{margin-bottom:20px}.blogpost-content__metadata--description{font-family:roboto,sans-serif!important;font-weight:400!important;font-size:16px!important;line-height:1.63!important;margin-bottom:20px}}.blog-pager{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center;max-width:1200px;margin:60px auto 0}.blog-pager .pager{margin-top:40px;-webkit-box-pack:center;-webkit-justify-content:center;-ms-flex-pack:center;justify-content:center}.home-page-layout.base-layout{padding-top:70px}@media(max-width:640px){.home-page-layout.base-layout{padding-top:16px}}.principles-header{margin-top:20px;margin-bottom:4px}.integrations-header{margin-bottom:60px}@media(max-width:640px){.integrations-header{margin-bottom:30px}}#integrations .list-items{margin-top:40px}@media(max-width:640px){#integrations .list-items{margin-top:20px}}.video-section-container{margin:80px auto;max-width:1200px}@media(max-width:640px){.video-section-container{margin:60px 0}}.host-header{margin-bottom:6px}.meetups{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center}.meetups>.list-items{margin-top:40px;margin-bottom:40px;width:100%}@media(max-width:1280px){.meetups>.list-items{margin-top:30px;margin-bottom:30px}}@media(max-width:640px){.meetups>.list-items{margin-bottom:10px}}.meetups-page.page-subtitle{margin-bottom:0}.list-link{text-decoration:underline}.community--header-container{max-width:936px;margin:0 auto}.community--header-join{text-align:center}.community--accordion-container{margin:60px 18px}.community--committers-header{text-align:center;margin-top:70px;margin-bottom:40px}.community--committers-header.large-margin{margin-top:100px;margin-bottom:40px}@media(min-width:1920px){.community .list-items{max-width:1220px;margin-right:auto;margin-left:auto}.community .list-item{width:25%}}@media(max-width:1280px){.community--header-container{max-width:580px}.community--header-join{font-family:roboto,sans-serif!important;font-size:24px!important;line-height:1.5!important}.community--accordion-container{margin:40px 0}.community--committers-header{font-size:36px!important;line-height:1.22!important;margin-top:60px}.community--committers-header.large-margin{margin-top:60px;margin-bottom:40px}.community--button-container{margin-top:20px}}.install .page-subtitle{margin-bottom:45px}.install--headers-wrapper{max-width:936px;margin:0 auto}.install--description{text-align:center;margin:45px 0 60px}.install--description a{color:#017cee;text-decoration:underline}.install__accordions--wrapper{max-width:900px;margin:60px auto}.install__accordions-content--header{font-weight:500}.install__accordions-content--list-wrapper{margin-bottom:40px}.install__accordions-content--methods-wrapper{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;margin-bottom:20px}.install__accordions-content--method-box{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;width:270px;height:160px;-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:center;-webkit-justify-content:center;-ms-flex-pack:center;justify-content:center;border:solid 1px #cbcbcb;border-radius:5px;margin-right:40px}@media(max-width:1280px){.install .page-subtitle{margin-bottom:30px}.install--headers-wrapper{max-width:580px}.install--description{margin-top:30px;margin-bottom:30px}.install__accordions--wrapper{max-width:580px;margin-top:40px;margin-bottom:0}}@media(max-width:640px){.install__accordions-content--methods-wrapper{-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center;margin-bottom:0;margin-right:-36px}.install__accordions-content--method-box{margin-right:0;margin-bottom:20px}}footer{min-height:unset}footer .footer-section{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-flex-wrap:wrap;-ms-flex-wrap:wrap;flex-wrap:wrap;-webkit-box-pack:justify;-webkit-justify-content:space-between;-ms-flex-pack:justify;justify-content:space-between}footer .footer-section__media-section{padding:60px 60px 30px;background-color:#51504f}footer .footer-section__media-section--link{margin-right:30px}footer .footer-section__media-section--button-with-text{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center}footer .footer-section__media-section--text{margin-right:20px}footer .footer-section__policies-section{padding:30px 60px;background-color:#636365;font-size:12px;-webkit-box-orient:vertical!important;-webkit-box-direction:normal!important;-webkit-flex-direction:column!important;-ms-flex-direction:column!important;flex-direction:column!important}footer .footer-section__policies-section span{font-size:12px}footer .footer-section__policies-section--policies{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex}footer .footer-section__policies-section--policy-item::before{content:"\00a0\00a0"}footer .footer-section__policies-section--policy-item::after{content:"\00a0\00a0|";color:#fff}footer .footer-section__policies-section--policy-item:last-of-type::after{content:"\00a0\00a0|\00a0\00a0"}footer .footer-section__policies-section--disclaimer{display:block;max-width:600px;color:#cbcbcb!important;margin-top:16px}@media(min-width:1920px){footer .footer-section__policies-section--disclaimer{max-width:800px}}footer .dropdown-toggle::after{color:#fff;vertical-align:middle}@media(max-width:1280px){footer .footer-section{-webkit-box-orient:vertical;-webkit-box-direction:reverse;-webkit-flex-direction:column-reverse;-ms-flex-direction:column-reverse;flex-direction:column-reverse;-webkit-box-align:start;-webkit-align-items:flex-start;-ms-flex-align:start;align-items:flex-start}footer .footer-section span{font-size:14px!important;line-height:1.57!important}footer .footer-section__media-section{padding:30px 40px}footer .footer-section__media-section svg{height:31px;width:auto}footer .footer-section__media-section--link{margin-right:20px}footer .footer-section__media-section--button-with-text{-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;-webkit-box-align:start;-webkit-align-items:flex-start;-ms-flex-align:start;align-items:flex-start;margin-bottom:47px}footer .footer-section__media-section--text{margin-right:0;margin-bottom:16px}footer .footer-section__policies-section{padding:30px 40px}footer .footer-section__policies-section--policies{-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column}footer .footer-section__policies-section--policy-item::before,footer .footer-section__policies-section--policy-item::after,footer .footer-section__policies-section--policy-item:last-of-type::before,footer .footer-section__policies-section--policy-item:last-of-type::after{content:""}footer .footer-section__policies-section--language-toggle{margin:17px 0 35px}}.navbar{position:fixed;top:0;width:100%;background-color:#fff;-webkit-box-pack:start;-webkit-justify-content:flex-start;-ms-flex-pack:start;justify-content:flex-start;border-bottom:solid 1px #cbcbcb;z-index:32;padding:30px 60px}.navbar__menu-container{-webkit-box-flex:1;-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1}.navbar__menu-content{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-pack:justify;-webkit-justify-content:space-between;-ms-flex-pack:justify;justify-content:space-between;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center;padding-top:16px;padding-left:88px}.navbar__links-container{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex}.navbar__text-link{margin-right:30px;position:relative;width:-webkit-fit-content;width:-moz-fit-content;width:fit-content}.navbar__text-link::before,.navbar__text-link::after{content:"";position:absolute;top:100%;width:0;right:0;height:2px;background-color:#017cee;-webkit-transition:.2s ease-out;-o-transition:.2s ease-out;transition:.2s ease-out}.navbar__text-link:hover,.navbar__text-link.active{color:#51504f}.navbar__text-link:hover::before,.navbar__text-link:hover::after,.navbar__text-link.active::before,.navbar__text-link.active::after{width:100%;left:0}.navbar--box-shadow{-webkit-box-shadow:0 2px 6px 0 rgba(0,0,0,.12);box-shadow:0 2px 6px 0 rgba(0,0,0,.12)}@media(max-width:1280px){.navbar{padding:20px}.navbar__icon-container svg{width:93px;height:auto}.navbar__menu-content{-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;-webkit-box-align:start;-webkit-align-items:flex-start;-ms-flex-align:start;align-items:flex-start;padding-left:0;padding-top:0}.navbar__drawer-container{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-flex:1;-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1;-webkit-box-pack:end;-webkit-justify-content:flex-end;-ms-flex-pack:end;justify-content:flex-end}.navbar__toggle-button{border:none;background:0 0;padding:0;position:relative;width:26px;height:20px}.navbar__toggle-button--icon{position:absolute;top:0;bottom:0;left:0;right:0;visibility:hidden;opacity:0;-webkit-transition:.2s ease-out;-o-transition:.2s ease-out;transition:.2s ease-out}.navbar__toggle-button--icon.visible{visibility:visible;opacity:1}.navbar__drawer{position:fixed;top:77px;left:0;width:100%;height:-webkit-calc(100% - 77px);height:calc(100% - 77px);background-color:#fff;-webkit-transform:translateX(100%);-ms-transform:translateX(100%);-o-transform:translateX(100%);transform:translateX(100%);-webkit-transition:.2s ease-out;-o-transition:.2s ease-out;transition:.2s ease-out;padding:40px 40px 30px}.navbar__drawer--open{-webkit-transform:translateX(0);-ms-transform:translateX(0);-o-transform:translateX(0);transform:translateX(0)}.navbar__links-container{-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column}.navbar__text-link{margin-right:0;margin-bottom:10px}.navbar__text-link:last-child{margin-bottom:20px}}#header{position:relative;margin:123px -20px 0;min-height:-webkit-calc(100vh - 123px);min-height:calc(100vh - 123px)}#header-canvas{padding:0;margin:0;position:absolute;width:100%;height:100%;top:0;left:0;right:0;bottom:0}#header-canvas .text-area{max-width:706px;width:100%;display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;-webkit-box-pack:center;-webkit-justify-content:center;-ms-flex-pack:center;justify-content:center;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center;position:absolute;top:50%;left:50%;-webkit-transform:translate(-50%,-50%);-ms-transform:translate(-50%,-50%);-o-transform:translate(-50%,-50%);transform:translate(-50%,-50%)}#header-canvas .text-area--header{text-align:center;margin-bottom:20px}#header-canvas .text-area--subheader{font-weight:400!important;text-align:center;margin-bottom:20px}#header-canvas canvas{position:absolute;top:0;left:0;width:100%;height:100%;z-index:-1}@media(min-width:1920px){#header-canvas .text-area--header{font-size:90px}}@media(max-width:1280px){#header{margin:77px -20px 0;min-height:-webkit-calc(100vh - 77px);min-height:calc(100vh - 77px)}#header-canvas .text-area{max-width:450px}#header-canvas .text-area--header{margin-bottom:14px}#header-canvas .text-area--subheader{margin-bottom:26px}}@media(max-width:640px){#header-canvas .text-area{max-width:290px}#header-canvas .text-area--header{font-size:48px!important;line-height:1.25!important}#header-canvas .text-area--subheader{font-size:16px!important;line-height:1.63!important}}.roadmap{margin-top:40px}.roadmap main{padding-left:40px}.roadmap .breadcrumb{padding-bottom:0;margin-bottom:30px}.roadmap .breadcrumb-item+.breadcrumb-item{padding-left:4px}.roadmap .breadcrumb-item+.breadcrumb-item::before{color:#707070;padding-right:0}.roadmap .td-sidebar{position:-webkit-sticky;position:sticky;top:163px;height:-webkit-fit-content;height:-moz-fit-content;height:fit-content;max-height:-webkit-calc(100vh - 163px);max-height:calc(100vh - 163px);max-width:270px;min-width:270px;width:100%;overflow-y:auto;padding-top:12px;padding-left:15px;padding-bottom:30px;margin-left:40px;background-color:#f9f9f9;border:none}.roadmap .td-sidebar::-webkit-scrollbar{-webkit-appearance:none}.roadmap .td-sidebar::-webkit-scrollbar-thumb{border-radius:8px;border:2px solid #fff;background-color:rgba(0,0,0,.5)}.roadmap .td-sidebar::-webkit-scrollbar:vertical{width:9px}.roadmap .td-sidebar__inner{position:static;height:unset}.roadmap .td-sidebar li>a{width:-webkit-fit-content;width:-moz-fit-content;width:fit-content}.roadmap .td-sidebar li>a.active{color:#017cee}.roadmap .td-sidebar .searchb-box{margin-bottom:26px}.roadmap .td-sidebar .searchb-box .search-form{width:100%}.roadmap .td-sidebar .toctree li{list-style:none;font-family:roboto,sans-serif;font-size:16px;font-weight:400;font-stretch:normal;font-style:normal;line-height:1.63;letter-spacing:normal;color:#707070}.roadmap .td-sidebar .toctree ul{padding-left:15px;display:none}.roadmap .td-sidebar .toctree>ul,.roadmap .td-sidebar .toctree li.current>ul{display:block}.roadmap .td-sidebar .toctree .caption{font-family:roboto,sans-serif;font-size:18px;font-weight:700;font-stretch:normal;font-style:normal;line-height:1.33;letter-spacing:normal;color:#51504f;padding-bottom:13px;text-transform:uppercase;margin-bottom:0}.roadmap .td-sidebar .toctree .current{color:#017cee;font-weight:500}.roadmap .td-sidebar .toctree .current>a:not([href="#"]){color:#017cee}.roadmap .td-sidebar .toctree a .toctree-expand{display:inline-block;position:relative;height:1em}.roadmap .td-sidebar .toctree a .toctree-expand::before{position:absolute;top:6px;left:-12px;content:'►';font-size:7px}.roadmap .td-sidebar .toctree .current>a>.toctree-expand:before{content:'▼'}.roadmap .td-sidebar-nav__section{padding-right:0}.roadmap .td-sidebar-nav>.td-sidebar-nav__section .td-sidebar-nav__section{list-style:none;position:relative;margin-left:10px}.roadmap .td-sidebar-nav>.td-sidebar-nav__section .td-sidebar-nav__section::before{content:'►';position:absolute;top:6px;left:-12px;font-size:8px;color:#51504f}.roadmap .td-sidebar-nav>.td-sidebar-nav__section .td-sidebar-nav__section>ul{display:none}.roadmap .td-sidebar-nav>.td-sidebar-nav__section .td-sidebar-nav__section.current-section::before{content:'▼'}.roadmap .td-sidebar-nav>.td-sidebar-nav__section .td-sidebar-nav__section.current-section>ul{display:block}.roadmap .wy-nav-side-toc{position:-webkit-sticky;position:sticky;top:163px;overflow-x:hidden;overflow-y:auto;width:280px;height:-webkit-fit-content;height:-moz-fit-content;height:fit-content;max-height:-webkit-calc(100vh - 163px);max-height:calc(100vh - 163px);font-size:14px;line-height:1.43}.roadmap .wy-nav-side-toc::-webkit-scrollbar{-webkit-appearance:none}.roadmap .wy-nav-side-toc::-webkit-scrollbar-thumb{border-radius:8px;border:2px solid #fff;background-color:rgba(0,0,0,.5)}.roadmap .wy-nav-side-toc::-webkit-scrollbar:vertical{width:9px}.roadmap .wy-nav-side-toc ul,.roadmap .wy-nav-side-toc ol{padding:0;list-style:none none}.roadmap .wy-nav-side-toc li{list-style:none}.roadmap .wy-nav-side-toc .wy-menu-vertical>ul,.roadmap .wy-nav-side-toc .wy-menu-vertical li.current>ul{padding-left:1px}.roadmap .wy-nav-side-toc .wy-menu-vertical a{display:inline-block;padding:.4045em 0;color:#707070}.roadmap .wy-nav-side-toc .wy-menu-vertical li a{border-left:solid 2px #cbcbcb;padding-left:-webkit-calc(1.25em + 1px);padding-left:calc(1.25em + 1px)}.roadmap .wy-nav-side-toc .wy-menu-vertical li.current{margin-left:-1px}.roadmap .wy-nav-side-toc .wy-menu-vertical li.current>a{border-left:solid 4px #017cee;color:#017cee}.roadmap .wy-nav-side-toc .wy-menu-vertical li li>a{padding-left:2.427em}.roadmap .wy-nav-side-toc .wy-menu-vertical li li li>a{padding-left:4.045em}.roadmap .wy-nav-side-toc .wy-menu-vertical li li li li>a{padding-left:5.663em}@media(max-width:1280px){.roadmap main{padding-left:0}.roadmap .td-sidebar{position:static;background-color:transparent;padding:0;margin:0;max-width:unset;height:530px}}.search-form{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;width:344px;padding:8px 20px;border:solid 1px #cbcbcb;border-radius:5px;margin:60px auto 0}.search-form__input{font-family:roboto,sans-serif;font-size:16px;color:#707070;line-height:1.63;-webkit-box-flex:1;-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1;padding-right:10px;border:none;background:0 0;outline:none;float:left}.search-form__button{border:none;background-color:transparent;padding:0}@media(max-width:1280px){.search-form{width:270px;padding:3px 20px;margin-top:30px}}.rating-container{margin-top:40px}.rating{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-orient:horizontal;-webkit-box-direction:reverse;-webkit-flex-direction:row-reverse;-ms-flex-direction:row-reverse;flex-direction:row-reverse;width:-webkit-fit-content;width:-moz-fit-content;width:fit-content}.rate-star{cursor:pointer;margin-right:13px}.rate-star svg path{fill:none;stroke:#51504f}.rate-star:hover svg path,.rate-star:hover~.rate-star svg path{fill:#017cee;stroke:none}.rst-content{color:#707070}.rst-content h1{margin-top:0;margin-bottom:30px;font-weight:500;font-family:rubik,sans-serif;color:#51504f;font-size:225%}.rst-content h2,.rst-content h3,.rst-content h4,.rst-content h5,.rst-content h6,.rst-content p{font-family:roboto,sans-serif;color:#707070}.rst-content h2,.rst-content h3,.rst-content h4,.rst-content h5,.rst-content h6{margin-top:40px;margin-bottom:20px;font-weight:500}.rst-content p{line-height:1.63;margin:0 0 30px;font-size:16px;overflow-wrap:break-word}.rst-content h2{font-size:150%}.rst-content h3{font-size:125%}.rst-content h4{font-size:115%}.rst-content h5{font-size:110%}.rst-content h6{font-size:100%}.rst-content code{max-width:100%;color:#51504f;padding:0 5px;font-family:roboto mono,monospace;overflow-x:auto}.rst-content .note,.rst-content .attention,.rst-content .caution,.rst-content .danger,.rst-content .error,.rst-content .hint,.rst-content .important,.rst-content .tip,.rst-content .warning,.rst-content .admonition-todo,.rst-content .admonition{padding:9px 10px;line-height:24px;margin-bottom:24px;background:#e7f2fa}@media(max-width:768px){.rst-content .admonition p:not(.admonition-title){font-size:12px;line-height:1.83}}.rst-content .admonition-title:before{content:"!";background-color:#fff;border-radius:50%;padding:0 4px;margin-right:5px}.rst-content .admonition-title{color:#fff;font-weight:500;font-size:10px;line-height:2.1;display:block;background:#68d1ff;margin:-10px;padding:0 12px;margin-bottom:9px}.rst-content .danger,.rst-content .error{background:#fdece9}.rst-content .danger::before,.rst-content .error::before{color:#fdece9}.rst-content .danger .admonition-title,.rst-content .error .admonition-title{background:#ee8170}.rst-content .danger .admonition-title::before,.rst-content .error .admonition-title::before{color:#ee8170}.rst-content .attention,.rst-content .caution{background:#fff8f6}.rst-content .warning{background:#f8f8f8}.rst-content .attention .admonition-title,.rst-content .caution .admonition-title{background:#ffa996}.rst-content .attention .admonition-title::before,.rst-content .caution .admonition-title::before{color:#ffa996}.rst-content .warning .admonition-title{background:#a6a6a6}.rst-content .warning .admonition-title::before{color:#a6a6a6}.rst-content .note,.rst-content .seealso{background:#f3fbff}.rst-content .note .admonition-title,.rst-content .seealso .admonition-title{background:#68d2fe}.rst-content .note .admonition-title::before,.rst-content .seealso .admonition-title::before{color:#68d2fe}.rst-content .hint{background:#f2fef6}.rst-content .important{background:#e6f9fc}.rst-content .tip{background:#e5f7ec}.rst-content .hint .admonition-title{background:#63e598}.rst-content .hint .admonition-title::before{color:#63e598}.rst-content .important .admonition-title{background:#5bdae3}.rst-content .important .admonition-title::before{color:#5bdae3}.rst-content .tip .admonition-title{background:#5bcb88}.rst-content .tip .admonition-title::before{color:#5bcb88}.rst-content .note p:last-child,.rst-content .attention p:last-child,.rst-content .caution p:last-child,.rst-content .danger p:last-child,.rst-content .error p:last-child,.rst-content .hint p:last-child,.rst-content .important p:last-child,.rst-content .tip p:last-child,.rst-content .warning p:last-child,.rst-content .seealso p:last-child,.rst-content .admonition p:last-child{margin-bottom:0}.rst-content img{max-width:100%;height:auto}.rst-content div.figure{margin-bottom:24px}.rst-content div.figure p.caption{font-style:italic}.rst-content div.figure p:last-child.caption{margin-bottom:0}.rst-content div.figure.align-center{text-align:center}.rst-content .section>img,.rst-content .section>a>img{margin-bottom:24px}.rst-content abbr[title]{text-decoration:none}.rst-content blockquote{margin-left:24px;line-height:24px;margin-bottom:24px}.rst-content pre{background-color:#f2f8fe}.rst-content pre.literal-block,.rst-content .linenodiv pre{font-family:roboto mono,monospace;font-size:12px;line-height:1.4}@media print{.rst-content div[class^=highlight],.rst-content div[class^=highlight] pre{white-space:pre-wrap}}.rst-content .admonition table{border-color:rgba(0,0,0,.1)}.rst-content .admonition table td,.rst-content .admonition table th{background:transparent!important;border-color:rgba(0,0,0,.1)!important}.rst-content .section ol p,.rst-content .section ul p{margin-bottom:12px}.rst-content .section ol li p:last-child,.rst-content .section ul li p:last-child{margin-bottom:0}.rst-content .section ol p:last-child,.rst-content .section ul p:last-child{margin-bottom:24px}.rst-content .topic-title{font-weight:700;margin-bottom:12px}.rst-content .toc-backref{color:inherit}.rst-content h1 .headerlink,.rst-content h2 .headerlink,.rst-content .toctree-wrapper p.caption .headerlink,.rst-content h3 .headerlink,.rst-content h4 .headerlink,.rst-content h5 .headerlink,.rst-content h6 .headerlink,.rst-content dl dt .headerlink,.rst-content p.caption .headerlink,.rst-content table>caption .headerlink,.rst-content .code-block-caption .headerlink{visibility:hidden;font-size:0}.rst-content h1 .headerlink:after,.rst-content h2 .headerlink:after,.rst-content .toctree-wrapper p.caption .headerlink:after,.rst-content h3 .headerlink:after,.rst-content h4 .headerlink:after,.rst-content h5 .headerlink:after,.rst-content h6 .headerlink:after,.rst-content dl dt .headerlink:after,.rst-content p.caption .headerlink:after,.rst-content table>caption .headerlink:after,.rst-content .code-block-caption .headerlink:after{content:url(/images/anchor.svg);vertical-align:bottom;padding-left:8px}.rst-content h1:hover .headerlink:after,.rst-content h2:hover .headerlink:after,.rst-content .toctree-wrapper p.caption:hover .headerlink:after,.rst-content h3:hover .headerlink:after,.rst-content h4:hover .headerlink:after,.rst-content h5:hover .headerlink:after,.rst-content h6:hover .headerlink:after,.rst-content dl dt:hover .headerlink:after,.rst-content p.caption:hover .headerlink:after,.rst-content table>caption:hover .headerlink:after,.rst-content .code-block-caption:hover .headerlink:after{visibility:visible}.rst-content table>caption .headerlink:after{font-size:12px}.rst-content .footnote-reference,.rst-content .citation-reference{vertical-align:baseline;position:relative;top:-.4em;line-height:0;font-size:90%}.rst-content table.docutils,.rst-content table.field-list{border-collapse:collapse;border-spacing:0;empty-cells:show;margin-bottom:24px}.rst-content table.docutils caption,.rst-content table.field-list caption{padding:1em 0;text-align:center}.rst-content table.docutils td,.rst-content table.docutils th,.rst-content table.field-list th{margin:0;overflow:visible}.rst-content table.docutils td{padding:10px 31px}.rst-content table.docutils th,.rst-content table.field-list th{padding:11px 31px}.rst-content table.docutils td:first-child,.rst-content table.field-list td:first-child,.rst-content table.docutils th:first-child,.rst-content table.field-list th:first-child{border-left-width:0}.rst-content table.docutils thead,.rst-content table.field-list thead{text-align:left;vertical-align:bottom;white-space:nowrap}.rst-content table.docutils thead th,.rst-content table.field-list thead th{border-bottom:solid 1px rgba(81,80,79,.3);border-left:solid 1px rgba(81,80,79,.3)}.rst-content table.docutils thead th p,.rst-content table.field-list thead th p{font-weight:700;font-size:18px;color:#51504f;line-height:1.33;margin-bottom:0}.rst-content table.docutils td,.rst-content table.field-list td{background-color:transparent;vertical-align:middle}.rst-content td p:last-child,.rst-content table.docutils td p:last-child,.rst-content table.field-list td p:last-child{margin-bottom:0}.rst-content table.docutils:not(.field-list) tr:nth-child(2n-1) td{background-color:rgba(112,112,112,.05)}.rst-content table.docutils{border:1px solid rgba(81,80,79,.3)}.rst-content table.docutils td{border-bottom:1px solid rgba(81,80,79,.3);border-left:1px solid rgba(81,80,79,.3)}.rst-content table.docutils tbody>tr:last-child td{border-bottom-width:0}.rst-content .wy-table-responsive{margin-bottom:24px;max-width:100%;overflow:auto}.rst-content .wy-table-responsive table{margin-bottom:0!important}.rst-content .wy-table-responsive table td,.rst-content .wy-table-responsive table th{white-space:nowrap}.rst-content code big,.rst-content tt em,.rst-content code em{font-size:100%!important;line-height:normal}.rst-content code.literal{color:#e74c3c}.rst-content code.xref,.rst-content a code{font-weight:700;color:#707070}.rst-content pre,.rst-content kbd{font-family:roboto mono,monospace}.rst-content kbd{background-color:inherit;color:inherit;-webkit-box-shadow:none;box-shadow:none;border:none;font-size:100%}.rst-content a code{color:#2980b9}.rst-content dl{margin-bottom:24px}.rst-content dl dt{font-weight:700;margin-bottom:12px;word-break:break-word}.rst-content dl p,.rst-content dl table,.rst-content dl ul,.rst-content dl ol{margin-bottom:12px!important}.rst-content dl dd{margin:0 0 12px 24px;line-height:24px}.rst-content dl:not(.docutils){margin-bottom:24px}.rst-content dl:not(.docutils) dt{font-family:roboto mono,monospace;display:table;margin:6px 0;font-size:100%;line-height:1.63;background:#f3fbff;color:#51504f;border-top:solid 4px #68d1ff;padding:8px 10px;position:relative}@media(max-width:768px){.rst-content dl:not(.docutils) dt{font-size:10px}}.rst-content dl:not(.docutils) dt:before{color:#68d1ff}.rst-content dl:not(.docutils) dt .headerlink{color:#707070;font-size:100%!important}.rst-content dl:not(.docutils) dt .fn-backref{color:#0cb6ff}.rst-content dl:not(.docutils) dl dt{margin-bottom:6px;border:none;border-left:solid 8px #a6a6a6;background:#f8f8f8;color:#707070}.rst-content dl:not(.docutils) dl dt .headerlink{color:#707070;font-size:100%!important}.rst-content dl:not(.docutils) dt:first-child{margin-top:0}.rst-content dl:not(.docutils) code{font-weight:700}.rst-content dl:not(.docutils) code.descname,.rst-content dl:not(.docutils) code.descclassname{background-color:transparent;border:none;padding:0;font-size:100%!important}.rst-content dl:not(.docutils) code.descname{font-weight:700}.rst-content dl:not(.docutils) .optional{display:inline-block;padding:0 4px;color:#51504f;font-weight:700}.rst-content dl:not(.docutils) .property{display:inline-block;padding-right:8px}.rst-content p.rubric{margin-bottom:12px;font-weight:700}.rst-content .versionmodified{font-style:italic}.rst-content .example-header{position:relative;background:#017cee;padding:8px 16px;margin-bottom:0}.rst-content .example-block-wrapper pre{margin:0;width:unset;border-top-left-radius:0;border-top-right-radius:0}.rst-content .example-header--with-button{padding-right:166px}@media(max-width:768px){.rst-content .example-header--with-button{padding-right:100px}}.rst-content .example-header:after{content:'';display:table;clear:both}.rst-content .example-title{display:block;padding:4px;margin-right:16px;color:#fff;overflow-x:auto}@media(max-width:768px){.rst-content .example-title{overflow-wrap:initial;font-size:12px}}.rst-content .example-header-button{top:8px;right:16px;position:absolute}.rst-content .example-header+.highlight-python{margin-top:0!important}.rst-content .viewcode-button{display:inline-block;padding:8px 16px;border:0;margin:0;color:#fff;font-weight:700;line-height:1;text-decoration:underline;text-overflow:ellipsis;overflow:hidden;text-transform:lowercase;vertical-align:middle;white-space:nowrap}@media(max-width:768px){.rst-content .viewcode-button{font-size:12px;padding:7px 0}}.rst-content .viewcode-button:visited{color:#404040}.rst-content .viewcode-button:hover,.rst-content .viewcode-button:focus{color:#404040}@media(min-width:1024px){.rst-content .section::before{display:block;content:" ";margin-top:-83px;height:83px;visibility:hidden}}.content-drawer-wrapper{display:none}@media(max-width:1280px){.content-drawer-wrapper{display:block;margin-bottom:30px}}.content-drawer-wrapper .navbar{-webkit-box-pack:justify;-webkit-justify-content:space-between;-ms-flex-pack:justify;justify-content:space-between;left:0}.content-drawer-wrapper .navbar--hidden{display:none}.content-drawer-container{position:fixed;top:77px;left:0;width:100%;height:100%;background-color:#fff;-webkit-transform:translateX(-100%);-ms-transform:translateX(-100%);-o-transform:translateX(-100%);transform:translateX(-100%);-webkit-transition:.2s ease-out;-o-transition:.2s ease-out;transition:.2s ease-out;z-index:100}.content-drawer-container--open{-webkit-transform:translateX(0);-ms-transform:translateX(0);-o-transform:translateX(0);transform:translateX(0)}.content-drawer{padding:20px 40px}.content-drawer__toggle-button{border:none;background:0 0;padding:0;position:relative;width:26px;height:20px}.content-drawer__toggle-button--icon{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;width:-webkit-fit-content;width:-moz-fit-content;width:fit-content;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center;visibility:hidden;opacity:0;-webkit-transition:.2s ease-out;-o-transition:.2s ease-out;transition:.2s ease-out}.content-drawer__toggle-button--icon svg{margin-right:10px}.content-drawer__toggle-button--icon.visible{visibility:visible;opacity:1}.dropdown-menu{font-family:roboto,sans-serif}.dropdown-toggle::after{color:#51504f}.sidebar__version-selector{margin-bottom:22px}.chroma,.highlight{background-color:#fff}.chroma .lntd,.highlight .lntd{vertical-align:top;padding:0;margin:0;border:0}.chroma .lntable,.highlight .lntable{border-spacing:0;padding:0;margin:0;border:0;width:auto;overflow:auto;display:block}.chroma .hl,.highlight .hl{display:block;width:100%;background-color:#ffc}.chroma .lnt,.chroma .ln,.highlight .lnt,.highlight .ln{margin-right:.4em;padding:0 .4em;color:#7f7f7f}.chroma .k,.chroma .kc,.chroma .kd,.chroma .kn,.chroma .kp,.chroma .kr,.highlight .k,.highlight .kc,.highlight .kd,.highlight .kn,.highlight .kp,.highlight .kr{color:#00f}.chroma .kt,.chroma .nc,.highlight .kt,.highlight .nc{color:#2b91af}.chroma .s,.chroma .sa,.chroma .sb,.chroma .sc,.chroma .dl,.chroma .sd,.chroma .s2,.chroma .se,.chroma .sh,.chroma .si,.chroma .sx,.chroma .sr,.chroma .s1,.chroma .ss,.highlight .s,.highlight .sa,.highlight .sb,.highlight .sc,.highlight .dl,.highlight .sd,.highlight .s2,.highlight .se,.highlight .sh,.highlight .si,.highlight .sx,.highlight .sr,.highlight .s1,.highlight .ss{color:#a31515}.chroma .ow,.highlight .ow{color:#00f}.chroma .c,.chroma .ch,.chroma .cm,.chroma .c1,.chroma .cs,.highlight .c,.highlight .ch,.highlight .cm,.highlight .c1,.highlight .cs{color:green}.chroma .cp,.chroma .cpf,.highlight .cp,.highlight .cpf{color:#00f}.chroma .ge,.highlight .ge{font-style:italic}.chroma .gh,.chroma .gp,.chroma .gs,.chroma .gu,.highlight .gh,.highlight .gp,.highlight .gs,.highlight .gu{font-weight:700}pre{margin:40px 0;padding:16px 20px;border:solid 1px #cbcbcb;border-radius:5px;width:100%}.share-section--icons-wrapper{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex}.share-section--icon{margin-right:12px;cursor:pointer}.four-oh-four{height:-webkit-calc(100vh - 123px);height:calc(100vh - 123px);position:relative}.four-oh-four__text-container{position:relative;top:50%;left:50%;-webkit-transform:translate(-50%,-50%);-ms-transform:translate(-50%,-50%);-o-transform:translate(-50%,-50%);transform:translate(-50%,-50%);text-align:center} \ No newline at end of file diff --git a/docs-archive/helm-chart/1.14.0/_static/_gen/css/main.min.css b/docs-archive/helm-chart/1.14.0/_static/_gen/css/main.min.css new file mode 100644 index 00000000000..603f3cb39ff --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_static/_gen/css/main.min.css @@ -0,0 +1,7 @@ +@import "https://fonts.googleapis.com/css?family=Open+Sans:300,300i,400,400i,700,700i";@fa-font-path:"../webfonts";/*!* Bootstrap v4.1.3 (https://getbootstrap.com/) +* Copyright 2011-2018 The Bootstrap Authors +* Copyright 2011-2018 Twitter, Inc. +* Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)*/:root{--blue: #72A1E5;--indigo: #6610f2;--purple: #6f42c1;--pink: #e83e8c;--red: #dc3545;--orange: #BA5A31;--yellow: #ffc107;--green: #28a745;--teal: #20c997;--cyan: #17a2b8;--white: #fff;--gray: #888;--gray-dark: #333;--primary: #30638E;--secondary: #FFA630;--success: #3772FF;--info: #C0E0DE;--warning: #ED6A5A;--danger: #ED6A5A;--light: #D3F3EE;--dark: #403F4C;--breakpoint-xs: 0;--breakpoint-sm: 576px;--breakpoint-md: 768px;--breakpoint-lg: 992px;--breakpoint-xl: 1200px;--font-family-sans-serif: "Open Sans", -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol";--font-family-monospace: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace}*,*::before,*::after{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}html{font-family:sans-serif;line-height:1.15;-webkit-text-size-adjust:100%;-ms-text-size-adjust:100%;-ms-overflow-style:scrollbar;-webkit-tap-highlight-color:rgba(0,0,0,0)}@-ms-viewport{width:device-width;}article,aside,figcaption,figure,footer,header,hgroup,main,nav,section{display:block}body{margin:0;font-family:open sans,-apple-system,BlinkMacSystemFont,segoe ui,Roboto,helvetica neue,Arial,sans-serif,apple color emoji,segoe ui emoji,segoe ui symbol;font-size:1rem;font-weight:400;line-height:1.5;color:#222;text-align:left;background-color:#fff}[tabindex="-1"]:focus{outline:0!important}hr{-webkit-box-sizing:content-box;-moz-box-sizing:content-box;box-sizing:content-box;height:0;overflow:visible}h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:.5rem}p{margin-top:0;margin-bottom:1rem}abbr[title],abbr[data-original-title]{text-decoration:underline;-webkit-text-decoration:underline dotted;-moz-text-decoration:underline dotted;text-decoration:underline dotted;cursor:help;border-bottom:0}address{margin-bottom:1rem;font-style:normal;line-height:inherit}ol,ul,dl{margin-top:0;margin-bottom:1rem}ol ol,ul ul,ol ul,ul ol{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}blockquote{margin:0 0 1rem}dfn{font-style:italic}b,strong{font-weight:bolder}small{font-size:80%}sub,sup{position:relative;font-size:75%;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}a{color:#3176d9;text-decoration:none;background-color:transparent;-webkit-text-decoration-skip:objects}a:hover{color:#1e53a0;text-decoration:none}a:not([href]):not([tabindex]){color:inherit;text-decoration:none}a:not([href]):not([tabindex]):hover,a:not([href]):not([tabindex]):focus{color:inherit;text-decoration:none}a:not([href]):not([tabindex]):focus{outline:0}pre,code,kbd,samp{font-family:SFMono-Regular,Menlo,Monaco,Consolas,liberation mono,courier new,monospace;font-size:1em}pre{margin-top:0;margin-bottom:1rem;overflow:auto;-ms-overflow-style:scrollbar}figure{margin:0 0 1rem}img{vertical-align:middle;border-style:none}svg{overflow:hidden;vertical-align:middle}table{border-collapse:collapse}caption{padding-top:.75rem;padding-bottom:.75rem;color:#888;text-align:left;caption-side:bottom}th{text-align:inherit}label{display:inline-block;margin-bottom:.5rem}button{border-radius:0}button:focus{outline:1px dotted;outline:5px auto -webkit-focus-ring-color}input,button,select,optgroup,textarea{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button,input{overflow:visible}button,select{text-transform:none}button,html [type=button],[type=reset],[type=submit]{-webkit-appearance:button}button::-moz-focus-inner,[type=button]::-moz-focus-inner,[type=reset]::-moz-focus-inner,[type=submit]::-moz-focus-inner{padding:0;border-style:none}input[type=radio],input[type=checkbox]{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box;padding:0}input[type=date],input[type=time],input[type=datetime-local],input[type=month]{-webkit-appearance:listbox}textarea{overflow:auto;resize:vertical}fieldset{min-width:0;padding:0;margin:0;border:0}legend{display:block;width:100%;max-width:100%;padding:0;margin-bottom:.5rem;font-size:1.5rem;line-height:inherit;color:inherit;white-space:normal}progress{vertical-align:baseline}[type=number]::-webkit-inner-spin-button,[type=number]::-webkit-outer-spin-button{height:auto}[type=search]{outline-offset:-2px;-webkit-appearance:none}[type=search]::-webkit-search-cancel-button,[type=search]::-webkit-search-decoration{-webkit-appearance:none}::-webkit-file-upload-button{font:inherit;-webkit-appearance:button}output{display:inline-block}summary{display:list-item;cursor:pointer}template{display:none}[hidden]{display:none!important}h1,h2,h3,h4,h5,h6,.h1,.h2,.h3,.h4,.h5,.h6{margin-bottom:.5rem;font-family:inherit;font-weight:500;line-height:1.2;color:inherit}h1,.h1{font-size:2.25rem}h2,.h2{font-size:2rem}h3,.h3{font-size:1.5rem}h4,.h4{font-size:1.35rem}h5,.h5{font-size:1.15rem}h6,.h6{font-size:1rem}.lead{font-size:1.25rem;font-weight:300}.display-1{font-size:3rem;font-weight:700;line-height:1.2}.display-2{font-size:2.5rem;font-weight:700;line-height:1.2}.display-3{font-size:2rem;font-weight:700;line-height:1.2}.display-4{font-size:1.75rem;font-weight:700;line-height:1.2}hr{margin-top:1rem;margin-bottom:1rem;border:0;border-top:1px solid rgba(0,0,0,.1)}small,.small{font-size:80%;font-weight:400}mark,.mark{padding:.2em;background-color:#fcf8e3}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;list-style:none}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.initialism{font-size:90%;text-transform:uppercase}.blockquote{margin-bottom:1rem;font-size:1.25rem}.blockquote-footer{display:block;font-size:80%;color:#888}.blockquote-footer::before{content:"\2014 \00A0"}.img-fluid,.td-content img{max-width:100%;height:auto}.img-thumbnail{padding:.25rem;background-color:#fff;border:1px solid #dee2e6;border-radius:.25rem;-webkit-box-shadow:0 1px 2px rgba(0,0,0,.075);box-shadow:0 1px 2px rgba(0,0,0,.075);max-width:100%;height:auto}.figure{display:inline-block}.figure-img{margin-bottom:.5rem;line-height:1}.figure-caption{font-size:90%;color:#888}code{font-size:87.5%;color:#c97300;word-break:break-word}a>code{color:inherit}kbd{padding:.2rem .4rem;font-size:87.5%;color:#fff;background-color:#222;border-radius:.2rem;-webkit-box-shadow:inset 0 -.1rem 0 rgba(0,0,0,.25);box-shadow:inset 0 -.1rem 0 rgba(0,0,0,.25)}kbd kbd{padding:0;font-size:100%;font-weight:700;-webkit-box-shadow:none;box-shadow:none}pre{display:block;font-size:87.5%;color:#222}pre code{font-size:inherit;color:inherit;word-break:normal}.pre-scrollable{max-height:340px;overflow-y:scroll}.container{width:100%;padding-right:15px;padding-left:15px;margin-right:auto;margin-left:auto}@media(min-width:576px){.container{max-width:540px}}@media(min-width:768px){.container{max-width:720px}}@media(min-width:992px){.container{max-width:960px}}@media(min-width:1200px){.container{max-width:1140px}}.container-fluid{width:100%;padding-right:15px;padding-left:15px;margin-right:auto;margin-left:auto}.row{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-flex-wrap:wrap;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-right:-15px;margin-left:-15px}.no-gutters{margin-right:0;margin-left:0}.no-gutters>.col,.no-gutters>[class*=col-]{padding-right:0;padding-left:0}.col-1,.col-2,.col-3,.col-4,.col-5,.col-6,.col-7,.col-8,.col-9,.col-10,.col-11,.col-12,.col,.col-auto,.col-sm-1,.col-sm-2,.col-sm-3,.col-sm-4,.col-sm-5,.col-sm-6,.col-sm-7,.col-sm-8,.col-sm-9,.col-sm-10,.col-sm-11,.col-sm-12,.col-sm,.col-sm-auto,.col-md-1,.col-md-2,.col-md-3,.col-md-4,.col-md-5,.col-md-6,.col-md-7,.col-md-8,.col-md-9,.col-md-10,.col-md-11,.col-md-12,.col-md,.col-md-auto,.col-lg-1,.col-lg-2,.col-lg-3,.col-lg-4,.col-lg-5,.col-lg-6,.col-lg-7,.col-lg-8,.col-lg-9,.col-lg-10,.col-lg-11,.col-lg-12,.col-lg,.col-lg-auto,.col-xl-1,.col-xl-2,.col-xl-3,.col-xl-4,.col-xl-5,.col-xl-6,.col-xl-7,.col-xl-8,.col-xl-9,.col-xl-10,.col-xl-11,.col-xl-12,.col-xl,.col-xl-auto{position:relative;width:100%;min-height:1px;padding-right:15px;padding-left:15px}.col{-webkit-flex-basis:0;-ms-flex-preferred-size:0;flex-basis:0;-webkit-box-flex:1;-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-auto{-webkit-box-flex:0;-webkit-flex:0 0 auto;-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-1{-webkit-box-flex:0;-webkit-flex:0 0 8.33333333%;-ms-flex:0 0 8.33333333%;flex:0 0 8.33333333%;max-width:8.33333333%}.col-2{-webkit-box-flex:0;-webkit-flex:0 0 16.66666667%;-ms-flex:0 0 16.66666667%;flex:0 0 16.66666667%;max-width:16.66666667%}.col-3{-webkit-box-flex:0;-webkit-flex:0 0 25%;-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-4{-webkit-box-flex:0;-webkit-flex:0 0 33.33333333%;-ms-flex:0 0 33.33333333%;flex:0 0 33.33333333%;max-width:33.33333333%}.col-5{-webkit-box-flex:0;-webkit-flex:0 0 41.66666667%;-ms-flex:0 0 41.66666667%;flex:0 0 41.66666667%;max-width:41.66666667%}.col-6{-webkit-box-flex:0;-webkit-flex:0 0 50%;-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-7{-webkit-box-flex:0;-webkit-flex:0 0 58.33333333%;-ms-flex:0 0 58.33333333%;flex:0 0 58.33333333%;max-width:58.33333333%}.col-8{-webkit-box-flex:0;-webkit-flex:0 0 66.66666667%;-ms-flex:0 0 66.66666667%;flex:0 0 66.66666667%;max-width:66.66666667%}.col-9{-webkit-box-flex:0;-webkit-flex:0 0 75%;-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-10{-webkit-box-flex:0;-webkit-flex:0 0 83.33333333%;-ms-flex:0 0 83.33333333%;flex:0 0 83.33333333%;max-width:83.33333333%}.col-11{-webkit-box-flex:0;-webkit-flex:0 0 91.66666667%;-ms-flex:0 0 91.66666667%;flex:0 0 91.66666667%;max-width:91.66666667%}.col-12{-webkit-box-flex:0;-webkit-flex:0 0 100%;-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-first{-webkit-box-ordinal-group:0;-webkit-order:-1;-ms-flex-order:-1;order:-1}.order-last{-webkit-box-ordinal-group:14;-webkit-order:13;-ms-flex-order:13;order:13}.order-0{-webkit-box-ordinal-group:1;-webkit-order:0;-ms-flex-order:0;order:0}.order-1{-webkit-box-ordinal-group:2;-webkit-order:1;-ms-flex-order:1;order:1}.order-2{-webkit-box-ordinal-group:3;-webkit-order:2;-ms-flex-order:2;order:2}.order-3{-webkit-box-ordinal-group:4;-webkit-order:3;-ms-flex-order:3;order:3}.order-4{-webkit-box-ordinal-group:5;-webkit-order:4;-ms-flex-order:4;order:4}.order-5{-webkit-box-ordinal-group:6;-webkit-order:5;-ms-flex-order:5;order:5}.order-6{-webkit-box-ordinal-group:7;-webkit-order:6;-ms-flex-order:6;order:6}.order-7{-webkit-box-ordinal-group:8;-webkit-order:7;-ms-flex-order:7;order:7}.order-8{-webkit-box-ordinal-group:9;-webkit-order:8;-ms-flex-order:8;order:8}.order-9{-webkit-box-ordinal-group:10;-webkit-order:9;-ms-flex-order:9;order:9}.order-10{-webkit-box-ordinal-group:11;-webkit-order:10;-ms-flex-order:10;order:10}.order-11{-webkit-box-ordinal-group:12;-webkit-order:11;-ms-flex-order:11;order:11}.order-12{-webkit-box-ordinal-group:13;-webkit-order:12;-ms-flex-order:12;order:12}.offset-1{margin-left:8.33333333%}.offset-2{margin-left:16.66666667%}.offset-3{margin-left:25%}.offset-4{margin-left:33.33333333%}.offset-5{margin-left:41.66666667%}.offset-6{margin-left:50%}.offset-7{margin-left:58.33333333%}.offset-8{margin-left:66.66666667%}.offset-9{margin-left:75%}.offset-10{margin-left:83.33333333%}.offset-11{margin-left:91.66666667%}@media(min-width:576px){.col-sm{-webkit-flex-basis:0;-ms-flex-preferred-size:0;flex-basis:0;-webkit-box-flex:1;-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-sm-auto{-webkit-box-flex:0;-webkit-flex:0 0 auto;-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-sm-1{-webkit-box-flex:0;-webkit-flex:0 0 8.33333333%;-ms-flex:0 0 8.33333333%;flex:0 0 8.33333333%;max-width:8.33333333%}.col-sm-2{-webkit-box-flex:0;-webkit-flex:0 0 16.66666667%;-ms-flex:0 0 16.66666667%;flex:0 0 16.66666667%;max-width:16.66666667%}.col-sm-3{-webkit-box-flex:0;-webkit-flex:0 0 25%;-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-sm-4{-webkit-box-flex:0;-webkit-flex:0 0 33.33333333%;-ms-flex:0 0 33.33333333%;flex:0 0 33.33333333%;max-width:33.33333333%}.col-sm-5{-webkit-box-flex:0;-webkit-flex:0 0 41.66666667%;-ms-flex:0 0 41.66666667%;flex:0 0 41.66666667%;max-width:41.66666667%}.col-sm-6{-webkit-box-flex:0;-webkit-flex:0 0 50%;-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-sm-7{-webkit-box-flex:0;-webkit-flex:0 0 58.33333333%;-ms-flex:0 0 58.33333333%;flex:0 0 58.33333333%;max-width:58.33333333%}.col-sm-8{-webkit-box-flex:0;-webkit-flex:0 0 66.66666667%;-ms-flex:0 0 66.66666667%;flex:0 0 66.66666667%;max-width:66.66666667%}.col-sm-9{-webkit-box-flex:0;-webkit-flex:0 0 75%;-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-sm-10{-webkit-box-flex:0;-webkit-flex:0 0 83.33333333%;-ms-flex:0 0 83.33333333%;flex:0 0 83.33333333%;max-width:83.33333333%}.col-sm-11{-webkit-box-flex:0;-webkit-flex:0 0 91.66666667%;-ms-flex:0 0 91.66666667%;flex:0 0 91.66666667%;max-width:91.66666667%}.col-sm-12{-webkit-box-flex:0;-webkit-flex:0 0 100%;-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-sm-first{-webkit-box-ordinal-group:0;-webkit-order:-1;-ms-flex-order:-1;order:-1}.order-sm-last{-webkit-box-ordinal-group:14;-webkit-order:13;-ms-flex-order:13;order:13}.order-sm-0{-webkit-box-ordinal-group:1;-webkit-order:0;-ms-flex-order:0;order:0}.order-sm-1{-webkit-box-ordinal-group:2;-webkit-order:1;-ms-flex-order:1;order:1}.order-sm-2{-webkit-box-ordinal-group:3;-webkit-order:2;-ms-flex-order:2;order:2}.order-sm-3{-webkit-box-ordinal-group:4;-webkit-order:3;-ms-flex-order:3;order:3}.order-sm-4{-webkit-box-ordinal-group:5;-webkit-order:4;-ms-flex-order:4;order:4}.order-sm-5{-webkit-box-ordinal-group:6;-webkit-order:5;-ms-flex-order:5;order:5}.order-sm-6{-webkit-box-ordinal-group:7;-webkit-order:6;-ms-flex-order:6;order:6}.order-sm-7{-webkit-box-ordinal-group:8;-webkit-order:7;-ms-flex-order:7;order:7}.order-sm-8{-webkit-box-ordinal-group:9;-webkit-order:8;-ms-flex-order:8;order:8}.order-sm-9{-webkit-box-ordinal-group:10;-webkit-order:9;-ms-flex-order:9;order:9}.order-sm-10{-webkit-box-ordinal-group:11;-webkit-order:10;-ms-flex-order:10;order:10}.order-sm-11{-webkit-box-ordinal-group:12;-webkit-order:11;-ms-flex-order:11;order:11}.order-sm-12{-webkit-box-ordinal-group:13;-webkit-order:12;-ms-flex-order:12;order:12}.offset-sm-0{margin-left:0}.offset-sm-1{margin-left:8.33333333%}.offset-sm-2{margin-left:16.66666667%}.offset-sm-3{margin-left:25%}.offset-sm-4{margin-left:33.33333333%}.offset-sm-5{margin-left:41.66666667%}.offset-sm-6{margin-left:50%}.offset-sm-7{margin-left:58.33333333%}.offset-sm-8{margin-left:66.66666667%}.offset-sm-9{margin-left:75%}.offset-sm-10{margin-left:83.33333333%}.offset-sm-11{margin-left:91.66666667%}}@media(min-width:768px){.col-md{-webkit-flex-basis:0;-ms-flex-preferred-size:0;flex-basis:0;-webkit-box-flex:1;-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-md-auto{-webkit-box-flex:0;-webkit-flex:0 0 auto;-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-md-1{-webkit-box-flex:0;-webkit-flex:0 0 8.33333333%;-ms-flex:0 0 8.33333333%;flex:0 0 8.33333333%;max-width:8.33333333%}.col-md-2{-webkit-box-flex:0;-webkit-flex:0 0 16.66666667%;-ms-flex:0 0 16.66666667%;flex:0 0 16.66666667%;max-width:16.66666667%}.col-md-3{-webkit-box-flex:0;-webkit-flex:0 0 25%;-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-md-4{-webkit-box-flex:0;-webkit-flex:0 0 33.33333333%;-ms-flex:0 0 33.33333333%;flex:0 0 33.33333333%;max-width:33.33333333%}.col-md-5{-webkit-box-flex:0;-webkit-flex:0 0 41.66666667%;-ms-flex:0 0 41.66666667%;flex:0 0 41.66666667%;max-width:41.66666667%}.col-md-6{-webkit-box-flex:0;-webkit-flex:0 0 50%;-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-md-7{-webkit-box-flex:0;-webkit-flex:0 0 58.33333333%;-ms-flex:0 0 58.33333333%;flex:0 0 58.33333333%;max-width:58.33333333%}.col-md-8{-webkit-box-flex:0;-webkit-flex:0 0 66.66666667%;-ms-flex:0 0 66.66666667%;flex:0 0 66.66666667%;max-width:66.66666667%}.col-md-9{-webkit-box-flex:0;-webkit-flex:0 0 75%;-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-md-10{-webkit-box-flex:0;-webkit-flex:0 0 83.33333333%;-ms-flex:0 0 83.33333333%;flex:0 0 83.33333333%;max-width:83.33333333%}.col-md-11{-webkit-box-flex:0;-webkit-flex:0 0 91.66666667%;-ms-flex:0 0 91.66666667%;flex:0 0 91.66666667%;max-width:91.66666667%}.col-md-12{-webkit-box-flex:0;-webkit-flex:0 0 100%;-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-md-first{-webkit-box-ordinal-group:0;-webkit-order:-1;-ms-flex-order:-1;order:-1}.order-md-last{-webkit-box-ordinal-group:14;-webkit-order:13;-ms-flex-order:13;order:13}.order-md-0{-webkit-box-ordinal-group:1;-webkit-order:0;-ms-flex-order:0;order:0}.order-md-1{-webkit-box-ordinal-group:2;-webkit-order:1;-ms-flex-order:1;order:1}.order-md-2{-webkit-box-ordinal-group:3;-webkit-order:2;-ms-flex-order:2;order:2}.order-md-3{-webkit-box-ordinal-group:4;-webkit-order:3;-ms-flex-order:3;order:3}.order-md-4{-webkit-box-ordinal-group:5;-webkit-order:4;-ms-flex-order:4;order:4}.order-md-5{-webkit-box-ordinal-group:6;-webkit-order:5;-ms-flex-order:5;order:5}.order-md-6{-webkit-box-ordinal-group:7;-webkit-order:6;-ms-flex-order:6;order:6}.order-md-7{-webkit-box-ordinal-group:8;-webkit-order:7;-ms-flex-order:7;order:7}.order-md-8{-webkit-box-ordinal-group:9;-webkit-order:8;-ms-flex-order:8;order:8}.order-md-9{-webkit-box-ordinal-group:10;-webkit-order:9;-ms-flex-order:9;order:9}.order-md-10{-webkit-box-ordinal-group:11;-webkit-order:10;-ms-flex-order:10;order:10}.order-md-11{-webkit-box-ordinal-group:12;-webkit-order:11;-ms-flex-order:11;order:11}.order-md-12{-webkit-box-ordinal-group:13;-webkit-order:12;-ms-flex-order:12;order:12}.offset-md-0{margin-left:0}.offset-md-1{margin-left:8.33333333%}.offset-md-2{margin-left:16.66666667%}.offset-md-3{margin-left:25%}.offset-md-4{margin-left:33.33333333%}.offset-md-5{margin-left:41.66666667%}.offset-md-6{margin-left:50%}.offset-md-7{margin-left:58.33333333%}.offset-md-8{margin-left:66.66666667%}.offset-md-9{margin-left:75%}.offset-md-10{margin-left:83.33333333%}.offset-md-11{margin-left:91.66666667%}}@media(min-width:992px){.col-lg{-webkit-flex-basis:0;-ms-flex-preferred-size:0;flex-basis:0;-webkit-box-flex:1;-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-lg-auto{-webkit-box-flex:0;-webkit-flex:0 0 auto;-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-lg-1{-webkit-box-flex:0;-webkit-flex:0 0 8.33333333%;-ms-flex:0 0 8.33333333%;flex:0 0 8.33333333%;max-width:8.33333333%}.col-lg-2{-webkit-box-flex:0;-webkit-flex:0 0 16.66666667%;-ms-flex:0 0 16.66666667%;flex:0 0 16.66666667%;max-width:16.66666667%}.col-lg-3{-webkit-box-flex:0;-webkit-flex:0 0 25%;-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-lg-4{-webkit-box-flex:0;-webkit-flex:0 0 33.33333333%;-ms-flex:0 0 33.33333333%;flex:0 0 33.33333333%;max-width:33.33333333%}.col-lg-5{-webkit-box-flex:0;-webkit-flex:0 0 41.66666667%;-ms-flex:0 0 41.66666667%;flex:0 0 41.66666667%;max-width:41.66666667%}.col-lg-6{-webkit-box-flex:0;-webkit-flex:0 0 50%;-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-lg-7{-webkit-box-flex:0;-webkit-flex:0 0 58.33333333%;-ms-flex:0 0 58.33333333%;flex:0 0 58.33333333%;max-width:58.33333333%}.col-lg-8{-webkit-box-flex:0;-webkit-flex:0 0 66.66666667%;-ms-flex:0 0 66.66666667%;flex:0 0 66.66666667%;max-width:66.66666667%}.col-lg-9{-webkit-box-flex:0;-webkit-flex:0 0 75%;-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-lg-10{-webkit-box-flex:0;-webkit-flex:0 0 83.33333333%;-ms-flex:0 0 83.33333333%;flex:0 0 83.33333333%;max-width:83.33333333%}.col-lg-11{-webkit-box-flex:0;-webkit-flex:0 0 91.66666667%;-ms-flex:0 0 91.66666667%;flex:0 0 91.66666667%;max-width:91.66666667%}.col-lg-12{-webkit-box-flex:0;-webkit-flex:0 0 100%;-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-lg-first{-webkit-box-ordinal-group:0;-webkit-order:-1;-ms-flex-order:-1;order:-1}.order-lg-last{-webkit-box-ordinal-group:14;-webkit-order:13;-ms-flex-order:13;order:13}.order-lg-0{-webkit-box-ordinal-group:1;-webkit-order:0;-ms-flex-order:0;order:0}.order-lg-1{-webkit-box-ordinal-group:2;-webkit-order:1;-ms-flex-order:1;order:1}.order-lg-2{-webkit-box-ordinal-group:3;-webkit-order:2;-ms-flex-order:2;order:2}.order-lg-3{-webkit-box-ordinal-group:4;-webkit-order:3;-ms-flex-order:3;order:3}.order-lg-4{-webkit-box-ordinal-group:5;-webkit-order:4;-ms-flex-order:4;order:4}.order-lg-5{-webkit-box-ordinal-group:6;-webkit-order:5;-ms-flex-order:5;order:5}.order-lg-6{-webkit-box-ordinal-group:7;-webkit-order:6;-ms-flex-order:6;order:6}.order-lg-7{-webkit-box-ordinal-group:8;-webkit-order:7;-ms-flex-order:7;order:7}.order-lg-8{-webkit-box-ordinal-group:9;-webkit-order:8;-ms-flex-order:8;order:8}.order-lg-9{-webkit-box-ordinal-group:10;-webkit-order:9;-ms-flex-order:9;order:9}.order-lg-10{-webkit-box-ordinal-group:11;-webkit-order:10;-ms-flex-order:10;order:10}.order-lg-11{-webkit-box-ordinal-group:12;-webkit-order:11;-ms-flex-order:11;order:11}.order-lg-12{-webkit-box-ordinal-group:13;-webkit-order:12;-ms-flex-order:12;order:12}.offset-lg-0{margin-left:0}.offset-lg-1{margin-left:8.33333333%}.offset-lg-2{margin-left:16.66666667%}.offset-lg-3{margin-left:25%}.offset-lg-4{margin-left:33.33333333%}.offset-lg-5{margin-left:41.66666667%}.offset-lg-6{margin-left:50%}.offset-lg-7{margin-left:58.33333333%}.offset-lg-8{margin-left:66.66666667%}.offset-lg-9{margin-left:75%}.offset-lg-10{margin-left:83.33333333%}.offset-lg-11{margin-left:91.66666667%}}@media(min-width:1200px){.col-xl{-webkit-flex-basis:0;-ms-flex-preferred-size:0;flex-basis:0;-webkit-box-flex:1;-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1;max-width:100%}.col-xl-auto{-webkit-box-flex:0;-webkit-flex:0 0 auto;-ms-flex:0 0 auto;flex:0 0 auto;width:auto;max-width:none}.col-xl-1{-webkit-box-flex:0;-webkit-flex:0 0 8.33333333%;-ms-flex:0 0 8.33333333%;flex:0 0 8.33333333%;max-width:8.33333333%}.col-xl-2{-webkit-box-flex:0;-webkit-flex:0 0 16.66666667%;-ms-flex:0 0 16.66666667%;flex:0 0 16.66666667%;max-width:16.66666667%}.col-xl-3{-webkit-box-flex:0;-webkit-flex:0 0 25%;-ms-flex:0 0 25%;flex:0 0 25%;max-width:25%}.col-xl-4{-webkit-box-flex:0;-webkit-flex:0 0 33.33333333%;-ms-flex:0 0 33.33333333%;flex:0 0 33.33333333%;max-width:33.33333333%}.col-xl-5{-webkit-box-flex:0;-webkit-flex:0 0 41.66666667%;-ms-flex:0 0 41.66666667%;flex:0 0 41.66666667%;max-width:41.66666667%}.col-xl-6{-webkit-box-flex:0;-webkit-flex:0 0 50%;-ms-flex:0 0 50%;flex:0 0 50%;max-width:50%}.col-xl-7{-webkit-box-flex:0;-webkit-flex:0 0 58.33333333%;-ms-flex:0 0 58.33333333%;flex:0 0 58.33333333%;max-width:58.33333333%}.col-xl-8{-webkit-box-flex:0;-webkit-flex:0 0 66.66666667%;-ms-flex:0 0 66.66666667%;flex:0 0 66.66666667%;max-width:66.66666667%}.col-xl-9{-webkit-box-flex:0;-webkit-flex:0 0 75%;-ms-flex:0 0 75%;flex:0 0 75%;max-width:75%}.col-xl-10{-webkit-box-flex:0;-webkit-flex:0 0 83.33333333%;-ms-flex:0 0 83.33333333%;flex:0 0 83.33333333%;max-width:83.33333333%}.col-xl-11{-webkit-box-flex:0;-webkit-flex:0 0 91.66666667%;-ms-flex:0 0 91.66666667%;flex:0 0 91.66666667%;max-width:91.66666667%}.col-xl-12{-webkit-box-flex:0;-webkit-flex:0 0 100%;-ms-flex:0 0 100%;flex:0 0 100%;max-width:100%}.order-xl-first{-webkit-box-ordinal-group:0;-webkit-order:-1;-ms-flex-order:-1;order:-1}.order-xl-last{-webkit-box-ordinal-group:14;-webkit-order:13;-ms-flex-order:13;order:13}.order-xl-0{-webkit-box-ordinal-group:1;-webkit-order:0;-ms-flex-order:0;order:0}.order-xl-1{-webkit-box-ordinal-group:2;-webkit-order:1;-ms-flex-order:1;order:1}.order-xl-2{-webkit-box-ordinal-group:3;-webkit-order:2;-ms-flex-order:2;order:2}.order-xl-3{-webkit-box-ordinal-group:4;-webkit-order:3;-ms-flex-order:3;order:3}.order-xl-4{-webkit-box-ordinal-group:5;-webkit-order:4;-ms-flex-order:4;order:4}.order-xl-5{-webkit-box-ordinal-group:6;-webkit-order:5;-ms-flex-order:5;order:5}.order-xl-6{-webkit-box-ordinal-group:7;-webkit-order:6;-ms-flex-order:6;order:6}.order-xl-7{-webkit-box-ordinal-group:8;-webkit-order:7;-ms-flex-order:7;order:7}.order-xl-8{-webkit-box-ordinal-group:9;-webkit-order:8;-ms-flex-order:8;order:8}.order-xl-9{-webkit-box-ordinal-group:10;-webkit-order:9;-ms-flex-order:9;order:9}.order-xl-10{-webkit-box-ordinal-group:11;-webkit-order:10;-ms-flex-order:10;order:10}.order-xl-11{-webkit-box-ordinal-group:12;-webkit-order:11;-ms-flex-order:11;order:11}.order-xl-12{-webkit-box-ordinal-group:13;-webkit-order:12;-ms-flex-order:12;order:12}.offset-xl-0{margin-left:0}.offset-xl-1{margin-left:8.33333333%}.offset-xl-2{margin-left:16.66666667%}.offset-xl-3{margin-left:25%}.offset-xl-4{margin-left:33.33333333%}.offset-xl-5{margin-left:41.66666667%}.offset-xl-6{margin-left:50%}.offset-xl-7{margin-left:58.33333333%}.offset-xl-8{margin-left:66.66666667%}.offset-xl-9{margin-left:75%}.offset-xl-10{margin-left:83.33333333%}.offset-xl-11{margin-left:91.66666667%}}.table,.td-box .row.section>table,.td-content>table{width:100%;margin-bottom:1rem;background-color:transparent}.table th,.td-box .row.section>table th,.td-content>table th,.table td,.td-box .row.section>table td,.td-content>table td{padding:.75rem;vertical-align:top;border-top:1px solid #dee2e6}.table thead th,.td-box .row.section>table thead th,.td-content>table thead th{vertical-align:bottom;border-bottom:2px solid #dee2e6}.table tbody+tbody,.td-box .row.section>table tbody+tbody,.td-content>table tbody+tbody{border-top:2px solid #dee2e6}.table .table,.td-box .row.section>table .table,.td-content>table .table,.table .td-box .row.section>table,.td-box .table .row.section>table,.td-box .row.section>table .row.section>table,.td-content>table .td-box .row.section>table,.td-box .td-content>table .row.section>table,.table .td-content>table,.td-box .row.section>table .td-content>table,.td-content>table .td-content>table{background-color:#fff}.table-sm th,.table-sm td{padding:.3rem}.table-bordered{border:1px solid #dee2e6}.table-bordered th,.table-bordered td{border:1px solid #dee2e6}.table-bordered thead th,.table-bordered thead td{border-bottom-width:2px}.table-borderless th,.table-borderless td,.table-borderless thead th,.table-borderless tbody+tbody{border:0}.table-striped tbody tr:nth-of-type(odd),.td-box .row.section>table tbody tr:nth-of-type(odd),.td-content>table tbody tr:nth-of-type(odd){background-color:rgba(0,0,0,.05)}.table-hover tbody tr:hover{background-color:rgba(0,0,0,.075)}.table-primary,.table-primary>th,.table-primary>td{background-color:#c5d3df}.table-hover .table-primary:hover{background-color:#b5c7d6}.table-hover .table-primary:hover>td,.table-hover .table-primary:hover>th{background-color:#b5c7d6}.table-secondary,.table-secondary>th,.table-secondary>td{background-color:#ffe6c5}.table-hover .table-secondary:hover{background-color:#ffdbac}.table-hover .table-secondary:hover>td,.table-hover .table-secondary:hover>th{background-color:#ffdbac}.table-success,.table-success>th,.table-success>td{background-color:#c7d8ff}.table-hover .table-success:hover{background-color:#aec6ff}.table-hover .table-success:hover>td,.table-hover .table-success:hover>th{background-color:#aec6ff}.table-info,.table-info>th,.table-info>td{background-color:#edf6f6}.table-hover .table-info:hover{background-color:#dceeee}.table-hover .table-info:hover>td,.table-hover .table-info:hover>th{background-color:#dceeee}.table-warning,.table-warning>th,.table-warning>td{background-color:#fad5d1}.table-hover .table-warning:hover{background-color:#f8c0ba}.table-hover .table-warning:hover>td,.table-hover .table-warning:hover>th{background-color:#f8c0ba}.table-danger,.table-danger>th,.table-danger>td{background-color:#fad5d1}.table-hover .table-danger:hover{background-color:#f8c0ba}.table-hover .table-danger:hover>td,.table-hover .table-danger:hover>th{background-color:#f8c0ba}.table-light,.table-light>th,.table-light>td{background-color:#f3fcfa}.table-hover .table-light:hover{background-color:#dff7f2}.table-hover .table-light:hover>td,.table-hover .table-light:hover>th{background-color:#dff7f2}.table-dark,.table-dark>th,.table-dark>td{background-color:#cac9cd}.table-hover .table-dark:hover{background-color:#bdbcc1}.table-hover .table-dark:hover>td,.table-hover .table-dark:hover>th{background-color:#bdbcc1}.table-active,.table-active>th,.table-active>td{background-color:rgba(0,0,0,.075)}.table-hover .table-active:hover{background-color:rgba(0,0,0,.075)}.table-hover .table-active:hover>td,.table-hover .table-active:hover>th{background-color:rgba(0,0,0,.075)}.table .thead-dark th,.td-box .row.section>table .thead-dark th,.td-content>table .thead-dark th{color:#fff;background-color:#222;border-color:#353535}.table .thead-light th,.td-box .row.section>table .thead-light th,.td-content>table .thead-light th{color:#495057;background-color:#eee;border-color:#dee2e6}.table-dark{color:#fff;background-color:#222}.table-dark th,.table-dark td,.table-dark thead th{border-color:#353535}.table-dark.table-bordered{border:0}.table-dark.table-striped tbody tr:nth-of-type(odd),.td-box .row.section>table.table-dark tbody tr:nth-of-type(odd),.td-content>table.table-dark tbody tr:nth-of-type(odd){background-color:rgba(255,255,255,.05)}.table-dark.table-hover tbody tr:hover{background-color:rgba(255,255,255,.075)}@media(max-width:575.98px){.table-responsive-sm{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive-sm>.table-bordered{border:0}}@media(max-width:767.98px){.table-responsive-md{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive-md>.table-bordered{border:0}}@media(max-width:991.98px){.table-responsive-lg{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive-lg>.table-bordered{border:0}}@media(max-width:1199.98px){.table-responsive-xl{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive-xl>.table-bordered{border:0}}.table-responsive,.td-box .row.section>table,.td-content>table{display:block;width:100%;overflow-x:auto;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar}.table-responsive>.table-bordered,.td-box .row.section>table>.table-bordered,.td-content>table>.table-bordered{border:0}.form-control{display:block;width:100%;height:-webkit-calc(2.25rem + 2px);height:calc(2.25rem + 2px);padding:.375rem .75rem;font-size:1rem;line-height:1.5;color:#495057;background-color:#fff;background-clip:padding-box;border:1px solid #ccc;border-radius:.25rem;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.075);box-shadow:inset 0 1px 1px rgba(0,0,0,.075);-webkit-transition:border-color .15s ease-in-out,-webkit-box-shadow .15s ease-in-out;transition:border-color .15s ease-in-out,-webkit-box-shadow .15s ease-in-out;-o-transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out,-webkit-box-shadow .15s ease-in-out}@media screen and (prefers-reduced-motion:reduce){.form-control{-webkit-transition:none;-o-transition:none;transition:none}}.form-control::-ms-expand{background-color:transparent;border:0}.form-control:focus{color:#495057;background-color:#fff;border-color:#6fa3ce;outline:0;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.075),0 0 0 .2rem rgba(48,99,142,.25);box-shadow:inset 0 1px 1px rgba(0,0,0,.075),0 0 0 .2rem rgba(48,99,142,.25)}.form-control::-webkit-input-placeholder{color:#888;opacity:1}.form-control::-moz-placeholder{color:#888;opacity:1}.form-control:-ms-input-placeholder{color:#888;opacity:1}.form-control::placeholder{color:#888;opacity:1}.form-control:disabled,.form-control[readonly]{background-color:#eee;opacity:1}select.form-control:focus::-ms-value{color:#495057;background-color:#fff}.form-control-file,.form-control-range{display:block;width:100%}.col-form-label{padding-top:-webkit-calc(0.375rem + 1px);padding-top:calc(0.375rem + 1px);padding-bottom:-webkit-calc(0.375rem + 1px);padding-bottom:calc(0.375rem + 1px);margin-bottom:0;font-size:inherit;line-height:1.5}.col-form-label-lg{padding-top:-webkit-calc(0.5rem + 1px);padding-top:calc(0.5rem + 1px);padding-bottom:-webkit-calc(0.5rem + 1px);padding-bottom:calc(0.5rem + 1px);font-size:1.25rem;line-height:1.5}.col-form-label-sm{padding-top:-webkit-calc(0.25rem + 1px);padding-top:calc(0.25rem + 1px);padding-bottom:-webkit-calc(0.25rem + 1px);padding-bottom:calc(0.25rem + 1px);font-size:.875rem;line-height:1.5}.form-control-plaintext{display:block;width:100%;padding-top:.375rem;padding-bottom:.375rem;margin-bottom:0;line-height:1.5;color:#222;background-color:transparent;border:solid transparent;border-width:1px 0}.form-control-plaintext.form-control-sm,.form-control-plaintext.form-control-lg{padding-right:0;padding-left:0}.form-control-sm{height:-webkit-calc(1.8125rem + 2px);height:calc(1.8125rem + 2px);padding:.25rem .5rem;font-size:.875rem;line-height:1.5;border-radius:.2rem}.form-control-lg{height:-webkit-calc(2.875rem + 2px);height:calc(2.875rem + 2px);padding:.5rem 1rem;font-size:1.25rem;line-height:1.5;border-radius:.3rem}select.form-control[size],select.form-control[multiple]{height:auto}textarea.form-control{height:auto}.form-group{margin-bottom:1rem}.form-text{display:block;margin-top:.25rem}.form-row{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-flex-wrap:wrap;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-right:-5px;margin-left:-5px}.form-row>.col,.form-row>[class*=col-]{padding-right:5px;padding-left:5px}.form-check{position:relative;display:block;padding-left:1.25rem}.form-check-input{position:absolute;margin-top:.3rem;margin-left:-1.25rem}.form-check-input:disabled~.form-check-label{color:#888}.form-check-label{margin-bottom:0}.form-check-inline{display:-webkit-inline-box;display:-webkit-inline-flex;display:-ms-inline-flexbox;display:inline-flex;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center;padding-left:0;margin-right:.75rem}.form-check-inline .form-check-input{position:static;margin-top:0;margin-right:.3125rem;margin-left:0}.valid-feedback{display:none;width:100%;margin-top:.25rem;font-size:80%;color:#3772ff}.valid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;line-height:1.5;color:#fff;background-color:rgba(55,114,255,.9);border-radius:.25rem}.was-validated .form-control:valid,.form-control.is-valid,.was-validated .custom-select:valid,.custom-select.is-valid{border-color:#3772ff}.was-validated .form-control:valid:focus,.form-control.is-valid:focus,.was-validated .custom-select:valid:focus,.custom-select.is-valid:focus{border-color:#3772ff;-webkit-box-shadow:0 0 0 .2rem rgba(55,114,255,.25);box-shadow:0 0 0 .2rem rgba(55,114,255,.25)}.was-validated .form-control:valid~.valid-feedback,.was-validated .form-control:valid~.valid-tooltip,.form-control.is-valid~.valid-feedback,.form-control.is-valid~.valid-tooltip,.was-validated .custom-select:valid~.valid-feedback,.was-validated .custom-select:valid~.valid-tooltip,.custom-select.is-valid~.valid-feedback,.custom-select.is-valid~.valid-tooltip{display:block}.was-validated .form-control-file:valid~.valid-feedback,.was-validated .form-control-file:valid~.valid-tooltip,.form-control-file.is-valid~.valid-feedback,.form-control-file.is-valid~.valid-tooltip{display:block}.was-validated .form-check-input:valid~.form-check-label,.form-check-input.is-valid~.form-check-label{color:#3772ff}.was-validated .form-check-input:valid~.valid-feedback,.was-validated .form-check-input:valid~.valid-tooltip,.form-check-input.is-valid~.valid-feedback,.form-check-input.is-valid~.valid-tooltip{display:block}.was-validated .custom-control-input:valid~.custom-control-label,.custom-control-input.is-valid~.custom-control-label{color:#3772ff}.was-validated .custom-control-input:valid~.custom-control-label::before,.custom-control-input.is-valid~.custom-control-label::before{background-color:#b7ccff}.was-validated .custom-control-input:valid~.valid-feedback,.was-validated .custom-control-input:valid~.valid-tooltip,.custom-control-input.is-valid~.valid-feedback,.custom-control-input.is-valid~.valid-tooltip{display:block}.was-validated .custom-control-input:valid:checked~.custom-control-label::before,.custom-control-input.is-valid:checked~.custom-control-label::before{background:#6a96ff -webkit-gradient(linear,left top,left bottom,from(#80a6ff),to(#6a96ff)) repeat-x;background:#6a96ff -webkit-linear-gradient(top,#80a6ff,#6a96ff) repeat-x;background:#6a96ff -o-linear-gradient(top,#80a6ff,#6a96ff) repeat-x;background:#6a96ff linear-gradient(180deg,#80a6ff,#6a96ff) repeat-x}.was-validated .custom-control-input:valid:focus~.custom-control-label::before,.custom-control-input.is-valid:focus~.custom-control-label::before{-webkit-box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(55,114,255,.25);box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(55,114,255,.25)}.was-validated .custom-file-input:valid~.custom-file-label,.custom-file-input.is-valid~.custom-file-label{border-color:#3772ff}.was-validated .custom-file-input:valid~.custom-file-label::after,.custom-file-input.is-valid~.custom-file-label::after{border-color:inherit}.was-validated .custom-file-input:valid~.valid-feedback,.was-validated .custom-file-input:valid~.valid-tooltip,.custom-file-input.is-valid~.valid-feedback,.custom-file-input.is-valid~.valid-tooltip{display:block}.was-validated .custom-file-input:valid:focus~.custom-file-label,.custom-file-input.is-valid:focus~.custom-file-label{-webkit-box-shadow:0 0 0 .2rem rgba(55,114,255,.25);box-shadow:0 0 0 .2rem rgba(55,114,255,.25)}.invalid-feedback{display:none;width:100%;margin-top:.25rem;font-size:80%;color:#ed6a5a}.invalid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;line-height:1.5;color:#fff;background-color:rgba(237,106,90,.9);border-radius:.25rem}.was-validated .form-control:invalid,.form-control.is-invalid,.was-validated .custom-select:invalid,.custom-select.is-invalid{border-color:#ed6a5a}.was-validated .form-control:invalid:focus,.form-control.is-invalid:focus,.was-validated .custom-select:invalid:focus,.custom-select.is-invalid:focus{border-color:#ed6a5a;-webkit-box-shadow:0 0 0 .2rem rgba(237,106,90,.25);box-shadow:0 0 0 .2rem rgba(237,106,90,.25)}.was-validated .form-control:invalid~.invalid-feedback,.was-validated .form-control:invalid~.invalid-tooltip,.form-control.is-invalid~.invalid-feedback,.form-control.is-invalid~.invalid-tooltip,.was-validated .custom-select:invalid~.invalid-feedback,.was-validated .custom-select:invalid~.invalid-tooltip,.custom-select.is-invalid~.invalid-feedback,.custom-select.is-invalid~.invalid-tooltip{display:block}.was-validated .form-control-file:invalid~.invalid-feedback,.was-validated .form-control-file:invalid~.invalid-tooltip,.form-control-file.is-invalid~.invalid-feedback,.form-control-file.is-invalid~.invalid-tooltip{display:block}.was-validated .form-check-input:invalid~.form-check-label,.form-check-input.is-invalid~.form-check-label{color:#ed6a5a}.was-validated .form-check-input:invalid~.invalid-feedback,.was-validated .form-check-input:invalid~.invalid-tooltip,.form-check-input.is-invalid~.invalid-feedback,.form-check-input.is-invalid~.invalid-tooltip{display:block}.was-validated .custom-control-input:invalid~.custom-control-label,.custom-control-input.is-invalid~.custom-control-label{color:#ed6a5a}.was-validated .custom-control-input:invalid~.custom-control-label::before,.custom-control-input.is-invalid~.custom-control-label::before{background-color:#fad2cd}.was-validated .custom-control-input:invalid~.invalid-feedback,.was-validated .custom-control-input:invalid~.invalid-tooltip,.custom-control-input.is-invalid~.invalid-feedback,.custom-control-input.is-invalid~.invalid-tooltip{display:block}.was-validated .custom-control-input:invalid:checked~.custom-control-label::before,.custom-control-input.is-invalid:checked~.custom-control-label::before{background:#f29488 -webkit-gradient(linear,left top,left bottom,from(#f4a49a),to(#f29488)) repeat-x;background:#f29488 -webkit-linear-gradient(top,#f4a49a,#f29488) repeat-x;background:#f29488 -o-linear-gradient(top,#f4a49a,#f29488) repeat-x;background:#f29488 linear-gradient(180deg,#f4a49a,#f29488) repeat-x}.was-validated .custom-control-input:invalid:focus~.custom-control-label::before,.custom-control-input.is-invalid:focus~.custom-control-label::before{-webkit-box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(237,106,90,.25);box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(237,106,90,.25)}.was-validated .custom-file-input:invalid~.custom-file-label,.custom-file-input.is-invalid~.custom-file-label{border-color:#ed6a5a}.was-validated .custom-file-input:invalid~.custom-file-label::after,.custom-file-input.is-invalid~.custom-file-label::after{border-color:inherit}.was-validated .custom-file-input:invalid~.invalid-feedback,.was-validated .custom-file-input:invalid~.invalid-tooltip,.custom-file-input.is-invalid~.invalid-feedback,.custom-file-input.is-invalid~.invalid-tooltip{display:block}.was-validated .custom-file-input:invalid:focus~.custom-file-label,.custom-file-input.is-invalid:focus~.custom-file-label{-webkit-box-shadow:0 0 0 .2rem rgba(237,106,90,.25);box-shadow:0 0 0 .2rem rgba(237,106,90,.25)}.form-inline{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-orient:horizontal;-webkit-box-direction:normal;-webkit-flex-flow:row wrap;-ms-flex-flow:row wrap;flex-flow:row wrap;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center}.form-inline .form-check{width:100%}@media(min-width:576px){.form-inline label{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:center;-webkit-justify-content:center;-ms-flex-pack:center;justify-content:center;margin-bottom:0}.form-inline .form-group{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-flex:0;-webkit-flex:0 0 auto;-ms-flex:0 0 auto;flex:0 0 auto;-webkit-box-orient:horizontal;-webkit-box-direction:normal;-webkit-flex-flow:row wrap;-ms-flex-flow:row wrap;flex-flow:row wrap;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center;margin-bottom:0}.form-inline .form-control{display:inline-block;width:auto;vertical-align:middle}.form-inline .form-control-plaintext{display:inline-block}.form-inline .input-group,.form-inline .custom-select{width:auto}.form-inline .form-check{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:center;-webkit-justify-content:center;-ms-flex-pack:center;justify-content:center;width:auto;padding-left:0}.form-inline .form-check-input{position:relative;margin-top:0;margin-right:.25rem;margin-left:0}.form-inline .custom-control{-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:center;-webkit-justify-content:center;-ms-flex-pack:center;justify-content:center}.form-inline .custom-control-label{margin-bottom:0}}.btn{display:inline-block;font-weight:400;text-align:center;white-space:nowrap;vertical-align:middle;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;border:1px solid transparent;padding:.375rem .75rem;font-size:1rem;line-height:1.5;border-radius:.25rem;-webkit-transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,-webkit-box-shadow .15s ease-in-out;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,-webkit-box-shadow .15s ease-in-out;-o-transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out,-webkit-box-shadow .15s ease-in-out}@media screen and (prefers-reduced-motion:reduce){.btn{-webkit-transition:none;-o-transition:none;transition:none}}.btn:hover,.btn:focus{text-decoration:none}.btn:focus,.btn.focus{outline:0;-webkit-box-shadow:0 0 0 .2rem rgba(48,99,142,.25);box-shadow:0 0 0 .2rem rgba(48,99,142,.25)}.btn.disabled,.btn:disabled{opacity:.65;-webkit-box-shadow:none;box-shadow:none}.btn:not(:disabled):not(.disabled){cursor:pointer}.btn:not(:disabled):not(.disabled):active,.btn:not(:disabled):not(.disabled).active{-webkit-box-shadow:inset 0 3px 5px rgba(0,0,0,.125);box-shadow:inset 0 3px 5px rgba(0,0,0,.125)}.btn:not(:disabled):not(.disabled):active:focus,.btn:not(:disabled):not(.disabled).active:focus{-webkit-box-shadow:0 0 0 .2rem rgba(48,99,142,.25),inset 0 3px 5px rgba(0,0,0,.125);box-shadow:0 0 0 .2rem rgba(48,99,142,.25),inset 0 3px 5px rgba(0,0,0,.125)}a.btn.disabled,fieldset:disabled a.btn{pointer-events:none}.btn-primary{color:#fff;background:#30638E -webkit-gradient(linear,left top,left bottom,from(#4f7a9f),to(#30638E)) repeat-x;background:#30638e -webkit-linear-gradient(top,#4f7a9f,#30638E) repeat-x;background:#30638e -o-linear-gradient(top,#4f7a9f,#30638E) repeat-x;background:#30638e linear-gradient(180deg,#4f7a9f,#30638E) repeat-x;border-color:#30638e;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075);box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075)}.btn-primary:hover{color:#fff;background:#264f71 -webkit-gradient(linear,left top,left bottom,from(#476987),to(#264f71)) repeat-x;background:#264f71 -webkit-linear-gradient(top,#476987,#264f71) repeat-x;background:#264f71 -o-linear-gradient(top,#476987,#264f71) repeat-x;background:#264f71 linear-gradient(180deg,#476987,#264f71) repeat-x;border-color:#234868}.btn-primary:focus,.btn-primary.focus{-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075),0 0 0 .2rem rgba(48,99,142,.5);box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075),0 0 0 .2rem rgba(48,99,142,.5)}.btn-primary.disabled,.btn-primary:disabled{color:#fff;background-color:#30638e;border-color:#30638e}.btn-primary:not(:disabled):not(.disabled):active,.btn-primary:not(:disabled):not(.disabled).active,.show>.btn-primary.dropdown-toggle{color:#fff;background-color:#234868;background-image:none;border-color:#20425e}.btn-primary:not(:disabled):not(.disabled):active:focus,.btn-primary:not(:disabled):not(.disabled).active:focus,.show>.btn-primary.dropdown-toggle:focus{-webkit-box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(48,99,142,.5);box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(48,99,142,.5)}.btn-secondary{color:#fff;background:#FFA630 -webkit-gradient(linear,left top,left bottom,from(#ffb34f),to(#FFA630)) repeat-x;background:#ffa630 -webkit-linear-gradient(top,#ffb34f,#FFA630) repeat-x;background:#ffa630 -o-linear-gradient(top,#ffb34f,#FFA630) repeat-x;background:#ffa630 linear-gradient(180deg,#ffb34f,#FFA630) repeat-x;border-color:#ffa630;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075);box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075)}.btn-secondary:hover{color:#fff;background:#ff960a -webkit-gradient(linear,left top,left bottom,from(#ffa52f),to(#ff960a)) repeat-x;background:#ff960a -webkit-linear-gradient(top,#ffa52f,#ff960a) repeat-x;background:#ff960a -o-linear-gradient(top,#ffa52f,#ff960a) repeat-x;background:#ff960a linear-gradient(180deg,#ffa52f,#ff960a) repeat-x;border-color:#fc9000}.btn-secondary:focus,.btn-secondary.focus{-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075),0 0 0 .2rem rgba(255,166,48,.5);box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075),0 0 0 .2rem rgba(255,166,48,.5)}.btn-secondary.disabled,.btn-secondary:disabled{color:#fff;background-color:#ffa630;border-color:#ffa630}.btn-secondary:not(:disabled):not(.disabled):active,.btn-secondary:not(:disabled):not(.disabled).active,.show>.btn-secondary.dropdown-toggle{color:#fff;background-color:#fc9000;background-image:none;border-color:#ef8800}.btn-secondary:not(:disabled):not(.disabled):active:focus,.btn-secondary:not(:disabled):not(.disabled).active:focus,.show>.btn-secondary.dropdown-toggle:focus{-webkit-box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(255,166,48,.5);box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(255,166,48,.5)}.btn-success{color:#fff;background:#3772FF -webkit-gradient(linear,left top,left bottom,from(#5587ff),to(#3772FF)) repeat-x;background:#3772ff -webkit-linear-gradient(top,#5587ff,#3772FF) repeat-x;background:#3772ff -o-linear-gradient(top,#5587ff,#3772FF) repeat-x;background:#3772ff linear-gradient(180deg,#5587ff,#3772FF) repeat-x;border-color:#3772ff;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075);box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075)}.btn-success:hover{color:#fff;background:#1157ff -webkit-gradient(linear,left top,left bottom,from(#3470ff),to(#1157ff)) repeat-x;background:#1157ff -webkit-linear-gradient(top,#3470ff,#1157ff) repeat-x;background:#1157ff -o-linear-gradient(top,#3470ff,#1157ff) repeat-x;background:#1157ff linear-gradient(180deg,#3470ff,#1157ff) repeat-x;border-color:#044eff}.btn-success:focus,.btn-success.focus{-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075),0 0 0 .2rem rgba(55,114,255,.5);box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075),0 0 0 .2rem rgba(55,114,255,.5)}.btn-success.disabled,.btn-success:disabled{color:#fff;background-color:#3772ff;border-color:#3772ff}.btn-success:not(:disabled):not(.disabled):active,.btn-success:not(:disabled):not(.disabled).active,.show>.btn-success.dropdown-toggle{color:#fff;background-color:#044eff;background-image:none;border-color:#0049f6}.btn-success:not(:disabled):not(.disabled):active:focus,.btn-success:not(:disabled):not(.disabled).active:focus,.show>.btn-success.dropdown-toggle:focus{-webkit-box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(55,114,255,.5);box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(55,114,255,.5)}.btn-info{color:#222;background:#C0E0DE -webkit-gradient(linear,left top,left bottom,from(#c9e5e3),to(#C0E0DE)) repeat-x;background:#c0e0de -webkit-linear-gradient(top,#c9e5e3,#C0E0DE) repeat-x;background:#c0e0de -o-linear-gradient(top,#c9e5e3,#C0E0DE) repeat-x;background:#c0e0de linear-gradient(180deg,#c9e5e3,#C0E0DE) repeat-x;border-color:#c0e0de;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075);box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075)}.btn-info:hover{color:#fff;background:#a6d3d1 -webkit-gradient(linear,left top,left bottom,from(#b4dad8),to(#a6d3d1)) repeat-x;background:#a6d3d1 -webkit-linear-gradient(top,#b4dad8,#a6d3d1) repeat-x;background:#a6d3d1 -o-linear-gradient(top,#b4dad8,#a6d3d1) repeat-x;background:#a6d3d1 linear-gradient(180deg,#b4dad8,#a6d3d1) repeat-x;border-color:#9ecfcc}.btn-info:focus,.btn-info.focus{-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075),0 0 0 .2rem rgba(192,224,222,.5);box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075),0 0 0 .2rem rgba(192,224,222,.5)}.btn-info.disabled,.btn-info:disabled{color:#222;background-color:#c0e0de;border-color:#c0e0de}.btn-info:not(:disabled):not(.disabled):active,.btn-info:not(:disabled):not(.disabled).active,.show>.btn-info.dropdown-toggle{color:#fff;background-color:#9ecfcc;background-image:none;border-color:#95cbc8}.btn-info:not(:disabled):not(.disabled):active:focus,.btn-info:not(:disabled):not(.disabled).active:focus,.show>.btn-info.dropdown-toggle:focus{-webkit-box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(192,224,222,.5);box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(192,224,222,.5)}.btn-warning{color:#fff;background:#ED6A5A -webkit-gradient(linear,left top,left bottom,from(#f08073),to(#ED6A5A)) repeat-x;background:#ed6a5a -webkit-linear-gradient(top,#f08073,#ED6A5A) repeat-x;background:#ed6a5a -o-linear-gradient(top,#f08073,#ED6A5A) repeat-x;background:#ed6a5a linear-gradient(180deg,#f08073,#ED6A5A) repeat-x;border-color:#ed6a5a;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075);box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075)}.btn-warning:hover{color:#fff;background:#e94b38 -webkit-gradient(linear,left top,left bottom,from(#ed6655),to(#e94b38)) repeat-x;background:#e94b38 -webkit-linear-gradient(top,#ed6655,#e94b38) repeat-x;background:#e94b38 -o-linear-gradient(top,#ed6655,#e94b38) repeat-x;background:#e94b38 linear-gradient(180deg,#ed6655,#e94b38) repeat-x;border-color:#e8402c}.btn-warning:focus,.btn-warning.focus{-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075),0 0 0 .2rem rgba(237,106,90,.5);box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075),0 0 0 .2rem rgba(237,106,90,.5)}.btn-warning.disabled,.btn-warning:disabled{color:#fff;background-color:#ed6a5a;border-color:#ed6a5a}.btn-warning:not(:disabled):not(.disabled):active,.btn-warning:not(:disabled):not(.disabled).active,.show>.btn-warning.dropdown-toggle{color:#fff;background-color:#e8402c;background-image:none;border-color:#e73621}.btn-warning:not(:disabled):not(.disabled):active:focus,.btn-warning:not(:disabled):not(.disabled).active:focus,.show>.btn-warning.dropdown-toggle:focus{-webkit-box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(237,106,90,.5);box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(237,106,90,.5)}.btn-danger{color:#fff;background:#ED6A5A -webkit-gradient(linear,left top,left bottom,from(#f08073),to(#ED6A5A)) repeat-x;background:#ed6a5a -webkit-linear-gradient(top,#f08073,#ED6A5A) repeat-x;background:#ed6a5a -o-linear-gradient(top,#f08073,#ED6A5A) repeat-x;background:#ed6a5a linear-gradient(180deg,#f08073,#ED6A5A) repeat-x;border-color:#ed6a5a;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075);box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075)}.btn-danger:hover{color:#fff;background:#e94b38 -webkit-gradient(linear,left top,left bottom,from(#ed6655),to(#e94b38)) repeat-x;background:#e94b38 -webkit-linear-gradient(top,#ed6655,#e94b38) repeat-x;background:#e94b38 -o-linear-gradient(top,#ed6655,#e94b38) repeat-x;background:#e94b38 linear-gradient(180deg,#ed6655,#e94b38) repeat-x;border-color:#e8402c}.btn-danger:focus,.btn-danger.focus{-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075),0 0 0 .2rem rgba(237,106,90,.5);box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075),0 0 0 .2rem rgba(237,106,90,.5)}.btn-danger.disabled,.btn-danger:disabled{color:#fff;background-color:#ed6a5a;border-color:#ed6a5a}.btn-danger:not(:disabled):not(.disabled):active,.btn-danger:not(:disabled):not(.disabled).active,.show>.btn-danger.dropdown-toggle{color:#fff;background-color:#e8402c;background-image:none;border-color:#e73621}.btn-danger:not(:disabled):not(.disabled):active:focus,.btn-danger:not(:disabled):not(.disabled).active:focus,.show>.btn-danger.dropdown-toggle:focus{-webkit-box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(237,106,90,.5);box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(237,106,90,.5)}.btn-light{color:#222;background:#D3F3EE -webkit-gradient(linear,left top,left bottom,from(#daf5f1),to(#D3F3EE)) repeat-x;background:#d3f3ee -webkit-linear-gradient(top,#daf5f1,#D3F3EE) repeat-x;background:#d3f3ee -o-linear-gradient(top,#daf5f1,#D3F3EE) repeat-x;background:#d3f3ee linear-gradient(180deg,#daf5f1,#D3F3EE) repeat-x;border-color:#d3f3ee;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075);box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075)}.btn-light:hover{color:#222;background:#b5ebe2 -webkit-gradient(linear,left top,left bottom,from(#c0eee7),to(#b5ebe2)) repeat-x;background:#b5ebe2 -webkit-linear-gradient(top,#c0eee7,#b5ebe2) repeat-x;background:#b5ebe2 -o-linear-gradient(top,#c0eee7,#b5ebe2) repeat-x;background:#b5ebe2 linear-gradient(180deg,#c0eee7,#b5ebe2) repeat-x;border-color:#abe8df}.btn-light:focus,.btn-light.focus{-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075),0 0 0 .2rem rgba(211,243,238,.5);box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075),0 0 0 .2rem rgba(211,243,238,.5)}.btn-light.disabled,.btn-light:disabled{color:#222;background-color:#d3f3ee;border-color:#d3f3ee}.btn-light:not(:disabled):not(.disabled):active,.btn-light:not(:disabled):not(.disabled).active,.show>.btn-light.dropdown-toggle{color:#222;background-color:#abe8df;background-image:none;border-color:#a1e5db}.btn-light:not(:disabled):not(.disabled):active:focus,.btn-light:not(:disabled):not(.disabled).active:focus,.show>.btn-light.dropdown-toggle:focus{-webkit-box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(211,243,238,.5);box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(211,243,238,.5)}.btn-dark{color:#fff;background:#403F4C -webkit-gradient(linear,left top,left bottom,from(#5d5c67),to(#403F4C)) repeat-x;background:#403f4c -webkit-linear-gradient(top,#5d5c67,#403F4C) repeat-x;background:#403f4c -o-linear-gradient(top,#5d5c67,#403F4C) repeat-x;background:#403f4c linear-gradient(180deg,#5d5c67,#403F4C) repeat-x;border-color:#403f4c;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075);box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075)}.btn-dark:hover{color:#fff;background:#2e2e37 -webkit-gradient(linear,left top,left bottom,from(#4e4d55),to(#2e2e37)) repeat-x;background:#2e2e37 -webkit-linear-gradient(top,#4e4d55,#2e2e37) repeat-x;background:#2e2e37 -o-linear-gradient(top,#4e4d55,#2e2e37) repeat-x;background:#2e2e37 linear-gradient(180deg,#4e4d55,#2e2e37) repeat-x;border-color:#292830}.btn-dark:focus,.btn-dark.focus{-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075),0 0 0 .2rem rgba(64,63,76,.5);box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075),0 0 0 .2rem rgba(64,63,76,.5)}.btn-dark.disabled,.btn-dark:disabled{color:#fff;background-color:#403f4c;border-color:#403f4c}.btn-dark:not(:disabled):not(.disabled):active,.btn-dark:not(:disabled):not(.disabled).active,.show>.btn-dark.dropdown-toggle{color:#fff;background-color:#292830;background-image:none;border-color:#232229}.btn-dark:not(:disabled):not(.disabled):active:focus,.btn-dark:not(:disabled):not(.disabled).active:focus,.show>.btn-dark.dropdown-toggle:focus{-webkit-box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(64,63,76,.5);box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(64,63,76,.5)}.btn-outline-primary{color:#30638e;background-color:transparent;background-image:none;border-color:#30638e}.btn-outline-primary:hover{color:#fff;background-color:#30638e;border-color:#30638e}.btn-outline-primary:focus,.btn-outline-primary.focus{-webkit-box-shadow:0 0 0 .2rem rgba(48,99,142,.5);box-shadow:0 0 0 .2rem rgba(48,99,142,.5)}.btn-outline-primary.disabled,.btn-outline-primary:disabled{color:#30638e;background-color:transparent}.btn-outline-primary:not(:disabled):not(.disabled):active,.btn-outline-primary:not(:disabled):not(.disabled).active,.show>.btn-outline-primary.dropdown-toggle{color:#fff;background-color:#30638e;border-color:#30638e}.btn-outline-primary:not(:disabled):not(.disabled):active:focus,.btn-outline-primary:not(:disabled):not(.disabled).active:focus,.show>.btn-outline-primary.dropdown-toggle:focus{-webkit-box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(48,99,142,.5);box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(48,99,142,.5)}.btn-outline-secondary{color:#ffa630;background-color:transparent;background-image:none;border-color:#ffa630}.btn-outline-secondary:hover{color:#fff;background-color:#ffa630;border-color:#ffa630}.btn-outline-secondary:focus,.btn-outline-secondary.focus{-webkit-box-shadow:0 0 0 .2rem rgba(255,166,48,.5);box-shadow:0 0 0 .2rem rgba(255,166,48,.5)}.btn-outline-secondary.disabled,.btn-outline-secondary:disabled{color:#ffa630;background-color:transparent}.btn-outline-secondary:not(:disabled):not(.disabled):active,.btn-outline-secondary:not(:disabled):not(.disabled).active,.show>.btn-outline-secondary.dropdown-toggle{color:#fff;background-color:#ffa630;border-color:#ffa630}.btn-outline-secondary:not(:disabled):not(.disabled):active:focus,.btn-outline-secondary:not(:disabled):not(.disabled).active:focus,.show>.btn-outline-secondary.dropdown-toggle:focus{-webkit-box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(255,166,48,.5);box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(255,166,48,.5)}.btn-outline-success{color:#3772ff;background-color:transparent;background-image:none;border-color:#3772ff}.btn-outline-success:hover{color:#fff;background-color:#3772ff;border-color:#3772ff}.btn-outline-success:focus,.btn-outline-success.focus{-webkit-box-shadow:0 0 0 .2rem rgba(55,114,255,.5);box-shadow:0 0 0 .2rem rgba(55,114,255,.5)}.btn-outline-success.disabled,.btn-outline-success:disabled{color:#3772ff;background-color:transparent}.btn-outline-success:not(:disabled):not(.disabled):active,.btn-outline-success:not(:disabled):not(.disabled).active,.show>.btn-outline-success.dropdown-toggle{color:#fff;background-color:#3772ff;border-color:#3772ff}.btn-outline-success:not(:disabled):not(.disabled):active:focus,.btn-outline-success:not(:disabled):not(.disabled).active:focus,.show>.btn-outline-success.dropdown-toggle:focus{-webkit-box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(55,114,255,.5);box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(55,114,255,.5)}.btn-outline-info{color:#c0e0de;background-color:transparent;background-image:none;border-color:#c0e0de}.btn-outline-info:hover{color:#222;background-color:#c0e0de;border-color:#c0e0de}.btn-outline-info:focus,.btn-outline-info.focus{-webkit-box-shadow:0 0 0 .2rem rgba(192,224,222,.5);box-shadow:0 0 0 .2rem rgba(192,224,222,.5)}.btn-outline-info.disabled,.btn-outline-info:disabled{color:#c0e0de;background-color:transparent}.btn-outline-info:not(:disabled):not(.disabled):active,.btn-outline-info:not(:disabled):not(.disabled).active,.show>.btn-outline-info.dropdown-toggle{color:#222;background-color:#c0e0de;border-color:#c0e0de}.btn-outline-info:not(:disabled):not(.disabled):active:focus,.btn-outline-info:not(:disabled):not(.disabled).active:focus,.show>.btn-outline-info.dropdown-toggle:focus{-webkit-box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(192,224,222,.5);box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(192,224,222,.5)}.btn-outline-warning{color:#ed6a5a;background-color:transparent;background-image:none;border-color:#ed6a5a}.btn-outline-warning:hover{color:#fff;background-color:#ed6a5a;border-color:#ed6a5a}.btn-outline-warning:focus,.btn-outline-warning.focus{-webkit-box-shadow:0 0 0 .2rem rgba(237,106,90,.5);box-shadow:0 0 0 .2rem rgba(237,106,90,.5)}.btn-outline-warning.disabled,.btn-outline-warning:disabled{color:#ed6a5a;background-color:transparent}.btn-outline-warning:not(:disabled):not(.disabled):active,.btn-outline-warning:not(:disabled):not(.disabled).active,.show>.btn-outline-warning.dropdown-toggle{color:#fff;background-color:#ed6a5a;border-color:#ed6a5a}.btn-outline-warning:not(:disabled):not(.disabled):active:focus,.btn-outline-warning:not(:disabled):not(.disabled).active:focus,.show>.btn-outline-warning.dropdown-toggle:focus{-webkit-box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(237,106,90,.5);box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(237,106,90,.5)}.btn-outline-danger{color:#ed6a5a;background-color:transparent;background-image:none;border-color:#ed6a5a}.btn-outline-danger:hover{color:#fff;background-color:#ed6a5a;border-color:#ed6a5a}.btn-outline-danger:focus,.btn-outline-danger.focus{-webkit-box-shadow:0 0 0 .2rem rgba(237,106,90,.5);box-shadow:0 0 0 .2rem rgba(237,106,90,.5)}.btn-outline-danger.disabled,.btn-outline-danger:disabled{color:#ed6a5a;background-color:transparent}.btn-outline-danger:not(:disabled):not(.disabled):active,.btn-outline-danger:not(:disabled):not(.disabled).active,.show>.btn-outline-danger.dropdown-toggle{color:#fff;background-color:#ed6a5a;border-color:#ed6a5a}.btn-outline-danger:not(:disabled):not(.disabled):active:focus,.btn-outline-danger:not(:disabled):not(.disabled).active:focus,.show>.btn-outline-danger.dropdown-toggle:focus{-webkit-box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(237,106,90,.5);box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(237,106,90,.5)}.btn-outline-light{color:#d3f3ee;background-color:transparent;background-image:none;border-color:#d3f3ee}.btn-outline-light:hover{color:#222;background-color:#d3f3ee;border-color:#d3f3ee}.btn-outline-light:focus,.btn-outline-light.focus{-webkit-box-shadow:0 0 0 .2rem rgba(211,243,238,.5);box-shadow:0 0 0 .2rem rgba(211,243,238,.5)}.btn-outline-light.disabled,.btn-outline-light:disabled{color:#d3f3ee;background-color:transparent}.btn-outline-light:not(:disabled):not(.disabled):active,.btn-outline-light:not(:disabled):not(.disabled).active,.show>.btn-outline-light.dropdown-toggle{color:#222;background-color:#d3f3ee;border-color:#d3f3ee}.btn-outline-light:not(:disabled):not(.disabled):active:focus,.btn-outline-light:not(:disabled):not(.disabled).active:focus,.show>.btn-outline-light.dropdown-toggle:focus{-webkit-box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(211,243,238,.5);box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(211,243,238,.5)}.btn-outline-dark{color:#403f4c;background-color:transparent;background-image:none;border-color:#403f4c}.btn-outline-dark:hover{color:#fff;background-color:#403f4c;border-color:#403f4c}.btn-outline-dark:focus,.btn-outline-dark.focus{-webkit-box-shadow:0 0 0 .2rem rgba(64,63,76,.5);box-shadow:0 0 0 .2rem rgba(64,63,76,.5)}.btn-outline-dark.disabled,.btn-outline-dark:disabled{color:#403f4c;background-color:transparent}.btn-outline-dark:not(:disabled):not(.disabled):active,.btn-outline-dark:not(:disabled):not(.disabled).active,.show>.btn-outline-dark.dropdown-toggle{color:#fff;background-color:#403f4c;border-color:#403f4c}.btn-outline-dark:not(:disabled):not(.disabled):active:focus,.btn-outline-dark:not(:disabled):not(.disabled).active:focus,.show>.btn-outline-dark.dropdown-toggle:focus{-webkit-box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(64,63,76,.5);box-shadow:inset 0 3px 5px rgba(0,0,0,.125),0 0 0 .2rem rgba(64,63,76,.5)}.btn-link{font-weight:400;color:#3176d9;background-color:transparent}.btn-link:hover{color:#1e53a0;text-decoration:none;background-color:transparent;border-color:transparent}.btn-link:focus,.btn-link.focus{text-decoration:none;border-color:transparent;-webkit-box-shadow:none;box-shadow:none}.btn-link:disabled,.btn-link.disabled{color:#888;pointer-events:none}.btn-lg,.btn-group-lg>.btn{padding:.5rem 1rem;font-size:1.25rem;line-height:1.5;border-radius:.3rem}.btn-sm,.btn-group-sm>.btn{padding:.25rem .5rem;font-size:.875rem;line-height:1.5;border-radius:.2rem}.btn-block{display:block;width:100%}.btn-block+.btn-block{margin-top:.5rem}input[type=submit].btn-block,input[type=reset].btn-block,input[type=button].btn-block{width:100%}.fade{-webkit-transition:opacity .15s linear;-o-transition:opacity .15s linear;transition:opacity .15s linear}@media screen and (prefers-reduced-motion:reduce){.fade{-webkit-transition:none;-o-transition:none;transition:none}}.fade:not(.show){opacity:0}.collapse:not(.show){display:none}.collapsing{position:relative;height:0;overflow:hidden;-webkit-transition:height .35s ease;-o-transition:height .35s ease;transition:height .35s ease}@media screen and (prefers-reduced-motion:reduce){.collapsing{-webkit-transition:none;-o-transition:none;transition:none}}.dropup,.dropright,.dropdown,.dropleft{position:relative}.dropdown-toggle::after{display:inline-block;width:0;height:0;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid;border-right:.3em solid transparent;border-bottom:0;border-left:.3em solid transparent}.dropdown-toggle:empty::after{margin-left:0}.dropdown-menu{position:absolute;top:100%;left:0;z-index:1000;display:none;float:left;min-width:10rem;padding:.5rem 0;margin:.125rem 0 0;font-size:1rem;color:#222;text-align:left;list-style:none;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,.15);border-radius:.25rem;-webkit-box-shadow:0 .5rem 1rem rgba(0,0,0,.175);box-shadow:0 .5rem 1rem rgba(0,0,0,.175)}.dropdown-menu-right{right:0;left:auto}.dropup .dropdown-menu{top:auto;bottom:100%;margin-top:0;margin-bottom:.125rem}.dropup .dropdown-toggle::after{display:inline-block;width:0;height:0;margin-left:.255em;vertical-align:.255em;content:"";border-top:0;border-right:.3em solid transparent;border-bottom:.3em solid;border-left:.3em solid transparent}.dropup .dropdown-toggle:empty::after{margin-left:0}.dropright .dropdown-menu{top:0;right:auto;left:100%;margin-top:0;margin-left:.125rem}.dropright .dropdown-toggle::after{display:inline-block;width:0;height:0;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:0;border-bottom:.3em solid transparent;border-left:.3em solid}.dropright .dropdown-toggle:empty::after{margin-left:0}.dropright .dropdown-toggle::after{vertical-align:0}.dropleft .dropdown-menu{top:0;right:100%;left:auto;margin-top:0;margin-right:.125rem}.dropleft .dropdown-toggle::after{display:inline-block;width:0;height:0;margin-left:.255em;vertical-align:.255em;content:""}.dropleft .dropdown-toggle::after{display:none}.dropleft .dropdown-toggle::before{display:inline-block;width:0;height:0;margin-right:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:.3em solid;border-bottom:.3em solid transparent}.dropleft .dropdown-toggle:empty::after{margin-left:0}.dropleft .dropdown-toggle::before{vertical-align:0}.dropdown-menu[x-placement^=top],.dropdown-menu[x-placement^=right],.dropdown-menu[x-placement^=bottom],.dropdown-menu[x-placement^=left]{right:auto;bottom:auto}.dropdown-divider{height:0;margin:.5rem 0;overflow:hidden;border-top:1px solid #eee}.dropdown-item{display:block;width:100%;padding:.25rem 1.5rem;clear:both;font-weight:400;color:#222;text-align:inherit;white-space:nowrap;background-color:transparent;border:0}.dropdown-item:hover,.dropdown-item:focus{color:#151515;text-decoration:none;background:#f8f9fa -webkit-gradient(linear,left top,left bottom,from(#f9fafb),to(#f8f9fa)) repeat-x;background:#f8f9fa -webkit-linear-gradient(top,#f9fafb,#f8f9fa) repeat-x;background:#f8f9fa -o-linear-gradient(top,#f9fafb,#f8f9fa) repeat-x;background:#f8f9fa linear-gradient(180deg,#f9fafb,#f8f9fa) repeat-x}.dropdown-item.active,.dropdown-item:active{color:#fff;text-decoration:none;background:#30638E -webkit-gradient(linear,left top,left bottom,from(#4f7a9f),to(#30638E)) repeat-x;background:#30638e -webkit-linear-gradient(top,#4f7a9f,#30638E) repeat-x;background:#30638e -o-linear-gradient(top,#4f7a9f,#30638E) repeat-x;background:#30638e linear-gradient(180deg,#4f7a9f,#30638E) repeat-x}.dropdown-item.disabled,.dropdown-item:disabled{color:#888;background-color:transparent;background-image:none}.dropdown-menu.show{display:block}.dropdown-header{display:block;padding:.5rem 1.5rem;margin-bottom:0;font-size:.875rem;color:#888;white-space:nowrap}.dropdown-item-text{display:block;padding:.25rem 1.5rem;color:#222}.btn-group,.btn-group-vertical{position:relative;display:-webkit-inline-box;display:-webkit-inline-flex;display:-ms-inline-flexbox;display:inline-flex;vertical-align:middle}.btn-group>.btn,.btn-group-vertical>.btn{position:relative;-webkit-box-flex:0;-webkit-flex:0 1 auto;-ms-flex:0 1 auto;flex:0 1 auto}.btn-group>.btn:hover,.btn-group-vertical>.btn:hover{z-index:1}.btn-group>.btn:focus,.btn-group>.btn:active,.btn-group>.btn.active,.btn-group-vertical>.btn:focus,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn.active{z-index:1}.btn-group .btn+.btn,.btn-group .btn+.btn-group,.btn-group .btn-group+.btn,.btn-group .btn-group+.btn-group,.btn-group-vertical .btn+.btn,.btn-group-vertical .btn+.btn-group,.btn-group-vertical .btn-group+.btn,.btn-group-vertical .btn-group+.btn-group{margin-left:-1px}.btn-toolbar{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-flex-wrap:wrap;-ms-flex-wrap:wrap;flex-wrap:wrap;-webkit-box-pack:start;-webkit-justify-content:flex-start;-ms-flex-pack:start;justify-content:flex-start}.btn-toolbar .input-group{width:auto}.btn-group>.btn:first-child{margin-left:0}.btn-group>.btn:not(:last-child):not(.dropdown-toggle),.btn-group>.btn-group:not(:last-child)>.btn{border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn:not(:first-child),.btn-group>.btn-group:not(:first-child)>.btn{border-top-left-radius:0;border-bottom-left-radius:0}.dropdown-toggle-split{padding-right:.5625rem;padding-left:.5625rem}.dropdown-toggle-split::after,.dropup .dropdown-toggle-split::after,.dropright .dropdown-toggle-split::after{margin-left:0}.dropleft .dropdown-toggle-split::before{margin-right:0}.btn-sm+.dropdown-toggle-split,.btn-group-sm>.btn+.dropdown-toggle-split{padding-right:.375rem;padding-left:.375rem}.btn-lg+.dropdown-toggle-split,.btn-group-lg>.btn+.dropdown-toggle-split{padding-right:.75rem;padding-left:.75rem}.btn-group.show .dropdown-toggle{-webkit-box-shadow:inset 0 3px 5px rgba(0,0,0,.125);box-shadow:inset 0 3px 5px rgba(0,0,0,.125)}.btn-group.show .dropdown-toggle.btn-link{-webkit-box-shadow:none;box-shadow:none}.btn-group-vertical{-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;-webkit-box-align:start;-webkit-align-items:flex-start;-ms-flex-align:start;align-items:flex-start;-webkit-box-pack:center;-webkit-justify-content:center;-ms-flex-pack:center;justify-content:center}.btn-group-vertical .btn,.btn-group-vertical .btn-group{width:100%}.btn-group-vertical>.btn+.btn,.btn-group-vertical>.btn+.btn-group,.btn-group-vertical>.btn-group+.btn,.btn-group-vertical>.btn-group+.btn-group{margin-top:-1px;margin-left:0}.btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle),.btn-group-vertical>.btn-group:not(:last-child)>.btn{border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn:not(:first-child),.btn-group-vertical>.btn-group:not(:first-child)>.btn{border-top-left-radius:0;border-top-right-radius:0}.btn-group-toggle>.btn,.btn-group-toggle>.btn-group>.btn{margin-bottom:0}.btn-group-toggle>.btn input[type=radio],.btn-group-toggle>.btn input[type=checkbox],.btn-group-toggle>.btn-group>.btn input[type=radio],.btn-group-toggle>.btn-group>.btn input[type=checkbox]{position:absolute;clip:rect(0,0,0,0);pointer-events:none}.input-group{position:relative;display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-flex-wrap:wrap;-ms-flex-wrap:wrap;flex-wrap:wrap;-webkit-box-align:stretch;-webkit-align-items:stretch;-ms-flex-align:stretch;align-items:stretch;width:100%}.input-group>.form-control,.input-group>.custom-select,.input-group>.custom-file{position:relative;-webkit-box-flex:1;-webkit-flex:1 1 auto;-ms-flex:1 1 auto;flex:1 1 auto;width:1%;margin-bottom:0}.input-group>.form-control+.form-control,.input-group>.form-control+.custom-select,.input-group>.form-control+.custom-file,.input-group>.custom-select+.form-control,.input-group>.custom-select+.custom-select,.input-group>.custom-select+.custom-file,.input-group>.custom-file+.form-control,.input-group>.custom-file+.custom-select,.input-group>.custom-file+.custom-file{margin-left:-1px}.input-group>.form-control:focus,.input-group>.custom-select:focus,.input-group>.custom-file .custom-file-input:focus~.custom-file-label{z-index:3}.input-group>.custom-file .custom-file-input:focus{z-index:4}.input-group>.form-control:not(:last-child),.input-group>.custom-select:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.form-control:not(:first-child),.input-group>.custom-select:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.input-group>.custom-file{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center}.input-group>.custom-file:not(:last-child) .custom-file-label,.input-group>.custom-file:not(:last-child) .custom-file-label::after{border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.custom-file:not(:first-child) .custom-file-label{border-top-left-radius:0;border-bottom-left-radius:0}.input-group-prepend,.input-group-append{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex}.input-group-prepend .btn,.input-group-append .btn{position:relative;z-index:2}.input-group-prepend .btn+.btn,.input-group-prepend .btn+.input-group-text,.input-group-prepend .input-group-text+.input-group-text,.input-group-prepend .input-group-text+.btn,.input-group-append .btn+.btn,.input-group-append .btn+.input-group-text,.input-group-append .input-group-text+.input-group-text,.input-group-append .input-group-text+.btn{margin-left:-1px}.input-group-prepend{margin-right:-1px}.input-group-append{margin-left:-1px}.input-group-text{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center;padding:.375rem .75rem;margin-bottom:0;font-size:1rem;font-weight:400;line-height:1.5;color:#495057;text-align:center;white-space:nowrap;background-color:#eee;border:1px solid #ccc;border-radius:.25rem}.input-group-text input[type=radio],.input-group-text input[type=checkbox]{margin-top:0}.input-group-lg>.form-control,.input-group-lg>.input-group-prepend>.input-group-text,.input-group-lg>.input-group-append>.input-group-text,.input-group-lg>.input-group-prepend>.btn,.input-group-lg>.input-group-append>.btn{height:-webkit-calc(2.875rem + 2px);height:calc(2.875rem + 2px);padding:.5rem 1rem;font-size:1.25rem;line-height:1.5;border-radius:.3rem}.input-group-sm>.form-control,.input-group-sm>.input-group-prepend>.input-group-text,.input-group-sm>.input-group-append>.input-group-text,.input-group-sm>.input-group-prepend>.btn,.input-group-sm>.input-group-append>.btn{height:-webkit-calc(1.8125rem + 2px);height:calc(1.8125rem + 2px);padding:.25rem .5rem;font-size:.875rem;line-height:1.5;border-radius:.2rem}.input-group>.input-group-prepend>.btn,.input-group>.input-group-prepend>.input-group-text,.input-group>.input-group-append:not(:last-child)>.btn,.input-group>.input-group-append:not(:last-child)>.input-group-text,.input-group>.input-group-append:last-child>.btn:not(:last-child):not(.dropdown-toggle),.input-group>.input-group-append:last-child>.input-group-text:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.input-group>.input-group-append>.btn,.input-group>.input-group-append>.input-group-text,.input-group>.input-group-prepend:not(:first-child)>.btn,.input-group>.input-group-prepend:not(:first-child)>.input-group-text,.input-group>.input-group-prepend:first-child>.btn:not(:first-child),.input-group>.input-group-prepend:first-child>.input-group-text:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.custom-control{position:relative;display:block;min-height:1.5rem;padding-left:1.5rem}.custom-control-inline{display:-webkit-inline-box;display:-webkit-inline-flex;display:-ms-inline-flexbox;display:inline-flex;margin-right:1rem}.custom-control-input{position:absolute;z-index:-1;opacity:0}.custom-control-input:checked~.custom-control-label::before{color:#fff;background:#30638E -webkit-gradient(linear,left top,left bottom,from(#4f7a9f),to(#30638E)) repeat-x;background:#30638e -webkit-linear-gradient(top,#4f7a9f,#30638E) repeat-x;background:#30638e -o-linear-gradient(top,#4f7a9f,#30638E) repeat-x;background:#30638e linear-gradient(180deg,#4f7a9f,#30638E) repeat-x;-webkit-box-shadow:none;box-shadow:none}.custom-control-input:focus~.custom-control-label::before{-webkit-box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(48,99,142,.25);box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(48,99,142,.25)}.custom-control-input:active~.custom-control-label::before{color:#fff;background-color:#95bbdb;-webkit-box-shadow:none;box-shadow:none}.custom-control-input:disabled~.custom-control-label{color:#888}.custom-control-input:disabled~.custom-control-label::before{background-color:#eee}.custom-control-label{position:relative;margin-bottom:0}.custom-control-label::before{position:absolute;top:.25rem;left:-1.5rem;display:block;width:1rem;height:1rem;pointer-events:none;content:"";-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;background-color:#dee2e6;-webkit-box-shadow:inset 0 .25rem .25rem rgba(0,0,0,.1);box-shadow:inset 0 .25rem .25rem rgba(0,0,0,.1)}.custom-control-label::after{position:absolute;top:.25rem;left:-1.5rem;display:block;width:1rem;height:1rem;content:"";background-repeat:no-repeat;background-position:50%;-webkit-background-size:50% 50%;background-size:50% 50%}.custom-checkbox .custom-control-label::before{border-radius:.25rem}.custom-checkbox .custom-control-input:checked~.custom-control-label::before{background:#30638E -webkit-gradient(linear,left top,left bottom,from(#4f7a9f),to(#30638E)) repeat-x;background:#30638e -webkit-linear-gradient(top,#4f7a9f,#30638E) repeat-x;background:#30638e -o-linear-gradient(top,#4f7a9f,#30638E) repeat-x;background:#30638e linear-gradient(180deg,#4f7a9f,#30638E) repeat-x}.custom-checkbox .custom-control-input:checked~.custom-control-label::after{background-image:url(data:image/svg+xml;charset=utf8;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHZpZXdCb3g9IjAgMCA4IDgiPjxwYXRoIGZpbGw9IiNmZmYiIGQ9Ik02LjU2NC43NWwtMy41OSAzLjYxMi0xLjUzOC0xLjU1TDAgNC4yNiAyLjk3NCA3LjI1IDggMi4xOTN6Ii8+PC9zdmc+)}.custom-checkbox .custom-control-input:indeterminate~.custom-control-label::before{background:#30638E -webkit-gradient(linear,left top,left bottom,from(#4f7a9f),to(#30638E)) repeat-x;background:#30638e -webkit-linear-gradient(top,#4f7a9f,#30638E) repeat-x;background:#30638e -o-linear-gradient(top,#4f7a9f,#30638E) repeat-x;background:#30638e linear-gradient(180deg,#4f7a9f,#30638E) repeat-x;-webkit-box-shadow:none;box-shadow:none}.custom-checkbox .custom-control-input:indeterminate~.custom-control-label::after{background-image:url(data:image/svg+xml;charset=utf8;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHZpZXdCb3g9IjAgMCA0IDQiPjxwYXRoIHN0cm9rZT0iI2ZmZiIgZD0iTTAgMmg0Ii8+PC9zdmc+)}.custom-checkbox .custom-control-input:disabled:checked~.custom-control-label::before{background-color:rgba(48,99,142,.5)}.custom-checkbox .custom-control-input:disabled:indeterminate~.custom-control-label::before{background-color:rgba(48,99,142,.5)}.custom-radio .custom-control-label::before{border-radius:50%}.custom-radio .custom-control-input:checked~.custom-control-label::before{background:#30638E -webkit-gradient(linear,left top,left bottom,from(#4f7a9f),to(#30638E)) repeat-x;background:#30638e -webkit-linear-gradient(top,#4f7a9f,#30638E) repeat-x;background:#30638e -o-linear-gradient(top,#4f7a9f,#30638E) repeat-x;background:#30638e linear-gradient(180deg,#4f7a9f,#30638E) repeat-x}.custom-radio .custom-control-input:checked~.custom-control-label::after{background-image:url(data:image/svg+xml;charset=utf8;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHZpZXdCb3g9Ii00IC00IDggOCI+PGNpcmNsZSByPSIzIiBmaWxsPSIjZmZmIi8+PC9zdmc+)}.custom-radio .custom-control-input:disabled:checked~.custom-control-label::before{background-color:rgba(48,99,142,.5)}.custom-select{display:inline-block;width:100%;height:-webkit-calc(2.25rem + 2px);height:calc(2.25rem + 2px);padding:.375rem 1.75rem .375rem .75rem;line-height:1.5;color:#495057;vertical-align:middle;background:#fff url(data:image/svg+xml;charset=utf8;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHZpZXdCb3g9IjAgMCA0IDUiPjxwYXRoIGZpbGw9IiMzMzMiIGQ9Ik0yIDAgMCAyaDR6bTAgNUwwIDNoNHoiLz48L3N2Zz4=) no-repeat 100% .75rem 50%;-webkit-background-size:8px 10px;background-size:8px 10px;border:1px solid #ccc;border-radius:.25rem;-webkit-box-shadow:inset 0 1px 2px rgba(0,0,0,.075);box-shadow:inset 0 1px 2px rgba(0,0,0,.075);-webkit-appearance:none;-moz-appearance:none;appearance:none}.custom-select:focus{border-color:#6fa3ce;outline:0;-webkit-box-shadow:inset 0 1px 2px rgba(0,0,0,.075),0 0 0 .2rem rgba(111,163,206,.5);box-shadow:inset 0 1px 2px rgba(0,0,0,.075),0 0 0 .2rem rgba(111,163,206,.5)}.custom-select:focus::-ms-value{color:#495057;background-color:#fff}.custom-select[multiple],.custom-select[size]:not([size="1"]){height:auto;padding-right:.75rem;background-image:none}.custom-select:disabled{color:#888;background-color:#eee}.custom-select::-ms-expand{opacity:0}.custom-select-sm{height:-webkit-calc(1.8125rem + 2px);height:calc(1.8125rem + 2px);padding-top:.375rem;padding-bottom:.375rem;font-size:75%}.custom-select-lg{height:-webkit-calc(2.875rem + 2px);height:calc(2.875rem + 2px);padding-top:.375rem;padding-bottom:.375rem;font-size:125%}.custom-file{position:relative;display:inline-block;width:100%;height:-webkit-calc(2.25rem + 2px);height:calc(2.25rem + 2px);margin-bottom:0}.custom-file-input{position:relative;z-index:2;width:100%;height:-webkit-calc(2.25rem + 2px);height:calc(2.25rem + 2px);margin:0;opacity:0}.custom-file-input:focus~.custom-file-label{border-color:#6fa3ce;-webkit-box-shadow:0 0 0 .2rem rgba(48,99,142,.25);box-shadow:0 0 0 .2rem rgba(48,99,142,.25)}.custom-file-input:focus~.custom-file-label::after{border-color:#6fa3ce}.custom-file-input:disabled~.custom-file-label{background-color:#eee}.custom-file-input:lang(en)~.custom-file-label::after{content:"Browse"}.custom-file-label{position:absolute;top:0;right:0;left:0;z-index:1;height:-webkit-calc(2.25rem + 2px);height:calc(2.25rem + 2px);padding:.375rem .75rem;line-height:1.5;color:#495057;background-color:#fff;border:1px solid #ccc;border-radius:.25rem;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.075);box-shadow:inset 0 1px 1px rgba(0,0,0,.075)}.custom-file-label::after{position:absolute;top:0;right:0;bottom:0;z-index:3;display:block;height:2.25rem;padding:.375rem .75rem;line-height:1.5;color:#495057;content:"Browse";background:#eee -webkit-gradient(linear,left top,left bottom,from(#f1f1f1),to(#eee)) repeat-x;background:#eee -webkit-linear-gradient(top,#f1f1f1,#eee) repeat-x;background:#eee -o-linear-gradient(top,#f1f1f1,#eee) repeat-x;background:#eee linear-gradient(180deg,#f1f1f1,#eee) repeat-x;border-left:1px solid #ccc;border-radius:0 .25rem .25rem 0}.custom-range{width:100%;padding-left:0;background-color:transparent;-webkit-appearance:none;-moz-appearance:none;appearance:none}.custom-range:focus{outline:none}.custom-range:focus::-webkit-slider-thumb{-webkit-box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(48,99,142,.25);box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(48,99,142,.25)}.custom-range:focus::-moz-range-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(48,99,142,.25)}.custom-range:focus::-ms-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .2rem rgba(48,99,142,.25)}.custom-range::-moz-focus-outer{border:0}.custom-range::-webkit-slider-thumb{width:1rem;height:1rem;margin-top:-.25rem;background:#30638E -webkit-gradient(linear,left top,left bottom,from(#4f7a9f),to(#30638E)) repeat-x;background:#30638e -webkit-linear-gradient(top,#4f7a9f,#30638E) repeat-x;background:#30638e linear-gradient(180deg,#4f7a9f,#30638E) repeat-x;border:0;border-radius:1rem;-webkit-box-shadow:0 .1rem .25rem rgba(0,0,0,.1);box-shadow:0 .1rem .25rem rgba(0,0,0,.1);-webkit-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,-webkit-box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,-webkit-box-shadow .15s ease-in-out;-o-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out,-webkit-box-shadow .15s ease-in-out;-webkit-appearance:none;appearance:none}@media screen and (prefers-reduced-motion:reduce){.custom-range::-webkit-slider-thumb{-webkit-transition:none;-o-transition:none;transition:none}}.custom-range::-webkit-slider-thumb:active{background:#95bbdb -webkit-gradient(linear,left top,left bottom,from(#a5c5e1),to(#95bbdb)) repeat-x;background:#95bbdb -webkit-linear-gradient(top,#a5c5e1,#95bbdb) repeat-x;background:#95bbdb linear-gradient(180deg,#a5c5e1,#95bbdb) repeat-x}.custom-range::-webkit-slider-runnable-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:#dee2e6;border-color:transparent;border-radius:1rem;-webkit-box-shadow:inset 0 .25rem .25rem rgba(0,0,0,.1);box-shadow:inset 0 .25rem .25rem rgba(0,0,0,.1)}.custom-range::-moz-range-thumb{width:1rem;height:1rem;background:#30638e linear-gradient(180deg,#4f7a9f,#30638E) repeat-x;border:0;border-radius:1rem;box-shadow:0 .1rem .25rem rgba(0,0,0,.1);-webkit-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,-webkit-box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,-webkit-box-shadow .15s ease-in-out;-o-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out,-webkit-box-shadow .15s ease-in-out;-moz-appearance:none;appearance:none}@media screen and (prefers-reduced-motion:reduce){.custom-range::-moz-range-thumb{-webkit-transition:none;-o-transition:none;transition:none}}.custom-range::-moz-range-thumb:active{background:#95bbdb linear-gradient(180deg,#a5c5e1,#95bbdb) repeat-x}.custom-range::-moz-range-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:#dee2e6;border-color:transparent;border-radius:1rem;box-shadow:inset 0 .25rem .25rem rgba(0,0,0,.1)}.custom-range::-ms-thumb{width:1rem;height:1rem;margin-top:0;margin-right:.2rem;margin-left:.2rem;background:#30638e linear-gradient(180deg,#4f7a9f,#30638E) repeat-x;border:0;border-radius:1rem;box-shadow:0 .1rem .25rem rgba(0,0,0,.1);-webkit-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,-webkit-box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,-webkit-box-shadow .15s ease-in-out;-o-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out,-webkit-box-shadow .15s ease-in-out;appearance:none}@media screen and (prefers-reduced-motion:reduce){.custom-range::-ms-thumb{-webkit-transition:none;-o-transition:none;transition:none}}.custom-range::-ms-thumb:active{background:#95bbdb linear-gradient(180deg,#a5c5e1,#95bbdb) repeat-x}.custom-range::-ms-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:transparent;border-color:transparent;border-width:.5rem;box-shadow:inset 0 .25rem .25rem rgba(0,0,0,.1)}.custom-range::-ms-fill-lower{background-color:#dee2e6;border-radius:1rem}.custom-range::-ms-fill-upper{margin-right:15px;background-color:#dee2e6;border-radius:1rem}.custom-control-label::before,.custom-file-label,.custom-select{-webkit-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,-webkit-box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,-webkit-box-shadow .15s ease-in-out;-o-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out,-webkit-box-shadow .15s ease-in-out}@media screen and (prefers-reduced-motion:reduce){.custom-control-label::before,.custom-file-label,.custom-select{-webkit-transition:none;-o-transition:none;transition:none}}.nav{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-flex-wrap:wrap;-ms-flex-wrap:wrap;flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:.5rem 1rem}.nav-link:hover,.nav-link:focus{text-decoration:none}.nav-link.disabled{color:#888}.nav-tabs{border-bottom:1px solid #dee2e6}.nav-tabs .nav-item{margin-bottom:-1px}.nav-tabs .nav-link{border:1px solid transparent;border-top-left-radius:.25rem;border-top-right-radius:.25rem}.nav-tabs .nav-link:hover,.nav-tabs .nav-link:focus{border-color:#eee #eee #dee2e6}.nav-tabs .nav-link.disabled{color:#888;background-color:transparent;border-color:transparent}.nav-tabs .nav-link.active,.nav-tabs .nav-item.show .nav-link{color:#495057;background-color:#fff;border-color:#dee2e6 #dee2e6 #fff}.nav-tabs .dropdown-menu{margin-top:-1px;border-top-left-radius:0;border-top-right-radius:0}.nav-pills .nav-link{border-radius:.25rem}.nav-pills .nav-link.active,.nav-pills .show>.nav-link{color:#fff;background-color:#30638e}.nav-fill .nav-item{-webkit-box-flex:1;-webkit-flex:1 1 auto;-ms-flex:1 1 auto;flex:1 1 auto;text-align:center}.nav-justified .nav-item{-webkit-flex-basis:0;-ms-flex-preferred-size:0;flex-basis:0;-webkit-box-flex:1;-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1;text-align:center}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.navbar{position:relative;display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-flex-wrap:wrap;-ms-flex-wrap:wrap;flex-wrap:wrap;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:justify;-webkit-justify-content:space-between;-ms-flex-pack:justify;justify-content:space-between;padding:.5rem 1rem}.navbar>.container,.navbar>.container-fluid{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-flex-wrap:wrap;-ms-flex-wrap:wrap;flex-wrap:wrap;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:justify;-webkit-justify-content:space-between;-ms-flex-pack:justify;justify-content:space-between}.navbar-brand{display:inline-block;padding-top:.3125rem;padding-bottom:.3125rem;margin-right:1rem;font-size:1.25rem;line-height:inherit;white-space:nowrap}.navbar-brand:hover,.navbar-brand:focus{text-decoration:none}.navbar-nav{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .nav-link{padding-right:0;padding-left:0}.navbar-nav .dropdown-menu{position:static;float:none}.navbar-text{display:inline-block;padding-top:.5rem;padding-bottom:.5rem}.navbar-collapse{-webkit-flex-basis:100%;-ms-flex-preferred-size:100%;flex-basis:100%;-webkit-box-flex:1;-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center}.navbar-toggler{padding:.25rem .75rem;font-size:1.25rem;line-height:1;background-color:transparent;border:1px solid transparent;border-radius:.25rem}.navbar-toggler:hover,.navbar-toggler:focus{text-decoration:none}.navbar-toggler:not(:disabled):not(.disabled){cursor:pointer}.navbar-toggler-icon{display:inline-block;width:1.5em;height:1.5em;vertical-align:middle;content:"";background:no-repeat 50%;-webkit-background-size:100% 100%;background-size:100% 100%}@media(max-width:575.98px){.navbar-expand-sm>.container,.navbar-expand-sm>.container-fluid{padding-right:0;padding-left:0}}@media(min-width:576px){.navbar-expand-sm{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-webkit-flex-flow:row nowrap;-ms-flex-flow:row nowrap;flex-flow:row nowrap;-webkit-box-pack:start;-webkit-justify-content:flex-start;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-sm .navbar-nav{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-webkit-flex-direction:row;-ms-flex-direction:row;flex-direction:row}.navbar-expand-sm .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-sm .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-sm>.container,.navbar-expand-sm>.container-fluid{-webkit-flex-wrap:nowrap;-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-sm .navbar-collapse{display:-webkit-box!important;display:-webkit-flex!important;display:-ms-flexbox!important;display:flex!important;-webkit-flex-basis:auto;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-sm .navbar-toggler{display:none}}@media(max-width:767.98px){.navbar-expand-md>.container,.navbar-expand-md>.container-fluid{padding-right:0;padding-left:0}}@media(min-width:768px){.navbar-expand-md{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-webkit-flex-flow:row nowrap;-ms-flex-flow:row nowrap;flex-flow:row nowrap;-webkit-box-pack:start;-webkit-justify-content:flex-start;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-md .navbar-nav{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-webkit-flex-direction:row;-ms-flex-direction:row;flex-direction:row}.navbar-expand-md .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-md .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-md>.container,.navbar-expand-md>.container-fluid{-webkit-flex-wrap:nowrap;-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-md .navbar-collapse{display:-webkit-box!important;display:-webkit-flex!important;display:-ms-flexbox!important;display:flex!important;-webkit-flex-basis:auto;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-md .navbar-toggler{display:none}}@media(max-width:991.98px){.navbar-expand-lg>.container,.navbar-expand-lg>.container-fluid{padding-right:0;padding-left:0}}@media(min-width:992px){.navbar-expand-lg{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-webkit-flex-flow:row nowrap;-ms-flex-flow:row nowrap;flex-flow:row nowrap;-webkit-box-pack:start;-webkit-justify-content:flex-start;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-lg .navbar-nav{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-webkit-flex-direction:row;-ms-flex-direction:row;flex-direction:row}.navbar-expand-lg .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-lg .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-lg>.container,.navbar-expand-lg>.container-fluid{-webkit-flex-wrap:nowrap;-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-lg .navbar-collapse{display:-webkit-box!important;display:-webkit-flex!important;display:-ms-flexbox!important;display:flex!important;-webkit-flex-basis:auto;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-lg .navbar-toggler{display:none}}@media(max-width:1199.98px){.navbar-expand-xl>.container,.navbar-expand-xl>.container-fluid{padding-right:0;padding-left:0}}@media(min-width:1200px){.navbar-expand-xl{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-webkit-flex-flow:row nowrap;-ms-flex-flow:row nowrap;flex-flow:row nowrap;-webkit-box-pack:start;-webkit-justify-content:flex-start;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand-xl .navbar-nav{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-webkit-flex-direction:row;-ms-flex-direction:row;flex-direction:row}.navbar-expand-xl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xl .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand-xl>.container,.navbar-expand-xl>.container-fluid{-webkit-flex-wrap:nowrap;-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand-xl .navbar-collapse{display:-webkit-box!important;display:-webkit-flex!important;display:-ms-flexbox!important;display:flex!important;-webkit-flex-basis:auto;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand-xl .navbar-toggler{display:none}}.navbar-expand{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-webkit-flex-flow:row nowrap;-ms-flex-flow:row nowrap;flex-flow:row nowrap;-webkit-box-pack:start;-webkit-justify-content:flex-start;-ms-flex-pack:start;justify-content:flex-start}.navbar-expand>.container,.navbar-expand>.container-fluid{padding-right:0;padding-left:0}.navbar-expand .navbar-nav{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-webkit-flex-direction:row;-ms-flex-direction:row;flex-direction:row}.navbar-expand .navbar-nav .dropdown-menu{position:absolute}.navbar-expand .navbar-nav .nav-link{padding-right:.5rem;padding-left:.5rem}.navbar-expand>.container,.navbar-expand>.container-fluid{-webkit-flex-wrap:nowrap;-ms-flex-wrap:nowrap;flex-wrap:nowrap}.navbar-expand .navbar-collapse{display:-webkit-box!important;display:-webkit-flex!important;display:-ms-flexbox!important;display:flex!important;-webkit-flex-basis:auto;-ms-flex-preferred-size:auto;flex-basis:auto}.navbar-expand .navbar-toggler{display:none}.navbar-light .navbar-brand{color:rgba(0,0,0,.9)}.navbar-light .navbar-brand:hover,.navbar-light .navbar-brand:focus{color:rgba(0,0,0,.9)}.navbar-light .navbar-nav .nav-link{color:rgba(0,0,0,.5)}.navbar-light .navbar-nav .nav-link:hover,.navbar-light .navbar-nav .nav-link:focus{color:rgba(0,0,0,.7)}.navbar-light .navbar-nav .nav-link.disabled{color:rgba(0,0,0,.3)}.navbar-light .navbar-nav .show>.nav-link,.navbar-light .navbar-nav .active>.nav-link,.navbar-light .navbar-nav .nav-link.show,.navbar-light .navbar-nav .nav-link.active{color:rgba(0,0,0,.9)}.navbar-light .navbar-toggler{color:rgba(0,0,0,.5);border-color:rgba(0,0,0,.1)}.navbar-light .navbar-toggler-icon{background-image:url(data:image/svg+xml;charset=utf8;base64,PHN2ZyB2aWV3Qm94PSIwIDAgMzAgMzAiIHhtbG5zPSJodHRwOi8vd3d3LnczLm9yZy8yMDAwL3N2ZyI+PHBhdGggc3Ryb2tlPSJyZ2JhKDAsIDAsIDAsIDAuNSkiIHN0cm9rZS13aWR0aD0iMiIgc3Ryb2tlLWxpbmVjYXA9InJvdW5kIiBzdHJva2UtbWl0ZXJsaW1pdD0iMTAiIGQ9Ik00IDdoMjJNNCAxNWgyMk00IDIzaDIyIi8+PC9zdmc+)}.navbar-light .navbar-text{color:rgba(0,0,0,.5)}.navbar-light .navbar-text a{color:rgba(0,0,0,.9)}.navbar-light .navbar-text a:hover,.navbar-light .navbar-text a:focus{color:rgba(0,0,0,.9)}.navbar-dark .navbar-brand{color:#fff}.navbar-dark .navbar-brand:hover,.navbar-dark .navbar-brand:focus{color:#fff}.navbar-dark .navbar-nav .nav-link{color:rgba(255,255,255,.75)}.navbar-dark .navbar-nav .nav-link:hover,.navbar-dark .navbar-nav .nav-link:focus{color:rgba(255,255,255,.5)}.navbar-dark .navbar-nav .nav-link.disabled{color:rgba(255,255,255,.25)}.navbar-dark .navbar-nav .show>.nav-link,.navbar-dark .navbar-nav .active>.nav-link,.navbar-dark .navbar-nav .nav-link.show,.navbar-dark .navbar-nav .nav-link.active{color:#fff}.navbar-dark .navbar-toggler{color:rgba(255,255,255,.75);border-color:rgba(255,255,255,.1)}.navbar-dark .navbar-toggler-icon{background-image:url(data:image/svg+xml;charset=utf8;base64,PHN2ZyB2aWV3Qm94PSIwIDAgMzAgMzAiIHhtbG5zPSJodHRwOi8vd3d3LnczLm9yZy8yMDAwL3N2ZyI+PHBhdGggc3Ryb2tlPSJyZ2JhKDI1NSwgMjU1LCAyNTUsIDAuNzUpIiBzdHJva2Utd2lkdGg9IjIiIHN0cm9rZS1saW5lY2FwPSJyb3VuZCIgc3Ryb2tlLW1pdGVybGltaXQ9IjEwIiBkPSJNNCA3aDIyTTQgMTVoMjJNNCAyM2gyMiIvPjwvc3ZnPg==)}.navbar-dark .navbar-text{color:rgba(255,255,255,.75)}.navbar-dark .navbar-text a{color:#fff}.navbar-dark .navbar-text a:hover,.navbar-dark .navbar-text a:focus{color:#fff}.card,.td-content .highlight{position:relative;display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;min-width:0;word-wrap:break-word;background-color:#fff;background-clip:border-box;border:1px solid rgba(0,0,0,.125);border-radius:.25rem}.card>hr,.td-content .highlight>hr{margin-right:0;margin-left:0}.card>.list-group:first-child .list-group-item:first-child,.td-content .highlight>.list-group:first-child .list-group-item:first-child{border-top-left-radius:.25rem;border-top-right-radius:.25rem}.card>.list-group:last-child .list-group-item:last-child,.td-content .highlight>.list-group:last-child .list-group-item:last-child{border-bottom-right-radius:.25rem;border-bottom-left-radius:.25rem}.card-body{-webkit-box-flex:1;-webkit-flex:1 1 auto;-ms-flex:1 1 auto;flex:1 1 auto;padding:1.25rem}.card-title{margin-bottom:.75rem}.card-subtitle{margin-top:-.375rem;margin-bottom:0}.card-text:last-child{margin-bottom:0}.card-link:hover{text-decoration:none}.card-link+.card-link{margin-left:1.25rem}.card-header{padding:.75rem 1.25rem;margin-bottom:0;background-color:rgba(0,0,0,.03);border-bottom:1px solid rgba(0,0,0,.125)}.card-header:first-child{border-radius:-webkit-calc(0.25rem - 1px) -webkit-calc(0.25rem - 1px) 0 0;border-radius:calc(0.25rem - 1px) calc(0.25rem - 1px) 0 0}.card-header+.list-group .list-group-item:first-child{border-top:0}.card-footer{padding:.75rem 1.25rem;background-color:rgba(0,0,0,.03);border-top:1px solid rgba(0,0,0,.125)}.card-footer:last-child{border-radius:0 0 -webkit-calc(0.25rem - 1px) -webkit-calc(0.25rem - 1px);border-radius:0 0 calc(0.25rem - 1px) calc(0.25rem - 1px)}.card-header-tabs{margin-right:-.625rem;margin-bottom:-.75rem;margin-left:-.625rem;border-bottom:0}.card-header-pills{margin-right:-.625rem;margin-left:-.625rem}.card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:1.25rem}.card-img{width:100%;border-radius:-webkit-calc(0.25rem - 1px);border-radius:calc(0.25rem - 1px)}.card-img-top{width:100%;border-top-left-radius:-webkit-calc(0.25rem - 1px);border-top-left-radius:calc(0.25rem - 1px);border-top-right-radius:-webkit-calc(0.25rem - 1px);border-top-right-radius:calc(0.25rem - 1px)}.card-img-bottom{width:100%;border-bottom-right-radius:-webkit-calc(0.25rem - 1px);border-bottom-right-radius:calc(0.25rem - 1px);border-bottom-left-radius:-webkit-calc(0.25rem - 1px);border-bottom-left-radius:calc(0.25rem - 1px)}.card-deck{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column}.card-deck .card,.card-deck .td-content .highlight,.td-content .card-deck .highlight{margin-bottom:15px}@media(min-width:576px){.card-deck{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-webkit-flex-flow:row wrap;-ms-flex-flow:row wrap;flex-flow:row wrap;margin-right:-15px;margin-left:-15px}.card-deck .card,.card-deck .td-content .highlight,.td-content .card-deck .highlight{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-flex:1;-webkit-flex:1 0 0%;-ms-flex:1 0 0%;flex:1 0 0%;-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;margin-right:15px;margin-bottom:0;margin-left:15px}}.card-group{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column}.card-group>.card,.td-content .card-group>.highlight{margin-bottom:15px}@media(min-width:576px){.card-group{-webkit-box-orient:horizontal;-webkit-box-direction:normal;-webkit-flex-flow:row wrap;-ms-flex-flow:row wrap;flex-flow:row wrap}.card-group>.card,.td-content .card-group>.highlight{-webkit-box-flex:1;-webkit-flex:1 0 0%;-ms-flex:1 0 0%;flex:1 0 0%;margin-bottom:0}.card-group>.card+.card,.td-content .card-group>.highlight+.card,.td-content .card-group>.card+.highlight,.td-content .card-group>.highlight+.highlight{margin-left:0;border-left:0}.card-group>.card:first-child,.td-content .card-group>.highlight:first-child{border-top-right-radius:0;border-bottom-right-radius:0}.card-group>.card:first-child .card-img-top,.td-content .card-group>.highlight:first-child .card-img-top,.card-group>.card:first-child .card-header,.td-content .card-group>.highlight:first-child .card-header{border-top-right-radius:0}.card-group>.card:first-child .card-img-bottom,.td-content .card-group>.highlight:first-child .card-img-bottom,.card-group>.card:first-child .card-footer,.td-content .card-group>.highlight:first-child .card-footer{border-bottom-right-radius:0}.card-group>.card:last-child,.td-content .card-group>.highlight:last-child{border-top-left-radius:0;border-bottom-left-radius:0}.card-group>.card:last-child .card-img-top,.td-content .card-group>.highlight:last-child .card-img-top,.card-group>.card:last-child .card-header,.td-content .card-group>.highlight:last-child .card-header{border-top-left-radius:0}.card-group>.card:last-child .card-img-bottom,.td-content .card-group>.highlight:last-child .card-img-bottom,.card-group>.card:last-child .card-footer,.td-content .card-group>.highlight:last-child .card-footer{border-bottom-left-radius:0}.card-group>.card:only-child,.td-content .card-group>.highlight:only-child{border-radius:.25rem}.card-group>.card:only-child .card-img-top,.td-content .card-group>.highlight:only-child .card-img-top,.card-group>.card:only-child .card-header,.td-content .card-group>.highlight:only-child .card-header{border-top-left-radius:.25rem;border-top-right-radius:.25rem}.card-group>.card:only-child .card-img-bottom,.td-content .card-group>.highlight:only-child .card-img-bottom,.card-group>.card:only-child .card-footer,.td-content .card-group>.highlight:only-child .card-footer{border-bottom-right-radius:.25rem;border-bottom-left-radius:.25rem}.card-group>.card:not(:first-child):not(:last-child):not(:only-child),.td-content .card-group>.highlight:not(:first-child):not(:last-child):not(:only-child){border-radius:0}.card-group>.card:not(:first-child):not(:last-child):not(:only-child) .card-img-top,.td-content .card-group>.highlight:not(:first-child):not(:last-child):not(:only-child) .card-img-top,.card-group>.card:not(:first-child):not(:last-child):not(:only-child) .card-img-bottom,.td-content .card-group>.highlight:not(:first-child):not(:last-child):not(:only-child) .card-img-bottom,.card-group>.card:not(:first-child):not(:last-child):not(:only-child) .card-header,.td-content .card-group>.highlight:not(:first-child):not(:last-child):not(:only-child) .card-header,.card-group>.card:not(:first-child):not(:last-child):not(:only-child) .card-footer,.td-content .card-group>.highlight:not(:first-child):not(:last-child):not(:only-child) .card-footer{border-radius:0}}.card-columns .card,.card-columns .td-content .highlight,.td-content .card-columns .highlight{margin-bottom:.75rem}@media(min-width:576px){.card-columns{-webkit-column-count:3;-moz-column-count:3;column-count:3;-webkit-column-gap:1.25rem;-moz-column-gap:1.25rem;column-gap:1.25rem;orphans:1;widows:1}.card-columns .card,.card-columns .td-content .highlight,.td-content .card-columns .highlight{display:inline-block;width:100%}}.accordion .card:not(:first-of-type):not(:last-of-type),.accordion .td-content .highlight:not(:first-of-type):not(:last-of-type),.td-content .accordion .highlight:not(:first-of-type):not(:last-of-type){border-bottom:0;border-radius:0}.accordion .card:not(:first-of-type) .card-header:first-child,.accordion .td-content .highlight:not(:first-of-type) .card-header:first-child,.td-content .accordion .highlight:not(:first-of-type) .card-header:first-child{border-radius:0}.accordion .card:first-of-type,.accordion .td-content .highlight:first-of-type,.td-content .accordion .highlight:first-of-type{border-bottom:0;border-bottom-right-radius:0;border-bottom-left-radius:0}.accordion .card:last-of-type,.accordion .td-content .highlight:last-of-type,.td-content .accordion .highlight:last-of-type{border-top-left-radius:0;border-top-right-radius:0}.breadcrumb{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-flex-wrap:wrap;-ms-flex-wrap:wrap;flex-wrap:wrap;padding:.75rem 1rem;margin-bottom:1rem;list-style:none;background-color:#eee;border-radius:.25rem}.breadcrumb-item+.breadcrumb-item{padding-left:.5rem}.breadcrumb-item+.breadcrumb-item::before{display:inline-block;padding-right:.5rem;color:#888;content:"/"}.breadcrumb-item+.breadcrumb-item:hover::before{text-decoration:underline}.breadcrumb-item+.breadcrumb-item:hover::before{text-decoration:none}.breadcrumb-item.active{color:#888}.pagination{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;padding-left:0;list-style:none;border-radius:.25rem}.page-link{position:relative;display:block;padding:.5rem .75rem;margin-left:-1px;line-height:1.25;color:#888;background-color:#fff;border:1px solid rgba(0,0,0,.1)}.page-link:hover{z-index:2;color:#1e53a0;text-decoration:none;background-color:#eee;border-color:#dee2e6}.page-link:focus{z-index:2;outline:0;-webkit-box-shadow:0 0 0 .2rem rgba(48,99,142,.25);box-shadow:0 0 0 .2rem rgba(48,99,142,.25)}.page-link:not(:disabled):not(.disabled){cursor:pointer}.page-item:first-child .page-link{margin-left:0;border-top-left-radius:.25rem;border-bottom-left-radius:.25rem}.page-item:last-child .page-link{border-top-right-radius:.25rem;border-bottom-right-radius:.25rem}.page-item.active .page-link{z-index:1;color:#fff;background-color:#30638e;border-color:#2a567b}.page-item.disabled .page-link{color:#dee2e6;pointer-events:none;cursor:auto;background-color:#fff;border-color:#dee2e6}.pagination-lg .page-link{padding:.75rem 1.5rem;font-size:1.25rem;line-height:1.5}.pagination-lg .page-item:first-child .page-link{border-top-left-radius:.3rem;border-bottom-left-radius:.3rem}.pagination-lg .page-item:last-child .page-link{border-top-right-radius:.3rem;border-bottom-right-radius:.3rem}.pagination-sm .page-link{padding:.25rem .5rem;font-size:.875rem;line-height:1.5}.pagination-sm .page-item:first-child .page-link{border-top-left-radius:.2rem;border-bottom-left-radius:.2rem}.pagination-sm .page-item:last-child .page-link{border-top-right-radius:.2rem;border-bottom-right-radius:.2rem}.badge{display:inline-block;padding:.25em .4em;font-size:75%;font-weight:700;line-height:1;text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:.25rem}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.badge-pill{padding-right:.6em;padding-left:.6em;border-radius:10rem}.badge-primary{color:#fff;background-color:#30638e}.badge-primary[href]:hover,.badge-primary[href]:focus{color:#fff;text-decoration:none;background-color:#234868}.badge-secondary{color:#fff;background-color:#ffa630}.badge-secondary[href]:hover,.badge-secondary[href]:focus{color:#fff;text-decoration:none;background-color:#fc9000}.badge-success{color:#fff;background-color:#3772ff}.badge-success[href]:hover,.badge-success[href]:focus{color:#fff;text-decoration:none;background-color:#044eff}.badge-info{color:#222;background-color:#c0e0de}.badge-info[href]:hover,.badge-info[href]:focus{color:#222;text-decoration:none;background-color:#9ecfcc}.badge-warning{color:#fff;background-color:#ed6a5a}.badge-warning[href]:hover,.badge-warning[href]:focus{color:#fff;text-decoration:none;background-color:#e8402c}.badge-danger{color:#fff;background-color:#ed6a5a}.badge-danger[href]:hover,.badge-danger[href]:focus{color:#fff;text-decoration:none;background-color:#e8402c}.badge-light{color:#222;background-color:#d3f3ee}.badge-light[href]:hover,.badge-light[href]:focus{color:#222;text-decoration:none;background-color:#abe8df}.badge-dark{color:#fff;background-color:#403f4c}.badge-dark[href]:hover,.badge-dark[href]:focus{color:#fff;text-decoration:none;background-color:#292830}.jumbotron{padding:2rem 1rem;margin-bottom:2rem;background-color:#eee;border-radius:.3rem}@media(min-width:576px){.jumbotron{padding:4rem 2rem}}.jumbotron-fluid{padding-right:0;padding-left:0;border-radius:0}.alert{position:relative;padding:.75rem 1.25rem;margin-bottom:1rem;border:1px solid transparent;border-radius:.25rem}.alert-heading{color:inherit}.alert-link{font-weight:700}.alert-dismissible{padding-right:4rem}.alert-dismissible .close{position:absolute;top:0;right:0;padding:.75rem 1.25rem;color:inherit}.alert-primary{color:#19334a;background:#d6e0e8 -webkit-gradient(linear,left top,left bottom,from(#dce5eb),to(#d6e0e8)) repeat-x;background:#d6e0e8 -webkit-linear-gradient(top,#dce5eb,#d6e0e8) repeat-x;background:#d6e0e8 -o-linear-gradient(top,#dce5eb,#d6e0e8) repeat-x;background:#d6e0e8 linear-gradient(180deg,#dce5eb,#d6e0e8) repeat-x;border-color:#c5d3df}.alert-primary hr{border-top-color:#b5c7d6}.alert-primary .alert-link{color:#0c1924}.alert-secondary{color:#855619;background:#ffedd6 -webkit-gradient(linear,left top,left bottom,from(#fff0dc),to(#ffedd6)) repeat-x;background:#ffedd6 -webkit-linear-gradient(top,#fff0dc,#ffedd6) repeat-x;background:#ffedd6 -o-linear-gradient(top,#fff0dc,#ffedd6) repeat-x;background:#ffedd6 linear-gradient(180deg,#fff0dc,#ffedd6) repeat-x;border-color:#ffe6c5}.alert-secondary hr{border-top-color:#ffdbac}.alert-secondary .alert-link{color:#5a3a11}.alert-success{color:#1d3b85;background:#d7e3ff -webkit-gradient(linear,left top,left bottom,from(#dde7ff),to(#d7e3ff)) repeat-x;background:#d7e3ff -webkit-linear-gradient(top,#dde7ff,#d7e3ff) repeat-x;background:#d7e3ff -o-linear-gradient(top,#dde7ff,#d7e3ff) repeat-x;background:#d7e3ff linear-gradient(180deg,#dde7ff,#d7e3ff) repeat-x;border-color:#c7d8ff}.alert-success hr{border-top-color:#aec6ff}.alert-success .alert-link{color:#14285b}.alert-info{color:#647473;background:#f2f9f8 -webkit-gradient(linear,left top,left bottom,from(#f4faf9),to(#f2f9f8)) repeat-x;background:#f2f9f8 -webkit-linear-gradient(top,#f4faf9,#f2f9f8) repeat-x;background:#f2f9f8 -o-linear-gradient(top,#f4faf9,#f2f9f8) repeat-x;background:#f2f9f8 linear-gradient(180deg,#f4faf9,#f2f9f8) repeat-x;border-color:#edf6f6}.alert-info hr{border-top-color:#dceeee}.alert-info .alert-link{color:#4c5958}.alert-warning{color:#7b372f;background:#fbe1de -webkit-gradient(linear,left top,left bottom,from(#fce6e3),to(#fbe1de)) repeat-x;background:#fbe1de -webkit-linear-gradient(top,#fce6e3,#fbe1de) repeat-x;background:#fbe1de -o-linear-gradient(top,#fce6e3,#fbe1de) repeat-x;background:#fbe1de linear-gradient(180deg,#fce6e3,#fbe1de) repeat-x;border-color:#fad5d1}.alert-warning hr{border-top-color:#f8c0ba}.alert-warning .alert-link{color:#562721}.alert-danger{color:#7b372f;background:#fbe1de -webkit-gradient(linear,left top,left bottom,from(#fce6e3),to(#fbe1de)) repeat-x;background:#fbe1de -webkit-linear-gradient(top,#fce6e3,#fbe1de) repeat-x;background:#fbe1de -o-linear-gradient(top,#fce6e3,#fbe1de) repeat-x;background:#fbe1de linear-gradient(180deg,#fce6e3,#fbe1de) repeat-x;border-color:#fad5d1}.alert-danger hr{border-top-color:#f8c0ba}.alert-danger .alert-link{color:#562721}.alert-light{color:#6e7e7c;background:#f6fdfc -webkit-gradient(linear,left top,left bottom,from(#f7fdfc),to(#f6fdfc)) repeat-x;background:#f6fdfc -webkit-linear-gradient(top,#f7fdfc,#f6fdfc) repeat-x;background:#f6fdfc -o-linear-gradient(top,#f7fdfc,#f6fdfc) repeat-x;background:#f6fdfc linear-gradient(180deg,#f7fdfc,#f6fdfc) repeat-x;border-color:#f3fcfa}.alert-light hr{border-top-color:#dff7f2}.alert-light .alert-link{color:#566361}.alert-dark{color:#212128;background:#d9d9db -webkit-gradient(linear,left top,left bottom,from(#dfdfe0),to(#d9d9db)) repeat-x;background:#d9d9db -webkit-linear-gradient(top,#dfdfe0,#d9d9db) repeat-x;background:#d9d9db -o-linear-gradient(top,#dfdfe0,#d9d9db) repeat-x;background:#d9d9db linear-gradient(180deg,#dfdfe0,#d9d9db) repeat-x;border-color:#cac9cd}.alert-dark hr{border-top-color:#bdbcc1}.alert-dark .alert-link{color:#0a0a0c}@-webkit-keyframes progress-bar-stripes{from{background-position:1rem 0}to{background-position:0 0}}@-o-keyframes progress-bar-stripes{from{background-position:1rem 0}to{background-position:0 0}}@keyframes progress-bar-stripes{from{background-position:1rem 0}to{background-position:0 0}}.progress{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;height:1rem;overflow:hidden;font-size:.75rem;background-color:#eee;border-radius:.25rem;-webkit-box-shadow:inset 0 .1rem .1rem rgba(0,0,0,.1);box-shadow:inset 0 .1rem .1rem rgba(0,0,0,.1)}.progress-bar{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;-webkit-box-pack:center;-webkit-justify-content:center;-ms-flex-pack:center;justify-content:center;color:#fff;text-align:center;white-space:nowrap;background-color:#30638e;-webkit-transition:width .6s ease;-o-transition:width .6s ease;transition:width .6s ease}@media screen and (prefers-reduced-motion:reduce){.progress-bar{-webkit-transition:none;-o-transition:none;transition:none}}.progress-bar-striped{background-image:-webkit-linear-gradient(45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:-o-linear-gradient(45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);background-image:linear-gradient(45deg,rgba(255,255,255,0.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,0.15) 50%,rgba(255,255,255,0.15) 75%,transparent 75%,transparent);-webkit-background-size:1rem 1rem;background-size:1rem 1rem}.progress-bar-animated{-webkit-animation:progress-bar-stripes 1s linear infinite;-o-animation:progress-bar-stripes 1s linear infinite;animation:progress-bar-stripes 1s linear infinite}.media{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-align:start;-webkit-align-items:flex-start;-ms-flex-align:start;align-items:flex-start}.media-body{-webkit-box-flex:1;-webkit-flex:1;-ms-flex:1;flex:1}.list-group{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;padding-left:0;margin-bottom:0}.list-group-item-action{width:100%;color:#495057;text-align:inherit}.list-group-item-action:hover,.list-group-item-action:focus{color:#495057;text-decoration:none;background-color:#f8f9fa}.list-group-item-action:active{color:#222;background-color:#eee}.list-group-item{position:relative;display:block;padding:.75rem 1.25rem;margin-bottom:-1px;background-color:#fff;border:1px solid rgba(0,0,0,.125)}.list-group-item:first-child{border-top-left-radius:.25rem;border-top-right-radius:.25rem}.list-group-item:last-child{margin-bottom:0;border-bottom-right-radius:.25rem;border-bottom-left-radius:.25rem}.list-group-item:hover,.list-group-item:focus{z-index:1;text-decoration:none}.list-group-item.disabled,.list-group-item:disabled{color:#888;background-color:#fff}.list-group-item.active{z-index:2;color:#fff;background-color:#30638e;border-color:#30638e}.list-group-flush .list-group-item{border-right:0;border-left:0;border-radius:0}.list-group-flush:first-child .list-group-item:first-child{border-top:0}.list-group-flush:last-child .list-group-item:last-child{border-bottom:0}.list-group-item-primary{color:#19334a;background-color:#c5d3df}.list-group-item-primary.list-group-item-action:hover,.list-group-item-primary.list-group-item-action:focus{color:#19334a;background-color:#b5c7d6}.list-group-item-primary.list-group-item-action.active{color:#fff;background-color:#19334a;border-color:#19334a}.list-group-item-secondary{color:#855619;background-color:#ffe6c5}.list-group-item-secondary.list-group-item-action:hover,.list-group-item-secondary.list-group-item-action:focus{color:#855619;background-color:#ffdbac}.list-group-item-secondary.list-group-item-action.active{color:#fff;background-color:#855619;border-color:#855619}.list-group-item-success{color:#1d3b85;background-color:#c7d8ff}.list-group-item-success.list-group-item-action:hover,.list-group-item-success.list-group-item-action:focus{color:#1d3b85;background-color:#aec6ff}.list-group-item-success.list-group-item-action.active{color:#fff;background-color:#1d3b85;border-color:#1d3b85}.list-group-item-info{color:#647473;background-color:#edf6f6}.list-group-item-info.list-group-item-action:hover,.list-group-item-info.list-group-item-action:focus{color:#647473;background-color:#dceeee}.list-group-item-info.list-group-item-action.active{color:#fff;background-color:#647473;border-color:#647473}.list-group-item-warning{color:#7b372f;background-color:#fad5d1}.list-group-item-warning.list-group-item-action:hover,.list-group-item-warning.list-group-item-action:focus{color:#7b372f;background-color:#f8c0ba}.list-group-item-warning.list-group-item-action.active{color:#fff;background-color:#7b372f;border-color:#7b372f}.list-group-item-danger{color:#7b372f;background-color:#fad5d1}.list-group-item-danger.list-group-item-action:hover,.list-group-item-danger.list-group-item-action:focus{color:#7b372f;background-color:#f8c0ba}.list-group-item-danger.list-group-item-action.active{color:#fff;background-color:#7b372f;border-color:#7b372f}.list-group-item-light{color:#6e7e7c;background-color:#f3fcfa}.list-group-item-light.list-group-item-action:hover,.list-group-item-light.list-group-item-action:focus{color:#6e7e7c;background-color:#dff7f2}.list-group-item-light.list-group-item-action.active{color:#fff;background-color:#6e7e7c;border-color:#6e7e7c}.list-group-item-dark{color:#212128;background-color:#cac9cd}.list-group-item-dark.list-group-item-action:hover,.list-group-item-dark.list-group-item-action:focus{color:#212128;background-color:#bdbcc1}.list-group-item-dark.list-group-item-action.active{color:#fff;background-color:#212128;border-color:#212128}.close{float:right;font-size:1.5rem;font-weight:700;line-height:1;color:#000;text-shadow:0 1px 0 #fff;opacity:.5}.close:not(:disabled):not(.disabled){cursor:pointer}.close:not(:disabled):not(.disabled):hover,.close:not(:disabled):not(.disabled):focus{color:#000;text-decoration:none;opacity:.75}button.close{padding:0;background-color:transparent;border:0;-webkit-appearance:none}.modal-open{overflow:hidden}.modal-open .modal{overflow-x:hidden;overflow-y:auto}.modal{position:fixed;top:0;right:0;bottom:0;left:0;z-index:1050;display:none;overflow:hidden;outline:0}.modal-dialog{position:relative;width:auto;margin:.5rem;pointer-events:none}.modal.fade .modal-dialog{-webkit-transition:-webkit-transform .3s ease-out;transition:-webkit-transform .3s ease-out;-o-transition:-o-transform .3s ease-out;transition:transform .3s ease-out;transition:transform .3s ease-out,-webkit-transform .3s ease-out,-o-transform .3s ease-out;-webkit-transform:translate(0,-25%);-ms-transform:translate(0,-25%);-o-transform:translate(0,-25%);transform:translate(0,-25%)}@media screen and (prefers-reduced-motion:reduce){.modal.fade .modal-dialog{-webkit-transition:none;-o-transition:none;transition:none}}.modal.show .modal-dialog{-webkit-transform:translate(0,0);-ms-transform:translate(0,0);-o-transform:translate(0,0);transform:translate(0,0)}.modal-dialog-centered{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center;min-height:-webkit-calc(100% - (0.5rem * 2));min-height:calc(100% - (0.5rem * 2))}.modal-dialog-centered::before{display:block;height:-webkit-calc(100vh - (0.5rem * 2));height:calc(100vh - (0.5rem * 2));content:""}.modal-content{position:relative;display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;width:100%;pointer-events:auto;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,.2);border-radius:.3rem;-webkit-box-shadow:0 .25rem .5rem rgba(0,0,0,.5);box-shadow:0 .25rem .5rem rgba(0,0,0,.5);outline:0}.modal-backdrop{position:fixed;top:0;right:0;bottom:0;left:0;z-index:1040;background-color:#000}.modal-backdrop.fade{opacity:0}.modal-backdrop.show{opacity:.5}.modal-header{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-align:start;-webkit-align-items:flex-start;-ms-flex-align:start;align-items:flex-start;-webkit-box-pack:justify;-webkit-justify-content:space-between;-ms-flex-pack:justify;justify-content:space-between;padding:1rem;border-bottom:1px solid #eee;border-top-left-radius:.3rem;border-top-right-radius:.3rem}.modal-header .close{padding:1rem;margin:-1rem -1rem -1rem auto}.modal-title{margin-bottom:0;line-height:1.5}.modal-body{position:relative;-webkit-box-flex:1;-webkit-flex:1 1 auto;-ms-flex:1 1 auto;flex:1 1 auto;padding:1rem}.modal-footer{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:end;-webkit-justify-content:flex-end;-ms-flex-pack:end;justify-content:flex-end;padding:1rem;border-top:1px solid #eee}.modal-footer>:not(:first-child){margin-left:.25rem}.modal-footer>:not(:last-child){margin-right:.25rem}.modal-scrollbar-measure{position:absolute;top:-9999px;width:50px;height:50px;overflow:scroll}@media(min-width:576px){.modal-dialog{max-width:500px;margin:1.75rem auto}.modal-dialog-centered{min-height:-webkit-calc(100% - (1.75rem * 2));min-height:calc(100% - (1.75rem * 2))}.modal-dialog-centered::before{height:-webkit-calc(100vh - (1.75rem * 2));height:calc(100vh - (1.75rem * 2))}.modal-content{-webkit-box-shadow:0 .5rem 1rem rgba(0,0,0,.5);box-shadow:0 .5rem 1rem rgba(0,0,0,.5)}.modal-sm{max-width:300px}}@media(min-width:992px){.modal-lg{max-width:800px}}.tooltip{position:absolute;z-index:1070;display:block;margin:0;font-family:open sans,-apple-system,BlinkMacSystemFont,segoe ui,Roboto,helvetica neue,Arial,sans-serif,apple color emoji,segoe ui emoji,segoe ui symbol;font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;word-spacing:normal;white-space:normal;line-break:auto;font-size:.875rem;word-wrap:break-word;opacity:0}.tooltip.show{opacity:.9}.tooltip .arrow{position:absolute;display:block;width:.8rem;height:.4rem}.tooltip .arrow::before{position:absolute;content:"";border-color:transparent;border-style:solid}.bs-tooltip-top,.bs-tooltip-auto[x-placement^=top]{padding:.4rem 0}.bs-tooltip-top .arrow,.bs-tooltip-auto[x-placement^=top] .arrow{bottom:0}.bs-tooltip-top .arrow::before,.bs-tooltip-auto[x-placement^=top] .arrow::before{top:0;border-width:.4rem .4rem 0;border-top-color:#000}.bs-tooltip-right,.bs-tooltip-auto[x-placement^=right]{padding:0 .4rem}.bs-tooltip-right .arrow,.bs-tooltip-auto[x-placement^=right] .arrow{left:0;width:.4rem;height:.8rem}.bs-tooltip-right .arrow::before,.bs-tooltip-auto[x-placement^=right] .arrow::before{right:0;border-width:.4rem .4rem .4rem 0;border-right-color:#000}.bs-tooltip-bottom,.bs-tooltip-auto[x-placement^=bottom]{padding:.4rem 0}.bs-tooltip-bottom .arrow,.bs-tooltip-auto[x-placement^=bottom] .arrow{top:0}.bs-tooltip-bottom .arrow::before,.bs-tooltip-auto[x-placement^=bottom] .arrow::before{bottom:0;border-width:0 .4rem .4rem;border-bottom-color:#000}.bs-tooltip-left,.bs-tooltip-auto[x-placement^=left]{padding:0 .4rem}.bs-tooltip-left .arrow,.bs-tooltip-auto[x-placement^=left] .arrow{right:0;width:.4rem;height:.8rem}.bs-tooltip-left .arrow::before,.bs-tooltip-auto[x-placement^=left] .arrow::before{left:0;border-width:.4rem 0 .4rem .4rem;border-left-color:#000}.tooltip-inner{max-width:200px;padding:.25rem .5rem;color:#fff;text-align:center;background-color:#000;border-radius:.25rem}.popover{position:absolute;top:0;left:0;z-index:1060;display:block;max-width:276px;font-family:open sans,-apple-system,BlinkMacSystemFont,segoe ui,Roboto,helvetica neue,Arial,sans-serif,apple color emoji,segoe ui emoji,segoe ui symbol;font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;word-spacing:normal;white-space:normal;line-break:auto;font-size:.875rem;word-wrap:break-word;background-color:#fff;background-clip:padding-box;border:1px solid rgba(0,0,0,.2);border-radius:.3rem;-webkit-box-shadow:0 .25rem .5rem rgba(0,0,0,.2);box-shadow:0 .25rem .5rem rgba(0,0,0,.2)}.popover .arrow{position:absolute;display:block;width:1rem;height:.5rem;margin:0 .3rem}.popover .arrow::before,.popover .arrow::after{position:absolute;display:block;content:"";border-color:transparent;border-style:solid}.bs-popover-top,.bs-popover-auto[x-placement^=top]{margin-bottom:.5rem}.bs-popover-top .arrow,.bs-popover-auto[x-placement^=top] .arrow{bottom:-webkit-calc((0.5rem + 1px) * -1);bottom:calc((0.5rem + 1px) * -1)}.bs-popover-top .arrow::before,.bs-popover-auto[x-placement^=top] .arrow::before,.bs-popover-top .arrow::after,.bs-popover-auto[x-placement^=top] .arrow::after{border-width:.5rem .5rem 0}.bs-popover-top .arrow::before,.bs-popover-auto[x-placement^=top] .arrow::before{bottom:0;border-top-color:rgba(0,0,0,.25)}.bs-popover-top .arrow::after,.bs-popover-auto[x-placement^=top] .arrow::after{bottom:1px;border-top-color:#fff}.bs-popover-right,.bs-popover-auto[x-placement^=right]{margin-left:.5rem}.bs-popover-right .arrow,.bs-popover-auto[x-placement^=right] .arrow{left:-webkit-calc((0.5rem + 1px) * -1);left:calc((0.5rem + 1px) * -1);width:.5rem;height:1rem;margin:.3rem 0}.bs-popover-right .arrow::before,.bs-popover-auto[x-placement^=right] .arrow::before,.bs-popover-right .arrow::after,.bs-popover-auto[x-placement^=right] .arrow::after{border-width:.5rem .5rem .5rem 0}.bs-popover-right .arrow::before,.bs-popover-auto[x-placement^=right] .arrow::before{left:0;border-right-color:rgba(0,0,0,.25)}.bs-popover-right .arrow::after,.bs-popover-auto[x-placement^=right] .arrow::after{left:1px;border-right-color:#fff}.bs-popover-bottom,.bs-popover-auto[x-placement^=bottom]{margin-top:.5rem}.bs-popover-bottom .arrow,.bs-popover-auto[x-placement^=bottom] .arrow{top:-webkit-calc((0.5rem + 1px) * -1);top:calc((0.5rem + 1px) * -1)}.bs-popover-bottom .arrow::before,.bs-popover-auto[x-placement^=bottom] .arrow::before,.bs-popover-bottom .arrow::after,.bs-popover-auto[x-placement^=bottom] .arrow::after{border-width:0 .5rem .5rem}.bs-popover-bottom .arrow::before,.bs-popover-auto[x-placement^=bottom] .arrow::before{top:0;border-bottom-color:rgba(0,0,0,.25)}.bs-popover-bottom .arrow::after,.bs-popover-auto[x-placement^=bottom] .arrow::after{top:1px;border-bottom-color:#fff}.bs-popover-bottom .popover-header::before,.bs-popover-auto[x-placement^=bottom] .popover-header::before{position:absolute;top:0;left:50%;display:block;width:1rem;margin-left:-.5rem;content:"";border-bottom:1px solid #f7f7f7}.bs-popover-left,.bs-popover-auto[x-placement^=left]{margin-right:.5rem}.bs-popover-left .arrow,.bs-popover-auto[x-placement^=left] .arrow{right:-webkit-calc((0.5rem + 1px) * -1);right:calc((0.5rem + 1px) * -1);width:.5rem;height:1rem;margin:.3rem 0}.bs-popover-left .arrow::before,.bs-popover-auto[x-placement^=left] .arrow::before,.bs-popover-left .arrow::after,.bs-popover-auto[x-placement^=left] .arrow::after{border-width:.5rem 0 .5rem .5rem}.bs-popover-left .arrow::before,.bs-popover-auto[x-placement^=left] .arrow::before{right:0;border-left-color:rgba(0,0,0,.25)}.bs-popover-left .arrow::after,.bs-popover-auto[x-placement^=left] .arrow::after{right:1px;border-left-color:#fff}.popover-header{padding:.5rem .75rem;margin-bottom:0;font-size:1rem;color:inherit;background-color:#f7f7f7;border-bottom:1px solid #ebebeb;border-top-left-radius:-webkit-calc(0.3rem - 1px);border-top-left-radius:calc(0.3rem - 1px);border-top-right-radius:-webkit-calc(0.3rem - 1px);border-top-right-radius:calc(0.3rem - 1px)}.popover-header:empty{display:none}.popover-body{padding:.5rem .75rem;color:#222}.carousel{position:relative}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-item{position:relative;display:none;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center;width:100%;-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-perspective:1000px;perspective:1000px}.carousel-item.active,.carousel-item-next,.carousel-item-prev{display:block;-webkit-transition:-webkit-transform .6s ease;transition:-webkit-transform .6s ease;-o-transition:-o-transform .6s ease;transition:transform .6s ease;transition:transform .6s ease,-webkit-transform .6s ease,-o-transform .6s ease}@media screen and (prefers-reduced-motion:reduce){.carousel-item.active,.carousel-item-next,.carousel-item-prev{-webkit-transition:none;-o-transition:none;transition:none}}.carousel-item-next,.carousel-item-prev{position:absolute;top:0}.carousel-item-next.carousel-item-left,.carousel-item-prev.carousel-item-right{-webkit-transform:translateX(0);-ms-transform:translateX(0);-o-transform:translateX(0);transform:translateX(0)}@supports((-webkit-transform-style:preserve-3d) or (transform-style:preserve-3d)){.carousel-item-next.carousel-item-left,.carousel-item-prev.carousel-item-right{-webkit-transform:translate3d(0,0,0);transform:translate3d(0,0,0)}}.carousel-item-next,.active.carousel-item-right{-webkit-transform:translateX(100%);-ms-transform:translateX(100%);-o-transform:translateX(100%);transform:translateX(100%)}@supports((-webkit-transform-style:preserve-3d) or (transform-style:preserve-3d)){.carousel-item-next,.active.carousel-item-right{-webkit-transform:translate3d(100%,0,0);transform:translate3d(100%,0,0)}}.carousel-item-prev,.active.carousel-item-left{-webkit-transform:translateX(-100%);-ms-transform:translateX(-100%);-o-transform:translateX(-100%);transform:translateX(-100%)}@supports((-webkit-transform-style:preserve-3d) or (transform-style:preserve-3d)){.carousel-item-prev,.active.carousel-item-left{-webkit-transform:translate3d(-100%,0,0);transform:translate3d(-100%,0,0)}}.carousel-fade .carousel-item{opacity:0;-webkit-transition-duration:.6s;-o-transition-duration:.6s;transition-duration:.6s;-webkit-transition-property:opacity;-o-transition-property:opacity;transition-property:opacity}.carousel-fade .carousel-item.active,.carousel-fade .carousel-item-next.carousel-item-left,.carousel-fade .carousel-item-prev.carousel-item-right{opacity:1}.carousel-fade .active.carousel-item-left,.carousel-fade .active.carousel-item-right{opacity:0}.carousel-fade .carousel-item-next,.carousel-fade .carousel-item-prev,.carousel-fade .carousel-item.active,.carousel-fade .active.carousel-item-left,.carousel-fade .active.carousel-item-prev{-webkit-transform:translateX(0);-ms-transform:translateX(0);-o-transform:translateX(0);transform:translateX(0)}@supports((-webkit-transform-style:preserve-3d) or (transform-style:preserve-3d)){.carousel-fade .carousel-item-next,.carousel-fade .carousel-item-prev,.carousel-fade .carousel-item.active,.carousel-fade .active.carousel-item-left,.carousel-fade .active.carousel-item-prev{-webkit-transform:translate3d(0,0,0);transform:translate3d(0,0,0)}}.carousel-control-prev,.carousel-control-next{position:absolute;top:0;bottom:0;display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-align:center;-webkit-align-items:center;-ms-flex-align:center;align-items:center;-webkit-box-pack:center;-webkit-justify-content:center;-ms-flex-pack:center;justify-content:center;width:15%;color:#fff;text-align:center;opacity:.5}.carousel-control-prev:hover,.carousel-control-prev:focus,.carousel-control-next:hover,.carousel-control-next:focus{color:#fff;text-decoration:none;outline:0;opacity:.9}.carousel-control-prev{left:0;background:-webkit-gradient(linear,left top,right top,from(rgba(0,0,0,0.25)),to(rgba(0,0,0,0.001)));background:-webkit-linear-gradient(left,rgba(0,0,0,0.25),rgba(0,0,0,0.001));background:-o-linear-gradient(left,rgba(0,0,0,0.25),rgba(0,0,0,0.001));background:linear-gradient(90deg,rgba(0,0,0,0.25),rgba(0,0,0,0.001))}.carousel-control-next{right:0;background:-webkit-gradient(linear,right top,left top,from(rgba(0,0,0,0.25)),to(rgba(0,0,0,0.001)));background:-webkit-linear-gradient(right,rgba(0,0,0,0.25),rgba(0,0,0,0.001));background:-o-linear-gradient(right,rgba(0,0,0,0.25),rgba(0,0,0,0.001));background:linear-gradient(270deg,rgba(0,0,0,0.25),rgba(0,0,0,0.001))}.carousel-control-prev-icon,.carousel-control-next-icon{display:inline-block;width:20px;height:20px;background:transparent no-repeat 50%;-webkit-background-size:100% 100%;background-size:100% 100%}.carousel-control-prev-icon{background-image:url(data:image/svg+xml;charset=utf8;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIGZpbGw9IiNmZmYiIHZpZXdCb3g9IjAgMCA4IDgiPjxwYXRoIGQ9Ik01LjI1LjBsLTQgNCA0IDQgMS41LTEuNUw0LjI1IDRsMi41LTIuNUw1LjI1LjB6Ii8+PC9zdmc+)}.carousel-control-next-icon{background-image:url(data:image/svg+xml;charset=utf8;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIGZpbGw9IiNmZmYiIHZpZXdCb3g9IjAgMCA4IDgiPjxwYXRoIGQ9Ik0yLjc1LjBsLTEuNSAxLjVMMy43NSA0bC0yLjUgMi41TDIuNzUgOGw0LTQtNC00eiIvPjwvc3ZnPg==)}.carousel-indicators{position:absolute;right:0;bottom:10px;left:0;z-index:15;display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-pack:center;-webkit-justify-content:center;-ms-flex-pack:center;justify-content:center;padding-left:0;margin-right:15%;margin-left:15%;list-style:none}.carousel-indicators li{position:relative;-webkit-box-flex:0;-webkit-flex:0 1 auto;-ms-flex:0 1 auto;flex:0 1 auto;width:30px;height:3px;margin-right:3px;margin-left:3px;text-indent:-999px;cursor:pointer;background-color:rgba(255,255,255,.5)}.carousel-indicators li::before{position:absolute;top:-10px;left:0;display:inline-block;width:100%;height:10px;content:""}.carousel-indicators li::after{position:absolute;bottom:-10px;left:0;display:inline-block;width:100%;height:10px;content:""}.carousel-indicators .active{background-color:#fff}.carousel-caption{position:absolute;right:15%;bottom:20px;left:15%;z-index:10;padding-top:20px;padding-bottom:20px;color:#fff;text-align:center}.align-baseline{vertical-align:baseline!important}.align-top{vertical-align:top!important}.align-middle{vertical-align:middle!important}.align-bottom{vertical-align:bottom!important}.align-text-bottom{vertical-align:text-bottom!important}.align-text-top{vertical-align:text-top!important}.bg-primary{background-color:#30638e!important}a.bg-primary:hover,a.bg-primary:focus,button.bg-primary:hover,button.bg-primary:focus{background-color:#234868!important}.bg-secondary{background-color:#ffa630!important}a.bg-secondary:hover,a.bg-secondary:focus,button.bg-secondary:hover,button.bg-secondary:focus{background-color:#fc9000!important}.bg-success{background-color:#3772ff!important}a.bg-success:hover,a.bg-success:focus,button.bg-success:hover,button.bg-success:focus{background-color:#044eff!important}.bg-info{background-color:#c0e0de!important}a.bg-info:hover,a.bg-info:focus,button.bg-info:hover,button.bg-info:focus{background-color:#9ecfcc!important}.bg-warning{background-color:#ed6a5a!important}a.bg-warning:hover,a.bg-warning:focus,button.bg-warning:hover,button.bg-warning:focus{background-color:#e8402c!important}.bg-danger{background-color:#ed6a5a!important}a.bg-danger:hover,a.bg-danger:focus,button.bg-danger:hover,button.bg-danger:focus{background-color:#e8402c!important}.bg-light{background-color:#d3f3ee!important}a.bg-light:hover,a.bg-light:focus,button.bg-light:hover,button.bg-light:focus{background-color:#abe8df!important}.bg-dark{background-color:#403f4c!important}a.bg-dark:hover,a.bg-dark:focus,button.bg-dark:hover,button.bg-dark:focus{background-color:#292830!important}.bg-gradient-primary{background:#30638E -webkit-gradient(linear,left top,left bottom,from(#4f7a9f),to(#30638E)) repeat-x!important;background:#30638e -webkit-linear-gradient(top,#4f7a9f,#30638E) repeat-x!important;background:#30638e -o-linear-gradient(top,#4f7a9f,#30638E) repeat-x!important;background:#30638e linear-gradient(180deg,#4f7a9f,#30638E) repeat-x!important}.bg-gradient-secondary{background:#FFA630 -webkit-gradient(linear,left top,left bottom,from(#ffb34f),to(#FFA630)) repeat-x!important;background:#ffa630 -webkit-linear-gradient(top,#ffb34f,#FFA630) repeat-x!important;background:#ffa630 -o-linear-gradient(top,#ffb34f,#FFA630) repeat-x!important;background:#ffa630 linear-gradient(180deg,#ffb34f,#FFA630) repeat-x!important}.bg-gradient-success{background:#3772FF -webkit-gradient(linear,left top,left bottom,from(#5587ff),to(#3772FF)) repeat-x!important;background:#3772ff -webkit-linear-gradient(top,#5587ff,#3772FF) repeat-x!important;background:#3772ff -o-linear-gradient(top,#5587ff,#3772FF) repeat-x!important;background:#3772ff linear-gradient(180deg,#5587ff,#3772FF) repeat-x!important}.bg-gradient-info{background:#C0E0DE -webkit-gradient(linear,left top,left bottom,from(#c9e5e3),to(#C0E0DE)) repeat-x!important;background:#c0e0de -webkit-linear-gradient(top,#c9e5e3,#C0E0DE) repeat-x!important;background:#c0e0de -o-linear-gradient(top,#c9e5e3,#C0E0DE) repeat-x!important;background:#c0e0de linear-gradient(180deg,#c9e5e3,#C0E0DE) repeat-x!important}.bg-gradient-warning{background:#ED6A5A -webkit-gradient(linear,left top,left bottom,from(#f08073),to(#ED6A5A)) repeat-x!important;background:#ed6a5a -webkit-linear-gradient(top,#f08073,#ED6A5A) repeat-x!important;background:#ed6a5a -o-linear-gradient(top,#f08073,#ED6A5A) repeat-x!important;background:#ed6a5a linear-gradient(180deg,#f08073,#ED6A5A) repeat-x!important}.bg-gradient-danger{background:#ED6A5A -webkit-gradient(linear,left top,left bottom,from(#f08073),to(#ED6A5A)) repeat-x!important;background:#ed6a5a -webkit-linear-gradient(top,#f08073,#ED6A5A) repeat-x!important;background:#ed6a5a -o-linear-gradient(top,#f08073,#ED6A5A) repeat-x!important;background:#ed6a5a linear-gradient(180deg,#f08073,#ED6A5A) repeat-x!important}.bg-gradient-light{background:#D3F3EE -webkit-gradient(linear,left top,left bottom,from(#daf5f1),to(#D3F3EE)) repeat-x!important;background:#d3f3ee -webkit-linear-gradient(top,#daf5f1,#D3F3EE) repeat-x!important;background:#d3f3ee -o-linear-gradient(top,#daf5f1,#D3F3EE) repeat-x!important;background:#d3f3ee linear-gradient(180deg,#daf5f1,#D3F3EE) repeat-x!important}.bg-gradient-dark{background:#403F4C -webkit-gradient(linear,left top,left bottom,from(#5d5c67),to(#403F4C)) repeat-x!important;background:#403f4c -webkit-linear-gradient(top,#5d5c67,#403F4C) repeat-x!important;background:#403f4c -o-linear-gradient(top,#5d5c67,#403F4C) repeat-x!important;background:#403f4c linear-gradient(180deg,#5d5c67,#403F4C) repeat-x!important}.bg-white{background-color:#fff!important}.bg-transparent{background-color:transparent!important}.border{border:1px solid #dee2e6!important}.border-top{border-top:1px solid #dee2e6!important}.border-right{border-right:1px solid #dee2e6!important}.border-bottom{border-bottom:1px solid #dee2e6!important}.border-left{border-left:1px solid #dee2e6!important}.border-0{border:0!important}.border-top-0{border-top:0!important}.border-right-0{border-right:0!important}.border-bottom-0{border-bottom:0!important}.border-left-0{border-left:0!important}.border-primary{border-color:#30638e!important}.border-secondary{border-color:#ffa630!important}.border-success{border-color:#3772ff!important}.border-info{border-color:#c0e0de!important}.border-warning{border-color:#ed6a5a!important}.border-danger{border-color:#ed6a5a!important}.border-light{border-color:#d3f3ee!important}.border-dark{border-color:#403f4c!important}.border-white{border-color:#fff!important}.rounded{border-radius:.25rem!important}.rounded-top{border-top-left-radius:.25rem!important;border-top-right-radius:.25rem!important}.rounded-right{border-top-right-radius:.25rem!important;border-bottom-right-radius:.25rem!important}.rounded-bottom{border-bottom-right-radius:.25rem!important;border-bottom-left-radius:.25rem!important}.rounded-left{border-top-left-radius:.25rem!important;border-bottom-left-radius:.25rem!important}.rounded-circle{border-radius:50%!important}.rounded-0{border-radius:0!important}.clearfix::after{display:block;clear:both;content:""}.d-none{display:none!important}.d-inline{display:inline!important}.d-inline-block{display:inline-block!important}.d-block{display:block!important}.d-table{display:table!important}.d-table-row{display:table-row!important}.d-table-cell{display:table-cell!important}.d-flex{display:-webkit-box!important;display:-webkit-flex!important;display:-ms-flexbox!important;display:flex!important}.d-inline-flex{display:-webkit-inline-box!important;display:-webkit-inline-flex!important;display:-ms-inline-flexbox!important;display:inline-flex!important}@media(min-width:576px){.d-sm-none{display:none!important}.d-sm-inline{display:inline!important}.d-sm-inline-block{display:inline-block!important}.d-sm-block{display:block!important}.d-sm-table{display:table!important}.d-sm-table-row{display:table-row!important}.d-sm-table-cell{display:table-cell!important}.d-sm-flex{display:-webkit-box!important;display:-webkit-flex!important;display:-ms-flexbox!important;display:flex!important}.d-sm-inline-flex{display:-webkit-inline-box!important;display:-webkit-inline-flex!important;display:-ms-inline-flexbox!important;display:inline-flex!important}}@media(min-width:768px){.d-md-none{display:none!important}.d-md-inline{display:inline!important}.d-md-inline-block{display:inline-block!important}.d-md-block{display:block!important}.d-md-table{display:table!important}.d-md-table-row{display:table-row!important}.d-md-table-cell{display:table-cell!important}.d-md-flex{display:-webkit-box!important;display:-webkit-flex!important;display:-ms-flexbox!important;display:flex!important}.d-md-inline-flex{display:-webkit-inline-box!important;display:-webkit-inline-flex!important;display:-ms-inline-flexbox!important;display:inline-flex!important}}@media(min-width:992px){.d-lg-none{display:none!important}.d-lg-inline{display:inline!important}.d-lg-inline-block{display:inline-block!important}.d-lg-block{display:block!important}.d-lg-table{display:table!important}.d-lg-table-row{display:table-row!important}.d-lg-table-cell{display:table-cell!important}.d-lg-flex{display:-webkit-box!important;display:-webkit-flex!important;display:-ms-flexbox!important;display:flex!important}.d-lg-inline-flex{display:-webkit-inline-box!important;display:-webkit-inline-flex!important;display:-ms-inline-flexbox!important;display:inline-flex!important}}@media(min-width:1200px){.d-xl-none{display:none!important}.d-xl-inline{display:inline!important}.d-xl-inline-block{display:inline-block!important}.d-xl-block{display:block!important}.d-xl-table{display:table!important}.d-xl-table-row{display:table-row!important}.d-xl-table-cell{display:table-cell!important}.d-xl-flex{display:-webkit-box!important;display:-webkit-flex!important;display:-ms-flexbox!important;display:flex!important}.d-xl-inline-flex{display:-webkit-inline-box!important;display:-webkit-inline-flex!important;display:-ms-inline-flexbox!important;display:inline-flex!important}}@media print{.d-print-none{display:none!important}.d-print-inline{display:inline!important}.d-print-inline-block{display:inline-block!important}.d-print-block{display:block!important}.d-print-table{display:table!important}.d-print-table-row{display:table-row!important}.d-print-table-cell{display:table-cell!important}.d-print-flex{display:-webkit-box!important;display:-webkit-flex!important;display:-ms-flexbox!important;display:flex!important}.d-print-inline-flex{display:-webkit-inline-box!important;display:-webkit-inline-flex!important;display:-ms-inline-flexbox!important;display:inline-flex!important}}.embed-responsive{position:relative;display:block;width:100%;padding:0;overflow:hidden}.embed-responsive::before{display:block;content:""}.embed-responsive .embed-responsive-item,.embed-responsive iframe,.embed-responsive embed,.embed-responsive object,.embed-responsive video{position:absolute;top:0;bottom:0;left:0;width:100%;height:100%;border:0}.embed-responsive-21by9::before{padding-top:42.85714286%}.embed-responsive-16by9::before{padding-top:56.25%}.embed-responsive-4by3::before{padding-top:75%}.embed-responsive-1by1::before{padding-top:100%}.flex-row{-webkit-box-orient:horizontal!important;-webkit-box-direction:normal!important;-webkit-flex-direction:row!important;-ms-flex-direction:row!important;flex-direction:row!important}.flex-column{-webkit-box-orient:vertical!important;-webkit-box-direction:normal!important;-webkit-flex-direction:column!important;-ms-flex-direction:column!important;flex-direction:column!important}.flex-row-reverse{-webkit-box-orient:horizontal!important;-webkit-box-direction:reverse!important;-webkit-flex-direction:row-reverse!important;-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-column-reverse{-webkit-box-orient:vertical!important;-webkit-box-direction:reverse!important;-webkit-flex-direction:column-reverse!important;-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-wrap{-webkit-flex-wrap:wrap!important;-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-nowrap{-webkit-flex-wrap:nowrap!important;-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-wrap-reverse{-webkit-flex-wrap:wrap-reverse!important;-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.flex-fill{-webkit-box-flex:1!important;-webkit-flex:1 1 auto!important;-ms-flex:1 1 auto!important;flex:1 1 auto!important}.flex-grow-0{-webkit-box-flex:0!important;-webkit-flex-grow:0!important;-ms-flex-positive:0!important;flex-grow:0!important}.flex-grow-1{-webkit-box-flex:1!important;-webkit-flex-grow:1!important;-ms-flex-positive:1!important;flex-grow:1!important}.flex-shrink-0{-webkit-flex-shrink:0!important;-ms-flex-negative:0!important;flex-shrink:0!important}.flex-shrink-1{-webkit-flex-shrink:1!important;-ms-flex-negative:1!important;flex-shrink:1!important}.justify-content-start{-webkit-box-pack:start!important;-webkit-justify-content:flex-start!important;-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-end{-webkit-box-pack:end!important;-webkit-justify-content:flex-end!important;-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-center{-webkit-box-pack:center!important;-webkit-justify-content:center!important;-ms-flex-pack:center!important;justify-content:center!important}.justify-content-between{-webkit-box-pack:justify!important;-webkit-justify-content:space-between!important;-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-around{-webkit-justify-content:space-around!important;-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-start{-webkit-box-align:start!important;-webkit-align-items:flex-start!important;-ms-flex-align:start!important;align-items:flex-start!important}.align-items-end{-webkit-box-align:end!important;-webkit-align-items:flex-end!important;-ms-flex-align:end!important;align-items:flex-end!important}.align-items-center{-webkit-box-align:center!important;-webkit-align-items:center!important;-ms-flex-align:center!important;align-items:center!important}.align-items-baseline{-webkit-box-align:baseline!important;-webkit-align-items:baseline!important;-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-stretch{-webkit-box-align:stretch!important;-webkit-align-items:stretch!important;-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-start{-webkit-align-content:flex-start!important;-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-end{-webkit-align-content:flex-end!important;-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-center{-webkit-align-content:center!important;-ms-flex-line-pack:center!important;align-content:center!important}.align-content-between{-webkit-align-content:space-between!important;-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-around{-webkit-align-content:space-around!important;-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-stretch{-webkit-align-content:stretch!important;-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-auto{-webkit-align-self:auto!important;-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-start{-webkit-align-self:flex-start!important;-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-end{-webkit-align-self:flex-end!important;-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-center{-webkit-align-self:center!important;-ms-flex-item-align:center!important;align-self:center!important}.align-self-baseline{-webkit-align-self:baseline!important;-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-stretch{-webkit-align-self:stretch!important;-ms-flex-item-align:stretch!important;align-self:stretch!important}@media(min-width:576px){.flex-sm-row{-webkit-box-orient:horizontal!important;-webkit-box-direction:normal!important;-webkit-flex-direction:row!important;-ms-flex-direction:row!important;flex-direction:row!important}.flex-sm-column{-webkit-box-orient:vertical!important;-webkit-box-direction:normal!important;-webkit-flex-direction:column!important;-ms-flex-direction:column!important;flex-direction:column!important}.flex-sm-row-reverse{-webkit-box-orient:horizontal!important;-webkit-box-direction:reverse!important;-webkit-flex-direction:row-reverse!important;-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-sm-column-reverse{-webkit-box-orient:vertical!important;-webkit-box-direction:reverse!important;-webkit-flex-direction:column-reverse!important;-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-sm-wrap{-webkit-flex-wrap:wrap!important;-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-sm-nowrap{-webkit-flex-wrap:nowrap!important;-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-sm-wrap-reverse{-webkit-flex-wrap:wrap-reverse!important;-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.flex-sm-fill{-webkit-box-flex:1!important;-webkit-flex:1 1 auto!important;-ms-flex:1 1 auto!important;flex:1 1 auto!important}.flex-sm-grow-0{-webkit-box-flex:0!important;-webkit-flex-grow:0!important;-ms-flex-positive:0!important;flex-grow:0!important}.flex-sm-grow-1{-webkit-box-flex:1!important;-webkit-flex-grow:1!important;-ms-flex-positive:1!important;flex-grow:1!important}.flex-sm-shrink-0{-webkit-flex-shrink:0!important;-ms-flex-negative:0!important;flex-shrink:0!important}.flex-sm-shrink-1{-webkit-flex-shrink:1!important;-ms-flex-negative:1!important;flex-shrink:1!important}.justify-content-sm-start{-webkit-box-pack:start!important;-webkit-justify-content:flex-start!important;-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-sm-end{-webkit-box-pack:end!important;-webkit-justify-content:flex-end!important;-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-sm-center{-webkit-box-pack:center!important;-webkit-justify-content:center!important;-ms-flex-pack:center!important;justify-content:center!important}.justify-content-sm-between{-webkit-box-pack:justify!important;-webkit-justify-content:space-between!important;-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-sm-around{-webkit-justify-content:space-around!important;-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-sm-start{-webkit-box-align:start!important;-webkit-align-items:flex-start!important;-ms-flex-align:start!important;align-items:flex-start!important}.align-items-sm-end{-webkit-box-align:end!important;-webkit-align-items:flex-end!important;-ms-flex-align:end!important;align-items:flex-end!important}.align-items-sm-center{-webkit-box-align:center!important;-webkit-align-items:center!important;-ms-flex-align:center!important;align-items:center!important}.align-items-sm-baseline{-webkit-box-align:baseline!important;-webkit-align-items:baseline!important;-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-sm-stretch{-webkit-box-align:stretch!important;-webkit-align-items:stretch!important;-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-sm-start{-webkit-align-content:flex-start!important;-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-sm-end{-webkit-align-content:flex-end!important;-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-sm-center{-webkit-align-content:center!important;-ms-flex-line-pack:center!important;align-content:center!important}.align-content-sm-between{-webkit-align-content:space-between!important;-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-sm-around{-webkit-align-content:space-around!important;-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-sm-stretch{-webkit-align-content:stretch!important;-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-sm-auto{-webkit-align-self:auto!important;-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-sm-start{-webkit-align-self:flex-start!important;-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-sm-end{-webkit-align-self:flex-end!important;-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-sm-center{-webkit-align-self:center!important;-ms-flex-item-align:center!important;align-self:center!important}.align-self-sm-baseline{-webkit-align-self:baseline!important;-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-sm-stretch{-webkit-align-self:stretch!important;-ms-flex-item-align:stretch!important;align-self:stretch!important}}@media(min-width:768px){.flex-md-row{-webkit-box-orient:horizontal!important;-webkit-box-direction:normal!important;-webkit-flex-direction:row!important;-ms-flex-direction:row!important;flex-direction:row!important}.flex-md-column{-webkit-box-orient:vertical!important;-webkit-box-direction:normal!important;-webkit-flex-direction:column!important;-ms-flex-direction:column!important;flex-direction:column!important}.flex-md-row-reverse{-webkit-box-orient:horizontal!important;-webkit-box-direction:reverse!important;-webkit-flex-direction:row-reverse!important;-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-md-column-reverse{-webkit-box-orient:vertical!important;-webkit-box-direction:reverse!important;-webkit-flex-direction:column-reverse!important;-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-md-wrap{-webkit-flex-wrap:wrap!important;-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-md-nowrap{-webkit-flex-wrap:nowrap!important;-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-md-wrap-reverse{-webkit-flex-wrap:wrap-reverse!important;-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.flex-md-fill{-webkit-box-flex:1!important;-webkit-flex:1 1 auto!important;-ms-flex:1 1 auto!important;flex:1 1 auto!important}.flex-md-grow-0{-webkit-box-flex:0!important;-webkit-flex-grow:0!important;-ms-flex-positive:0!important;flex-grow:0!important}.flex-md-grow-1{-webkit-box-flex:1!important;-webkit-flex-grow:1!important;-ms-flex-positive:1!important;flex-grow:1!important}.flex-md-shrink-0{-webkit-flex-shrink:0!important;-ms-flex-negative:0!important;flex-shrink:0!important}.flex-md-shrink-1{-webkit-flex-shrink:1!important;-ms-flex-negative:1!important;flex-shrink:1!important}.justify-content-md-start{-webkit-box-pack:start!important;-webkit-justify-content:flex-start!important;-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-md-end{-webkit-box-pack:end!important;-webkit-justify-content:flex-end!important;-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-md-center{-webkit-box-pack:center!important;-webkit-justify-content:center!important;-ms-flex-pack:center!important;justify-content:center!important}.justify-content-md-between{-webkit-box-pack:justify!important;-webkit-justify-content:space-between!important;-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-md-around{-webkit-justify-content:space-around!important;-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-md-start{-webkit-box-align:start!important;-webkit-align-items:flex-start!important;-ms-flex-align:start!important;align-items:flex-start!important}.align-items-md-end{-webkit-box-align:end!important;-webkit-align-items:flex-end!important;-ms-flex-align:end!important;align-items:flex-end!important}.align-items-md-center{-webkit-box-align:center!important;-webkit-align-items:center!important;-ms-flex-align:center!important;align-items:center!important}.align-items-md-baseline{-webkit-box-align:baseline!important;-webkit-align-items:baseline!important;-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-md-stretch{-webkit-box-align:stretch!important;-webkit-align-items:stretch!important;-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-md-start{-webkit-align-content:flex-start!important;-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-md-end{-webkit-align-content:flex-end!important;-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-md-center{-webkit-align-content:center!important;-ms-flex-line-pack:center!important;align-content:center!important}.align-content-md-between{-webkit-align-content:space-between!important;-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-md-around{-webkit-align-content:space-around!important;-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-md-stretch{-webkit-align-content:stretch!important;-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-md-auto{-webkit-align-self:auto!important;-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-md-start{-webkit-align-self:flex-start!important;-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-md-end{-webkit-align-self:flex-end!important;-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-md-center{-webkit-align-self:center!important;-ms-flex-item-align:center!important;align-self:center!important}.align-self-md-baseline{-webkit-align-self:baseline!important;-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-md-stretch{-webkit-align-self:stretch!important;-ms-flex-item-align:stretch!important;align-self:stretch!important}}@media(min-width:992px){.flex-lg-row{-webkit-box-orient:horizontal!important;-webkit-box-direction:normal!important;-webkit-flex-direction:row!important;-ms-flex-direction:row!important;flex-direction:row!important}.flex-lg-column{-webkit-box-orient:vertical!important;-webkit-box-direction:normal!important;-webkit-flex-direction:column!important;-ms-flex-direction:column!important;flex-direction:column!important}.flex-lg-row-reverse{-webkit-box-orient:horizontal!important;-webkit-box-direction:reverse!important;-webkit-flex-direction:row-reverse!important;-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-lg-column-reverse{-webkit-box-orient:vertical!important;-webkit-box-direction:reverse!important;-webkit-flex-direction:column-reverse!important;-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-lg-wrap{-webkit-flex-wrap:wrap!important;-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-lg-nowrap{-webkit-flex-wrap:nowrap!important;-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-lg-wrap-reverse{-webkit-flex-wrap:wrap-reverse!important;-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.flex-lg-fill{-webkit-box-flex:1!important;-webkit-flex:1 1 auto!important;-ms-flex:1 1 auto!important;flex:1 1 auto!important}.flex-lg-grow-0{-webkit-box-flex:0!important;-webkit-flex-grow:0!important;-ms-flex-positive:0!important;flex-grow:0!important}.flex-lg-grow-1{-webkit-box-flex:1!important;-webkit-flex-grow:1!important;-ms-flex-positive:1!important;flex-grow:1!important}.flex-lg-shrink-0{-webkit-flex-shrink:0!important;-ms-flex-negative:0!important;flex-shrink:0!important}.flex-lg-shrink-1{-webkit-flex-shrink:1!important;-ms-flex-negative:1!important;flex-shrink:1!important}.justify-content-lg-start{-webkit-box-pack:start!important;-webkit-justify-content:flex-start!important;-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-lg-end{-webkit-box-pack:end!important;-webkit-justify-content:flex-end!important;-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-lg-center{-webkit-box-pack:center!important;-webkit-justify-content:center!important;-ms-flex-pack:center!important;justify-content:center!important}.justify-content-lg-between{-webkit-box-pack:justify!important;-webkit-justify-content:space-between!important;-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-lg-around{-webkit-justify-content:space-around!important;-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-lg-start{-webkit-box-align:start!important;-webkit-align-items:flex-start!important;-ms-flex-align:start!important;align-items:flex-start!important}.align-items-lg-end{-webkit-box-align:end!important;-webkit-align-items:flex-end!important;-ms-flex-align:end!important;align-items:flex-end!important}.align-items-lg-center{-webkit-box-align:center!important;-webkit-align-items:center!important;-ms-flex-align:center!important;align-items:center!important}.align-items-lg-baseline{-webkit-box-align:baseline!important;-webkit-align-items:baseline!important;-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-lg-stretch{-webkit-box-align:stretch!important;-webkit-align-items:stretch!important;-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-lg-start{-webkit-align-content:flex-start!important;-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-lg-end{-webkit-align-content:flex-end!important;-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-lg-center{-webkit-align-content:center!important;-ms-flex-line-pack:center!important;align-content:center!important}.align-content-lg-between{-webkit-align-content:space-between!important;-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-lg-around{-webkit-align-content:space-around!important;-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-lg-stretch{-webkit-align-content:stretch!important;-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-lg-auto{-webkit-align-self:auto!important;-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-lg-start{-webkit-align-self:flex-start!important;-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-lg-end{-webkit-align-self:flex-end!important;-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-lg-center{-webkit-align-self:center!important;-ms-flex-item-align:center!important;align-self:center!important}.align-self-lg-baseline{-webkit-align-self:baseline!important;-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-lg-stretch{-webkit-align-self:stretch!important;-ms-flex-item-align:stretch!important;align-self:stretch!important}}@media(min-width:1200px){.flex-xl-row{-webkit-box-orient:horizontal!important;-webkit-box-direction:normal!important;-webkit-flex-direction:row!important;-ms-flex-direction:row!important;flex-direction:row!important}.flex-xl-column{-webkit-box-orient:vertical!important;-webkit-box-direction:normal!important;-webkit-flex-direction:column!important;-ms-flex-direction:column!important;flex-direction:column!important}.flex-xl-row-reverse{-webkit-box-orient:horizontal!important;-webkit-box-direction:reverse!important;-webkit-flex-direction:row-reverse!important;-ms-flex-direction:row-reverse!important;flex-direction:row-reverse!important}.flex-xl-column-reverse{-webkit-box-orient:vertical!important;-webkit-box-direction:reverse!important;-webkit-flex-direction:column-reverse!important;-ms-flex-direction:column-reverse!important;flex-direction:column-reverse!important}.flex-xl-wrap{-webkit-flex-wrap:wrap!important;-ms-flex-wrap:wrap!important;flex-wrap:wrap!important}.flex-xl-nowrap{-webkit-flex-wrap:nowrap!important;-ms-flex-wrap:nowrap!important;flex-wrap:nowrap!important}.flex-xl-wrap-reverse{-webkit-flex-wrap:wrap-reverse!important;-ms-flex-wrap:wrap-reverse!important;flex-wrap:wrap-reverse!important}.flex-xl-fill{-webkit-box-flex:1!important;-webkit-flex:1 1 auto!important;-ms-flex:1 1 auto!important;flex:1 1 auto!important}.flex-xl-grow-0{-webkit-box-flex:0!important;-webkit-flex-grow:0!important;-ms-flex-positive:0!important;flex-grow:0!important}.flex-xl-grow-1{-webkit-box-flex:1!important;-webkit-flex-grow:1!important;-ms-flex-positive:1!important;flex-grow:1!important}.flex-xl-shrink-0{-webkit-flex-shrink:0!important;-ms-flex-negative:0!important;flex-shrink:0!important}.flex-xl-shrink-1{-webkit-flex-shrink:1!important;-ms-flex-negative:1!important;flex-shrink:1!important}.justify-content-xl-start{-webkit-box-pack:start!important;-webkit-justify-content:flex-start!important;-ms-flex-pack:start!important;justify-content:flex-start!important}.justify-content-xl-end{-webkit-box-pack:end!important;-webkit-justify-content:flex-end!important;-ms-flex-pack:end!important;justify-content:flex-end!important}.justify-content-xl-center{-webkit-box-pack:center!important;-webkit-justify-content:center!important;-ms-flex-pack:center!important;justify-content:center!important}.justify-content-xl-between{-webkit-box-pack:justify!important;-webkit-justify-content:space-between!important;-ms-flex-pack:justify!important;justify-content:space-between!important}.justify-content-xl-around{-webkit-justify-content:space-around!important;-ms-flex-pack:distribute!important;justify-content:space-around!important}.align-items-xl-start{-webkit-box-align:start!important;-webkit-align-items:flex-start!important;-ms-flex-align:start!important;align-items:flex-start!important}.align-items-xl-end{-webkit-box-align:end!important;-webkit-align-items:flex-end!important;-ms-flex-align:end!important;align-items:flex-end!important}.align-items-xl-center{-webkit-box-align:center!important;-webkit-align-items:center!important;-ms-flex-align:center!important;align-items:center!important}.align-items-xl-baseline{-webkit-box-align:baseline!important;-webkit-align-items:baseline!important;-ms-flex-align:baseline!important;align-items:baseline!important}.align-items-xl-stretch{-webkit-box-align:stretch!important;-webkit-align-items:stretch!important;-ms-flex-align:stretch!important;align-items:stretch!important}.align-content-xl-start{-webkit-align-content:flex-start!important;-ms-flex-line-pack:start!important;align-content:flex-start!important}.align-content-xl-end{-webkit-align-content:flex-end!important;-ms-flex-line-pack:end!important;align-content:flex-end!important}.align-content-xl-center{-webkit-align-content:center!important;-ms-flex-line-pack:center!important;align-content:center!important}.align-content-xl-between{-webkit-align-content:space-between!important;-ms-flex-line-pack:justify!important;align-content:space-between!important}.align-content-xl-around{-webkit-align-content:space-around!important;-ms-flex-line-pack:distribute!important;align-content:space-around!important}.align-content-xl-stretch{-webkit-align-content:stretch!important;-ms-flex-line-pack:stretch!important;align-content:stretch!important}.align-self-xl-auto{-webkit-align-self:auto!important;-ms-flex-item-align:auto!important;align-self:auto!important}.align-self-xl-start{-webkit-align-self:flex-start!important;-ms-flex-item-align:start!important;align-self:flex-start!important}.align-self-xl-end{-webkit-align-self:flex-end!important;-ms-flex-item-align:end!important;align-self:flex-end!important}.align-self-xl-center{-webkit-align-self:center!important;-ms-flex-item-align:center!important;align-self:center!important}.align-self-xl-baseline{-webkit-align-self:baseline!important;-ms-flex-item-align:baseline!important;align-self:baseline!important}.align-self-xl-stretch{-webkit-align-self:stretch!important;-ms-flex-item-align:stretch!important;align-self:stretch!important}}.float-left{float:left!important}.float-right{float:right!important}.float-none{float:none!important}@media(min-width:576px){.float-sm-left{float:left!important}.float-sm-right{float:right!important}.float-sm-none{float:none!important}}@media(min-width:768px){.float-md-left{float:left!important}.float-md-right{float:right!important}.float-md-none{float:none!important}}@media(min-width:992px){.float-lg-left{float:left!important}.float-lg-right{float:right!important}.float-lg-none{float:none!important}}@media(min-width:1200px){.float-xl-left{float:left!important}.float-xl-right{float:right!important}.float-xl-none{float:none!important}}.position-static{position:static!important}.position-relative{position:relative!important}.position-absolute{position:absolute!important}.position-fixed{position:fixed!important}.position-sticky{position:-webkit-sticky!important;position:sticky!important}.fixed-top{position:fixed;top:0;right:0;left:0;z-index:1030}.fixed-bottom{position:fixed;right:0;bottom:0;left:0;z-index:1030}@supports((position:-webkit-sticky) or (position:sticky)){.sticky-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}}.sr-only{position:absolute;width:1px;height:1px;padding:0;overflow:hidden;clip:rect(0,0,0,0);white-space:nowrap;border:0}.sr-only-focusable:active,.sr-only-focusable:focus{position:static;width:auto;height:auto;overflow:visible;clip:auto;white-space:normal}.shadow-sm{-webkit-box-shadow:0 .125rem .25rem rgba(0,0,0,.075)!important;box-shadow:0 .125rem .25rem rgba(0,0,0,.075)!important}.shadow{-webkit-box-shadow:0 .5rem 1rem rgba(0,0,0,.15)!important;box-shadow:0 .5rem 1rem rgba(0,0,0,.15)!important}.shadow-lg{-webkit-box-shadow:0 1rem 3rem rgba(0,0,0,.175)!important;box-shadow:0 1rem 3rem rgba(0,0,0,.175)!important}.shadow-none{-webkit-box-shadow:none!important;box-shadow:none!important}.w-25{width:25%!important}.w-50{width:50%!important}.w-75{width:75%!important}.w-100{width:100%!important}.w-auto{width:auto!important}.h-25{height:25%!important}.h-50{height:50%!important}.h-75{height:75%!important}.h-100{height:100%!important}.h-auto{height:auto!important}.mw-100{max-width:100%!important}.mh-100{max-height:100%!important}.m-0{margin:0!important}.mt-0,.my-0{margin-top:0!important}.mr-0,.mx-0{margin-right:0!important}.mb-0,.my-0{margin-bottom:0!important}.ml-0,.mx-0{margin-left:0!important}.m-1{margin:.25rem!important}.mt-1,.my-1{margin-top:.25rem!important}.mr-1,.mx-1{margin-right:.25rem!important}.mb-1,.my-1{margin-bottom:.25rem!important}.ml-1,.mx-1{margin-left:.25rem!important}.m-2{margin:.5rem!important}.mt-2,.my-2{margin-top:.5rem!important}.mr-2,.mx-2{margin-right:.5rem!important}.mb-2,.my-2{margin-bottom:.5rem!important}.ml-2,.mx-2{margin-left:.5rem!important}.m-3{margin:1rem!important}.mt-3,.my-3{margin-top:1rem!important}.mr-3,.mx-3{margin-right:1rem!important}.mb-3,.my-3{margin-bottom:1rem!important}.ml-3,.mx-3{margin-left:1rem!important}.m-4{margin:1.5rem!important}.mt-4,.my-4{margin-top:1.5rem!important}.mr-4,.mx-4{margin-right:1.5rem!important}.mb-4,.my-4{margin-bottom:1.5rem!important}.ml-4,.mx-4{margin-left:1.5rem!important}.m-5{margin:3rem!important}.mt-5,.my-5{margin-top:3rem!important}.mr-5,.mx-5{margin-right:3rem!important}.mb-5,.my-5{margin-bottom:3rem!important}.ml-5,.mx-5{margin-left:3rem!important}.p-0{padding:0!important}.pt-0,.py-0{padding-top:0!important}.pr-0,.px-0{padding-right:0!important}.pb-0,.py-0{padding-bottom:0!important}.pl-0,.px-0{padding-left:0!important}.p-1{padding:.25rem!important}.pt-1,.py-1{padding-top:.25rem!important}.pr-1,.px-1{padding-right:.25rem!important}.pb-1,.py-1{padding-bottom:.25rem!important}.pl-1,.px-1{padding-left:.25rem!important}.p-2{padding:.5rem!important}.pt-2,.py-2{padding-top:.5rem!important}.pr-2,.px-2{padding-right:.5rem!important}.pb-2,.py-2{padding-bottom:.5rem!important}.pl-2,.px-2{padding-left:.5rem!important}.p-3{padding:1rem!important}.pt-3,.py-3{padding-top:1rem!important}.pr-3,.px-3{padding-right:1rem!important}.pb-3,.py-3{padding-bottom:1rem!important}.pl-3,.px-3{padding-left:1rem!important}.p-4{padding:1.5rem!important}.pt-4,.py-4{padding-top:1.5rem!important}.pr-4,.px-4{padding-right:1.5rem!important}.pb-4,.py-4{padding-bottom:1.5rem!important}.pl-4,.px-4{padding-left:1.5rem!important}.p-5{padding:3rem!important}.pt-5,.py-5{padding-top:3rem!important}.pr-5,.px-5{padding-right:3rem!important}.pb-5,.py-5{padding-bottom:3rem!important}.pl-5,.px-5{padding-left:3rem!important}.m-auto{margin:auto!important}.mt-auto,.my-auto{margin-top:auto!important}.mr-auto,.mx-auto{margin-right:auto!important}.mb-auto,.my-auto{margin-bottom:auto!important}.ml-auto,.mx-auto{margin-left:auto!important}@media(min-width:576px){.m-sm-0{margin:0!important}.mt-sm-0,.my-sm-0{margin-top:0!important}.mr-sm-0,.mx-sm-0{margin-right:0!important}.mb-sm-0,.my-sm-0{margin-bottom:0!important}.ml-sm-0,.mx-sm-0{margin-left:0!important}.m-sm-1{margin:.25rem!important}.mt-sm-1,.my-sm-1{margin-top:.25rem!important}.mr-sm-1,.mx-sm-1{margin-right:.25rem!important}.mb-sm-1,.my-sm-1{margin-bottom:.25rem!important}.ml-sm-1,.mx-sm-1{margin-left:.25rem!important}.m-sm-2{margin:.5rem!important}.mt-sm-2,.my-sm-2{margin-top:.5rem!important}.mr-sm-2,.mx-sm-2{margin-right:.5rem!important}.mb-sm-2,.my-sm-2{margin-bottom:.5rem!important}.ml-sm-2,.mx-sm-2{margin-left:.5rem!important}.m-sm-3{margin:1rem!important}.mt-sm-3,.my-sm-3{margin-top:1rem!important}.mr-sm-3,.mx-sm-3{margin-right:1rem!important}.mb-sm-3,.my-sm-3{margin-bottom:1rem!important}.ml-sm-3,.mx-sm-3{margin-left:1rem!important}.m-sm-4{margin:1.5rem!important}.mt-sm-4,.my-sm-4{margin-top:1.5rem!important}.mr-sm-4,.mx-sm-4{margin-right:1.5rem!important}.mb-sm-4,.my-sm-4{margin-bottom:1.5rem!important}.ml-sm-4,.mx-sm-4{margin-left:1.5rem!important}.m-sm-5{margin:3rem!important}.mt-sm-5,.my-sm-5{margin-top:3rem!important}.mr-sm-5,.mx-sm-5{margin-right:3rem!important}.mb-sm-5,.my-sm-5{margin-bottom:3rem!important}.ml-sm-5,.mx-sm-5{margin-left:3rem!important}.p-sm-0{padding:0!important}.pt-sm-0,.py-sm-0{padding-top:0!important}.pr-sm-0,.px-sm-0{padding-right:0!important}.pb-sm-0,.py-sm-0{padding-bottom:0!important}.pl-sm-0,.px-sm-0{padding-left:0!important}.p-sm-1{padding:.25rem!important}.pt-sm-1,.py-sm-1{padding-top:.25rem!important}.pr-sm-1,.px-sm-1{padding-right:.25rem!important}.pb-sm-1,.py-sm-1{padding-bottom:.25rem!important}.pl-sm-1,.px-sm-1{padding-left:.25rem!important}.p-sm-2{padding:.5rem!important}.pt-sm-2,.py-sm-2{padding-top:.5rem!important}.pr-sm-2,.px-sm-2{padding-right:.5rem!important}.pb-sm-2,.py-sm-2{padding-bottom:.5rem!important}.pl-sm-2,.px-sm-2{padding-left:.5rem!important}.p-sm-3{padding:1rem!important}.pt-sm-3,.py-sm-3{padding-top:1rem!important}.pr-sm-3,.px-sm-3{padding-right:1rem!important}.pb-sm-3,.py-sm-3{padding-bottom:1rem!important}.pl-sm-3,.px-sm-3{padding-left:1rem!important}.p-sm-4{padding:1.5rem!important}.pt-sm-4,.py-sm-4{padding-top:1.5rem!important}.pr-sm-4,.px-sm-4{padding-right:1.5rem!important}.pb-sm-4,.py-sm-4{padding-bottom:1.5rem!important}.pl-sm-4,.px-sm-4{padding-left:1.5rem!important}.p-sm-5{padding:3rem!important}.pt-sm-5,.py-sm-5{padding-top:3rem!important}.pr-sm-5,.px-sm-5{padding-right:3rem!important}.pb-sm-5,.py-sm-5{padding-bottom:3rem!important}.pl-sm-5,.px-sm-5{padding-left:3rem!important}.m-sm-auto{margin:auto!important}.mt-sm-auto,.my-sm-auto{margin-top:auto!important}.mr-sm-auto,.mx-sm-auto{margin-right:auto!important}.mb-sm-auto,.my-sm-auto{margin-bottom:auto!important}.ml-sm-auto,.mx-sm-auto{margin-left:auto!important}}@media(min-width:768px){.m-md-0{margin:0!important}.mt-md-0,.my-md-0{margin-top:0!important}.mr-md-0,.mx-md-0{margin-right:0!important}.mb-md-0,.my-md-0{margin-bottom:0!important}.ml-md-0,.mx-md-0{margin-left:0!important}.m-md-1{margin:.25rem!important}.mt-md-1,.my-md-1{margin-top:.25rem!important}.mr-md-1,.mx-md-1{margin-right:.25rem!important}.mb-md-1,.my-md-1{margin-bottom:.25rem!important}.ml-md-1,.mx-md-1{margin-left:.25rem!important}.m-md-2{margin:.5rem!important}.mt-md-2,.my-md-2{margin-top:.5rem!important}.mr-md-2,.mx-md-2{margin-right:.5rem!important}.mb-md-2,.my-md-2{margin-bottom:.5rem!important}.ml-md-2,.mx-md-2{margin-left:.5rem!important}.m-md-3{margin:1rem!important}.mt-md-3,.my-md-3{margin-top:1rem!important}.mr-md-3,.mx-md-3{margin-right:1rem!important}.mb-md-3,.my-md-3{margin-bottom:1rem!important}.ml-md-3,.mx-md-3{margin-left:1rem!important}.m-md-4{margin:1.5rem!important}.mt-md-4,.my-md-4{margin-top:1.5rem!important}.mr-md-4,.mx-md-4{margin-right:1.5rem!important}.mb-md-4,.my-md-4{margin-bottom:1.5rem!important}.ml-md-4,.mx-md-4{margin-left:1.5rem!important}.m-md-5{margin:3rem!important}.mt-md-5,.my-md-5{margin-top:3rem!important}.mr-md-5,.mx-md-5{margin-right:3rem!important}.mb-md-5,.my-md-5{margin-bottom:3rem!important}.ml-md-5,.mx-md-5{margin-left:3rem!important}.p-md-0{padding:0!important}.pt-md-0,.py-md-0{padding-top:0!important}.pr-md-0,.px-md-0{padding-right:0!important}.pb-md-0,.py-md-0{padding-bottom:0!important}.pl-md-0,.px-md-0{padding-left:0!important}.p-md-1{padding:.25rem!important}.pt-md-1,.py-md-1{padding-top:.25rem!important}.pr-md-1,.px-md-1{padding-right:.25rem!important}.pb-md-1,.py-md-1{padding-bottom:.25rem!important}.pl-md-1,.px-md-1{padding-left:.25rem!important}.p-md-2{padding:.5rem!important}.pt-md-2,.py-md-2{padding-top:.5rem!important}.pr-md-2,.px-md-2{padding-right:.5rem!important}.pb-md-2,.py-md-2{padding-bottom:.5rem!important}.pl-md-2,.px-md-2{padding-left:.5rem!important}.p-md-3{padding:1rem!important}.pt-md-3,.py-md-3{padding-top:1rem!important}.pr-md-3,.px-md-3{padding-right:1rem!important}.pb-md-3,.py-md-3{padding-bottom:1rem!important}.pl-md-3,.px-md-3{padding-left:1rem!important}.p-md-4{padding:1.5rem!important}.pt-md-4,.py-md-4{padding-top:1.5rem!important}.pr-md-4,.px-md-4{padding-right:1.5rem!important}.pb-md-4,.py-md-4{padding-bottom:1.5rem!important}.pl-md-4,.px-md-4{padding-left:1.5rem!important}.p-md-5{padding:3rem!important}.pt-md-5,.py-md-5{padding-top:3rem!important}.pr-md-5,.px-md-5{padding-right:3rem!important}.pb-md-5,.py-md-5{padding-bottom:3rem!important}.pl-md-5,.px-md-5{padding-left:3rem!important}.m-md-auto{margin:auto!important}.mt-md-auto,.my-md-auto{margin-top:auto!important}.mr-md-auto,.mx-md-auto{margin-right:auto!important}.mb-md-auto,.my-md-auto{margin-bottom:auto!important}.ml-md-auto,.mx-md-auto{margin-left:auto!important}}@media(min-width:992px){.m-lg-0{margin:0!important}.mt-lg-0,.my-lg-0{margin-top:0!important}.mr-lg-0,.mx-lg-0{margin-right:0!important}.mb-lg-0,.my-lg-0{margin-bottom:0!important}.ml-lg-0,.mx-lg-0{margin-left:0!important}.m-lg-1{margin:.25rem!important}.mt-lg-1,.my-lg-1{margin-top:.25rem!important}.mr-lg-1,.mx-lg-1{margin-right:.25rem!important}.mb-lg-1,.my-lg-1{margin-bottom:.25rem!important}.ml-lg-1,.mx-lg-1{margin-left:.25rem!important}.m-lg-2{margin:.5rem!important}.mt-lg-2,.my-lg-2{margin-top:.5rem!important}.mr-lg-2,.mx-lg-2{margin-right:.5rem!important}.mb-lg-2,.my-lg-2{margin-bottom:.5rem!important}.ml-lg-2,.mx-lg-2{margin-left:.5rem!important}.m-lg-3{margin:1rem!important}.mt-lg-3,.my-lg-3{margin-top:1rem!important}.mr-lg-3,.mx-lg-3{margin-right:1rem!important}.mb-lg-3,.my-lg-3{margin-bottom:1rem!important}.ml-lg-3,.mx-lg-3{margin-left:1rem!important}.m-lg-4{margin:1.5rem!important}.mt-lg-4,.my-lg-4{margin-top:1.5rem!important}.mr-lg-4,.mx-lg-4{margin-right:1.5rem!important}.mb-lg-4,.my-lg-4{margin-bottom:1.5rem!important}.ml-lg-4,.mx-lg-4{margin-left:1.5rem!important}.m-lg-5{margin:3rem!important}.mt-lg-5,.my-lg-5{margin-top:3rem!important}.mr-lg-5,.mx-lg-5{margin-right:3rem!important}.mb-lg-5,.my-lg-5{margin-bottom:3rem!important}.ml-lg-5,.mx-lg-5{margin-left:3rem!important}.p-lg-0{padding:0!important}.pt-lg-0,.py-lg-0{padding-top:0!important}.pr-lg-0,.px-lg-0{padding-right:0!important}.pb-lg-0,.py-lg-0{padding-bottom:0!important}.pl-lg-0,.px-lg-0{padding-left:0!important}.p-lg-1{padding:.25rem!important}.pt-lg-1,.py-lg-1{padding-top:.25rem!important}.pr-lg-1,.px-lg-1{padding-right:.25rem!important}.pb-lg-1,.py-lg-1{padding-bottom:.25rem!important}.pl-lg-1,.px-lg-1{padding-left:.25rem!important}.p-lg-2{padding:.5rem!important}.pt-lg-2,.py-lg-2{padding-top:.5rem!important}.pr-lg-2,.px-lg-2{padding-right:.5rem!important}.pb-lg-2,.py-lg-2{padding-bottom:.5rem!important}.pl-lg-2,.px-lg-2{padding-left:.5rem!important}.p-lg-3{padding:1rem!important}.pt-lg-3,.py-lg-3{padding-top:1rem!important}.pr-lg-3,.px-lg-3{padding-right:1rem!important}.pb-lg-3,.py-lg-3{padding-bottom:1rem!important}.pl-lg-3,.px-lg-3{padding-left:1rem!important}.p-lg-4{padding:1.5rem!important}.pt-lg-4,.py-lg-4{padding-top:1.5rem!important}.pr-lg-4,.px-lg-4{padding-right:1.5rem!important}.pb-lg-4,.py-lg-4{padding-bottom:1.5rem!important}.pl-lg-4,.px-lg-4{padding-left:1.5rem!important}.p-lg-5{padding:3rem!important}.pt-lg-5,.py-lg-5{padding-top:3rem!important}.pr-lg-5,.px-lg-5{padding-right:3rem!important}.pb-lg-5,.py-lg-5{padding-bottom:3rem!important}.pl-lg-5,.px-lg-5{padding-left:3rem!important}.m-lg-auto{margin:auto!important}.mt-lg-auto,.my-lg-auto{margin-top:auto!important}.mr-lg-auto,.mx-lg-auto{margin-right:auto!important}.mb-lg-auto,.my-lg-auto{margin-bottom:auto!important}.ml-lg-auto,.mx-lg-auto{margin-left:auto!important}}@media(min-width:1200px){.m-xl-0{margin:0!important}.mt-xl-0,.my-xl-0{margin-top:0!important}.mr-xl-0,.mx-xl-0{margin-right:0!important}.mb-xl-0,.my-xl-0{margin-bottom:0!important}.ml-xl-0,.mx-xl-0{margin-left:0!important}.m-xl-1{margin:.25rem!important}.mt-xl-1,.my-xl-1{margin-top:.25rem!important}.mr-xl-1,.mx-xl-1{margin-right:.25rem!important}.mb-xl-1,.my-xl-1{margin-bottom:.25rem!important}.ml-xl-1,.mx-xl-1{margin-left:.25rem!important}.m-xl-2{margin:.5rem!important}.mt-xl-2,.my-xl-2{margin-top:.5rem!important}.mr-xl-2,.mx-xl-2{margin-right:.5rem!important}.mb-xl-2,.my-xl-2{margin-bottom:.5rem!important}.ml-xl-2,.mx-xl-2{margin-left:.5rem!important}.m-xl-3{margin:1rem!important}.mt-xl-3,.my-xl-3{margin-top:1rem!important}.mr-xl-3,.mx-xl-3{margin-right:1rem!important}.mb-xl-3,.my-xl-3{margin-bottom:1rem!important}.ml-xl-3,.mx-xl-3{margin-left:1rem!important}.m-xl-4{margin:1.5rem!important}.mt-xl-4,.my-xl-4{margin-top:1.5rem!important}.mr-xl-4,.mx-xl-4{margin-right:1.5rem!important}.mb-xl-4,.my-xl-4{margin-bottom:1.5rem!important}.ml-xl-4,.mx-xl-4{margin-left:1.5rem!important}.m-xl-5{margin:3rem!important}.mt-xl-5,.my-xl-5{margin-top:3rem!important}.mr-xl-5,.mx-xl-5{margin-right:3rem!important}.mb-xl-5,.my-xl-5{margin-bottom:3rem!important}.ml-xl-5,.mx-xl-5{margin-left:3rem!important}.p-xl-0{padding:0!important}.pt-xl-0,.py-xl-0{padding-top:0!important}.pr-xl-0,.px-xl-0{padding-right:0!important}.pb-xl-0,.py-xl-0{padding-bottom:0!important}.pl-xl-0,.px-xl-0{padding-left:0!important}.p-xl-1{padding:.25rem!important}.pt-xl-1,.py-xl-1{padding-top:.25rem!important}.pr-xl-1,.px-xl-1{padding-right:.25rem!important}.pb-xl-1,.py-xl-1{padding-bottom:.25rem!important}.pl-xl-1,.px-xl-1{padding-left:.25rem!important}.p-xl-2{padding:.5rem!important}.pt-xl-2,.py-xl-2{padding-top:.5rem!important}.pr-xl-2,.px-xl-2{padding-right:.5rem!important}.pb-xl-2,.py-xl-2{padding-bottom:.5rem!important}.pl-xl-2,.px-xl-2{padding-left:.5rem!important}.p-xl-3{padding:1rem!important}.pt-xl-3,.py-xl-3{padding-top:1rem!important}.pr-xl-3,.px-xl-3{padding-right:1rem!important}.pb-xl-3,.py-xl-3{padding-bottom:1rem!important}.pl-xl-3,.px-xl-3{padding-left:1rem!important}.p-xl-4{padding:1.5rem!important}.pt-xl-4,.py-xl-4{padding-top:1.5rem!important}.pr-xl-4,.px-xl-4{padding-right:1.5rem!important}.pb-xl-4,.py-xl-4{padding-bottom:1.5rem!important}.pl-xl-4,.px-xl-4{padding-left:1.5rem!important}.p-xl-5{padding:3rem!important}.pt-xl-5,.py-xl-5{padding-top:3rem!important}.pr-xl-5,.px-xl-5{padding-right:3rem!important}.pb-xl-5,.py-xl-5{padding-bottom:3rem!important}.pl-xl-5,.px-xl-5{padding-left:3rem!important}.m-xl-auto{margin:auto!important}.mt-xl-auto,.my-xl-auto{margin-top:auto!important}.mr-xl-auto,.mx-xl-auto{margin-right:auto!important}.mb-xl-auto,.my-xl-auto{margin-bottom:auto!important}.ml-xl-auto,.mx-xl-auto{margin-left:auto!important}}.text-monospace{font-family:SFMono-Regular,Menlo,Monaco,Consolas,liberation mono,courier new,monospace}.text-justify{text-align:justify!important}.text-nowrap{white-space:nowrap!important}.text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.text-left{text-align:left!important}.text-right{text-align:right!important}.text-center{text-align:center!important}@media(min-width:576px){.text-sm-left{text-align:left!important}.text-sm-right{text-align:right!important}.text-sm-center{text-align:center!important}}@media(min-width:768px){.text-md-left{text-align:left!important}.text-md-right{text-align:right!important}.text-md-center{text-align:center!important}}@media(min-width:992px){.text-lg-left{text-align:left!important}.text-lg-right{text-align:right!important}.text-lg-center{text-align:center!important}}@media(min-width:1200px){.text-xl-left{text-align:left!important}.text-xl-right{text-align:right!important}.text-xl-center{text-align:center!important}}.text-lowercase{text-transform:lowercase!important}.text-uppercase{text-transform:uppercase!important}.text-capitalize{text-transform:capitalize!important}.font-weight-light{font-weight:300!important}.font-weight-normal{font-weight:400!important}.font-weight-bold{font-weight:700!important}.font-italic{font-style:italic!important}.text-white{color:#fff!important}.text-primary{color:#30638e!important}a.text-primary:hover,a.text-primary:focus{color:#234868!important}.text-secondary{color:#ffa630!important}a.text-secondary:hover,a.text-secondary:focus{color:#fc9000!important}.text-success{color:#3772ff!important}a.text-success:hover,a.text-success:focus{color:#044eff!important}.text-info{color:#c0e0de!important}a.text-info:hover,a.text-info:focus{color:#9ecfcc!important}.text-warning{color:#ed6a5a!important}a.text-warning:hover,a.text-warning:focus{color:#e8402c!important}.text-danger{color:#ed6a5a!important}a.text-danger:hover,a.text-danger:focus{color:#e8402c!important}.text-light{color:#d3f3ee!important}a.text-light:hover,a.text-light:focus{color:#abe8df!important}.text-dark{color:#403f4c!important}a.text-dark:hover,a.text-dark:focus{color:#292830!important}.text-body{color:#222!important}.text-muted{color:#888!important}.text-black-50{color:rgba(0,0,0,.5)!important}.text-white-50{color:rgba(255,255,255,.5)!important}.text-hide{font:0/0 a;color:transparent;text-shadow:none;background-color:transparent;border:0}.visible{visibility:visible!important}.invisible{visibility:hidden!important}@media print{*,*::before,*::after{text-shadow:none!important;-webkit-box-shadow:none!important;box-shadow:none!important}a:not(.btn){text-decoration:underline}abbr[title]::after{content:" (" attr(title) ")"}pre{white-space:pre-wrap!important}pre,blockquote{border:1px solid #adb5bd;page-break-inside:avoid}thead{display:table-header-group}tr,img{page-break-inside:avoid}p,h2,h3{orphans:3;widows:3}h2,h3{page-break-after:avoid}@page{size:a3}body{min-width:992px!important}.container{min-width:992px!important}.navbar{display:none}.badge{border:1px solid #000}.table,.td-box .row.section>table,.td-content>table{border-collapse:collapse!important}.table td,.td-box .row.section>table td,.td-content>table td,.table th,.td-box .row.section>table th,.td-content>table th{background-color:#fff!important}.table-bordered th,.table-bordered td{border:1px solid #dee2e6!important}.table-dark{color:inherit}.table-dark th,.table-dark td,.table-dark thead th,.table-dark tbody+tbody{border-color:#dee2e6}.table .thead-dark th,.td-box .row.section>table .thead-dark th,.td-content>table .thead-dark th{color:inherit;border-color:#dee2e6}}/*!* Font Awesome Free 5.10.1 by @fontawesome - https://fontawesome.com +* License - https://fontawesome.com/license/free (Icons: CC BY 4.0, Fonts: SIL OFL 1.1, Code: MIT License)*/.fa,.fas,.far,.fal,.fad,.fab{-moz-osx-font-smoothing:grayscale;-webkit-font-smoothing:antialiased;display:inline-block;font-style:normal;font-variant:normal;text-rendering:auto;line-height:1}.fa-lg{font-size:1.33333333em;line-height:.75em;vertical-align:-.0667em}.fa-xs{font-size:.75em}.fa-sm{font-size:.875em}.fa-1x{font-size:1em}.fa-2x{font-size:2em}.fa-3x{font-size:3em}.fa-4x{font-size:4em}.fa-5x{font-size:5em}.fa-6x{font-size:6em}.fa-7x{font-size:7em}.fa-8x{font-size:8em}.fa-9x{font-size:9em}.fa-10x{font-size:10em}.fa-fw{text-align:center;width:1.25em}.fa-ul{list-style-type:none;margin-left:2.5em;padding-left:0}.fa-ul>li{position:relative}.fa-li{left:-2em;position:absolute;text-align:center;width:2em;line-height:inherit}.fa-border{border:solid .08em #eee;border-radius:.1em;padding:.2em .25em .15em}.fa-pull-left{float:left}.fa-pull-right{float:right}.fa.fa-pull-left,.fas.fa-pull-left,.far.fa-pull-left,.fal.fa-pull-left,.fab.fa-pull-left{margin-right:.3em}.fa.fa-pull-right,.fas.fa-pull-right,.far.fa-pull-right,.fal.fa-pull-right,.fab.fa-pull-right{margin-left:.3em}.fa-spin{-webkit-animation:fa-spin 2s infinite linear;-o-animation:fa-spin 2s infinite linear;animation:fa-spin 2s infinite linear}.fa-pulse{-webkit-animation:fa-spin 1s infinite steps(8);-o-animation:fa-spin 1s infinite steps(8);animation:fa-spin 1s infinite steps(8)}@-webkit-keyframes fa-spin{0%{-webkit-transform:rotate(0deg);transform:rotate(0deg)}100%{-webkit-transform:rotate(360deg);transform:rotate(360deg)}}@-o-keyframes fa-spin{0%{-o-transform:rotate(0deg);transform:rotate(0deg)}100%{-o-transform:rotate(360deg);transform:rotate(360deg)}}@keyframes fa-spin{0%{-webkit-transform:rotate(0deg);-o-transform:rotate(0deg);transform:rotate(0deg)}100%{-webkit-transform:rotate(360deg);-o-transform:rotate(360deg);transform:rotate(360deg)}}.fa-rotate-90{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=1)";-webkit-transform:rotate(90deg);-ms-transform:rotate(90deg);-o-transform:rotate(90deg);transform:rotate(90deg)}.fa-rotate-180{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=2)";-webkit-transform:rotate(180deg);-ms-transform:rotate(180deg);-o-transform:rotate(180deg);transform:rotate(180deg)}.fa-rotate-270{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=3)";-webkit-transform:rotate(270deg);-ms-transform:rotate(270deg);-o-transform:rotate(270deg);transform:rotate(270deg)}.fa-flip-horizontal{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=0, mirror=1)";-webkit-transform:scale(-1,1);-ms-transform:scale(-1,1);-o-transform:scale(-1,1);transform:scale(-1,1)}.fa-flip-vertical{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)";-webkit-transform:scale(1,-1);-ms-transform:scale(1,-1);-o-transform:scale(1,-1);transform:scale(1,-1)}.fa-flip-both,.fa-flip-horizontal.fa-flip-vertical{-ms-filter:"progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)";-webkit-transform:scale(-1,-1);-ms-transform:scale(-1,-1);-o-transform:scale(-1,-1);transform:scale(-1,-1)}:root .fa-rotate-90,:root .fa-rotate-180,:root .fa-rotate-270,:root .fa-flip-horizontal,:root .fa-flip-vertical,:root .fa-flip-both{-webkit-filter:none;filter:none}.fa-stack{display:inline-block;height:2em;line-height:2em;position:relative;vertical-align:middle;width:2.5em}.fa-stack-1x,.fa-stack-2x{left:0;position:absolute;text-align:center;width:100%}.fa-stack-1x{line-height:inherit}.fa-stack-2x{font-size:2em}.fa-inverse{color:#fff}.fa-500px:before{content:"\f26e"}.fa-accessible-icon:before{content:"\f368"}.fa-accusoft:before{content:"\f369"}.fa-acquisitions-incorporated:before{content:"\f6af"}.fa-ad:before{content:"\f641"}.fa-address-book:before{content:"\f2b9"}.fa-address-card:before{content:"\f2bb"}.fa-adjust:before{content:"\f042"}.fa-adn:before{content:"\f170"}.fa-adobe:before{content:"\f778"}.fa-adversal:before{content:"\f36a"}.fa-affiliatetheme:before{content:"\f36b"}.fa-air-freshener:before{content:"\f5d0"}.fa-airbnb:before{content:"\f834"}.fa-algolia:before{content:"\f36c"}.fa-align-center:before{content:"\f037"}.fa-align-justify:before{content:"\f039"}.fa-align-left:before{content:"\f036"}.fa-align-right:before{content:"\f038"}.fa-alipay:before{content:"\f642"}.fa-allergies:before{content:"\f461"}.fa-amazon:before{content:"\f270"}.fa-amazon-pay:before{content:"\f42c"}.fa-ambulance:before{content:"\f0f9"}.fa-american-sign-language-interpreting:before{content:"\f2a3"}.fa-amilia:before{content:"\f36d"}.fa-anchor:before{content:"\f13d"}.fa-android:before{content:"\f17b"}.fa-angellist:before{content:"\f209"}.fa-angle-double-down:before{content:"\f103"}.fa-angle-double-left:before{content:"\f100"}.fa-angle-double-right:before{content:"\f101"}.fa-angle-double-up:before{content:"\f102"}.fa-angle-down:before{content:"\f107"}.fa-angle-left:before{content:"\f104"}.fa-angle-right:before{content:"\f105"}.fa-angle-up:before{content:"\f106"}.fa-angry:before{content:"\f556"}.fa-angrycreative:before{content:"\f36e"}.fa-angular:before{content:"\f420"}.fa-ankh:before{content:"\f644"}.fa-app-store:before{content:"\f36f"}.fa-app-store-ios:before{content:"\f370"}.fa-apper:before{content:"\f371"}.fa-apple:before{content:"\f179"}.fa-apple-alt:before{content:"\f5d1"}.fa-apple-pay:before{content:"\f415"}.fa-archive:before{content:"\f187"}.fa-archway:before{content:"\f557"}.fa-arrow-alt-circle-down:before{content:"\f358"}.fa-arrow-alt-circle-left:before{content:"\f359"}.fa-arrow-alt-circle-right:before{content:"\f35a"}.fa-arrow-alt-circle-up:before{content:"\f35b"}.fa-arrow-circle-down:before{content:"\f0ab"}.fa-arrow-circle-left:before{content:"\f0a8"}.fa-arrow-circle-right:before{content:"\f0a9"}.fa-arrow-circle-up:before{content:"\f0aa"}.fa-arrow-down:before{content:"\f063"}.fa-arrow-left:before{content:"\f060"}.fa-arrow-right:before{content:"\f061"}.fa-arrow-up:before{content:"\f062"}.fa-arrows-alt:before{content:"\f0b2"}.fa-arrows-alt-h:before{content:"\f337"}.fa-arrows-alt-v:before{content:"\f338"}.fa-artstation:before{content:"\f77a"}.fa-assistive-listening-systems:before{content:"\f2a2"}.fa-asterisk:before{content:"\f069"}.fa-asymmetrik:before{content:"\f372"}.fa-at:before{content:"\f1fa"}.fa-atlas:before{content:"\f558"}.fa-atlassian:before{content:"\f77b"}.fa-atom:before{content:"\f5d2"}.fa-audible:before{content:"\f373"}.fa-audio-description:before{content:"\f29e"}.fa-autoprefixer:before{content:"\f41c"}.fa-avianex:before{content:"\f374"}.fa-aviato:before{content:"\f421"}.fa-award:before{content:"\f559"}.fa-aws:before{content:"\f375"}.fa-baby:before{content:"\f77c"}.fa-baby-carriage:before{content:"\f77d"}.fa-backspace:before{content:"\f55a"}.fa-backward:before{content:"\f04a"}.fa-bacon:before{content:"\f7e5"}.fa-balance-scale:before{content:"\f24e"}.fa-balance-scale-left:before{content:"\f515"}.fa-balance-scale-right:before{content:"\f516"}.fa-ban:before{content:"\f05e"}.fa-band-aid:before{content:"\f462"}.fa-bandcamp:before{content:"\f2d5"}.fa-barcode:before{content:"\f02a"}.fa-bars:before{content:"\f0c9"}.fa-baseball-ball:before{content:"\f433"}.fa-basketball-ball:before{content:"\f434"}.fa-bath:before{content:"\f2cd"}.fa-battery-empty:before{content:"\f244"}.fa-battery-full:before{content:"\f240"}.fa-battery-half:before{content:"\f242"}.fa-battery-quarter:before{content:"\f243"}.fa-battery-three-quarters:before{content:"\f241"}.fa-battle-net:before{content:"\f835"}.fa-bed:before{content:"\f236"}.fa-beer:before{content:"\f0fc"}.fa-behance:before{content:"\f1b4"}.fa-behance-square:before{content:"\f1b5"}.fa-bell:before{content:"\f0f3"}.fa-bell-slash:before{content:"\f1f6"}.fa-bezier-curve:before{content:"\f55b"}.fa-bible:before{content:"\f647"}.fa-bicycle:before{content:"\f206"}.fa-biking:before{content:"\f84a"}.fa-bimobject:before{content:"\f378"}.fa-binoculars:before{content:"\f1e5"}.fa-biohazard:before{content:"\f780"}.fa-birthday-cake:before{content:"\f1fd"}.fa-bitbucket:before{content:"\f171"}.fa-bitcoin:before{content:"\f379"}.fa-bity:before{content:"\f37a"}.fa-black-tie:before{content:"\f27e"}.fa-blackberry:before{content:"\f37b"}.fa-blender:before{content:"\f517"}.fa-blender-phone:before{content:"\f6b6"}.fa-blind:before{content:"\f29d"}.fa-blog:before{content:"\f781"}.fa-blogger:before{content:"\f37c"}.fa-blogger-b:before{content:"\f37d"}.fa-bluetooth:before{content:"\f293"}.fa-bluetooth-b:before{content:"\f294"}.fa-bold:before{content:"\f032"}.fa-bolt:before{content:"\f0e7"}.fa-bomb:before{content:"\f1e2"}.fa-bone:before{content:"\f5d7"}.fa-bong:before{content:"\f55c"}.fa-book:before{content:"\f02d"}.fa-book-dead:before{content:"\f6b7"}.fa-book-medical:before{content:"\f7e6"}.fa-book-open:before{content:"\f518"}.fa-book-reader:before{content:"\f5da"}.fa-bookmark:before{content:"\f02e"}.fa-bootstrap:before{content:"\f836"}.fa-border-all:before{content:"\f84c"}.fa-border-none:before{content:"\f850"}.fa-border-style:before{content:"\f853"}.fa-bowling-ball:before{content:"\f436"}.fa-box:before{content:"\f466"}.fa-box-open:before{content:"\f49e"}.fa-boxes:before{content:"\f468"}.fa-braille:before{content:"\f2a1"}.fa-brain:before{content:"\f5dc"}.fa-bread-slice:before{content:"\f7ec"}.fa-briefcase:before{content:"\f0b1"}.fa-briefcase-medical:before{content:"\f469"}.fa-broadcast-tower:before{content:"\f519"}.fa-broom:before{content:"\f51a"}.fa-brush:before{content:"\f55d"}.fa-btc:before{content:"\f15a"}.fa-buffer:before{content:"\f837"}.fa-bug:before{content:"\f188"}.fa-building:before{content:"\f1ad"}.fa-bullhorn:before{content:"\f0a1"}.fa-bullseye:before{content:"\f140"}.fa-burn:before{content:"\f46a"}.fa-buromobelexperte:before{content:"\f37f"}.fa-bus:before{content:"\f207"}.fa-bus-alt:before{content:"\f55e"}.fa-business-time:before{content:"\f64a"}.fa-buysellads:before{content:"\f20d"}.fa-calculator:before{content:"\f1ec"}.fa-calendar:before{content:"\f133"}.fa-calendar-alt:before{content:"\f073"}.fa-calendar-check:before{content:"\f274"}.fa-calendar-day:before{content:"\f783"}.fa-calendar-minus:before{content:"\f272"}.fa-calendar-plus:before{content:"\f271"}.fa-calendar-times:before{content:"\f273"}.fa-calendar-week:before{content:"\f784"}.fa-camera:before{content:"\f030"}.fa-camera-retro:before{content:"\f083"}.fa-campground:before{content:"\f6bb"}.fa-canadian-maple-leaf:before{content:"\f785"}.fa-candy-cane:before{content:"\f786"}.fa-cannabis:before{content:"\f55f"}.fa-capsules:before{content:"\f46b"}.fa-car:before{content:"\f1b9"}.fa-car-alt:before{content:"\f5de"}.fa-car-battery:before{content:"\f5df"}.fa-car-crash:before{content:"\f5e1"}.fa-car-side:before{content:"\f5e4"}.fa-caret-down:before{content:"\f0d7"}.fa-caret-left:before{content:"\f0d9"}.fa-caret-right:before{content:"\f0da"}.fa-caret-square-down:before{content:"\f150"}.fa-caret-square-left:before{content:"\f191"}.fa-caret-square-right:before{content:"\f152"}.fa-caret-square-up:before{content:"\f151"}.fa-caret-up:before{content:"\f0d8"}.fa-carrot:before{content:"\f787"}.fa-cart-arrow-down:before{content:"\f218"}.fa-cart-plus:before{content:"\f217"}.fa-cash-register:before{content:"\f788"}.fa-cat:before{content:"\f6be"}.fa-cc-amazon-pay:before{content:"\f42d"}.fa-cc-amex:before{content:"\f1f3"}.fa-cc-apple-pay:before{content:"\f416"}.fa-cc-diners-club:before{content:"\f24c"}.fa-cc-discover:before{content:"\f1f2"}.fa-cc-jcb:before{content:"\f24b"}.fa-cc-mastercard:before{content:"\f1f1"}.fa-cc-paypal:before{content:"\f1f4"}.fa-cc-stripe:before{content:"\f1f5"}.fa-cc-visa:before{content:"\f1f0"}.fa-centercode:before{content:"\f380"}.fa-centos:before{content:"\f789"}.fa-certificate:before{content:"\f0a3"}.fa-chair:before{content:"\f6c0"}.fa-chalkboard:before{content:"\f51b"}.fa-chalkboard-teacher:before{content:"\f51c"}.fa-charging-station:before{content:"\f5e7"}.fa-chart-area:before{content:"\f1fe"}.fa-chart-bar:before{content:"\f080"}.fa-chart-line:before{content:"\f201"}.fa-chart-pie:before{content:"\f200"}.fa-check:before{content:"\f00c"}.fa-check-circle:before{content:"\f058"}.fa-check-double:before{content:"\f560"}.fa-check-square:before{content:"\f14a"}.fa-cheese:before{content:"\f7ef"}.fa-chess:before{content:"\f439"}.fa-chess-bishop:before{content:"\f43a"}.fa-chess-board:before{content:"\f43c"}.fa-chess-king:before{content:"\f43f"}.fa-chess-knight:before{content:"\f441"}.fa-chess-pawn:before{content:"\f443"}.fa-chess-queen:before{content:"\f445"}.fa-chess-rook:before{content:"\f447"}.fa-chevron-circle-down:before{content:"\f13a"}.fa-chevron-circle-left:before{content:"\f137"}.fa-chevron-circle-right:before{content:"\f138"}.fa-chevron-circle-up:before{content:"\f139"}.fa-chevron-down:before{content:"\f078"}.fa-chevron-left:before{content:"\f053"}.fa-chevron-right:before{content:"\f054"}.fa-chevron-up:before{content:"\f077"}.fa-child:before{content:"\f1ae"}.fa-chrome:before{content:"\f268"}.fa-chromecast:before{content:"\f838"}.fa-church:before{content:"\f51d"}.fa-circle:before{content:"\f111"}.fa-circle-notch:before{content:"\f1ce"}.fa-city:before{content:"\f64f"}.fa-clinic-medical:before{content:"\f7f2"}.fa-clipboard:before{content:"\f328"}.fa-clipboard-check:before{content:"\f46c"}.fa-clipboard-list:before{content:"\f46d"}.fa-clock:before{content:"\f017"}.fa-clone:before{content:"\f24d"}.fa-closed-captioning:before{content:"\f20a"}.fa-cloud:before{content:"\f0c2"}.fa-cloud-download-alt:before{content:"\f381"}.fa-cloud-meatball:before{content:"\f73b"}.fa-cloud-moon:before{content:"\f6c3"}.fa-cloud-moon-rain:before{content:"\f73c"}.fa-cloud-rain:before{content:"\f73d"}.fa-cloud-showers-heavy:before{content:"\f740"}.fa-cloud-sun:before{content:"\f6c4"}.fa-cloud-sun-rain:before{content:"\f743"}.fa-cloud-upload-alt:before{content:"\f382"}.fa-cloudscale:before{content:"\f383"}.fa-cloudsmith:before{content:"\f384"}.fa-cloudversify:before{content:"\f385"}.fa-cocktail:before{content:"\f561"}.fa-code:before{content:"\f121"}.fa-code-branch:before{content:"\f126"}.fa-codepen:before{content:"\f1cb"}.fa-codiepie:before{content:"\f284"}.fa-coffee:before{content:"\f0f4"}.fa-cog:before{content:"\f013"}.fa-cogs:before{content:"\f085"}.fa-coins:before{content:"\f51e"}.fa-columns:before{content:"\f0db"}.fa-comment:before{content:"\f075"}.fa-comment-alt:before{content:"\f27a"}.fa-comment-dollar:before{content:"\f651"}.fa-comment-dots:before{content:"\f4ad"}.fa-comment-medical:before{content:"\f7f5"}.fa-comment-slash:before{content:"\f4b3"}.fa-comments:before{content:"\f086"}.fa-comments-dollar:before{content:"\f653"}.fa-compact-disc:before{content:"\f51f"}.fa-compass:before{content:"\f14e"}.fa-compress:before{content:"\f066"}.fa-compress-arrows-alt:before{content:"\f78c"}.fa-concierge-bell:before{content:"\f562"}.fa-confluence:before{content:"\f78d"}.fa-connectdevelop:before{content:"\f20e"}.fa-contao:before{content:"\f26d"}.fa-cookie:before{content:"\f563"}.fa-cookie-bite:before{content:"\f564"}.fa-copy:before{content:"\f0c5"}.fa-copyright:before{content:"\f1f9"}.fa-cotton-bureau:before{content:"\f89e"}.fa-couch:before{content:"\f4b8"}.fa-cpanel:before{content:"\f388"}.fa-creative-commons:before{content:"\f25e"}.fa-creative-commons-by:before{content:"\f4e7"}.fa-creative-commons-nc:before{content:"\f4e8"}.fa-creative-commons-nc-eu:before{content:"\f4e9"}.fa-creative-commons-nc-jp:before{content:"\f4ea"}.fa-creative-commons-nd:before{content:"\f4eb"}.fa-creative-commons-pd:before{content:"\f4ec"}.fa-creative-commons-pd-alt:before{content:"\f4ed"}.fa-creative-commons-remix:before{content:"\f4ee"}.fa-creative-commons-sa:before{content:"\f4ef"}.fa-creative-commons-sampling:before{content:"\f4f0"}.fa-creative-commons-sampling-plus:before{content:"\f4f1"}.fa-creative-commons-share:before{content:"\f4f2"}.fa-creative-commons-zero:before{content:"\f4f3"}.fa-credit-card:before{content:"\f09d"}.fa-critical-role:before{content:"\f6c9"}.fa-crop:before{content:"\f125"}.fa-crop-alt:before{content:"\f565"}.fa-cross:before{content:"\f654"}.fa-crosshairs:before{content:"\f05b"}.fa-crow:before{content:"\f520"}.fa-crown:before{content:"\f521"}.fa-crutch:before{content:"\f7f7"}.fa-css3:before{content:"\f13c"}.fa-css3-alt:before{content:"\f38b"}.fa-cube:before{content:"\f1b2"}.fa-cubes:before{content:"\f1b3"}.fa-cut:before{content:"\f0c4"}.fa-cuttlefish:before{content:"\f38c"}.fa-d-and-d:before{content:"\f38d"}.fa-d-and-d-beyond:before{content:"\f6ca"}.fa-dashcube:before{content:"\f210"}.fa-database:before{content:"\f1c0"}.fa-deaf:before{content:"\f2a4"}.fa-delicious:before{content:"\f1a5"}.fa-democrat:before{content:"\f747"}.fa-deploydog:before{content:"\f38e"}.fa-deskpro:before{content:"\f38f"}.fa-desktop:before{content:"\f108"}.fa-dev:before{content:"\f6cc"}.fa-deviantart:before{content:"\f1bd"}.fa-dharmachakra:before{content:"\f655"}.fa-dhl:before{content:"\f790"}.fa-diagnoses:before{content:"\f470"}.fa-diaspora:before{content:"\f791"}.fa-dice:before{content:"\f522"}.fa-dice-d20:before{content:"\f6cf"}.fa-dice-d6:before{content:"\f6d1"}.fa-dice-five:before{content:"\f523"}.fa-dice-four:before{content:"\f524"}.fa-dice-one:before{content:"\f525"}.fa-dice-six:before{content:"\f526"}.fa-dice-three:before{content:"\f527"}.fa-dice-two:before{content:"\f528"}.fa-digg:before{content:"\f1a6"}.fa-digital-ocean:before{content:"\f391"}.fa-digital-tachograph:before{content:"\f566"}.fa-directions:before{content:"\f5eb"}.fa-discord:before{content:"\f392"}.fa-discourse:before{content:"\f393"}.fa-divide:before{content:"\f529"}.fa-dizzy:before{content:"\f567"}.fa-dna:before{content:"\f471"}.fa-dochub:before{content:"\f394"}.fa-docker:before{content:"\f395"}.fa-dog:before{content:"\f6d3"}.fa-dollar-sign:before{content:"\f155"}.fa-dolly:before{content:"\f472"}.fa-dolly-flatbed:before{content:"\f474"}.fa-donate:before{content:"\f4b9"}.fa-door-closed:before{content:"\f52a"}.fa-door-open:before{content:"\f52b"}.fa-dot-circle:before{content:"\f192"}.fa-dove:before{content:"\f4ba"}.fa-download:before{content:"\f019"}.fa-draft2digital:before{content:"\f396"}.fa-drafting-compass:before{content:"\f568"}.fa-dragon:before{content:"\f6d5"}.fa-draw-polygon:before{content:"\f5ee"}.fa-dribbble:before{content:"\f17d"}.fa-dribbble-square:before{content:"\f397"}.fa-dropbox:before{content:"\f16b"}.fa-drum:before{content:"\f569"}.fa-drum-steelpan:before{content:"\f56a"}.fa-drumstick-bite:before{content:"\f6d7"}.fa-drupal:before{content:"\f1a9"}.fa-dumbbell:before{content:"\f44b"}.fa-dumpster:before{content:"\f793"}.fa-dumpster-fire:before{content:"\f794"}.fa-dungeon:before{content:"\f6d9"}.fa-dyalog:before{content:"\f399"}.fa-earlybirds:before{content:"\f39a"}.fa-ebay:before{content:"\f4f4"}.fa-edge:before{content:"\f282"}.fa-edit:before{content:"\f044"}.fa-egg:before{content:"\f7fb"}.fa-eject:before{content:"\f052"}.fa-elementor:before{content:"\f430"}.fa-ellipsis-h:before{content:"\f141"}.fa-ellipsis-v:before{content:"\f142"}.fa-ello:before{content:"\f5f1"}.fa-ember:before{content:"\f423"}.fa-empire:before{content:"\f1d1"}.fa-envelope:before{content:"\f0e0"}.fa-envelope-open:before{content:"\f2b6"}.fa-envelope-open-text:before{content:"\f658"}.fa-envelope-square:before{content:"\f199"}.fa-envira:before{content:"\f299"}.fa-equals:before{content:"\f52c"}.fa-eraser:before{content:"\f12d"}.fa-erlang:before{content:"\f39d"}.fa-ethereum:before{content:"\f42e"}.fa-ethernet:before{content:"\f796"}.fa-etsy:before{content:"\f2d7"}.fa-euro-sign:before{content:"\f153"}.fa-evernote:before{content:"\f839"}.fa-exchange-alt:before{content:"\f362"}.fa-exclamation:before{content:"\f12a"}.fa-exclamation-circle:before{content:"\f06a"}.fa-exclamation-triangle:before{content:"\f071"}.fa-expand:before{content:"\f065"}.fa-expand-arrows-alt:before{content:"\f31e"}.fa-expeditedssl:before{content:"\f23e"}.fa-external-link-alt:before{content:"\f35d"}.fa-external-link-square-alt:before{content:"\f360"}.fa-eye:before{content:"\f06e"}.fa-eye-dropper:before{content:"\f1fb"}.fa-eye-slash:before{content:"\f070"}.fa-facebook:before{content:"\f09a"}.fa-facebook-f:before{content:"\f39e"}.fa-facebook-messenger:before{content:"\f39f"}.fa-facebook-square:before{content:"\f082"}.fa-fan:before{content:"\f863"}.fa-fantasy-flight-games:before{content:"\f6dc"}.fa-fast-backward:before{content:"\f049"}.fa-fast-forward:before{content:"\f050"}.fa-fax:before{content:"\f1ac"}.fa-feather:before{content:"\f52d"}.fa-feather-alt:before{content:"\f56b"}.fa-fedex:before{content:"\f797"}.fa-fedora:before{content:"\f798"}.fa-female:before{content:"\f182"}.fa-fighter-jet:before{content:"\f0fb"}.fa-figma:before{content:"\f799"}.fa-file:before{content:"\f15b"}.fa-file-alt:before{content:"\f15c"}.fa-file-archive:before{content:"\f1c6"}.fa-file-audio:before{content:"\f1c7"}.fa-file-code:before{content:"\f1c9"}.fa-file-contract:before{content:"\f56c"}.fa-file-csv:before{content:"\f6dd"}.fa-file-download:before{content:"\f56d"}.fa-file-excel:before{content:"\f1c3"}.fa-file-export:before{content:"\f56e"}.fa-file-image:before{content:"\f1c5"}.fa-file-import:before{content:"\f56f"}.fa-file-invoice:before{content:"\f570"}.fa-file-invoice-dollar:before{content:"\f571"}.fa-file-medical:before{content:"\f477"}.fa-file-medical-alt:before{content:"\f478"}.fa-file-pdf:before{content:"\f1c1"}.fa-file-powerpoint:before{content:"\f1c4"}.fa-file-prescription:before{content:"\f572"}.fa-file-signature:before{content:"\f573"}.fa-file-upload:before{content:"\f574"}.fa-file-video:before{content:"\f1c8"}.fa-file-word:before{content:"\f1c2"}.fa-fill:before{content:"\f575"}.fa-fill-drip:before{content:"\f576"}.fa-film:before{content:"\f008"}.fa-filter:before{content:"\f0b0"}.fa-fingerprint:before{content:"\f577"}.fa-fire:before{content:"\f06d"}.fa-fire-alt:before{content:"\f7e4"}.fa-fire-extinguisher:before{content:"\f134"}.fa-firefox:before{content:"\f269"}.fa-first-aid:before{content:"\f479"}.fa-first-order:before{content:"\f2b0"}.fa-first-order-alt:before{content:"\f50a"}.fa-firstdraft:before{content:"\f3a1"}.fa-fish:before{content:"\f578"}.fa-fist-raised:before{content:"\f6de"}.fa-flag:before{content:"\f024"}.fa-flag-checkered:before{content:"\f11e"}.fa-flag-usa:before{content:"\f74d"}.fa-flask:before{content:"\f0c3"}.fa-flickr:before{content:"\f16e"}.fa-flipboard:before{content:"\f44d"}.fa-flushed:before{content:"\f579"}.fa-fly:before{content:"\f417"}.fa-folder:before{content:"\f07b"}.fa-folder-minus:before{content:"\f65d"}.fa-folder-open:before{content:"\f07c"}.fa-folder-plus:before{content:"\f65e"}.fa-font:before{content:"\f031"}.fa-font-awesome:before{content:"\f2b4"}.fa-font-awesome-alt:before{content:"\f35c"}.fa-font-awesome-flag:before{content:"\f425"}.fa-font-awesome-logo-full:before{content:"\f4e6"}.fa-fonticons:before{content:"\f280"}.fa-fonticons-fi:before{content:"\f3a2"}.fa-football-ball:before{content:"\f44e"}.fa-fort-awesome:before{content:"\f286"}.fa-fort-awesome-alt:before{content:"\f3a3"}.fa-forumbee:before{content:"\f211"}.fa-forward:before{content:"\f04e"}.fa-foursquare:before{content:"\f180"}.fa-free-code-camp:before{content:"\f2c5"}.fa-freebsd:before{content:"\f3a4"}.fa-frog:before{content:"\f52e"}.fa-frown:before{content:"\f119"}.fa-frown-open:before{content:"\f57a"}.fa-fulcrum:before{content:"\f50b"}.fa-funnel-dollar:before{content:"\f662"}.fa-futbol:before{content:"\f1e3"}.fa-galactic-republic:before{content:"\f50c"}.fa-galactic-senate:before{content:"\f50d"}.fa-gamepad:before{content:"\f11b"}.fa-gas-pump:before{content:"\f52f"}.fa-gavel:before{content:"\f0e3"}.fa-gem:before{content:"\f3a5"}.fa-genderless:before{content:"\f22d"}.fa-get-pocket:before{content:"\f265"}.fa-gg:before{content:"\f260"}.fa-gg-circle:before{content:"\f261"}.fa-ghost:before{content:"\f6e2"}.fa-gift:before{content:"\f06b"}.fa-gifts:before{content:"\f79c"}.fa-git:before{content:"\f1d3"}.fa-git-alt:before{content:"\f841"}.fa-git-square:before{content:"\f1d2"}.fa-github:before{content:"\f09b"}.fa-github-alt:before{content:"\f113"}.fa-github-square:before{content:"\f092"}.fa-gitkraken:before{content:"\f3a6"}.fa-gitlab:before{content:"\f296"}.fa-gitter:before{content:"\f426"}.fa-glass-cheers:before{content:"\f79f"}.fa-glass-martini:before{content:"\f000"}.fa-glass-martini-alt:before{content:"\f57b"}.fa-glass-whiskey:before{content:"\f7a0"}.fa-glasses:before{content:"\f530"}.fa-glide:before{content:"\f2a5"}.fa-glide-g:before{content:"\f2a6"}.fa-globe:before{content:"\f0ac"}.fa-globe-africa:before{content:"\f57c"}.fa-globe-americas:before{content:"\f57d"}.fa-globe-asia:before{content:"\f57e"}.fa-globe-europe:before{content:"\f7a2"}.fa-gofore:before{content:"\f3a7"}.fa-golf-ball:before{content:"\f450"}.fa-goodreads:before{content:"\f3a8"}.fa-goodreads-g:before{content:"\f3a9"}.fa-google:before{content:"\f1a0"}.fa-google-drive:before{content:"\f3aa"}.fa-google-play:before{content:"\f3ab"}.fa-google-plus:before{content:"\f2b3"}.fa-google-plus-g:before{content:"\f0d5"}.fa-google-plus-square:before{content:"\f0d4"}.fa-google-wallet:before{content:"\f1ee"}.fa-gopuram:before{content:"\f664"}.fa-graduation-cap:before{content:"\f19d"}.fa-gratipay:before{content:"\f184"}.fa-grav:before{content:"\f2d6"}.fa-greater-than:before{content:"\f531"}.fa-greater-than-equal:before{content:"\f532"}.fa-grimace:before{content:"\f57f"}.fa-grin:before{content:"\f580"}.fa-grin-alt:before{content:"\f581"}.fa-grin-beam:before{content:"\f582"}.fa-grin-beam-sweat:before{content:"\f583"}.fa-grin-hearts:before{content:"\f584"}.fa-grin-squint:before{content:"\f585"}.fa-grin-squint-tears:before{content:"\f586"}.fa-grin-stars:before{content:"\f587"}.fa-grin-tears:before{content:"\f588"}.fa-grin-tongue:before{content:"\f589"}.fa-grin-tongue-squint:before{content:"\f58a"}.fa-grin-tongue-wink:before{content:"\f58b"}.fa-grin-wink:before{content:"\f58c"}.fa-grip-horizontal:before{content:"\f58d"}.fa-grip-lines:before{content:"\f7a4"}.fa-grip-lines-vertical:before{content:"\f7a5"}.fa-grip-vertical:before{content:"\f58e"}.fa-gripfire:before{content:"\f3ac"}.fa-grunt:before{content:"\f3ad"}.fa-guitar:before{content:"\f7a6"}.fa-gulp:before{content:"\f3ae"}.fa-h-square:before{content:"\f0fd"}.fa-hacker-news:before{content:"\f1d4"}.fa-hacker-news-square:before{content:"\f3af"}.fa-hackerrank:before{content:"\f5f7"}.fa-hamburger:before{content:"\f805"}.fa-hammer:before{content:"\f6e3"}.fa-hamsa:before{content:"\f665"}.fa-hand-holding:before{content:"\f4bd"}.fa-hand-holding-heart:before{content:"\f4be"}.fa-hand-holding-usd:before{content:"\f4c0"}.fa-hand-lizard:before{content:"\f258"}.fa-hand-middle-finger:before{content:"\f806"}.fa-hand-paper:before{content:"\f256"}.fa-hand-peace:before{content:"\f25b"}.fa-hand-point-down:before{content:"\f0a7"}.fa-hand-point-left:before{content:"\f0a5"}.fa-hand-point-right:before{content:"\f0a4"}.fa-hand-point-up:before{content:"\f0a6"}.fa-hand-pointer:before{content:"\f25a"}.fa-hand-rock:before{content:"\f255"}.fa-hand-scissors:before{content:"\f257"}.fa-hand-spock:before{content:"\f259"}.fa-hands:before{content:"\f4c2"}.fa-hands-helping:before{content:"\f4c4"}.fa-handshake:before{content:"\f2b5"}.fa-hanukiah:before{content:"\f6e6"}.fa-hard-hat:before{content:"\f807"}.fa-hashtag:before{content:"\f292"}.fa-hat-wizard:before{content:"\f6e8"}.fa-haykal:before{content:"\f666"}.fa-hdd:before{content:"\f0a0"}.fa-heading:before{content:"\f1dc"}.fa-headphones:before{content:"\f025"}.fa-headphones-alt:before{content:"\f58f"}.fa-headset:before{content:"\f590"}.fa-heart:before{content:"\f004"}.fa-heart-broken:before{content:"\f7a9"}.fa-heartbeat:before{content:"\f21e"}.fa-helicopter:before{content:"\f533"}.fa-highlighter:before{content:"\f591"}.fa-hiking:before{content:"\f6ec"}.fa-hippo:before{content:"\f6ed"}.fa-hips:before{content:"\f452"}.fa-hire-a-helper:before{content:"\f3b0"}.fa-history:before{content:"\f1da"}.fa-hockey-puck:before{content:"\f453"}.fa-holly-berry:before{content:"\f7aa"}.fa-home:before{content:"\f015"}.fa-hooli:before{content:"\f427"}.fa-hornbill:before{content:"\f592"}.fa-horse:before{content:"\f6f0"}.fa-horse-head:before{content:"\f7ab"}.fa-hospital:before{content:"\f0f8"}.fa-hospital-alt:before{content:"\f47d"}.fa-hospital-symbol:before{content:"\f47e"}.fa-hot-tub:before{content:"\f593"}.fa-hotdog:before{content:"\f80f"}.fa-hotel:before{content:"\f594"}.fa-hotjar:before{content:"\f3b1"}.fa-hourglass:before{content:"\f254"}.fa-hourglass-end:before{content:"\f253"}.fa-hourglass-half:before{content:"\f252"}.fa-hourglass-start:before{content:"\f251"}.fa-house-damage:before{content:"\f6f1"}.fa-houzz:before{content:"\f27c"}.fa-hryvnia:before{content:"\f6f2"}.fa-html5:before{content:"\f13b"}.fa-hubspot:before{content:"\f3b2"}.fa-i-cursor:before{content:"\f246"}.fa-ice-cream:before{content:"\f810"}.fa-icicles:before{content:"\f7ad"}.fa-icons:before{content:"\f86d"}.fa-id-badge:before{content:"\f2c1"}.fa-id-card:before{content:"\f2c2"}.fa-id-card-alt:before{content:"\f47f"}.fa-igloo:before{content:"\f7ae"}.fa-image:before{content:"\f03e"}.fa-images:before{content:"\f302"}.fa-imdb:before{content:"\f2d8"}.fa-inbox:before{content:"\f01c"}.fa-indent:before{content:"\f03c"}.fa-industry:before{content:"\f275"}.fa-infinity:before{content:"\f534"}.fa-info:before{content:"\f129"}.fa-info-circle:before{content:"\f05a"}.fa-instagram:before{content:"\f16d"}.fa-intercom:before{content:"\f7af"}.fa-internet-explorer:before{content:"\f26b"}.fa-invision:before{content:"\f7b0"}.fa-ioxhost:before{content:"\f208"}.fa-italic:before{content:"\f033"}.fa-itch-io:before{content:"\f83a"}.fa-itunes:before{content:"\f3b4"}.fa-itunes-note:before{content:"\f3b5"}.fa-java:before{content:"\f4e4"}.fa-jedi:before{content:"\f669"}.fa-jedi-order:before{content:"\f50e"}.fa-jenkins:before{content:"\f3b6"}.fa-jira:before{content:"\f7b1"}.fa-joget:before{content:"\f3b7"}.fa-joint:before{content:"\f595"}.fa-joomla:before{content:"\f1aa"}.fa-journal-whills:before{content:"\f66a"}.fa-js:before{content:"\f3b8"}.fa-js-square:before{content:"\f3b9"}.fa-jsfiddle:before{content:"\f1cc"}.fa-kaaba:before{content:"\f66b"}.fa-kaggle:before{content:"\f5fa"}.fa-key:before{content:"\f084"}.fa-keybase:before{content:"\f4f5"}.fa-keyboard:before{content:"\f11c"}.fa-keycdn:before{content:"\f3ba"}.fa-khanda:before{content:"\f66d"}.fa-kickstarter:before{content:"\f3bb"}.fa-kickstarter-k:before{content:"\f3bc"}.fa-kiss:before{content:"\f596"}.fa-kiss-beam:before{content:"\f597"}.fa-kiss-wink-heart:before{content:"\f598"}.fa-kiwi-bird:before{content:"\f535"}.fa-korvue:before{content:"\f42f"}.fa-landmark:before{content:"\f66f"}.fa-language:before{content:"\f1ab"}.fa-laptop:before{content:"\f109"}.fa-laptop-code:before{content:"\f5fc"}.fa-laptop-medical:before{content:"\f812"}.fa-laravel:before{content:"\f3bd"}.fa-lastfm:before{content:"\f202"}.fa-lastfm-square:before{content:"\f203"}.fa-laugh:before{content:"\f599"}.fa-laugh-beam:before{content:"\f59a"}.fa-laugh-squint:before{content:"\f59b"}.fa-laugh-wink:before{content:"\f59c"}.fa-layer-group:before{content:"\f5fd"}.fa-leaf:before{content:"\f06c"}.fa-leanpub:before{content:"\f212"}.fa-lemon:before{content:"\f094"}.fa-less:before{content:"\f41d"}.fa-less-than:before{content:"\f536"}.fa-less-than-equal:before{content:"\f537"}.fa-level-down-alt:before{content:"\f3be"}.fa-level-up-alt:before{content:"\f3bf"}.fa-life-ring:before{content:"\f1cd"}.fa-lightbulb:before{content:"\f0eb"}.fa-line:before{content:"\f3c0"}.fa-link:before{content:"\f0c1"}.fa-linkedin:before{content:"\f08c"}.fa-linkedin-in:before{content:"\f0e1"}.fa-linode:before{content:"\f2b8"}.fa-linux:before{content:"\f17c"}.fa-lira-sign:before{content:"\f195"}.fa-list:before{content:"\f03a"}.fa-list-alt:before{content:"\f022"}.fa-list-ol:before{content:"\f0cb"}.fa-list-ul:before{content:"\f0ca"}.fa-location-arrow:before{content:"\f124"}.fa-lock:before{content:"\f023"}.fa-lock-open:before{content:"\f3c1"}.fa-long-arrow-alt-down:before{content:"\f309"}.fa-long-arrow-alt-left:before{content:"\f30a"}.fa-long-arrow-alt-right:before{content:"\f30b"}.fa-long-arrow-alt-up:before{content:"\f30c"}.fa-low-vision:before{content:"\f2a8"}.fa-luggage-cart:before{content:"\f59d"}.fa-lyft:before{content:"\f3c3"}.fa-magento:before{content:"\f3c4"}.fa-magic:before{content:"\f0d0"}.fa-magnet:before{content:"\f076"}.fa-mail-bulk:before{content:"\f674"}.fa-mailchimp:before{content:"\f59e"}.fa-male:before{content:"\f183"}.fa-mandalorian:before{content:"\f50f"}.fa-map:before{content:"\f279"}.fa-map-marked:before{content:"\f59f"}.fa-map-marked-alt:before{content:"\f5a0"}.fa-map-marker:before{content:"\f041"}.fa-map-marker-alt:before{content:"\f3c5"}.fa-map-pin:before{content:"\f276"}.fa-map-signs:before{content:"\f277"}.fa-markdown:before{content:"\f60f"}.fa-marker:before{content:"\f5a1"}.fa-mars:before{content:"\f222"}.fa-mars-double:before{content:"\f227"}.fa-mars-stroke:before{content:"\f229"}.fa-mars-stroke-h:before{content:"\f22b"}.fa-mars-stroke-v:before{content:"\f22a"}.fa-mask:before{content:"\f6fa"}.fa-mastodon:before{content:"\f4f6"}.fa-maxcdn:before{content:"\f136"}.fa-medal:before{content:"\f5a2"}.fa-medapps:before{content:"\f3c6"}.fa-medium:before{content:"\f23a"}.fa-medium-m:before{content:"\f3c7"}.fa-medkit:before{content:"\f0fa"}.fa-medrt:before{content:"\f3c8"}.fa-meetup:before{content:"\f2e0"}.fa-megaport:before{content:"\f5a3"}.fa-meh:before{content:"\f11a"}.fa-meh-blank:before{content:"\f5a4"}.fa-meh-rolling-eyes:before{content:"\f5a5"}.fa-memory:before{content:"\f538"}.fa-mendeley:before{content:"\f7b3"}.fa-menorah:before{content:"\f676"}.fa-mercury:before{content:"\f223"}.fa-meteor:before{content:"\f753"}.fa-microchip:before{content:"\f2db"}.fa-microphone:before{content:"\f130"}.fa-microphone-alt:before{content:"\f3c9"}.fa-microphone-alt-slash:before{content:"\f539"}.fa-microphone-slash:before{content:"\f131"}.fa-microscope:before{content:"\f610"}.fa-microsoft:before{content:"\f3ca"}.fa-minus:before{content:"\f068"}.fa-minus-circle:before{content:"\f056"}.fa-minus-square:before{content:"\f146"}.fa-mitten:before{content:"\f7b5"}.fa-mix:before{content:"\f3cb"}.fa-mixcloud:before{content:"\f289"}.fa-mizuni:before{content:"\f3cc"}.fa-mobile:before{content:"\f10b"}.fa-mobile-alt:before{content:"\f3cd"}.fa-modx:before{content:"\f285"}.fa-monero:before{content:"\f3d0"}.fa-money-bill:before{content:"\f0d6"}.fa-money-bill-alt:before{content:"\f3d1"}.fa-money-bill-wave:before{content:"\f53a"}.fa-money-bill-wave-alt:before{content:"\f53b"}.fa-money-check:before{content:"\f53c"}.fa-money-check-alt:before{content:"\f53d"}.fa-monument:before{content:"\f5a6"}.fa-moon:before{content:"\f186"}.fa-mortar-pestle:before{content:"\f5a7"}.fa-mosque:before{content:"\f678"}.fa-motorcycle:before{content:"\f21c"}.fa-mountain:before{content:"\f6fc"}.fa-mouse-pointer:before{content:"\f245"}.fa-mug-hot:before{content:"\f7b6"}.fa-music:before{content:"\f001"}.fa-napster:before{content:"\f3d2"}.fa-neos:before{content:"\f612"}.fa-network-wired:before{content:"\f6ff"}.fa-neuter:before{content:"\f22c"}.fa-newspaper:before{content:"\f1ea"}.fa-nimblr:before{content:"\f5a8"}.fa-node:before{content:"\f419"}.fa-node-js:before{content:"\f3d3"}.fa-not-equal:before{content:"\f53e"}.fa-notes-medical:before{content:"\f481"}.fa-npm:before{content:"\f3d4"}.fa-ns8:before{content:"\f3d5"}.fa-nutritionix:before{content:"\f3d6"}.fa-object-group:before{content:"\f247"}.fa-object-ungroup:before{content:"\f248"}.fa-odnoklassniki:before{content:"\f263"}.fa-odnoklassniki-square:before{content:"\f264"}.fa-oil-can:before{content:"\f613"}.fa-old-republic:before{content:"\f510"}.fa-om:before{content:"\f679"}.fa-opencart:before{content:"\f23d"}.fa-openid:before{content:"\f19b"}.fa-opera:before{content:"\f26a"}.fa-optin-monster:before{content:"\f23c"}.fa-osi:before{content:"\f41a"}.fa-otter:before{content:"\f700"}.fa-outdent:before{content:"\f03b"}.fa-page4:before{content:"\f3d7"}.fa-pagelines:before{content:"\f18c"}.fa-pager:before{content:"\f815"}.fa-paint-brush:before{content:"\f1fc"}.fa-paint-roller:before{content:"\f5aa"}.fa-palette:before{content:"\f53f"}.fa-palfed:before{content:"\f3d8"}.fa-pallet:before{content:"\f482"}.fa-paper-plane:before{content:"\f1d8"}.fa-paperclip:before{content:"\f0c6"}.fa-parachute-box:before{content:"\f4cd"}.fa-paragraph:before{content:"\f1dd"}.fa-parking:before{content:"\f540"}.fa-passport:before{content:"\f5ab"}.fa-pastafarianism:before{content:"\f67b"}.fa-paste:before{content:"\f0ea"}.fa-patreon:before{content:"\f3d9"}.fa-pause:before{content:"\f04c"}.fa-pause-circle:before{content:"\f28b"}.fa-paw:before{content:"\f1b0"}.fa-paypal:before{content:"\f1ed"}.fa-peace:before{content:"\f67c"}.fa-pen:before{content:"\f304"}.fa-pen-alt:before{content:"\f305"}.fa-pen-fancy:before{content:"\f5ac"}.fa-pen-nib:before{content:"\f5ad"}.fa-pen-square:before{content:"\f14b"}.fa-pencil-alt:before{content:"\f303"}.fa-pencil-ruler:before{content:"\f5ae"}.fa-penny-arcade:before{content:"\f704"}.fa-people-carry:before{content:"\f4ce"}.fa-pepper-hot:before{content:"\f816"}.fa-percent:before{content:"\f295"}.fa-percentage:before{content:"\f541"}.fa-periscope:before{content:"\f3da"}.fa-person-booth:before{content:"\f756"}.fa-phabricator:before{content:"\f3db"}.fa-phoenix-framework:before{content:"\f3dc"}.fa-phoenix-squadron:before{content:"\f511"}.fa-phone:before{content:"\f095"}.fa-phone-alt:before{content:"\f879"}.fa-phone-slash:before{content:"\f3dd"}.fa-phone-square:before{content:"\f098"}.fa-phone-square-alt:before{content:"\f87b"}.fa-phone-volume:before{content:"\f2a0"}.fa-photo-video:before{content:"\f87c"}.fa-php:before{content:"\f457"}.fa-pied-piper:before{content:"\f2ae"}.fa-pied-piper-alt:before{content:"\f1a8"}.fa-pied-piper-hat:before{content:"\f4e5"}.fa-pied-piper-pp:before{content:"\f1a7"}.fa-piggy-bank:before{content:"\f4d3"}.fa-pills:before{content:"\f484"}.fa-pinterest:before{content:"\f0d2"}.fa-pinterest-p:before{content:"\f231"}.fa-pinterest-square:before{content:"\f0d3"}.fa-pizza-slice:before{content:"\f818"}.fa-place-of-worship:before{content:"\f67f"}.fa-plane:before{content:"\f072"}.fa-plane-arrival:before{content:"\f5af"}.fa-plane-departure:before{content:"\f5b0"}.fa-play:before{content:"\f04b"}.fa-play-circle:before{content:"\f144"}.fa-playstation:before{content:"\f3df"}.fa-plug:before{content:"\f1e6"}.fa-plus:before{content:"\f067"}.fa-plus-circle:before{content:"\f055"}.fa-plus-square:before{content:"\f0fe"}.fa-podcast:before{content:"\f2ce"}.fa-poll:before{content:"\f681"}.fa-poll-h:before{content:"\f682"}.fa-poo:before{content:"\f2fe"}.fa-poo-storm:before{content:"\f75a"}.fa-poop:before{content:"\f619"}.fa-portrait:before{content:"\f3e0"}.fa-pound-sign:before{content:"\f154"}.fa-power-off:before{content:"\f011"}.fa-pray:before{content:"\f683"}.fa-praying-hands:before{content:"\f684"}.fa-prescription:before{content:"\f5b1"}.fa-prescription-bottle:before{content:"\f485"}.fa-prescription-bottle-alt:before{content:"\f486"}.fa-print:before{content:"\f02f"}.fa-procedures:before{content:"\f487"}.fa-product-hunt:before{content:"\f288"}.fa-project-diagram:before{content:"\f542"}.fa-pushed:before{content:"\f3e1"}.fa-puzzle-piece:before{content:"\f12e"}.fa-python:before{content:"\f3e2"}.fa-qq:before{content:"\f1d6"}.fa-qrcode:before{content:"\f029"}.fa-question:before{content:"\f128"}.fa-question-circle:before{content:"\f059"}.fa-quidditch:before{content:"\f458"}.fa-quinscape:before{content:"\f459"}.fa-quora:before{content:"\f2c4"}.fa-quote-left:before{content:"\f10d"}.fa-quote-right:before{content:"\f10e"}.fa-quran:before{content:"\f687"}.fa-r-project:before{content:"\f4f7"}.fa-radiation:before{content:"\f7b9"}.fa-radiation-alt:before{content:"\f7ba"}.fa-rainbow:before{content:"\f75b"}.fa-random:before{content:"\f074"}.fa-raspberry-pi:before{content:"\f7bb"}.fa-ravelry:before{content:"\f2d9"}.fa-react:before{content:"\f41b"}.fa-reacteurope:before{content:"\f75d"}.fa-readme:before{content:"\f4d5"}.fa-rebel:before{content:"\f1d0"}.fa-receipt:before{content:"\f543"}.fa-recycle:before{content:"\f1b8"}.fa-red-river:before{content:"\f3e3"}.fa-reddit:before{content:"\f1a1"}.fa-reddit-alien:before{content:"\f281"}.fa-reddit-square:before{content:"\f1a2"}.fa-redhat:before{content:"\f7bc"}.fa-redo:before{content:"\f01e"}.fa-redo-alt:before{content:"\f2f9"}.fa-registered:before{content:"\f25d"}.fa-remove-format:before{content:"\f87d"}.fa-renren:before{content:"\f18b"}.fa-reply:before{content:"\f3e5"}.fa-reply-all:before{content:"\f122"}.fa-replyd:before{content:"\f3e6"}.fa-republican:before{content:"\f75e"}.fa-researchgate:before{content:"\f4f8"}.fa-resolving:before{content:"\f3e7"}.fa-restroom:before{content:"\f7bd"}.fa-retweet:before{content:"\f079"}.fa-rev:before{content:"\f5b2"}.fa-ribbon:before{content:"\f4d6"}.fa-ring:before{content:"\f70b"}.fa-road:before{content:"\f018"}.fa-robot:before{content:"\f544"}.fa-rocket:before{content:"\f135"}.fa-rocketchat:before{content:"\f3e8"}.fa-rockrms:before{content:"\f3e9"}.fa-route:before{content:"\f4d7"}.fa-rss:before{content:"\f09e"}.fa-rss-square:before{content:"\f143"}.fa-ruble-sign:before{content:"\f158"}.fa-ruler:before{content:"\f545"}.fa-ruler-combined:before{content:"\f546"}.fa-ruler-horizontal:before{content:"\f547"}.fa-ruler-vertical:before{content:"\f548"}.fa-running:before{content:"\f70c"}.fa-rupee-sign:before{content:"\f156"}.fa-sad-cry:before{content:"\f5b3"}.fa-sad-tear:before{content:"\f5b4"}.fa-safari:before{content:"\f267"}.fa-salesforce:before{content:"\f83b"}.fa-sass:before{content:"\f41e"}.fa-satellite:before{content:"\f7bf"}.fa-satellite-dish:before{content:"\f7c0"}.fa-save:before{content:"\f0c7"}.fa-schlix:before{content:"\f3ea"}.fa-school:before{content:"\f549"}.fa-screwdriver:before{content:"\f54a"}.fa-scribd:before{content:"\f28a"}.fa-scroll:before{content:"\f70e"}.fa-sd-card:before{content:"\f7c2"}.fa-search:before{content:"\f002"}.fa-search-dollar:before{content:"\f688"}.fa-search-location:before{content:"\f689"}.fa-search-minus:before{content:"\f010"}.fa-search-plus:before{content:"\f00e"}.fa-searchengin:before{content:"\f3eb"}.fa-seedling:before{content:"\f4d8"}.fa-sellcast:before{content:"\f2da"}.fa-sellsy:before{content:"\f213"}.fa-server:before{content:"\f233"}.fa-servicestack:before{content:"\f3ec"}.fa-shapes:before{content:"\f61f"}.fa-share:before{content:"\f064"}.fa-share-alt:before{content:"\f1e0"}.fa-share-alt-square:before{content:"\f1e1"}.fa-share-square:before{content:"\f14d"}.fa-shekel-sign:before{content:"\f20b"}.fa-shield-alt:before{content:"\f3ed"}.fa-ship:before{content:"\f21a"}.fa-shipping-fast:before{content:"\f48b"}.fa-shirtsinbulk:before{content:"\f214"}.fa-shoe-prints:before{content:"\f54b"}.fa-shopping-bag:before{content:"\f290"}.fa-shopping-basket:before{content:"\f291"}.fa-shopping-cart:before{content:"\f07a"}.fa-shopware:before{content:"\f5b5"}.fa-shower:before{content:"\f2cc"}.fa-shuttle-van:before{content:"\f5b6"}.fa-sign:before{content:"\f4d9"}.fa-sign-in-alt:before{content:"\f2f6"}.fa-sign-language:before{content:"\f2a7"}.fa-sign-out-alt:before{content:"\f2f5"}.fa-signal:before{content:"\f012"}.fa-signature:before{content:"\f5b7"}.fa-sim-card:before{content:"\f7c4"}.fa-simplybuilt:before{content:"\f215"}.fa-sistrix:before{content:"\f3ee"}.fa-sitemap:before{content:"\f0e8"}.fa-sith:before{content:"\f512"}.fa-skating:before{content:"\f7c5"}.fa-sketch:before{content:"\f7c6"}.fa-skiing:before{content:"\f7c9"}.fa-skiing-nordic:before{content:"\f7ca"}.fa-skull:before{content:"\f54c"}.fa-skull-crossbones:before{content:"\f714"}.fa-skyatlas:before{content:"\f216"}.fa-skype:before{content:"\f17e"}.fa-slack:before{content:"\f198"}.fa-slack-hash:before{content:"\f3ef"}.fa-slash:before{content:"\f715"}.fa-sleigh:before{content:"\f7cc"}.fa-sliders-h:before{content:"\f1de"}.fa-slideshare:before{content:"\f1e7"}.fa-smile:before{content:"\f118"}.fa-smile-beam:before{content:"\f5b8"}.fa-smile-wink:before{content:"\f4da"}.fa-smog:before{content:"\f75f"}.fa-smoking:before{content:"\f48d"}.fa-smoking-ban:before{content:"\f54d"}.fa-sms:before{content:"\f7cd"}.fa-snapchat:before{content:"\f2ab"}.fa-snapchat-ghost:before{content:"\f2ac"}.fa-snapchat-square:before{content:"\f2ad"}.fa-snowboarding:before{content:"\f7ce"}.fa-snowflake:before{content:"\f2dc"}.fa-snowman:before{content:"\f7d0"}.fa-snowplow:before{content:"\f7d2"}.fa-socks:before{content:"\f696"}.fa-solar-panel:before{content:"\f5ba"}.fa-sort:before{content:"\f0dc"}.fa-sort-alpha-down:before{content:"\f15d"}.fa-sort-alpha-down-alt:before{content:"\f881"}.fa-sort-alpha-up:before{content:"\f15e"}.fa-sort-alpha-up-alt:before{content:"\f882"}.fa-sort-amount-down:before{content:"\f160"}.fa-sort-amount-down-alt:before{content:"\f884"}.fa-sort-amount-up:before{content:"\f161"}.fa-sort-amount-up-alt:before{content:"\f885"}.fa-sort-down:before{content:"\f0dd"}.fa-sort-numeric-down:before{content:"\f162"}.fa-sort-numeric-down-alt:before{content:"\f886"}.fa-sort-numeric-up:before{content:"\f163"}.fa-sort-numeric-up-alt:before{content:"\f887"}.fa-sort-up:before{content:"\f0de"}.fa-soundcloud:before{content:"\f1be"}.fa-sourcetree:before{content:"\f7d3"}.fa-spa:before{content:"\f5bb"}.fa-space-shuttle:before{content:"\f197"}.fa-speakap:before{content:"\f3f3"}.fa-speaker-deck:before{content:"\f83c"}.fa-spell-check:before{content:"\f891"}.fa-spider:before{content:"\f717"}.fa-spinner:before{content:"\f110"}.fa-splotch:before{content:"\f5bc"}.fa-spotify:before{content:"\f1bc"}.fa-spray-can:before{content:"\f5bd"}.fa-square:before{content:"\f0c8"}.fa-square-full:before{content:"\f45c"}.fa-square-root-alt:before{content:"\f698"}.fa-squarespace:before{content:"\f5be"}.fa-stack-exchange:before{content:"\f18d"}.fa-stack-overflow:before{content:"\f16c"}.fa-stackpath:before{content:"\f842"}.fa-stamp:before{content:"\f5bf"}.fa-star:before{content:"\f005"}.fa-star-and-crescent:before{content:"\f699"}.fa-star-half:before{content:"\f089"}.fa-star-half-alt:before{content:"\f5c0"}.fa-star-of-david:before{content:"\f69a"}.fa-star-of-life:before{content:"\f621"}.fa-staylinked:before{content:"\f3f5"}.fa-steam:before{content:"\f1b6"}.fa-steam-square:before{content:"\f1b7"}.fa-steam-symbol:before{content:"\f3f6"}.fa-step-backward:before{content:"\f048"}.fa-step-forward:before{content:"\f051"}.fa-stethoscope:before{content:"\f0f1"}.fa-sticker-mule:before{content:"\f3f7"}.fa-sticky-note:before{content:"\f249"}.fa-stop:before{content:"\f04d"}.fa-stop-circle:before{content:"\f28d"}.fa-stopwatch:before{content:"\f2f2"}.fa-store:before{content:"\f54e"}.fa-store-alt:before{content:"\f54f"}.fa-strava:before{content:"\f428"}.fa-stream:before{content:"\f550"}.fa-street-view:before{content:"\f21d"}.fa-strikethrough:before{content:"\f0cc"}.fa-stripe:before{content:"\f429"}.fa-stripe-s:before{content:"\f42a"}.fa-stroopwafel:before{content:"\f551"}.fa-studiovinari:before{content:"\f3f8"}.fa-stumbleupon:before{content:"\f1a4"}.fa-stumbleupon-circle:before{content:"\f1a3"}.fa-subscript:before{content:"\f12c"}.fa-subway:before{content:"\f239"}.fa-suitcase:before{content:"\f0f2"}.fa-suitcase-rolling:before{content:"\f5c1"}.fa-sun:before{content:"\f185"}.fa-superpowers:before{content:"\f2dd"}.fa-superscript:before{content:"\f12b"}.fa-supple:before{content:"\f3f9"}.fa-surprise:before{content:"\f5c2"}.fa-suse:before{content:"\f7d6"}.fa-swatchbook:before{content:"\f5c3"}.fa-swimmer:before{content:"\f5c4"}.fa-swimming-pool:before{content:"\f5c5"}.fa-symfony:before{content:"\f83d"}.fa-synagogue:before{content:"\f69b"}.fa-sync:before{content:"\f021"}.fa-sync-alt:before{content:"\f2f1"}.fa-syringe:before{content:"\f48e"}.fa-table:before{content:"\f0ce"}.fa-table-tennis:before{content:"\f45d"}.fa-tablet:before{content:"\f10a"}.fa-tablet-alt:before{content:"\f3fa"}.fa-tablets:before{content:"\f490"}.fa-tachometer-alt:before{content:"\f3fd"}.fa-tag:before{content:"\f02b"}.fa-tags:before{content:"\f02c"}.fa-tape:before{content:"\f4db"}.fa-tasks:before{content:"\f0ae"}.fa-taxi:before{content:"\f1ba"}.fa-teamspeak:before{content:"\f4f9"}.fa-teeth:before{content:"\f62e"}.fa-teeth-open:before{content:"\f62f"}.fa-telegram:before{content:"\f2c6"}.fa-telegram-plane:before{content:"\f3fe"}.fa-temperature-high:before{content:"\f769"}.fa-temperature-low:before{content:"\f76b"}.fa-tencent-weibo:before{content:"\f1d5"}.fa-tenge:before{content:"\f7d7"}.fa-terminal:before{content:"\f120"}.fa-text-height:before{content:"\f034"}.fa-text-width:before{content:"\f035"}.fa-th:before{content:"\f00a"}.fa-th-large:before{content:"\f009"}.fa-th-list:before{content:"\f00b"}.fa-the-red-yeti:before{content:"\f69d"}.fa-theater-masks:before{content:"\f630"}.fa-themeco:before{content:"\f5c6"}.fa-themeisle:before{content:"\f2b2"}.fa-thermometer:before{content:"\f491"}.fa-thermometer-empty:before{content:"\f2cb"}.fa-thermometer-full:before{content:"\f2c7"}.fa-thermometer-half:before{content:"\f2c9"}.fa-thermometer-quarter:before{content:"\f2ca"}.fa-thermometer-three-quarters:before{content:"\f2c8"}.fa-think-peaks:before{content:"\f731"}.fa-thumbs-down:before{content:"\f165"}.fa-thumbs-up:before{content:"\f164"}.fa-thumbtack:before{content:"\f08d"}.fa-ticket-alt:before{content:"\f3ff"}.fa-times:before{content:"\f00d"}.fa-times-circle:before{content:"\f057"}.fa-tint:before{content:"\f043"}.fa-tint-slash:before{content:"\f5c7"}.fa-tired:before{content:"\f5c8"}.fa-toggle-off:before{content:"\f204"}.fa-toggle-on:before{content:"\f205"}.fa-toilet:before{content:"\f7d8"}.fa-toilet-paper:before{content:"\f71e"}.fa-toolbox:before{content:"\f552"}.fa-tools:before{content:"\f7d9"}.fa-tooth:before{content:"\f5c9"}.fa-torah:before{content:"\f6a0"}.fa-torii-gate:before{content:"\f6a1"}.fa-tractor:before{content:"\f722"}.fa-trade-federation:before{content:"\f513"}.fa-trademark:before{content:"\f25c"}.fa-traffic-light:before{content:"\f637"}.fa-train:before{content:"\f238"}.fa-tram:before{content:"\f7da"}.fa-transgender:before{content:"\f224"}.fa-transgender-alt:before{content:"\f225"}.fa-trash:before{content:"\f1f8"}.fa-trash-alt:before{content:"\f2ed"}.fa-trash-restore:before{content:"\f829"}.fa-trash-restore-alt:before{content:"\f82a"}.fa-tree:before{content:"\f1bb"}.fa-trello:before{content:"\f181"}.fa-tripadvisor:before{content:"\f262"}.fa-trophy:before{content:"\f091"}.fa-truck:before{content:"\f0d1"}.fa-truck-loading:before{content:"\f4de"}.fa-truck-monster:before{content:"\f63b"}.fa-truck-moving:before{content:"\f4df"}.fa-truck-pickup:before{content:"\f63c"}.fa-tshirt:before{content:"\f553"}.fa-tty:before{content:"\f1e4"}.fa-tumblr:before{content:"\f173"}.fa-tumblr-square:before{content:"\f174"}.fa-tv:before{content:"\f26c"}.fa-twitch:before{content:"\f1e8"}.fa-twitter:before{content:"\f099"}.fa-twitter-square:before{content:"\f081"}.fa-typo3:before{content:"\f42b"}.fa-uber:before{content:"\f402"}.fa-ubuntu:before{content:"\f7df"}.fa-uikit:before{content:"\f403"}.fa-umbrella:before{content:"\f0e9"}.fa-umbrella-beach:before{content:"\f5ca"}.fa-underline:before{content:"\f0cd"}.fa-undo:before{content:"\f0e2"}.fa-undo-alt:before{content:"\f2ea"}.fa-uniregistry:before{content:"\f404"}.fa-universal-access:before{content:"\f29a"}.fa-university:before{content:"\f19c"}.fa-unlink:before{content:"\f127"}.fa-unlock:before{content:"\f09c"}.fa-unlock-alt:before{content:"\f13e"}.fa-untappd:before{content:"\f405"}.fa-upload:before{content:"\f093"}.fa-ups:before{content:"\f7e0"}.fa-usb:before{content:"\f287"}.fa-user:before{content:"\f007"}.fa-user-alt:before{content:"\f406"}.fa-user-alt-slash:before{content:"\f4fa"}.fa-user-astronaut:before{content:"\f4fb"}.fa-user-check:before{content:"\f4fc"}.fa-user-circle:before{content:"\f2bd"}.fa-user-clock:before{content:"\f4fd"}.fa-user-cog:before{content:"\f4fe"}.fa-user-edit:before{content:"\f4ff"}.fa-user-friends:before{content:"\f500"}.fa-user-graduate:before{content:"\f501"}.fa-user-injured:before{content:"\f728"}.fa-user-lock:before{content:"\f502"}.fa-user-md:before{content:"\f0f0"}.fa-user-minus:before{content:"\f503"}.fa-user-ninja:before{content:"\f504"}.fa-user-nurse:before{content:"\f82f"}.fa-user-plus:before{content:"\f234"}.fa-user-secret:before{content:"\f21b"}.fa-user-shield:before{content:"\f505"}.fa-user-slash:before{content:"\f506"}.fa-user-tag:before{content:"\f507"}.fa-user-tie:before{content:"\f508"}.fa-user-times:before{content:"\f235"}.fa-users:before{content:"\f0c0"}.fa-users-cog:before{content:"\f509"}.fa-usps:before{content:"\f7e1"}.fa-ussunnah:before{content:"\f407"}.fa-utensil-spoon:before{content:"\f2e5"}.fa-utensils:before{content:"\f2e7"}.fa-vaadin:before{content:"\f408"}.fa-vector-square:before{content:"\f5cb"}.fa-venus:before{content:"\f221"}.fa-venus-double:before{content:"\f226"}.fa-venus-mars:before{content:"\f228"}.fa-viacoin:before{content:"\f237"}.fa-viadeo:before{content:"\f2a9"}.fa-viadeo-square:before{content:"\f2aa"}.fa-vial:before{content:"\f492"}.fa-vials:before{content:"\f493"}.fa-viber:before{content:"\f409"}.fa-video:before{content:"\f03d"}.fa-video-slash:before{content:"\f4e2"}.fa-vihara:before{content:"\f6a7"}.fa-vimeo:before{content:"\f40a"}.fa-vimeo-square:before{content:"\f194"}.fa-vimeo-v:before{content:"\f27d"}.fa-vine:before{content:"\f1ca"}.fa-vk:before{content:"\f189"}.fa-vnv:before{content:"\f40b"}.fa-voicemail:before{content:"\f897"}.fa-volleyball-ball:before{content:"\f45f"}.fa-volume-down:before{content:"\f027"}.fa-volume-mute:before{content:"\f6a9"}.fa-volume-off:before{content:"\f026"}.fa-volume-up:before{content:"\f028"}.fa-vote-yea:before{content:"\f772"}.fa-vr-cardboard:before{content:"\f729"}.fa-vuejs:before{content:"\f41f"}.fa-walking:before{content:"\f554"}.fa-wallet:before{content:"\f555"}.fa-warehouse:before{content:"\f494"}.fa-water:before{content:"\f773"}.fa-wave-square:before{content:"\f83e"}.fa-waze:before{content:"\f83f"}.fa-weebly:before{content:"\f5cc"}.fa-weibo:before{content:"\f18a"}.fa-weight:before{content:"\f496"}.fa-weight-hanging:before{content:"\f5cd"}.fa-weixin:before{content:"\f1d7"}.fa-whatsapp:before{content:"\f232"}.fa-whatsapp-square:before{content:"\f40c"}.fa-wheelchair:before{content:"\f193"}.fa-whmcs:before{content:"\f40d"}.fa-wifi:before{content:"\f1eb"}.fa-wikipedia-w:before{content:"\f266"}.fa-wind:before{content:"\f72e"}.fa-window-close:before{content:"\f410"}.fa-window-maximize:before{content:"\f2d0"}.fa-window-minimize:before{content:"\f2d1"}.fa-window-restore:before{content:"\f2d2"}.fa-windows:before{content:"\f17a"}.fa-wine-bottle:before{content:"\f72f"}.fa-wine-glass:before{content:"\f4e3"}.fa-wine-glass-alt:before{content:"\f5ce"}.fa-wix:before{content:"\f5cf"}.fa-wizards-of-the-coast:before{content:"\f730"}.fa-wolf-pack-battalion:before{content:"\f514"}.fa-won-sign:before{content:"\f159"}.fa-wordpress:before{content:"\f19a"}.fa-wordpress-simple:before{content:"\f411"}.fa-wpbeginner:before{content:"\f297"}.fa-wpexplorer:before{content:"\f2de"}.fa-wpforms:before{content:"\f298"}.fa-wpressr:before{content:"\f3e4"}.fa-wrench:before{content:"\f0ad"}.fa-x-ray:before{content:"\f497"}.fa-xbox:before{content:"\f412"}.fa-xing:before{content:"\f168"}.fa-xing-square:before{content:"\f169"}.fa-y-combinator:before{content:"\f23b"}.fa-yahoo:before{content:"\f19e"}.fa-yammer:before{content:"\f840"}.fa-yandex:before{content:"\f413"}.fa-yandex-international:before{content:"\f414"}.fa-yarn:before{content:"\f7e3"}.fa-yelp:before{content:"\f1e9"}.fa-yen-sign:before{content:"\f157"}.fa-yin-yang:before{content:"\f6ad"}.fa-yoast:before{content:"\f2b1"}.fa-youtube:before{content:"\f167"}.fa-youtube-square:before{content:"\f431"}.fa-zhihu:before{content:"\f63f"}.sr-only{border:0;clip:rect(0,0,0,0);height:1px;margin:-1px;overflow:hidden;padding:0;position:absolute;width:1px}.sr-only-focusable:active,.sr-only-focusable:focus{clip:auto;height:auto;margin:0;overflow:visible;position:static;width:auto}/*!* Font Awesome Free 5.10.1 by @fontawesome - https://fontawesome.com +* License - https://fontawesome.com/license/free (Icons: CC BY 4.0, Fonts: SIL OFL 1.1, Code: MIT License)*/@font-face{font-family:'font awesome 5 free';font-style:normal;font-weight:900;font-display:auto;src:url(../webfonts/fa-solid-900.eot);src:url(../webfonts/fa-solid-900.eot?#iefix) format("embedded-opentype"),url(../webfonts/fa-solid-900.woff2) format("woff2"),url(../webfonts/fa-solid-900.woff) format("woff"),url(../webfonts/fa-solid-900.ttf) format("truetype"),url(../webfonts/fa-solid-900.svg#fontawesome) format("svg")}.fa,.fas{font-family:'font awesome 5 free';font-weight:900}/*!* Font Awesome Free 5.10.1 by @fontawesome - https://fontawesome.com +* License - https://fontawesome.com/license/free (Icons: CC BY 4.0, Fonts: SIL OFL 1.1, Code: MIT License)*/@font-face{font-family:'font awesome 5 brands';font-style:normal;font-weight:400;font-display:auto;src:url(../webfonts/fa-brands-400.eot);src:url(../webfonts/fa-brands-400.eot?#iefix) format("embedded-opentype"),url(../webfonts/fa-brands-400.woff2) format("woff2"),url(../webfonts/fa-brands-400.woff) format("woff"),url(../webfonts/fa-brands-400.ttf) format("truetype"),url(../webfonts/fa-brands-400.svg#fontawesome) format("svg")}.fab{font-family:'font awesome 5 brands'}.td-border-top{border:none;border-top:1px solid #eee}.td-border-none{border:none}.td-block-padding,.td-default main section{padding-top:4rem;padding-bottom:4rem}@media(min-width:768px){.td-block-padding,.td-default main section{padding-top:5rem;padding-bottom:5rem}}.td-overlay{position:relative}.td-overlay::after{content:"";position:absolute;top:0;right:0;bottom:0;left:0}.td-overlay--dark::after{background-color:rgba(64,63,76,.3)}.td-overlay--light::after{background-color:rgba(211,243,238,.3)}.td-overlay__inner{position:relative;z-index:1}@media(min-width:992px){.td-max-width-on-larger-screens,.td-content>pre,.td-content>.highlight,.td-content>.lead,.td-content>h1,.td-content>h2,.td-content>ul,.td-content>ol,.td-content>p,.td-content>blockquote,.td-content>dl dd,.td-content .footnotes,.td-content>.alert{max-width:80%}}.td-box--height-min{min-height:300px}.td-box--height-med{min-height:400px}.td-box--height-max{min-height:500px}.td-box--height-full{min-height:100vh}@media(min-width:768px){.td-box--height-min{min-height:450px}.td-box--height-med{min-height:500px}.td-box--height-max{min-height:650px}}.td-box .row.section{padding-left:5rem;padding-right:5rem;-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column}.td-box .row{padding-left:5rem;padding-right:5rem;-webkit-box-orient:horizontal;-webkit-box-direction:normal;-webkit-flex-direction:row;-ms-flex-direction:row;flex-direction:row}.td-box.linkbox{padding:5rem}.td-box--0{color:#fff;background-color:#403f4c}.td-box--0 .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#403f4c transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--0 p>a{color:#d9e5f8}.td-box--10.td-box--gradient{background:#403F4C -webkit-gradient(linear,left top,left bottom,from(#5d5c67),to(#403F4C)) repeat-x!important;background:#403f4c -webkit-linear-gradient(top,#5d5c67,#403F4C) repeat-x!important;background:#403f4c -o-linear-gradient(top,#5d5c67,#403F4C) repeat-x!important;background:#403f4c linear-gradient(180deg,#5d5c67,#403F4C) repeat-x!important}.td-box--1{color:#fff;background-color:#30638e}.td-box--1 .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#30638e transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--1 p>a{color:#cadcf5}.td-box--11.td-box--gradient{background:#30638E -webkit-gradient(linear,left top,left bottom,from(#4f7a9f),to(#30638E)) repeat-x!important;background:#30638e -webkit-linear-gradient(top,#4f7a9f,#30638E) repeat-x!important;background:#30638e -o-linear-gradient(top,#4f7a9f,#30638E) repeat-x!important;background:#30638e linear-gradient(180deg,#4f7a9f,#30638E) repeat-x!important}.td-box--2{color:#fff;background-color:#ffa630}.td-box--2 .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#ffa630 transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--2 p>a{color:#abc7f0}.td-box--12.td-box--gradient{background:#FFA630 -webkit-gradient(linear,left top,left bottom,from(#ffb34f),to(#FFA630)) repeat-x!important;background:#ffa630 -webkit-linear-gradient(top,#ffb34f,#FFA630) repeat-x!important;background:#ffa630 -o-linear-gradient(top,#ffb34f,#FFA630) repeat-x!important;background:#ffa630 linear-gradient(180deg,#ffb34f,#FFA630) repeat-x!important}.td-box--3{color:#222;background-color:#c0e0de}.td-box--3 .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#c0e0de transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--3 p>a{color:#638ac1}.td-box--13.td-box--gradient{background:#C0E0DE -webkit-gradient(linear,left top,left bottom,from(#c9e5e3),to(#C0E0DE)) repeat-x!important;background:#c0e0de -webkit-linear-gradient(top,#c9e5e3,#C0E0DE) repeat-x!important;background:#c0e0de -o-linear-gradient(top,#c9e5e3,#C0E0DE) repeat-x!important;background:#c0e0de linear-gradient(180deg,#c9e5e3,#C0E0DE) repeat-x!important}.td-box--4{color:#222;background-color:#fff}.td-box--4 .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#fff transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--4 p>a{color:#72a1e5}.td-box--14.td-box--gradient{background:white -webkit-gradient(linear,left top,left bottom,from(white),to(white)) repeat-x!important;background:#fff -webkit-linear-gradient(top,white,white) repeat-x!important;background:#fff -o-linear-gradient(top,white,white) repeat-x!important;background:#fff linear-gradient(180deg,white,white) repeat-x!important}.td-box--5{color:#fff;background-color:#888}.td-box--5 .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#888 transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--5 p>a{color:#b4cdf1}.td-box--15.td-box--gradient{background:#888 -webkit-gradient(linear,left top,left bottom,from(#9a9a9a),to(#888)) repeat-x!important;background:#888 -webkit-linear-gradient(top,#9a9a9a,#888) repeat-x!important;background:#888 -o-linear-gradient(top,#9a9a9a,#888) repeat-x!important;background:#888 linear-gradient(180deg,#9a9a9a,#888) repeat-x!important}.td-box--6{color:#fff;background-color:#3772ff}.td-box--6 .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#3772ff transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--6 p>a{color:#a9c6ef}.td-box--16.td-box--gradient{background:#3772FF -webkit-gradient(linear,left top,left bottom,from(#5587ff),to(#3772FF)) repeat-x!important;background:#3772ff -webkit-linear-gradient(top,#5587ff,#3772FF) repeat-x!important;background:#3772ff -o-linear-gradient(top,#5587ff,#3772FF) repeat-x!important;background:#3772ff linear-gradient(180deg,#5587ff,#3772FF) repeat-x!important}.td-box--7{color:#fff;background-color:#ed6a5a}.td-box--7 .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#ed6a5a transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--7 p>a{color:#a5c3ee}.td-box--17.td-box--gradient{background:#ED6A5A -webkit-gradient(linear,left top,left bottom,from(#f08073),to(#ED6A5A)) repeat-x!important;background:#ed6a5a -webkit-linear-gradient(top,#f08073,#ED6A5A) repeat-x!important;background:#ed6a5a -o-linear-gradient(top,#f08073,#ED6A5A) repeat-x!important;background:#ed6a5a linear-gradient(180deg,#f08073,#ED6A5A) repeat-x!important}.td-box--8{color:#fff;background-color:#403f4c}.td-box--8 .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#403f4c transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--8 p>a{color:#d9e5f8}.td-box--18.td-box--gradient{background:#403F4C -webkit-gradient(linear,left top,left bottom,from(#5d5c67),to(#403F4C)) repeat-x!important;background:#403f4c -webkit-linear-gradient(top,#5d5c67,#403F4C) repeat-x!important;background:#403f4c -o-linear-gradient(top,#5d5c67,#403F4C) repeat-x!important;background:#403f4c linear-gradient(180deg,#5d5c67,#403F4C) repeat-x!important}.td-box--9{color:#fff;background-color:#ed6a5a}.td-box--9 .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#ed6a5a transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--9 p>a{color:#a5c3ee}.td-box--19.td-box--gradient{background:#ED6A5A -webkit-gradient(linear,left top,left bottom,from(#f08073),to(#ED6A5A)) repeat-x!important;background:#ed6a5a -webkit-linear-gradient(top,#f08073,#ED6A5A) repeat-x!important;background:#ed6a5a -o-linear-gradient(top,#f08073,#ED6A5A) repeat-x!important;background:#ed6a5a linear-gradient(180deg,#f08073,#ED6A5A) repeat-x!important}.td-box--10{color:#fff;background-color:#30638e}.td-box--10 .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#30638e transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--10 p>a{color:#cadcf5}.td-box--110.td-box--gradient{background:#30638E -webkit-gradient(linear,left top,left bottom,from(#4f7a9f),to(#30638E)) repeat-x!important;background:#30638e -webkit-linear-gradient(top,#4f7a9f,#30638E) repeat-x!important;background:#30638e -o-linear-gradient(top,#4f7a9f,#30638E) repeat-x!important;background:#30638e linear-gradient(180deg,#4f7a9f,#30638E) repeat-x!important}.td-box--11{color:#fff;background-color:#ffa630}.td-box--11 .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#ffa630 transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--11 p>a{color:#abc7f0}.td-box--111.td-box--gradient{background:#FFA630 -webkit-gradient(linear,left top,left bottom,from(#ffb34f),to(#FFA630)) repeat-x!important;background:#ffa630 -webkit-linear-gradient(top,#ffb34f,#FFA630) repeat-x!important;background:#ffa630 -o-linear-gradient(top,#ffb34f,#FFA630) repeat-x!important;background:#ffa630 linear-gradient(180deg,#ffb34f,#FFA630) repeat-x!important}.td-box--12{color:#222;background-color:#fff}.td-box--12 .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#fff transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--12 p>a{color:#72a1e5}.td-box--112.td-box--gradient{background:white -webkit-gradient(linear,left top,left bottom,from(white),to(white)) repeat-x!important;background:#fff -webkit-linear-gradient(top,white,white) repeat-x!important;background:#fff -o-linear-gradient(top,white,white) repeat-x!important;background:#fff linear-gradient(180deg,white,white) repeat-x!important}.td-box--13{color:#222;background-color:#c0e0de}.td-box--13 .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#c0e0de transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--13 p>a{color:#638ac1}.td-box--113.td-box--gradient{background:#C0E0DE -webkit-gradient(linear,left top,left bottom,from(#c9e5e3),to(#C0E0DE)) repeat-x!important;background:#c0e0de -webkit-linear-gradient(top,#c9e5e3,#C0E0DE) repeat-x!important;background:#c0e0de -o-linear-gradient(top,#c9e5e3,#C0E0DE) repeat-x!important;background:#c0e0de linear-gradient(180deg,#c9e5e3,#C0E0DE) repeat-x!important}.td-box--cerulean-blue{color:#fff;background-color:#017cee}.td-box--cerulean-blue .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#017cee transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--cerulean-blue p>a{color:#bdd3f3}.td-box--1cerulean-blue.td-box--gradient{background:#017cee -webkit-gradient(linear,left top,left bottom,from(#2790f1),to(#017cee)) repeat-x!important;background:#017cee -webkit-linear-gradient(top,#2790f1,#017cee) repeat-x!important;background:#017cee -o-linear-gradient(top,#2790f1,#017cee) repeat-x!important;background:#017cee linear-gradient(180deg,#2790f1,#017cee) repeat-x!important}.td-box--shamrock{color:#fff;background-color:#00ad46}.td-box--shamrock .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#00ad46 transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--shamrock p>a{color:#cfdff6}.td-box--1shamrock.td-box--gradient{background:#00ad46 -webkit-gradient(linear,left top,left bottom,from(#26b962),to(#00ad46)) repeat-x!important;background:#00ad46 -webkit-linear-gradient(top,#26b962,#00ad46) repeat-x!important;background:#00ad46 -o-linear-gradient(top,#26b962,#00ad46) repeat-x!important;background:#00ad46 linear-gradient(180deg,#26b962,#00ad46) repeat-x!important}.td-box--bright-sky-blue{color:#fff;background-color:#0cb6ff}.td-box--bright-sky-blue .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#0cb6ff transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--bright-sky-blue p>a{color:#b5cef1}.td-box--1bright-sky-blue.td-box--gradient{background:#0cb6ff -webkit-gradient(linear,left top,left bottom,from(#30c1ff),to(#0cb6ff)) repeat-x!important;background:#0cb6ff -webkit-linear-gradient(top,#30c1ff,#0cb6ff) repeat-x!important;background:#0cb6ff -o-linear-gradient(top,#30c1ff,#0cb6ff) repeat-x!important;background:#0cb6ff linear-gradient(180deg,#30c1ff,#0cb6ff) repeat-x!important}.td-box--melon{color:#fff;background-color:#ff7557}.td-box--melon .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#ff7557 transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--melon p>a{color:#a0c0ee}.td-box--1melon.td-box--gradient{background:#ff7557 -webkit-gradient(linear,left top,left bottom,from(#ff8a70),to(#ff7557)) repeat-x!important;background:#ff7557 -webkit-linear-gradient(top,#ff8a70,#ff7557) repeat-x!important;background:#ff7557 -o-linear-gradient(top,#ff8a70,#ff7557) repeat-x!important;background:#ff7557 linear-gradient(180deg,#ff8a70,#ff7557) repeat-x!important}.td-box--vermillion{color:#fff;background-color:#e43921}.td-box--vermillion .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#e43921 transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--vermillion p>a{color:#b7cff2}.td-box--1vermillion.td-box--gradient{background:#e43921 -webkit-gradient(linear,left top,left bottom,from(#e85742),to(#e43921)) repeat-x!important;background:#e43921 -webkit-linear-gradient(top,#e85742,#e43921) repeat-x!important;background:#e43921 -o-linear-gradient(top,#e85742,#e43921) repeat-x!important;background:#e43921 linear-gradient(180deg,#e85742,#e43921) repeat-x!important}.td-box--aqua{color:#fff;background-color:#11e1ee}.td-box--aqua .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#11e1ee transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--aqua p>a{color:#b9d0f2}.td-box--1aqua.td-box--gradient{background:#11e1ee -webkit-gradient(linear,left top,left bottom,from(#35e6f1),to(#11e1ee)) repeat-x!important;background:#11e1ee -webkit-linear-gradient(top,#35e6f1,#11e1ee) repeat-x!important;background:#11e1ee -o-linear-gradient(top,#35e6f1,#11e1ee) repeat-x!important;background:#11e1ee linear-gradient(180deg,#35e6f1,#11e1ee) repeat-x!important}.td-box--shamrock-green{color:#fff;background-color:#04d659}.td-box--shamrock-green .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#04d659 transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--shamrock-green p>a{color:#c3d7f4}.td-box--1shamrock-green.td-box--gradient{background:#04d659 -webkit-gradient(linear,left top,left bottom,from(#2adc72),to(#04d659)) repeat-x!important;background:#04d659 -webkit-linear-gradient(top,#2adc72,#04d659) repeat-x!important;background:#04d659 -o-linear-gradient(top,#2adc72,#04d659) repeat-x!important;background:#04d659 linear-gradient(180deg,#2adc72,#04d659) repeat-x!important}.td-box--aqua-blue{color:#fff;background-color:#00c7d4}.td-box--aqua-blue .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#00c7d4 transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--aqua-blue p>a{color:#c4d8f4}.td-box--1aqua-blue.td-box--gradient{background:#00c7d4 -webkit-gradient(linear,left top,left bottom,from(#26cfda),to(#00c7d4)) repeat-x!important;background:#00c7d4 -webkit-linear-gradient(top,#26cfda,#00c7d4) repeat-x!important;background:#00c7d4 -o-linear-gradient(top,#26cfda,#00c7d4) repeat-x!important;background:#00c7d4 linear-gradient(180deg,#26cfda,#00c7d4) repeat-x!important}.td-box--white{color:#222;background-color:#fff}.td-box--white .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#fff transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--white p>a{color:#72a1e5}.td-box--1white.td-box--gradient{background:#ffffff -webkit-gradient(linear,left top,left bottom,from(white),to(#ffffff)) repeat-x!important;background:#fff -webkit-linear-gradient(top,white,#ffffff) repeat-x!important;background:#fff -o-linear-gradient(top,white,#ffffff) repeat-x!important;background:#fff linear-gradient(180deg,white,#ffffff) repeat-x!important}.td-box--brownish-grey{color:#fff;background-color:#707070}.td-box--brownish-grey .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#707070 transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--brownish-grey p>a{color:#c1d6f4}.td-box--1brownish-grey.td-box--gradient{background:#707070 -webkit-gradient(linear,left top,left bottom,from(#858585),to(#707070)) repeat-x!important;background:#707070 -webkit-linear-gradient(top,#858585,#707070) repeat-x!important;background:#707070 -o-linear-gradient(top,#858585,#707070) repeat-x!important;background:#707070 linear-gradient(180deg,#858585,#707070) repeat-x!important}.td-box--very-light-pink{color:#222;background-color:#cbcbcb}.td-box--very-light-pink .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#cbcbcb transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--very-light-pink p>a{color:#6287bd}.td-box--1very-light-pink.td-box--gradient{background:#cbcbcb -webkit-gradient(linear,left top,left bottom,from(lightgray),to(#cbcbcb)) repeat-x!important;background:#cbcbcb -webkit-linear-gradient(top,lightgray,#cbcbcb) repeat-x!important;background:#cbcbcb -o-linear-gradient(top,lightgray,#cbcbcb) repeat-x!important;background:#cbcbcb linear-gradient(180deg,lightgray,#cbcbcb) repeat-x!important}.td-box--slate-grey{color:#fff;background-color:#636365}.td-box--slate-grey .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#636365 transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--slate-grey p>a{color:#c8daf5}.td-box--1slate-grey.td-box--gradient{background:#636365 -webkit-gradient(linear,left top,left bottom,from(#7a7a7c),to(#636365)) repeat-x!important;background:#636365 -webkit-linear-gradient(top,#7a7a7c,#636365) repeat-x!important;background:#636365 -o-linear-gradient(top,#7a7a7c,#636365) repeat-x!important;background:#636365 linear-gradient(180deg,#7a7a7c,#636365) repeat-x!important}.td-box--greyish-brown{color:#fff;background-color:#51504f}.td-box--greyish-brown .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#51504f transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--greyish-brown p>a{color:#d3e2f7}.td-box--1greyish-brown.td-box--gradient{background:#51504f -webkit-gradient(linear,left top,left bottom,from(#6b6a69),to(#51504f)) repeat-x!important;background:#51504f -webkit-linear-gradient(top,#6b6a69,#51504f) repeat-x!important;background:#51504f -o-linear-gradient(top,#6b6a69,#51504f) repeat-x!important;background:#51504f linear-gradient(180deg,#6b6a69,#51504f) repeat-x!important}.td-box--primary{color:#fff;background-color:#30638e}.td-box--primary .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#30638e transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--primary p>a{color:#cadcf5}.td-box--1primary.td-box--gradient{background:#30638E -webkit-gradient(linear,left top,left bottom,from(#4f7a9f),to(#30638E)) repeat-x!important;background:#30638e -webkit-linear-gradient(top,#4f7a9f,#30638E) repeat-x!important;background:#30638e -o-linear-gradient(top,#4f7a9f,#30638E) repeat-x!important;background:#30638e linear-gradient(180deg,#4f7a9f,#30638E) repeat-x!important}.td-box--secondary{color:#fff;background-color:#ffa630}.td-box--secondary .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#ffa630 transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--secondary p>a{color:#abc7f0}.td-box--1secondary.td-box--gradient{background:#FFA630 -webkit-gradient(linear,left top,left bottom,from(#ffb34f),to(#FFA630)) repeat-x!important;background:#ffa630 -webkit-linear-gradient(top,#ffb34f,#FFA630) repeat-x!important;background:#ffa630 -o-linear-gradient(top,#ffb34f,#FFA630) repeat-x!important;background:#ffa630 linear-gradient(180deg,#ffb34f,#FFA630) repeat-x!important}.td-box--success{color:#fff;background-color:#3772ff}.td-box--success .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#3772ff transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--success p>a{color:#a9c6ef}.td-box--1success.td-box--gradient{background:#3772FF -webkit-gradient(linear,left top,left bottom,from(#5587ff),to(#3772FF)) repeat-x!important;background:#3772ff -webkit-linear-gradient(top,#5587ff,#3772FF) repeat-x!important;background:#3772ff -o-linear-gradient(top,#5587ff,#3772FF) repeat-x!important;background:#3772ff linear-gradient(180deg,#5587ff,#3772FF) repeat-x!important}.td-box--info{color:#222;background-color:#c0e0de}.td-box--info .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#c0e0de transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--info p>a{color:#638ac1}.td-box--1info.td-box--gradient{background:#C0E0DE -webkit-gradient(linear,left top,left bottom,from(#c9e5e3),to(#C0E0DE)) repeat-x!important;background:#c0e0de -webkit-linear-gradient(top,#c9e5e3,#C0E0DE) repeat-x!important;background:#c0e0de -o-linear-gradient(top,#c9e5e3,#C0E0DE) repeat-x!important;background:#c0e0de linear-gradient(180deg,#c9e5e3,#C0E0DE) repeat-x!important}.td-box--warning{color:#fff;background-color:#ed6a5a}.td-box--warning .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#ed6a5a transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--warning p>a{color:#a5c3ee}.td-box--1warning.td-box--gradient{background:#ED6A5A -webkit-gradient(linear,left top,left bottom,from(#f08073),to(#ED6A5A)) repeat-x!important;background:#ed6a5a -webkit-linear-gradient(top,#f08073,#ED6A5A) repeat-x!important;background:#ed6a5a -o-linear-gradient(top,#f08073,#ED6A5A) repeat-x!important;background:#ed6a5a linear-gradient(180deg,#f08073,#ED6A5A) repeat-x!important}.td-box--danger{color:#fff;background-color:#ed6a5a}.td-box--danger .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#ed6a5a transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--danger p>a{color:#a5c3ee}.td-box--1danger.td-box--gradient{background:#ED6A5A -webkit-gradient(linear,left top,left bottom,from(#f08073),to(#ED6A5A)) repeat-x!important;background:#ed6a5a -webkit-linear-gradient(top,#f08073,#ED6A5A) repeat-x!important;background:#ed6a5a -o-linear-gradient(top,#f08073,#ED6A5A) repeat-x!important;background:#ed6a5a linear-gradient(180deg,#f08073,#ED6A5A) repeat-x!important}.td-box--light{color:#222;background-color:#d3f3ee}.td-box--light .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#d3f3ee transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--light p>a{color:#6993d0}.td-box--1light.td-box--gradient{background:#D3F3EE -webkit-gradient(linear,left top,left bottom,from(#daf5f1),to(#D3F3EE)) repeat-x!important;background:#d3f3ee -webkit-linear-gradient(top,#daf5f1,#D3F3EE) repeat-x!important;background:#d3f3ee -o-linear-gradient(top,#daf5f1,#D3F3EE) repeat-x!important;background:#d3f3ee linear-gradient(180deg,#daf5f1,#D3F3EE) repeat-x!important}.td-box--dark{color:#fff;background-color:#403f4c}.td-box--dark .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#403f4c transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--dark p>a{color:#d9e5f8}.td-box--1dark.td-box--gradient{background:#403F4C -webkit-gradient(linear,left top,left bottom,from(#5d5c67),to(#403F4C)) repeat-x!important;background:#403f4c -webkit-linear-gradient(top,#5d5c67,#403F4C) repeat-x!important;background:#403f4c -o-linear-gradient(top,#5d5c67,#403F4C) repeat-x!important;background:#403f4c linear-gradient(180deg,#5d5c67,#403F4C) repeat-x!important}.td-box--100{color:#222;background-color:#f8f9fa}.td-box--100 .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#f8f9fa transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--100 p>a{color:#709ee0}.td-box--1100.td-box--gradient{background:#f8f9fa -webkit-gradient(linear,left top,left bottom,from(#f9fafb),to(#f8f9fa)) repeat-x!important;background:#f8f9fa -webkit-linear-gradient(top,#f9fafb,#f8f9fa) repeat-x!important;background:#f8f9fa -o-linear-gradient(top,#f9fafb,#f8f9fa) repeat-x!important;background:#f8f9fa linear-gradient(180deg,#f9fafb,#f8f9fa) repeat-x!important}.td-box--200{color:#222;background-color:#eee}.td-box--200 .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#eee transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--200 p>a{color:#6d99d8}.td-box--1200.td-box--gradient{background:#eee -webkit-gradient(linear,left top,left bottom,from(#f1f1f1),to(#eee)) repeat-x!important;background:#eee -webkit-linear-gradient(top,#f1f1f1,#eee) repeat-x!important;background:#eee -o-linear-gradient(top,#f1f1f1,#eee) repeat-x!important;background:#eee linear-gradient(180deg,#f1f1f1,#eee) repeat-x!important}.td-box--300{color:#222;background-color:#dee2e6}.td-box--300 .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#dee2e6 transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--300 p>a{color:#6993cf}.td-box--1300.td-box--gradient{background:#dee2e6 -webkit-gradient(linear,left top,left bottom,from(#e3e6ea),to(#dee2e6)) repeat-x!important;background:#dee2e6 -webkit-linear-gradient(top,#e3e6ea,#dee2e6) repeat-x!important;background:#dee2e6 -o-linear-gradient(top,#e3e6ea,#dee2e6) repeat-x!important;background:#dee2e6 linear-gradient(180deg,#e3e6ea,#dee2e6) repeat-x!important}.td-box--400{color:#222;background-color:#ccc}.td-box--400 .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#ccc transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--400 p>a{color:#6288be}.td-box--1400.td-box--gradient{background:#ccc -webkit-gradient(linear,left top,left bottom,from(#d4d4d4),to(#ccc)) repeat-x!important;background:#ccc -webkit-linear-gradient(top,#d4d4d4,#ccc) repeat-x!important;background:#ccc -o-linear-gradient(top,#d4d4d4,#ccc) repeat-x!important;background:#ccc linear-gradient(180deg,#d4d4d4,#ccc) repeat-x!important}.td-box--500{color:#fff;background-color:#adb5bd}.td-box--500 .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#adb5bd transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--500 p>a{color:#9bbced}.td-box--1500.td-box--gradient{background:#adb5bd -webkit-gradient(linear,left top,left bottom,from(#b9c0c7),to(#adb5bd)) repeat-x!important;background:#adb5bd -webkit-linear-gradient(top,#b9c0c7,#adb5bd) repeat-x!important;background:#adb5bd -o-linear-gradient(top,#b9c0c7,#adb5bd) repeat-x!important;background:#adb5bd linear-gradient(180deg,#b9c0c7,#adb5bd) repeat-x!important}.td-box--600{color:#fff;background-color:#888}.td-box--600 .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#888 transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--600 p>a{color:#b4cdf1}.td-box--1600.td-box--gradient{background:#888 -webkit-gradient(linear,left top,left bottom,from(#9a9a9a),to(#888)) repeat-x!important;background:#888 -webkit-linear-gradient(top,#9a9a9a,#888) repeat-x!important;background:#888 -o-linear-gradient(top,#9a9a9a,#888) repeat-x!important;background:#888 linear-gradient(180deg,#9a9a9a,#888) repeat-x!important}.td-box--700{color:#fff;background-color:#495057}.td-box--700 .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#495057 transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--700 p>a{color:#d3e2f7}.td-box--1700.td-box--gradient{background:#495057 -webkit-gradient(linear,left top,left bottom,from(#646a70),to(#495057)) repeat-x!important;background:#495057 -webkit-linear-gradient(top,#646a70,#495057) repeat-x!important;background:#495057 -o-linear-gradient(top,#646a70,#495057) repeat-x!important;background:#495057 linear-gradient(180deg,#646a70,#495057) repeat-x!important}.td-box--800{color:#fff;background-color:#333}.td-box--800 .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#333 transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--800 p>a{color:#e3ecfa}.td-box--1800.td-box--gradient{background:#333 -webkit-gradient(linear,left top,left bottom,from(#525252),to(#333)) repeat-x!important;background:#333 -webkit-linear-gradient(top,#525252,#333) repeat-x!important;background:#333 -o-linear-gradient(top,#525252,#333) repeat-x!important;background:#333 linear-gradient(180deg,#525252,#333) repeat-x!important}.td-box--900{color:#fff;background-color:#222}.td-box--900 .td-arrow-down::before{left:50%;margin-left:-30px;bottom:-25px;border-style:solid;border-width:25px 30px 0;border-color:#222 transparent transparent transparent;z-index:3;position:absolute;content:""}.td-box--900 p>a{color:#ecf2fc}.td-box--1900.td-box--gradient{background:#222 -webkit-gradient(linear,left top,left bottom,from(#434343),to(#222)) repeat-x!important;background:#222 -webkit-linear-gradient(top,#434343,#222) repeat-x!important;background:#222 -o-linear-gradient(top,#434343,#222) repeat-x!important;background:#222 linear-gradient(180deg,#434343,#222) repeat-x!important}.td-blog .td-rss-button{position:absolute;top:5.5rem;right:1rem;z-index:22}.td-content .highlight{margin:2rem 0;padding:1rem;background-color:#f8f9fa}.td-content .highlight pre,.td-content .highlight div{background-color:inherit!important}.td-content .highlight pre{margin:0;padding:0}.td-content p code,.td-content li>code,.td-content table code{color:inherit;padding:.2em .4em;margin:0;font-size:85%;word-break:normal;background-color:rgba(0,0,0,.05);border-radius:.25rem}.td-content p code br,.td-content li>code br,.td-content table code br{display:none}.td-content pre{word-wrap:normal;background-color:#f8f9fa;padding:1rem}.td-content pre>code{padding:0;margin:0;font-size:100%;word-break:normal;white-space:pre;border:0}.td-navbar-cover{background:#30638e}@media(min-width:768px){.td-navbar-cover{background:transparent!important}.td-navbar-cover .nav-link{text-shadow:1px 1px 2px #403f4c}}.td-navbar-cover.navbar-bg-onscroll .nav-link{text-shadow:none}.navbar-bg-onscroll{background:#30638e!important;opacity:inherit}.td-navbar{background:#30638e;min-height:4rem;margin:0;z-index:32}@media(min-width:768px){.td-navbar{position:fixed;top:0;width:100%}}.td-navbar .navbar-brand{text-transform:none;text-align:middle}.td-navbar .navbar-brand .nav-link{display:inline-block;margin-right:-30px}.td-navbar .navbar-brand svg{display:inline-block;margin:0 10px;height:30px}.td-navbar .nav-link{text-transform:none;font-weight:700}.td-navbar .td-search-input{border:none}.td-navbar .td-search-input::-webkit-input-placeholder{color:rgba(255,255,255,.75)}.td-navbar .td-search-input:-moz-placeholder{color:rgba(255,255,255,.75)}.td-navbar .td-search-input::-moz-placeholder{color:rgba(255,255,255,.75)}.td-navbar .td-search-input:-ms-input-placeholder{color:rgba(255,255,255,.75)}.td-navbar .dropdown{min-width:100px}@media(max-width:991.98px){.td-navbar{padding-right:.5rem;padding-left:.75rem}.td-navbar .td-navbar-nav-scroll{max-width:100%;height:2.5rem;margin-top:.25rem;overflow:hidden;font-size:.875rem}.td-navbar .td-navbar-nav-scroll .nav-link{padding-right:.25rem;padding-left:0}.td-navbar .td-navbar-nav-scroll .navbar-nav{padding-bottom:2rem;overflow-x:auto;white-space:nowrap;-webkit-overflow-scrolling:touch}}.td-sidebar-nav{padding-right:.5rem;margin-right:-15px;margin-left:-15px}@media(min-width:768px){@supports((position:-webkit-sticky) or (position:sticky)){.td-sidebar-nav{max-height:-webkit-calc(100vh - 10rem);max-height:calc(100vh - 10rem);overflow-y:auto}}}@media(min-width:768px){.td-sidebar-nav{display:block!important}}.td-sidebar-nav__section{padding-left:0}.td-sidebar-nav__section li{list-style:none}.td-sidebar-nav__section ul{padding:0;margin:0}@media(min-width:768px){.td-sidebar-nav__section>ul{padding-left:.5rem}}.td-sidebar-nav__section-title{display:block;font-weight:500}.td-sidebar-nav__section-title .active{font-weight:700}.td-sidebar-nav__section-title a{color:#222}.td-sidebar-nav .td-sidebar-link{display:block;padding-bottom:.375rem}.td-sidebar-nav .td-sidebar-link__page{color:#495057;font-weight:300}.td-sidebar-nav a:hover{color:#72a1e5;text-decoration:none}.td-sidebar-nav a.active{font-weight:700}.td-sidebar-nav .dropdown a{color:#495057}.td-sidebar-nav .dropdown .nav-link{padding:0 0 1rem}.td-sidebar{padding-bottom:1rem}@media(min-width:768px){.td-sidebar{padding-top:4rem;background-color:rgba(48,99,142,.03);padding-right:1rem;border-right:1px solid #dee2e6}}.td-sidebar__toggle{line-height:1;color:#222;margin:1rem}.td-sidebar__search{padding:1rem 15px;margin-right:-15px;margin-left:-15px}.td-sidebar__inner{-webkit-box-ordinal-group:1;-webkit-order:0;-ms-flex-order:0;order:0}@media(min-width:768px){@supports((position:-webkit-sticky) or (position:sticky)){.td-sidebar__inner{position:-webkit-sticky;position:sticky;top:4rem;z-index:10;height:-webkit-calc(100vh - 6rem);height:calc(100vh - 6rem)}}}@media(min-width:1200px){.td-sidebar__inner{-webkit-box-flex:0;-webkit-flex:0 1 320px;-ms-flex:0 1 320px;flex:0 1 320px}}.td-sidebar__inner .td-search-box{width:100%}.td-toc{border-left:1px solid #dee2e6;-webkit-box-ordinal-group:3;-webkit-order:2;-ms-flex-order:2;order:2;padding-top:.75rem;padding-bottom:1.5rem;vertical-align:top}@supports((position:-webkit-sticky) or (position:sticky)){.td-toc{position:-webkit-sticky;position:sticky;top:4rem;height:-webkit-calc(100vh - 10rem);height:calc(100vh - 10rem);overflow-y:auto}}.td-toc a{display:block;font-weight:300;padding-bottom:.25rem}.td-toc li{list-style:none;display:block}.td-toc li li{margin-left:.5rem}.td-toc .td-page-meta a{font-weight:500}.td-toc #TableOfContents a{color:#888}.td-toc #TableOfContents a:hover{color:#72a1e5;text-decoration:none}.td-toc ul{padding-left:0}button{cursor:pointer;border:1px solid;border-radius:5px;padding:9px 29px;-webkit-transition:all ease-out .2s;-o-transition:all ease-out .2s;transition:all ease-out .2s}button:disabled{cursor:not-allowed}button.btn-filled{border-color:#017cee;background-color:#017cee}button.btn-filled:hover{border-color:#0cb6ff;background-color:#0cb6ff}button.btn-with-icon{padding:14px 20px}button.btn-with-icon svg{height:30px;width:auto;padding-right:15px}button.btn-with-icon span{display:inline-block;line-height:30px;vertical-align:middle}button.btn-hollow{background-color:#fff}button.btn-hollow.btn-blue{color:#017cee;border-color:#017cee}button.btn-hollow.btn-blue:disabled{color:#cbcbcb;border-color:#cbcbcb}button.btn-hollow.btn-blue:hover:enabled{color:#fff;background-color:#017cee}button.btn-hollow.btn-brown{border-color:#cbcbcb}button.btn-hollow.btn-brown:hover{background-color:#51504f;border-color:#51504f}button.btn-hollow.btn-brown:hover span{color:#fff}button.btn-hollow.btn-brown:hover svg path{fill:#fff}button.with-box-shadow{-webkit-box-shadow:0 2px 6px 0 rgba(0,0,0,.12);box-shadow:0 2px 6px 0 rgba(0,0,0,.12)}@media(max-width:1280px){button{padding:4px 17px}}.breadcrumb{background:0 0;padding-left:0;padding-top:0}.alert{font-weight:500;background:#fff;color:inherit;border-radius:0}.alert-primary{border-style:solid;border-color:#30638e;border-width:0 0 0 4px}.alert-primary .alert-heading{color:#30638e}.alert-secondary{border-style:solid;border-color:#ffa630;border-width:0 0 0 4px}.alert-secondary .alert-heading{color:#ffa630}.alert-success{border-style:solid;border-color:#3772ff;border-width:0 0 0 4px}.alert-success .alert-heading{color:#3772ff}.alert-info{border-style:solid;border-color:#c0e0de;border-width:0 0 0 4px}.alert-info .alert-heading{color:#c0e0de}.alert-warning{border-style:solid;border-color:#ed6a5a;border-width:0 0 0 4px}.alert-warning .alert-heading{color:#ed6a5a}.alert-danger{border-style:solid;border-color:#ed6a5a;border-width:0 0 0 4px}.alert-danger .alert-heading{color:#ed6a5a}.alert-light{border-style:solid;border-color:#d3f3ee;border-width:0 0 0 4px}.alert-light .alert-heading{color:#d3f3ee}.alert-dark{border-style:solid;border-color:#403f4c;border-width:0 0 0 4px}.alert-dark .alert-heading{color:#403f4c}.td-content{-webkit-box-ordinal-group:2;-webkit-order:1;-ms-flex-order:1;order:1}.td-content p,.td-content li,.td-content td{font-weight:400}.td-content>h1{font-weight:700;margin-bottom:1rem}.td-content>h2{margin-bottom:1rem}.td-content>h2:not(:first-child){margin-top:3rem}.td-content>h2+h3{margin-top:1rem}.td-content>h3,.td-content>h4,.td-content>h5,.td-content>h6{margin-bottom:1rem;margin-top:2rem}.td-content>blockquote{padding:0 0 0 1rem;margin-bottom:1rem;color:#888;border-left:6px solid #ffa630}.td-content>ul li,.td-content>ol li{margin-bottom:.25rem}.td-content strong{font-weight:700}.td-content .alert:not(:first-child){margin-top:2rem;margin-bottom:2rem}.td-content .lead{margin-bottom:1.5rem}.td-title{margin-top:1rem;margin-bottom:.5rem}@media(min-width:576px){.td-title{font-size:3rem}}.search-form{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;width:344px;padding:8px 20px;border:solid 1px #cbcbcb;border-radius:5px;margin:60px auto 0}.search-form__input{font-family:roboto,sans-serif;font-size:16px;color:#707070;line-height:1.63;-webkit-box-flex:1;-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1;padding-right:10px;border:none;background:0 0;outline:none;float:left}.search-form__button{border:none;background-color:transparent;padding:0}@media(max-width:1280px){.search-form{width:270px;padding:3px 20px;margin-top:30px}}.td-outer{display:-webkit-box;display:-webkit-flex;display:-ms-flexbox;display:flex;-webkit-box-orient:vertical;-webkit-box-direction:normal;-webkit-flex-direction:column;-ms-flex-direction:column;flex-direction:column;height:100vh}@media(min-width:768px){.td-default main section:first-of-type{padding-top:8rem}}.td-main{-webkit-box-flex:1;-webkit-flex-grow:1;-ms-flex-positive:1;flex-grow:1}.td-main main{padding-bottom:2rem}@media(min-width:768px){.td-main main{padding-top:5.5rem}}.td-cover-block--height-min{min-height:300px}.td-cover-block--height-med{min-height:400px}.td-cover-block--height-max{min-height:500px}.td-cover-block--height-full{min-height:100vh}@media(min-width:768px){.td-cover-block--height-min{min-height:450px}.td-cover-block--height-med{min-height:500px}.td-cover-block--height-max{min-height:650px}}.td-cover-logo{margin-right:.5em}.td-cover-block{position:relative;padding-top:5rem;padding-bottom:5rem;background-repeat:no-repeat;background-position:50% 0;-webkit-background-size:cover;background-size:cover}.td-bg-arrow-wrapper{position:relative}.section-index .entry{padding:.75rem}.section-index h5{margin-bottom:0}.section-index h5 a{font-weight:700}.section-index p{margin-top:0}.pageinfo{font-weight:500;background:#f8f9fa;color:inherit;border-radius:0;margin:2rem;padding:1.5rem;padding-bottom:.5rem}.pageinfo-primary{border-style:solid;border-color:#30638e}.pageinfo-secondary{border-style:solid;border-color:#ffa630}.pageinfo-success{border-style:solid;border-color:#3772ff}.pageinfo-info{border-style:solid;border-color:#c0e0de}.pageinfo-warning{border-style:solid;border-color:#ed6a5a}.pageinfo-danger{border-style:solid;border-color:#ed6a5a}.pageinfo-light{border-style:solid;border-color:#d3f3ee}.pageinfo-dark{border-style:solid;border-color:#403f4c}footer{min-height:150px}@media(max-width:991.98px){footer{min-height:200px}}@media(min-width:768px){.td-offset-anchor:target{display:block;position:relative;top:-4rem;visibility:hidden}h2[id]:before,h3[id]:before,h4[id]:before,h5[id]:before{display:block;content:" ";margin-top:-5rem;height:5rem;visibility:hidden}} \ No newline at end of file diff --git a/docs-archive/helm-chart/1.14.0/_static/_gen/js/docs.js b/docs-archive/helm-chart/1.14.0/_static/_gen/js/docs.js new file mode 100644 index 00000000000..90898d86d50 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_static/_gen/js/docs.js @@ -0,0 +1 @@ +!function(r){var n={};function o(t){if(n[t])return n[t].exports;var e=n[t]={i:t,l:!1,exports:{}};return r[t].call(e.exports,e,e.exports,o),e.l=!0,e.exports}o.m=r,o.c=n,o.d=function(t,e,r){o.o(t,e)||Object.defineProperty(t,e,{enumerable:!0,get:r})},o.r=function(t){"undefined"!=typeof Symbol&&Symbol.toStringTag&&Object.defineProperty(t,Symbol.toStringTag,{value:"Module"}),Object.defineProperty(t,"__esModule",{value:!0})},o.t=function(e,t){if(1&t&&(e=o(e)),8&t)return e;if(4&t&&"object"==typeof e&&e&&e.__esModule)return e;var r=Object.create(null);if(o.r(r),Object.defineProperty(r,"default",{enumerable:!0,value:e}),2&t&&"string"!=typeof e)for(var n in e)o.d(r,n,function(t){return e[t]}.bind(null,n));return r},o.n=function(t){var e=t&&t.__esModule?function(){return t.default}:function(){return t};return o.d(e,"a",e),e},o.o=function(t,e){return Object.prototype.hasOwnProperty.call(t,e)},o.p="/",o(o.s=54)}([function(t,e,r){var m=r(1),w=r(14),g=r(15),E=Math.max,x=Math.min;t.exports=function(n,r,t){var o,i,a,s,u,c,f=0,l=!1,d=!1,e=!0;if("function"!=typeof n)throw new TypeError("Expected a function");function h(t){var e=o,r=i;return o=i=void 0,f=t,s=n.apply(r,e)}function p(t){var e=t-c;return void 0===c||r<=e||e<0||d&&a<=t-f}function y(){var t=w();if(p(t))return b(t);u=setTimeout(y,function(t){var e=r-(t-c);return d?x(e,a-(t-f)):e}(t))}function b(t){return u=void 0,e&&o?h(t):(o=i=void 0,s)}function v(){var t=w(),e=p(t);if(o=arguments,i=this,c=t,e){if(void 0===u)return function(t){return f=t,u=setTimeout(y,r),l?h(t):s}(c);if(d)return clearTimeout(u),u=setTimeout(y,r),h(c)}return void 0===u&&(u=setTimeout(y,r)),s}return r=g(r)||0,m(t)&&(l=!!t.leading,a=(d="maxWait"in t)?E(g(t.maxWait)||0,r):a,e="trailing"in t?!!t.trailing:e),v.cancel=function(){void 0!==u&&clearTimeout(u),o=c=i=u=void(f=0)},v.flush=function(){return void 0===u?s:b(w())},v}},function(t,e){t.exports=function(t){var e=typeof t;return null!=t&&("object"==e||"function"==e)}},function(t,e,r){var n=r(8),o="object"==typeof self&&self&&self.Object===Object&&self,i=n||o||Function("return this")();t.exports=i},function(t,e,r){var n=r(6),o=r(17),i=r(18),a=n?n.toStringTag:void 0;t.exports=function(t){return null==t?void 0===t?"[object Undefined]":"[object Null]":a&&a in Object(t)?o(t):i(t)}},function(t,e){t.exports=function(t){return null!=t&&"object"==typeof t}},function(t,e,r){!function(s){"use strict";var u={searchParams:"URLSearchParams"in self,iterable:"Symbol"in self&&"iterator"in Symbol,blob:"FileReader"in self&&"Blob"in self&&function(){try{return new Blob,!0}catch(t){return!1}}(),formData:"FormData"in self,arrayBuffer:"ArrayBuffer"in self};if(u.arrayBuffer)var e=["[object Int8Array]","[object Uint8Array]","[object Uint8ClampedArray]","[object Int16Array]","[object Uint16Array]","[object Int32Array]","[object Uint32Array]","[object Float32Array]","[object Float64Array]"],r=ArrayBuffer.isView||function(t){return t&&-1 nav").offsetHeight,n=function(){var t;e.sort(function(t,e){return t.targetElement.offsetTop-e.targetElement.offsetTop}),t=e[0].targetElement.offsetTop+r>window.scrollY?0:e[e.length-1].targetElement.offsetTop+rwindow.scrollY})-1,e.forEach(function(t){return t.navElement.classList.remove("current")}),e[t].navElement.classList.add("current")};window.addEventListener("scroll",o()(n,10)),window.addEventListener("resize",o()(n,10)),n()}}()},function(t,e,r){var n=r(2);t.exports=function(){return n.Date.now()}},function(t,e,r){var n=r(1),o=r(16),i=/^\s+|\s+$/g,a=/^[-+]0x[0-9a-f]+$/i,s=/^0b[01]+$/i,u=/^0o[0-7]+$/i,c=parseInt;t.exports=function(t){if("number"==typeof t)return t;if(o(t))return NaN;if(n(t)){var e="function"==typeof t.valueOf?t.valueOf():t;t=n(e)?e+"":e}if("string"!=typeof t)return 0===t?t:+t;t=t.replace(i,"");var r=s.test(t);return r||u.test(t)?c(t.slice(2),r?2:8):a.test(t)?NaN:+t}},function(t,e,r){var n=r(3),o=r(4);t.exports=function(t){return"symbol"==typeof t||o(t)&&"[object Symbol]"==n(t)}},function(t,e,r){var n=r(6),o=Object.prototype,i=o.hasOwnProperty,a=o.toString,s=n?n.toStringTag:void 0;t.exports=function(t){var e=i.call(t,s),r=t[s];try{var n=!(t[s]=void 0)}catch(t){}var o=a.call(t);return n&&(e?t[s]=r:delete t[s]),o}},function(t,e){var r=Object.prototype.toString;t.exports=function(t){return r.call(t)}},function(t,e){!function(){var e=window.document.querySelector(".rating");if(e){function t(t){e.querySelector("#rate-star-".concat(t)).addEventListener("click",function(){!function(t){window._paq.push(["trackEvent","Docs","Rating",window.location.pathname,t])}(t),e.innerHTML="

Thank you!

"})}for(var r=1;r<=5;r++)t(r)}}()},function(t,e){var r=window.document.querySelector(".rst-content");!function(){if(r){var t=r.querySelectorAll("table");t&&0!==t.length&&t.forEach(function(t){if(!t.parentNode.classList.contains("wy-table-responsive")){var e=document.createElement("div");e.classList.add("wy-table-responsive"),t.parentNode.insertBefore(e,t),e.appendChild(t)}})}}()},function(t,e,n){"use strict";(function(t){var i=n(7);function r(t){return function(t){if(Array.isArray(t))return t}(t)||function(t){if(Symbol.iterator in Object(t)||"[object Arguments]"===Object.prototype.toString.call(t))return Array.from(t)}(t)||function(){throw new TypeError("Invalid attempt to destructure non-iterable instance")}()}function f(){var t=r(document.location.pathname.split("/")),e=t[2];return{currentVersion:t[3],currentPackageName:e,pagePath:t.slice(4).join("/")}}var a;(a=window.document.querySelectorAll(".docs-version-selector"))&&0!==a.length&&t("/_gen/packages-metadata.json").then(function(t){return t.json()}).then(function(t){var e=f().currentPackageName,r=t.find(function(t){return t["package-name"]===e});if(r){var n=r["all-versions"].sort(i.a).reverse(),o=r["stable-version"];a.forEach(function(t){return function(t,e,r){var n=t.querySelector("#version-item-template").innerText,o=document.createElement("div");function i(t,e){var r=o.cloneNode(!0),n="/docs/".concat(u,"/").concat(t,"/").concat(c);r.setAttribute("href",n),r.innerText=e,a.appendChild(r)}o.innerHTML=n,o=o.firstElementChild;var a=t.querySelector(".dropdown-menu"),s=f(),u=s.currentPackageName,c=s.pagePath;i("stable","Stable (".concat(r,")")),e.forEach(function(t){return i(t,t)})}(t,n,o)})}})}).call(this,n(5))},,,,,,,,,,,,,,,,,,,,,,,,,,,,,,,,,function(t,e,r){"use strict";r.r(e);r(10),r(11),r(12),r(13),r(19),r(20),r(55),r(21)},function(t,e){Array.from(document.querySelectorAll(".toctree ul")).forEach(function(t){Array.from(t.parentNode.children).filter(function(t){return"A"===t.tagName}).forEach(function(t){var e=document.createElement("span");e.classList.add("toctree-expand"),t.insertBefore(e,t.firstChild)})})}]); \ No newline at end of file diff --git a/docs-archive/helm-chart/1.14.0/_static/_sphinx_javascript_frameworks_compat.js b/docs-archive/helm-chart/1.14.0/_static/_sphinx_javascript_frameworks_compat.js new file mode 100644 index 00000000000..8549469dc29 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_static/_sphinx_javascript_frameworks_compat.js @@ -0,0 +1,134 @@ +/* + * _sphinx_javascript_frameworks_compat.js + * ~~~~~~~~~~ + * + * Compatability shim for jQuery and underscores.js. + * + * WILL BE REMOVED IN Sphinx 6.0 + * xref RemovedInSphinx60Warning + * + */ + +/** + * select a different prefix for underscore + */ +$u = _.noConflict(); + + +/** + * small helper function to urldecode strings + * + * See https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/decodeURIComponent#Decoding_query_parameters_from_a_URL + */ +jQuery.urldecode = function(x) { + if (!x) { + return x + } + return decodeURIComponent(x.replace(/\+/g, ' ')); +}; + +/** + * small helper function to urlencode strings + */ +jQuery.urlencode = encodeURIComponent; + +/** + * This function returns the parsed url parameters of the + * current request. Multiple values per key are supported, + * it will always return arrays of strings for the value parts. + */ +jQuery.getQueryParameters = function(s) { + if (typeof s === 'undefined') + s = document.location.search; + var parts = s.substr(s.indexOf('?') + 1).split('&'); + var result = {}; + for (var i = 0; i < parts.length; i++) { + var tmp = parts[i].split('=', 2); + var key = jQuery.urldecode(tmp[0]); + var value = jQuery.urldecode(tmp[1]); + if (key in result) + result[key].push(value); + else + result[key] = [value]; + } + return result; +}; + +/** + * highlight a given string on a jquery object by wrapping it in + * span elements with the given class name. + */ +jQuery.fn.highlightText = function(text, className) { + function highlight(node, addItems) { + if (node.nodeType === 3) { + var val = node.nodeValue; + var pos = val.toLowerCase().indexOf(text); + if (pos >= 0 && + !jQuery(node.parentNode).hasClass(className) && + !jQuery(node.parentNode).hasClass("nohighlight")) { + var span; + var isInSVG = jQuery(node).closest("body, svg, foreignObject").is("svg"); + if (isInSVG) { + span = document.createElementNS("http://www.w3.org/2000/svg", "tspan"); + } else { + span = document.createElement("span"); + span.className = className; + } + span.appendChild(document.createTextNode(val.substr(pos, text.length))); + node.parentNode.insertBefore(span, node.parentNode.insertBefore( + document.createTextNode(val.substr(pos + text.length)), + node.nextSibling)); + node.nodeValue = val.substr(0, pos); + if (isInSVG) { + var rect = document.createElementNS("http://www.w3.org/2000/svg", "rect"); + var bbox = node.parentElement.getBBox(); + rect.x.baseVal.value = bbox.x; + rect.y.baseVal.value = bbox.y; + rect.width.baseVal.value = bbox.width; + rect.height.baseVal.value = bbox.height; + rect.setAttribute('class', className); + addItems.push({ + "parent": node.parentNode, + "target": rect}); + } + } + } + else if (!jQuery(node).is("button, select, textarea")) { + jQuery.each(node.childNodes, function() { + highlight(this, addItems); + }); + } + } + var addItems = []; + var result = this.each(function() { + highlight(this, addItems); + }); + for (var i = 0; i < addItems.length; ++i) { + jQuery(addItems[i].parent).before(addItems[i].target); + } + return result; +}; + +/* + * backward compatibility for jQuery.browser + * This will be supported until firefox bug is fixed. + */ +if (!jQuery.browser) { + jQuery.uaMatch = function(ua) { + ua = ua.toLowerCase(); + + var match = /(chrome)[ \/]([\w.]+)/.exec(ua) || + /(webkit)[ \/]([\w.]+)/.exec(ua) || + /(opera)(?:.*version|)[ \/]([\w.]+)/.exec(ua) || + /(msie) ([\w.]+)/.exec(ua) || + ua.indexOf("compatible") < 0 && /(mozilla)(?:.*? rv:([\w.]+)|)/.exec(ua) || + []; + + return { + browser: match[ 1 ] || "", + version: match[ 2 ] || "0" + }; + }; + jQuery.browser = {}; + jQuery.browser[jQuery.uaMatch(navigator.userAgent).browser] = true; +} diff --git a/docs-archive/helm-chart/1.14.0/_static/basic.css b/docs-archive/helm-chart/1.14.0/_static/basic.css new file mode 100644 index 00000000000..eeb0519a69b --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_static/basic.css @@ -0,0 +1,899 @@ +/* + * basic.css + * ~~~~~~~~~ + * + * Sphinx stylesheet -- basic theme. + * + * :copyright: Copyright 2007-2022 by the Sphinx team, see AUTHORS. + * :license: BSD, see LICENSE for details. + * + */ + +/* -- main layout ----------------------------------------------------------- */ + +div.clearer { + clear: both; +} + +div.section::after { + display: block; + content: ''; + clear: left; +} + +/* -- relbar ---------------------------------------------------------------- */ + +div.related { + width: 100%; + font-size: 90%; +} + +div.related h3 { + display: none; +} + +div.related ul { + margin: 0; + padding: 0 0 0 10px; + list-style: none; +} + +div.related li { + display: inline; +} + +div.related li.right { + float: right; + margin-right: 5px; +} + +/* -- sidebar --------------------------------------------------------------- */ + +div.sphinxsidebarwrapper { + padding: 10px 5px 0 10px; +} + +div.sphinxsidebar { + float: left; + width: 230px; + margin-left: -100%; + font-size: 90%; + word-wrap: break-word; + overflow-wrap : break-word; +} + +div.sphinxsidebar ul { + list-style: none; +} + +div.sphinxsidebar ul ul, +div.sphinxsidebar ul.want-points { + margin-left: 20px; + list-style: square; +} + +div.sphinxsidebar ul ul { + margin-top: 0; + margin-bottom: 0; +} + +div.sphinxsidebar form { + margin-top: 10px; +} + +div.sphinxsidebar input { + border: 1px solid #98dbcc; + font-family: sans-serif; + font-size: 1em; +} + +div.sphinxsidebar #searchbox form.search { + overflow: hidden; +} + +div.sphinxsidebar #searchbox input[type="text"] { + float: left; + width: 80%; + padding: 0.25em; + box-sizing: border-box; +} + +div.sphinxsidebar #searchbox input[type="submit"] { + float: left; + width: 20%; + border-left: none; + padding: 0.25em; + box-sizing: border-box; +} + + +img { + border: 0; + max-width: 100%; +} + +/* -- search page ----------------------------------------------------------- */ + +ul.search { + margin: 10px 0 0 20px; + padding: 0; +} + +ul.search li { + padding: 5px 0 5px 20px; + background-image: url(file.png); + background-repeat: no-repeat; + background-position: 0 7px; +} + +ul.search li a { + font-weight: bold; +} + +ul.search li p.context { + color: #888; + margin: 2px 0 0 30px; + text-align: left; +} + +ul.keywordmatches li.goodmatch a { + font-weight: bold; +} + +/* -- index page ------------------------------------------------------------ */ + +table.contentstable { + width: 90%; + margin-left: auto; + margin-right: auto; +} + +table.contentstable p.biglink { + line-height: 150%; +} + +a.biglink { + font-size: 1.3em; +} + +span.linkdescr { + font-style: italic; + padding-top: 5px; + font-size: 90%; +} + +/* -- general index --------------------------------------------------------- */ + +table.indextable { + width: 100%; +} + +table.indextable td { + text-align: left; + vertical-align: top; +} + +table.indextable ul { + margin-top: 0; + margin-bottom: 0; + list-style-type: none; +} + +table.indextable > tbody > tr > td > ul { + padding-left: 0em; +} + +table.indextable tr.pcap { + height: 10px; +} + +table.indextable tr.cap { + margin-top: 10px; + background-color: #f2f2f2; +} + +img.toggler { + margin-right: 3px; + margin-top: 3px; + cursor: pointer; +} + +div.modindex-jumpbox { + border-top: 1px solid #ddd; + border-bottom: 1px solid #ddd; + margin: 1em 0 1em 0; + padding: 0.4em; +} + +div.genindex-jumpbox { + border-top: 1px solid #ddd; + border-bottom: 1px solid #ddd; + margin: 1em 0 1em 0; + padding: 0.4em; +} + +/* -- domain module index --------------------------------------------------- */ + +table.modindextable td { + padding: 2px; + border-collapse: collapse; +} + +/* -- general body styles --------------------------------------------------- */ + +div.body { + min-width: 360px; + max-width: 800px; +} + +div.body p, div.body dd, div.body li, div.body blockquote { + -moz-hyphens: auto; + -ms-hyphens: auto; + -webkit-hyphens: auto; + hyphens: auto; +} + +a.headerlink { + visibility: hidden; +} +a.brackets:before, +span.brackets > a:before{ + content: "["; +} + +a.brackets:after, +span.brackets > a:after { + content: "]"; +} + + +h1:hover > a.headerlink, +h2:hover > a.headerlink, +h3:hover > a.headerlink, +h4:hover > a.headerlink, +h5:hover > a.headerlink, +h6:hover > a.headerlink, +dt:hover > a.headerlink, +caption:hover > a.headerlink, +p.caption:hover > a.headerlink, +div.code-block-caption:hover > a.headerlink { + visibility: visible; +} + +div.body p.caption { + text-align: inherit; +} + +div.body td { + text-align: left; +} + +.first { + margin-top: 0 !important; +} + +p.rubric { + margin-top: 30px; + font-weight: bold; +} + +img.align-left, figure.align-left, .figure.align-left, object.align-left { + clear: left; + float: left; + margin-right: 1em; +} + +img.align-right, figure.align-right, .figure.align-right, object.align-right { + clear: right; + float: right; + margin-left: 1em; +} + +img.align-center, figure.align-center, .figure.align-center, object.align-center { + display: block; + margin-left: auto; + margin-right: auto; +} + +img.align-default, figure.align-default, .figure.align-default { + display: block; + margin-left: auto; + margin-right: auto; +} + +.align-left { + text-align: left; +} + +.align-center { + text-align: center; +} + +.align-default { + text-align: center; +} + +.align-right { + text-align: right; +} + +/* -- sidebars -------------------------------------------------------------- */ + +div.sidebar, +aside.sidebar { + margin: 0 0 0.5em 1em; + border: 1px solid #ddb; + padding: 7px; + background-color: #ffe; + width: 40%; + float: right; + clear: right; + overflow-x: auto; +} + +p.sidebar-title { + font-weight: bold; +} +div.admonition, div.topic, blockquote { + clear: left; +} + +/* -- topics ---------------------------------------------------------------- */ +div.topic { + border: 1px solid #ccc; + padding: 7px; + margin: 10px 0 10px 0; +} + +p.topic-title { + font-size: 1.1em; + font-weight: bold; + margin-top: 10px; +} + +/* -- admonitions ----------------------------------------------------------- */ + +div.admonition { + margin-top: 10px; + margin-bottom: 10px; + padding: 7px; +} + +div.admonition dt { + font-weight: bold; +} + +p.admonition-title { + margin: 0px 10px 5px 0px; + font-weight: bold; +} + +div.body p.centered { + text-align: center; + margin-top: 25px; +} + +/* -- content of sidebars/topics/admonitions -------------------------------- */ + +div.sidebar > :last-child, +aside.sidebar > :last-child, +div.topic > :last-child, +div.admonition > :last-child { + margin-bottom: 0; +} + +div.sidebar::after, +aside.sidebar::after, +div.topic::after, +div.admonition::after, +blockquote::after { + display: block; + content: ''; + clear: both; +} + +/* -- tables ---------------------------------------------------------------- */ + +table.docutils { + margin-top: 10px; + margin-bottom: 10px; + border: 0; + border-collapse: collapse; +} + +table.align-center { + margin-left: auto; + margin-right: auto; +} + +table.align-default { + margin-left: auto; + margin-right: auto; +} + +table caption span.caption-number { + font-style: italic; +} + +table caption span.caption-text { +} + +table.docutils td, table.docutils th { + padding: 1px 8px 1px 5px; + border-top: 0; + border-left: 0; + border-right: 0; + border-bottom: 1px solid #aaa; +} + +th { + text-align: left; + padding-right: 5px; +} + +table.citation { + border-left: solid 1px gray; + margin-left: 1px; +} + +table.citation td { + border-bottom: none; +} + +th > :first-child, +td > :first-child { + margin-top: 0px; +} + +th > :last-child, +td > :last-child { + margin-bottom: 0px; +} + +/* -- figures --------------------------------------------------------------- */ + +div.figure, figure { + margin: 0.5em; + padding: 0.5em; +} + +div.figure p.caption, figcaption { + padding: 0.3em; +} + +div.figure p.caption span.caption-number, +figcaption span.caption-number { + font-style: italic; +} + +div.figure p.caption span.caption-text, +figcaption span.caption-text { +} + +/* -- field list styles ----------------------------------------------------- */ + +table.field-list td, table.field-list th { + border: 0 !important; +} + +.field-list ul { + margin: 0; + padding-left: 1em; +} + +.field-list p { + margin: 0; +} + +.field-name { + -moz-hyphens: manual; + -ms-hyphens: manual; + -webkit-hyphens: manual; + hyphens: manual; +} + +/* -- hlist styles ---------------------------------------------------------- */ + +table.hlist { + margin: 1em 0; +} + +table.hlist td { + vertical-align: top; +} + +/* -- object description styles --------------------------------------------- */ + +.sig { + font-family: 'Consolas', 'Menlo', 'DejaVu Sans Mono', 'Bitstream Vera Sans Mono', monospace; +} + +.sig-name, code.descname { + background-color: transparent; + font-weight: bold; +} + +.sig-name { + font-size: 1.1em; +} + +code.descname { + font-size: 1.2em; +} + +.sig-prename, code.descclassname { + background-color: transparent; +} + +.optional { + font-size: 1.3em; +} + +.sig-paren { + font-size: larger; +} + +.sig-param.n { + font-style: italic; +} + +/* C++ specific styling */ + +.sig-inline.c-texpr, +.sig-inline.cpp-texpr { + font-family: unset; +} + +.sig.c .k, .sig.c .kt, +.sig.cpp .k, .sig.cpp .kt { + color: #0033B3; +} + +.sig.c .m, +.sig.cpp .m { + color: #1750EB; +} + +.sig.c .s, .sig.c .sc, +.sig.cpp .s, .sig.cpp .sc { + color: #067D17; +} + + +/* -- other body styles ----------------------------------------------------- */ + +ol.arabic { + list-style: decimal; +} + +ol.loweralpha { + list-style: lower-alpha; +} + +ol.upperalpha { + list-style: upper-alpha; +} + +ol.lowerroman { + list-style: lower-roman; +} + +ol.upperroman { + list-style: upper-roman; +} + +:not(li) > ol > li:first-child > :first-child, +:not(li) > ul > li:first-child > :first-child { + margin-top: 0px; +} + +:not(li) > ol > li:last-child > :last-child, +:not(li) > ul > li:last-child > :last-child { + margin-bottom: 0px; +} + +ol.simple ol p, +ol.simple ul p, +ul.simple ol p, +ul.simple ul p { + margin-top: 0; +} + +ol.simple > li:not(:first-child) > p, +ul.simple > li:not(:first-child) > p { + margin-top: 0; +} + +ol.simple p, +ul.simple p { + margin-bottom: 0; +} +dl.footnote > dt, +dl.citation > dt { + float: left; + margin-right: 0.5em; +} + +dl.footnote > dd, +dl.citation > dd { + margin-bottom: 0em; +} + +dl.footnote > dd:after, +dl.citation > dd:after { + content: ""; + clear: both; +} + +dl.field-list { + display: grid; + grid-template-columns: fit-content(30%) auto; +} + +dl.field-list > dt { + font-weight: bold; + word-break: break-word; + padding-left: 0.5em; + padding-right: 5px; +} +dl.field-list > dt:after { + content: ":"; +} + + +dl.field-list > dd { + padding-left: 0.5em; + margin-top: 0em; + margin-left: 0em; + margin-bottom: 0em; +} + +dl { + margin-bottom: 15px; +} + +dd > :first-child { + margin-top: 0px; +} + +dd ul, dd table { + margin-bottom: 10px; +} + +dd { + margin-top: 3px; + margin-bottom: 10px; + margin-left: 30px; +} + +dl > dd:last-child, +dl > dd:last-child > :last-child { + margin-bottom: 0; +} + +dt:target, span.highlighted { + background-color: #fbe54e; +} + +rect.highlighted { + fill: #fbe54e; +} + +dl.glossary dt { + font-weight: bold; + font-size: 1.1em; +} + +.versionmodified { + font-style: italic; +} + +.system-message { + background-color: #fda; + padding: 5px; + border: 3px solid red; +} + +.footnote:target { + background-color: #ffa; +} + +.line-block { + display: block; + margin-top: 1em; + margin-bottom: 1em; +} + +.line-block .line-block { + margin-top: 0; + margin-bottom: 0; + margin-left: 1.5em; +} + +.guilabel, .menuselection { + font-family: sans-serif; +} + +.accelerator { + text-decoration: underline; +} + +.classifier { + font-style: oblique; +} + +.classifier:before { + font-style: normal; + margin: 0 0.5em; + content: ":"; + display: inline-block; +} + +abbr, acronym { + border-bottom: dotted 1px; + cursor: help; +} + +/* -- code displays --------------------------------------------------------- */ + +pre { + overflow: auto; + overflow-y: hidden; /* fixes display issues on Chrome browsers */ +} + +pre, div[class*="highlight-"] { + clear: both; +} + +span.pre { + -moz-hyphens: none; + -ms-hyphens: none; + -webkit-hyphens: none; + hyphens: none; + white-space: nowrap; +} + +div[class*="highlight-"] { + margin: 1em 0; +} + +td.linenos pre { + border: 0; + background-color: transparent; + color: #aaa; +} + +table.highlighttable { + display: block; +} + +table.highlighttable tbody { + display: block; +} + +table.highlighttable tr { + display: flex; +} + +table.highlighttable td { + margin: 0; + padding: 0; +} + +table.highlighttable td.linenos { + padding-right: 0.5em; +} + +table.highlighttable td.code { + flex: 1; + overflow: hidden; +} + +.highlight .hll { + display: block; +} + +div.highlight pre, +table.highlighttable pre { + margin: 0; +} + +div.code-block-caption + div { + margin-top: 0; +} + +div.code-block-caption { + margin-top: 1em; + padding: 2px 5px; + font-size: small; +} + +div.code-block-caption code { + background-color: transparent; +} + +table.highlighttable td.linenos, +span.linenos, +div.highlight span.gp { /* gp: Generic.Prompt */ + user-select: none; + -webkit-user-select: text; /* Safari fallback only */ + -webkit-user-select: none; /* Chrome/Safari */ + -moz-user-select: none; /* Firefox */ + -ms-user-select: none; /* IE10+ */ +} + +div.code-block-caption span.caption-number { + padding: 0.1em 0.3em; + font-style: italic; +} + +div.code-block-caption span.caption-text { +} + +div.literal-block-wrapper { + margin: 1em 0; +} + +code.xref, a code { + background-color: transparent; + font-weight: bold; +} + +h1 code, h2 code, h3 code, h4 code, h5 code, h6 code { + background-color: transparent; +} + +.viewcode-link { + float: right; +} + +.viewcode-back { + float: right; + font-family: sans-serif; +} + +div.viewcode-block:target { + margin: -1px -10px; + padding: 0 10px; +} + +/* -- math display ---------------------------------------------------------- */ + +img.math { + vertical-align: middle; +} + +div.body div.math p { + text-align: center; +} + +span.eqno { + float: right; +} + +span.eqno a.headerlink { + position: absolute; + z-index: 1; +} + +div.math:hover a.headerlink { + visibility: visible; +} + +/* -- printout stylesheet --------------------------------------------------- */ + +@media print { + div.document, + div.documentwrapper, + div.bodywrapper { + margin: 0 !important; + width: 100%; + } + + div.sphinxsidebar, + div.related, + div.footer, + #top-link { + display: none; + } +} \ No newline at end of file diff --git a/docs-archive/helm-chart/1.14.0/_static/check-solid.svg b/docs-archive/helm-chart/1.14.0/_static/check-solid.svg new file mode 100644 index 00000000000..92fad4b5c0b --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_static/check-solid.svg @@ -0,0 +1,4 @@ + + + + diff --git a/docs-archive/helm-chart/1.14.0/_static/clipboard.min.js b/docs-archive/helm-chart/1.14.0/_static/clipboard.min.js new file mode 100644 index 00000000000..54b3c463811 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_static/clipboard.min.js @@ -0,0 +1,7 @@ +/*! + * clipboard.js v2.0.8 + * https://clipboardjs.com/ + * + * Licensed MIT © Zeno Rocha + */ +!function(t,e){"object"==typeof exports&&"object"==typeof module?module.exports=e():"function"==typeof define&&define.amd?define([],e):"object"==typeof exports?exports.ClipboardJS=e():t.ClipboardJS=e()}(this,function(){return n={686:function(t,e,n){"use strict";n.d(e,{default:function(){return o}});var e=n(279),i=n.n(e),e=n(370),u=n.n(e),e=n(817),c=n.n(e);function a(t){try{return document.execCommand(t)}catch(t){return}}var f=function(t){t=c()(t);return a("cut"),t};var l=function(t){var e,n,o,r=1 + + + + diff --git a/docs-archive/helm-chart/1.14.0/_static/copybutton.css b/docs-archive/helm-chart/1.14.0/_static/copybutton.css new file mode 100644 index 00000000000..f1916ec7d1b --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_static/copybutton.css @@ -0,0 +1,94 @@ +/* Copy buttons */ +button.copybtn { + position: absolute; + display: flex; + top: .3em; + right: .3em; + width: 1.7em; + height: 1.7em; + opacity: 0; + transition: opacity 0.3s, border .3s, background-color .3s; + user-select: none; + padding: 0; + border: none; + outline: none; + border-radius: 0.4em; + /* The colors that GitHub uses */ + border: #1b1f2426 1px solid; + background-color: #f6f8fa; + color: #57606a; +} + +button.copybtn.success { + border-color: #22863a; + color: #22863a; +} + +button.copybtn svg { + stroke: currentColor; + width: 1.5em; + height: 1.5em; + padding: 0.1em; +} + +div.highlight { + position: relative; +} + +/* Show the copybutton */ +.highlight:hover button.copybtn, button.copybtn.success { + opacity: 1; +} + +.highlight button.copybtn:hover { + background-color: rgb(235, 235, 235); +} + +.highlight button.copybtn:active { + background-color: rgb(187, 187, 187); +} + +/** + * A minimal CSS-only tooltip copied from: + * https://codepen.io/mildrenben/pen/rVBrpK + * + * To use, write HTML like the following: + * + *

Short

+ */ + .o-tooltip--left { + position: relative; + } + + .o-tooltip--left:after { + opacity: 0; + visibility: hidden; + position: absolute; + content: attr(data-tooltip); + padding: .2em; + font-size: .8em; + left: -.2em; + background: grey; + color: white; + white-space: nowrap; + z-index: 2; + border-radius: 2px; + transform: translateX(-102%) translateY(0); + transition: opacity 0.2s cubic-bezier(0.64, 0.09, 0.08, 1), transform 0.2s cubic-bezier(0.64, 0.09, 0.08, 1); +} + +.o-tooltip--left:hover:after { + display: block; + opacity: 1; + visibility: visible; + transform: translateX(-100%) translateY(0); + transition: opacity 0.2s cubic-bezier(0.64, 0.09, 0.08, 1), transform 0.2s cubic-bezier(0.64, 0.09, 0.08, 1); + transition-delay: .5s; +} + +/* By default the copy button shouldn't show up when printing a page */ +@media print { + button.copybtn { + display: none; + } +} diff --git a/docs-archive/helm-chart/1.14.0/_static/copybutton.js b/docs-archive/helm-chart/1.14.0/_static/copybutton.js new file mode 100644 index 00000000000..2ea7ff3e217 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_static/copybutton.js @@ -0,0 +1,248 @@ +// Localization support +const messages = { + 'en': { + 'copy': 'Copy', + 'copy_to_clipboard': 'Copy to clipboard', + 'copy_success': 'Copied!', + 'copy_failure': 'Failed to copy', + }, + 'es' : { + 'copy': 'Copiar', + 'copy_to_clipboard': 'Copiar al portapapeles', + 'copy_success': '¡Copiado!', + 'copy_failure': 'Error al copiar', + }, + 'de' : { + 'copy': 'Kopieren', + 'copy_to_clipboard': 'In die Zwischenablage kopieren', + 'copy_success': 'Kopiert!', + 'copy_failure': 'Fehler beim Kopieren', + }, + 'fr' : { + 'copy': 'Copier', + 'copy_to_clipboard': 'Copier dans le presse-papier', + 'copy_success': 'Copié !', + 'copy_failure': 'Échec de la copie', + }, + 'ru': { + 'copy': 'Скопировать', + 'copy_to_clipboard': 'Скопировать в буфер', + 'copy_success': 'Скопировано!', + 'copy_failure': 'Не удалось скопировать', + }, + 'zh-CN': { + 'copy': '复制', + 'copy_to_clipboard': '复制到剪贴板', + 'copy_success': '复制成功!', + 'copy_failure': '复制失败', + }, + 'it' : { + 'copy': 'Copiare', + 'copy_to_clipboard': 'Copiato negli appunti', + 'copy_success': 'Copiato!', + 'copy_failure': 'Errore durante la copia', + } +} + +let locale = 'en' +if( document.documentElement.lang !== undefined + && messages[document.documentElement.lang] !== undefined ) { + locale = document.documentElement.lang +} + +let doc_url_root = DOCUMENTATION_OPTIONS.URL_ROOT; +if (doc_url_root == '#') { + doc_url_root = ''; +} + +/** + * SVG files for our copy buttons + */ +let iconCheck = ` + ${messages[locale]['copy_success']} + + +` + +// If the user specified their own SVG use that, otherwise use the default +let iconCopy = ``; +if (!iconCopy) { + iconCopy = ` + ${messages[locale]['copy_to_clipboard']} + + + +` +} + +/** + * Set up copy/paste for code blocks + */ + +const runWhenDOMLoaded = cb => { + if (document.readyState != 'loading') { + cb() + } else if (document.addEventListener) { + document.addEventListener('DOMContentLoaded', cb) + } else { + document.attachEvent('onreadystatechange', function() { + if (document.readyState == 'complete') cb() + }) + } +} + +const codeCellId = index => `codecell${index}` + +// Clears selected text since ClipboardJS will select the text when copying +const clearSelection = () => { + if (window.getSelection) { + window.getSelection().removeAllRanges() + } else if (document.selection) { + document.selection.empty() + } +} + +// Changes tooltip text for a moment, then changes it back +// We want the timeout of our `success` class to be a bit shorter than the +// tooltip and icon change, so that we can hide the icon before changing back. +var timeoutIcon = 2000; +var timeoutSuccessClass = 1500; + +const temporarilyChangeTooltip = (el, oldText, newText) => { + el.setAttribute('data-tooltip', newText) + el.classList.add('success') + // Remove success a little bit sooner than we change the tooltip + // So that we can use CSS to hide the copybutton first + setTimeout(() => el.classList.remove('success'), timeoutSuccessClass) + setTimeout(() => el.setAttribute('data-tooltip', oldText), timeoutIcon) +} + +// Changes the copy button icon for two seconds, then changes it back +const temporarilyChangeIcon = (el) => { + el.innerHTML = iconCheck; + setTimeout(() => {el.innerHTML = iconCopy}, timeoutIcon) +} + +const addCopyButtonToCodeCells = () => { + // If ClipboardJS hasn't loaded, wait a bit and try again. This + // happens because we load ClipboardJS asynchronously. + if (window.ClipboardJS === undefined) { + setTimeout(addCopyButtonToCodeCells, 250) + return + } + + // Add copybuttons to all of our code cells + const COPYBUTTON_SELECTOR = 'div.highlight pre'; + const codeCells = document.querySelectorAll(COPYBUTTON_SELECTOR) + codeCells.forEach((codeCell, index) => { + const id = codeCellId(index) + codeCell.setAttribute('id', id) + + const clipboardButton = id => + `` + codeCell.insertAdjacentHTML('afterend', clipboardButton(id)) + }) + +function escapeRegExp(string) { + return string.replace(/[.*+?^${}()|[\]\\]/g, '\\$&'); // $& means the whole matched string +} + +/** + * Removes excluded text from a Node. + * + * @param {Node} target Node to filter. + * @param {string} exclude CSS selector of nodes to exclude. + * @returns {DOMString} Text from `target` with text removed. + */ +function filterText(target, exclude) { + const clone = target.cloneNode(true); // clone as to not modify the live DOM + if (exclude) { + // remove excluded nodes + clone.querySelectorAll(exclude).forEach(node => node.remove()); + } + return clone.innerText; +} + +// Callback when a copy button is clicked. Will be passed the node that was clicked +// should then grab the text and replace pieces of text that shouldn't be used in output +function formatCopyText(textContent, copybuttonPromptText, isRegexp = false, onlyCopyPromptLines = true, removePrompts = true, copyEmptyLines = true, lineContinuationChar = "", hereDocDelim = "") { + var regexp; + var match; + + // Do we check for line continuation characters and "HERE-documents"? + var useLineCont = !!lineContinuationChar + var useHereDoc = !!hereDocDelim + + // create regexp to capture prompt and remaining line + if (isRegexp) { + regexp = new RegExp('^(' + copybuttonPromptText + ')(.*)') + } else { + regexp = new RegExp('^(' + escapeRegExp(copybuttonPromptText) + ')(.*)') + } + + const outputLines = []; + var promptFound = false; + var gotLineCont = false; + var gotHereDoc = false; + const lineGotPrompt = []; + for (const line of textContent.split('\n')) { + match = line.match(regexp) + if (match || gotLineCont || gotHereDoc) { + promptFound = regexp.test(line) + lineGotPrompt.push(promptFound) + if (removePrompts && promptFound) { + outputLines.push(match[2]) + } else { + outputLines.push(line) + } + gotLineCont = line.endsWith(lineContinuationChar) & useLineCont + if (line.includes(hereDocDelim) & useHereDoc) + gotHereDoc = !gotHereDoc + } else if (!onlyCopyPromptLines) { + outputLines.push(line) + } else if (copyEmptyLines && line.trim() === '') { + outputLines.push(line) + } + } + + // If no lines with the prompt were found then just use original lines + if (lineGotPrompt.some(v => v === true)) { + textContent = outputLines.join('\n'); + } + + // Remove a trailing newline to avoid auto-running when pasting + if (textContent.endsWith("\n")) { + textContent = textContent.slice(0, -1) + } + return textContent +} + + +var copyTargetText = (trigger) => { + var target = document.querySelector(trigger.attributes['data-clipboard-target'].value); + + // get filtered text + let exclude = '.linenos'; + + let text = filterText(target, exclude); + return formatCopyText(text, '', false, true, true, true, '', '') +} + + // Initialize with a callback so we can modify the text before copy + const clipboard = new ClipboardJS('.copybtn', {text: copyTargetText}) + + // Update UI with error/success messages + clipboard.on('success', event => { + clearSelection() + temporarilyChangeTooltip(event.trigger, messages[locale]['copy'], messages[locale]['copy_success']) + temporarilyChangeIcon(event.trigger) + }) + + clipboard.on('error', event => { + temporarilyChangeTooltip(event.trigger, messages[locale]['copy'], messages[locale]['copy_failure']) + }) +} + +runWhenDOMLoaded(addCopyButtonToCodeCells) \ No newline at end of file diff --git a/docs-archive/helm-chart/1.14.0/_static/copybutton_funcs.js b/docs-archive/helm-chart/1.14.0/_static/copybutton_funcs.js new file mode 100644 index 00000000000..dbe1aaad79c --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_static/copybutton_funcs.js @@ -0,0 +1,73 @@ +function escapeRegExp(string) { + return string.replace(/[.*+?^${}()|[\]\\]/g, '\\$&'); // $& means the whole matched string +} + +/** + * Removes excluded text from a Node. + * + * @param {Node} target Node to filter. + * @param {string} exclude CSS selector of nodes to exclude. + * @returns {DOMString} Text from `target` with text removed. + */ +export function filterText(target, exclude) { + const clone = target.cloneNode(true); // clone as to not modify the live DOM + if (exclude) { + // remove excluded nodes + clone.querySelectorAll(exclude).forEach(node => node.remove()); + } + return clone.innerText; +} + +// Callback when a copy button is clicked. Will be passed the node that was clicked +// should then grab the text and replace pieces of text that shouldn't be used in output +export function formatCopyText(textContent, copybuttonPromptText, isRegexp = false, onlyCopyPromptLines = true, removePrompts = true, copyEmptyLines = true, lineContinuationChar = "", hereDocDelim = "") { + var regexp; + var match; + + // Do we check for line continuation characters and "HERE-documents"? + var useLineCont = !!lineContinuationChar + var useHereDoc = !!hereDocDelim + + // create regexp to capture prompt and remaining line + if (isRegexp) { + regexp = new RegExp('^(' + copybuttonPromptText + ')(.*)') + } else { + regexp = new RegExp('^(' + escapeRegExp(copybuttonPromptText) + ')(.*)') + } + + const outputLines = []; + var promptFound = false; + var gotLineCont = false; + var gotHereDoc = false; + const lineGotPrompt = []; + for (const line of textContent.split('\n')) { + match = line.match(regexp) + if (match || gotLineCont || gotHereDoc) { + promptFound = regexp.test(line) + lineGotPrompt.push(promptFound) + if (removePrompts && promptFound) { + outputLines.push(match[2]) + } else { + outputLines.push(line) + } + gotLineCont = line.endsWith(lineContinuationChar) & useLineCont + if (line.includes(hereDocDelim) & useHereDoc) + gotHereDoc = !gotHereDoc + } else if (!onlyCopyPromptLines) { + outputLines.push(line) + } else if (copyEmptyLines && line.trim() === '') { + outputLines.push(line) + } + } + + // If no lines with the prompt were found then just use original lines + if (lineGotPrompt.some(v => v === true)) { + textContent = outputLines.join('\n'); + } + + // Remove a trailing newline to avoid auto-running when pasting + if (textContent.endsWith("\n")) { + textContent = textContent.slice(0, -1) + } + return textContent +} diff --git a/docs-archive/helm-chart/1.14.0/_static/custom.css b/docs-archive/helm-chart/1.14.0/_static/custom.css new file mode 100644 index 00000000000..b1cf49f37d4 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_static/custom.css @@ -0,0 +1,33 @@ +/*! + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, + * software distributed under the License is distributed on an + * "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY + * KIND, either express or implied. See the License for the + * specific language governing permissions and limitations + * under the License. + */ + + /* + This file contains style overrides for the sphinx-design extension. + + The original defaults can be found here: + https://sphinx-design.readthedocs.io/en/alabaster-theme/css_variables.html + */ + +:root { + --sd-color-tabs-label-active: #017cee; + --sd-color-tabs-label-hover: #68d1ff; + --sd-color-tabs-underline-active: #017cee; + --sd-color-tabs-underline-hover: #68d1ff; + --sd-color-tabs-underline: transparent; +} diff --git a/docs-archive/helm-chart/1.14.0/_static/design-style.1e8bd061cd6da7fc9cf755528e8ffc24.min.css b/docs-archive/helm-chart/1.14.0/_static/design-style.1e8bd061cd6da7fc9cf755528e8ffc24.min.css new file mode 100644 index 00000000000..eb19f698afc --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_static/design-style.1e8bd061cd6da7fc9cf755528e8ffc24.min.css @@ -0,0 +1 @@ +.sd-bg-primary{background-color:var(--sd-color-primary) !important}.sd-bg-text-primary{color:var(--sd-color-primary-text) !important}button.sd-bg-primary:focus,button.sd-bg-primary:hover{background-color:var(--sd-color-primary-highlight) !important}a.sd-bg-primary:focus,a.sd-bg-primary:hover{background-color:var(--sd-color-primary-highlight) !important}.sd-bg-secondary{background-color:var(--sd-color-secondary) !important}.sd-bg-text-secondary{color:var(--sd-color-secondary-text) !important}button.sd-bg-secondary:focus,button.sd-bg-secondary:hover{background-color:var(--sd-color-secondary-highlight) !important}a.sd-bg-secondary:focus,a.sd-bg-secondary:hover{background-color:var(--sd-color-secondary-highlight) !important}.sd-bg-success{background-color:var(--sd-color-success) !important}.sd-bg-text-success{color:var(--sd-color-success-text) !important}button.sd-bg-success:focus,button.sd-bg-success:hover{background-color:var(--sd-color-success-highlight) !important}a.sd-bg-success:focus,a.sd-bg-success:hover{background-color:var(--sd-color-success-highlight) !important}.sd-bg-info{background-color:var(--sd-color-info) !important}.sd-bg-text-info{color:var(--sd-color-info-text) !important}button.sd-bg-info:focus,button.sd-bg-info:hover{background-color:var(--sd-color-info-highlight) !important}a.sd-bg-info:focus,a.sd-bg-info:hover{background-color:var(--sd-color-info-highlight) !important}.sd-bg-warning{background-color:var(--sd-color-warning) !important}.sd-bg-text-warning{color:var(--sd-color-warning-text) !important}button.sd-bg-warning:focus,button.sd-bg-warning:hover{background-color:var(--sd-color-warning-highlight) !important}a.sd-bg-warning:focus,a.sd-bg-warning:hover{background-color:var(--sd-color-warning-highlight) !important}.sd-bg-danger{background-color:var(--sd-color-danger) !important}.sd-bg-text-danger{color:var(--sd-color-danger-text) !important}button.sd-bg-danger:focus,button.sd-bg-danger:hover{background-color:var(--sd-color-danger-highlight) !important}a.sd-bg-danger:focus,a.sd-bg-danger:hover{background-color:var(--sd-color-danger-highlight) !important}.sd-bg-light{background-color:var(--sd-color-light) !important}.sd-bg-text-light{color:var(--sd-color-light-text) !important}button.sd-bg-light:focus,button.sd-bg-light:hover{background-color:var(--sd-color-light-highlight) !important}a.sd-bg-light:focus,a.sd-bg-light:hover{background-color:var(--sd-color-light-highlight) !important}.sd-bg-muted{background-color:var(--sd-color-muted) !important}.sd-bg-text-muted{color:var(--sd-color-muted-text) !important}button.sd-bg-muted:focus,button.sd-bg-muted:hover{background-color:var(--sd-color-muted-highlight) !important}a.sd-bg-muted:focus,a.sd-bg-muted:hover{background-color:var(--sd-color-muted-highlight) !important}.sd-bg-dark{background-color:var(--sd-color-dark) !important}.sd-bg-text-dark{color:var(--sd-color-dark-text) !important}button.sd-bg-dark:focus,button.sd-bg-dark:hover{background-color:var(--sd-color-dark-highlight) !important}a.sd-bg-dark:focus,a.sd-bg-dark:hover{background-color:var(--sd-color-dark-highlight) !important}.sd-bg-black{background-color:var(--sd-color-black) !important}.sd-bg-text-black{color:var(--sd-color-black-text) !important}button.sd-bg-black:focus,button.sd-bg-black:hover{background-color:var(--sd-color-black-highlight) !important}a.sd-bg-black:focus,a.sd-bg-black:hover{background-color:var(--sd-color-black-highlight) !important}.sd-bg-white{background-color:var(--sd-color-white) !important}.sd-bg-text-white{color:var(--sd-color-white-text) !important}button.sd-bg-white:focus,button.sd-bg-white:hover{background-color:var(--sd-color-white-highlight) !important}a.sd-bg-white:focus,a.sd-bg-white:hover{background-color:var(--sd-color-white-highlight) !important}.sd-text-primary,.sd-text-primary>p{color:var(--sd-color-primary) !important}a.sd-text-primary:focus,a.sd-text-primary:hover{color:var(--sd-color-primary-highlight) !important}.sd-text-secondary,.sd-text-secondary>p{color:var(--sd-color-secondary) !important}a.sd-text-secondary:focus,a.sd-text-secondary:hover{color:var(--sd-color-secondary-highlight) !important}.sd-text-success,.sd-text-success>p{color:var(--sd-color-success) !important}a.sd-text-success:focus,a.sd-text-success:hover{color:var(--sd-color-success-highlight) !important}.sd-text-info,.sd-text-info>p{color:var(--sd-color-info) !important}a.sd-text-info:focus,a.sd-text-info:hover{color:var(--sd-color-info-highlight) !important}.sd-text-warning,.sd-text-warning>p{color:var(--sd-color-warning) !important}a.sd-text-warning:focus,a.sd-text-warning:hover{color:var(--sd-color-warning-highlight) !important}.sd-text-danger,.sd-text-danger>p{color:var(--sd-color-danger) !important}a.sd-text-danger:focus,a.sd-text-danger:hover{color:var(--sd-color-danger-highlight) !important}.sd-text-light,.sd-text-light>p{color:var(--sd-color-light) !important}a.sd-text-light:focus,a.sd-text-light:hover{color:var(--sd-color-light-highlight) !important}.sd-text-muted,.sd-text-muted>p{color:var(--sd-color-muted) !important}a.sd-text-muted:focus,a.sd-text-muted:hover{color:var(--sd-color-muted-highlight) !important}.sd-text-dark,.sd-text-dark>p{color:var(--sd-color-dark) !important}a.sd-text-dark:focus,a.sd-text-dark:hover{color:var(--sd-color-dark-highlight) !important}.sd-text-black,.sd-text-black>p{color:var(--sd-color-black) !important}a.sd-text-black:focus,a.sd-text-black:hover{color:var(--sd-color-black-highlight) !important}.sd-text-white,.sd-text-white>p{color:var(--sd-color-white) !important}a.sd-text-white:focus,a.sd-text-white:hover{color:var(--sd-color-white-highlight) !important}.sd-outline-primary{border-color:var(--sd-color-primary) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-primary:focus,a.sd-outline-primary:hover{border-color:var(--sd-color-primary-highlight) !important}.sd-outline-secondary{border-color:var(--sd-color-secondary) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-secondary:focus,a.sd-outline-secondary:hover{border-color:var(--sd-color-secondary-highlight) !important}.sd-outline-success{border-color:var(--sd-color-success) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-success:focus,a.sd-outline-success:hover{border-color:var(--sd-color-success-highlight) !important}.sd-outline-info{border-color:var(--sd-color-info) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-info:focus,a.sd-outline-info:hover{border-color:var(--sd-color-info-highlight) !important}.sd-outline-warning{border-color:var(--sd-color-warning) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-warning:focus,a.sd-outline-warning:hover{border-color:var(--sd-color-warning-highlight) !important}.sd-outline-danger{border-color:var(--sd-color-danger) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-danger:focus,a.sd-outline-danger:hover{border-color:var(--sd-color-danger-highlight) !important}.sd-outline-light{border-color:var(--sd-color-light) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-light:focus,a.sd-outline-light:hover{border-color:var(--sd-color-light-highlight) !important}.sd-outline-muted{border-color:var(--sd-color-muted) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-muted:focus,a.sd-outline-muted:hover{border-color:var(--sd-color-muted-highlight) !important}.sd-outline-dark{border-color:var(--sd-color-dark) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-dark:focus,a.sd-outline-dark:hover{border-color:var(--sd-color-dark-highlight) !important}.sd-outline-black{border-color:var(--sd-color-black) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-black:focus,a.sd-outline-black:hover{border-color:var(--sd-color-black-highlight) !important}.sd-outline-white{border-color:var(--sd-color-white) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-white:focus,a.sd-outline-white:hover{border-color:var(--sd-color-white-highlight) !important}.sd-bg-transparent{background-color:transparent !important}.sd-outline-transparent{border-color:transparent !important}.sd-text-transparent{color:transparent !important}.sd-p-0{padding:0 !important}.sd-pt-0,.sd-py-0{padding-top:0 !important}.sd-pr-0,.sd-px-0{padding-right:0 !important}.sd-pb-0,.sd-py-0{padding-bottom:0 !important}.sd-pl-0,.sd-px-0{padding-left:0 !important}.sd-p-1{padding:.25rem !important}.sd-pt-1,.sd-py-1{padding-top:.25rem !important}.sd-pr-1,.sd-px-1{padding-right:.25rem !important}.sd-pb-1,.sd-py-1{padding-bottom:.25rem !important}.sd-pl-1,.sd-px-1{padding-left:.25rem !important}.sd-p-2{padding:.5rem !important}.sd-pt-2,.sd-py-2{padding-top:.5rem !important}.sd-pr-2,.sd-px-2{padding-right:.5rem !important}.sd-pb-2,.sd-py-2{padding-bottom:.5rem !important}.sd-pl-2,.sd-px-2{padding-left:.5rem !important}.sd-p-3{padding:1rem !important}.sd-pt-3,.sd-py-3{padding-top:1rem !important}.sd-pr-3,.sd-px-3{padding-right:1rem !important}.sd-pb-3,.sd-py-3{padding-bottom:1rem !important}.sd-pl-3,.sd-px-3{padding-left:1rem !important}.sd-p-4{padding:1.5rem !important}.sd-pt-4,.sd-py-4{padding-top:1.5rem !important}.sd-pr-4,.sd-px-4{padding-right:1.5rem !important}.sd-pb-4,.sd-py-4{padding-bottom:1.5rem !important}.sd-pl-4,.sd-px-4{padding-left:1.5rem !important}.sd-p-5{padding:3rem !important}.sd-pt-5,.sd-py-5{padding-top:3rem !important}.sd-pr-5,.sd-px-5{padding-right:3rem !important}.sd-pb-5,.sd-py-5{padding-bottom:3rem !important}.sd-pl-5,.sd-px-5{padding-left:3rem !important}.sd-m-auto{margin:auto !important}.sd-mt-auto,.sd-my-auto{margin-top:auto !important}.sd-mr-auto,.sd-mx-auto{margin-right:auto !important}.sd-mb-auto,.sd-my-auto{margin-bottom:auto !important}.sd-ml-auto,.sd-mx-auto{margin-left:auto !important}.sd-m-0{margin:0 !important}.sd-mt-0,.sd-my-0{margin-top:0 !important}.sd-mr-0,.sd-mx-0{margin-right:0 !important}.sd-mb-0,.sd-my-0{margin-bottom:0 !important}.sd-ml-0,.sd-mx-0{margin-left:0 !important}.sd-m-1{margin:.25rem !important}.sd-mt-1,.sd-my-1{margin-top:.25rem !important}.sd-mr-1,.sd-mx-1{margin-right:.25rem !important}.sd-mb-1,.sd-my-1{margin-bottom:.25rem !important}.sd-ml-1,.sd-mx-1{margin-left:.25rem !important}.sd-m-2{margin:.5rem !important}.sd-mt-2,.sd-my-2{margin-top:.5rem !important}.sd-mr-2,.sd-mx-2{margin-right:.5rem !important}.sd-mb-2,.sd-my-2{margin-bottom:.5rem !important}.sd-ml-2,.sd-mx-2{margin-left:.5rem !important}.sd-m-3{margin:1rem !important}.sd-mt-3,.sd-my-3{margin-top:1rem !important}.sd-mr-3,.sd-mx-3{margin-right:1rem !important}.sd-mb-3,.sd-my-3{margin-bottom:1rem !important}.sd-ml-3,.sd-mx-3{margin-left:1rem !important}.sd-m-4{margin:1.5rem !important}.sd-mt-4,.sd-my-4{margin-top:1.5rem !important}.sd-mr-4,.sd-mx-4{margin-right:1.5rem !important}.sd-mb-4,.sd-my-4{margin-bottom:1.5rem !important}.sd-ml-4,.sd-mx-4{margin-left:1.5rem !important}.sd-m-5{margin:3rem !important}.sd-mt-5,.sd-my-5{margin-top:3rem !important}.sd-mr-5,.sd-mx-5{margin-right:3rem !important}.sd-mb-5,.sd-my-5{margin-bottom:3rem !important}.sd-ml-5,.sd-mx-5{margin-left:3rem !important}.sd-w-25{width:25% !important}.sd-w-50{width:50% !important}.sd-w-75{width:75% !important}.sd-w-100{width:100% !important}.sd-w-auto{width:auto !important}.sd-h-25{height:25% !important}.sd-h-50{height:50% !important}.sd-h-75{height:75% !important}.sd-h-100{height:100% !important}.sd-h-auto{height:auto !important}.sd-d-none{display:none !important}.sd-d-inline{display:inline !important}.sd-d-inline-block{display:inline-block !important}.sd-d-block{display:block !important}.sd-d-grid{display:grid !important}.sd-d-flex-row{display:-ms-flexbox !important;display:flex !important;flex-direction:row !important}.sd-d-flex-column{display:-ms-flexbox !important;display:flex !important;flex-direction:column !important}.sd-d-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}@media(min-width: 576px){.sd-d-sm-none{display:none !important}.sd-d-sm-inline{display:inline !important}.sd-d-sm-inline-block{display:inline-block !important}.sd-d-sm-block{display:block !important}.sd-d-sm-grid{display:grid !important}.sd-d-sm-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-sm-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 768px){.sd-d-md-none{display:none !important}.sd-d-md-inline{display:inline !important}.sd-d-md-inline-block{display:inline-block !important}.sd-d-md-block{display:block !important}.sd-d-md-grid{display:grid !important}.sd-d-md-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-md-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 992px){.sd-d-lg-none{display:none !important}.sd-d-lg-inline{display:inline !important}.sd-d-lg-inline-block{display:inline-block !important}.sd-d-lg-block{display:block !important}.sd-d-lg-grid{display:grid !important}.sd-d-lg-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-lg-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 1200px){.sd-d-xl-none{display:none !important}.sd-d-xl-inline{display:inline !important}.sd-d-xl-inline-block{display:inline-block !important}.sd-d-xl-block{display:block !important}.sd-d-xl-grid{display:grid !important}.sd-d-xl-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-xl-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}.sd-align-major-start{justify-content:flex-start !important}.sd-align-major-end{justify-content:flex-end !important}.sd-align-major-center{justify-content:center !important}.sd-align-major-justify{justify-content:space-between !important}.sd-align-major-spaced{justify-content:space-evenly !important}.sd-align-minor-start{align-items:flex-start !important}.sd-align-minor-end{align-items:flex-end !important}.sd-align-minor-center{align-items:center !important}.sd-align-minor-stretch{align-items:stretch !important}.sd-text-justify{text-align:justify !important}.sd-text-left{text-align:left !important}.sd-text-right{text-align:right !important}.sd-text-center{text-align:center !important}.sd-font-weight-light{font-weight:300 !important}.sd-font-weight-lighter{font-weight:lighter !important}.sd-font-weight-normal{font-weight:400 !important}.sd-font-weight-bold{font-weight:700 !important}.sd-font-weight-bolder{font-weight:bolder !important}.sd-font-italic{font-style:italic !important}.sd-text-decoration-none{text-decoration:none !important}.sd-text-lowercase{text-transform:lowercase !important}.sd-text-uppercase{text-transform:uppercase !important}.sd-text-capitalize{text-transform:capitalize !important}.sd-text-wrap{white-space:normal !important}.sd-text-nowrap{white-space:nowrap !important}.sd-text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.sd-fs-1,.sd-fs-1>p{font-size:calc(1.375rem + 1.5vw) !important;line-height:unset !important}.sd-fs-2,.sd-fs-2>p{font-size:calc(1.325rem + 0.9vw) !important;line-height:unset !important}.sd-fs-3,.sd-fs-3>p{font-size:calc(1.3rem + 0.6vw) !important;line-height:unset !important}.sd-fs-4,.sd-fs-4>p{font-size:calc(1.275rem + 0.3vw) !important;line-height:unset !important}.sd-fs-5,.sd-fs-5>p{font-size:1.25rem !important;line-height:unset !important}.sd-fs-6,.sd-fs-6>p{font-size:1rem !important;line-height:unset !important}.sd-border-0{border:0 solid !important}.sd-border-top-0{border-top:0 solid !important}.sd-border-bottom-0{border-bottom:0 solid !important}.sd-border-right-0{border-right:0 solid !important}.sd-border-left-0{border-left:0 solid !important}.sd-border-1{border:1px solid !important}.sd-border-top-1{border-top:1px solid !important}.sd-border-bottom-1{border-bottom:1px solid !important}.sd-border-right-1{border-right:1px solid !important}.sd-border-left-1{border-left:1px solid !important}.sd-border-2{border:2px solid !important}.sd-border-top-2{border-top:2px solid !important}.sd-border-bottom-2{border-bottom:2px solid !important}.sd-border-right-2{border-right:2px solid !important}.sd-border-left-2{border-left:2px solid !important}.sd-border-3{border:3px solid !important}.sd-border-top-3{border-top:3px solid !important}.sd-border-bottom-3{border-bottom:3px solid !important}.sd-border-right-3{border-right:3px solid !important}.sd-border-left-3{border-left:3px solid !important}.sd-border-4{border:4px solid !important}.sd-border-top-4{border-top:4px solid !important}.sd-border-bottom-4{border-bottom:4px solid !important}.sd-border-right-4{border-right:4px solid !important}.sd-border-left-4{border-left:4px solid !important}.sd-border-5{border:5px solid !important}.sd-border-top-5{border-top:5px solid !important}.sd-border-bottom-5{border-bottom:5px solid !important}.sd-border-right-5{border-right:5px solid !important}.sd-border-left-5{border-left:5px solid !important}.sd-rounded-0{border-radius:0 !important}.sd-rounded-1{border-radius:.2rem !important}.sd-rounded-2{border-radius:.3rem !important}.sd-rounded-3{border-radius:.5rem !important}.sd-rounded-pill{border-radius:50rem !important}.sd-rounded-circle{border-radius:50% !important}.shadow-none{box-shadow:none !important}.sd-shadow-sm{box-shadow:0 .125rem .25rem var(--sd-color-shadow) !important}.sd-shadow-md{box-shadow:0 .5rem 1rem var(--sd-color-shadow) !important}.sd-shadow-lg{box-shadow:0 1rem 3rem var(--sd-color-shadow) !important}@keyframes sd-slide-from-left{0%{transform:translateX(-100%)}100%{transform:translateX(0)}}@keyframes sd-slide-from-right{0%{transform:translateX(200%)}100%{transform:translateX(0)}}@keyframes sd-grow100{0%{transform:scale(0);opacity:.5}100%{transform:scale(1);opacity:1}}@keyframes sd-grow50{0%{transform:scale(0.5);opacity:.5}100%{transform:scale(1);opacity:1}}@keyframes sd-grow50-rot20{0%{transform:scale(0.5) rotateZ(-20deg);opacity:.5}75%{transform:scale(1) rotateZ(5deg);opacity:1}95%{transform:scale(1) rotateZ(-1deg);opacity:1}100%{transform:scale(1) rotateZ(0);opacity:1}}.sd-animate-slide-from-left{animation:1s ease-out 0s 1 normal none running sd-slide-from-left}.sd-animate-slide-from-right{animation:1s ease-out 0s 1 normal none running sd-slide-from-right}.sd-animate-grow100{animation:1s ease-out 0s 1 normal none running sd-grow100}.sd-animate-grow50{animation:1s ease-out 0s 1 normal none running sd-grow50}.sd-animate-grow50-rot20{animation:1s ease-out 0s 1 normal none running sd-grow50-rot20}.sd-badge{display:inline-block;padding:.35em .65em;font-size:.75em;font-weight:700;line-height:1;text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:.25rem}.sd-badge:empty{display:none}a.sd-badge{text-decoration:none}.sd-btn .sd-badge{position:relative;top:-1px}.sd-btn{background-color:transparent;border:1px solid transparent;border-radius:.25rem;cursor:pointer;display:inline-block;font-weight:400;font-size:1rem;line-height:1.5;padding:.375rem .75rem;text-align:center;text-decoration:none;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;vertical-align:middle;user-select:none;-moz-user-select:none;-ms-user-select:none;-webkit-user-select:none}.sd-btn:hover{text-decoration:none}@media(prefers-reduced-motion: reduce){.sd-btn{transition:none}}.sd-btn-primary,.sd-btn-outline-primary:hover,.sd-btn-outline-primary:focus{color:var(--sd-color-primary-text) !important;background-color:var(--sd-color-primary) !important;border-color:var(--sd-color-primary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-primary:hover,.sd-btn-primary:focus{color:var(--sd-color-primary-text) !important;background-color:var(--sd-color-primary-highlight) !important;border-color:var(--sd-color-primary-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-primary{color:var(--sd-color-primary) !important;border-color:var(--sd-color-primary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-secondary,.sd-btn-outline-secondary:hover,.sd-btn-outline-secondary:focus{color:var(--sd-color-secondary-text) !important;background-color:var(--sd-color-secondary) !important;border-color:var(--sd-color-secondary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-secondary:hover,.sd-btn-secondary:focus{color:var(--sd-color-secondary-text) !important;background-color:var(--sd-color-secondary-highlight) !important;border-color:var(--sd-color-secondary-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-secondary{color:var(--sd-color-secondary) !important;border-color:var(--sd-color-secondary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-success,.sd-btn-outline-success:hover,.sd-btn-outline-success:focus{color:var(--sd-color-success-text) !important;background-color:var(--sd-color-success) !important;border-color:var(--sd-color-success) !important;border-width:1px !important;border-style:solid !important}.sd-btn-success:hover,.sd-btn-success:focus{color:var(--sd-color-success-text) !important;background-color:var(--sd-color-success-highlight) !important;border-color:var(--sd-color-success-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-success{color:var(--sd-color-success) !important;border-color:var(--sd-color-success) !important;border-width:1px !important;border-style:solid !important}.sd-btn-info,.sd-btn-outline-info:hover,.sd-btn-outline-info:focus{color:var(--sd-color-info-text) !important;background-color:var(--sd-color-info) !important;border-color:var(--sd-color-info) !important;border-width:1px !important;border-style:solid !important}.sd-btn-info:hover,.sd-btn-info:focus{color:var(--sd-color-info-text) !important;background-color:var(--sd-color-info-highlight) !important;border-color:var(--sd-color-info-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-info{color:var(--sd-color-info) !important;border-color:var(--sd-color-info) !important;border-width:1px !important;border-style:solid !important}.sd-btn-warning,.sd-btn-outline-warning:hover,.sd-btn-outline-warning:focus{color:var(--sd-color-warning-text) !important;background-color:var(--sd-color-warning) !important;border-color:var(--sd-color-warning) !important;border-width:1px !important;border-style:solid !important}.sd-btn-warning:hover,.sd-btn-warning:focus{color:var(--sd-color-warning-text) !important;background-color:var(--sd-color-warning-highlight) !important;border-color:var(--sd-color-warning-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-warning{color:var(--sd-color-warning) !important;border-color:var(--sd-color-warning) !important;border-width:1px !important;border-style:solid !important}.sd-btn-danger,.sd-btn-outline-danger:hover,.sd-btn-outline-danger:focus{color:var(--sd-color-danger-text) !important;background-color:var(--sd-color-danger) !important;border-color:var(--sd-color-danger) !important;border-width:1px !important;border-style:solid !important}.sd-btn-danger:hover,.sd-btn-danger:focus{color:var(--sd-color-danger-text) !important;background-color:var(--sd-color-danger-highlight) !important;border-color:var(--sd-color-danger-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-danger{color:var(--sd-color-danger) !important;border-color:var(--sd-color-danger) !important;border-width:1px !important;border-style:solid !important}.sd-btn-light,.sd-btn-outline-light:hover,.sd-btn-outline-light:focus{color:var(--sd-color-light-text) !important;background-color:var(--sd-color-light) !important;border-color:var(--sd-color-light) !important;border-width:1px !important;border-style:solid !important}.sd-btn-light:hover,.sd-btn-light:focus{color:var(--sd-color-light-text) !important;background-color:var(--sd-color-light-highlight) !important;border-color:var(--sd-color-light-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-light{color:var(--sd-color-light) !important;border-color:var(--sd-color-light) !important;border-width:1px !important;border-style:solid !important}.sd-btn-muted,.sd-btn-outline-muted:hover,.sd-btn-outline-muted:focus{color:var(--sd-color-muted-text) !important;background-color:var(--sd-color-muted) !important;border-color:var(--sd-color-muted) !important;border-width:1px !important;border-style:solid !important}.sd-btn-muted:hover,.sd-btn-muted:focus{color:var(--sd-color-muted-text) !important;background-color:var(--sd-color-muted-highlight) !important;border-color:var(--sd-color-muted-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-muted{color:var(--sd-color-muted) !important;border-color:var(--sd-color-muted) !important;border-width:1px !important;border-style:solid !important}.sd-btn-dark,.sd-btn-outline-dark:hover,.sd-btn-outline-dark:focus{color:var(--sd-color-dark-text) !important;background-color:var(--sd-color-dark) !important;border-color:var(--sd-color-dark) !important;border-width:1px !important;border-style:solid !important}.sd-btn-dark:hover,.sd-btn-dark:focus{color:var(--sd-color-dark-text) !important;background-color:var(--sd-color-dark-highlight) !important;border-color:var(--sd-color-dark-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-dark{color:var(--sd-color-dark) !important;border-color:var(--sd-color-dark) !important;border-width:1px !important;border-style:solid !important}.sd-btn-black,.sd-btn-outline-black:hover,.sd-btn-outline-black:focus{color:var(--sd-color-black-text) !important;background-color:var(--sd-color-black) !important;border-color:var(--sd-color-black) !important;border-width:1px !important;border-style:solid !important}.sd-btn-black:hover,.sd-btn-black:focus{color:var(--sd-color-black-text) !important;background-color:var(--sd-color-black-highlight) !important;border-color:var(--sd-color-black-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-black{color:var(--sd-color-black) !important;border-color:var(--sd-color-black) !important;border-width:1px !important;border-style:solid !important}.sd-btn-white,.sd-btn-outline-white:hover,.sd-btn-outline-white:focus{color:var(--sd-color-white-text) !important;background-color:var(--sd-color-white) !important;border-color:var(--sd-color-white) !important;border-width:1px !important;border-style:solid !important}.sd-btn-white:hover,.sd-btn-white:focus{color:var(--sd-color-white-text) !important;background-color:var(--sd-color-white-highlight) !important;border-color:var(--sd-color-white-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-white{color:var(--sd-color-white) !important;border-color:var(--sd-color-white) !important;border-width:1px !important;border-style:solid !important}.sd-stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.sd-hide-link-text{font-size:0}.sd-octicon,.sd-material-icon{display:inline-block;fill:currentColor;vertical-align:middle}.sd-avatar-xs{border-radius:50%;object-fit:cover;object-position:center;width:1rem;height:1rem}.sd-avatar-sm{border-radius:50%;object-fit:cover;object-position:center;width:3rem;height:3rem}.sd-avatar-md{border-radius:50%;object-fit:cover;object-position:center;width:5rem;height:5rem}.sd-avatar-lg{border-radius:50%;object-fit:cover;object-position:center;width:7rem;height:7rem}.sd-avatar-xl{border-radius:50%;object-fit:cover;object-position:center;width:10rem;height:10rem}.sd-avatar-inherit{border-radius:50%;object-fit:cover;object-position:center;width:inherit;height:inherit}.sd-avatar-initial{border-radius:50%;object-fit:cover;object-position:center;width:initial;height:initial}.sd-card{background-clip:border-box;background-color:var(--sd-color-card-background);border:1px solid var(--sd-color-card-border);border-radius:.25rem;color:var(--sd-color-card-text);display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;min-width:0;position:relative;word-wrap:break-word}.sd-card>hr{margin-left:0;margin-right:0}.sd-card-hover:hover{border-color:var(--sd-color-card-border-hover);transform:scale(1.01)}.sd-card-body{-ms-flex:1 1 auto;flex:1 1 auto;padding:1rem 1rem}.sd-card-title{margin-bottom:.5rem}.sd-card-subtitle{margin-top:-0.25rem;margin-bottom:0}.sd-card-text:last-child{margin-bottom:0}.sd-card-link:hover{text-decoration:none}.sd-card-link+.card-link{margin-left:1rem}.sd-card-header{padding:.5rem 1rem;margin-bottom:0;background-color:var(--sd-color-card-header);border-bottom:1px solid var(--sd-color-card-border)}.sd-card-header:first-child{border-radius:calc(0.25rem - 1px) calc(0.25rem - 1px) 0 0}.sd-card-footer{padding:.5rem 1rem;background-color:var(--sd-color-card-footer);border-top:1px solid var(--sd-color-card-border)}.sd-card-footer:last-child{border-radius:0 0 calc(0.25rem - 1px) calc(0.25rem - 1px)}.sd-card-header-tabs{margin-right:-0.5rem;margin-bottom:-0.5rem;margin-left:-0.5rem;border-bottom:0}.sd-card-header-pills{margin-right:-0.5rem;margin-left:-0.5rem}.sd-card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:1rem;border-radius:calc(0.25rem - 1px)}.sd-card-img,.sd-card-img-bottom,.sd-card-img-top{width:100%}.sd-card-img,.sd-card-img-top{border-top-left-radius:calc(0.25rem - 1px);border-top-right-radius:calc(0.25rem - 1px)}.sd-card-img,.sd-card-img-bottom{border-bottom-left-radius:calc(0.25rem - 1px);border-bottom-right-radius:calc(0.25rem - 1px)}.sd-cards-carousel{width:100%;display:flex;flex-wrap:nowrap;-ms-flex-direction:row;flex-direction:row;overflow-x:hidden;scroll-snap-type:x mandatory}.sd-cards-carousel.sd-show-scrollbar{overflow-x:auto}.sd-cards-carousel:hover,.sd-cards-carousel:focus{overflow-x:auto}.sd-cards-carousel>.sd-card{flex-shrink:0;scroll-snap-align:start}.sd-cards-carousel>.sd-card:not(:last-child){margin-right:3px}.sd-card-cols-1>.sd-card{width:90%}.sd-card-cols-2>.sd-card{width:45%}.sd-card-cols-3>.sd-card{width:30%}.sd-card-cols-4>.sd-card{width:22.5%}.sd-card-cols-5>.sd-card{width:18%}.sd-card-cols-6>.sd-card{width:15%}.sd-card-cols-7>.sd-card{width:12.8571428571%}.sd-card-cols-8>.sd-card{width:11.25%}.sd-card-cols-9>.sd-card{width:10%}.sd-card-cols-10>.sd-card{width:9%}.sd-card-cols-11>.sd-card{width:8.1818181818%}.sd-card-cols-12>.sd-card{width:7.5%}.sd-container,.sd-container-fluid,.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container-xl{margin-left:auto;margin-right:auto;padding-left:var(--sd-gutter-x, 0.75rem);padding-right:var(--sd-gutter-x, 0.75rem);width:100%}@media(min-width: 576px){.sd-container-sm,.sd-container{max-width:540px}}@media(min-width: 768px){.sd-container-md,.sd-container-sm,.sd-container{max-width:720px}}@media(min-width: 992px){.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container{max-width:960px}}@media(min-width: 1200px){.sd-container-xl,.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container{max-width:1140px}}.sd-row{--sd-gutter-x: 1.5rem;--sd-gutter-y: 0;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-top:calc(var(--sd-gutter-y) * -1);margin-right:calc(var(--sd-gutter-x) * -0.5);margin-left:calc(var(--sd-gutter-x) * -0.5)}.sd-row>*{box-sizing:border-box;flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--sd-gutter-x) * 0.5);padding-left:calc(var(--sd-gutter-x) * 0.5);margin-top:var(--sd-gutter-y)}.sd-col{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-auto>*{flex:0 0 auto;width:auto}.sd-row-cols-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}@media(min-width: 576px){.sd-col-sm{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-sm-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-sm-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-sm-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-sm-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-sm-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-sm-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-sm-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-sm-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-sm-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-sm-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-sm-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-sm-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-sm-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 768px){.sd-col-md{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-md-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-md-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-md-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-md-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-md-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-md-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-md-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-md-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-md-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-md-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-md-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-md-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-md-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 992px){.sd-col-lg{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-lg-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-lg-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-lg-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-lg-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-lg-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-lg-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-lg-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-lg-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-lg-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-lg-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-lg-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-lg-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-lg-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 1200px){.sd-col-xl{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-xl-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-xl-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-xl-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-xl-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-xl-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-xl-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-xl-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-xl-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-xl-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-xl-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-xl-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-xl-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-xl-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}.sd-col-auto{flex:0 0 auto;-ms-flex:0 0 auto;width:auto}.sd-col-1{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}.sd-col-2{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-col-3{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-col-4{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-col-5{flex:0 0 auto;-ms-flex:0 0 auto;width:41.6666666667%}.sd-col-6{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-col-7{flex:0 0 auto;-ms-flex:0 0 auto;width:58.3333333333%}.sd-col-8{flex:0 0 auto;-ms-flex:0 0 auto;width:66.6666666667%}.sd-col-9{flex:0 0 auto;-ms-flex:0 0 auto;width:75%}.sd-col-10{flex:0 0 auto;-ms-flex:0 0 auto;width:83.3333333333%}.sd-col-11{flex:0 0 auto;-ms-flex:0 0 auto;width:91.6666666667%}.sd-col-12{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-g-0,.sd-gy-0{--sd-gutter-y: 0}.sd-g-0,.sd-gx-0{--sd-gutter-x: 0}.sd-g-1,.sd-gy-1{--sd-gutter-y: 0.25rem}.sd-g-1,.sd-gx-1{--sd-gutter-x: 0.25rem}.sd-g-2,.sd-gy-2{--sd-gutter-y: 0.5rem}.sd-g-2,.sd-gx-2{--sd-gutter-x: 0.5rem}.sd-g-3,.sd-gy-3{--sd-gutter-y: 1rem}.sd-g-3,.sd-gx-3{--sd-gutter-x: 1rem}.sd-g-4,.sd-gy-4{--sd-gutter-y: 1.5rem}.sd-g-4,.sd-gx-4{--sd-gutter-x: 1.5rem}.sd-g-5,.sd-gy-5{--sd-gutter-y: 3rem}.sd-g-5,.sd-gx-5{--sd-gutter-x: 3rem}@media(min-width: 576px){.sd-col-sm-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-sm-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-sm-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-sm-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-sm-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-sm-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-sm-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-sm-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-sm-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-sm-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-sm-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-sm-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-sm-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-sm-0,.sd-gy-sm-0{--sd-gutter-y: 0}.sd-g-sm-0,.sd-gx-sm-0{--sd-gutter-x: 0}.sd-g-sm-1,.sd-gy-sm-1{--sd-gutter-y: 0.25rem}.sd-g-sm-1,.sd-gx-sm-1{--sd-gutter-x: 0.25rem}.sd-g-sm-2,.sd-gy-sm-2{--sd-gutter-y: 0.5rem}.sd-g-sm-2,.sd-gx-sm-2{--sd-gutter-x: 0.5rem}.sd-g-sm-3,.sd-gy-sm-3{--sd-gutter-y: 1rem}.sd-g-sm-3,.sd-gx-sm-3{--sd-gutter-x: 1rem}.sd-g-sm-4,.sd-gy-sm-4{--sd-gutter-y: 1.5rem}.sd-g-sm-4,.sd-gx-sm-4{--sd-gutter-x: 1.5rem}.sd-g-sm-5,.sd-gy-sm-5{--sd-gutter-y: 3rem}.sd-g-sm-5,.sd-gx-sm-5{--sd-gutter-x: 3rem}}@media(min-width: 768px){.sd-col-md-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-md-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-md-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-md-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-md-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-md-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-md-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-md-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-md-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-md-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-md-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-md-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-md-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-md-0,.sd-gy-md-0{--sd-gutter-y: 0}.sd-g-md-0,.sd-gx-md-0{--sd-gutter-x: 0}.sd-g-md-1,.sd-gy-md-1{--sd-gutter-y: 0.25rem}.sd-g-md-1,.sd-gx-md-1{--sd-gutter-x: 0.25rem}.sd-g-md-2,.sd-gy-md-2{--sd-gutter-y: 0.5rem}.sd-g-md-2,.sd-gx-md-2{--sd-gutter-x: 0.5rem}.sd-g-md-3,.sd-gy-md-3{--sd-gutter-y: 1rem}.sd-g-md-3,.sd-gx-md-3{--sd-gutter-x: 1rem}.sd-g-md-4,.sd-gy-md-4{--sd-gutter-y: 1.5rem}.sd-g-md-4,.sd-gx-md-4{--sd-gutter-x: 1.5rem}.sd-g-md-5,.sd-gy-md-5{--sd-gutter-y: 3rem}.sd-g-md-5,.sd-gx-md-5{--sd-gutter-x: 3rem}}@media(min-width: 992px){.sd-col-lg-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-lg-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-lg-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-lg-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-lg-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-lg-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-lg-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-lg-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-lg-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-lg-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-lg-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-lg-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-lg-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-lg-0,.sd-gy-lg-0{--sd-gutter-y: 0}.sd-g-lg-0,.sd-gx-lg-0{--sd-gutter-x: 0}.sd-g-lg-1,.sd-gy-lg-1{--sd-gutter-y: 0.25rem}.sd-g-lg-1,.sd-gx-lg-1{--sd-gutter-x: 0.25rem}.sd-g-lg-2,.sd-gy-lg-2{--sd-gutter-y: 0.5rem}.sd-g-lg-2,.sd-gx-lg-2{--sd-gutter-x: 0.5rem}.sd-g-lg-3,.sd-gy-lg-3{--sd-gutter-y: 1rem}.sd-g-lg-3,.sd-gx-lg-3{--sd-gutter-x: 1rem}.sd-g-lg-4,.sd-gy-lg-4{--sd-gutter-y: 1.5rem}.sd-g-lg-4,.sd-gx-lg-4{--sd-gutter-x: 1.5rem}.sd-g-lg-5,.sd-gy-lg-5{--sd-gutter-y: 3rem}.sd-g-lg-5,.sd-gx-lg-5{--sd-gutter-x: 3rem}}@media(min-width: 1200px){.sd-col-xl-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-xl-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-xl-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-xl-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-xl-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-xl-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-xl-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-xl-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-xl-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-xl-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-xl-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-xl-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-xl-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-xl-0,.sd-gy-xl-0{--sd-gutter-y: 0}.sd-g-xl-0,.sd-gx-xl-0{--sd-gutter-x: 0}.sd-g-xl-1,.sd-gy-xl-1{--sd-gutter-y: 0.25rem}.sd-g-xl-1,.sd-gx-xl-1{--sd-gutter-x: 0.25rem}.sd-g-xl-2,.sd-gy-xl-2{--sd-gutter-y: 0.5rem}.sd-g-xl-2,.sd-gx-xl-2{--sd-gutter-x: 0.5rem}.sd-g-xl-3,.sd-gy-xl-3{--sd-gutter-y: 1rem}.sd-g-xl-3,.sd-gx-xl-3{--sd-gutter-x: 1rem}.sd-g-xl-4,.sd-gy-xl-4{--sd-gutter-y: 1.5rem}.sd-g-xl-4,.sd-gx-xl-4{--sd-gutter-x: 1.5rem}.sd-g-xl-5,.sd-gy-xl-5{--sd-gutter-y: 3rem}.sd-g-xl-5,.sd-gx-xl-5{--sd-gutter-x: 3rem}}.sd-flex-row-reverse{flex-direction:row-reverse !important}details.sd-dropdown{position:relative}details.sd-dropdown .sd-summary-title{font-weight:700;padding-right:3em !important;-moz-user-select:none;-ms-user-select:none;-webkit-user-select:none;user-select:none}details.sd-dropdown:hover{cursor:pointer}details.sd-dropdown .sd-summary-content{cursor:default}details.sd-dropdown summary{list-style:none;padding:1em}details.sd-dropdown summary .sd-octicon.no-title{vertical-align:middle}details.sd-dropdown[open] summary .sd-octicon.no-title{visibility:hidden}details.sd-dropdown summary::-webkit-details-marker{display:none}details.sd-dropdown summary:focus{outline:none}details.sd-dropdown .sd-summary-icon{margin-right:.5em}details.sd-dropdown .sd-summary-icon svg{opacity:.8}details.sd-dropdown summary:hover .sd-summary-up svg,details.sd-dropdown summary:hover .sd-summary-down svg{opacity:1;transform:scale(1.1)}details.sd-dropdown .sd-summary-up svg,details.sd-dropdown .sd-summary-down svg{display:block;opacity:.6}details.sd-dropdown .sd-summary-up,details.sd-dropdown .sd-summary-down{pointer-events:none;position:absolute;right:1em;top:1em}details.sd-dropdown[open]>.sd-summary-title .sd-summary-down{visibility:hidden}details.sd-dropdown:not([open])>.sd-summary-title .sd-summary-up{visibility:hidden}details.sd-dropdown:not([open]).sd-card{border:none}details.sd-dropdown:not([open])>.sd-card-header{border:1px solid var(--sd-color-card-border);border-radius:.25rem}details.sd-dropdown.sd-fade-in[open] summary~*{-moz-animation:sd-fade-in .5s ease-in-out;-webkit-animation:sd-fade-in .5s ease-in-out;animation:sd-fade-in .5s ease-in-out}details.sd-dropdown.sd-fade-in-slide-down[open] summary~*{-moz-animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out;-webkit-animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out;animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out}.sd-col>.sd-dropdown{width:100%}.sd-summary-content>.sd-tab-set:first-child{margin-top:0}@keyframes sd-fade-in{0%{opacity:0}100%{opacity:1}}@keyframes sd-slide-down{0%{transform:translate(0, -10px)}100%{transform:translate(0, 0)}}.sd-tab-set{border-radius:.125rem;display:flex;flex-wrap:wrap;margin:1em 0;position:relative}.sd-tab-set>input{opacity:0;position:absolute}.sd-tab-set>input:checked+label{border-color:var(--sd-color-tabs-underline-active);color:var(--sd-color-tabs-label-active)}.sd-tab-set>input:checked+label+.sd-tab-content{display:block}.sd-tab-set>input:not(:checked)+label:hover{color:var(--sd-color-tabs-label-hover);border-color:var(--sd-color-tabs-underline-hover)}.sd-tab-set>input:focus+label{outline-style:auto}.sd-tab-set>input:not(.focus-visible)+label{outline:none;-webkit-tap-highlight-color:transparent}.sd-tab-set>label{border-bottom:.125rem solid transparent;margin-bottom:0;color:var(--sd-color-tabs-label-inactive);border-color:var(--sd-color-tabs-underline-inactive);cursor:pointer;font-size:var(--sd-fontsize-tabs-label);font-weight:700;padding:1em 1.25em .5em;transition:color 250ms;width:auto;z-index:1}html .sd-tab-set>label:hover{color:var(--sd-color-tabs-label-active)}.sd-col>.sd-tab-set{width:100%}.sd-tab-content{box-shadow:0 -0.0625rem var(--sd-color-tabs-overline),0 .0625rem var(--sd-color-tabs-underline);display:none;order:99;padding-bottom:.75rem;padding-top:.75rem;width:100%}.sd-tab-content>:first-child{margin-top:0 !important}.sd-tab-content>:last-child{margin-bottom:0 !important}.sd-tab-content>.sd-tab-set{margin:0}.sd-sphinx-override,.sd-sphinx-override *{-moz-box-sizing:border-box;-webkit-box-sizing:border-box;box-sizing:border-box}.sd-sphinx-override p{margin-top:0}:root{--sd-color-primary: #0071bc;--sd-color-secondary: #6c757d;--sd-color-success: #28a745;--sd-color-info: #17a2b8;--sd-color-warning: #f0b37e;--sd-color-danger: #dc3545;--sd-color-light: #f8f9fa;--sd-color-muted: #6c757d;--sd-color-dark: #212529;--sd-color-black: black;--sd-color-white: white;--sd-color-primary-highlight: #0060a0;--sd-color-secondary-highlight: #5c636a;--sd-color-success-highlight: #228e3b;--sd-color-info-highlight: #148a9c;--sd-color-warning-highlight: #cc986b;--sd-color-danger-highlight: #bb2d3b;--sd-color-light-highlight: #d3d4d5;--sd-color-muted-highlight: #5c636a;--sd-color-dark-highlight: #1c1f23;--sd-color-black-highlight: black;--sd-color-white-highlight: #d9d9d9;--sd-color-primary-text: #fff;--sd-color-secondary-text: #fff;--sd-color-success-text: #fff;--sd-color-info-text: #fff;--sd-color-warning-text: #212529;--sd-color-danger-text: #fff;--sd-color-light-text: #212529;--sd-color-muted-text: #fff;--sd-color-dark-text: #fff;--sd-color-black-text: #fff;--sd-color-white-text: #212529;--sd-color-shadow: rgba(0, 0, 0, 0.15);--sd-color-card-border: rgba(0, 0, 0, 0.125);--sd-color-card-border-hover: hsla(231, 99%, 66%, 1);--sd-color-card-background: transparent;--sd-color-card-text: inherit;--sd-color-card-header: transparent;--sd-color-card-footer: transparent;--sd-color-tabs-label-active: hsla(231, 99%, 66%, 1);--sd-color-tabs-label-hover: hsla(231, 99%, 66%, 1);--sd-color-tabs-label-inactive: hsl(0, 0%, 66%);--sd-color-tabs-underline-active: hsla(231, 99%, 66%, 1);--sd-color-tabs-underline-hover: rgba(178, 206, 245, 0.62);--sd-color-tabs-underline-inactive: transparent;--sd-color-tabs-overline: rgb(222, 222, 222);--sd-color-tabs-underline: rgb(222, 222, 222);--sd-fontsize-tabs-label: 1rem} diff --git a/docs-archive/helm-chart/1.14.0/_static/design-tabs.js b/docs-archive/helm-chart/1.14.0/_static/design-tabs.js new file mode 100644 index 00000000000..36b38cf0d91 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_static/design-tabs.js @@ -0,0 +1,27 @@ +var sd_labels_by_text = {}; + +function ready() { + const li = document.getElementsByClassName("sd-tab-label"); + for (const label of li) { + syncId = label.getAttribute("data-sync-id"); + if (syncId) { + label.onclick = onLabelClick; + if (!sd_labels_by_text[syncId]) { + sd_labels_by_text[syncId] = []; + } + sd_labels_by_text[syncId].push(label); + } + } +} + +function onLabelClick() { + // Activate other inputs with the same sync id. + syncId = this.getAttribute("data-sync-id"); + for (label of sd_labels_by_text[syncId]) { + if (label === this) continue; + label.previousElementSibling.checked = true; + } + window.localStorage.setItem("sphinx-design-last-tab", syncId); +} + +document.addEventListener("DOMContentLoaded", ready, false); diff --git a/docs-archive/helm-chart/1.14.0/_static/doctools.js b/docs-archive/helm-chart/1.14.0/_static/doctools.js new file mode 100644 index 00000000000..527b876ca63 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_static/doctools.js @@ -0,0 +1,156 @@ +/* + * doctools.js + * ~~~~~~~~~~~ + * + * Base JavaScript utilities for all Sphinx HTML documentation. + * + * :copyright: Copyright 2007-2022 by the Sphinx team, see AUTHORS. + * :license: BSD, see LICENSE for details. + * + */ +"use strict"; + +const BLACKLISTED_KEY_CONTROL_ELEMENTS = new Set([ + "TEXTAREA", + "INPUT", + "SELECT", + "BUTTON", +]); + +const _ready = (callback) => { + if (document.readyState !== "loading") { + callback(); + } else { + document.addEventListener("DOMContentLoaded", callback); + } +}; + +/** + * Small JavaScript module for the documentation. + */ +const Documentation = { + init: () => { + Documentation.initDomainIndexTable(); + Documentation.initOnKeyListeners(); + }, + + /** + * i18n support + */ + TRANSLATIONS: {}, + PLURAL_EXPR: (n) => (n === 1 ? 0 : 1), + LOCALE: "unknown", + + // gettext and ngettext don't access this so that the functions + // can safely bound to a different name (_ = Documentation.gettext) + gettext: (string) => { + const translated = Documentation.TRANSLATIONS[string]; + switch (typeof translated) { + case "undefined": + return string; // no translation + case "string": + return translated; // translation exists + default: + return translated[0]; // (singular, plural) translation tuple exists + } + }, + + ngettext: (singular, plural, n) => { + const translated = Documentation.TRANSLATIONS[singular]; + if (typeof translated !== "undefined") + return translated[Documentation.PLURAL_EXPR(n)]; + return n === 1 ? singular : plural; + }, + + addTranslations: (catalog) => { + Object.assign(Documentation.TRANSLATIONS, catalog.messages); + Documentation.PLURAL_EXPR = new Function( + "n", + `return (${catalog.plural_expr})` + ); + Documentation.LOCALE = catalog.locale; + }, + + /** + * helper function to focus on search bar + */ + focusSearchBar: () => { + document.querySelectorAll("input[name=q]")[0]?.focus(); + }, + + /** + * Initialise the domain index toggle buttons + */ + initDomainIndexTable: () => { + const toggler = (el) => { + const idNumber = el.id.substr(7); + const toggledRows = document.querySelectorAll(`tr.cg-${idNumber}`); + if (el.src.substr(-9) === "minus.png") { + el.src = `${el.src.substr(0, el.src.length - 9)}plus.png`; + toggledRows.forEach((el) => (el.style.display = "none")); + } else { + el.src = `${el.src.substr(0, el.src.length - 8)}minus.png`; + toggledRows.forEach((el) => (el.style.display = "")); + } + }; + + const togglerElements = document.querySelectorAll("img.toggler"); + togglerElements.forEach((el) => + el.addEventListener("click", (event) => toggler(event.currentTarget)) + ); + togglerElements.forEach((el) => (el.style.display = "")); + if (DOCUMENTATION_OPTIONS.COLLAPSE_INDEX) togglerElements.forEach(toggler); + }, + + initOnKeyListeners: () => { + // only install a listener if it is really needed + if ( + !DOCUMENTATION_OPTIONS.NAVIGATION_WITH_KEYS && + !DOCUMENTATION_OPTIONS.ENABLE_SEARCH_SHORTCUTS + ) + return; + + document.addEventListener("keydown", (event) => { + // bail for input elements + if (BLACKLISTED_KEY_CONTROL_ELEMENTS.has(document.activeElement.tagName)) return; + // bail with special keys + if (event.altKey || event.ctrlKey || event.metaKey) return; + + if (!event.shiftKey) { + switch (event.key) { + case "ArrowLeft": + if (!DOCUMENTATION_OPTIONS.NAVIGATION_WITH_KEYS) break; + + const prevLink = document.querySelector('link[rel="prev"]'); + if (prevLink && prevLink.href) { + window.location.href = prevLink.href; + event.preventDefault(); + } + break; + case "ArrowRight": + if (!DOCUMENTATION_OPTIONS.NAVIGATION_WITH_KEYS) break; + + const nextLink = document.querySelector('link[rel="next"]'); + if (nextLink && nextLink.href) { + window.location.href = nextLink.href; + event.preventDefault(); + } + break; + } + } + + // some keyboard layouts may need Shift to get / + switch (event.key) { + case "/": + if (!DOCUMENTATION_OPTIONS.ENABLE_SEARCH_SHORTCUTS) break; + Documentation.focusSearchBar(); + event.preventDefault(); + } + }); + }, +}; + +// quick alias for translations +const _ = Documentation.gettext; + +_ready(Documentation.init); diff --git a/docs-archive/helm-chart/1.14.0/_static/documentation_options.js b/docs-archive/helm-chart/1.14.0/_static/documentation_options.js new file mode 100644 index 00000000000..96fcefe3ee0 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_static/documentation_options.js @@ -0,0 +1,14 @@ +var DOCUMENTATION_OPTIONS = { + URL_ROOT: document.getElementById("documentation_options").getAttribute('data-url_root'), + VERSION: '1.14.0', + LANGUAGE: 'en', + COLLAPSE_INDEX: false, + BUILDER: 'html', + FILE_SUFFIX: '.html', + LINK_SUFFIX: '.html', + HAS_SOURCE: true, + SOURCELINK_SUFFIX: '.txt', + NAVIGATION_WITH_KEYS: false, + SHOW_SEARCH_SUMMARY: true, + ENABLE_SEARCH_SHORTCUTS: true, +}; \ No newline at end of file diff --git a/docs-archive/helm-chart/1.14.0/_static/file.png b/docs-archive/helm-chart/1.14.0/_static/file.png new file mode 100644 index 0000000000000000000000000000000000000000..a858a410e4faa62ce324d814e4b816fff83a6fb3 GIT binary patch literal 286 zcmV+(0pb3MP)s`hMrGg#P~ix$^RISR_I47Y|r1 z_CyJOe}D1){SET-^Amu_i71Lt6eYfZjRyw@I6OQAIXXHDfiX^GbOlHe=Ae4>0m)d(f|Me07*qoM6N<$f}vM^LjV8( literal 0 HcmV?d00001 diff --git a/docs-archive/helm-chart/1.14.0/_static/gh-jira-links.js b/docs-archive/helm-chart/1.14.0/_static/gh-jira-links.js new file mode 100644 index 00000000000..d731a937389 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_static/gh-jira-links.js @@ -0,0 +1,34 @@ +/*! + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, + * software distributed under the License is distributed on an + * "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY + * KIND, either express or implied. See the License for the + * specific language governing permissions and limitations + * under the License. + */ + +document.addEventListener('DOMContentLoaded', function() { + var el = document.getElementById('release-notes'); + if (el !== null ) { + // [AIRFLOW-...] + el.innerHTML = el.innerHTML.replace( + /\[(AIRFLOW-[\d]+)\]/g, + `[$1]` + ); + // (#...) + el.innerHTML = el.innerHTML.replace( + /\(#([\d]+)\)/g, + `(#$1)` + ); + }; +}) diff --git a/docs-archive/helm-chart/1.14.0/_static/jquery-3.6.0.js b/docs-archive/helm-chart/1.14.0/_static/jquery-3.6.0.js new file mode 100644 index 00000000000..fc6c299b73e --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/_static/jquery-3.6.0.js @@ -0,0 +1,10881 @@ +/*! + * jQuery JavaScript Library v3.6.0 + * https://jquery.com/ + * + * Includes Sizzle.js + * https://sizzlejs.com/ + * + * Copyright OpenJS Foundation and other contributors + * Released under the MIT license + * https://jquery.org/license + * + * Date: 2021-03-02T17:08Z + */ +( function( global, factory ) { + + "use strict"; + + if ( typeof module === "object" && typeof module.exports === "object" ) { + + // For CommonJS and CommonJS-like environments where a proper `window` + // is present, execute the factory and get jQuery. + // For environments that do not have a `window` with a `document` + // (such as Node.js), expose a factory as module.exports. + // This accentuates the need for the creation of a real `window`. + // e.g. var jQuery = require("jquery")(window); + // See ticket #14549 for more info. + module.exports = global.document ? + factory( global, true ) : + function( w ) { + if ( !w.document ) { + throw new Error( "jQuery requires a window with a document" ); + } + return factory( w ); + }; + } else { + factory( global ); + } + +// Pass this if window is not defined yet +} )( typeof window !== "undefined" ? window : this, function( window, noGlobal ) { + +// Edge <= 12 - 13+, Firefox <=18 - 45+, IE 10 - 11, Safari 5.1 - 9+, iOS 6 - 9.1 +// throw exceptions when non-strict code (e.g., ASP.NET 4.5) accesses strict mode +// arguments.callee.caller (trac-13335). But as of jQuery 3.0 (2016), strict mode should be common +// enough that all such attempts are guarded in a try block. +"use strict"; + +var arr = []; + +var getProto = Object.getPrototypeOf; + +var slice = arr.slice; + +var flat = arr.flat ? function( array ) { + return arr.flat.call( array ); +} : function( array ) { + return arr.concat.apply( [], array ); +}; + + +var push = arr.push; + +var indexOf = arr.indexOf; + +var class2type = {}; + +var toString = class2type.toString; + +var hasOwn = class2type.hasOwnProperty; + +var fnToString = hasOwn.toString; + +var ObjectFunctionString = fnToString.call( Object ); + +var support = {}; + +var isFunction = function isFunction( obj ) { + + // Support: Chrome <=57, Firefox <=52 + // In some browsers, typeof returns "function" for HTML elements + // (i.e., `typeof document.createElement( "object" ) === "function"`). + // We don't want to classify *any* DOM node as a function. + // Support: QtWeb <=3.8.5, WebKit <=534.34, wkhtmltopdf tool <=0.12.5 + // Plus for old WebKit, typeof returns "function" for HTML collections + // (e.g., `typeof document.getElementsByTagName("div") === "function"`). (gh-4756) + return typeof obj === "function" && typeof obj.nodeType !== "number" && + typeof obj.item !== "function"; + }; + + +var isWindow = function isWindow( obj ) { + return obj != null && obj === obj.window; + }; + + +var document = window.document; + + + + var preservedScriptAttributes = { + type: true, + src: true, + nonce: true, + noModule: true + }; + + function DOMEval( code, node, doc ) { + doc = doc || document; + + var i, val, + script = doc.createElement( "script" ); + + script.text = code; + if ( node ) { + for ( i in preservedScriptAttributes ) { + + // Support: Firefox 64+, Edge 18+ + // Some browsers don't support the "nonce" property on scripts. + // On the other hand, just using `getAttribute` is not enough as + // the `nonce` attribute is reset to an empty string whenever it + // becomes browsing-context connected. + // See https://github.com/whatwg/html/issues/2369 + // See https://html.spec.whatwg.org/#nonce-attributes + // The `node.getAttribute` check was added for the sake of + // `jQuery.globalEval` so that it can fake a nonce-containing node + // via an object. + val = node[ i ] || node.getAttribute && node.getAttribute( i ); + if ( val ) { + script.setAttribute( i, val ); + } + } + } + doc.head.appendChild( script ).parentNode.removeChild( script ); + } + + +function toType( obj ) { + if ( obj == null ) { + return obj + ""; + } + + // Support: Android <=2.3 only (functionish RegExp) + return typeof obj === "object" || typeof obj === "function" ? + class2type[ toString.call( obj ) ] || "object" : + typeof obj; +} +/* global Symbol */ +// Defining this global in .eslintrc.json would create a danger of using the global +// unguarded in another place, it seems safer to define global only for this module + + + +var + version = "3.6.0", + + // Define a local copy of jQuery + jQuery = function( selector, context ) { + + // The jQuery object is actually just the init constructor 'enhanced' + // Need init if jQuery is called (just allow error to be thrown if not included) + return new jQuery.fn.init( selector, context ); + }; + +jQuery.fn = jQuery.prototype = { + + // The current version of jQuery being used + jquery: version, + + constructor: jQuery, + + // The default length of a jQuery object is 0 + length: 0, + + toArray: function() { + return slice.call( this ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + + // Return all the elements in a clean array + if ( num == null ) { + return slice.call( this ); + } + + // Return just the one element from the set + return num < 0 ? this[ num + this.length ] : this[ num ]; + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems ) { + + // Build a new jQuery matched element set + var ret = jQuery.merge( this.constructor(), elems ); + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + each: function( callback ) { + return jQuery.each( this, callback ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map( this, function( elem, i ) { + return callback.call( elem, i, elem ); + } ) ); + }, + + slice: function() { + return this.pushStack( slice.apply( this, arguments ) ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + even: function() { + return this.pushStack( jQuery.grep( this, function( _elem, i ) { + return ( i + 1 ) % 2; + } ) ); + }, + + odd: function() { + return this.pushStack( jQuery.grep( this, function( _elem, i ) { + return i % 2; + } ) ); + }, + + eq: function( i ) { + var len = this.length, + j = +i + ( i < 0 ? len : 0 ); + return this.pushStack( j >= 0 && j < len ? [ this[ j ] ] : [] ); + }, + + end: function() { + return this.prevObject || this.constructor(); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: push, + sort: arr.sort, + splice: arr.splice +}; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[ 0 ] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + + // Skip the boolean and the target + target = arguments[ i ] || {}; + i++; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !isFunction( target ) ) { + target = {}; + } + + // Extend jQuery itself if only one argument is passed + if ( i === length ) { + target = this; + i--; + } + + for ( ; i < length; i++ ) { + + // Only deal with non-null/undefined values + if ( ( options = arguments[ i ] ) != null ) { + + // Extend the base object + for ( name in options ) { + copy = options[ name ]; + + // Prevent Object.prototype pollution + // Prevent never-ending loop + if ( name === "__proto__" || target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject( copy ) || + ( copyIsArray = Array.isArray( copy ) ) ) ) { + src = target[ name ]; + + // Ensure proper type for the source value + if ( copyIsArray && !Array.isArray( src ) ) { + clone = []; + } else if ( !copyIsArray && !jQuery.isPlainObject( src ) ) { + clone = {}; + } else { + clone = src; + } + copyIsArray = false; + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend( { + + // Unique for each copy of jQuery on the page + expando: "jQuery" + ( version + Math.random() ).replace( /\D/g, "" ), + + // Assume jQuery is ready without the ready module + isReady: true, + + error: function( msg ) { + throw new Error( msg ); + }, + + noop: function() {}, + + isPlainObject: function( obj ) { + var proto, Ctor; + + // Detect obvious negatives + // Use toString instead of jQuery.type to catch host objects + if ( !obj || toString.call( obj ) !== "[object Object]" ) { + return false; + } + + proto = getProto( obj ); + + // Objects with no prototype (e.g., `Object.create( null )`) are plain + if ( !proto ) { + return true; + } + + // Objects with prototype are plain iff they were constructed by a global Object function + Ctor = hasOwn.call( proto, "constructor" ) && proto.constructor; + return typeof Ctor === "function" && fnToString.call( Ctor ) === ObjectFunctionString; + }, + + isEmptyObject: function( obj ) { + var name; + + for ( name in obj ) { + return false; + } + return true; + }, + + // Evaluates a script in a provided context; falls back to the global one + // if not specified. + globalEval: function( code, options, doc ) { + DOMEval( code, { nonce: options && options.nonce }, doc ); + }, + + each: function( obj, callback ) { + var length, i = 0; + + if ( isArrayLike( obj ) ) { + length = obj.length; + for ( ; i < length; i++ ) { + if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) { + break; + } + } + } else { + for ( i in obj ) { + if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) { + break; + } + } + } + + return obj; + }, + + // results is for internal usage only + makeArray: function( arr, results ) { + var ret = results || []; + + if ( arr != null ) { + if ( isArrayLike( Object( arr ) ) ) { + jQuery.merge( ret, + typeof arr === "string" ? + [ arr ] : arr + ); + } else { + push.call( ret, arr ); + } + } + + return ret; + }, + + inArray: function( elem, arr, i ) { + return arr == null ? -1 : indexOf.call( arr, elem, i ); + }, + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + merge: function( first, second ) { + var len = +second.length, + j = 0, + i = first.length; + + for ( ; j < len; j++ ) { + first[ i++ ] = second[ j ]; + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, invert ) { + var callbackInverse, + matches = [], + i = 0, + length = elems.length, + callbackExpect = !invert; + + // Go through the array, only saving the items + // that pass the validator function + for ( ; i < length; i++ ) { + callbackInverse = !callback( elems[ i ], i ); + if ( callbackInverse !== callbackExpect ) { + matches.push( elems[ i ] ); + } + } + + return matches; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var length, value, + i = 0, + ret = []; + + // Go through the array, translating each of the items to their new values + if ( isArrayLike( elems ) ) { + length = elems.length; + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret.push( value ); + } + } + + // Go through every key on the object, + } else { + for ( i in elems ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret.push( value ); + } + } + } + + // Flatten any nested arrays + return flat( ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // jQuery.support is not used in Core but other projects attach their + // properties to it so it needs to exist. + support: support +} ); + +if ( typeof Symbol === "function" ) { + jQuery.fn[ Symbol.iterator ] = arr[ Symbol.iterator ]; +} + +// Populate the class2type map +jQuery.each( "Boolean Number String Function Array Date RegExp Object Error Symbol".split( " " ), + function( _i, name ) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); + } ); + +function isArrayLike( obj ) { + + // Support: real iOS 8.2 only (not reproducible in simulator) + // `in` check used to prevent JIT error (gh-2145) + // hasOwn isn't used here due to false negatives + // regarding Nodelist length in IE + var length = !!obj && "length" in obj && obj.length, + type = toType( obj ); + + if ( isFunction( obj ) || isWindow( obj ) ) { + return false; + } + + return type === "array" || length === 0 || + typeof length === "number" && length > 0 && ( length - 1 ) in obj; +} +var Sizzle = +/*! + * Sizzle CSS Selector Engine v2.3.6 + * https://sizzlejs.com/ + * + * Copyright JS Foundation and other contributors + * Released under the MIT license + * https://js.foundation/ + * + * Date: 2021-02-16 + */ +( function( window ) { +var i, + support, + Expr, + getText, + isXML, + tokenize, + compile, + select, + outermostContext, + sortInput, + hasDuplicate, + + // Local document vars + setDocument, + document, + docElem, + documentIsHTML, + rbuggyQSA, + rbuggyMatches, + matches, + contains, + + // Instance-specific data + expando = "sizzle" + 1 * new Date(), + preferredDoc = window.document, + dirruns = 0, + done = 0, + classCache = createCache(), + tokenCache = createCache(), + compilerCache = createCache(), + nonnativeSelectorCache = createCache(), + sortOrder = function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + } + return 0; + }, + + // Instance methods + hasOwn = ( {} ).hasOwnProperty, + arr = [], + pop = arr.pop, + pushNative = arr.push, + push = arr.push, + slice = arr.slice, + + // Use a stripped-down indexOf as it's faster than native + // https://jsperf.com/thor-indexof-vs-for/5 + indexOf = function( list, elem ) { + var i = 0, + len = list.length; + for ( ; i < len; i++ ) { + if ( list[ i ] === elem ) { + return i; + } + } + return -1; + }, + + booleans = "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|" + + "ismap|loop|multiple|open|readonly|required|scoped", + + // Regular expressions + + // http://www.w3.org/TR/css3-selectors/#whitespace + whitespace = "[\\x20\\t\\r\\n\\f]", + + // https://www.w3.org/TR/css-syntax-3/#ident-token-diagram + identifier = "(?:\\\\[\\da-fA-F]{1,6}" + whitespace + + "?|\\\\[^\\r\\n\\f]|[\\w-]|[^\0-\\x7f])+", + + // Attribute selectors: http://www.w3.org/TR/selectors/#attribute-selectors + attributes = "\\[" + whitespace + "*(" + identifier + ")(?:" + whitespace + + + // Operator (capture 2) + "*([*^$|!~]?=)" + whitespace + + + // "Attribute values must be CSS identifiers [capture 5] + // or strings [capture 3 or capture 4]" + "*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|(" + identifier + "))|)" + + whitespace + "*\\]", + + pseudos = ":(" + identifier + ")(?:\\((" + + + // To reduce the number of selectors needing tokenize in the preFilter, prefer arguments: + // 1. quoted (capture 3; capture 4 or capture 5) + "('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|" + + + // 2. simple (capture 6) + "((?:\\\\.|[^\\\\()[\\]]|" + attributes + ")*)|" + + + // 3. anything else (capture 2) + ".*" + + ")\\)|)", + + // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter + rwhitespace = new RegExp( whitespace + "+", "g" ), + rtrim = new RegExp( "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + + whitespace + "+$", "g" ), + + rcomma = new RegExp( "^" + whitespace + "*," + whitespace + "*" ), + rcombinators = new RegExp( "^" + whitespace + "*([>+~]|" + whitespace + ")" + whitespace + + "*" ), + rdescend = new RegExp( whitespace + "|>" ), + + rpseudo = new RegExp( pseudos ), + ridentifier = new RegExp( "^" + identifier + "$" ), + + matchExpr = { + "ID": new RegExp( "^#(" + identifier + ")" ), + "CLASS": new RegExp( "^\\.(" + identifier + ")" ), + "TAG": new RegExp( "^(" + identifier + "|[*])" ), + "ATTR": new RegExp( "^" + attributes ), + "PSEUDO": new RegExp( "^" + pseudos ), + "CHILD": new RegExp( "^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + + whitespace + "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + + whitespace + "*(\\d+)|))" + whitespace + "*\\)|)", "i" ), + "bool": new RegExp( "^(?:" + booleans + ")$", "i" ), + + // For use in libraries implementing .is() + // We use this for POS matching in `select` + "needsContext": new RegExp( "^" + whitespace + + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" + whitespace + + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i" ) + }, + + rhtml = /HTML$/i, + rinputs = /^(?:input|select|textarea|button)$/i, + rheader = /^h\d$/i, + + rnative = /^[^{]+\{\s*\[native \w/, + + // Easily-parseable/retrievable ID or TAG or CLASS selectors + rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/, + + rsibling = /[+~]/, + + // CSS escapes + // http://www.w3.org/TR/CSS21/syndata.html#escaped-characters + runescape = new RegExp( "\\\\[\\da-fA-F]{1,6}" + whitespace + "?|\\\\([^\\r\\n\\f])", "g" ), + funescape = function( escape, nonHex ) { + var high = "0x" + escape.slice( 1 ) - 0x10000; + + return nonHex ? + + // Strip the backslash prefix from a non-hex escape sequence + nonHex : + + // Replace a hexadecimal escape sequence with the encoded Unicode code point + // Support: IE <=11+ + // For values outside the Basic Multilingual Plane (BMP), manually construct a + // surrogate pair + high < 0 ? + String.fromCharCode( high + 0x10000 ) : + String.fromCharCode( high >> 10 | 0xD800, high & 0x3FF | 0xDC00 ); + }, + + // CSS string/identifier serialization + // https://drafts.csswg.org/cssom/#common-serializing-idioms + rcssescape = /([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g, + fcssescape = function( ch, asCodePoint ) { + if ( asCodePoint ) { + + // U+0000 NULL becomes U+FFFD REPLACEMENT CHARACTER + if ( ch === "\0" ) { + return "\uFFFD"; + } + + // Control characters and (dependent upon position) numbers get escaped as code points + return ch.slice( 0, -1 ) + "\\" + + ch.charCodeAt( ch.length - 1 ).toString( 16 ) + " "; + } + + // Other potentially-special ASCII characters get backslash-escaped + return "\\" + ch; + }, + + // Used for iframes + // See setDocument() + // Removing the function wrapper causes a "Permission Denied" + // error in IE + unloadHandler = function() { + setDocument(); + }, + + inDisabledFieldset = addCombinator( + function( elem ) { + return elem.disabled === true && elem.nodeName.toLowerCase() === "fieldset"; + }, + { dir: "parentNode", next: "legend" } + ); + +// Optimize for push.apply( _, NodeList ) +try { + push.apply( + ( arr = slice.call( preferredDoc.childNodes ) ), + preferredDoc.childNodes + ); + + // Support: Android<4.0 + // Detect silently failing push.apply + // eslint-disable-next-line no-unused-expressions + arr[ preferredDoc.childNodes.length ].nodeType; +} catch ( e ) { + push = { apply: arr.length ? + + // Leverage slice if possible + function( target, els ) { + pushNative.apply( target, slice.call( els ) ); + } : + + // Support: IE<9 + // Otherwise append directly + function( target, els ) { + var j = target.length, + i = 0; + + // Can't trust NodeList.length + while ( ( target[ j++ ] = els[ i++ ] ) ) {} + target.length = j - 1; + } + }; +} + +function Sizzle( selector, context, results, seed ) { + var m, i, elem, nid, match, groups, newSelector, + newContext = context && context.ownerDocument, + + // nodeType defaults to 9, since context defaults to document + nodeType = context ? context.nodeType : 9; + + results = results || []; + + // Return early from calls with invalid selector or context + if ( typeof selector !== "string" || !selector || + nodeType !== 1 && nodeType !== 9 && nodeType !== 11 ) { + + return results; + } + + // Try to shortcut find operations (as opposed to filters) in HTML documents + if ( !seed ) { + setDocument( context ); + context = context || document; + + if ( documentIsHTML ) { + + // If the selector is sufficiently simple, try using a "get*By*" DOM method + // (excepting DocumentFragment context, where the methods don't exist) + if ( nodeType !== 11 && ( match = rquickExpr.exec( selector ) ) ) { + + // ID selector + if ( ( m = match[ 1 ] ) ) { + + // Document context + if ( nodeType === 9 ) { + if ( ( elem = context.getElementById( m ) ) ) { + + // Support: IE, Opera, Webkit + // TODO: identify versions + // getElementById can match elements by name instead of ID + if ( elem.id === m ) { + results.push( elem ); + return results; + } + } else { + return results; + } + + // Element context + } else { + + // Support: IE, Opera, Webkit + // TODO: identify versions + // getElementById can match elements by name instead of ID + if ( newContext && ( elem = newContext.getElementById( m ) ) && + contains( context, elem ) && + elem.id === m ) { + + results.push( elem ); + return results; + } + } + + // Type selector + } else if ( match[ 2 ] ) { + push.apply( results, context.getElementsByTagName( selector ) ); + return results; + + // Class selector + } else if ( ( m = match[ 3 ] ) && support.getElementsByClassName && + context.getElementsByClassName ) { + + push.apply( results, context.getElementsByClassName( m ) ); + return results; + } + } + + // Take advantage of querySelectorAll + if ( support.qsa && + !nonnativeSelectorCache[ selector + " " ] && + ( !rbuggyQSA || !rbuggyQSA.test( selector ) ) && + + // Support: IE 8 only + // Exclude object elements + ( nodeType !== 1 || context.nodeName.toLowerCase() !== "object" ) ) { + + newSelector = selector; + newContext = context; + + // qSA considers elements outside a scoping root when evaluating child or + // descendant combinators, which is not what we want. + // In such cases, we work around the behavior by prefixing every selector in the + // list with an ID selector referencing the scope context. + // The technique has to be used as well when a leading combinator is used + // as such selectors are not recognized by querySelectorAll. + // Thanks to Andrew Dupont for this technique. + if ( nodeType === 1 && + ( rdescend.test( selector ) || rcombinators.test( selector ) ) ) { + + // Expand context for sibling selectors + newContext = rsibling.test( selector ) && testContext( context.parentNode ) || + context; + + // We can use :scope instead of the ID hack if the browser + // supports it & if we're not changing the context. + if ( newContext !== context || !support.scope ) { + + // Capture the context ID, setting it first if necessary + if ( ( nid = context.getAttribute( "id" ) ) ) { + nid = nid.replace( rcssescape, fcssescape ); + } else { + context.setAttribute( "id", ( nid = expando ) ); + } + } + + // Prefix every selector in the list + groups = tokenize( selector ); + i = groups.length; + while ( i-- ) { + groups[ i ] = ( nid ? "#" + nid : ":scope" ) + " " + + toSelector( groups[ i ] ); + } + newSelector = groups.join( "," ); + } + + try { + push.apply( results, + newContext.querySelectorAll( newSelector ) + ); + return results; + } catch ( qsaError ) { + nonnativeSelectorCache( selector, true ); + } finally { + if ( nid === expando ) { + context.removeAttribute( "id" ); + } + } + } + } + } + + // All others + return select( selector.replace( rtrim, "$1" ), context, results, seed ); +} + +/** + * Create key-value caches of limited size + * @returns {function(string, object)} Returns the Object data after storing it on itself with + * property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength) + * deleting the oldest entry + */ +function createCache() { + var keys = []; + + function cache( key, value ) { + + // Use (key + " ") to avoid collision with native prototype properties (see Issue #157) + if ( keys.push( key + " " ) > Expr.cacheLength ) { + + // Only keep the most recent entries + delete cache[ keys.shift() ]; + } + return ( cache[ key + " " ] = value ); + } + return cache; +} + +/** + * Mark a function for special use by Sizzle + * @param {Function} fn The function to mark + */ +function markFunction( fn ) { + fn[ expando ] = true; + return fn; +} + +/** + * Support testing using an element + * @param {Function} fn Passed the created element and returns a boolean result + */ +function assert( fn ) { + var el = document.createElement( "fieldset" ); + + try { + return !!fn( el ); + } catch ( e ) { + return false; + } finally { + + // Remove from its parent by default + if ( el.parentNode ) { + el.parentNode.removeChild( el ); + } + + // release memory in IE + el = null; + } +} + +/** + * Adds the same handler for all of the specified attrs + * @param {String} attrs Pipe-separated list of attributes + * @param {Function} handler The method that will be applied + */ +function addHandle( attrs, handler ) { + var arr = attrs.split( "|" ), + i = arr.length; + + while ( i-- ) { + Expr.attrHandle[ arr[ i ] ] = handler; + } +} + +/** + * Checks document order of two siblings + * @param {Element} a + * @param {Element} b + * @returns {Number} Returns less than 0 if a precedes b, greater than 0 if a follows b + */ +function siblingCheck( a, b ) { + var cur = b && a, + diff = cur && a.nodeType === 1 && b.nodeType === 1 && + a.sourceIndex - b.sourceIndex; + + // Use IE sourceIndex if available on both nodes + if ( diff ) { + return diff; + } + + // Check if b follows a + if ( cur ) { + while ( ( cur = cur.nextSibling ) ) { + if ( cur === b ) { + return -1; + } + } + } + + return a ? 1 : -1; +} + +/** + * Returns a function to use in pseudos for input types + * @param {String} type + */ +function createInputPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === type; + }; +} + +/** + * Returns a function to use in pseudos for buttons + * @param {String} type + */ +function createButtonPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return ( name === "input" || name === "button" ) && elem.type === type; + }; +} + +/** + * Returns a function to use in pseudos for :enabled/:disabled + * @param {Boolean} disabled true for :disabled; false for :enabled + */ +function createDisabledPseudo( disabled ) { + + // Known :disabled false positives: fieldset[disabled] > legend:nth-of-type(n+2) :can-disable + return function( elem ) { + + // Only certain elements can match :enabled or :disabled + // https://html.spec.whatwg.org/multipage/scripting.html#selector-enabled + // https://html.spec.whatwg.org/multipage/scripting.html#selector-disabled + if ( "form" in elem ) { + + // Check for inherited disabledness on relevant non-disabled elements: + // * listed form-associated elements in a disabled fieldset + // https://html.spec.whatwg.org/multipage/forms.html#category-listed + // https://html.spec.whatwg.org/multipage/forms.html#concept-fe-disabled + // * option elements in a disabled optgroup + // https://html.spec.whatwg.org/multipage/forms.html#concept-option-disabled + // All such elements have a "form" property. + if ( elem.parentNode && elem.disabled === false ) { + + // Option elements defer to a parent optgroup if present + if ( "label" in elem ) { + if ( "label" in elem.parentNode ) { + return elem.parentNode.disabled === disabled; + } else { + return elem.disabled === disabled; + } + } + + // Support: IE 6 - 11 + // Use the isDisabled shortcut property to check for disabled fieldset ancestors + return elem.isDisabled === disabled || + + // Where there is no isDisabled, check manually + /* jshint -W018 */ + elem.isDisabled !== !disabled && + inDisabledFieldset( elem ) === disabled; + } + + return elem.disabled === disabled; + + // Try to winnow out elements that can't be disabled before trusting the disabled property. + // Some victims get caught in our net (label, legend, menu, track), but it shouldn't + // even exist on them, let alone have a boolean value. + } else if ( "label" in elem ) { + return elem.disabled === disabled; + } + + // Remaining elements are neither :enabled nor :disabled + return false; + }; +} + +/** + * Returns a function to use in pseudos for positionals + * @param {Function} fn + */ +function createPositionalPseudo( fn ) { + return markFunction( function( argument ) { + argument = +argument; + return markFunction( function( seed, matches ) { + var j, + matchIndexes = fn( [], seed.length, argument ), + i = matchIndexes.length; + + // Match elements found at the specified indexes + while ( i-- ) { + if ( seed[ ( j = matchIndexes[ i ] ) ] ) { + seed[ j ] = !( matches[ j ] = seed[ j ] ); + } + } + } ); + } ); +} + +/** + * Checks a node for validity as a Sizzle context + * @param {Element|Object=} context + * @returns {Element|Object|Boolean} The input node if acceptable, otherwise a falsy value + */ +function testContext( context ) { + return context && typeof context.getElementsByTagName !== "undefined" && context; +} + +// Expose support vars for convenience +support = Sizzle.support = {}; + +/** + * Detects XML nodes + * @param {Element|Object} elem An element or a document + * @returns {Boolean} True iff elem is a non-HTML XML node + */ +isXML = Sizzle.isXML = function( elem ) { + var namespace = elem && elem.namespaceURI, + docElem = elem && ( elem.ownerDocument || elem ).documentElement; + + // Support: IE <=8 + // Assume HTML when documentElement doesn't yet exist, such as inside loading iframes + // https://bugs.jquery.com/ticket/4833 + return !rhtml.test( namespace || docElem && docElem.nodeName || "HTML" ); +}; + +/** + * Sets document-related variables once based on the current document + * @param {Element|Object} [doc] An element or document object to use to set the document + * @returns {Object} Returns the current document + */ +setDocument = Sizzle.setDocument = function( node ) { + var hasCompare, subWindow, + doc = node ? node.ownerDocument || node : preferredDoc; + + // Return early if doc is invalid or already selected + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( doc == document || doc.nodeType !== 9 || !doc.documentElement ) { + return document; + } + + // Update global variables + document = doc; + docElem = document.documentElement; + documentIsHTML = !isXML( document ); + + // Support: IE 9 - 11+, Edge 12 - 18+ + // Accessing iframe documents after unload throws "permission denied" errors (jQuery #13936) + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( preferredDoc != document && + ( subWindow = document.defaultView ) && subWindow.top !== subWindow ) { + + // Support: IE 11, Edge + if ( subWindow.addEventListener ) { + subWindow.addEventListener( "unload", unloadHandler, false ); + + // Support: IE 9 - 10 only + } else if ( subWindow.attachEvent ) { + subWindow.attachEvent( "onunload", unloadHandler ); + } + } + + // Support: IE 8 - 11+, Edge 12 - 18+, Chrome <=16 - 25 only, Firefox <=3.6 - 31 only, + // Safari 4 - 5 only, Opera <=11.6 - 12.x only + // IE/Edge & older browsers don't support the :scope pseudo-class. + // Support: Safari 6.0 only + // Safari 6.0 supports :scope but it's an alias of :root there. + support.scope = assert( function( el ) { + docElem.appendChild( el ).appendChild( document.createElement( "div" ) ); + return typeof el.querySelectorAll !== "undefined" && + !el.querySelectorAll( ":scope fieldset div" ).length; + } ); + + /* Attributes + ---------------------------------------------------------------------- */ + + // Support: IE<8 + // Verify that getAttribute really returns attributes and not properties + // (excepting IE8 booleans) + support.attributes = assert( function( el ) { + el.className = "i"; + return !el.getAttribute( "className" ); + } ); + + /* getElement(s)By* + ---------------------------------------------------------------------- */ + + // Check if getElementsByTagName("*") returns only elements + support.getElementsByTagName = assert( function( el ) { + el.appendChild( document.createComment( "" ) ); + return !el.getElementsByTagName( "*" ).length; + } ); + + // Support: IE<9 + support.getElementsByClassName = rnative.test( document.getElementsByClassName ); + + // Support: IE<10 + // Check if getElementById returns elements by name + // The broken getElementById methods don't pick up programmatically-set names, + // so use a roundabout getElementsByName test + support.getById = assert( function( el ) { + docElem.appendChild( el ).id = expando; + return !document.getElementsByName || !document.getElementsByName( expando ).length; + } ); + + // ID filter and find + if ( support.getById ) { + Expr.filter[ "ID" ] = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + return elem.getAttribute( "id" ) === attrId; + }; + }; + Expr.find[ "ID" ] = function( id, context ) { + if ( typeof context.getElementById !== "undefined" && documentIsHTML ) { + var elem = context.getElementById( id ); + return elem ? [ elem ] : []; + } + }; + } else { + Expr.filter[ "ID" ] = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + var node = typeof elem.getAttributeNode !== "undefined" && + elem.getAttributeNode( "id" ); + return node && node.value === attrId; + }; + }; + + // Support: IE 6 - 7 only + // getElementById is not reliable as a find shortcut + Expr.find[ "ID" ] = function( id, context ) { + if ( typeof context.getElementById !== "undefined" && documentIsHTML ) { + var node, i, elems, + elem = context.getElementById( id ); + + if ( elem ) { + + // Verify the id attribute + node = elem.getAttributeNode( "id" ); + if ( node && node.value === id ) { + return [ elem ]; + } + + // Fall back on getElementsByName + elems = context.getElementsByName( id ); + i = 0; + while ( ( elem = elems[ i++ ] ) ) { + node = elem.getAttributeNode( "id" ); + if ( node && node.value === id ) { + return [ elem ]; + } + } + } + + return []; + } + }; + } + + // Tag + Expr.find[ "TAG" ] = support.getElementsByTagName ? + function( tag, context ) { + if ( typeof context.getElementsByTagName !== "undefined" ) { + return context.getElementsByTagName( tag ); + + // DocumentFragment nodes don't have gEBTN + } else if ( support.qsa ) { + return context.querySelectorAll( tag ); + } + } : + + function( tag, context ) { + var elem, + tmp = [], + i = 0, + + // By happy coincidence, a (broken) gEBTN appears on DocumentFragment nodes too + results = context.getElementsByTagName( tag ); + + // Filter out possible comments + if ( tag === "*" ) { + while ( ( elem = results[ i++ ] ) ) { + if ( elem.nodeType === 1 ) { + tmp.push( elem ); + } + } + + return tmp; + } + return results; + }; + + // Class + Expr.find[ "CLASS" ] = support.getElementsByClassName && function( className, context ) { + if ( typeof context.getElementsByClassName !== "undefined" && documentIsHTML ) { + return context.getElementsByClassName( className ); + } + }; + + /* QSA/matchesSelector + ---------------------------------------------------------------------- */ + + // QSA and matchesSelector support + + // matchesSelector(:active) reports false when true (IE9/Opera 11.5) + rbuggyMatches = []; + + // qSa(:focus) reports false when true (Chrome 21) + // We allow this because of a bug in IE8/9 that throws an error + // whenever `document.activeElement` is accessed on an iframe + // So, we allow :focus to pass through QSA all the time to avoid the IE error + // See https://bugs.jquery.com/ticket/13378 + rbuggyQSA = []; + + if ( ( support.qsa = rnative.test( document.querySelectorAll ) ) ) { + + // Build QSA regex + // Regex strategy adopted from Diego Perini + assert( function( el ) { + + var input; + + // Select is set to empty string on purpose + // This is to test IE's treatment of not explicitly + // setting a boolean content attribute, + // since its presence should be enough + // https://bugs.jquery.com/ticket/12359 + docElem.appendChild( el ).innerHTML = "" + + ""; + + // Support: IE8, Opera 11-12.16 + // Nothing should be selected when empty strings follow ^= or $= or *= + // The test attribute must be unknown in Opera but "safe" for WinRT + // https://msdn.microsoft.com/en-us/library/ie/hh465388.aspx#attribute_section + if ( el.querySelectorAll( "[msallowcapture^='']" ).length ) { + rbuggyQSA.push( "[*^$]=" + whitespace + "*(?:''|\"\")" ); + } + + // Support: IE8 + // Boolean attributes and "value" are not treated correctly + if ( !el.querySelectorAll( "[selected]" ).length ) { + rbuggyQSA.push( "\\[" + whitespace + "*(?:value|" + booleans + ")" ); + } + + // Support: Chrome<29, Android<4.4, Safari<7.0+, iOS<7.0+, PhantomJS<1.9.8+ + if ( !el.querySelectorAll( "[id~=" + expando + "-]" ).length ) { + rbuggyQSA.push( "~=" ); + } + + // Support: IE 11+, Edge 15 - 18+ + // IE 11/Edge don't find elements on a `[name='']` query in some cases. + // Adding a temporary attribute to the document before the selection works + // around the issue. + // Interestingly, IE 10 & older don't seem to have the issue. + input = document.createElement( "input" ); + input.setAttribute( "name", "" ); + el.appendChild( input ); + if ( !el.querySelectorAll( "[name='']" ).length ) { + rbuggyQSA.push( "\\[" + whitespace + "*name" + whitespace + "*=" + + whitespace + "*(?:''|\"\")" ); + } + + // Webkit/Opera - :checked should return selected option elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + // IE8 throws error here and will not see later tests + if ( !el.querySelectorAll( ":checked" ).length ) { + rbuggyQSA.push( ":checked" ); + } + + // Support: Safari 8+, iOS 8+ + // https://bugs.webkit.org/show_bug.cgi?id=136851 + // In-page `selector#id sibling-combinator selector` fails + if ( !el.querySelectorAll( "a#" + expando + "+*" ).length ) { + rbuggyQSA.push( ".#.+[+~]" ); + } + + // Support: Firefox <=3.6 - 5 only + // Old Firefox doesn't throw on a badly-escaped identifier. + el.querySelectorAll( "\\\f" ); + rbuggyQSA.push( "[\\r\\n\\f]" ); + } ); + + assert( function( el ) { + el.innerHTML = "" + + ""; + + // Support: Windows 8 Native Apps + // The type and name attributes are restricted during .innerHTML assignment + var input = document.createElement( "input" ); + input.setAttribute( "type", "hidden" ); + el.appendChild( input ).setAttribute( "name", "D" ); + + // Support: IE8 + // Enforce case-sensitivity of name attribute + if ( el.querySelectorAll( "[name=d]" ).length ) { + rbuggyQSA.push( "name" + whitespace + "*[*^$|!~]?=" ); + } + + // FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled) + // IE8 throws error here and will not see later tests + if ( el.querySelectorAll( ":enabled" ).length !== 2 ) { + rbuggyQSA.push( ":enabled", ":disabled" ); + } + + // Support: IE9-11+ + // IE's :disabled selector does not pick up the children of disabled fieldsets + docElem.appendChild( el ).disabled = true; + if ( el.querySelectorAll( ":disabled" ).length !== 2 ) { + rbuggyQSA.push( ":enabled", ":disabled" ); + } + + // Support: Opera 10 - 11 only + // Opera 10-11 does not throw on post-comma invalid pseudos + el.querySelectorAll( "*,:x" ); + rbuggyQSA.push( ",.*:" ); + } ); + } + + if ( ( support.matchesSelector = rnative.test( ( matches = docElem.matches || + docElem.webkitMatchesSelector || + docElem.mozMatchesSelector || + docElem.oMatchesSelector || + docElem.msMatchesSelector ) ) ) ) { + + assert( function( el ) { + + // Check to see if it's possible to do matchesSelector + // on a disconnected node (IE 9) + support.disconnectedMatch = matches.call( el, "*" ); + + // This should fail with an exception + // Gecko does not error, returns false instead + matches.call( el, "[s!='']:x" ); + rbuggyMatches.push( "!=", pseudos ); + } ); + } + + rbuggyQSA = rbuggyQSA.length && new RegExp( rbuggyQSA.join( "|" ) ); + rbuggyMatches = rbuggyMatches.length && new RegExp( rbuggyMatches.join( "|" ) ); + + /* Contains + ---------------------------------------------------------------------- */ + hasCompare = rnative.test( docElem.compareDocumentPosition ); + + // Element contains another + // Purposefully self-exclusive + // As in, an element does not contain itself + contains = hasCompare || rnative.test( docElem.contains ) ? + function( a, b ) { + var adown = a.nodeType === 9 ? a.documentElement : a, + bup = b && b.parentNode; + return a === bup || !!( bup && bup.nodeType === 1 && ( + adown.contains ? + adown.contains( bup ) : + a.compareDocumentPosition && a.compareDocumentPosition( bup ) & 16 + ) ); + } : + function( a, b ) { + if ( b ) { + while ( ( b = b.parentNode ) ) { + if ( b === a ) { + return true; + } + } + } + return false; + }; + + /* Sorting + ---------------------------------------------------------------------- */ + + // Document order sorting + sortOrder = hasCompare ? + function( a, b ) { + + // Flag for duplicate removal + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + // Sort on method existence if only one input has compareDocumentPosition + var compare = !a.compareDocumentPosition - !b.compareDocumentPosition; + if ( compare ) { + return compare; + } + + // Calculate position if both inputs belong to the same document + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + compare = ( a.ownerDocument || a ) == ( b.ownerDocument || b ) ? + a.compareDocumentPosition( b ) : + + // Otherwise we know they are disconnected + 1; + + // Disconnected nodes + if ( compare & 1 || + ( !support.sortDetached && b.compareDocumentPosition( a ) === compare ) ) { + + // Choose the first element that is related to our preferred document + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( a == document || a.ownerDocument == preferredDoc && + contains( preferredDoc, a ) ) { + return -1; + } + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( b == document || b.ownerDocument == preferredDoc && + contains( preferredDoc, b ) ) { + return 1; + } + + // Maintain original order + return sortInput ? + ( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) : + 0; + } + + return compare & 4 ? -1 : 1; + } : + function( a, b ) { + + // Exit early if the nodes are identical + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + var cur, + i = 0, + aup = a.parentNode, + bup = b.parentNode, + ap = [ a ], + bp = [ b ]; + + // Parentless nodes are either documents or disconnected + if ( !aup || !bup ) { + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + /* eslint-disable eqeqeq */ + return a == document ? -1 : + b == document ? 1 : + /* eslint-enable eqeqeq */ + aup ? -1 : + bup ? 1 : + sortInput ? + ( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) : + 0; + + // If the nodes are siblings, we can do a quick check + } else if ( aup === bup ) { + return siblingCheck( a, b ); + } + + // Otherwise we need full lists of their ancestors for comparison + cur = a; + while ( ( cur = cur.parentNode ) ) { + ap.unshift( cur ); + } + cur = b; + while ( ( cur = cur.parentNode ) ) { + bp.unshift( cur ); + } + + // Walk down the tree looking for a discrepancy + while ( ap[ i ] === bp[ i ] ) { + i++; + } + + return i ? + + // Do a sibling check if the nodes have a common ancestor + siblingCheck( ap[ i ], bp[ i ] ) : + + // Otherwise nodes in our document sort first + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + /* eslint-disable eqeqeq */ + ap[ i ] == preferredDoc ? -1 : + bp[ i ] == preferredDoc ? 1 : + /* eslint-enable eqeqeq */ + 0; + }; + + return document; +}; + +Sizzle.matches = function( expr, elements ) { + return Sizzle( expr, null, null, elements ); +}; + +Sizzle.matchesSelector = function( elem, expr ) { + setDocument( elem ); + + if ( support.matchesSelector && documentIsHTML && + !nonnativeSelectorCache[ expr + " " ] && + ( !rbuggyMatches || !rbuggyMatches.test( expr ) ) && + ( !rbuggyQSA || !rbuggyQSA.test( expr ) ) ) { + + try { + var ret = matches.call( elem, expr ); + + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || support.disconnectedMatch || + + // As well, disconnected nodes are said to be in a document + // fragment in IE 9 + elem.document && elem.document.nodeType !== 11 ) { + return ret; + } + } catch ( e ) { + nonnativeSelectorCache( expr, true ); + } + } + + return Sizzle( expr, document, null, [ elem ] ).length > 0; +}; + +Sizzle.contains = function( context, elem ) { + + // Set document vars if needed + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( ( context.ownerDocument || context ) != document ) { + setDocument( context ); + } + return contains( context, elem ); +}; + +Sizzle.attr = function( elem, name ) { + + // Set document vars if needed + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( ( elem.ownerDocument || elem ) != document ) { + setDocument( elem ); + } + + var fn = Expr.attrHandle[ name.toLowerCase() ], + + // Don't get fooled by Object.prototype properties (jQuery #13807) + val = fn && hasOwn.call( Expr.attrHandle, name.toLowerCase() ) ? + fn( elem, name, !documentIsHTML ) : + undefined; + + return val !== undefined ? + val : + support.attributes || !documentIsHTML ? + elem.getAttribute( name ) : + ( val = elem.getAttributeNode( name ) ) && val.specified ? + val.value : + null; +}; + +Sizzle.escape = function( sel ) { + return ( sel + "" ).replace( rcssescape, fcssescape ); +}; + +Sizzle.error = function( msg ) { + throw new Error( "Syntax error, unrecognized expression: " + msg ); +}; + +/** + * Document sorting and removing duplicates + * @param {ArrayLike} results + */ +Sizzle.uniqueSort = function( results ) { + var elem, + duplicates = [], + j = 0, + i = 0; + + // Unless we *know* we can detect duplicates, assume their presence + hasDuplicate = !support.detectDuplicates; + sortInput = !support.sortStable && results.slice( 0 ); + results.sort( sortOrder ); + + if ( hasDuplicate ) { + while ( ( elem = results[ i++ ] ) ) { + if ( elem === results[ i ] ) { + j = duplicates.push( i ); + } + } + while ( j-- ) { + results.splice( duplicates[ j ], 1 ); + } + } + + // Clear input after sorting to release objects + // See https://github.com/jquery/sizzle/pull/225 + sortInput = null; + + return results; +}; + +/** + * Utility function for retrieving the text value of an array of DOM nodes + * @param {Array|Element} elem + */ +getText = Sizzle.getText = function( elem ) { + var node, + ret = "", + i = 0, + nodeType = elem.nodeType; + + if ( !nodeType ) { + + // If no nodeType, this is expected to be an array + while ( ( node = elem[ i++ ] ) ) { + + // Do not traverse comment nodes + ret += getText( node ); + } + } else if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) { + + // Use textContent for elements + // innerText usage removed for consistency of new lines (jQuery #11153) + if ( typeof elem.textContent === "string" ) { + return elem.textContent; + } else { + + // Traverse its children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + ret += getText( elem ); + } + } + } else if ( nodeType === 3 || nodeType === 4 ) { + return elem.nodeValue; + } + + // Do not include comment or processing instruction nodes + + return ret; +}; + +Expr = Sizzle.selectors = { + + // Can be adjusted by the user + cacheLength: 50, + + createPseudo: markFunction, + + match: matchExpr, + + attrHandle: {}, + + find: {}, + + relative: { + ">": { dir: "parentNode", first: true }, + " ": { dir: "parentNode" }, + "+": { dir: "previousSibling", first: true }, + "~": { dir: "previousSibling" } + }, + + preFilter: { + "ATTR": function( match ) { + match[ 1 ] = match[ 1 ].replace( runescape, funescape ); + + // Move the given value to match[3] whether quoted or unquoted + match[ 3 ] = ( match[ 3 ] || match[ 4 ] || + match[ 5 ] || "" ).replace( runescape, funescape ); + + if ( match[ 2 ] === "~=" ) { + match[ 3 ] = " " + match[ 3 ] + " "; + } + + return match.slice( 0, 4 ); + }, + + "CHILD": function( match ) { + + /* matches from matchExpr["CHILD"] + 1 type (only|nth|...) + 2 what (child|of-type) + 3 argument (even|odd|\d*|\d*n([+-]\d+)?|...) + 4 xn-component of xn+y argument ([+-]?\d*n|) + 5 sign of xn-component + 6 x of xn-component + 7 sign of y-component + 8 y of y-component + */ + match[ 1 ] = match[ 1 ].toLowerCase(); + + if ( match[ 1 ].slice( 0, 3 ) === "nth" ) { + + // nth-* requires argument + if ( !match[ 3 ] ) { + Sizzle.error( match[ 0 ] ); + } + + // numeric x and y parameters for Expr.filter.CHILD + // remember that false/true cast respectively to 0/1 + match[ 4 ] = +( match[ 4 ] ? + match[ 5 ] + ( match[ 6 ] || 1 ) : + 2 * ( match[ 3 ] === "even" || match[ 3 ] === "odd" ) ); + match[ 5 ] = +( ( match[ 7 ] + match[ 8 ] ) || match[ 3 ] === "odd" ); + + // other types prohibit arguments + } else if ( match[ 3 ] ) { + Sizzle.error( match[ 0 ] ); + } + + return match; + }, + + "PSEUDO": function( match ) { + var excess, + unquoted = !match[ 6 ] && match[ 2 ]; + + if ( matchExpr[ "CHILD" ].test( match[ 0 ] ) ) { + return null; + } + + // Accept quoted arguments as-is + if ( match[ 3 ] ) { + match[ 2 ] = match[ 4 ] || match[ 5 ] || ""; + + // Strip excess characters from unquoted arguments + } else if ( unquoted && rpseudo.test( unquoted ) && + + // Get excess from tokenize (recursively) + ( excess = tokenize( unquoted, true ) ) && + + // advance to the next closing parenthesis + ( excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length ) ) { + + // excess is a negative index + match[ 0 ] = match[ 0 ].slice( 0, excess ); + match[ 2 ] = unquoted.slice( 0, excess ); + } + + // Return only captures needed by the pseudo filter method (type and argument) + return match.slice( 0, 3 ); + } + }, + + filter: { + + "TAG": function( nodeNameSelector ) { + var nodeName = nodeNameSelector.replace( runescape, funescape ).toLowerCase(); + return nodeNameSelector === "*" ? + function() { + return true; + } : + function( elem ) { + return elem.nodeName && elem.nodeName.toLowerCase() === nodeName; + }; + }, + + "CLASS": function( className ) { + var pattern = classCache[ className + " " ]; + + return pattern || + ( pattern = new RegExp( "(^|" + whitespace + + ")" + className + "(" + whitespace + "|$)" ) ) && classCache( + className, function( elem ) { + return pattern.test( + typeof elem.className === "string" && elem.className || + typeof elem.getAttribute !== "undefined" && + elem.getAttribute( "class" ) || + "" + ); + } ); + }, + + "ATTR": function( name, operator, check ) { + return function( elem ) { + var result = Sizzle.attr( elem, name ); + + if ( result == null ) { + return operator === "!="; + } + if ( !operator ) { + return true; + } + + result += ""; + + /* eslint-disable max-len */ + + return operator === "=" ? result === check : + operator === "!=" ? result !== check : + operator === "^=" ? check && result.indexOf( check ) === 0 : + operator === "*=" ? check && result.indexOf( check ) > -1 : + operator === "$=" ? check && result.slice( -check.length ) === check : + operator === "~=" ? ( " " + result.replace( rwhitespace, " " ) + " " ).indexOf( check ) > -1 : + operator === "|=" ? result === check || result.slice( 0, check.length + 1 ) === check + "-" : + false; + /* eslint-enable max-len */ + + }; + }, + + "CHILD": function( type, what, _argument, first, last ) { + var simple = type.slice( 0, 3 ) !== "nth", + forward = type.slice( -4 ) !== "last", + ofType = what === "of-type"; + + return first === 1 && last === 0 ? + + // Shortcut for :nth-*(n) + function( elem ) { + return !!elem.parentNode; + } : + + function( elem, _context, xml ) { + var cache, uniqueCache, outerCache, node, nodeIndex, start, + dir = simple !== forward ? "nextSibling" : "previousSibling", + parent = elem.parentNode, + name = ofType && elem.nodeName.toLowerCase(), + useCache = !xml && !ofType, + diff = false; + + if ( parent ) { + + // :(first|last|only)-(child|of-type) + if ( simple ) { + while ( dir ) { + node = elem; + while ( ( node = node[ dir ] ) ) { + if ( ofType ? + node.nodeName.toLowerCase() === name : + node.nodeType === 1 ) { + + return false; + } + } + + // Reverse direction for :only-* (if we haven't yet done so) + start = dir = type === "only" && !start && "nextSibling"; + } + return true; + } + + start = [ forward ? parent.firstChild : parent.lastChild ]; + + // non-xml :nth-child(...) stores cache data on `parent` + if ( forward && useCache ) { + + // Seek `elem` from a previously-cached index + + // ...in a gzip-friendly way + node = parent; + outerCache = node[ expando ] || ( node[ expando ] = {} ); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + ( outerCache[ node.uniqueID ] = {} ); + + cache = uniqueCache[ type ] || []; + nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ]; + diff = nodeIndex && cache[ 2 ]; + node = nodeIndex && parent.childNodes[ nodeIndex ]; + + while ( ( node = ++nodeIndex && node && node[ dir ] || + + // Fallback to seeking `elem` from the start + ( diff = nodeIndex = 0 ) || start.pop() ) ) { + + // When found, cache indexes on `parent` and break + if ( node.nodeType === 1 && ++diff && node === elem ) { + uniqueCache[ type ] = [ dirruns, nodeIndex, diff ]; + break; + } + } + + } else { + + // Use previously-cached element index if available + if ( useCache ) { + + // ...in a gzip-friendly way + node = elem; + outerCache = node[ expando ] || ( node[ expando ] = {} ); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + ( outerCache[ node.uniqueID ] = {} ); + + cache = uniqueCache[ type ] || []; + nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ]; + diff = nodeIndex; + } + + // xml :nth-child(...) + // or :nth-last-child(...) or :nth(-last)?-of-type(...) + if ( diff === false ) { + + // Use the same loop as above to seek `elem` from the start + while ( ( node = ++nodeIndex && node && node[ dir ] || + ( diff = nodeIndex = 0 ) || start.pop() ) ) { + + if ( ( ofType ? + node.nodeName.toLowerCase() === name : + node.nodeType === 1 ) && + ++diff ) { + + // Cache the index of each encountered element + if ( useCache ) { + outerCache = node[ expando ] || + ( node[ expando ] = {} ); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + ( outerCache[ node.uniqueID ] = {} ); + + uniqueCache[ type ] = [ dirruns, diff ]; + } + + if ( node === elem ) { + break; + } + } + } + } + } + + // Incorporate the offset, then check against cycle size + diff -= last; + return diff === first || ( diff % first === 0 && diff / first >= 0 ); + } + }; + }, + + "PSEUDO": function( pseudo, argument ) { + + // pseudo-class names are case-insensitive + // http://www.w3.org/TR/selectors/#pseudo-classes + // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters + // Remember that setFilters inherits from pseudos + var args, + fn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] || + Sizzle.error( "unsupported pseudo: " + pseudo ); + + // The user may use createPseudo to indicate that + // arguments are needed to create the filter function + // just as Sizzle does + if ( fn[ expando ] ) { + return fn( argument ); + } + + // But maintain support for old signatures + if ( fn.length > 1 ) { + args = [ pseudo, pseudo, "", argument ]; + return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ? + markFunction( function( seed, matches ) { + var idx, + matched = fn( seed, argument ), + i = matched.length; + while ( i-- ) { + idx = indexOf( seed, matched[ i ] ); + seed[ idx ] = !( matches[ idx ] = matched[ i ] ); + } + } ) : + function( elem ) { + return fn( elem, 0, args ); + }; + } + + return fn; + } + }, + + pseudos: { + + // Potentially complex pseudos + "not": markFunction( function( selector ) { + + // Trim the selector passed to compile + // to avoid treating leading and trailing + // spaces as combinators + var input = [], + results = [], + matcher = compile( selector.replace( rtrim, "$1" ) ); + + return matcher[ expando ] ? + markFunction( function( seed, matches, _context, xml ) { + var elem, + unmatched = matcher( seed, null, xml, [] ), + i = seed.length; + + // Match elements unmatched by `matcher` + while ( i-- ) { + if ( ( elem = unmatched[ i ] ) ) { + seed[ i ] = !( matches[ i ] = elem ); + } + } + } ) : + function( elem, _context, xml ) { + input[ 0 ] = elem; + matcher( input, null, xml, results ); + + // Don't keep the element (issue #299) + input[ 0 ] = null; + return !results.pop(); + }; + } ), + + "has": markFunction( function( selector ) { + return function( elem ) { + return Sizzle( selector, elem ).length > 0; + }; + } ), + + "contains": markFunction( function( text ) { + text = text.replace( runescape, funescape ); + return function( elem ) { + return ( elem.textContent || getText( elem ) ).indexOf( text ) > -1; + }; + } ), + + // "Whether an element is represented by a :lang() selector + // is based solely on the element's language value + // being equal to the identifier C, + // or beginning with the identifier C immediately followed by "-". + // The matching of C against the element's language value is performed case-insensitively. + // The identifier C does not have to be a valid language name." + // http://www.w3.org/TR/selectors/#lang-pseudo + "lang": markFunction( function( lang ) { + + // lang value must be a valid identifier + if ( !ridentifier.test( lang || "" ) ) { + Sizzle.error( "unsupported lang: " + lang ); + } + lang = lang.replace( runescape, funescape ).toLowerCase(); + return function( elem ) { + var elemLang; + do { + if ( ( elemLang = documentIsHTML ? + elem.lang : + elem.getAttribute( "xml:lang" ) || elem.getAttribute( "lang" ) ) ) { + + elemLang = elemLang.toLowerCase(); + return elemLang === lang || elemLang.indexOf( lang + "-" ) === 0; + } + } while ( ( elem = elem.parentNode ) && elem.nodeType === 1 ); + return false; + }; + } ), + + // Miscellaneous + "target": function( elem ) { + var hash = window.location && window.location.hash; + return hash && hash.slice( 1 ) === elem.id; + }, + + "root": function( elem ) { + return elem === docElem; + }, + + "focus": function( elem ) { + return elem === document.activeElement && + ( !document.hasFocus || document.hasFocus() ) && + !!( elem.type || elem.href || ~elem.tabIndex ); + }, + + // Boolean properties + "enabled": createDisabledPseudo( false ), + "disabled": createDisabledPseudo( true ), + + "checked": function( elem ) { + + // In CSS3, :checked should return both checked and selected elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + var nodeName = elem.nodeName.toLowerCase(); + return ( nodeName === "input" && !!elem.checked ) || + ( nodeName === "option" && !!elem.selected ); + }, + + "selected": function( elem ) { + + // Accessing this property makes selected-by-default + // options in Safari work properly + if ( elem.parentNode ) { + // eslint-disable-next-line no-unused-expressions + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + // Contents + "empty": function( elem ) { + + // http://www.w3.org/TR/selectors/#empty-pseudo + // :empty is negated by element (1) or content nodes (text: 3; cdata: 4; entity ref: 5), + // but not by others (comment: 8; processing instruction: 7; etc.) + // nodeType < 6 works because attributes (2) do not appear as children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + if ( elem.nodeType < 6 ) { + return false; + } + } + return true; + }, + + "parent": function( elem ) { + return !Expr.pseudos[ "empty" ]( elem ); + }, + + // Element/input types + "header": function( elem ) { + return rheader.test( elem.nodeName ); + }, + + "input": function( elem ) { + return rinputs.test( elem.nodeName ); + }, + + "button": function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === "button" || name === "button"; + }, + + "text": function( elem ) { + var attr; + return elem.nodeName.toLowerCase() === "input" && + elem.type === "text" && + + // Support: IE<8 + // New HTML5 attribute values (e.g., "search") appear with elem.type === "text" + ( ( attr = elem.getAttribute( "type" ) ) == null || + attr.toLowerCase() === "text" ); + }, + + // Position-in-collection + "first": createPositionalPseudo( function() { + return [ 0 ]; + } ), + + "last": createPositionalPseudo( function( _matchIndexes, length ) { + return [ length - 1 ]; + } ), + + "eq": createPositionalPseudo( function( _matchIndexes, length, argument ) { + return [ argument < 0 ? argument + length : argument ]; + } ), + + "even": createPositionalPseudo( function( matchIndexes, length ) { + var i = 0; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + } ), + + "odd": createPositionalPseudo( function( matchIndexes, length ) { + var i = 1; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + } ), + + "lt": createPositionalPseudo( function( matchIndexes, length, argument ) { + var i = argument < 0 ? + argument + length : + argument > length ? + length : + argument; + for ( ; --i >= 0; ) { + matchIndexes.push( i ); + } + return matchIndexes; + } ), + + "gt": createPositionalPseudo( function( matchIndexes, length, argument ) { + var i = argument < 0 ? argument + length : argument; + for ( ; ++i < length; ) { + matchIndexes.push( i ); + } + return matchIndexes; + } ) + } +}; + +Expr.pseudos[ "nth" ] = Expr.pseudos[ "eq" ]; + +// Add button/input type pseudos +for ( i in { radio: true, checkbox: true, file: true, password: true, image: true } ) { + Expr.pseudos[ i ] = createInputPseudo( i ); +} +for ( i in { submit: true, reset: true } ) { + Expr.pseudos[ i ] = createButtonPseudo( i ); +} + +// Easy API for creating new setFilters +function setFilters() {} +setFilters.prototype = Expr.filters = Expr.pseudos; +Expr.setFilters = new setFilters(); + +tokenize = Sizzle.tokenize = function( selector, parseOnly ) { + var matched, match, tokens, type, + soFar, groups, preFilters, + cached = tokenCache[ selector + " " ]; + + if ( cached ) { + return parseOnly ? 0 : cached.slice( 0 ); + } + + soFar = selector; + groups = []; + preFilters = Expr.preFilter; + + while ( soFar ) { + + // Comma and first run + if ( !matched || ( match = rcomma.exec( soFar ) ) ) { + if ( match ) { + + // Don't consume trailing commas as valid + soFar = soFar.slice( match[ 0 ].length ) || soFar; + } + groups.push( ( tokens = [] ) ); + } + + matched = false; + + // Combinators + if ( ( match = rcombinators.exec( soFar ) ) ) { + matched = match.shift(); + tokens.push( { + value: matched, + + // Cast descendant combinators to space + type: match[ 0 ].replace( rtrim, " " ) + } ); + soFar = soFar.slice( matched.length ); + } + + // Filters + for ( type in Expr.filter ) { + if ( ( match = matchExpr[ type ].exec( soFar ) ) && ( !preFilters[ type ] || + ( match = preFilters[ type ]( match ) ) ) ) { + matched = match.shift(); + tokens.push( { + value: matched, + type: type, + matches: match + } ); + soFar = soFar.slice( matched.length ); + } + } + + if ( !matched ) { + break; + } + } + + // Return the length of the invalid excess + // if we're just parsing + // Otherwise, throw an error or return tokens + return parseOnly ? + soFar.length : + soFar ? + Sizzle.error( selector ) : + + // Cache the tokens + tokenCache( selector, groups ).slice( 0 ); +}; + +function toSelector( tokens ) { + var i = 0, + len = tokens.length, + selector = ""; + for ( ; i < len; i++ ) { + selector += tokens[ i ].value; + } + return selector; +} + +function addCombinator( matcher, combinator, base ) { + var dir = combinator.dir, + skip = combinator.next, + key = skip || dir, + checkNonElements = base && key === "parentNode", + doneName = done++; + + return combinator.first ? + + // Check against closest ancestor/preceding element + function( elem, context, xml ) { + while ( ( elem = elem[ dir ] ) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + return matcher( elem, context, xml ); + } + } + return false; + } : + + // Check against all ancestor/preceding elements + function( elem, context, xml ) { + var oldCache, uniqueCache, outerCache, + newCache = [ dirruns, doneName ]; + + // We can't set arbitrary data on XML nodes, so they don't benefit from combinator caching + if ( xml ) { + while ( ( elem = elem[ dir ] ) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + if ( matcher( elem, context, xml ) ) { + return true; + } + } + } + } else { + while ( ( elem = elem[ dir ] ) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + outerCache = elem[ expando ] || ( elem[ expando ] = {} ); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ elem.uniqueID ] || + ( outerCache[ elem.uniqueID ] = {} ); + + if ( skip && skip === elem.nodeName.toLowerCase() ) { + elem = elem[ dir ] || elem; + } else if ( ( oldCache = uniqueCache[ key ] ) && + oldCache[ 0 ] === dirruns && oldCache[ 1 ] === doneName ) { + + // Assign to newCache so results back-propagate to previous elements + return ( newCache[ 2 ] = oldCache[ 2 ] ); + } else { + + // Reuse newcache so results back-propagate to previous elements + uniqueCache[ key ] = newCache; + + // A match means we're done; a fail means we have to keep checking + if ( ( newCache[ 2 ] = matcher( elem, context, xml ) ) ) { + return true; + } + } + } + } + } + return false; + }; +} + +function elementMatcher( matchers ) { + return matchers.length > 1 ? + function( elem, context, xml ) { + var i = matchers.length; + while ( i-- ) { + if ( !matchers[ i ]( elem, context, xml ) ) { + return false; + } + } + return true; + } : + matchers[ 0 ]; +} + +function multipleContexts( selector, contexts, results ) { + var i = 0, + len = contexts.length; + for ( ; i < len; i++ ) { + Sizzle( selector, contexts[ i ], results ); + } + return results; +} + +function condense( unmatched, map, filter, context, xml ) { + var elem, + newUnmatched = [], + i = 0, + len = unmatched.length, + mapped = map != null; + + for ( ; i < len; i++ ) { + if ( ( elem = unmatched[ i ] ) ) { + if ( !filter || filter( elem, context, xml ) ) { + newUnmatched.push( elem ); + if ( mapped ) { + map.push( i ); + } + } + } + } + + return newUnmatched; +} + +function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) { + if ( postFilter && !postFilter[ expando ] ) { + postFilter = setMatcher( postFilter ); + } + if ( postFinder && !postFinder[ expando ] ) { + postFinder = setMatcher( postFinder, postSelector ); + } + return markFunction( function( seed, results, context, xml ) { + var temp, i, elem, + preMap = [], + postMap = [], + preexisting = results.length, + + // Get initial elements from seed or context + elems = seed || multipleContexts( + selector || "*", + context.nodeType ? [ context ] : context, + [] + ), + + // Prefilter to get matcher input, preserving a map for seed-results synchronization + matcherIn = preFilter && ( seed || !selector ) ? + condense( elems, preMap, preFilter, context, xml ) : + elems, + + matcherOut = matcher ? + + // If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results, + postFinder || ( seed ? preFilter : preexisting || postFilter ) ? + + // ...intermediate processing is necessary + [] : + + // ...otherwise use results directly + results : + matcherIn; + + // Find primary matches + if ( matcher ) { + matcher( matcherIn, matcherOut, context, xml ); + } + + // Apply postFilter + if ( postFilter ) { + temp = condense( matcherOut, postMap ); + postFilter( temp, [], context, xml ); + + // Un-match failing elements by moving them back to matcherIn + i = temp.length; + while ( i-- ) { + if ( ( elem = temp[ i ] ) ) { + matcherOut[ postMap[ i ] ] = !( matcherIn[ postMap[ i ] ] = elem ); + } + } + } + + if ( seed ) { + if ( postFinder || preFilter ) { + if ( postFinder ) { + + // Get the final matcherOut by condensing this intermediate into postFinder contexts + temp = []; + i = matcherOut.length; + while ( i-- ) { + if ( ( elem = matcherOut[ i ] ) ) { + + // Restore matcherIn since elem is not yet a final match + temp.push( ( matcherIn[ i ] = elem ) ); + } + } + postFinder( null, ( matcherOut = [] ), temp, xml ); + } + + // Move matched elements from seed to results to keep them synchronized + i = matcherOut.length; + while ( i-- ) { + if ( ( elem = matcherOut[ i ] ) && + ( temp = postFinder ? indexOf( seed, elem ) : preMap[ i ] ) > -1 ) { + + seed[ temp ] = !( results[ temp ] = elem ); + } + } + } + + // Add elements to results, through postFinder if defined + } else { + matcherOut = condense( + matcherOut === results ? + matcherOut.splice( preexisting, matcherOut.length ) : + matcherOut + ); + if ( postFinder ) { + postFinder( null, results, matcherOut, xml ); + } else { + push.apply( results, matcherOut ); + } + } + } ); +} + +function matcherFromTokens( tokens ) { + var checkContext, matcher, j, + len = tokens.length, + leadingRelative = Expr.relative[ tokens[ 0 ].type ], + implicitRelative = leadingRelative || Expr.relative[ " " ], + i = leadingRelative ? 1 : 0, + + // The foundational matcher ensures that elements are reachable from top-level context(s) + matchContext = addCombinator( function( elem ) { + return elem === checkContext; + }, implicitRelative, true ), + matchAnyContext = addCombinator( function( elem ) { + return indexOf( checkContext, elem ) > -1; + }, implicitRelative, true ), + matchers = [ function( elem, context, xml ) { + var ret = ( !leadingRelative && ( xml || context !== outermostContext ) ) || ( + ( checkContext = context ).nodeType ? + matchContext( elem, context, xml ) : + matchAnyContext( elem, context, xml ) ); + + // Avoid hanging onto element (issue #299) + checkContext = null; + return ret; + } ]; + + for ( ; i < len; i++ ) { + if ( ( matcher = Expr.relative[ tokens[ i ].type ] ) ) { + matchers = [ addCombinator( elementMatcher( matchers ), matcher ) ]; + } else { + matcher = Expr.filter[ tokens[ i ].type ].apply( null, tokens[ i ].matches ); + + // Return special upon seeing a positional matcher + if ( matcher[ expando ] ) { + + // Find the next relative operator (if any) for proper handling + j = ++i; + for ( ; j < len; j++ ) { + if ( Expr.relative[ tokens[ j ].type ] ) { + break; + } + } + return setMatcher( + i > 1 && elementMatcher( matchers ), + i > 1 && toSelector( + + // If the preceding token was a descendant combinator, insert an implicit any-element `*` + tokens + .slice( 0, i - 1 ) + .concat( { value: tokens[ i - 2 ].type === " " ? "*" : "" } ) + ).replace( rtrim, "$1" ), + matcher, + i < j && matcherFromTokens( tokens.slice( i, j ) ), + j < len && matcherFromTokens( ( tokens = tokens.slice( j ) ) ), + j < len && toSelector( tokens ) + ); + } + matchers.push( matcher ); + } + } + + return elementMatcher( matchers ); +} + +function matcherFromGroupMatchers( elementMatchers, setMatchers ) { + var bySet = setMatchers.length > 0, + byElement = elementMatchers.length > 0, + superMatcher = function( seed, context, xml, results, outermost ) { + var elem, j, matcher, + matchedCount = 0, + i = "0", + unmatched = seed && [], + setMatched = [], + contextBackup = outermostContext, + + // We must always have either seed elements or outermost context + elems = seed || byElement && Expr.find[ "TAG" ]( "*", outermost ), + + // Use integer dirruns iff this is the outermost matcher + dirrunsUnique = ( dirruns += contextBackup == null ? 1 : Math.random() || 0.1 ), + len = elems.length; + + if ( outermost ) { + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + outermostContext = context == document || context || outermost; + } + + // Add elements passing elementMatchers directly to results + // Support: IE<9, Safari + // Tolerate NodeList properties (IE: "length"; Safari: ) matching elements by id + for ( ; i !== len && ( elem = elems[ i ] ) != null; i++ ) { + if ( byElement && elem ) { + j = 0; + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( !context && elem.ownerDocument != document ) { + setDocument( elem ); + xml = !documentIsHTML; + } + while ( ( matcher = elementMatchers[ j++ ] ) ) { + if ( matcher( elem, context || document, xml ) ) { + results.push( elem ); + break; + } + } + if ( outermost ) { + dirruns = dirrunsUnique; + } + } + + // Track unmatched elements for set filters + if ( bySet ) { + + // They will have gone through all possible matchers + if ( ( elem = !matcher && elem ) ) { + matchedCount--; + } + + // Lengthen the array for every element, matched or not + if ( seed ) { + unmatched.push( elem ); + } + } + } + + // `i` is now the count of elements visited above, and adding it to `matchedCount` + // makes the latter nonnegative. + matchedCount += i; + + // Apply set filters to unmatched elements + // NOTE: This can be skipped if there are no unmatched elements (i.e., `matchedCount` + // equals `i`), unless we didn't visit _any_ elements in the above loop because we have + // no element matchers and no seed. + // Incrementing an initially-string "0" `i` allows `i` to remain a string only in that + // case, which will result in a "00" `matchedCount` that differs from `i` but is also + // numerically zero. + if ( bySet && i !== matchedCount ) { + j = 0; + while ( ( matcher = setMatchers[ j++ ] ) ) { + matcher( unmatched, setMatched, context, xml ); + } + + if ( seed ) { + + // Reintegrate element matches to eliminate the need for sorting + if ( matchedCount > 0 ) { + while ( i-- ) { + if ( !( unmatched[ i ] || setMatched[ i ] ) ) { + setMatched[ i ] = pop.call( results ); + } + } + } + + // Discard index placeholder values to get only actual matches + setMatched = condense( setMatched ); + } + + // Add matches to results + push.apply( results, setMatched ); + + // Seedless set matches succeeding multiple successful matchers stipulate sorting + if ( outermost && !seed && setMatched.length > 0 && + ( matchedCount + setMatchers.length ) > 1 ) { + + Sizzle.uniqueSort( results ); + } + } + + // Override manipulation of globals by nested matchers + if ( outermost ) { + dirruns = dirrunsUnique; + outermostContext = contextBackup; + } + + return unmatched; + }; + + return bySet ? + markFunction( superMatcher ) : + superMatcher; +} + +compile = Sizzle.compile = function( selector, match /* Internal Use Only */ ) { + var i, + setMatchers = [], + elementMatchers = [], + cached = compilerCache[ selector + " " ]; + + if ( !cached ) { + + // Generate a function of recursive functions that can be used to check each element + if ( !match ) { + match = tokenize( selector ); + } + i = match.length; + while ( i-- ) { + cached = matcherFromTokens( match[ i ] ); + if ( cached[ expando ] ) { + setMatchers.push( cached ); + } else { + elementMatchers.push( cached ); + } + } + + // Cache the compiled function + cached = compilerCache( + selector, + matcherFromGroupMatchers( elementMatchers, setMatchers ) + ); + + // Save selector and tokenization + cached.selector = selector; + } + return cached; +}; + +/** + * A low-level selection function that works with Sizzle's compiled + * selector functions + * @param {String|Function} selector A selector or a pre-compiled + * selector function built with Sizzle.compile + * @param {Element} context + * @param {Array} [results] + * @param {Array} [seed] A set of elements to match against + */ +select = Sizzle.select = function( selector, context, results, seed ) { + var i, tokens, token, type, find, + compiled = typeof selector === "function" && selector, + match = !seed && tokenize( ( selector = compiled.selector || selector ) ); + + results = results || []; + + // Try to minimize operations if there is only one selector in the list and no seed + // (the latter of which guarantees us context) + if ( match.length === 1 ) { + + // Reduce context if the leading compound selector is an ID + tokens = match[ 0 ] = match[ 0 ].slice( 0 ); + if ( tokens.length > 2 && ( token = tokens[ 0 ] ).type === "ID" && + context.nodeType === 9 && documentIsHTML && Expr.relative[ tokens[ 1 ].type ] ) { + + context = ( Expr.find[ "ID" ]( token.matches[ 0 ] + .replace( runescape, funescape ), context ) || [] )[ 0 ]; + if ( !context ) { + return results; + + // Precompiled matchers will still verify ancestry, so step up a level + } else if ( compiled ) { + context = context.parentNode; + } + + selector = selector.slice( tokens.shift().value.length ); + } + + // Fetch a seed set for right-to-left matching + i = matchExpr[ "needsContext" ].test( selector ) ? 0 : tokens.length; + while ( i-- ) { + token = tokens[ i ]; + + // Abort if we hit a combinator + if ( Expr.relative[ ( type = token.type ) ] ) { + break; + } + if ( ( find = Expr.find[ type ] ) ) { + + // Search, expanding context for leading sibling combinators + if ( ( seed = find( + token.matches[ 0 ].replace( runescape, funescape ), + rsibling.test( tokens[ 0 ].type ) && testContext( context.parentNode ) || + context + ) ) ) { + + // If seed is empty or no tokens remain, we can return early + tokens.splice( i, 1 ); + selector = seed.length && toSelector( tokens ); + if ( !selector ) { + push.apply( results, seed ); + return results; + } + + break; + } + } + } + } + + // Compile and execute a filtering function if one is not provided + // Provide `match` to avoid retokenization if we modified the selector above + ( compiled || compile( selector, match ) )( + seed, + context, + !documentIsHTML, + results, + !context || rsibling.test( selector ) && testContext( context.parentNode ) || context + ); + return results; +}; + +// One-time assignments + +// Sort stability +support.sortStable = expando.split( "" ).sort( sortOrder ).join( "" ) === expando; + +// Support: Chrome 14-35+ +// Always assume duplicates if they aren't passed to the comparison function +support.detectDuplicates = !!hasDuplicate; + +// Initialize against the default document +setDocument(); + +// Support: Webkit<537.32 - Safari 6.0.3/Chrome 25 (fixed in Chrome 27) +// Detached nodes confoundingly follow *each other* +support.sortDetached = assert( function( el ) { + + // Should return 1, but returns 4 (following) + return el.compareDocumentPosition( document.createElement( "fieldset" ) ) & 1; +} ); + +// Support: IE<8 +// Prevent attribute/property "interpolation" +// https://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx +if ( !assert( function( el ) { + el.innerHTML = ""; + return el.firstChild.getAttribute( "href" ) === "#"; +} ) ) { + addHandle( "type|href|height|width", function( elem, name, isXML ) { + if ( !isXML ) { + return elem.getAttribute( name, name.toLowerCase() === "type" ? 1 : 2 ); + } + } ); +} + +// Support: IE<9 +// Use defaultValue in place of getAttribute("value") +if ( !support.attributes || !assert( function( el ) { + el.innerHTML = ""; + el.firstChild.setAttribute( "value", "" ); + return el.firstChild.getAttribute( "value" ) === ""; +} ) ) { + addHandle( "value", function( elem, _name, isXML ) { + if ( !isXML && elem.nodeName.toLowerCase() === "input" ) { + return elem.defaultValue; + } + } ); +} + +// Support: IE<9 +// Use getAttributeNode to fetch booleans when getAttribute lies +if ( !assert( function( el ) { + return el.getAttribute( "disabled" ) == null; +} ) ) { + addHandle( booleans, function( elem, name, isXML ) { + var val; + if ( !isXML ) { + return elem[ name ] === true ? name.toLowerCase() : + ( val = elem.getAttributeNode( name ) ) && val.specified ? + val.value : + null; + } + } ); +} + +return Sizzle; + +} )( window ); + + + +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; + +// Deprecated +jQuery.expr[ ":" ] = jQuery.expr.pseudos; +jQuery.uniqueSort = jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; +jQuery.escapeSelector = Sizzle.escape; + + + + +var dir = function( elem, dir, until ) { + var matched = [], + truncate = until !== undefined; + + while ( ( elem = elem[ dir ] ) && elem.nodeType !== 9 ) { + if ( elem.nodeType === 1 ) { + if ( truncate && jQuery( elem ).is( until ) ) { + break; + } + matched.push( elem ); + } + } + return matched; +}; + + +var siblings = function( n, elem ) { + var matched = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + matched.push( n ); + } + } + + return matched; +}; + + +var rneedsContext = jQuery.expr.match.needsContext; + + + +function nodeName( elem, name ) { + + return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase(); + +} +var rsingleTag = ( /^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i ); + + + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, not ) { + if ( isFunction( qualifier ) ) { + return jQuery.grep( elements, function( elem, i ) { + return !!qualifier.call( elem, i, elem ) !== not; + } ); + } + + // Single element + if ( qualifier.nodeType ) { + return jQuery.grep( elements, function( elem ) { + return ( elem === qualifier ) !== not; + } ); + } + + // Arraylike of elements (jQuery, arguments, Array) + if ( typeof qualifier !== "string" ) { + return jQuery.grep( elements, function( elem ) { + return ( indexOf.call( qualifier, elem ) > -1 ) !== not; + } ); + } + + // Filtered directly for both simple and complex selectors + return jQuery.filter( qualifier, elements, not ); +} + +jQuery.filter = function( expr, elems, not ) { + var elem = elems[ 0 ]; + + if ( not ) { + expr = ":not(" + expr + ")"; + } + + if ( elems.length === 1 && elem.nodeType === 1 ) { + return jQuery.find.matchesSelector( elem, expr ) ? [ elem ] : []; + } + + return jQuery.find.matches( expr, jQuery.grep( elems, function( elem ) { + return elem.nodeType === 1; + } ) ); +}; + +jQuery.fn.extend( { + find: function( selector ) { + var i, ret, + len = this.length, + self = this; + + if ( typeof selector !== "string" ) { + return this.pushStack( jQuery( selector ).filter( function() { + for ( i = 0; i < len; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + } ) ); + } + + ret = this.pushStack( [] ); + + for ( i = 0; i < len; i++ ) { + jQuery.find( selector, self[ i ], ret ); + } + + return len > 1 ? jQuery.uniqueSort( ret ) : ret; + }, + filter: function( selector ) { + return this.pushStack( winnow( this, selector || [], false ) ); + }, + not: function( selector ) { + return this.pushStack( winnow( this, selector || [], true ) ); + }, + is: function( selector ) { + return !!winnow( + this, + + // If this is a positional/relative selector, check membership in the returned set + // so $("p:first").is("p:last") won't return true for a doc with two "p". + typeof selector === "string" && rneedsContext.test( selector ) ? + jQuery( selector ) : + selector || [], + false + ).length; + } +} ); + + +// Initialize a jQuery object + + +// A central reference to the root jQuery(document) +var rootjQuery, + + // A simple way to check for HTML strings + // Prioritize #id over to avoid XSS via location.hash (#9521) + // Strict HTML recognition (#11290: must start with <) + // Shortcut simple #id case for speed + rquickExpr = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/, + + init = jQuery.fn.init = function( selector, context, root ) { + var match, elem; + + // HANDLE: $(""), $(null), $(undefined), $(false) + if ( !selector ) { + return this; + } + + // Method init() accepts an alternate rootjQuery + // so migrate can support jQuery.sub (gh-2101) + root = root || rootjQuery; + + // Handle HTML strings + if ( typeof selector === "string" ) { + if ( selector[ 0 ] === "<" && + selector[ selector.length - 1 ] === ">" && + selector.length >= 3 ) { + + // Assume that strings that start and end with <> are HTML and skip the regex check + match = [ null, selector, null ]; + + } else { + match = rquickExpr.exec( selector ); + } + + // Match html or make sure no context is specified for #id + if ( match && ( match[ 1 ] || !context ) ) { + + // HANDLE: $(html) -> $(array) + if ( match[ 1 ] ) { + context = context instanceof jQuery ? context[ 0 ] : context; + + // Option to run scripts is true for back-compat + // Intentionally let the error be thrown if parseHTML is not present + jQuery.merge( this, jQuery.parseHTML( + match[ 1 ], + context && context.nodeType ? context.ownerDocument || context : document, + true + ) ); + + // HANDLE: $(html, props) + if ( rsingleTag.test( match[ 1 ] ) && jQuery.isPlainObject( context ) ) { + for ( match in context ) { + + // Properties of context are called as methods if possible + if ( isFunction( this[ match ] ) ) { + this[ match ]( context[ match ] ); + + // ...and otherwise set as attributes + } else { + this.attr( match, context[ match ] ); + } + } + } + + return this; + + // HANDLE: $(#id) + } else { + elem = document.getElementById( match[ 2 ] ); + + if ( elem ) { + + // Inject the element directly into the jQuery object + this[ 0 ] = elem; + this.length = 1; + } + return this; + } + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return ( context || root ).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor( context ).find( selector ); + } + + // HANDLE: $(DOMElement) + } else if ( selector.nodeType ) { + this[ 0 ] = selector; + this.length = 1; + return this; + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( isFunction( selector ) ) { + return root.ready !== undefined ? + root.ready( selector ) : + + // Execute immediately if ready is not present + selector( jQuery ); + } + + return jQuery.makeArray( selector, this ); + }; + +// Give the init function the jQuery prototype for later instantiation +init.prototype = jQuery.fn; + +// Initialize central reference +rootjQuery = jQuery( document ); + + +var rparentsprev = /^(?:parents|prev(?:Until|All))/, + + // Methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend( { + has: function( target ) { + var targets = jQuery( target, this ), + l = targets.length; + + return this.filter( function() { + var i = 0; + for ( ; i < l; i++ ) { + if ( jQuery.contains( this, targets[ i ] ) ) { + return true; + } + } + } ); + }, + + closest: function( selectors, context ) { + var cur, + i = 0, + l = this.length, + matched = [], + targets = typeof selectors !== "string" && jQuery( selectors ); + + // Positional selectors never match, since there's no _selection_ context + if ( !rneedsContext.test( selectors ) ) { + for ( ; i < l; i++ ) { + for ( cur = this[ i ]; cur && cur !== context; cur = cur.parentNode ) { + + // Always skip document fragments + if ( cur.nodeType < 11 && ( targets ? + targets.index( cur ) > -1 : + + // Don't pass non-elements to Sizzle + cur.nodeType === 1 && + jQuery.find.matchesSelector( cur, selectors ) ) ) { + + matched.push( cur ); + break; + } + } + } + } + + return this.pushStack( matched.length > 1 ? jQuery.uniqueSort( matched ) : matched ); + }, + + // Determine the position of an element within the set + index: function( elem ) { + + // No argument, return index in parent + if ( !elem ) { + return ( this[ 0 ] && this[ 0 ].parentNode ) ? this.first().prevAll().length : -1; + } + + // Index in selector + if ( typeof elem === "string" ) { + return indexOf.call( jQuery( elem ), this[ 0 ] ); + } + + // Locate the position of the desired element + return indexOf.call( this, + + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[ 0 ] : elem + ); + }, + + add: function( selector, context ) { + return this.pushStack( + jQuery.uniqueSort( + jQuery.merge( this.get(), jQuery( selector, context ) ) + ) + ); + }, + + addBack: function( selector ) { + return this.add( selector == null ? + this.prevObject : this.prevObject.filter( selector ) + ); + } +} ); + +function sibling( cur, dir ) { + while ( ( cur = cur[ dir ] ) && cur.nodeType !== 1 ) {} + return cur; +} + +jQuery.each( { + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, _i, until ) { + return dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return sibling( elem, "nextSibling" ); + }, + prev: function( elem ) { + return sibling( elem, "previousSibling" ); + }, + nextAll: function( elem ) { + return dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, _i, until ) { + return dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, _i, until ) { + return dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return siblings( ( elem.parentNode || {} ).firstChild, elem ); + }, + children: function( elem ) { + return siblings( elem.firstChild ); + }, + contents: function( elem ) { + if ( elem.contentDocument != null && + + // Support: IE 11+ + // elements with no `data` attribute has an object + // `contentDocument` with a `null` prototype. + getProto( elem.contentDocument ) ) { + + return elem.contentDocument; + } + + // Support: IE 9 - 11 only, iOS 7 only, Android Browser <=4.3 only + // Treat the template element as a regular one in browsers that + // don't support it. + if ( nodeName( elem, "template" ) ) { + elem = elem.content || elem; + } + + return jQuery.merge( [], elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var matched = jQuery.map( this, fn, until ); + + if ( name.slice( -5 ) !== "Until" ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + matched = jQuery.filter( selector, matched ); + } + + if ( this.length > 1 ) { + + // Remove duplicates + if ( !guaranteedUnique[ name ] ) { + jQuery.uniqueSort( matched ); + } + + // Reverse order for parents* and prev-derivatives + if ( rparentsprev.test( name ) ) { + matched.reverse(); + } + } + + return this.pushStack( matched ); + }; +} ); +var rnothtmlwhite = ( /[^\x20\t\r\n\f]+/g ); + + + +// Convert String-formatted options into Object-formatted ones +function createOptions( options ) { + var object = {}; + jQuery.each( options.match( rnothtmlwhite ) || [], function( _, flag ) { + object[ flag ] = true; + } ); + return object; +} + +/* + * Create a callback list using the following parameters: + * + * options: an optional list of space-separated options that will change how + * the callback list behaves or a more traditional option object + * + * By default a callback list will act like an event callback list and can be + * "fired" multiple times. + * + * Possible options: + * + * once: will ensure the callback list can only be fired once (like a Deferred) + * + * memory: will keep track of previous values and will call any callback added + * after the list has been fired right away with the latest "memorized" + * values (like a Deferred) + * + * unique: will ensure a callback can only be added once (no duplicate in the list) + * + * stopOnFalse: interrupt callings when a callback returns false + * + */ +jQuery.Callbacks = function( options ) { + + // Convert options from String-formatted to Object-formatted if needed + // (we check in cache first) + options = typeof options === "string" ? + createOptions( options ) : + jQuery.extend( {}, options ); + + var // Flag to know if list is currently firing + firing, + + // Last fire value for non-forgettable lists + memory, + + // Flag to know if list was already fired + fired, + + // Flag to prevent firing + locked, + + // Actual callback list + list = [], + + // Queue of execution data for repeatable lists + queue = [], + + // Index of currently firing callback (modified by add/remove as needed) + firingIndex = -1, + + // Fire callbacks + fire = function() { + + // Enforce single-firing + locked = locked || options.once; + + // Execute callbacks for all pending executions, + // respecting firingIndex overrides and runtime changes + fired = firing = true; + for ( ; queue.length; firingIndex = -1 ) { + memory = queue.shift(); + while ( ++firingIndex < list.length ) { + + // Run callback and check for early termination + if ( list[ firingIndex ].apply( memory[ 0 ], memory[ 1 ] ) === false && + options.stopOnFalse ) { + + // Jump to end and forget the data so .add doesn't re-fire + firingIndex = list.length; + memory = false; + } + } + } + + // Forget the data if we're done with it + if ( !options.memory ) { + memory = false; + } + + firing = false; + + // Clean up if we're done firing for good + if ( locked ) { + + // Keep an empty list if we have data for future add calls + if ( memory ) { + list = []; + + // Otherwise, this object is spent + } else { + list = ""; + } + } + }, + + // Actual Callbacks object + self = { + + // Add a callback or a collection of callbacks to the list + add: function() { + if ( list ) { + + // If we have memory from a past run, we should fire after adding + if ( memory && !firing ) { + firingIndex = list.length - 1; + queue.push( memory ); + } + + ( function add( args ) { + jQuery.each( args, function( _, arg ) { + if ( isFunction( arg ) ) { + if ( !options.unique || !self.has( arg ) ) { + list.push( arg ); + } + } else if ( arg && arg.length && toType( arg ) !== "string" ) { + + // Inspect recursively + add( arg ); + } + } ); + } )( arguments ); + + if ( memory && !firing ) { + fire(); + } + } + return this; + }, + + // Remove a callback from the list + remove: function() { + jQuery.each( arguments, function( _, arg ) { + var index; + while ( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) { + list.splice( index, 1 ); + + // Handle firing indexes + if ( index <= firingIndex ) { + firingIndex--; + } + } + } ); + return this; + }, + + // Check if a given callback is in the list. + // If no argument is given, return whether or not list has callbacks attached. + has: function( fn ) { + return fn ? + jQuery.inArray( fn, list ) > -1 : + list.length > 0; + }, + + // Remove all callbacks from the list + empty: function() { + if ( list ) { + list = []; + } + return this; + }, + + // Disable .fire and .add + // Abort any current/pending executions + // Clear all callbacks and values + disable: function() { + locked = queue = []; + list = memory = ""; + return this; + }, + disabled: function() { + return !list; + }, + + // Disable .fire + // Also disable .add unless we have memory (since it would have no effect) + // Abort any pending executions + lock: function() { + locked = queue = []; + if ( !memory && !firing ) { + list = memory = ""; + } + return this; + }, + locked: function() { + return !!locked; + }, + + // Call all callbacks with the given context and arguments + fireWith: function( context, args ) { + if ( !locked ) { + args = args || []; + args = [ context, args.slice ? args.slice() : args ]; + queue.push( args ); + if ( !firing ) { + fire(); + } + } + return this; + }, + + // Call all the callbacks with the given arguments + fire: function() { + self.fireWith( this, arguments ); + return this; + }, + + // To know if the callbacks have already been called at least once + fired: function() { + return !!fired; + } + }; + + return self; +}; + + +function Identity( v ) { + return v; +} +function Thrower( ex ) { + throw ex; +} + +function adoptValue( value, resolve, reject, noValue ) { + var method; + + try { + + // Check for promise aspect first to privilege synchronous behavior + if ( value && isFunction( ( method = value.promise ) ) ) { + method.call( value ).done( resolve ).fail( reject ); + + // Other thenables + } else if ( value && isFunction( ( method = value.then ) ) ) { + method.call( value, resolve, reject ); + + // Other non-thenables + } else { + + // Control `resolve` arguments by letting Array#slice cast boolean `noValue` to integer: + // * false: [ value ].slice( 0 ) => resolve( value ) + // * true: [ value ].slice( 1 ) => resolve() + resolve.apply( undefined, [ value ].slice( noValue ) ); + } + + // For Promises/A+, convert exceptions into rejections + // Since jQuery.when doesn't unwrap thenables, we can skip the extra checks appearing in + // Deferred#then to conditionally suppress rejection. + } catch ( value ) { + + // Support: Android 4.0 only + // Strict mode functions invoked without .call/.apply get global-object context + reject.apply( undefined, [ value ] ); + } +} + +jQuery.extend( { + + Deferred: function( func ) { + var tuples = [ + + // action, add listener, callbacks, + // ... .then handlers, argument index, [final state] + [ "notify", "progress", jQuery.Callbacks( "memory" ), + jQuery.Callbacks( "memory" ), 2 ], + [ "resolve", "done", jQuery.Callbacks( "once memory" ), + jQuery.Callbacks( "once memory" ), 0, "resolved" ], + [ "reject", "fail", jQuery.Callbacks( "once memory" ), + jQuery.Callbacks( "once memory" ), 1, "rejected" ] + ], + state = "pending", + promise = { + state: function() { + return state; + }, + always: function() { + deferred.done( arguments ).fail( arguments ); + return this; + }, + "catch": function( fn ) { + return promise.then( null, fn ); + }, + + // Keep pipe for back-compat + pipe: function( /* fnDone, fnFail, fnProgress */ ) { + var fns = arguments; + + return jQuery.Deferred( function( newDefer ) { + jQuery.each( tuples, function( _i, tuple ) { + + // Map tuples (progress, done, fail) to arguments (done, fail, progress) + var fn = isFunction( fns[ tuple[ 4 ] ] ) && fns[ tuple[ 4 ] ]; + + // deferred.progress(function() { bind to newDefer or newDefer.notify }) + // deferred.done(function() { bind to newDefer or newDefer.resolve }) + // deferred.fail(function() { bind to newDefer or newDefer.reject }) + deferred[ tuple[ 1 ] ]( function() { + var returned = fn && fn.apply( this, arguments ); + if ( returned && isFunction( returned.promise ) ) { + returned.promise() + .progress( newDefer.notify ) + .done( newDefer.resolve ) + .fail( newDefer.reject ); + } else { + newDefer[ tuple[ 0 ] + "With" ]( + this, + fn ? [ returned ] : arguments + ); + } + } ); + } ); + fns = null; + } ).promise(); + }, + then: function( onFulfilled, onRejected, onProgress ) { + var maxDepth = 0; + function resolve( depth, deferred, handler, special ) { + return function() { + var that = this, + args = arguments, + mightThrow = function() { + var returned, then; + + // Support: Promises/A+ section 2.3.3.3.3 + // https://promisesaplus.com/#point-59 + // Ignore double-resolution attempts + if ( depth < maxDepth ) { + return; + } + + returned = handler.apply( that, args ); + + // Support: Promises/A+ section 2.3.1 + // https://promisesaplus.com/#point-48 + if ( returned === deferred.promise() ) { + throw new TypeError( "Thenable self-resolution" ); + } + + // Support: Promises/A+ sections 2.3.3.1, 3.5 + // https://promisesaplus.com/#point-54 + // https://promisesaplus.com/#point-75 + // Retrieve `then` only once + then = returned && + + // Support: Promises/A+ section 2.3.4 + // https://promisesaplus.com/#point-64 + // Only check objects and functions for thenability + ( typeof returned === "object" || + typeof returned === "function" ) && + returned.then; + + // Handle a returned thenable + if ( isFunction( then ) ) { + + // Special processors (notify) just wait for resolution + if ( special ) { + then.call( + returned, + resolve( maxDepth, deferred, Identity, special ), + resolve( maxDepth, deferred, Thrower, special ) + ); + + // Normal processors (resolve) also hook into progress + } else { + + // ...and disregard older resolution values + maxDepth++; + + then.call( + returned, + resolve( maxDepth, deferred, Identity, special ), + resolve( maxDepth, deferred, Thrower, special ), + resolve( maxDepth, deferred, Identity, + deferred.notifyWith ) + ); + } + + // Handle all other returned values + } else { + + // Only substitute handlers pass on context + // and multiple values (non-spec behavior) + if ( handler !== Identity ) { + that = undefined; + args = [ returned ]; + } + + // Process the value(s) + // Default process is resolve + ( special || deferred.resolveWith )( that, args ); + } + }, + + // Only normal processors (resolve) catch and reject exceptions + process = special ? + mightThrow : + function() { + try { + mightThrow(); + } catch ( e ) { + + if ( jQuery.Deferred.exceptionHook ) { + jQuery.Deferred.exceptionHook( e, + process.stackTrace ); + } + + // Support: Promises/A+ section 2.3.3.3.4.1 + // https://promisesaplus.com/#point-61 + // Ignore post-resolution exceptions + if ( depth + 1 >= maxDepth ) { + + // Only substitute handlers pass on context + // and multiple values (non-spec behavior) + if ( handler !== Thrower ) { + that = undefined; + args = [ e ]; + } + + deferred.rejectWith( that, args ); + } + } + }; + + // Support: Promises/A+ section 2.3.3.3.1 + // https://promisesaplus.com/#point-57 + // Re-resolve promises immediately to dodge false rejection from + // subsequent errors + if ( depth ) { + process(); + } else { + + // Call an optional hook to record the stack, in case of exception + // since it's otherwise lost when execution goes async + if ( jQuery.Deferred.getStackHook ) { + process.stackTrace = jQuery.Deferred.getStackHook(); + } + window.setTimeout( process ); + } + }; + } + + return jQuery.Deferred( function( newDefer ) { + + // progress_handlers.add( ... ) + tuples[ 0 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onProgress ) ? + onProgress : + Identity, + newDefer.notifyWith + ) + ); + + // fulfilled_handlers.add( ... ) + tuples[ 1 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onFulfilled ) ? + onFulfilled : + Identity + ) + ); + + // rejected_handlers.add( ... ) + tuples[ 2 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onRejected ) ? + onRejected : + Thrower + ) + ); + } ).promise(); + }, + + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + return obj != null ? jQuery.extend( obj, promise ) : promise; + } + }, + deferred = {}; + + // Add list-specific methods + jQuery.each( tuples, function( i, tuple ) { + var list = tuple[ 2 ], + stateString = tuple[ 5 ]; + + // promise.progress = list.add + // promise.done = list.add + // promise.fail = list.add + promise[ tuple[ 1 ] ] = list.add; + + // Handle state + if ( stateString ) { + list.add( + function() { + + // state = "resolved" (i.e., fulfilled) + // state = "rejected" + state = stateString; + }, + + // rejected_callbacks.disable + // fulfilled_callbacks.disable + tuples[ 3 - i ][ 2 ].disable, + + // rejected_handlers.disable + // fulfilled_handlers.disable + tuples[ 3 - i ][ 3 ].disable, + + // progress_callbacks.lock + tuples[ 0 ][ 2 ].lock, + + // progress_handlers.lock + tuples[ 0 ][ 3 ].lock + ); + } + + // progress_handlers.fire + // fulfilled_handlers.fire + // rejected_handlers.fire + list.add( tuple[ 3 ].fire ); + + // deferred.notify = function() { deferred.notifyWith(...) } + // deferred.resolve = function() { deferred.resolveWith(...) } + // deferred.reject = function() { deferred.rejectWith(...) } + deferred[ tuple[ 0 ] ] = function() { + deferred[ tuple[ 0 ] + "With" ]( this === deferred ? undefined : this, arguments ); + return this; + }; + + // deferred.notifyWith = list.fireWith + // deferred.resolveWith = list.fireWith + // deferred.rejectWith = list.fireWith + deferred[ tuple[ 0 ] + "With" ] = list.fireWith; + } ); + + // Make the deferred a promise + promise.promise( deferred ); + + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + + // All done! + return deferred; + }, + + // Deferred helper + when: function( singleValue ) { + var + + // count of uncompleted subordinates + remaining = arguments.length, + + // count of unprocessed arguments + i = remaining, + + // subordinate fulfillment data + resolveContexts = Array( i ), + resolveValues = slice.call( arguments ), + + // the primary Deferred + primary = jQuery.Deferred(), + + // subordinate callback factory + updateFunc = function( i ) { + return function( value ) { + resolveContexts[ i ] = this; + resolveValues[ i ] = arguments.length > 1 ? slice.call( arguments ) : value; + if ( !( --remaining ) ) { + primary.resolveWith( resolveContexts, resolveValues ); + } + }; + }; + + // Single- and empty arguments are adopted like Promise.resolve + if ( remaining <= 1 ) { + adoptValue( singleValue, primary.done( updateFunc( i ) ).resolve, primary.reject, + !remaining ); + + // Use .then() to unwrap secondary thenables (cf. gh-3000) + if ( primary.state() === "pending" || + isFunction( resolveValues[ i ] && resolveValues[ i ].then ) ) { + + return primary.then(); + } + } + + // Multiple arguments are aggregated like Promise.all array elements + while ( i-- ) { + adoptValue( resolveValues[ i ], updateFunc( i ), primary.reject ); + } + + return primary.promise(); + } +} ); + + +// These usually indicate a programmer mistake during development, +// warn about them ASAP rather than swallowing them by default. +var rerrorNames = /^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/; + +jQuery.Deferred.exceptionHook = function( error, stack ) { + + // Support: IE 8 - 9 only + // Console exists when dev tools are open, which can happen at any time + if ( window.console && window.console.warn && error && rerrorNames.test( error.name ) ) { + window.console.warn( "jQuery.Deferred exception: " + error.message, error.stack, stack ); + } +}; + + + + +jQuery.readyException = function( error ) { + window.setTimeout( function() { + throw error; + } ); +}; + + + + +// The deferred used on DOM ready +var readyList = jQuery.Deferred(); + +jQuery.fn.ready = function( fn ) { + + readyList + .then( fn ) + + // Wrap jQuery.readyException in a function so that the lookup + // happens at the time of error handling instead of callback + // registration. + .catch( function( error ) { + jQuery.readyException( error ); + } ); + + return this; +}; + +jQuery.extend( { + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Handle when the DOM is ready + ready: function( wait ) { + + // Abort if there are pending holds or we're already ready + if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) { + return; + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.resolveWith( document, [ jQuery ] ); + } +} ); + +jQuery.ready.then = readyList.then; + +// The ready event handler and self cleanup method +function completed() { + document.removeEventListener( "DOMContentLoaded", completed ); + window.removeEventListener( "load", completed ); + jQuery.ready(); +} + +// Catch cases where $(document).ready() is called +// after the browser event has already occurred. +// Support: IE <=9 - 10 only +// Older IE sometimes signals "interactive" too soon +if ( document.readyState === "complete" || + ( document.readyState !== "loading" && !document.documentElement.doScroll ) ) { + + // Handle it asynchronously to allow scripts the opportunity to delay ready + window.setTimeout( jQuery.ready ); + +} else { + + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", completed ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", completed ); +} + + + + +// Multifunctional method to get and set values of a collection +// The value/s can optionally be executed if it's a function +var access = function( elems, fn, key, value, chainable, emptyGet, raw ) { + var i = 0, + len = elems.length, + bulk = key == null; + + // Sets many values + if ( toType( key ) === "object" ) { + chainable = true; + for ( i in key ) { + access( elems, fn, i, key[ i ], true, emptyGet, raw ); + } + + // Sets one value + } else if ( value !== undefined ) { + chainable = true; + + if ( !isFunction( value ) ) { + raw = true; + } + + if ( bulk ) { + + // Bulk operations run against the entire set + if ( raw ) { + fn.call( elems, value ); + fn = null; + + // ...except when executing function values + } else { + bulk = fn; + fn = function( elem, _key, value ) { + return bulk.call( jQuery( elem ), value ); + }; + } + } + + if ( fn ) { + for ( ; i < len; i++ ) { + fn( + elems[ i ], key, raw ? + value : + value.call( elems[ i ], i, fn( elems[ i ], key ) ) + ); + } + } + } + + if ( chainable ) { + return elems; + } + + // Gets + if ( bulk ) { + return fn.call( elems ); + } + + return len ? fn( elems[ 0 ], key ) : emptyGet; +}; + + +// Matches dashed string for camelizing +var rmsPrefix = /^-ms-/, + rdashAlpha = /-([a-z])/g; + +// Used by camelCase as callback to replace() +function fcamelCase( _all, letter ) { + return letter.toUpperCase(); +} + +// Convert dashed to camelCase; used by the css and data modules +// Support: IE <=9 - 11, Edge 12 - 15 +// Microsoft forgot to hump their vendor prefix (#9572) +function camelCase( string ) { + return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); +} +var acceptData = function( owner ) { + + // Accepts only: + // - Node + // - Node.ELEMENT_NODE + // - Node.DOCUMENT_NODE + // - Object + // - Any + return owner.nodeType === 1 || owner.nodeType === 9 || !( +owner.nodeType ); +}; + + + + +function Data() { + this.expando = jQuery.expando + Data.uid++; +} + +Data.uid = 1; + +Data.prototype = { + + cache: function( owner ) { + + // Check if the owner object already has a cache + var value = owner[ this.expando ]; + + // If not, create one + if ( !value ) { + value = {}; + + // We can accept data for non-element nodes in modern browsers, + // but we should not, see #8335. + // Always return an empty object. + if ( acceptData( owner ) ) { + + // If it is a node unlikely to be stringify-ed or looped over + // use plain assignment + if ( owner.nodeType ) { + owner[ this.expando ] = value; + + // Otherwise secure it in a non-enumerable property + // configurable must be true to allow the property to be + // deleted when data is removed + } else { + Object.defineProperty( owner, this.expando, { + value: value, + configurable: true + } ); + } + } + } + + return value; + }, + set: function( owner, data, value ) { + var prop, + cache = this.cache( owner ); + + // Handle: [ owner, key, value ] args + // Always use camelCase key (gh-2257) + if ( typeof data === "string" ) { + cache[ camelCase( data ) ] = value; + + // Handle: [ owner, { properties } ] args + } else { + + // Copy the properties one-by-one to the cache object + for ( prop in data ) { + cache[ camelCase( prop ) ] = data[ prop ]; + } + } + return cache; + }, + get: function( owner, key ) { + return key === undefined ? + this.cache( owner ) : + + // Always use camelCase key (gh-2257) + owner[ this.expando ] && owner[ this.expando ][ camelCase( key ) ]; + }, + access: function( owner, key, value ) { + + // In cases where either: + // + // 1. No key was specified + // 2. A string key was specified, but no value provided + // + // Take the "read" path and allow the get method to determine + // which value to return, respectively either: + // + // 1. The entire cache object + // 2. The data stored at the key + // + if ( key === undefined || + ( ( key && typeof key === "string" ) && value === undefined ) ) { + + return this.get( owner, key ); + } + + // When the key is not a string, or both a key and value + // are specified, set or extend (existing objects) with either: + // + // 1. An object of properties + // 2. A key and value + // + this.set( owner, key, value ); + + // Since the "set" path can have two possible entry points + // return the expected data based on which path was taken[*] + return value !== undefined ? value : key; + }, + remove: function( owner, key ) { + var i, + cache = owner[ this.expando ]; + + if ( cache === undefined ) { + return; + } + + if ( key !== undefined ) { + + // Support array or space separated string of keys + if ( Array.isArray( key ) ) { + + // If key is an array of keys... + // We always set camelCase keys, so remove that. + key = key.map( camelCase ); + } else { + key = camelCase( key ); + + // If a key with the spaces exists, use it. + // Otherwise, create an array by matching non-whitespace + key = key in cache ? + [ key ] : + ( key.match( rnothtmlwhite ) || [] ); + } + + i = key.length; + + while ( i-- ) { + delete cache[ key[ i ] ]; + } + } + + // Remove the expando if there's no more data + if ( key === undefined || jQuery.isEmptyObject( cache ) ) { + + // Support: Chrome <=35 - 45 + // Webkit & Blink performance suffers when deleting properties + // from DOM nodes, so set to undefined instead + // https://bugs.chromium.org/p/chromium/issues/detail?id=378607 (bug restricted) + if ( owner.nodeType ) { + owner[ this.expando ] = undefined; + } else { + delete owner[ this.expando ]; + } + } + }, + hasData: function( owner ) { + var cache = owner[ this.expando ]; + return cache !== undefined && !jQuery.isEmptyObject( cache ); + } +}; +var dataPriv = new Data(); + +var dataUser = new Data(); + + + +// Implementation Summary +// +// 1. Enforce API surface and semantic compatibility with 1.9.x branch +// 2. Improve the module's maintainability by reducing the storage +// paths to a single mechanism. +// 3. Use the same single mechanism to support "private" and "user" data. +// 4. _Never_ expose "private" data to user code (TODO: Drop _data, _removeData) +// 5. Avoid exposing implementation details on user objects (eg. expando properties) +// 6. Provide a clear path for implementation upgrade to WeakMap in 2014 + +var rbrace = /^(?:\{[\w\W]*\}|\[[\w\W]*\])$/, + rmultiDash = /[A-Z]/g; + +function getData( data ) { + if ( data === "true" ) { + return true; + } + + if ( data === "false" ) { + return false; + } + + if ( data === "null" ) { + return null; + } + + // Only convert to a number if it doesn't change the string + if ( data === +data + "" ) { + return +data; + } + + if ( rbrace.test( data ) ) { + return JSON.parse( data ); + } + + return data; +} + +function dataAttr( elem, key, data ) { + var name; + + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + name = "data-" + key.replace( rmultiDash, "-$&" ).toLowerCase(); + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = getData( data ); + } catch ( e ) {} + + // Make sure we set the data so it isn't changed later + dataUser.set( elem, key, data ); + } else { + data = undefined; + } + } + return data; +} + +jQuery.extend( { + hasData: function( elem ) { + return dataUser.hasData( elem ) || dataPriv.hasData( elem ); + }, + + data: function( elem, name, data ) { + return dataUser.access( elem, name, data ); + }, + + removeData: function( elem, name ) { + dataUser.remove( elem, name ); + }, + + // TODO: Now that all calls to _data and _removeData have been replaced + // with direct calls to dataPriv methods, these can be deprecated. + _data: function( elem, name, data ) { + return dataPriv.access( elem, name, data ); + }, + + _removeData: function( elem, name ) { + dataPriv.remove( elem, name ); + } +} ); + +jQuery.fn.extend( { + data: function( key, value ) { + var i, name, data, + elem = this[ 0 ], + attrs = elem && elem.attributes; + + // Gets all values + if ( key === undefined ) { + if ( this.length ) { + data = dataUser.get( elem ); + + if ( elem.nodeType === 1 && !dataPriv.get( elem, "hasDataAttrs" ) ) { + i = attrs.length; + while ( i-- ) { + + // Support: IE 11 only + // The attrs elements can be null (#14894) + if ( attrs[ i ] ) { + name = attrs[ i ].name; + if ( name.indexOf( "data-" ) === 0 ) { + name = camelCase( name.slice( 5 ) ); + dataAttr( elem, name, data[ name ] ); + } + } + } + dataPriv.set( elem, "hasDataAttrs", true ); + } + } + + return data; + } + + // Sets multiple values + if ( typeof key === "object" ) { + return this.each( function() { + dataUser.set( this, key ); + } ); + } + + return access( this, function( value ) { + var data; + + // The calling jQuery object (element matches) is not empty + // (and therefore has an element appears at this[ 0 ]) and the + // `value` parameter was not undefined. An empty jQuery object + // will result in `undefined` for elem = this[ 0 ] which will + // throw an exception if an attempt to read a data cache is made. + if ( elem && value === undefined ) { + + // Attempt to get data from the cache + // The key will always be camelCased in Data + data = dataUser.get( elem, key ); + if ( data !== undefined ) { + return data; + } + + // Attempt to "discover" the data in + // HTML5 custom data-* attrs + data = dataAttr( elem, key ); + if ( data !== undefined ) { + return data; + } + + // We tried really hard, but the data doesn't exist. + return; + } + + // Set the data... + this.each( function() { + + // We always store the camelCased key + dataUser.set( this, key, value ); + } ); + }, null, value, arguments.length > 1, null, true ); + }, + + removeData: function( key ) { + return this.each( function() { + dataUser.remove( this, key ); + } ); + } +} ); + + +jQuery.extend( { + queue: function( elem, type, data ) { + var queue; + + if ( elem ) { + type = ( type || "fx" ) + "queue"; + queue = dataPriv.get( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !queue || Array.isArray( data ) ) { + queue = dataPriv.access( elem, type, jQuery.makeArray( data ) ); + } else { + queue.push( data ); + } + } + return queue || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + startLength = queue.length, + fn = queue.shift(), + hooks = jQuery._queueHooks( elem, type ), + next = function() { + jQuery.dequeue( elem, type ); + }; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + startLength--; + } + + if ( fn ) { + + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift( "inprogress" ); + } + + // Clear up the last queue stop function + delete hooks.stop; + fn.call( elem, next, hooks ); + } + + if ( !startLength && hooks ) { + hooks.empty.fire(); + } + }, + + // Not public - generate a queueHooks object, or return the current one + _queueHooks: function( elem, type ) { + var key = type + "queueHooks"; + return dataPriv.get( elem, key ) || dataPriv.access( elem, key, { + empty: jQuery.Callbacks( "once memory" ).add( function() { + dataPriv.remove( elem, [ type + "queue", key ] ); + } ) + } ); + } +} ); + +jQuery.fn.extend( { + queue: function( type, data ) { + var setter = 2; + + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + setter--; + } + + if ( arguments.length < setter ) { + return jQuery.queue( this[ 0 ], type ); + } + + return data === undefined ? + this : + this.each( function() { + var queue = jQuery.queue( this, type, data ); + + // Ensure a hooks for this queue + jQuery._queueHooks( this, type ); + + if ( type === "fx" && queue[ 0 ] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + } ); + }, + dequeue: function( type ) { + return this.each( function() { + jQuery.dequeue( this, type ); + } ); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, obj ) { + var tmp, + count = 1, + defer = jQuery.Deferred(), + elements = this, + i = this.length, + resolve = function() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + }; + + if ( typeof type !== "string" ) { + obj = type; + type = undefined; + } + type = type || "fx"; + + while ( i-- ) { + tmp = dataPriv.get( elements[ i ], type + "queueHooks" ); + if ( tmp && tmp.empty ) { + count++; + tmp.empty.add( resolve ); + } + } + resolve(); + return defer.promise( obj ); + } +} ); +var pnum = ( /[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/ ).source; + +var rcssNum = new RegExp( "^(?:([+-])=|)(" + pnum + ")([a-z%]*)$", "i" ); + + +var cssExpand = [ "Top", "Right", "Bottom", "Left" ]; + +var documentElement = document.documentElement; + + + + var isAttached = function( elem ) { + return jQuery.contains( elem.ownerDocument, elem ); + }, + composed = { composed: true }; + + // Support: IE 9 - 11+, Edge 12 - 18+, iOS 10.0 - 10.2 only + // Check attachment across shadow DOM boundaries when possible (gh-3504) + // Support: iOS 10.0-10.2 only + // Early iOS 10 versions support `attachShadow` but not `getRootNode`, + // leading to errors. We need to check for `getRootNode`. + if ( documentElement.getRootNode ) { + isAttached = function( elem ) { + return jQuery.contains( elem.ownerDocument, elem ) || + elem.getRootNode( composed ) === elem.ownerDocument; + }; + } +var isHiddenWithinTree = function( elem, el ) { + + // isHiddenWithinTree might be called from jQuery#filter function; + // in that case, element will be second argument + elem = el || elem; + + // Inline style trumps all + return elem.style.display === "none" || + elem.style.display === "" && + + // Otherwise, check computed style + // Support: Firefox <=43 - 45 + // Disconnected elements can have computed display: none, so first confirm that elem is + // in the document. + isAttached( elem ) && + + jQuery.css( elem, "display" ) === "none"; + }; + + + +function adjustCSS( elem, prop, valueParts, tween ) { + var adjusted, scale, + maxIterations = 20, + currentValue = tween ? + function() { + return tween.cur(); + } : + function() { + return jQuery.css( elem, prop, "" ); + }, + initial = currentValue(), + unit = valueParts && valueParts[ 3 ] || ( jQuery.cssNumber[ prop ] ? "" : "px" ), + + // Starting value computation is required for potential unit mismatches + initialInUnit = elem.nodeType && + ( jQuery.cssNumber[ prop ] || unit !== "px" && +initial ) && + rcssNum.exec( jQuery.css( elem, prop ) ); + + if ( initialInUnit && initialInUnit[ 3 ] !== unit ) { + + // Support: Firefox <=54 + // Halve the iteration target value to prevent interference from CSS upper bounds (gh-2144) + initial = initial / 2; + + // Trust units reported by jQuery.css + unit = unit || initialInUnit[ 3 ]; + + // Iteratively approximate from a nonzero starting point + initialInUnit = +initial || 1; + + while ( maxIterations-- ) { + + // Evaluate and update our best guess (doubling guesses that zero out). + // Finish if the scale equals or crosses 1 (making the old*new product non-positive). + jQuery.style( elem, prop, initialInUnit + unit ); + if ( ( 1 - scale ) * ( 1 - ( scale = currentValue() / initial || 0.5 ) ) <= 0 ) { + maxIterations = 0; + } + initialInUnit = initialInUnit / scale; + + } + + initialInUnit = initialInUnit * 2; + jQuery.style( elem, prop, initialInUnit + unit ); + + // Make sure we update the tween properties later on + valueParts = valueParts || []; + } + + if ( valueParts ) { + initialInUnit = +initialInUnit || +initial || 0; + + // Apply relative offset (+=/-=) if specified + adjusted = valueParts[ 1 ] ? + initialInUnit + ( valueParts[ 1 ] + 1 ) * valueParts[ 2 ] : + +valueParts[ 2 ]; + if ( tween ) { + tween.unit = unit; + tween.start = initialInUnit; + tween.end = adjusted; + } + } + return adjusted; +} + + +var defaultDisplayMap = {}; + +function getDefaultDisplay( elem ) { + var temp, + doc = elem.ownerDocument, + nodeName = elem.nodeName, + display = defaultDisplayMap[ nodeName ]; + + if ( display ) { + return display; + } + + temp = doc.body.appendChild( doc.createElement( nodeName ) ); + display = jQuery.css( temp, "display" ); + + temp.parentNode.removeChild( temp ); + + if ( display === "none" ) { + display = "block"; + } + defaultDisplayMap[ nodeName ] = display; + + return display; +} + +function showHide( elements, show ) { + var display, elem, + values = [], + index = 0, + length = elements.length; + + // Determine new display value for elements that need to change + for ( ; index < length; index++ ) { + elem = elements[ index ]; + if ( !elem.style ) { + continue; + } + + display = elem.style.display; + if ( show ) { + + // Since we force visibility upon cascade-hidden elements, an immediate (and slow) + // check is required in this first loop unless we have a nonempty display value (either + // inline or about-to-be-restored) + if ( display === "none" ) { + values[ index ] = dataPriv.get( elem, "display" ) || null; + if ( !values[ index ] ) { + elem.style.display = ""; + } + } + if ( elem.style.display === "" && isHiddenWithinTree( elem ) ) { + values[ index ] = getDefaultDisplay( elem ); + } + } else { + if ( display !== "none" ) { + values[ index ] = "none"; + + // Remember what we're overwriting + dataPriv.set( elem, "display", display ); + } + } + } + + // Set the display of the elements in a second loop to avoid constant reflow + for ( index = 0; index < length; index++ ) { + if ( values[ index ] != null ) { + elements[ index ].style.display = values[ index ]; + } + } + + return elements; +} + +jQuery.fn.extend( { + show: function() { + return showHide( this, true ); + }, + hide: function() { + return showHide( this ); + }, + toggle: function( state ) { + if ( typeof state === "boolean" ) { + return state ? this.show() : this.hide(); + } + + return this.each( function() { + if ( isHiddenWithinTree( this ) ) { + jQuery( this ).show(); + } else { + jQuery( this ).hide(); + } + } ); + } +} ); +var rcheckableType = ( /^(?:checkbox|radio)$/i ); + +var rtagName = ( /<([a-z][^\/\0>\x20\t\r\n\f]*)/i ); + +var rscriptType = ( /^$|^module$|\/(?:java|ecma)script/i ); + + + +( function() { + var fragment = document.createDocumentFragment(), + div = fragment.appendChild( document.createElement( "div" ) ), + input = document.createElement( "input" ); + + // Support: Android 4.0 - 4.3 only + // Check state lost if the name is set (#11217) + // Support: Windows Web Apps (WWA) + // `name` and `type` must use .setAttribute for WWA (#14901) + input.setAttribute( "type", "radio" ); + input.setAttribute( "checked", "checked" ); + input.setAttribute( "name", "t" ); + + div.appendChild( input ); + + // Support: Android <=4.1 only + // Older WebKit doesn't clone checked state correctly in fragments + support.checkClone = div.cloneNode( true ).cloneNode( true ).lastChild.checked; + + // Support: IE <=11 only + // Make sure textarea (and checkbox) defaultValue is properly cloned + div.innerHTML = ""; + support.noCloneChecked = !!div.cloneNode( true ).lastChild.defaultValue; + + // Support: IE <=9 only + // IE <=9 replaces "; + support.option = !!div.lastChild; +} )(); + + +// We have to close these tags to support XHTML (#13200) +var wrapMap = { + + // XHTML parsers do not magically insert elements in the + // same way that tag soup parsers do. So we cannot shorten + // this by omitting or other required elements. + thead: [ 1, "", "
" ], + col: [ 2, "", "
" ], + tr: [ 2, "", "
" ], + td: [ 3, "", "
" ], + + _default: [ 0, "", "" ] +}; + +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + +// Support: IE <=9 only +if ( !support.option ) { + wrapMap.optgroup = wrapMap.option = [ 1, "" ]; +} + + +function getAll( context, tag ) { + + // Support: IE <=9 - 11 only + // Use typeof to avoid zero-argument method invocation on host objects (#15151) + var ret; + + if ( typeof context.getElementsByTagName !== "undefined" ) { + ret = context.getElementsByTagName( tag || "*" ); + + } else if ( typeof context.querySelectorAll !== "undefined" ) { + ret = context.querySelectorAll( tag || "*" ); + + } else { + ret = []; + } + + if ( tag === undefined || tag && nodeName( context, tag ) ) { + return jQuery.merge( [ context ], ret ); + } + + return ret; +} + + +// Mark scripts as having already been evaluated +function setGlobalEval( elems, refElements ) { + var i = 0, + l = elems.length; + + for ( ; i < l; i++ ) { + dataPriv.set( + elems[ i ], + "globalEval", + !refElements || dataPriv.get( refElements[ i ], "globalEval" ) + ); + } +} + + +var rhtml = /<|&#?\w+;/; + +function buildFragment( elems, context, scripts, selection, ignored ) { + var elem, tmp, tag, wrap, attached, j, + fragment = context.createDocumentFragment(), + nodes = [], + i = 0, + l = elems.length; + + for ( ; i < l; i++ ) { + elem = elems[ i ]; + + if ( elem || elem === 0 ) { + + // Add nodes directly + if ( toType( elem ) === "object" ) { + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( nodes, elem.nodeType ? [ elem ] : elem ); + + // Convert non-html into a text node + } else if ( !rhtml.test( elem ) ) { + nodes.push( context.createTextNode( elem ) ); + + // Convert html into DOM nodes + } else { + tmp = tmp || fragment.appendChild( context.createElement( "div" ) ); + + // Deserialize a standard representation + tag = ( rtagName.exec( elem ) || [ "", "" ] )[ 1 ].toLowerCase(); + wrap = wrapMap[ tag ] || wrapMap._default; + tmp.innerHTML = wrap[ 1 ] + jQuery.htmlPrefilter( elem ) + wrap[ 2 ]; + + // Descend through wrappers to the right content + j = wrap[ 0 ]; + while ( j-- ) { + tmp = tmp.lastChild; + } + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( nodes, tmp.childNodes ); + + // Remember the top-level container + tmp = fragment.firstChild; + + // Ensure the created nodes are orphaned (#12392) + tmp.textContent = ""; + } + } + } + + // Remove wrapper from fragment + fragment.textContent = ""; + + i = 0; + while ( ( elem = nodes[ i++ ] ) ) { + + // Skip elements already in the context collection (trac-4087) + if ( selection && jQuery.inArray( elem, selection ) > -1 ) { + if ( ignored ) { + ignored.push( elem ); + } + continue; + } + + attached = isAttached( elem ); + + // Append to fragment + tmp = getAll( fragment.appendChild( elem ), "script" ); + + // Preserve script evaluation history + if ( attached ) { + setGlobalEval( tmp ); + } + + // Capture executables + if ( scripts ) { + j = 0; + while ( ( elem = tmp[ j++ ] ) ) { + if ( rscriptType.test( elem.type || "" ) ) { + scripts.push( elem ); + } + } + } + } + + return fragment; +} + + +var rtypenamespace = /^([^.]*)(?:\.(.+)|)/; + +function returnTrue() { + return true; +} + +function returnFalse() { + return false; +} + +// Support: IE <=9 - 11+ +// focus() and blur() are asynchronous, except when they are no-op. +// So expect focus to be synchronous when the element is already active, +// and blur to be synchronous when the element is not already active. +// (focus and blur are always synchronous in other supported browsers, +// this just defines when we can count on it). +function expectSync( elem, type ) { + return ( elem === safeActiveElement() ) === ( type === "focus" ); +} + +// Support: IE <=9 only +// Accessing document.activeElement can throw unexpectedly +// https://bugs.jquery.com/ticket/13393 +function safeActiveElement() { + try { + return document.activeElement; + } catch ( err ) { } +} + +function on( elem, types, selector, data, fn, one ) { + var origFn, type; + + // Types can be a map of types/handlers + if ( typeof types === "object" ) { + + // ( types-Object, selector, data ) + if ( typeof selector !== "string" ) { + + // ( types-Object, data ) + data = data || selector; + selector = undefined; + } + for ( type in types ) { + on( elem, type, selector, data, types[ type ], one ); + } + return elem; + } + + if ( data == null && fn == null ) { + + // ( types, fn ) + fn = selector; + data = selector = undefined; + } else if ( fn == null ) { + if ( typeof selector === "string" ) { + + // ( types, selector, fn ) + fn = data; + data = undefined; + } else { + + // ( types, data, fn ) + fn = data; + data = selector; + selector = undefined; + } + } + if ( fn === false ) { + fn = returnFalse; + } else if ( !fn ) { + return elem; + } + + if ( one === 1 ) { + origFn = fn; + fn = function( event ) { + + // Can use an empty set, since event contains the info + jQuery().off( event ); + return origFn.apply( this, arguments ); + }; + + // Use same guid so caller can remove using origFn + fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ ); + } + return elem.each( function() { + jQuery.event.add( this, types, fn, data, selector ); + } ); +} + +/* + * Helper functions for managing events -- not part of the public interface. + * Props to Dean Edwards' addEvent library for many of the ideas. + */ +jQuery.event = { + + global: {}, + + add: function( elem, types, handler, data, selector ) { + + var handleObjIn, eventHandle, tmp, + events, t, handleObj, + special, handlers, type, namespaces, origType, + elemData = dataPriv.get( elem ); + + // Only attach events to objects that accept data + if ( !acceptData( elem ) ) { + return; + } + + // Caller can pass in an object of custom data in lieu of the handler + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + selector = handleObjIn.selector; + } + + // Ensure that invalid selectors throw exceptions at attach time + // Evaluate against documentElement in case elem is a non-element node (e.g., document) + if ( selector ) { + jQuery.find.matchesSelector( documentElement, selector ); + } + + // Make sure that the handler has a unique ID, used to find/remove it later + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure and main handler, if this is the first + if ( !( events = elemData.events ) ) { + events = elemData.events = Object.create( null ); + } + if ( !( eventHandle = elemData.handle ) ) { + eventHandle = elemData.handle = function( e ) { + + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== "undefined" && jQuery.event.triggered !== e.type ? + jQuery.event.dispatch.apply( elem, arguments ) : undefined; + }; + } + + // Handle multiple events separated by a space + types = ( types || "" ).match( rnothtmlwhite ) || [ "" ]; + t = types.length; + while ( t-- ) { + tmp = rtypenamespace.exec( types[ t ] ) || []; + type = origType = tmp[ 1 ]; + namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort(); + + // There *must* be a type, no attaching namespace-only handlers + if ( !type ) { + continue; + } + + // If event changes its type, use the special event handlers for the changed type + special = jQuery.event.special[ type ] || {}; + + // If selector defined, determine special event api type, otherwise given type + type = ( selector ? special.delegateType : special.bindType ) || type; + + // Update special based on newly reset type + special = jQuery.event.special[ type ] || {}; + + // handleObj is passed to all event handlers + handleObj = jQuery.extend( { + type: type, + origType: origType, + data: data, + handler: handler, + guid: handler.guid, + selector: selector, + needsContext: selector && jQuery.expr.match.needsContext.test( selector ), + namespace: namespaces.join( "." ) + }, handleObjIn ); + + // Init the event handler queue if we're the first + if ( !( handlers = events[ type ] ) ) { + handlers = events[ type ] = []; + handlers.delegateCount = 0; + + // Only use addEventListener if the special events handler returns false + if ( !special.setup || + special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add to the element's handler list, delegates in front + if ( selector ) { + handlers.splice( handlers.delegateCount++, 0, handleObj ); + } else { + handlers.push( handleObj ); + } + + // Keep track of which events have ever been used, for event optimization + jQuery.event.global[ type ] = true; + } + + }, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, selector, mappedTypes ) { + + var j, origCount, tmp, + events, t, handleObj, + special, handlers, type, namespaces, origType, + elemData = dataPriv.hasData( elem ) && dataPriv.get( elem ); + + if ( !elemData || !( events = elemData.events ) ) { + return; + } + + // Once for each type.namespace in types; type may be omitted + types = ( types || "" ).match( rnothtmlwhite ) || [ "" ]; + t = types.length; + while ( t-- ) { + tmp = rtypenamespace.exec( types[ t ] ) || []; + type = origType = tmp[ 1 ]; + namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort(); + + // Unbind all events (on this namespace, if provided) for the element + if ( !type ) { + for ( type in events ) { + jQuery.event.remove( elem, type + types[ t ], handler, selector, true ); + } + continue; + } + + special = jQuery.event.special[ type ] || {}; + type = ( selector ? special.delegateType : special.bindType ) || type; + handlers = events[ type ] || []; + tmp = tmp[ 2 ] && + new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ); + + // Remove matching events + origCount = j = handlers.length; + while ( j-- ) { + handleObj = handlers[ j ]; + + if ( ( mappedTypes || origType === handleObj.origType ) && + ( !handler || handler.guid === handleObj.guid ) && + ( !tmp || tmp.test( handleObj.namespace ) ) && + ( !selector || selector === handleObj.selector || + selector === "**" && handleObj.selector ) ) { + handlers.splice( j, 1 ); + + if ( handleObj.selector ) { + handlers.delegateCount--; + } + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + } + + // Remove generic event handler if we removed something and no more handlers exist + // (avoids potential for endless recursion during removal of special event handlers) + if ( origCount && !handlers.length ) { + if ( !special.teardown || + special.teardown.call( elem, namespaces, elemData.handle ) === false ) { + + jQuery.removeEvent( elem, type, elemData.handle ); + } + + delete events[ type ]; + } + } + + // Remove data and the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + dataPriv.remove( elem, "handle events" ); + } + }, + + dispatch: function( nativeEvent ) { + + var i, j, ret, matched, handleObj, handlerQueue, + args = new Array( arguments.length ), + + // Make a writable jQuery.Event from the native event object + event = jQuery.event.fix( nativeEvent ), + + handlers = ( + dataPriv.get( this, "events" ) || Object.create( null ) + )[ event.type ] || [], + special = jQuery.event.special[ event.type ] || {}; + + // Use the fix-ed jQuery.Event rather than the (read-only) native event + args[ 0 ] = event; + + for ( i = 1; i < arguments.length; i++ ) { + args[ i ] = arguments[ i ]; + } + + event.delegateTarget = this; + + // Call the preDispatch hook for the mapped type, and let it bail if desired + if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) { + return; + } + + // Determine handlers + handlerQueue = jQuery.event.handlers.call( this, event, handlers ); + + // Run delegates first; they may want to stop propagation beneath us + i = 0; + while ( ( matched = handlerQueue[ i++ ] ) && !event.isPropagationStopped() ) { + event.currentTarget = matched.elem; + + j = 0; + while ( ( handleObj = matched.handlers[ j++ ] ) && + !event.isImmediatePropagationStopped() ) { + + // If the event is namespaced, then each handler is only invoked if it is + // specially universal or its namespaces are a superset of the event's. + if ( !event.rnamespace || handleObj.namespace === false || + event.rnamespace.test( handleObj.namespace ) ) { + + event.handleObj = handleObj; + event.data = handleObj.data; + + ret = ( ( jQuery.event.special[ handleObj.origType ] || {} ).handle || + handleObj.handler ).apply( matched.elem, args ); + + if ( ret !== undefined ) { + if ( ( event.result = ret ) === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + } + } + } + + // Call the postDispatch hook for the mapped type + if ( special.postDispatch ) { + special.postDispatch.call( this, event ); + } + + return event.result; + }, + + handlers: function( event, handlers ) { + var i, handleObj, sel, matchedHandlers, matchedSelectors, + handlerQueue = [], + delegateCount = handlers.delegateCount, + cur = event.target; + + // Find delegate handlers + if ( delegateCount && + + // Support: IE <=9 + // Black-hole SVG instance trees (trac-13180) + cur.nodeType && + + // Support: Firefox <=42 + // Suppress spec-violating clicks indicating a non-primary pointer button (trac-3861) + // https://www.w3.org/TR/DOM-Level-3-Events/#event-type-click + // Support: IE 11 only + // ...but not arrow key "clicks" of radio inputs, which can have `button` -1 (gh-2343) + !( event.type === "click" && event.button >= 1 ) ) { + + for ( ; cur !== this; cur = cur.parentNode || this ) { + + // Don't check non-elements (#13208) + // Don't process clicks on disabled elements (#6911, #8165, #11382, #11764) + if ( cur.nodeType === 1 && !( event.type === "click" && cur.disabled === true ) ) { + matchedHandlers = []; + matchedSelectors = {}; + for ( i = 0; i < delegateCount; i++ ) { + handleObj = handlers[ i ]; + + // Don't conflict with Object.prototype properties (#13203) + sel = handleObj.selector + " "; + + if ( matchedSelectors[ sel ] === undefined ) { + matchedSelectors[ sel ] = handleObj.needsContext ? + jQuery( sel, this ).index( cur ) > -1 : + jQuery.find( sel, this, null, [ cur ] ).length; + } + if ( matchedSelectors[ sel ] ) { + matchedHandlers.push( handleObj ); + } + } + if ( matchedHandlers.length ) { + handlerQueue.push( { elem: cur, handlers: matchedHandlers } ); + } + } + } + } + + // Add the remaining (directly-bound) handlers + cur = this; + if ( delegateCount < handlers.length ) { + handlerQueue.push( { elem: cur, handlers: handlers.slice( delegateCount ) } ); + } + + return handlerQueue; + }, + + addProp: function( name, hook ) { + Object.defineProperty( jQuery.Event.prototype, name, { + enumerable: true, + configurable: true, + + get: isFunction( hook ) ? + function() { + if ( this.originalEvent ) { + return hook( this.originalEvent ); + } + } : + function() { + if ( this.originalEvent ) { + return this.originalEvent[ name ]; + } + }, + + set: function( value ) { + Object.defineProperty( this, name, { + enumerable: true, + configurable: true, + writable: true, + value: value + } ); + } + } ); + }, + + fix: function( originalEvent ) { + return originalEvent[ jQuery.expando ] ? + originalEvent : + new jQuery.Event( originalEvent ); + }, + + special: { + load: { + + // Prevent triggered image.load events from bubbling to window.load + noBubble: true + }, + click: { + + // Utilize native event to ensure correct state for checkable inputs + setup: function( data ) { + + // For mutual compressibility with _default, replace `this` access with a local var. + // `|| data` is dead code meant only to preserve the variable through minification. + var el = this || data; + + // Claim the first handler + if ( rcheckableType.test( el.type ) && + el.click && nodeName( el, "input" ) ) { + + // dataPriv.set( el, "click", ... ) + leverageNative( el, "click", returnTrue ); + } + + // Return false to allow normal processing in the caller + return false; + }, + trigger: function( data ) { + + // For mutual compressibility with _default, replace `this` access with a local var. + // `|| data` is dead code meant only to preserve the variable through minification. + var el = this || data; + + // Force setup before triggering a click + if ( rcheckableType.test( el.type ) && + el.click && nodeName( el, "input" ) ) { + + leverageNative( el, "click" ); + } + + // Return non-false to allow normal event-path propagation + return true; + }, + + // For cross-browser consistency, suppress native .click() on links + // Also prevent it if we're currently inside a leveraged native-event stack + _default: function( event ) { + var target = event.target; + return rcheckableType.test( target.type ) && + target.click && nodeName( target, "input" ) && + dataPriv.get( target, "click" ) || + nodeName( target, "a" ); + } + }, + + beforeunload: { + postDispatch: function( event ) { + + // Support: Firefox 20+ + // Firefox doesn't alert if the returnValue field is not set. + if ( event.result !== undefined && event.originalEvent ) { + event.originalEvent.returnValue = event.result; + } + } + } + } +}; + +// Ensure the presence of an event listener that handles manually-triggered +// synthetic events by interrupting progress until reinvoked in response to +// *native* events that it fires directly, ensuring that state changes have +// already occurred before other listeners are invoked. +function leverageNative( el, type, expectSync ) { + + // Missing expectSync indicates a trigger call, which must force setup through jQuery.event.add + if ( !expectSync ) { + if ( dataPriv.get( el, type ) === undefined ) { + jQuery.event.add( el, type, returnTrue ); + } + return; + } + + // Register the controller as a special universal handler for all event namespaces + dataPriv.set( el, type, false ); + jQuery.event.add( el, type, { + namespace: false, + handler: function( event ) { + var notAsync, result, + saved = dataPriv.get( this, type ); + + if ( ( event.isTrigger & 1 ) && this[ type ] ) { + + // Interrupt processing of the outer synthetic .trigger()ed event + // Saved data should be false in such cases, but might be a leftover capture object + // from an async native handler (gh-4350) + if ( !saved.length ) { + + // Store arguments for use when handling the inner native event + // There will always be at least one argument (an event object), so this array + // will not be confused with a leftover capture object. + saved = slice.call( arguments ); + dataPriv.set( this, type, saved ); + + // Trigger the native event and capture its result + // Support: IE <=9 - 11+ + // focus() and blur() are asynchronous + notAsync = expectSync( this, type ); + this[ type ](); + result = dataPriv.get( this, type ); + if ( saved !== result || notAsync ) { + dataPriv.set( this, type, false ); + } else { + result = {}; + } + if ( saved !== result ) { + + // Cancel the outer synthetic event + event.stopImmediatePropagation(); + event.preventDefault(); + + // Support: Chrome 86+ + // In Chrome, if an element having a focusout handler is blurred by + // clicking outside of it, it invokes the handler synchronously. If + // that handler calls `.remove()` on the element, the data is cleared, + // leaving `result` undefined. We need to guard against this. + return result && result.value; + } + + // If this is an inner synthetic event for an event with a bubbling surrogate + // (focus or blur), assume that the surrogate already propagated from triggering the + // native event and prevent that from happening again here. + // This technically gets the ordering wrong w.r.t. to `.trigger()` (in which the + // bubbling surrogate propagates *after* the non-bubbling base), but that seems + // less bad than duplication. + } else if ( ( jQuery.event.special[ type ] || {} ).delegateType ) { + event.stopPropagation(); + } + + // If this is a native event triggered above, everything is now in order + // Fire an inner synthetic event with the original arguments + } else if ( saved.length ) { + + // ...and capture the result + dataPriv.set( this, type, { + value: jQuery.event.trigger( + + // Support: IE <=9 - 11+ + // Extend with the prototype to reset the above stopImmediatePropagation() + jQuery.extend( saved[ 0 ], jQuery.Event.prototype ), + saved.slice( 1 ), + this + ) + } ); + + // Abort handling of the native event + event.stopImmediatePropagation(); + } + } + } ); +} + +jQuery.removeEvent = function( elem, type, handle ) { + + // This "if" is needed for plain objects + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle ); + } +}; + +jQuery.Event = function( src, props ) { + + // Allow instantiation without the 'new' keyword + if ( !( this instanceof jQuery.Event ) ) { + return new jQuery.Event( src, props ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = src.defaultPrevented || + src.defaultPrevented === undefined && + + // Support: Android <=2.3 only + src.returnValue === false ? + returnTrue : + returnFalse; + + // Create target properties + // Support: Safari <=6 - 7 only + // Target should not be a text node (#504, #13143) + this.target = ( src.target && src.target.nodeType === 3 ) ? + src.target.parentNode : + src.target; + + this.currentTarget = src.currentTarget; + this.relatedTarget = src.relatedTarget; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if ( props ) { + jQuery.extend( this, props ); + } + + // Create a timestamp if incoming event doesn't have one + this.timeStamp = src && src.timeStamp || Date.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// https://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + constructor: jQuery.Event, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse, + isSimulated: false, + + preventDefault: function() { + var e = this.originalEvent; + + this.isDefaultPrevented = returnTrue; + + if ( e && !this.isSimulated ) { + e.preventDefault(); + } + }, + stopPropagation: function() { + var e = this.originalEvent; + + this.isPropagationStopped = returnTrue; + + if ( e && !this.isSimulated ) { + e.stopPropagation(); + } + }, + stopImmediatePropagation: function() { + var e = this.originalEvent; + + this.isImmediatePropagationStopped = returnTrue; + + if ( e && !this.isSimulated ) { + e.stopImmediatePropagation(); + } + + this.stopPropagation(); + } +}; + +// Includes all common event props including KeyEvent and MouseEvent specific props +jQuery.each( { + altKey: true, + bubbles: true, + cancelable: true, + changedTouches: true, + ctrlKey: true, + detail: true, + eventPhase: true, + metaKey: true, + pageX: true, + pageY: true, + shiftKey: true, + view: true, + "char": true, + code: true, + charCode: true, + key: true, + keyCode: true, + button: true, + buttons: true, + clientX: true, + clientY: true, + offsetX: true, + offsetY: true, + pointerId: true, + pointerType: true, + screenX: true, + screenY: true, + targetTouches: true, + toElement: true, + touches: true, + which: true +}, jQuery.event.addProp ); + +jQuery.each( { focus: "focusin", blur: "focusout" }, function( type, delegateType ) { + jQuery.event.special[ type ] = { + + // Utilize native event if possible so blur/focus sequence is correct + setup: function() { + + // Claim the first handler + // dataPriv.set( this, "focus", ... ) + // dataPriv.set( this, "blur", ... ) + leverageNative( this, type, expectSync ); + + // Return false to allow normal processing in the caller + return false; + }, + trigger: function() { + + // Force setup before trigger + leverageNative( this, type ); + + // Return non-false to allow normal event-path propagation + return true; + }, + + // Suppress native focus or blur as it's already being fired + // in leverageNative. + _default: function() { + return true; + }, + + delegateType: delegateType + }; +} ); + +// Create mouseenter/leave events using mouseover/out and event-time checks +// so that event delegation works in jQuery. +// Do the same for pointerenter/pointerleave and pointerover/pointerout +// +// Support: Safari 7 only +// Safari sends mouseenter too often; see: +// https://bugs.chromium.org/p/chromium/issues/detail?id=470258 +// for the description of the bug (it existed in older Chrome versions as well). +jQuery.each( { + mouseenter: "mouseover", + mouseleave: "mouseout", + pointerenter: "pointerover", + pointerleave: "pointerout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + delegateType: fix, + bindType: fix, + + handle: function( event ) { + var ret, + target = this, + related = event.relatedTarget, + handleObj = event.handleObj; + + // For mouseenter/leave call the handler if related is outside the target. + // NB: No relatedTarget if the mouse left/entered the browser window + if ( !related || ( related !== target && !jQuery.contains( target, related ) ) ) { + event.type = handleObj.origType; + ret = handleObj.handler.apply( this, arguments ); + event.type = fix; + } + return ret; + } + }; +} ); + +jQuery.fn.extend( { + + on: function( types, selector, data, fn ) { + return on( this, types, selector, data, fn ); + }, + one: function( types, selector, data, fn ) { + return on( this, types, selector, data, fn, 1 ); + }, + off: function( types, selector, fn ) { + var handleObj, type; + if ( types && types.preventDefault && types.handleObj ) { + + // ( event ) dispatched jQuery.Event + handleObj = types.handleObj; + jQuery( types.delegateTarget ).off( + handleObj.namespace ? + handleObj.origType + "." + handleObj.namespace : + handleObj.origType, + handleObj.selector, + handleObj.handler + ); + return this; + } + if ( typeof types === "object" ) { + + // ( types-object [, selector] ) + for ( type in types ) { + this.off( type, selector, types[ type ] ); + } + return this; + } + if ( selector === false || typeof selector === "function" ) { + + // ( types [, fn] ) + fn = selector; + selector = undefined; + } + if ( fn === false ) { + fn = returnFalse; + } + return this.each( function() { + jQuery.event.remove( this, types, fn, selector ); + } ); + } +} ); + + +var + + // Support: IE <=10 - 11, Edge 12 - 13 only + // In IE/Edge using regex groups here causes severe slowdowns. + // See https://connect.microsoft.com/IE/feedback/details/1736512/ + rnoInnerhtml = /\s*$/g; + +// Prefer a tbody over its parent table for containing new rows +function manipulationTarget( elem, content ) { + if ( nodeName( elem, "table" ) && + nodeName( content.nodeType !== 11 ? content : content.firstChild, "tr" ) ) { + + return jQuery( elem ).children( "tbody" )[ 0 ] || elem; + } + + return elem; +} + +// Replace/restore the type attribute of script elements for safe DOM manipulation +function disableScript( elem ) { + elem.type = ( elem.getAttribute( "type" ) !== null ) + "/" + elem.type; + return elem; +} +function restoreScript( elem ) { + if ( ( elem.type || "" ).slice( 0, 5 ) === "true/" ) { + elem.type = elem.type.slice( 5 ); + } else { + elem.removeAttribute( "type" ); + } + + return elem; +} + +function cloneCopyEvent( src, dest ) { + var i, l, type, pdataOld, udataOld, udataCur, events; + + if ( dest.nodeType !== 1 ) { + return; + } + + // 1. Copy private data: events, handlers, etc. + if ( dataPriv.hasData( src ) ) { + pdataOld = dataPriv.get( src ); + events = pdataOld.events; + + if ( events ) { + dataPriv.remove( dest, "handle events" ); + + for ( type in events ) { + for ( i = 0, l = events[ type ].length; i < l; i++ ) { + jQuery.event.add( dest, type, events[ type ][ i ] ); + } + } + } + } + + // 2. Copy user data + if ( dataUser.hasData( src ) ) { + udataOld = dataUser.access( src ); + udataCur = jQuery.extend( {}, udataOld ); + + dataUser.set( dest, udataCur ); + } +} + +// Fix IE bugs, see support tests +function fixInput( src, dest ) { + var nodeName = dest.nodeName.toLowerCase(); + + // Fails to persist the checked state of a cloned checkbox or radio button. + if ( nodeName === "input" && rcheckableType.test( src.type ) ) { + dest.checked = src.checked; + + // Fails to return the selected option to the default selected state when cloning options + } else if ( nodeName === "input" || nodeName === "textarea" ) { + dest.defaultValue = src.defaultValue; + } +} + +function domManip( collection, args, callback, ignored ) { + + // Flatten any nested arrays + args = flat( args ); + + var fragment, first, scripts, hasScripts, node, doc, + i = 0, + l = collection.length, + iNoClone = l - 1, + value = args[ 0 ], + valueIsFunction = isFunction( value ); + + // We can't cloneNode fragments that contain checked, in WebKit + if ( valueIsFunction || + ( l > 1 && typeof value === "string" && + !support.checkClone && rchecked.test( value ) ) ) { + return collection.each( function( index ) { + var self = collection.eq( index ); + if ( valueIsFunction ) { + args[ 0 ] = value.call( this, index, self.html() ); + } + domManip( self, args, callback, ignored ); + } ); + } + + if ( l ) { + fragment = buildFragment( args, collection[ 0 ].ownerDocument, false, collection, ignored ); + first = fragment.firstChild; + + if ( fragment.childNodes.length === 1 ) { + fragment = first; + } + + // Require either new content or an interest in ignored elements to invoke the callback + if ( first || ignored ) { + scripts = jQuery.map( getAll( fragment, "script" ), disableScript ); + hasScripts = scripts.length; + + // Use the original fragment for the last item + // instead of the first because it can end up + // being emptied incorrectly in certain situations (#8070). + for ( ; i < l; i++ ) { + node = fragment; + + if ( i !== iNoClone ) { + node = jQuery.clone( node, true, true ); + + // Keep references to cloned scripts for later restoration + if ( hasScripts ) { + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( scripts, getAll( node, "script" ) ); + } + } + + callback.call( collection[ i ], node, i ); + } + + if ( hasScripts ) { + doc = scripts[ scripts.length - 1 ].ownerDocument; + + // Reenable scripts + jQuery.map( scripts, restoreScript ); + + // Evaluate executable scripts on first document insertion + for ( i = 0; i < hasScripts; i++ ) { + node = scripts[ i ]; + if ( rscriptType.test( node.type || "" ) && + !dataPriv.access( node, "globalEval" ) && + jQuery.contains( doc, node ) ) { + + if ( node.src && ( node.type || "" ).toLowerCase() !== "module" ) { + + // Optional AJAX dependency, but won't run scripts if not present + if ( jQuery._evalUrl && !node.noModule ) { + jQuery._evalUrl( node.src, { + nonce: node.nonce || node.getAttribute( "nonce" ) + }, doc ); + } + } else { + DOMEval( node.textContent.replace( rcleanScript, "" ), node, doc ); + } + } + } + } + } + } + + return collection; +} + +function remove( elem, selector, keepData ) { + var node, + nodes = selector ? jQuery.filter( selector, elem ) : elem, + i = 0; + + for ( ; ( node = nodes[ i ] ) != null; i++ ) { + if ( !keepData && node.nodeType === 1 ) { + jQuery.cleanData( getAll( node ) ); + } + + if ( node.parentNode ) { + if ( keepData && isAttached( node ) ) { + setGlobalEval( getAll( node, "script" ) ); + } + node.parentNode.removeChild( node ); + } + } + + return elem; +} + +jQuery.extend( { + htmlPrefilter: function( html ) { + return html; + }, + + clone: function( elem, dataAndEvents, deepDataAndEvents ) { + var i, l, srcElements, destElements, + clone = elem.cloneNode( true ), + inPage = isAttached( elem ); + + // Fix IE cloning issues + if ( !support.noCloneChecked && ( elem.nodeType === 1 || elem.nodeType === 11 ) && + !jQuery.isXMLDoc( elem ) ) { + + // We eschew Sizzle here for performance reasons: https://jsperf.com/getall-vs-sizzle/2 + destElements = getAll( clone ); + srcElements = getAll( elem ); + + for ( i = 0, l = srcElements.length; i < l; i++ ) { + fixInput( srcElements[ i ], destElements[ i ] ); + } + } + + // Copy the events from the original to the clone + if ( dataAndEvents ) { + if ( deepDataAndEvents ) { + srcElements = srcElements || getAll( elem ); + destElements = destElements || getAll( clone ); + + for ( i = 0, l = srcElements.length; i < l; i++ ) { + cloneCopyEvent( srcElements[ i ], destElements[ i ] ); + } + } else { + cloneCopyEvent( elem, clone ); + } + } + + // Preserve script evaluation history + destElements = getAll( clone, "script" ); + if ( destElements.length > 0 ) { + setGlobalEval( destElements, !inPage && getAll( elem, "script" ) ); + } + + // Return the cloned set + return clone; + }, + + cleanData: function( elems ) { + var data, elem, type, + special = jQuery.event.special, + i = 0; + + for ( ; ( elem = elems[ i ] ) !== undefined; i++ ) { + if ( acceptData( elem ) ) { + if ( ( data = elem[ dataPriv.expando ] ) ) { + if ( data.events ) { + for ( type in data.events ) { + if ( special[ type ] ) { + jQuery.event.remove( elem, type ); + + // This is a shortcut to avoid jQuery.event.remove's overhead + } else { + jQuery.removeEvent( elem, type, data.handle ); + } + } + } + + // Support: Chrome <=35 - 45+ + // Assign undefined instead of using delete, see Data#remove + elem[ dataPriv.expando ] = undefined; + } + if ( elem[ dataUser.expando ] ) { + + // Support: Chrome <=35 - 45+ + // Assign undefined instead of using delete, see Data#remove + elem[ dataUser.expando ] = undefined; + } + } + } + } +} ); + +jQuery.fn.extend( { + detach: function( selector ) { + return remove( this, selector, true ); + }, + + remove: function( selector ) { + return remove( this, selector ); + }, + + text: function( value ) { + return access( this, function( value ) { + return value === undefined ? + jQuery.text( this ) : + this.empty().each( function() { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + this.textContent = value; + } + } ); + }, null, value, arguments.length ); + }, + + append: function() { + return domManip( this, arguments, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + var target = manipulationTarget( this, elem ); + target.appendChild( elem ); + } + } ); + }, + + prepend: function() { + return domManip( this, arguments, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + var target = manipulationTarget( this, elem ); + target.insertBefore( elem, target.firstChild ); + } + } ); + }, + + before: function() { + return domManip( this, arguments, function( elem ) { + if ( this.parentNode ) { + this.parentNode.insertBefore( elem, this ); + } + } ); + }, + + after: function() { + return domManip( this, arguments, function( elem ) { + if ( this.parentNode ) { + this.parentNode.insertBefore( elem, this.nextSibling ); + } + } ); + }, + + empty: function() { + var elem, + i = 0; + + for ( ; ( elem = this[ i ] ) != null; i++ ) { + if ( elem.nodeType === 1 ) { + + // Prevent memory leaks + jQuery.cleanData( getAll( elem, false ) ); + + // Remove any remaining nodes + elem.textContent = ""; + } + } + + return this; + }, + + clone: function( dataAndEvents, deepDataAndEvents ) { + dataAndEvents = dataAndEvents == null ? false : dataAndEvents; + deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents; + + return this.map( function() { + return jQuery.clone( this, dataAndEvents, deepDataAndEvents ); + } ); + }, + + html: function( value ) { + return access( this, function( value ) { + var elem = this[ 0 ] || {}, + i = 0, + l = this.length; + + if ( value === undefined && elem.nodeType === 1 ) { + return elem.innerHTML; + } + + // See if we can take a shortcut and just use innerHTML + if ( typeof value === "string" && !rnoInnerhtml.test( value ) && + !wrapMap[ ( rtagName.exec( value ) || [ "", "" ] )[ 1 ].toLowerCase() ] ) { + + value = jQuery.htmlPrefilter( value ); + + try { + for ( ; i < l; i++ ) { + elem = this[ i ] || {}; + + // Remove element nodes and prevent memory leaks + if ( elem.nodeType === 1 ) { + jQuery.cleanData( getAll( elem, false ) ); + elem.innerHTML = value; + } + } + + elem = 0; + + // If using innerHTML throws an exception, use the fallback method + } catch ( e ) {} + } + + if ( elem ) { + this.empty().append( value ); + } + }, null, value, arguments.length ); + }, + + replaceWith: function() { + var ignored = []; + + // Make the changes, replacing each non-ignored context element with the new content + return domManip( this, arguments, function( elem ) { + var parent = this.parentNode; + + if ( jQuery.inArray( this, ignored ) < 0 ) { + jQuery.cleanData( getAll( this ) ); + if ( parent ) { + parent.replaceChild( elem, this ); + } + } + + // Force callback invocation + }, ignored ); + } +} ); + +jQuery.each( { + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function( name, original ) { + jQuery.fn[ name ] = function( selector ) { + var elems, + ret = [], + insert = jQuery( selector ), + last = insert.length - 1, + i = 0; + + for ( ; i <= last; i++ ) { + elems = i === last ? this : this.clone( true ); + jQuery( insert[ i ] )[ original ]( elems ); + + // Support: Android <=4.0 only, PhantomJS 1 only + // .get() because push.apply(_, arraylike) throws on ancient WebKit + push.apply( ret, elems.get() ); + } + + return this.pushStack( ret ); + }; +} ); +var rnumnonpx = new RegExp( "^(" + pnum + ")(?!px)[a-z%]+$", "i" ); + +var getStyles = function( elem ) { + + // Support: IE <=11 only, Firefox <=30 (#15098, #14150) + // IE throws on elements created in popups + // FF meanwhile throws on frame elements through "defaultView.getComputedStyle" + var view = elem.ownerDocument.defaultView; + + if ( !view || !view.opener ) { + view = window; + } + + return view.getComputedStyle( elem ); + }; + +var swap = function( elem, options, callback ) { + var ret, name, + old = {}; + + // Remember the old values, and insert the new ones + for ( name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + ret = callback.call( elem ); + + // Revert the old values + for ( name in options ) { + elem.style[ name ] = old[ name ]; + } + + return ret; +}; + + +var rboxStyle = new RegExp( cssExpand.join( "|" ), "i" ); + + + +( function() { + + // Executing both pixelPosition & boxSizingReliable tests require only one layout + // so they're executed at the same time to save the second computation. + function computeStyleTests() { + + // This is a singleton, we need to execute it only once + if ( !div ) { + return; + } + + container.style.cssText = "position:absolute;left:-11111px;width:60px;" + + "margin-top:1px;padding:0;border:0"; + div.style.cssText = + "position:relative;display:block;box-sizing:border-box;overflow:scroll;" + + "margin:auto;border:1px;padding:1px;" + + "width:60%;top:1%"; + documentElement.appendChild( container ).appendChild( div ); + + var divStyle = window.getComputedStyle( div ); + pixelPositionVal = divStyle.top !== "1%"; + + // Support: Android 4.0 - 4.3 only, Firefox <=3 - 44 + reliableMarginLeftVal = roundPixelMeasures( divStyle.marginLeft ) === 12; + + // Support: Android 4.0 - 4.3 only, Safari <=9.1 - 10.1, iOS <=7.0 - 9.3 + // Some styles come back with percentage values, even though they shouldn't + div.style.right = "60%"; + pixelBoxStylesVal = roundPixelMeasures( divStyle.right ) === 36; + + // Support: IE 9 - 11 only + // Detect misreporting of content dimensions for box-sizing:border-box elements + boxSizingReliableVal = roundPixelMeasures( divStyle.width ) === 36; + + // Support: IE 9 only + // Detect overflow:scroll screwiness (gh-3699) + // Support: Chrome <=64 + // Don't get tricked when zoom affects offsetWidth (gh-4029) + div.style.position = "absolute"; + scrollboxSizeVal = roundPixelMeasures( div.offsetWidth / 3 ) === 12; + + documentElement.removeChild( container ); + + // Nullify the div so it wouldn't be stored in the memory and + // it will also be a sign that checks already performed + div = null; + } + + function roundPixelMeasures( measure ) { + return Math.round( parseFloat( measure ) ); + } + + var pixelPositionVal, boxSizingReliableVal, scrollboxSizeVal, pixelBoxStylesVal, + reliableTrDimensionsVal, reliableMarginLeftVal, + container = document.createElement( "div" ), + div = document.createElement( "div" ); + + // Finish early in limited (non-browser) environments + if ( !div.style ) { + return; + } + + // Support: IE <=9 - 11 only + // Style of cloned element affects source element cloned (#8908) + div.style.backgroundClip = "content-box"; + div.cloneNode( true ).style.backgroundClip = ""; + support.clearCloneStyle = div.style.backgroundClip === "content-box"; + + jQuery.extend( support, { + boxSizingReliable: function() { + computeStyleTests(); + return boxSizingReliableVal; + }, + pixelBoxStyles: function() { + computeStyleTests(); + return pixelBoxStylesVal; + }, + pixelPosition: function() { + computeStyleTests(); + return pixelPositionVal; + }, + reliableMarginLeft: function() { + computeStyleTests(); + return reliableMarginLeftVal; + }, + scrollboxSize: function() { + computeStyleTests(); + return scrollboxSizeVal; + }, + + // Support: IE 9 - 11+, Edge 15 - 18+ + // IE/Edge misreport `getComputedStyle` of table rows with width/height + // set in CSS while `offset*` properties report correct values. + // Behavior in IE 9 is more subtle than in newer versions & it passes + // some versions of this test; make sure not to make it pass there! + // + // Support: Firefox 70+ + // Only Firefox includes border widths + // in computed dimensions. (gh-4529) + reliableTrDimensions: function() { + var table, tr, trChild, trStyle; + if ( reliableTrDimensionsVal == null ) { + table = document.createElement( "table" ); + tr = document.createElement( "tr" ); + trChild = document.createElement( "div" ); + + table.style.cssText = "position:absolute;left:-11111px;border-collapse:separate"; + tr.style.cssText = "border:1px solid"; + + // Support: Chrome 86+ + // Height set through cssText does not get applied. + // Computed height then comes back as 0. + tr.style.height = "1px"; + trChild.style.height = "9px"; + + // Support: Android 8 Chrome 86+ + // In our bodyBackground.html iframe, + // display for all div elements is set to "inline", + // which causes a problem only in Android 8 Chrome 86. + // Ensuring the div is display: block + // gets around this issue. + trChild.style.display = "block"; + + documentElement + .appendChild( table ) + .appendChild( tr ) + .appendChild( trChild ); + + trStyle = window.getComputedStyle( tr ); + reliableTrDimensionsVal = ( parseInt( trStyle.height, 10 ) + + parseInt( trStyle.borderTopWidth, 10 ) + + parseInt( trStyle.borderBottomWidth, 10 ) ) === tr.offsetHeight; + + documentElement.removeChild( table ); + } + return reliableTrDimensionsVal; + } + } ); +} )(); + + +function curCSS( elem, name, computed ) { + var width, minWidth, maxWidth, ret, + + // Support: Firefox 51+ + // Retrieving style before computed somehow + // fixes an issue with getting wrong values + // on detached elements + style = elem.style; + + computed = computed || getStyles( elem ); + + // getPropertyValue is needed for: + // .css('filter') (IE 9 only, #12537) + // .css('--customProperty) (#3144) + if ( computed ) { + ret = computed.getPropertyValue( name ) || computed[ name ]; + + if ( ret === "" && !isAttached( elem ) ) { + ret = jQuery.style( elem, name ); + } + + // A tribute to the "awesome hack by Dean Edwards" + // Android Browser returns percentage for some values, + // but width seems to be reliably pixels. + // This is against the CSSOM draft spec: + // https://drafts.csswg.org/cssom/#resolved-values + if ( !support.pixelBoxStyles() && rnumnonpx.test( ret ) && rboxStyle.test( name ) ) { + + // Remember the original values + width = style.width; + minWidth = style.minWidth; + maxWidth = style.maxWidth; + + // Put in the new values to get a computed value out + style.minWidth = style.maxWidth = style.width = ret; + ret = computed.width; + + // Revert the changed values + style.width = width; + style.minWidth = minWidth; + style.maxWidth = maxWidth; + } + } + + return ret !== undefined ? + + // Support: IE <=9 - 11 only + // IE returns zIndex value as an integer. + ret + "" : + ret; +} + + +function addGetHookIf( conditionFn, hookFn ) { + + // Define the hook, we'll check on the first run if it's really needed. + return { + get: function() { + if ( conditionFn() ) { + + // Hook not needed (or it's not possible to use it due + // to missing dependency), remove it. + delete this.get; + return; + } + + // Hook needed; redefine it so that the support test is not executed again. + return ( this.get = hookFn ).apply( this, arguments ); + } + }; +} + + +var cssPrefixes = [ "Webkit", "Moz", "ms" ], + emptyStyle = document.createElement( "div" ).style, + vendorProps = {}; + +// Return a vendor-prefixed property or undefined +function vendorPropName( name ) { + + // Check for vendor prefixed names + var capName = name[ 0 ].toUpperCase() + name.slice( 1 ), + i = cssPrefixes.length; + + while ( i-- ) { + name = cssPrefixes[ i ] + capName; + if ( name in emptyStyle ) { + return name; + } + } +} + +// Return a potentially-mapped jQuery.cssProps or vendor prefixed property +function finalPropName( name ) { + var final = jQuery.cssProps[ name ] || vendorProps[ name ]; + + if ( final ) { + return final; + } + if ( name in emptyStyle ) { + return name; + } + return vendorProps[ name ] = vendorPropName( name ) || name; +} + + +var + + // Swappable if display is none or starts with table + // except "table", "table-cell", or "table-caption" + // See here for display values: https://developer.mozilla.org/en-US/docs/CSS/display + rdisplayswap = /^(none|table(?!-c[ea]).+)/, + rcustomProp = /^--/, + cssShow = { position: "absolute", visibility: "hidden", display: "block" }, + cssNormalTransform = { + letterSpacing: "0", + fontWeight: "400" + }; + +function setPositiveNumber( _elem, value, subtract ) { + + // Any relative (+/-) values have already been + // normalized at this point + var matches = rcssNum.exec( value ); + return matches ? + + // Guard against undefined "subtract", e.g., when used as in cssHooks + Math.max( 0, matches[ 2 ] - ( subtract || 0 ) ) + ( matches[ 3 ] || "px" ) : + value; +} + +function boxModelAdjustment( elem, dimension, box, isBorderBox, styles, computedVal ) { + var i = dimension === "width" ? 1 : 0, + extra = 0, + delta = 0; + + // Adjustment may not be necessary + if ( box === ( isBorderBox ? "border" : "content" ) ) { + return 0; + } + + for ( ; i < 4; i += 2 ) { + + // Both box models exclude margin + if ( box === "margin" ) { + delta += jQuery.css( elem, box + cssExpand[ i ], true, styles ); + } + + // If we get here with a content-box, we're seeking "padding" or "border" or "margin" + if ( !isBorderBox ) { + + // Add padding + delta += jQuery.css( elem, "padding" + cssExpand[ i ], true, styles ); + + // For "border" or "margin", add border + if ( box !== "padding" ) { + delta += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + + // But still keep track of it otherwise + } else { + extra += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + } + + // If we get here with a border-box (content + padding + border), we're seeking "content" or + // "padding" or "margin" + } else { + + // For "content", subtract padding + if ( box === "content" ) { + delta -= jQuery.css( elem, "padding" + cssExpand[ i ], true, styles ); + } + + // For "content" or "padding", subtract border + if ( box !== "margin" ) { + delta -= jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + } + } + } + + // Account for positive content-box scroll gutter when requested by providing computedVal + if ( !isBorderBox && computedVal >= 0 ) { + + // offsetWidth/offsetHeight is a rounded sum of content, padding, scroll gutter, and border + // Assuming integer scroll gutter, subtract the rest and round down + delta += Math.max( 0, Math.ceil( + elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] - + computedVal - + delta - + extra - + 0.5 + + // If offsetWidth/offsetHeight is unknown, then we can't determine content-box scroll gutter + // Use an explicit zero to avoid NaN (gh-3964) + ) ) || 0; + } + + return delta; +} + +function getWidthOrHeight( elem, dimension, extra ) { + + // Start with computed style + var styles = getStyles( elem ), + + // To avoid forcing a reflow, only fetch boxSizing if we need it (gh-4322). + // Fake content-box until we know it's needed to know the true value. + boxSizingNeeded = !support.boxSizingReliable() || extra, + isBorderBox = boxSizingNeeded && + jQuery.css( elem, "boxSizing", false, styles ) === "border-box", + valueIsBorderBox = isBorderBox, + + val = curCSS( elem, dimension, styles ), + offsetProp = "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ); + + // Support: Firefox <=54 + // Return a confounding non-pixel value or feign ignorance, as appropriate. + if ( rnumnonpx.test( val ) ) { + if ( !extra ) { + return val; + } + val = "auto"; + } + + + // Support: IE 9 - 11 only + // Use offsetWidth/offsetHeight for when box sizing is unreliable. + // In those cases, the computed value can be trusted to be border-box. + if ( ( !support.boxSizingReliable() && isBorderBox || + + // Support: IE 10 - 11+, Edge 15 - 18+ + // IE/Edge misreport `getComputedStyle` of table rows with width/height + // set in CSS while `offset*` properties report correct values. + // Interestingly, in some cases IE 9 doesn't suffer from this issue. + !support.reliableTrDimensions() && nodeName( elem, "tr" ) || + + // Fall back to offsetWidth/offsetHeight when value is "auto" + // This happens for inline elements with no explicit setting (gh-3571) + val === "auto" || + + // Support: Android <=4.1 - 4.3 only + // Also use offsetWidth/offsetHeight for misreported inline dimensions (gh-3602) + !parseFloat( val ) && jQuery.css( elem, "display", false, styles ) === "inline" ) && + + // Make sure the element is visible & connected + elem.getClientRects().length ) { + + isBorderBox = jQuery.css( elem, "boxSizing", false, styles ) === "border-box"; + + // Where available, offsetWidth/offsetHeight approximate border box dimensions. + // Where not available (e.g., SVG), assume unreliable box-sizing and interpret the + // retrieved value as a content box dimension. + valueIsBorderBox = offsetProp in elem; + if ( valueIsBorderBox ) { + val = elem[ offsetProp ]; + } + } + + // Normalize "" and auto + val = parseFloat( val ) || 0; + + // Adjust for the element's box model + return ( val + + boxModelAdjustment( + elem, + dimension, + extra || ( isBorderBox ? "border" : "content" ), + valueIsBorderBox, + styles, + + // Provide the current computed size to request scroll gutter calculation (gh-3589) + val + ) + ) + "px"; +} + +jQuery.extend( { + + // Add in style property hooks for overriding the default + // behavior of getting and setting a style property + cssHooks: { + opacity: { + get: function( elem, computed ) { + if ( computed ) { + + // We should always get a number back from opacity + var ret = curCSS( elem, "opacity" ); + return ret === "" ? "1" : ret; + } + } + } + }, + + // Don't automatically add "px" to these possibly-unitless properties + cssNumber: { + "animationIterationCount": true, + "columnCount": true, + "fillOpacity": true, + "flexGrow": true, + "flexShrink": true, + "fontWeight": true, + "gridArea": true, + "gridColumn": true, + "gridColumnEnd": true, + "gridColumnStart": true, + "gridRow": true, + "gridRowEnd": true, + "gridRowStart": true, + "lineHeight": true, + "opacity": true, + "order": true, + "orphans": true, + "widows": true, + "zIndex": true, + "zoom": true + }, + + // Add in properties whose names you wish to fix before + // setting or getting the value + cssProps: {}, + + // Get and set the style property on a DOM Node + style: function( elem, name, value, extra ) { + + // Don't set styles on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { + return; + } + + // Make sure that we're working with the right name + var ret, type, hooks, + origName = camelCase( name ), + isCustomProp = rcustomProp.test( name ), + style = elem.style; + + // Make sure that we're working with the right name. We don't + // want to query the value if it is a CSS custom property + // since they are user-defined. + if ( !isCustomProp ) { + name = finalPropName( origName ); + } + + // Gets hook for the prefixed version, then unprefixed version + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // Check if we're setting a value + if ( value !== undefined ) { + type = typeof value; + + // Convert "+=" or "-=" to relative numbers (#7345) + if ( type === "string" && ( ret = rcssNum.exec( value ) ) && ret[ 1 ] ) { + value = adjustCSS( elem, name, ret ); + + // Fixes bug #9237 + type = "number"; + } + + // Make sure that null and NaN values aren't set (#7116) + if ( value == null || value !== value ) { + return; + } + + // If a number was passed in, add the unit (except for certain CSS properties) + // The isCustomProp check can be removed in jQuery 4.0 when we only auto-append + // "px" to a few hardcoded values. + if ( type === "number" && !isCustomProp ) { + value += ret && ret[ 3 ] || ( jQuery.cssNumber[ origName ] ? "" : "px" ); + } + + // background-* props affect original clone's values + if ( !support.clearCloneStyle && value === "" && name.indexOf( "background" ) === 0 ) { + style[ name ] = "inherit"; + } + + // If a hook was provided, use that value, otherwise just set the specified value + if ( !hooks || !( "set" in hooks ) || + ( value = hooks.set( elem, value, extra ) ) !== undefined ) { + + if ( isCustomProp ) { + style.setProperty( name, value ); + } else { + style[ name ] = value; + } + } + + } else { + + // If a hook was provided get the non-computed value from there + if ( hooks && "get" in hooks && + ( ret = hooks.get( elem, false, extra ) ) !== undefined ) { + + return ret; + } + + // Otherwise just get the value from the style object + return style[ name ]; + } + }, + + css: function( elem, name, extra, styles ) { + var val, num, hooks, + origName = camelCase( name ), + isCustomProp = rcustomProp.test( name ); + + // Make sure that we're working with the right name. We don't + // want to modify the value if it is a CSS custom property + // since they are user-defined. + if ( !isCustomProp ) { + name = finalPropName( origName ); + } + + // Try prefixed name followed by the unprefixed name + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // If a hook was provided get the computed value from there + if ( hooks && "get" in hooks ) { + val = hooks.get( elem, true, extra ); + } + + // Otherwise, if a way to get the computed value exists, use that + if ( val === undefined ) { + val = curCSS( elem, name, styles ); + } + + // Convert "normal" to computed value + if ( val === "normal" && name in cssNormalTransform ) { + val = cssNormalTransform[ name ]; + } + + // Make numeric if forced or a qualifier was provided and val looks numeric + if ( extra === "" || extra ) { + num = parseFloat( val ); + return extra === true || isFinite( num ) ? num || 0 : val; + } + + return val; + } +} ); + +jQuery.each( [ "height", "width" ], function( _i, dimension ) { + jQuery.cssHooks[ dimension ] = { + get: function( elem, computed, extra ) { + if ( computed ) { + + // Certain elements can have dimension info if we invisibly show them + // but it must have a current display style that would benefit + return rdisplayswap.test( jQuery.css( elem, "display" ) ) && + + // Support: Safari 8+ + // Table columns in Safari have non-zero offsetWidth & zero + // getBoundingClientRect().width unless display is changed. + // Support: IE <=11 only + // Running getBoundingClientRect on a disconnected node + // in IE throws an error. + ( !elem.getClientRects().length || !elem.getBoundingClientRect().width ) ? + swap( elem, cssShow, function() { + return getWidthOrHeight( elem, dimension, extra ); + } ) : + getWidthOrHeight( elem, dimension, extra ); + } + }, + + set: function( elem, value, extra ) { + var matches, + styles = getStyles( elem ), + + // Only read styles.position if the test has a chance to fail + // to avoid forcing a reflow. + scrollboxSizeBuggy = !support.scrollboxSize() && + styles.position === "absolute", + + // To avoid forcing a reflow, only fetch boxSizing if we need it (gh-3991) + boxSizingNeeded = scrollboxSizeBuggy || extra, + isBorderBox = boxSizingNeeded && + jQuery.css( elem, "boxSizing", false, styles ) === "border-box", + subtract = extra ? + boxModelAdjustment( + elem, + dimension, + extra, + isBorderBox, + styles + ) : + 0; + + // Account for unreliable border-box dimensions by comparing offset* to computed and + // faking a content-box to get border and padding (gh-3699) + if ( isBorderBox && scrollboxSizeBuggy ) { + subtract -= Math.ceil( + elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] - + parseFloat( styles[ dimension ] ) - + boxModelAdjustment( elem, dimension, "border", false, styles ) - + 0.5 + ); + } + + // Convert to pixels if value adjustment is needed + if ( subtract && ( matches = rcssNum.exec( value ) ) && + ( matches[ 3 ] || "px" ) !== "px" ) { + + elem.style[ dimension ] = value; + value = jQuery.css( elem, dimension ); + } + + return setPositiveNumber( elem, value, subtract ); + } + }; +} ); + +jQuery.cssHooks.marginLeft = addGetHookIf( support.reliableMarginLeft, + function( elem, computed ) { + if ( computed ) { + return ( parseFloat( curCSS( elem, "marginLeft" ) ) || + elem.getBoundingClientRect().left - + swap( elem, { marginLeft: 0 }, function() { + return elem.getBoundingClientRect().left; + } ) + ) + "px"; + } + } +); + +// These hooks are used by animate to expand properties +jQuery.each( { + margin: "", + padding: "", + border: "Width" +}, function( prefix, suffix ) { + jQuery.cssHooks[ prefix + suffix ] = { + expand: function( value ) { + var i = 0, + expanded = {}, + + // Assumes a single number if not a string + parts = typeof value === "string" ? value.split( " " ) : [ value ]; + + for ( ; i < 4; i++ ) { + expanded[ prefix + cssExpand[ i ] + suffix ] = + parts[ i ] || parts[ i - 2 ] || parts[ 0 ]; + } + + return expanded; + } + }; + + if ( prefix !== "margin" ) { + jQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber; + } +} ); + +jQuery.fn.extend( { + css: function( name, value ) { + return access( this, function( elem, name, value ) { + var styles, len, + map = {}, + i = 0; + + if ( Array.isArray( name ) ) { + styles = getStyles( elem ); + len = name.length; + + for ( ; i < len; i++ ) { + map[ name[ i ] ] = jQuery.css( elem, name[ i ], false, styles ); + } + + return map; + } + + return value !== undefined ? + jQuery.style( elem, name, value ) : + jQuery.css( elem, name ); + }, name, value, arguments.length > 1 ); + } +} ); + + +function Tween( elem, options, prop, end, easing ) { + return new Tween.prototype.init( elem, options, prop, end, easing ); +} +jQuery.Tween = Tween; + +Tween.prototype = { + constructor: Tween, + init: function( elem, options, prop, end, easing, unit ) { + this.elem = elem; + this.prop = prop; + this.easing = easing || jQuery.easing._default; + this.options = options; + this.start = this.now = this.cur(); + this.end = end; + this.unit = unit || ( jQuery.cssNumber[ prop ] ? "" : "px" ); + }, + cur: function() { + var hooks = Tween.propHooks[ this.prop ]; + + return hooks && hooks.get ? + hooks.get( this ) : + Tween.propHooks._default.get( this ); + }, + run: function( percent ) { + var eased, + hooks = Tween.propHooks[ this.prop ]; + + if ( this.options.duration ) { + this.pos = eased = jQuery.easing[ this.easing ]( + percent, this.options.duration * percent, 0, 1, this.options.duration + ); + } else { + this.pos = eased = percent; + } + this.now = ( this.end - this.start ) * eased + this.start; + + if ( this.options.step ) { + this.options.step.call( this.elem, this.now, this ); + } + + if ( hooks && hooks.set ) { + hooks.set( this ); + } else { + Tween.propHooks._default.set( this ); + } + return this; + } +}; + +Tween.prototype.init.prototype = Tween.prototype; + +Tween.propHooks = { + _default: { + get: function( tween ) { + var result; + + // Use a property on the element directly when it is not a DOM element, + // or when there is no matching style property that exists. + if ( tween.elem.nodeType !== 1 || + tween.elem[ tween.prop ] != null && tween.elem.style[ tween.prop ] == null ) { + return tween.elem[ tween.prop ]; + } + + // Passing an empty string as a 3rd parameter to .css will automatically + // attempt a parseFloat and fallback to a string if the parse fails. + // Simple values such as "10px" are parsed to Float; + // complex values such as "rotate(1rad)" are returned as-is. + result = jQuery.css( tween.elem, tween.prop, "" ); + + // Empty strings, null, undefined and "auto" are converted to 0. + return !result || result === "auto" ? 0 : result; + }, + set: function( tween ) { + + // Use step hook for back compat. + // Use cssHook if its there. + // Use .style if available and use plain properties where available. + if ( jQuery.fx.step[ tween.prop ] ) { + jQuery.fx.step[ tween.prop ]( tween ); + } else if ( tween.elem.nodeType === 1 && ( + jQuery.cssHooks[ tween.prop ] || + tween.elem.style[ finalPropName( tween.prop ) ] != null ) ) { + jQuery.style( tween.elem, tween.prop, tween.now + tween.unit ); + } else { + tween.elem[ tween.prop ] = tween.now; + } + } + } +}; + +// Support: IE <=9 only +// Panic based approach to setting things on disconnected nodes +Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = { + set: function( tween ) { + if ( tween.elem.nodeType && tween.elem.parentNode ) { + tween.elem[ tween.prop ] = tween.now; + } + } +}; + +jQuery.easing = { + linear: function( p ) { + return p; + }, + swing: function( p ) { + return 0.5 - Math.cos( p * Math.PI ) / 2; + }, + _default: "swing" +}; + +jQuery.fx = Tween.prototype.init; + +// Back compat <1.8 extension point +jQuery.fx.step = {}; + + + + +var + fxNow, inProgress, + rfxtypes = /^(?:toggle|show|hide)$/, + rrun = /queueHooks$/; + +function schedule() { + if ( inProgress ) { + if ( document.hidden === false && window.requestAnimationFrame ) { + window.requestAnimationFrame( schedule ); + } else { + window.setTimeout( schedule, jQuery.fx.interval ); + } + + jQuery.fx.tick(); + } +} + +// Animations created synchronously will run synchronously +function createFxNow() { + window.setTimeout( function() { + fxNow = undefined; + } ); + return ( fxNow = Date.now() ); +} + +// Generate parameters to create a standard animation +function genFx( type, includeWidth ) { + var which, + i = 0, + attrs = { height: type }; + + // If we include width, step value is 1 to do all cssExpand values, + // otherwise step value is 2 to skip over Left and Right + includeWidth = includeWidth ? 1 : 0; + for ( ; i < 4; i += 2 - includeWidth ) { + which = cssExpand[ i ]; + attrs[ "margin" + which ] = attrs[ "padding" + which ] = type; + } + + if ( includeWidth ) { + attrs.opacity = attrs.width = type; + } + + return attrs; +} + +function createTween( value, prop, animation ) { + var tween, + collection = ( Animation.tweeners[ prop ] || [] ).concat( Animation.tweeners[ "*" ] ), + index = 0, + length = collection.length; + for ( ; index < length; index++ ) { + if ( ( tween = collection[ index ].call( animation, prop, value ) ) ) { + + // We're done with this property + return tween; + } + } +} + +function defaultPrefilter( elem, props, opts ) { + var prop, value, toggle, hooks, oldfire, propTween, restoreDisplay, display, + isBox = "width" in props || "height" in props, + anim = this, + orig = {}, + style = elem.style, + hidden = elem.nodeType && isHiddenWithinTree( elem ), + dataShow = dataPriv.get( elem, "fxshow" ); + + // Queue-skipping animations hijack the fx hooks + if ( !opts.queue ) { + hooks = jQuery._queueHooks( elem, "fx" ); + if ( hooks.unqueued == null ) { + hooks.unqueued = 0; + oldfire = hooks.empty.fire; + hooks.empty.fire = function() { + if ( !hooks.unqueued ) { + oldfire(); + } + }; + } + hooks.unqueued++; + + anim.always( function() { + + // Ensure the complete handler is called before this completes + anim.always( function() { + hooks.unqueued--; + if ( !jQuery.queue( elem, "fx" ).length ) { + hooks.empty.fire(); + } + } ); + } ); + } + + // Detect show/hide animations + for ( prop in props ) { + value = props[ prop ]; + if ( rfxtypes.test( value ) ) { + delete props[ prop ]; + toggle = toggle || value === "toggle"; + if ( value === ( hidden ? "hide" : "show" ) ) { + + // Pretend to be hidden if this is a "show" and + // there is still data from a stopped show/hide + if ( value === "show" && dataShow && dataShow[ prop ] !== undefined ) { + hidden = true; + + // Ignore all other no-op show/hide data + } else { + continue; + } + } + orig[ prop ] = dataShow && dataShow[ prop ] || jQuery.style( elem, prop ); + } + } + + // Bail out if this is a no-op like .hide().hide() + propTween = !jQuery.isEmptyObject( props ); + if ( !propTween && jQuery.isEmptyObject( orig ) ) { + return; + } + + // Restrict "overflow" and "display" styles during box animations + if ( isBox && elem.nodeType === 1 ) { + + // Support: IE <=9 - 11, Edge 12 - 15 + // Record all 3 overflow attributes because IE does not infer the shorthand + // from identically-valued overflowX and overflowY and Edge just mirrors + // the overflowX value there. + opts.overflow = [ style.overflow, style.overflowX, style.overflowY ]; + + // Identify a display type, preferring old show/hide data over the CSS cascade + restoreDisplay = dataShow && dataShow.display; + if ( restoreDisplay == null ) { + restoreDisplay = dataPriv.get( elem, "display" ); + } + display = jQuery.css( elem, "display" ); + if ( display === "none" ) { + if ( restoreDisplay ) { + display = restoreDisplay; + } else { + + // Get nonempty value(s) by temporarily forcing visibility + showHide( [ elem ], true ); + restoreDisplay = elem.style.display || restoreDisplay; + display = jQuery.css( elem, "display" ); + showHide( [ elem ] ); + } + } + + // Animate inline elements as inline-block + if ( display === "inline" || display === "inline-block" && restoreDisplay != null ) { + if ( jQuery.css( elem, "float" ) === "none" ) { + + // Restore the original display value at the end of pure show/hide animations + if ( !propTween ) { + anim.done( function() { + style.display = restoreDisplay; + } ); + if ( restoreDisplay == null ) { + display = style.display; + restoreDisplay = display === "none" ? "" : display; + } + } + style.display = "inline-block"; + } + } + } + + if ( opts.overflow ) { + style.overflow = "hidden"; + anim.always( function() { + style.overflow = opts.overflow[ 0 ]; + style.overflowX = opts.overflow[ 1 ]; + style.overflowY = opts.overflow[ 2 ]; + } ); + } + + // Implement show/hide animations + propTween = false; + for ( prop in orig ) { + + // General show/hide setup for this element animation + if ( !propTween ) { + if ( dataShow ) { + if ( "hidden" in dataShow ) { + hidden = dataShow.hidden; + } + } else { + dataShow = dataPriv.access( elem, "fxshow", { display: restoreDisplay } ); + } + + // Store hidden/visible for toggle so `.stop().toggle()` "reverses" + if ( toggle ) { + dataShow.hidden = !hidden; + } + + // Show elements before animating them + if ( hidden ) { + showHide( [ elem ], true ); + } + + /* eslint-disable no-loop-func */ + + anim.done( function() { + + /* eslint-enable no-loop-func */ + + // The final step of a "hide" animation is actually hiding the element + if ( !hidden ) { + showHide( [ elem ] ); + } + dataPriv.remove( elem, "fxshow" ); + for ( prop in orig ) { + jQuery.style( elem, prop, orig[ prop ] ); + } + } ); + } + + // Per-property setup + propTween = createTween( hidden ? dataShow[ prop ] : 0, prop, anim ); + if ( !( prop in dataShow ) ) { + dataShow[ prop ] = propTween.start; + if ( hidden ) { + propTween.end = propTween.start; + propTween.start = 0; + } + } + } +} + +function propFilter( props, specialEasing ) { + var index, name, easing, value, hooks; + + // camelCase, specialEasing and expand cssHook pass + for ( index in props ) { + name = camelCase( index ); + easing = specialEasing[ name ]; + value = props[ index ]; + if ( Array.isArray( value ) ) { + easing = value[ 1 ]; + value = props[ index ] = value[ 0 ]; + } + + if ( index !== name ) { + props[ name ] = value; + delete props[ index ]; + } + + hooks = jQuery.cssHooks[ name ]; + if ( hooks && "expand" in hooks ) { + value = hooks.expand( value ); + delete props[ name ]; + + // Not quite $.extend, this won't overwrite existing keys. + // Reusing 'index' because we have the correct "name" + for ( index in value ) { + if ( !( index in props ) ) { + props[ index ] = value[ index ]; + specialEasing[ index ] = easing; + } + } + } else { + specialEasing[ name ] = easing; + } + } +} + +function Animation( elem, properties, options ) { + var result, + stopped, + index = 0, + length = Animation.prefilters.length, + deferred = jQuery.Deferred().always( function() { + + // Don't match elem in the :animated selector + delete tick.elem; + } ), + tick = function() { + if ( stopped ) { + return false; + } + var currentTime = fxNow || createFxNow(), + remaining = Math.max( 0, animation.startTime + animation.duration - currentTime ), + + // Support: Android 2.3 only + // Archaic crash bug won't allow us to use `1 - ( 0.5 || 0 )` (#12497) + temp = remaining / animation.duration || 0, + percent = 1 - temp, + index = 0, + length = animation.tweens.length; + + for ( ; index < length; index++ ) { + animation.tweens[ index ].run( percent ); + } + + deferred.notifyWith( elem, [ animation, percent, remaining ] ); + + // If there's more to do, yield + if ( percent < 1 && length ) { + return remaining; + } + + // If this was an empty animation, synthesize a final progress notification + if ( !length ) { + deferred.notifyWith( elem, [ animation, 1, 0 ] ); + } + + // Resolve the animation and report its conclusion + deferred.resolveWith( elem, [ animation ] ); + return false; + }, + animation = deferred.promise( { + elem: elem, + props: jQuery.extend( {}, properties ), + opts: jQuery.extend( true, { + specialEasing: {}, + easing: jQuery.easing._default + }, options ), + originalProperties: properties, + originalOptions: options, + startTime: fxNow || createFxNow(), + duration: options.duration, + tweens: [], + createTween: function( prop, end ) { + var tween = jQuery.Tween( elem, animation.opts, prop, end, + animation.opts.specialEasing[ prop ] || animation.opts.easing ); + animation.tweens.push( tween ); + return tween; + }, + stop: function( gotoEnd ) { + var index = 0, + + // If we are going to the end, we want to run all the tweens + // otherwise we skip this part + length = gotoEnd ? animation.tweens.length : 0; + if ( stopped ) { + return this; + } + stopped = true; + for ( ; index < length; index++ ) { + animation.tweens[ index ].run( 1 ); + } + + // Resolve when we played the last frame; otherwise, reject + if ( gotoEnd ) { + deferred.notifyWith( elem, [ animation, 1, 0 ] ); + deferred.resolveWith( elem, [ animation, gotoEnd ] ); + } else { + deferred.rejectWith( elem, [ animation, gotoEnd ] ); + } + return this; + } + } ), + props = animation.props; + + propFilter( props, animation.opts.specialEasing ); + + for ( ; index < length; index++ ) { + result = Animation.prefilters[ index ].call( animation, elem, props, animation.opts ); + if ( result ) { + if ( isFunction( result.stop ) ) { + jQuery._queueHooks( animation.elem, animation.opts.queue ).stop = + result.stop.bind( result ); + } + return result; + } + } + + jQuery.map( props, createTween, animation ); + + if ( isFunction( animation.opts.start ) ) { + animation.opts.start.call( elem, animation ); + } + + // Attach callbacks from options + animation + .progress( animation.opts.progress ) + .done( animation.opts.done, animation.opts.complete ) + .fail( animation.opts.fail ) + .always( animation.opts.always ); + + jQuery.fx.timer( + jQuery.extend( tick, { + elem: elem, + anim: animation, + queue: animation.opts.queue + } ) + ); + + return animation; +} + +jQuery.Animation = jQuery.extend( Animation, { + + tweeners: { + "*": [ function( prop, value ) { + var tween = this.createTween( prop, value ); + adjustCSS( tween.elem, prop, rcssNum.exec( value ), tween ); + return tween; + } ] + }, + + tweener: function( props, callback ) { + if ( isFunction( props ) ) { + callback = props; + props = [ "*" ]; + } else { + props = props.match( rnothtmlwhite ); + } + + var prop, + index = 0, + length = props.length; + + for ( ; index < length; index++ ) { + prop = props[ index ]; + Animation.tweeners[ prop ] = Animation.tweeners[ prop ] || []; + Animation.tweeners[ prop ].unshift( callback ); + } + }, + + prefilters: [ defaultPrefilter ], + + prefilter: function( callback, prepend ) { + if ( prepend ) { + Animation.prefilters.unshift( callback ); + } else { + Animation.prefilters.push( callback ); + } + } +} ); + +jQuery.speed = function( speed, easing, fn ) { + var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : { + complete: fn || !fn && easing || + isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !isFunction( easing ) && easing + }; + + // Go to the end state if fx are off + if ( jQuery.fx.off ) { + opt.duration = 0; + + } else { + if ( typeof opt.duration !== "number" ) { + if ( opt.duration in jQuery.fx.speeds ) { + opt.duration = jQuery.fx.speeds[ opt.duration ]; + + } else { + opt.duration = jQuery.fx.speeds._default; + } + } + } + + // Normalize opt.queue - true/undefined/null -> "fx" + if ( opt.queue == null || opt.queue === true ) { + opt.queue = "fx"; + } + + // Queueing + opt.old = opt.complete; + + opt.complete = function() { + if ( isFunction( opt.old ) ) { + opt.old.call( this ); + } + + if ( opt.queue ) { + jQuery.dequeue( this, opt.queue ); + } + }; + + return opt; +}; + +jQuery.fn.extend( { + fadeTo: function( speed, to, easing, callback ) { + + // Show any hidden elements after setting opacity to 0 + return this.filter( isHiddenWithinTree ).css( "opacity", 0 ).show() + + // Animate to the value specified + .end().animate( { opacity: to }, speed, easing, callback ); + }, + animate: function( prop, speed, easing, callback ) { + var empty = jQuery.isEmptyObject( prop ), + optall = jQuery.speed( speed, easing, callback ), + doAnimation = function() { + + // Operate on a copy of prop so per-property easing won't be lost + var anim = Animation( this, jQuery.extend( {}, prop ), optall ); + + // Empty animations, or finishing resolves immediately + if ( empty || dataPriv.get( this, "finish" ) ) { + anim.stop( true ); + } + }; + + doAnimation.finish = doAnimation; + + return empty || optall.queue === false ? + this.each( doAnimation ) : + this.queue( optall.queue, doAnimation ); + }, + stop: function( type, clearQueue, gotoEnd ) { + var stopQueue = function( hooks ) { + var stop = hooks.stop; + delete hooks.stop; + stop( gotoEnd ); + }; + + if ( typeof type !== "string" ) { + gotoEnd = clearQueue; + clearQueue = type; + type = undefined; + } + if ( clearQueue ) { + this.queue( type || "fx", [] ); + } + + return this.each( function() { + var dequeue = true, + index = type != null && type + "queueHooks", + timers = jQuery.timers, + data = dataPriv.get( this ); + + if ( index ) { + if ( data[ index ] && data[ index ].stop ) { + stopQueue( data[ index ] ); + } + } else { + for ( index in data ) { + if ( data[ index ] && data[ index ].stop && rrun.test( index ) ) { + stopQueue( data[ index ] ); + } + } + } + + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && + ( type == null || timers[ index ].queue === type ) ) { + + timers[ index ].anim.stop( gotoEnd ); + dequeue = false; + timers.splice( index, 1 ); + } + } + + // Start the next in the queue if the last step wasn't forced. + // Timers currently will call their complete callbacks, which + // will dequeue but only if they were gotoEnd. + if ( dequeue || !gotoEnd ) { + jQuery.dequeue( this, type ); + } + } ); + }, + finish: function( type ) { + if ( type !== false ) { + type = type || "fx"; + } + return this.each( function() { + var index, + data = dataPriv.get( this ), + queue = data[ type + "queue" ], + hooks = data[ type + "queueHooks" ], + timers = jQuery.timers, + length = queue ? queue.length : 0; + + // Enable finishing flag on private data + data.finish = true; + + // Empty the queue first + jQuery.queue( this, type, [] ); + + if ( hooks && hooks.stop ) { + hooks.stop.call( this, true ); + } + + // Look for any active animations, and finish them + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && timers[ index ].queue === type ) { + timers[ index ].anim.stop( true ); + timers.splice( index, 1 ); + } + } + + // Look for any animations in the old queue and finish them + for ( index = 0; index < length; index++ ) { + if ( queue[ index ] && queue[ index ].finish ) { + queue[ index ].finish.call( this ); + } + } + + // Turn off finishing flag + delete data.finish; + } ); + } +} ); + +jQuery.each( [ "toggle", "show", "hide" ], function( _i, name ) { + var cssFn = jQuery.fn[ name ]; + jQuery.fn[ name ] = function( speed, easing, callback ) { + return speed == null || typeof speed === "boolean" ? + cssFn.apply( this, arguments ) : + this.animate( genFx( name, true ), speed, easing, callback ); + }; +} ); + +// Generate shortcuts for custom animations +jQuery.each( { + slideDown: genFx( "show" ), + slideUp: genFx( "hide" ), + slideToggle: genFx( "toggle" ), + fadeIn: { opacity: "show" }, + fadeOut: { opacity: "hide" }, + fadeToggle: { opacity: "toggle" } +}, function( name, props ) { + jQuery.fn[ name ] = function( speed, easing, callback ) { + return this.animate( props, speed, easing, callback ); + }; +} ); + +jQuery.timers = []; +jQuery.fx.tick = function() { + var timer, + i = 0, + timers = jQuery.timers; + + fxNow = Date.now(); + + for ( ; i < timers.length; i++ ) { + timer = timers[ i ]; + + // Run the timer and safely remove it when done (allowing for external removal) + if ( !timer() && timers[ i ] === timer ) { + timers.splice( i--, 1 ); + } + } + + if ( !timers.length ) { + jQuery.fx.stop(); + } + fxNow = undefined; +}; + +jQuery.fx.timer = function( timer ) { + jQuery.timers.push( timer ); + jQuery.fx.start(); +}; + +jQuery.fx.interval = 13; +jQuery.fx.start = function() { + if ( inProgress ) { + return; + } + + inProgress = true; + schedule(); +}; + +jQuery.fx.stop = function() { + inProgress = null; +}; + +jQuery.fx.speeds = { + slow: 600, + fast: 200, + + // Default speed + _default: 400 +}; + + +// Based off of the plugin by Clint Helfers, with permission. +// https://web.archive.org/web/20100324014747/http://blindsignals.com/index.php/2009/07/jquery-delay/ +jQuery.fn.delay = function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time; + type = type || "fx"; + + return this.queue( type, function( next, hooks ) { + var timeout = window.setTimeout( next, time ); + hooks.stop = function() { + window.clearTimeout( timeout ); + }; + } ); +}; + + +( function() { + var input = document.createElement( "input" ), + select = document.createElement( "select" ), + opt = select.appendChild( document.createElement( "option" ) ); + + input.type = "checkbox"; + + // Support: Android <=4.3 only + // Default value for a checkbox should be "on" + support.checkOn = input.value !== ""; + + // Support: IE <=11 only + // Must access selectedIndex to make default options select + support.optSelected = opt.selected; + + // Support: IE <=11 only + // An input loses its value after becoming a radio + input = document.createElement( "input" ); + input.value = "t"; + input.type = "radio"; + support.radioValue = input.value === "t"; +} )(); + + +var boolHook, + attrHandle = jQuery.expr.attrHandle; + +jQuery.fn.extend( { + attr: function( name, value ) { + return access( this, jQuery.attr, name, value, arguments.length > 1 ); + }, + + removeAttr: function( name ) { + return this.each( function() { + jQuery.removeAttr( this, name ); + } ); + } +} ); + +jQuery.extend( { + attr: function( elem, name, value ) { + var ret, hooks, + nType = elem.nodeType; + + // Don't get/set attributes on text, comment and attribute nodes + if ( nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + // Fallback to prop when attributes are not supported + if ( typeof elem.getAttribute === "undefined" ) { + return jQuery.prop( elem, name, value ); + } + + // Attribute hooks are determined by the lowercase version + // Grab necessary hook if one is defined + if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) { + hooks = jQuery.attrHooks[ name.toLowerCase() ] || + ( jQuery.expr.match.bool.test( name ) ? boolHook : undefined ); + } + + if ( value !== undefined ) { + if ( value === null ) { + jQuery.removeAttr( elem, name ); + return; + } + + if ( hooks && "set" in hooks && + ( ret = hooks.set( elem, value, name ) ) !== undefined ) { + return ret; + } + + elem.setAttribute( name, value + "" ); + return value; + } + + if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) { + return ret; + } + + ret = jQuery.find.attr( elem, name ); + + // Non-existent attributes return null, we normalize to undefined + return ret == null ? undefined : ret; + }, + + attrHooks: { + type: { + set: function( elem, value ) { + if ( !support.radioValue && value === "radio" && + nodeName( elem, "input" ) ) { + var val = elem.value; + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; + } + } + } + }, + + removeAttr: function( elem, value ) { + var name, + i = 0, + + // Attribute names can contain non-HTML whitespace characters + // https://html.spec.whatwg.org/multipage/syntax.html#attributes-2 + attrNames = value && value.match( rnothtmlwhite ); + + if ( attrNames && elem.nodeType === 1 ) { + while ( ( name = attrNames[ i++ ] ) ) { + elem.removeAttribute( name ); + } + } + } +} ); + +// Hooks for boolean attributes +boolHook = { + set: function( elem, value, name ) { + if ( value === false ) { + + // Remove boolean attributes when set to false + jQuery.removeAttr( elem, name ); + } else { + elem.setAttribute( name, name ); + } + return name; + } +}; + +jQuery.each( jQuery.expr.match.bool.source.match( /\w+/g ), function( _i, name ) { + var getter = attrHandle[ name ] || jQuery.find.attr; + + attrHandle[ name ] = function( elem, name, isXML ) { + var ret, handle, + lowercaseName = name.toLowerCase(); + + if ( !isXML ) { + + // Avoid an infinite loop by temporarily removing this function from the getter + handle = attrHandle[ lowercaseName ]; + attrHandle[ lowercaseName ] = ret; + ret = getter( elem, name, isXML ) != null ? + lowercaseName : + null; + attrHandle[ lowercaseName ] = handle; + } + return ret; + }; +} ); + + + + +var rfocusable = /^(?:input|select|textarea|button)$/i, + rclickable = /^(?:a|area)$/i; + +jQuery.fn.extend( { + prop: function( name, value ) { + return access( this, jQuery.prop, name, value, arguments.length > 1 ); + }, + + removeProp: function( name ) { + return this.each( function() { + delete this[ jQuery.propFix[ name ] || name ]; + } ); + } +} ); + +jQuery.extend( { + prop: function( elem, name, value ) { + var ret, hooks, + nType = elem.nodeType; + + // Don't get/set properties on text, comment and attribute nodes + if ( nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) { + + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } + + if ( value !== undefined ) { + if ( hooks && "set" in hooks && + ( ret = hooks.set( elem, value, name ) ) !== undefined ) { + return ret; + } + + return ( elem[ name ] = value ); + } + + if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) { + return ret; + } + + return elem[ name ]; + }, + + propHooks: { + tabIndex: { + get: function( elem ) { + + // Support: IE <=9 - 11 only + // elem.tabIndex doesn't always return the + // correct value when it hasn't been explicitly set + // https://web.archive.org/web/20141116233347/http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + // Use proper attribute retrieval(#12072) + var tabindex = jQuery.find.attr( elem, "tabindex" ); + + if ( tabindex ) { + return parseInt( tabindex, 10 ); + } + + if ( + rfocusable.test( elem.nodeName ) || + rclickable.test( elem.nodeName ) && + elem.href + ) { + return 0; + } + + return -1; + } + } + }, + + propFix: { + "for": "htmlFor", + "class": "className" + } +} ); + +// Support: IE <=11 only +// Accessing the selectedIndex property +// forces the browser to respect setting selected +// on the option +// The getter ensures a default option is selected +// when in an optgroup +// eslint rule "no-unused-expressions" is disabled for this code +// since it considers such accessions noop +if ( !support.optSelected ) { + jQuery.propHooks.selected = { + get: function( elem ) { + + /* eslint no-unused-expressions: "off" */ + + var parent = elem.parentNode; + if ( parent && parent.parentNode ) { + parent.parentNode.selectedIndex; + } + return null; + }, + set: function( elem ) { + + /* eslint no-unused-expressions: "off" */ + + var parent = elem.parentNode; + if ( parent ) { + parent.selectedIndex; + + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + } + }; +} + +jQuery.each( [ + "tabIndex", + "readOnly", + "maxLength", + "cellSpacing", + "cellPadding", + "rowSpan", + "colSpan", + "useMap", + "frameBorder", + "contentEditable" +], function() { + jQuery.propFix[ this.toLowerCase() ] = this; +} ); + + + + + // Strip and collapse whitespace according to HTML spec + // https://infra.spec.whatwg.org/#strip-and-collapse-ascii-whitespace + function stripAndCollapse( value ) { + var tokens = value.match( rnothtmlwhite ) || []; + return tokens.join( " " ); + } + + +function getClass( elem ) { + return elem.getAttribute && elem.getAttribute( "class" ) || ""; +} + +function classesToArray( value ) { + if ( Array.isArray( value ) ) { + return value; + } + if ( typeof value === "string" ) { + return value.match( rnothtmlwhite ) || []; + } + return []; +} + +jQuery.fn.extend( { + addClass: function( value ) { + var classes, elem, cur, curValue, clazz, j, finalValue, + i = 0; + + if ( isFunction( value ) ) { + return this.each( function( j ) { + jQuery( this ).addClass( value.call( this, j, getClass( this ) ) ); + } ); + } + + classes = classesToArray( value ); + + if ( classes.length ) { + while ( ( elem = this[ i++ ] ) ) { + curValue = getClass( elem ); + cur = elem.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " ); + + if ( cur ) { + j = 0; + while ( ( clazz = classes[ j++ ] ) ) { + if ( cur.indexOf( " " + clazz + " " ) < 0 ) { + cur += clazz + " "; + } + } + + // Only assign if different to avoid unneeded rendering. + finalValue = stripAndCollapse( cur ); + if ( curValue !== finalValue ) { + elem.setAttribute( "class", finalValue ); + } + } + } + } + + return this; + }, + + removeClass: function( value ) { + var classes, elem, cur, curValue, clazz, j, finalValue, + i = 0; + + if ( isFunction( value ) ) { + return this.each( function( j ) { + jQuery( this ).removeClass( value.call( this, j, getClass( this ) ) ); + } ); + } + + if ( !arguments.length ) { + return this.attr( "class", "" ); + } + + classes = classesToArray( value ); + + if ( classes.length ) { + while ( ( elem = this[ i++ ] ) ) { + curValue = getClass( elem ); + + // This expression is here for better compressibility (see addClass) + cur = elem.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " ); + + if ( cur ) { + j = 0; + while ( ( clazz = classes[ j++ ] ) ) { + + // Remove *all* instances + while ( cur.indexOf( " " + clazz + " " ) > -1 ) { + cur = cur.replace( " " + clazz + " ", " " ); + } + } + + // Only assign if different to avoid unneeded rendering. + finalValue = stripAndCollapse( cur ); + if ( curValue !== finalValue ) { + elem.setAttribute( "class", finalValue ); + } + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isValidValue = type === "string" || Array.isArray( value ); + + if ( typeof stateVal === "boolean" && isValidValue ) { + return stateVal ? this.addClass( value ) : this.removeClass( value ); + } + + if ( isFunction( value ) ) { + return this.each( function( i ) { + jQuery( this ).toggleClass( + value.call( this, i, getClass( this ), stateVal ), + stateVal + ); + } ); + } + + return this.each( function() { + var className, i, self, classNames; + + if ( isValidValue ) { + + // Toggle individual class names + i = 0; + self = jQuery( this ); + classNames = classesToArray( value ); + + while ( ( className = classNames[ i++ ] ) ) { + + // Check each className given, space separated list + if ( self.hasClass( className ) ) { + self.removeClass( className ); + } else { + self.addClass( className ); + } + } + + // Toggle whole class name + } else if ( value === undefined || type === "boolean" ) { + className = getClass( this ); + if ( className ) { + + // Store className if set + dataPriv.set( this, "__className__", className ); + } + + // If the element has a class name or if we're passed `false`, + // then remove the whole classname (if there was one, the above saved it). + // Otherwise bring back whatever was previously saved (if anything), + // falling back to the empty string if nothing was stored. + if ( this.setAttribute ) { + this.setAttribute( "class", + className || value === false ? + "" : + dataPriv.get( this, "__className__" ) || "" + ); + } + } + } ); + }, + + hasClass: function( selector ) { + var className, elem, + i = 0; + + className = " " + selector + " "; + while ( ( elem = this[ i++ ] ) ) { + if ( elem.nodeType === 1 && + ( " " + stripAndCollapse( getClass( elem ) ) + " " ).indexOf( className ) > -1 ) { + return true; + } + } + + return false; + } +} ); + + + + +var rreturn = /\r/g; + +jQuery.fn.extend( { + val: function( value ) { + var hooks, ret, valueIsFunction, + elem = this[ 0 ]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.type ] || + jQuery.valHooks[ elem.nodeName.toLowerCase() ]; + + if ( hooks && + "get" in hooks && + ( ret = hooks.get( elem, "value" ) ) !== undefined + ) { + return ret; + } + + ret = elem.value; + + // Handle most common string cases + if ( typeof ret === "string" ) { + return ret.replace( rreturn, "" ); + } + + // Handle cases where value is null/undef or number + return ret == null ? "" : ret; + } + + return; + } + + valueIsFunction = isFunction( value ); + + return this.each( function( i ) { + var val; + + if ( this.nodeType !== 1 ) { + return; + } + + if ( valueIsFunction ) { + val = value.call( this, i, jQuery( this ).val() ); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + + } else if ( typeof val === "number" ) { + val += ""; + + } else if ( Array.isArray( val ) ) { + val = jQuery.map( val, function( value ) { + return value == null ? "" : value + ""; + } ); + } + + hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ]; + + // If set returns undefined, fall back to normal setting + if ( !hooks || !( "set" in hooks ) || hooks.set( this, val, "value" ) === undefined ) { + this.value = val; + } + } ); + } +} ); + +jQuery.extend( { + valHooks: { + option: { + get: function( elem ) { + + var val = jQuery.find.attr( elem, "value" ); + return val != null ? + val : + + // Support: IE <=10 - 11 only + // option.text throws exceptions (#14686, #14858) + // Strip and collapse whitespace + // https://html.spec.whatwg.org/#strip-and-collapse-whitespace + stripAndCollapse( jQuery.text( elem ) ); + } + }, + select: { + get: function( elem ) { + var value, option, i, + options = elem.options, + index = elem.selectedIndex, + one = elem.type === "select-one", + values = one ? null : [], + max = one ? index + 1 : options.length; + + if ( index < 0 ) { + i = max; + + } else { + i = one ? index : 0; + } + + // Loop through all the selected options + for ( ; i < max; i++ ) { + option = options[ i ]; + + // Support: IE <=9 only + // IE8-9 doesn't update selected after form reset (#2551) + if ( ( option.selected || i === index ) && + + // Don't return options that are disabled or in a disabled optgroup + !option.disabled && + ( !option.parentNode.disabled || + !nodeName( option.parentNode, "optgroup" ) ) ) { + + // Get the specific value for the option + value = jQuery( option ).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + return values; + }, + + set: function( elem, value ) { + var optionSet, option, + options = elem.options, + values = jQuery.makeArray( value ), + i = options.length; + + while ( i-- ) { + option = options[ i ]; + + /* eslint-disable no-cond-assign */ + + if ( option.selected = + jQuery.inArray( jQuery.valHooks.option.get( option ), values ) > -1 + ) { + optionSet = true; + } + + /* eslint-enable no-cond-assign */ + } + + // Force browsers to behave consistently when non-matching value is set + if ( !optionSet ) { + elem.selectedIndex = -1; + } + return values; + } + } + } +} ); + +// Radios and checkboxes getter/setter +jQuery.each( [ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + set: function( elem, value ) { + if ( Array.isArray( value ) ) { + return ( elem.checked = jQuery.inArray( jQuery( elem ).val(), value ) > -1 ); + } + } + }; + if ( !support.checkOn ) { + jQuery.valHooks[ this ].get = function( elem ) { + return elem.getAttribute( "value" ) === null ? "on" : elem.value; + }; + } +} ); + + + + +// Return jQuery for attributes-only inclusion + + +support.focusin = "onfocusin" in window; + + +var rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, + stopPropagationCallback = function( e ) { + e.stopPropagation(); + }; + +jQuery.extend( jQuery.event, { + + trigger: function( event, data, elem, onlyHandlers ) { + + var i, cur, tmp, bubbleType, ontype, handle, special, lastElement, + eventPath = [ elem || document ], + type = hasOwn.call( event, "type" ) ? event.type : event, + namespaces = hasOwn.call( event, "namespace" ) ? event.namespace.split( "." ) : []; + + cur = lastElement = tmp = elem = elem || document; + + // Don't do events on text and comment nodes + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + // focus/blur morphs to focusin/out; ensure we're not firing them right now + if ( rfocusMorph.test( type + jQuery.event.triggered ) ) { + return; + } + + if ( type.indexOf( "." ) > -1 ) { + + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split( "." ); + type = namespaces.shift(); + namespaces.sort(); + } + ontype = type.indexOf( ":" ) < 0 && "on" + type; + + // Caller can pass in a jQuery.Event object, Object, or just an event type string + event = event[ jQuery.expando ] ? + event : + new jQuery.Event( type, typeof event === "object" && event ); + + // Trigger bitmask: & 1 for native handlers; & 2 for jQuery (always true) + event.isTrigger = onlyHandlers ? 2 : 3; + event.namespace = namespaces.join( "." ); + event.rnamespace = event.namespace ? + new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ) : + null; + + // Clean up the event in case it is being reused + event.result = undefined; + if ( !event.target ) { + event.target = elem; + } + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data == null ? + [ event ] : + jQuery.makeArray( data, [ event ] ); + + // Allow special events to draw outside the lines + special = jQuery.event.special[ type ] || {}; + if ( !onlyHandlers && special.trigger && special.trigger.apply( elem, data ) === false ) { + return; + } + + // Determine event propagation path in advance, per W3C events spec (#9951) + // Bubble up to document, then to window; watch for a global ownerDocument var (#9724) + if ( !onlyHandlers && !special.noBubble && !isWindow( elem ) ) { + + bubbleType = special.delegateType || type; + if ( !rfocusMorph.test( bubbleType + type ) ) { + cur = cur.parentNode; + } + for ( ; cur; cur = cur.parentNode ) { + eventPath.push( cur ); + tmp = cur; + } + + // Only add window if we got to document (e.g., not plain obj or detached DOM) + if ( tmp === ( elem.ownerDocument || document ) ) { + eventPath.push( tmp.defaultView || tmp.parentWindow || window ); + } + } + + // Fire handlers on the event path + i = 0; + while ( ( cur = eventPath[ i++ ] ) && !event.isPropagationStopped() ) { + lastElement = cur; + event.type = i > 1 ? + bubbleType : + special.bindType || type; + + // jQuery handler + handle = ( dataPriv.get( cur, "events" ) || Object.create( null ) )[ event.type ] && + dataPriv.get( cur, "handle" ); + if ( handle ) { + handle.apply( cur, data ); + } + + // Native handler + handle = ontype && cur[ ontype ]; + if ( handle && handle.apply && acceptData( cur ) ) { + event.result = handle.apply( cur, data ); + if ( event.result === false ) { + event.preventDefault(); + } + } + } + event.type = type; + + // If nobody prevented the default action, do it now + if ( !onlyHandlers && !event.isDefaultPrevented() ) { + + if ( ( !special._default || + special._default.apply( eventPath.pop(), data ) === false ) && + acceptData( elem ) ) { + + // Call a native DOM method on the target with the same name as the event. + // Don't do default actions on window, that's where global variables be (#6170) + if ( ontype && isFunction( elem[ type ] ) && !isWindow( elem ) ) { + + // Don't re-trigger an onFOO event when we call its FOO() method + tmp = elem[ ontype ]; + + if ( tmp ) { + elem[ ontype ] = null; + } + + // Prevent re-triggering of the same event, since we already bubbled it above + jQuery.event.triggered = type; + + if ( event.isPropagationStopped() ) { + lastElement.addEventListener( type, stopPropagationCallback ); + } + + elem[ type ](); + + if ( event.isPropagationStopped() ) { + lastElement.removeEventListener( type, stopPropagationCallback ); + } + + jQuery.event.triggered = undefined; + + if ( tmp ) { + elem[ ontype ] = tmp; + } + } + } + } + + return event.result; + }, + + // Piggyback on a donor event to simulate a different one + // Used only for `focus(in | out)` events + simulate: function( type, elem, event ) { + var e = jQuery.extend( + new jQuery.Event(), + event, + { + type: type, + isSimulated: true + } + ); + + jQuery.event.trigger( e, null, elem ); + } + +} ); + +jQuery.fn.extend( { + + trigger: function( type, data ) { + return this.each( function() { + jQuery.event.trigger( type, data, this ); + } ); + }, + triggerHandler: function( type, data ) { + var elem = this[ 0 ]; + if ( elem ) { + return jQuery.event.trigger( type, data, elem, true ); + } + } +} ); + + +// Support: Firefox <=44 +// Firefox doesn't have focus(in | out) events +// Related ticket - https://bugzilla.mozilla.org/show_bug.cgi?id=687787 +// +// Support: Chrome <=48 - 49, Safari <=9.0 - 9.1 +// focus(in | out) events fire after focus & blur events, +// which is spec violation - http://www.w3.org/TR/DOM-Level-3-Events/#events-focusevent-event-order +// Related ticket - https://bugs.chromium.org/p/chromium/issues/detail?id=449857 +if ( !support.focusin ) { + jQuery.each( { focus: "focusin", blur: "focusout" }, function( orig, fix ) { + + // Attach a single capturing handler on the document while someone wants focusin/focusout + var handler = function( event ) { + jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ) ); + }; + + jQuery.event.special[ fix ] = { + setup: function() { + + // Handle: regular nodes (via `this.ownerDocument`), window + // (via `this.document`) & document (via `this`). + var doc = this.ownerDocument || this.document || this, + attaches = dataPriv.access( doc, fix ); + + if ( !attaches ) { + doc.addEventListener( orig, handler, true ); + } + dataPriv.access( doc, fix, ( attaches || 0 ) + 1 ); + }, + teardown: function() { + var doc = this.ownerDocument || this.document || this, + attaches = dataPriv.access( doc, fix ) - 1; + + if ( !attaches ) { + doc.removeEventListener( orig, handler, true ); + dataPriv.remove( doc, fix ); + + } else { + dataPriv.access( doc, fix, attaches ); + } + } + }; + } ); +} +var location = window.location; + +var nonce = { guid: Date.now() }; + +var rquery = ( /\?/ ); + + + +// Cross-browser xml parsing +jQuery.parseXML = function( data ) { + var xml, parserErrorElem; + if ( !data || typeof data !== "string" ) { + return null; + } + + // Support: IE 9 - 11 only + // IE throws on parseFromString with invalid input. + try { + xml = ( new window.DOMParser() ).parseFromString( data, "text/xml" ); + } catch ( e ) {} + + parserErrorElem = xml && xml.getElementsByTagName( "parsererror" )[ 0 ]; + if ( !xml || parserErrorElem ) { + jQuery.error( "Invalid XML: " + ( + parserErrorElem ? + jQuery.map( parserErrorElem.childNodes, function( el ) { + return el.textContent; + } ).join( "\n" ) : + data + ) ); + } + return xml; +}; + + +var + rbracket = /\[\]$/, + rCRLF = /\r?\n/g, + rsubmitterTypes = /^(?:submit|button|image|reset|file)$/i, + rsubmittable = /^(?:input|select|textarea|keygen)/i; + +function buildParams( prefix, obj, traditional, add ) { + var name; + + if ( Array.isArray( obj ) ) { + + // Serialize array item. + jQuery.each( obj, function( i, v ) { + if ( traditional || rbracket.test( prefix ) ) { + + // Treat each array item as a scalar. + add( prefix, v ); + + } else { + + // Item is non-scalar (array or object), encode its numeric index. + buildParams( + prefix + "[" + ( typeof v === "object" && v != null ? i : "" ) + "]", + v, + traditional, + add + ); + } + } ); + + } else if ( !traditional && toType( obj ) === "object" ) { + + // Serialize object item. + for ( name in obj ) { + buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add ); + } + + } else { + + // Serialize scalar item. + add( prefix, obj ); + } +} + +// Serialize an array of form elements or a set of +// key/values into a query string +jQuery.param = function( a, traditional ) { + var prefix, + s = [], + add = function( key, valueOrFunction ) { + + // If value is a function, invoke it and use its return value + var value = isFunction( valueOrFunction ) ? + valueOrFunction() : + valueOrFunction; + + s[ s.length ] = encodeURIComponent( key ) + "=" + + encodeURIComponent( value == null ? "" : value ); + }; + + if ( a == null ) { + return ""; + } + + // If an array was passed in, assume that it is an array of form elements. + if ( Array.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) { + + // Serialize the form elements + jQuery.each( a, function() { + add( this.name, this.value ); + } ); + + } else { + + // If traditional, encode the "old" way (the way 1.3.2 or older + // did it), otherwise encode params recursively. + for ( prefix in a ) { + buildParams( prefix, a[ prefix ], traditional, add ); + } + } + + // Return the resulting serialization + return s.join( "&" ); +}; + +jQuery.fn.extend( { + serialize: function() { + return jQuery.param( this.serializeArray() ); + }, + serializeArray: function() { + return this.map( function() { + + // Can add propHook for "elements" to filter or add form elements + var elements = jQuery.prop( this, "elements" ); + return elements ? jQuery.makeArray( elements ) : this; + } ).filter( function() { + var type = this.type; + + // Use .is( ":disabled" ) so that fieldset[disabled] works + return this.name && !jQuery( this ).is( ":disabled" ) && + rsubmittable.test( this.nodeName ) && !rsubmitterTypes.test( type ) && + ( this.checked || !rcheckableType.test( type ) ); + } ).map( function( _i, elem ) { + var val = jQuery( this ).val(); + + if ( val == null ) { + return null; + } + + if ( Array.isArray( val ) ) { + return jQuery.map( val, function( val ) { + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + } ); + } + + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + } ).get(); + } +} ); + + +var + r20 = /%20/g, + rhash = /#.*$/, + rantiCache = /([?&])_=[^&]*/, + rheaders = /^(.*?):[ \t]*([^\r\n]*)$/mg, + + // #7653, #8125, #8152: local protocol detection + rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/, + rnoContent = /^(?:GET|HEAD)$/, + rprotocol = /^\/\//, + + /* Prefilters + * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example) + * 2) These are called: + * - BEFORE asking for a transport + * - AFTER param serialization (s.data is a string if s.processData is true) + * 3) key is the dataType + * 4) the catchall symbol "*" can be used + * 5) execution will start with transport dataType and THEN continue down to "*" if needed + */ + prefilters = {}, + + /* Transports bindings + * 1) key is the dataType + * 2) the catchall symbol "*" can be used + * 3) selection will start with transport dataType and THEN go to "*" if needed + */ + transports = {}, + + // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression + allTypes = "*/".concat( "*" ), + + // Anchor tag for parsing the document origin + originAnchor = document.createElement( "a" ); + +originAnchor.href = location.href; + +// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport +function addToPrefiltersOrTransports( structure ) { + + // dataTypeExpression is optional and defaults to "*" + return function( dataTypeExpression, func ) { + + if ( typeof dataTypeExpression !== "string" ) { + func = dataTypeExpression; + dataTypeExpression = "*"; + } + + var dataType, + i = 0, + dataTypes = dataTypeExpression.toLowerCase().match( rnothtmlwhite ) || []; + + if ( isFunction( func ) ) { + + // For each dataType in the dataTypeExpression + while ( ( dataType = dataTypes[ i++ ] ) ) { + + // Prepend if requested + if ( dataType[ 0 ] === "+" ) { + dataType = dataType.slice( 1 ) || "*"; + ( structure[ dataType ] = structure[ dataType ] || [] ).unshift( func ); + + // Otherwise append + } else { + ( structure[ dataType ] = structure[ dataType ] || [] ).push( func ); + } + } + } + }; +} + +// Base inspection function for prefilters and transports +function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR ) { + + var inspected = {}, + seekingTransport = ( structure === transports ); + + function inspect( dataType ) { + var selected; + inspected[ dataType ] = true; + jQuery.each( structure[ dataType ] || [], function( _, prefilterOrFactory ) { + var dataTypeOrTransport = prefilterOrFactory( options, originalOptions, jqXHR ); + if ( typeof dataTypeOrTransport === "string" && + !seekingTransport && !inspected[ dataTypeOrTransport ] ) { + + options.dataTypes.unshift( dataTypeOrTransport ); + inspect( dataTypeOrTransport ); + return false; + } else if ( seekingTransport ) { + return !( selected = dataTypeOrTransport ); + } + } ); + return selected; + } + + return inspect( options.dataTypes[ 0 ] ) || !inspected[ "*" ] && inspect( "*" ); +} + +// A special extend for ajax options +// that takes "flat" options (not to be deep extended) +// Fixes #9887 +function ajaxExtend( target, src ) { + var key, deep, + flatOptions = jQuery.ajaxSettings.flatOptions || {}; + + for ( key in src ) { + if ( src[ key ] !== undefined ) { + ( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ]; + } + } + if ( deep ) { + jQuery.extend( true, target, deep ); + } + + return target; +} + +/* Handles responses to an ajax request: + * - finds the right dataType (mediates between content-type and expected dataType) + * - returns the corresponding response + */ +function ajaxHandleResponses( s, jqXHR, responses ) { + + var ct, type, finalDataType, firstDataType, + contents = s.contents, + dataTypes = s.dataTypes; + + // Remove auto dataType and get content-type in the process + while ( dataTypes[ 0 ] === "*" ) { + dataTypes.shift(); + if ( ct === undefined ) { + ct = s.mimeType || jqXHR.getResponseHeader( "Content-Type" ); + } + } + + // Check if we're dealing with a known content-type + if ( ct ) { + for ( type in contents ) { + if ( contents[ type ] && contents[ type ].test( ct ) ) { + dataTypes.unshift( type ); + break; + } + } + } + + // Check to see if we have a response for the expected dataType + if ( dataTypes[ 0 ] in responses ) { + finalDataType = dataTypes[ 0 ]; + } else { + + // Try convertible dataTypes + for ( type in responses ) { + if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[ 0 ] ] ) { + finalDataType = type; + break; + } + if ( !firstDataType ) { + firstDataType = type; + } + } + + // Or just use first one + finalDataType = finalDataType || firstDataType; + } + + // If we found a dataType + // We add the dataType to the list if needed + // and return the corresponding response + if ( finalDataType ) { + if ( finalDataType !== dataTypes[ 0 ] ) { + dataTypes.unshift( finalDataType ); + } + return responses[ finalDataType ]; + } +} + +/* Chain conversions given the request and the original response + * Also sets the responseXXX fields on the jqXHR instance + */ +function ajaxConvert( s, response, jqXHR, isSuccess ) { + var conv2, current, conv, tmp, prev, + converters = {}, + + // Work with a copy of dataTypes in case we need to modify it for conversion + dataTypes = s.dataTypes.slice(); + + // Create converters map with lowercased keys + if ( dataTypes[ 1 ] ) { + for ( conv in s.converters ) { + converters[ conv.toLowerCase() ] = s.converters[ conv ]; + } + } + + current = dataTypes.shift(); + + // Convert to each sequential dataType + while ( current ) { + + if ( s.responseFields[ current ] ) { + jqXHR[ s.responseFields[ current ] ] = response; + } + + // Apply the dataFilter if provided + if ( !prev && isSuccess && s.dataFilter ) { + response = s.dataFilter( response, s.dataType ); + } + + prev = current; + current = dataTypes.shift(); + + if ( current ) { + + // There's only work to do if current dataType is non-auto + if ( current === "*" ) { + + current = prev; + + // Convert response if prev dataType is non-auto and differs from current + } else if ( prev !== "*" && prev !== current ) { + + // Seek a direct converter + conv = converters[ prev + " " + current ] || converters[ "* " + current ]; + + // If none found, seek a pair + if ( !conv ) { + for ( conv2 in converters ) { + + // If conv2 outputs current + tmp = conv2.split( " " ); + if ( tmp[ 1 ] === current ) { + + // If prev can be converted to accepted input + conv = converters[ prev + " " + tmp[ 0 ] ] || + converters[ "* " + tmp[ 0 ] ]; + if ( conv ) { + + // Condense equivalence converters + if ( conv === true ) { + conv = converters[ conv2 ]; + + // Otherwise, insert the intermediate dataType + } else if ( converters[ conv2 ] !== true ) { + current = tmp[ 0 ]; + dataTypes.unshift( tmp[ 1 ] ); + } + break; + } + } + } + } + + // Apply converter (if not an equivalence) + if ( conv !== true ) { + + // Unless errors are allowed to bubble, catch and return them + if ( conv && s.throws ) { + response = conv( response ); + } else { + try { + response = conv( response ); + } catch ( e ) { + return { + state: "parsererror", + error: conv ? e : "No conversion from " + prev + " to " + current + }; + } + } + } + } + } + } + + return { state: "success", data: response }; +} + +jQuery.extend( { + + // Counter for holding the number of active queries + active: 0, + + // Last-Modified header cache for next request + lastModified: {}, + etag: {}, + + ajaxSettings: { + url: location.href, + type: "GET", + isLocal: rlocalProtocol.test( location.protocol ), + global: true, + processData: true, + async: true, + contentType: "application/x-www-form-urlencoded; charset=UTF-8", + + /* + timeout: 0, + data: null, + dataType: null, + username: null, + password: null, + cache: null, + throws: false, + traditional: false, + headers: {}, + */ + + accepts: { + "*": allTypes, + text: "text/plain", + html: "text/html", + xml: "application/xml, text/xml", + json: "application/json, text/javascript" + }, + + contents: { + xml: /\bxml\b/, + html: /\bhtml/, + json: /\bjson\b/ + }, + + responseFields: { + xml: "responseXML", + text: "responseText", + json: "responseJSON" + }, + + // Data converters + // Keys separate source (or catchall "*") and destination types with a single space + converters: { + + // Convert anything to text + "* text": String, + + // Text to html (true = no transformation) + "text html": true, + + // Evaluate text as a json expression + "text json": JSON.parse, + + // Parse text as xml + "text xml": jQuery.parseXML + }, + + // For options that shouldn't be deep extended: + // you can add your own custom options here if + // and when you create one that shouldn't be + // deep extended (see ajaxExtend) + flatOptions: { + url: true, + context: true + } + }, + + // Creates a full fledged settings object into target + // with both ajaxSettings and settings fields. + // If target is omitted, writes into ajaxSettings. + ajaxSetup: function( target, settings ) { + return settings ? + + // Building a settings object + ajaxExtend( ajaxExtend( target, jQuery.ajaxSettings ), settings ) : + + // Extending ajaxSettings + ajaxExtend( jQuery.ajaxSettings, target ); + }, + + ajaxPrefilter: addToPrefiltersOrTransports( prefilters ), + ajaxTransport: addToPrefiltersOrTransports( transports ), + + // Main method + ajax: function( url, options ) { + + // If url is an object, simulate pre-1.5 signature + if ( typeof url === "object" ) { + options = url; + url = undefined; + } + + // Force options to be an object + options = options || {}; + + var transport, + + // URL without anti-cache param + cacheURL, + + // Response headers + responseHeadersString, + responseHeaders, + + // timeout handle + timeoutTimer, + + // Url cleanup var + urlAnchor, + + // Request state (becomes false upon send and true upon completion) + completed, + + // To know if global events are to be dispatched + fireGlobals, + + // Loop variable + i, + + // uncached part of the url + uncached, + + // Create the final options object + s = jQuery.ajaxSetup( {}, options ), + + // Callbacks context + callbackContext = s.context || s, + + // Context for global events is callbackContext if it is a DOM node or jQuery collection + globalEventContext = s.context && + ( callbackContext.nodeType || callbackContext.jquery ) ? + jQuery( callbackContext ) : + jQuery.event, + + // Deferreds + deferred = jQuery.Deferred(), + completeDeferred = jQuery.Callbacks( "once memory" ), + + // Status-dependent callbacks + statusCode = s.statusCode || {}, + + // Headers (they are sent all at once) + requestHeaders = {}, + requestHeadersNames = {}, + + // Default abort message + strAbort = "canceled", + + // Fake xhr + jqXHR = { + readyState: 0, + + // Builds headers hashtable if needed + getResponseHeader: function( key ) { + var match; + if ( completed ) { + if ( !responseHeaders ) { + responseHeaders = {}; + while ( ( match = rheaders.exec( responseHeadersString ) ) ) { + responseHeaders[ match[ 1 ].toLowerCase() + " " ] = + ( responseHeaders[ match[ 1 ].toLowerCase() + " " ] || [] ) + .concat( match[ 2 ] ); + } + } + match = responseHeaders[ key.toLowerCase() + " " ]; + } + return match == null ? null : match.join( ", " ); + }, + + // Raw string + getAllResponseHeaders: function() { + return completed ? responseHeadersString : null; + }, + + // Caches the header + setRequestHeader: function( name, value ) { + if ( completed == null ) { + name = requestHeadersNames[ name.toLowerCase() ] = + requestHeadersNames[ name.toLowerCase() ] || name; + requestHeaders[ name ] = value; + } + return this; + }, + + // Overrides response content-type header + overrideMimeType: function( type ) { + if ( completed == null ) { + s.mimeType = type; + } + return this; + }, + + // Status-dependent callbacks + statusCode: function( map ) { + var code; + if ( map ) { + if ( completed ) { + + // Execute the appropriate callbacks + jqXHR.always( map[ jqXHR.status ] ); + } else { + + // Lazy-add the new callbacks in a way that preserves old ones + for ( code in map ) { + statusCode[ code ] = [ statusCode[ code ], map[ code ] ]; + } + } + } + return this; + }, + + // Cancel the request + abort: function( statusText ) { + var finalText = statusText || strAbort; + if ( transport ) { + transport.abort( finalText ); + } + done( 0, finalText ); + return this; + } + }; + + // Attach deferreds + deferred.promise( jqXHR ); + + // Add protocol if not provided (prefilters might expect it) + // Handle falsy url in the settings object (#10093: consistency with old signature) + // We also use the url parameter if available + s.url = ( ( url || s.url || location.href ) + "" ) + .replace( rprotocol, location.protocol + "//" ); + + // Alias method option to type as per ticket #12004 + s.type = options.method || options.type || s.method || s.type; + + // Extract dataTypes list + s.dataTypes = ( s.dataType || "*" ).toLowerCase().match( rnothtmlwhite ) || [ "" ]; + + // A cross-domain request is in order when the origin doesn't match the current origin. + if ( s.crossDomain == null ) { + urlAnchor = document.createElement( "a" ); + + // Support: IE <=8 - 11, Edge 12 - 15 + // IE throws exception on accessing the href property if url is malformed, + // e.g. http://example.com:80x/ + try { + urlAnchor.href = s.url; + + // Support: IE <=8 - 11 only + // Anchor's host property isn't correctly set when s.url is relative + urlAnchor.href = urlAnchor.href; + s.crossDomain = originAnchor.protocol + "//" + originAnchor.host !== + urlAnchor.protocol + "//" + urlAnchor.host; + } catch ( e ) { + + // If there is an error parsing the URL, assume it is crossDomain, + // it can be rejected by the transport if it is invalid + s.crossDomain = true; + } + } + + // Convert data if not already a string + if ( s.data && s.processData && typeof s.data !== "string" ) { + s.data = jQuery.param( s.data, s.traditional ); + } + + // Apply prefilters + inspectPrefiltersOrTransports( prefilters, s, options, jqXHR ); + + // If request was aborted inside a prefilter, stop there + if ( completed ) { + return jqXHR; + } + + // We can fire global events as of now if asked to + // Don't fire events if jQuery.event is undefined in an AMD-usage scenario (#15118) + fireGlobals = jQuery.event && s.global; + + // Watch for a new set of requests + if ( fireGlobals && jQuery.active++ === 0 ) { + jQuery.event.trigger( "ajaxStart" ); + } + + // Uppercase the type + s.type = s.type.toUpperCase(); + + // Determine if request has content + s.hasContent = !rnoContent.test( s.type ); + + // Save the URL in case we're toying with the If-Modified-Since + // and/or If-None-Match header later on + // Remove hash to simplify url manipulation + cacheURL = s.url.replace( rhash, "" ); + + // More options handling for requests with no content + if ( !s.hasContent ) { + + // Remember the hash so we can put it back + uncached = s.url.slice( cacheURL.length ); + + // If data is available and should be processed, append data to url + if ( s.data && ( s.processData || typeof s.data === "string" ) ) { + cacheURL += ( rquery.test( cacheURL ) ? "&" : "?" ) + s.data; + + // #9682: remove data so that it's not used in an eventual retry + delete s.data; + } + + // Add or update anti-cache param if needed + if ( s.cache === false ) { + cacheURL = cacheURL.replace( rantiCache, "$1" ); + uncached = ( rquery.test( cacheURL ) ? "&" : "?" ) + "_=" + ( nonce.guid++ ) + + uncached; + } + + // Put hash and anti-cache on the URL that will be requested (gh-1732) + s.url = cacheURL + uncached; + + // Change '%20' to '+' if this is encoded form body content (gh-2658) + } else if ( s.data && s.processData && + ( s.contentType || "" ).indexOf( "application/x-www-form-urlencoded" ) === 0 ) { + s.data = s.data.replace( r20, "+" ); + } + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + if ( jQuery.lastModified[ cacheURL ] ) { + jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ cacheURL ] ); + } + if ( jQuery.etag[ cacheURL ] ) { + jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ cacheURL ] ); + } + } + + // Set the correct header, if data is being sent + if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) { + jqXHR.setRequestHeader( "Content-Type", s.contentType ); + } + + // Set the Accepts header for the server, depending on the dataType + jqXHR.setRequestHeader( + "Accept", + s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[ 0 ] ] ? + s.accepts[ s.dataTypes[ 0 ] ] + + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) : + s.accepts[ "*" ] + ); + + // Check for headers option + for ( i in s.headers ) { + jqXHR.setRequestHeader( i, s.headers[ i ] ); + } + + // Allow custom headers/mimetypes and early abort + if ( s.beforeSend && + ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || completed ) ) { + + // Abort if not done already and return + return jqXHR.abort(); + } + + // Aborting is no longer a cancellation + strAbort = "abort"; + + // Install callbacks on deferreds + completeDeferred.add( s.complete ); + jqXHR.done( s.success ); + jqXHR.fail( s.error ); + + // Get transport + transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR ); + + // If no transport, we auto-abort + if ( !transport ) { + done( -1, "No Transport" ); + } else { + jqXHR.readyState = 1; + + // Send global event + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] ); + } + + // If request was aborted inside ajaxSend, stop there + if ( completed ) { + return jqXHR; + } + + // Timeout + if ( s.async && s.timeout > 0 ) { + timeoutTimer = window.setTimeout( function() { + jqXHR.abort( "timeout" ); + }, s.timeout ); + } + + try { + completed = false; + transport.send( requestHeaders, done ); + } catch ( e ) { + + // Rethrow post-completion exceptions + if ( completed ) { + throw e; + } + + // Propagate others as results + done( -1, e ); + } + } + + // Callback for when everything is done + function done( status, nativeStatusText, responses, headers ) { + var isSuccess, success, error, response, modified, + statusText = nativeStatusText; + + // Ignore repeat invocations + if ( completed ) { + return; + } + + completed = true; + + // Clear timeout if it exists + if ( timeoutTimer ) { + window.clearTimeout( timeoutTimer ); + } + + // Dereference transport for early garbage collection + // (no matter how long the jqXHR object will be used) + transport = undefined; + + // Cache response headers + responseHeadersString = headers || ""; + + // Set readyState + jqXHR.readyState = status > 0 ? 4 : 0; + + // Determine if successful + isSuccess = status >= 200 && status < 300 || status === 304; + + // Get response data + if ( responses ) { + response = ajaxHandleResponses( s, jqXHR, responses ); + } + + // Use a noop converter for missing script but not if jsonp + if ( !isSuccess && + jQuery.inArray( "script", s.dataTypes ) > -1 && + jQuery.inArray( "json", s.dataTypes ) < 0 ) { + s.converters[ "text script" ] = function() {}; + } + + // Convert no matter what (that way responseXXX fields are always set) + response = ajaxConvert( s, response, jqXHR, isSuccess ); + + // If successful, handle type chaining + if ( isSuccess ) { + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + modified = jqXHR.getResponseHeader( "Last-Modified" ); + if ( modified ) { + jQuery.lastModified[ cacheURL ] = modified; + } + modified = jqXHR.getResponseHeader( "etag" ); + if ( modified ) { + jQuery.etag[ cacheURL ] = modified; + } + } + + // if no content + if ( status === 204 || s.type === "HEAD" ) { + statusText = "nocontent"; + + // if not modified + } else if ( status === 304 ) { + statusText = "notmodified"; + + // If we have data, let's convert it + } else { + statusText = response.state; + success = response.data; + error = response.error; + isSuccess = !error; + } + } else { + + // Extract error from statusText and normalize for non-aborts + error = statusText; + if ( status || !statusText ) { + statusText = "error"; + if ( status < 0 ) { + status = 0; + } + } + } + + // Set data for the fake xhr object + jqXHR.status = status; + jqXHR.statusText = ( nativeStatusText || statusText ) + ""; + + // Success/Error + if ( isSuccess ) { + deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] ); + } else { + deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] ); + } + + // Status-dependent callbacks + jqXHR.statusCode( statusCode ); + statusCode = undefined; + + if ( fireGlobals ) { + globalEventContext.trigger( isSuccess ? "ajaxSuccess" : "ajaxError", + [ jqXHR, s, isSuccess ? success : error ] ); + } + + // Complete + completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] ); + + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] ); + + // Handle the global AJAX counter + if ( !( --jQuery.active ) ) { + jQuery.event.trigger( "ajaxStop" ); + } + } + } + + return jqXHR; + }, + + getJSON: function( url, data, callback ) { + return jQuery.get( url, data, callback, "json" ); + }, + + getScript: function( url, callback ) { + return jQuery.get( url, undefined, callback, "script" ); + } +} ); + +jQuery.each( [ "get", "post" ], function( _i, method ) { + jQuery[ method ] = function( url, data, callback, type ) { + + // Shift arguments if data argument was omitted + if ( isFunction( data ) ) { + type = type || callback; + callback = data; + data = undefined; + } + + // The url can be an options object (which then must have .url) + return jQuery.ajax( jQuery.extend( { + url: url, + type: method, + dataType: type, + data: data, + success: callback + }, jQuery.isPlainObject( url ) && url ) ); + }; +} ); + +jQuery.ajaxPrefilter( function( s ) { + var i; + for ( i in s.headers ) { + if ( i.toLowerCase() === "content-type" ) { + s.contentType = s.headers[ i ] || ""; + } + } +} ); + + +jQuery._evalUrl = function( url, options, doc ) { + return jQuery.ajax( { + url: url, + + // Make this explicit, since user can override this through ajaxSetup (#11264) + type: "GET", + dataType: "script", + cache: true, + async: false, + global: false, + + // Only evaluate the response if it is successful (gh-4126) + // dataFilter is not invoked for failure responses, so using it instead + // of the default converter is kludgy but it works. + converters: { + "text script": function() {} + }, + dataFilter: function( response ) { + jQuery.globalEval( response, options, doc ); + } + } ); +}; + + +jQuery.fn.extend( { + wrapAll: function( html ) { + var wrap; + + if ( this[ 0 ] ) { + if ( isFunction( html ) ) { + html = html.call( this[ 0 ] ); + } + + // The elements to wrap the target around + wrap = jQuery( html, this[ 0 ].ownerDocument ).eq( 0 ).clone( true ); + + if ( this[ 0 ].parentNode ) { + wrap.insertBefore( this[ 0 ] ); + } + + wrap.map( function() { + var elem = this; + + while ( elem.firstElementChild ) { + elem = elem.firstElementChild; + } + + return elem; + } ).append( this ); + } + + return this; + }, + + wrapInner: function( html ) { + if ( isFunction( html ) ) { + return this.each( function( i ) { + jQuery( this ).wrapInner( html.call( this, i ) ); + } ); + } + + return this.each( function() { + var self = jQuery( this ), + contents = self.contents(); + + if ( contents.length ) { + contents.wrapAll( html ); + + } else { + self.append( html ); + } + } ); + }, + + wrap: function( html ) { + var htmlIsFunction = isFunction( html ); + + return this.each( function( i ) { + jQuery( this ).wrapAll( htmlIsFunction ? html.call( this, i ) : html ); + } ); + }, + + unwrap: function( selector ) { + this.parent( selector ).not( "body" ).each( function() { + jQuery( this ).replaceWith( this.childNodes ); + } ); + return this; + } +} ); + + +jQuery.expr.pseudos.hidden = function( elem ) { + return !jQuery.expr.pseudos.visible( elem ); +}; +jQuery.expr.pseudos.visible = function( elem ) { + return !!( elem.offsetWidth || elem.offsetHeight || elem.getClientRects().length ); +}; + + + + +jQuery.ajaxSettings.xhr = function() { + try { + return new window.XMLHttpRequest(); + } catch ( e ) {} +}; + +var xhrSuccessStatus = { + + // File protocol always yields status code 0, assume 200 + 0: 200, + + // Support: IE <=9 only + // #1450: sometimes IE returns 1223 when it should be 204 + 1223: 204 + }, + xhrSupported = jQuery.ajaxSettings.xhr(); + +support.cors = !!xhrSupported && ( "withCredentials" in xhrSupported ); +support.ajax = xhrSupported = !!xhrSupported; + +jQuery.ajaxTransport( function( options ) { + var callback, errorCallback; + + // Cross domain only allowed if supported through XMLHttpRequest + if ( support.cors || xhrSupported && !options.crossDomain ) { + return { + send: function( headers, complete ) { + var i, + xhr = options.xhr(); + + xhr.open( + options.type, + options.url, + options.async, + options.username, + options.password + ); + + // Apply custom fields if provided + if ( options.xhrFields ) { + for ( i in options.xhrFields ) { + xhr[ i ] = options.xhrFields[ i ]; + } + } + + // Override mime type if needed + if ( options.mimeType && xhr.overrideMimeType ) { + xhr.overrideMimeType( options.mimeType ); + } + + // X-Requested-With header + // For cross-domain requests, seeing as conditions for a preflight are + // akin to a jigsaw puzzle, we simply never set it to be sure. + // (it can always be set on a per-request basis or even using ajaxSetup) + // For same-domain requests, won't change header if already provided. + if ( !options.crossDomain && !headers[ "X-Requested-With" ] ) { + headers[ "X-Requested-With" ] = "XMLHttpRequest"; + } + + // Set headers + for ( i in headers ) { + xhr.setRequestHeader( i, headers[ i ] ); + } + + // Callback + callback = function( type ) { + return function() { + if ( callback ) { + callback = errorCallback = xhr.onload = + xhr.onerror = xhr.onabort = xhr.ontimeout = + xhr.onreadystatechange = null; + + if ( type === "abort" ) { + xhr.abort(); + } else if ( type === "error" ) { + + // Support: IE <=9 only + // On a manual native abort, IE9 throws + // errors on any property access that is not readyState + if ( typeof xhr.status !== "number" ) { + complete( 0, "error" ); + } else { + complete( + + // File: protocol always yields status 0; see #8605, #14207 + xhr.status, + xhr.statusText + ); + } + } else { + complete( + xhrSuccessStatus[ xhr.status ] || xhr.status, + xhr.statusText, + + // Support: IE <=9 only + // IE9 has no XHR2 but throws on binary (trac-11426) + // For XHR2 non-text, let the caller handle it (gh-2498) + ( xhr.responseType || "text" ) !== "text" || + typeof xhr.responseText !== "string" ? + { binary: xhr.response } : + { text: xhr.responseText }, + xhr.getAllResponseHeaders() + ); + } + } + }; + }; + + // Listen to events + xhr.onload = callback(); + errorCallback = xhr.onerror = xhr.ontimeout = callback( "error" ); + + // Support: IE 9 only + // Use onreadystatechange to replace onabort + // to handle uncaught aborts + if ( xhr.onabort !== undefined ) { + xhr.onabort = errorCallback; + } else { + xhr.onreadystatechange = function() { + + // Check readyState before timeout as it changes + if ( xhr.readyState === 4 ) { + + // Allow onerror to be called first, + // but that will not handle a native abort + // Also, save errorCallback to a variable + // as xhr.onerror cannot be accessed + window.setTimeout( function() { + if ( callback ) { + errorCallback(); + } + } ); + } + }; + } + + // Create the abort callback + callback = callback( "abort" ); + + try { + + // Do send the request (this may raise an exception) + xhr.send( options.hasContent && options.data || null ); + } catch ( e ) { + + // #14683: Only rethrow if this hasn't been notified as an error yet + if ( callback ) { + throw e; + } + } + }, + + abort: function() { + if ( callback ) { + callback(); + } + } + }; + } +} ); + + + + +// Prevent auto-execution of scripts when no explicit dataType was provided (See gh-2432) +jQuery.ajaxPrefilter( function( s ) { + if ( s.crossDomain ) { + s.contents.script = false; + } +} ); + +// Install script dataType +jQuery.ajaxSetup( { + accepts: { + script: "text/javascript, application/javascript, " + + "application/ecmascript, application/x-ecmascript" + }, + contents: { + script: /\b(?:java|ecma)script\b/ + }, + converters: { + "text script": function( text ) { + jQuery.globalEval( text ); + return text; + } + } +} ); + +// Handle cache's special case and crossDomain +jQuery.ajaxPrefilter( "script", function( s ) { + if ( s.cache === undefined ) { + s.cache = false; + } + if ( s.crossDomain ) { + s.type = "GET"; + } +} ); + +// Bind script tag hack transport +jQuery.ajaxTransport( "script", function( s ) { + + // This transport only deals with cross domain or forced-by-attrs requests + if ( s.crossDomain || s.scriptAttrs ) { + var script, callback; + return { + send: function( _, complete ) { + script = jQuery( " + + + + + + +
+ + +
+ + +
+ + +
+ + +
+
+
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+
+
+
+ +
+ + +
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+ + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+
+
+

Adding Connections, Variables and Environment Variables

+

You can programmatically add Connections, Variables and arbitrary Environment Variables to your +Airflow deployment using the Helm chart.

+
+

Connections and Sensitive Environment Variables

+

Under the secret and extraSecret sections of the values.yaml you can pass connection strings and sensitive +environment variables into Airflow using the Helm chart. To illustrate, lets create a yaml file called override.yaml +to override values under these sections of the values.yaml file.

+
# override.yaml
+
+secret:
+  - envName: "AIRFLOW_CONN_GCP"
+    secretName: "my-airflow-connections"
+    secretKey: "AIRFLOW_CONN_GCP"
+  - envName: "my-env"
+    secretName: "my-secret-name"
+    secretKey: "my-secret-key"
+
+extraSecrets:
+  my-airflow-connections:
+    data: |
+      AIRFLOW_CONN_GCP: 'base64_encoded_gcp_conn_string'
+  my-secret-name:
+    stringData: |
+      my-secret-key: my-secret
+
+
+
+
+

Variables

+

Airflow supports Variables which enable users to craft dynamic DAGs. You can set Variables in Airflow in three ways - UI, +command line, and within your DAG file. See Managing Variables for more.

+

With the Helm chart, you can also inject environment variables into Airflow. So in the example override.yaml file, +we can override values of interest in the env section of the values.yaml file.

+
env:
+  - name: "AIRFLOW_VAR_KEY"
+    value: "value_1"
+  - name: "AIRFLOW_VAR_ANOTHER_KEY"
+    value: "value_2"
+
+
+

You can also utilize extraEnv and extraEnvFrom if you need the name or value to be templated.

+
extraEnv: |
+  - name: AIRFLOW_VAR_HELM_RELEASE_NAME
+    value: '{{ .Release.Name }}'
+
+extraEnvFrom: |
+  - configMapRef:
+      name: '{{ .Release.Name }}-airflow-variables'
+
+extraConfigMaps:
+  '{{ .Release.Name }}-airflow-variables':
+    data: |
+      AIRFLOW_VAR_HELLO_MESSAGE: "Hi!"
+
+
+
+
+ + + +
+ +
+
+
+
+
+

Was this entry helpful?

+
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+
+ +
+ + + + + + +
+ + + + + + + + + + + + + + + +
+ + + + +
+ + +
+ + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/docs-archive/helm-chart/1.14.0/airflow-configuration.html b/docs-archive/helm-chart/1.14.0/airflow-configuration.html new file mode 100644 index 00000000000..0e107c6c310 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/airflow-configuration.html @@ -0,0 +1,874 @@ + + + + + + + + + + + + Configuring Airflow — helm-chart Documentation + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ + +
+ + +
+ + +
+
+
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+
+
+
+ +
+ + +
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+ + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+
+
+

Configuring Airflow

+

The chart allows for setting arbitrary Airflow configuration in values under the config key. +Some of the defaults in the chart differ from those of core Airflow and can be found in +values.yaml.

+

As an example of setting arbitrary configuration, the following yaml demonstrates how one would +allow webserver users to view the config from within the UI:

+
config:
+  webserver:
+    expose_config: 'True'  # by default this is 'False'
+
+
+

Generally speaking, it is useful to familiarize oneself with the Airflow +configuration prior to installing and deploying the service.

+
+

Note

+

The recommended way to load example DAGs using the official Docker image and chart is to configure the AIRFLOW__CORE__LOAD_EXAMPLES environment variable +in extraEnv (see Parameters reference). The official Docker image has AIRFLOW__CORE__LOAD_EXAMPLES=False +set within the image, so you need to override it with an environment variable when deploying the chart in order for the examples to be present.

+
+
+ + + +
+ +
+
+
+
+
+

Was this entry helpful?

+
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+
+ +
+ + + + + + +
+ + + + + + + + + + + + + + + +
+ + + + +
+ + +
+ + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/docs-archive/helm-chart/1.14.0/changelog.html b/docs-archive/helm-chart/1.14.0/changelog.html new file mode 100644 index 00000000000..327c53bdf40 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/changelog.html @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/docs-archive/helm-chart/1.14.0/customizing-workers.html b/docs-archive/helm-chart/1.14.0/customizing-workers.html new file mode 100644 index 00000000000..5234258b36d --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/customizing-workers.html @@ -0,0 +1,905 @@ + + + + + + + + + + + + Customizing Workers — helm-chart Documentation + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ + +
+ + +
+ + +
+
+
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+
+
+
+ +
+ + +
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+ + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+
+
+

Customizing Workers

+

Both CeleryExecutor and KubernetesExecutor workers can be highly customized with the workers parameters. +For example, to set resources on workers:

+
workers:
+  resources:
+    requests:
+      cpu: 1
+    limits:
+      cpu: 1
+
+
+

See workers parameters for a complete list.

+

One notable exception for KubernetesExecutor is that the default anti-affinity applied to CeleryExecutor workers to spread them across nodes +is not applied to KubernetesExecutor workers, as there is no reason to spread out per-task workers.

+
+

Custom pod_template_file

+

With KubernetesExecutor or CeleryKubernetesExecutor you can also provide a complete pod_template_file to configure Kubernetes workers. +This may be useful if you need different configuration between worker types for CeleryKubernetesExecutor +or if you need to customize something not possible with workers parameters alone.

+

As an example, let’s say you want to set priorityClassName on your workers:

+
+

Note

+

The following example is NOT functional, but meant to be illustrative of how you can provide a custom pod_template_file. +You’re better off starting with the default pod_template_file instead.

+
+
podTemplate: |
+  apiVersion: v1
+  kind: Pod
+  metadata:
+    name: placeholder-name
+    labels:
+      tier: airflow
+      component: worker
+      release: {{ .Release.Name }}
+  spec:
+    priorityClassName: high-priority
+    containers:
+      - name: base
+
+
+
+
+ + + +
+ +
+
+
+
+
+

Was this entry helpful?

+
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+
+ +
+ + + + + + +
+ + + + + + + + + + + + + + + +
+ + + + +
+ + +
+ + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/docs-archive/helm-chart/1.14.0/extending-the-chart.html b/docs-archive/helm-chart/1.14.0/extending-the-chart.html new file mode 100644 index 00000000000..fed51a1641f --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/extending-the-chart.html @@ -0,0 +1,960 @@ + + + + + + + + + + + + Extending the Chart — helm-chart Documentation + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ + +
+ + +
+ + +
+
+
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+
+
+
+ +
+ + +
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+ + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+
+
+

Extending the Chart

+

In some cases, you will want to deploy your custom templates (e.g. maintenance CronJobs you want to add) +together with the Airflow chart installation. +However, sometimes those templates are not directly related to the Airflow chart, +thus should not be added to the chart.

+

Instead, you can easily extend the chart and create a custom chart with your custom templates that +depends on the Airflow chart. +When you’ll install your custom chart, the Airflow chart will also be installed.

+

You can extend the official Airflow chart by applying the following steps.

+
+

Create your custom Chart

+

First, you will need to create you own chart directory. You can do it by running the following command:

+
helm create my-custom-chart
+
+
+

This command will create a directory called my-custom-chart with the following structure:

+
my-custom-chart/
+├── .helmignore
+├── Chart.yaml
+├── values.yaml
+├── charts/
+└── templates/
+    └── tests/
+
+
+
+
+

Add Airflow chart as dependency

+

Second, you will need to add the Airflow chart as dependency to your chart. +This will give you the ability to add your custom templates without the need to modify the Airflow chart itself. +In order to add the Airflow chart as a dependency (often called subcharts) to your chart, +add the following lines to your Chart.yaml file:

+
dependencies:
+  - name: airflow
+    version: 1.11.0
+    repository: https://airflow.apache.org
+
+
+
+

Note

+

Make sure you have already added the Airflow repo locally by running: helm repo add apache-airflow https://airflow.apache.org.

+
+
+

Tip

+

You can also use the name of the repo instead of the URL by replacing +https://airflow.apache.org with "@apache-airflow".

+
+

Adding the Airflow chart as a dependency means that it will be deployed together with your custom chart. +You can disable the installation of Airflow by adding the condition field to the dependencies section. +For example:

+
dependencies:
+  - name: airflow
+    version: 1.11.0
+    repository: https://airflow.apache.org
+    condition: airflow.enabled
+
+
+

This will check if the value of airflow.enabled inside your values.yaml is true. +If it is, the Airflow chart will be deployed together with your custom chart. +Otherwise, only your templates will be deployed.

+
+
+

Download the Airflow Chart

+

Third, after you have specified the Airflow chart inside the dependencies section in Chart.yaml file, +you can download the Airflow chart by running the following command:

+
helm dependency build
+
+
+
+

Note

+

Make sure you are inside the directory which contains the Chart.yaml file.

+
+

The chart will be downloaded and saved inside the charts/ directory.

+
+
+

Overriding default values

+

When you add a chart as a subchart to your chart, +you have the ability to override the default values of the subchart in your values.yaml. +This is useful when your chart needs a specific configuration for your custom chart. +E.g. if you want that the Airflow chart be installed with the KubernetesExecutor, +you can do it by adding the following section to your values.yaml:

+
airflow:
+  executor: KubernetesExecutor
+
+
+

You can override as many values as you like.

+
+
+ + + +
+ +
+
+
+
+
+

Was this entry helpful?

+
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+
+ +
+ + + + + + +
+ + + + + + + + + + + + + + + +
+ + + + +
+ + +
+ + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/docs-archive/helm-chart/1.14.0/genindex.html b/docs-archive/helm-chart/1.14.0/genindex.html new file mode 100644 index 00000000000..b11507a748e --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/genindex.html @@ -0,0 +1,846 @@ + + + + + + + + + + + + Index — helm-chart Documentation + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ + +
+ + +
+ + +
+
+
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+
+
+
+ +
+ + +
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+ + + + +
+ + + + + + + + + + +
+
+
+
+
+ + +

Index

+ +
+ +
+ + + +
+ +
+
+
+
+
+

Was this entry helpful?

+
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+
+ +
+ + + + + + +
+ + + + + + + + + + + + + + + +
+ + + + +
+ + +
+ + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/docs-archive/helm-chart/1.14.0/index.html b/docs-archive/helm-chart/1.14.0/index.html new file mode 100644 index 00000000000..e8de9ed2af8 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/index.html @@ -0,0 +1,987 @@ + + + + + + + + + + + + Helm Chart for Apache Airflow — helm-chart Documentation + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ + +
+ + +
+ + +
+
+
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+
+
+
+ +
+ + +
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+ + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+
+_images/helm-logo.svg
+

Helm Chart for Apache Airflow

+
+
+
+
+
+
+

This chart will bootstrap an Airflow +deployment on a Kubernetes cluster using the +Helm package manager.

+
+

Requirements

+
    +

  • Kubernetes 1.26+ cluster

    • +

  • Helm 3.0+

    • +

  • PV provisioner support in the underlying infrastructure (optionally)

    • +
+
+
+

Features

+
    +

  • Supported executors: LocalExecutor, CeleryExecutor, KubernetesExecutor, LocalKubernetesExecutor, CeleryKubernetesExecutor

    • +

  • Supported Airflow version: 1.10+, 2.0+

    • +

  • Supported database backend: PostgreSQL, MySQL

    • +

  • Autoscaling for CeleryExecutor provided by KEDA

    • +

  • PostgreSQL and PgBouncer with a battle-tested configuration

    • +

  • Monitoring:

    +
    +
      +

    • StatsD/Prometheus metrics for Airflow

      • +

    • Prometheus metrics for PgBouncer

      • +

    • Flower

      • +
    +
    +
    • +

  • Automatic database migration after a new deployment

    • +

  • Administrator account creation during deployment

    • +

  • Kerberos secure configuration

    • +

  • One-command deployment for any type of executor. You don’t need to provide other services e.g. Redis/Database to test the Airflow.

    • +
+
+
+

Installing the Chart

+

To install this chart using Helm 3, run the following commands:

+
helm repo add apache-airflow https://airflow.apache.org
+helm upgrade --install airflow apache-airflow/airflow --namespace airflow --create-namespace
+
+
+

The command deploys Airflow on the Kubernetes cluster in the default configuration. The Parameters reference +section lists the parameters that can be configured during installation.

+
+

Tip

+

List all releases using helm list.

+
+
+
+

Upgrading the Chart

+

To upgrade the chart with the release name airflow:

+
helm upgrade airflow apache-airflow/airflow --namespace airflow
+
+
+
+

Note

+

To upgrade to a new version of the chart, run helm repo update first.

+
+
+
+

Uninstalling the Chart

+

To uninstall/delete the airflow deployment:

+
helm delete airflow --namespace airflow
+
+
+

The command removes all the Kubernetes components associated with the chart and deletes the release.

+
+

Note

+

Some kubernetes resources created by the chart helm hooks might be left in the namespace after executing helm uninstall, for example, brokerUrlSecret or fernetKeySecret.

+
+
+
+

Installing the Chart with Argo CD, Flux, Rancher or Terraform

+

When installing the chart using Argo CD, Flux, Rancher or Terraform, you MUST set the four following values, or your application +will not start as the migrations will not be run:

+
createUserJob:
+  useHelmHooks: false
+  applyCustomEnv: false
+migrateDatabaseJob:
+  useHelmHooks: false
+  applyCustomEnv: false
+
+
+

This is so these CI/CD services can perform updates without issues and preserve the immutability of Kubernetes Job manifests.

+

This also applies if you install the chart using --wait in your helm install command.

+
+

Note

+

While deploying this Helm chart with Argo, you might encounter issues with database migrations not running automatically on upgrade.

+
+

To run database migrations with Argo CD automatically, you will need to add:

+
migrateDatabaseJob:
+    jobAnnotations:
+        "argocd.argoproj.io/hook": Sync
+
+
+

This will run database migrations every time there is a Sync event in Argo CD. While it is not ideal to run the migrations on every sync, it is a trade-off that allows them to be run automatically.

+

If you use the Celery(Kubernetes)Executor with the built-in Redis, it is recommended that you set up a static Redis password either by supplying redis.passwordSecretName and data.brokerUrlSecretName or redis.password.

+
+
+

Naming Conventions

+

For new installations it is highly recommended to start using standard naming conventions. +It is not enabled by default as this may cause unexpected behaviours on existing installations. However you can enable it using useStandardNaming:

+
useStandardNaming: true
+
+
+

For existing installations, all your resources will be recreated with a new name and helm will delete previous resources.

+

This won’t delete existing PVCs for logs used by StatefulSets/Deployments, but it will recreate them with brand new PVCs. +If you do want to preserve logs history you’ll need to manually copy the data of these volumes into the new volumes after +deployment. Depending on what storage backend/class you’re using this procedure may vary. If you don’t mind starting +with fresh logs/redis volumes, you can just delete the old persistent volume claims, for example:

+
kubectl delete pvc -n airflow logs-gta-triggerer-0
+kubectl delete pvc -n airflow logs-gta-worker-0
+kubectl delete pvc -n airflow redis-db-gta-redis-0
+
+
+
+

Note

+

If you do not change useStandardNaming or fullnameOverride after upgrade, you can proceed as usual and no unexpected behaviours will be presented.

+
+
+
+ + + +
+ +
+
+
+
+
+

Was this entry helpful?

+
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+
+ +
+ + + + + + +
+ + + + + + + + + + + + + + + +
+ + + + +
+ + +
+ + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/docs-archive/helm-chart/1.14.0/installing-helm-chart-from-sources.html b/docs-archive/helm-chart/1.14.0/installing-helm-chart-from-sources.html new file mode 100644 index 00000000000..2676c6b1665 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/installing-helm-chart-from-sources.html @@ -0,0 +1,945 @@ + + + + + + + + + + + + Installing Helm Chart from sources — helm-chart Documentation + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ + +
+ + +
+ + +
+
+
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+
+
+
+ +
+ + +
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+ + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+
+
+

Installing Helm Chart from sources

+
+

Released packages

+

This page describes downloading and verifying Apache Airflow Official Helm Chart version +1.14.0 using officially released source packages. You can also install the chart +directly from the airflow.apache.org repo as described in +Installing the chart. +You can choose different version of the chart by selecting different version from the drop-down at +the top-left of the page.

+

The sources and packages released are the “official” sources of installation that you can use if +you want to verify the origin of the packages and want to verify checksums and signatures of the packages. +The packages are available via the +Official Apache Software Foundations Downloads

+

The downloads are available at:

+ +

If you want to install from the source code, you can download from the sources link above, it will contain +a INSTALL file containing details on how you can build and install the chart.

+
+
+

Release integrity

+

PGP signatures KEYS

+

It is essential that you verify the integrity of the downloaded files using the PGP or SHA signatures. +The PGP signatures can be verified using GPG or PGP. Please download the KEYS as well as the asc +signature files for relevant distribution. It is recommended to get these files from the +main distribution directory and not from the mirrors.

+
gpg -i KEYS
+
+
+

or

+
pgpk -a KEYS
+
+
+

or

+
pgp -ka KEYS
+
+
+

To verify the binaries/sources you can download the relevant asc files for it from main +distribution directory and follow the below guide.

+
gpg --verify airflow-********.asc airflow-*********
+
+
+

or

+
pgpv airflow-********.asc
+
+
+

or

+
pgp airflow-********.asc
+
+
+

Example:

+
$ gpg --verify airflow-1.14.0.tgz.asc airflow-1.14.0.tgz
+  gpg: Signature made Sat 11 Sep 12:49:54 2021 BST
+  gpg:                using RSA key CDE15C6E4D3A8EC4ECF4BA4B6674E08AD7DE406F
+  gpg:                issuer "kaxilnaik@apache.org"
+  gpg: Good signature from "Kaxil Naik <kaxilnaik@apache.org>" [unknown]
+  gpg:                 aka "Kaxil Naik <kaxilnaik@gmail.com>" [unknown]
+  gpg: WARNING: The key's User ID is not certified with a trusted signature!
+  gpg:          There is no indication that the signature belongs to the owner.
+  Primary key fingerprint: CDE1 5C6E 4D3A 8EC4 ECF4  BA4B 6674 E08A D7DE 406F
+
+
+

The “Good signature from …” is indication that the signatures are correct. +Do not worry about the “not certified with a trusted signature” warning. Most of the certificates used +by release managers are self signed, that’s why you get this warning. By importing the server in the +previous step and importing it via ID from KEYS page, you know that this is a valid Key already.

+

For SHA512 sum check, download the relevant sha512 and run the following:

+
shasum -a 512 airflow-********  | diff - airflow-********.sha512
+
+
+

The SHASUM of the file should match the one provided in .sha512 file.

+

Example:

+
shasum -a 512 airflow-1.14.0.tgz  | diff - airflow-1.14.0.tgz.sha512
+
+
+
+
+ + + +
+ +
+
+
+
+
+

Was this entry helpful?

+
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+
+ +
+ + + + + + +
+ + + + + + + + + + + + + + + +
+ + + + +
+ + +
+ + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/docs-archive/helm-chart/1.14.0/keda.html b/docs-archive/helm-chart/1.14.0/keda.html new file mode 100644 index 00000000000..e1b2050dfe5 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/keda.html @@ -0,0 +1,900 @@ + + + + + + + + + + + + Autoscaling with KEDA — helm-chart Documentation + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ + +
+ + +
+ + +
+
+
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+
+
+
+ +
+ + +
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+ + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+
+
+

Autoscaling with KEDA

+

This feature is still experimental.

+

KEDA stands for Kubernetes Event Driven Autoscaling. +KEDA is a custom controller that +allows users to create custom bindings to the Kubernetes Horizontal Pod +Autoscaler. +The autoscaler will adjust the number of active Celery workers based on the number +of tasks in queued or running state.

+
helm repo add kedacore https://kedacore.github.io/charts
+
+helm repo update
+
+kubectl create namespace keda
+
+helm install keda kedacore/keda \
+    --namespace keda \
+    --version "v2.0.0"
+
+
+

Enable for the airflow instance by setting workers.keda.enabled=true in your +helm command or in the values.yaml.

+
kubectl create namespace airflow
+helm repo add apache-airflow https://airflow.apache.org
+helm install airflow apache-airflow/airflow \
+    --namespace airflow \
+    --set executor=CeleryExecutor \
+    --set workers.keda.enabled=true
+
+
+

A ScaledObject and an hpa will be created in the airflow namespace.

+

KEDA will derive the desired number of Celery workers by querying +Airflow metadata database:

+
SELECT
+    ceil(COUNT(*)::decimal / {{ .Values.config.celery.worker_concurrency }})
+FROM task_instance
+WHERE state='running' OR state='queued'
+
+
+
+

Note

+

Set Celery worker concurrency through the Helm value +config.celery.worker_concurrency (i.e. instead of airflow.cfg or +environment variables) so that the KEDA trigger will be consistent with +the worker concurrency setting.

+
+
+ + + +
+ +
+
+
+
+
+

Was this entry helpful?

+
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+
+ +
+ + + + + + +
+ + + + + + + + + + + + + + + +
+ + + + +
+ + +
+ + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/docs-archive/helm-chart/1.14.0/manage-dags-files.html b/docs-archive/helm-chart/1.14.0/manage-dags-files.html new file mode 100644 index 00000000000..34106f8f447 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/manage-dags-files.html @@ -0,0 +1,1104 @@ + + + + + + + + + + + + Manage DAGs files — helm-chart Documentation + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ + +
+ + +
+ + +
+
+
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+
+
+
+ +
+ + +
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+ + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+
+
+

Manage DAGs files

+

When you create new or modify existing DAG files, it is necessary to deploy them into the environment. This section will describe some basic techniques you can use.

+
+

Bake DAGs in Docker image

+

With this approach, you include your dag files and related code in the airflow image.

+

This method requires redeploying the services in the helm chart with the new docker image in order to deploy the new DAG code. This can work well particularly if DAG code is not expected to change frequently.

+
docker build --pull --tag "my-company/airflow:8a0da78" . -f - <<EOF
+FROM apache/airflow
+
+COPY ./dags/ \${AIRFLOW_HOME}/dags/
+
+EOF
+
+
+
+

Note

+

In Airflow images prior to version 2.0.2, there was a bug that required you to use +a bit longer Dockerfile, to make sure the image remains OpenShift-compatible (i.e DAG +has root group similarly as other files). In 2.0.2 this has been fixed.

+
+
docker build --pull --tag "my-company/airflow:8a0da78" . -f - <<EOF
+FROM apache/airflow:2.0.2
+
+USER root
+
+COPY --chown=airflow:root ./dags/ \${AIRFLOW_HOME}/dags/
+
+USER airflow
+
+EOF
+
+
+

Then publish it in the accessible registry:

+
docker push my-company/airflow:8a0da78
+
+
+

Finally, update the Airflow pods with that image:

+
helm upgrade --install airflow apache-airflow/airflow \
+  --set images.airflow.repository=my-company/airflow \
+  --set images.airflow.tag=8a0da78
+
+
+

If you are deploying an image with a constant tag, you need to make sure that the image is pulled every time.

+
+

Warning

+

Using constant tag should be used only for testing/development purpose. It is a bad practice to use the same tag as you’ll lose the history of your code.

+
+
helm upgrade --install airflow apache-airflow/airflow \
+  --set images.airflow.repository=my-company/airflow \
+  --set images.airflow.tag=8a0da78 \
+  --set images.airflow.pullPolicy=Always \
+  --set airflowPodAnnotations.random=r$(uuidgen)
+
+
+

The randomly generated pod annotation will ensure that pods are refreshed on helm upgrade.

+

If you are deploying an image from a private repository, you need to create a secret, e.g. gitlab-registry-credentials (refer Pull an Image from a Private Registry for details), and specify it using --set registry.secretName:

+
helm upgrade --install airflow apache-airflow/airflow \
+  --set images.airflow.repository=my-company/airflow \
+  --set images.airflow.tag=8a0da78 \
+  --set images.airflow.pullPolicy=Always \
+  --set registry.secretName=gitlab-registry-credentials
+
+
+
+
+

Using Git-sync

+
+

Mounting DAGs using Git-Sync sidecar with Persistence enabled

+

This option will use a Persistent Volume Claim with an access mode of ReadWriteMany. +The scheduler pod will sync DAGs from a git repository onto the PVC every configured number of +seconds. The other pods will read the synced DAGs. Not all volume plugins have support for +ReadWriteMany access mode. +Refer Persistent Volume Access Modes +for details.

+
helm upgrade --install airflow apache-airflow/airflow \
+  --set dags.persistence.enabled=true \
+  --set dags.gitSync.enabled=true
+  # you can also override the other persistence or gitSync values
+  # by setting the  dags.persistence.* and dags.gitSync.* values
+  # Please refer to values.yaml for details
+
+
+
+
+

Mounting DAGs using Git-Sync sidecar without Persistence

+

This option will use an always running Git-Sync sidecar on every scheduler, webserver (if airflowVersion < 2.0.0) +and worker pods. +The Git-Sync sidecar containers will sync DAGs from a git repository every configured number of +seconds. If you are using the KubernetesExecutor, Git-sync will run as an init container on your worker pods.

+
helm upgrade --install airflow apache-airflow/airflow \
+  --set dags.persistence.enabled=false \
+  --set dags.gitSync.enabled=true
+  # you can also override the other gitSync values
+  # by setting the  dags.gitSync.* values
+  # Refer values.yaml for details
+
+
+

When using apache-airflow >= 2.0.0, DAG Serialization is enabled by default, +hence Webserver does not need access to DAG files, so git-sync sidecar is not run on Webserver.

+
+
+

Notes for combining git-sync and persistence

+

While using both git-sync and persistence for DAGs is possible, it is generally not recommended unless the +deployment manager carefully considered the trade-offs it brings. There are cases when git-sync without +persistence has other trade-offs (for example delays in synchronization of DAGS vs. rate-limiting of Git +servers) that can often be mitigated (for example by sending signals to git-sync containers via web-hooks +when new commits are pushed to the repository) but there might be cases where you still might want to choose +git-sync and Persistence together, but as a Deployment Manager you should be aware of some consequences it has.

+

git-sync solution is primarily designed to be used for local, POSIX-compliant volumes to checkout Git +repositories into. Part of the process of synchronization of commits from git-sync involves checking out +new version of files in a freshly created folder and swapping symbolic links to the new folder, after the +checkout is complete. This is done to ensure that the whole DAGs folder is consistent at all times. The way +git-sync works with symbolic-link swaps, makes sure that Parsing the DAGs always work on a consistent +(single-commit-based) set of files in the whole DAG folder.

+

This approach, however might have undesirable side effects when the folder that git-sync works on is not +a local volume, but is a persistent volume (so effectively a networked, distributed volume). Depending on +the technology behind the persistent volumes might handle git-sync approach differently and with non-obvious +consequences. There are a lot of persistence solutions available for various K8S installations and each of +them has different characteristics, so you need to carefully test and monitor your filesystem to make sure +those undesired side effects do not affect you. Those effects might change over time or depend on parameters +like how often the files are being scanned by the Dag File Processor, the number and complexity of your +DAGs, how remote and how distributed your persistent volumes are, how many IOPS you allocate for some of +the filesystem (usually highly paid feature of such filesystems is how many IOPS you can get) and many other +factors.

+

The way git-sync works with symbolic links swapping generally causes a linear growth of the throughput and +potential delays in synchronization. The networking traffic from checkouts comes in bursts and the bursts +are linearly proportional to the number and size of files you have in the repository, makes it vulnerable +to pretty sudden and unexpected demand increase. Most of the persistence solution work “good enough” for +smaller/shorter burst of traffic, but when they outgrow certain thresholds, you need to upgrade the +networking to a much more capable and expensive options. This is difficult to control and impossible to +mitigate, so you might be suddenly faced with situation to pay a lot more for IOPS/persistence option to +keep your DAGs sufficiently synchronized to avoid inconsistencies and delays in synchronization.

+

The side-effects that you might observe:

+
    +

  • burst of networking/communication at the moment when new commit is checked out (because of the quick +succession of deleting old files, creating new files, symbolic link swapping.

    • +

  • temporary lack of consistency between files in DAG folders while DAGS are being synced (because of delays +in distributing changes to individual files for various nodes in the cluster)

    • +

  • visible drops of performance of the persistence solution when your DAG number grows, drops that might +amplify the side effects described above.

    • +

  • some of persistence solutions might lack filesystem functionality that git-sync needs to perform the sync +(for example changing permissions or creating symbolic links). While those can often be mitigated it is +only recommended to use git-sync with fully POSIX-filesystem compliant persistence filesystems.

    • +
+

General recommendation to use git-sync with local volumes only, and if you want to also use persistence, you +need to make sure that the persistence solution you use is POSIX-compliant and you monitor the side-effects +it might have.

+
+
+

Synchronizing multiple Git repositories with git-sync

+

Airflow git-sync integration in the Helm Chart, does not allow to configure multiple repositories to be +synchronized at the same time. The DAG folder must come from single git repository. However it is possible +to use submodules to create an “umbrella” repository +that you can use to bring a number of git repositories checked out together (with --submodules recursive +option). There are success stories of Airflow users using such approach with 100s of repositories put +together as submodules via such “umbrella” repo approach. When you choose this solution, however, +you need to work out the way how to ling the submodules, when to updated the umbrella repo when “submodule” +repository change and work out versioning approach and automate it. This might be as simple as always +using latest versions of all the submodule repositories, or as complex as managing versioning of shared +libraries, DAGs and code across multiple teams and doing that following your release process.

+

An example of such complex approach can found in this +Manage DAGs at scale presentation from the Airflow +Summit.

+
+
+
+

Mounting DAGs from an externally populated PVC

+

In this approach, Airflow will read the DAGs from a PVC which has ReadOnlyMany or ReadWriteMany access mode. You will have to ensure that the PVC is populated/updated with the required DAGs (this won’t be handled by the chart). You pass in the name of the volume claim to the chart:

+
helm upgrade --install airflow apache-airflow/airflow \
+  --set dags.persistence.enabled=true \
+  --set dags.persistence.existingClaim=my-volume-claim \
+  --set dags.gitSync.enabled=false
+
+
+
+
+

Mounting DAGs from a private GitHub repo using Git-Sync sidecar

+

Create a private repo on GitHub if you have not created one already.

+

Then create your ssh keys:

+
ssh-keygen -t rsa -b 4096 -C "your_email@example.com"
+
+
+

Add the public key to your private repo (under Settings > Deploy keys).

+

You have to convert the private ssh key to a base64 string. You can convert the private ssh key file like so:

+
base64 <my-private-ssh-key> -w 0 > temp.txt
+
+
+

Then copy the string from the temp.txt file. You’ll add it to your override-values.yaml next.

+

In this example, you will create a yaml file called override-values.yaml to override values in the +values.yaml file, instead of using --set:

+
dags:
+  gitSync:
+    enabled: true
+    repo: git@github.com:<username>/<private-repo-name>.git
+    branch: <branch-name>
+    subPath: ""
+    sshKeySecret: airflow-ssh-secret
+extraSecrets:
+  airflow-ssh-secret:
+    data: |
+      gitSshKey: '<base64-converted-ssh-private-key>'
+
+
+

Don’t forget to copy in your private key base64 string.

+

Finally, from the context of your Airflow Helm chart directory, you can install Airflow:

+
helm upgrade --install airflow apache-airflow/airflow -f override-values.yaml
+
+
+

If you have done everything correctly, Git-Sync will pick up the changes you make to the DAGs +in your private GitHub repo.

+

You should take this a step further and set dags.gitSync.knownHosts so you are not susceptible to man-in-the-middle +attacks. This process is documented in the production guide.

+
+
+ + + +
+ +
+
+
+
+
+

Was this entry helpful?

+
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+
+ +
+ + + + + + +
+ + + + + + + + + + + + + + + +
+ + + + +
+ + +
+ + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/docs-archive/helm-chart/1.14.0/manage-logs.html b/docs-archive/helm-chart/1.14.0/manage-logs.html new file mode 100644 index 00000000000..692587ac425 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/manage-logs.html @@ -0,0 +1,935 @@ + + + + + + + + + + + + Manage logs — helm-chart Documentation + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ + +
+ + +
+ + +
+
+
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+
+
+
+ +
+ + +
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+ + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+
+
+

Manage logs

+

You have a number of options when it comes to managing your Airflow logs.

+
+

No persistence

+

With this option, Airflow will log locally to each pod. As such, the logs will only be available during the lifetime of the pod.

+
helm upgrade --install airflow apache-airflow/airflow \
+  --set logs.persistence.enabled=false
+  # --set workers.persistence.enabled=false (also needed if using ``CeleryExecutor``)
+
+
+
+
+

Celery worker log persistence

+

If you are using CeleryExecutor, workers persist logs by default to a volume claim created with a volumeClaimTemplate.

+

You can modify the template:

+
helm upgrade --install airflow apache-airflow/airflow \
+  --set executor=CeleryExecutor \
+  --set workers.persistence.size=10Gi
+
+
+

Note with this option only task logs are persisted, unlike when log persistence is enabled which will also persist scheduler logs.

+
+
+

Log persistence enabled

+

This option will provision a PersistentVolumeClaim with an access mode of ReadWriteMany. Each component of Airflow will +then log onto the same volume.

+

Not all volume plugins have support for ReadWriteMany access mode. +Refer Persistent Volume Access Modes +for details.

+
helm upgrade --install airflow apache-airflow/airflow \
+  --set logs.persistence.enabled=true
+  # you can also override the other persistence
+  # by setting the logs.persistence.* values
+  # Please refer to values.yaml for details
+
+
+
+
+

Externally provisioned PVC

+

In this approach, Airflow will log to an existing ReadWriteMany PVC. You pass in the name of the volume claim to the chart.

+
helm upgrade --install airflow apache-airflow/airflow \
+  --set logs.persistence.enabled=true \
+  --set logs.persistence.existingClaim=my-volume-claim
+
+
+

Note that the volume will need to be writable by the Airflow user. The easiest way is to ensure GID 0 has write permission. +More information can be found in the Docker image entrypoint documentation.

+
+
+

Elasticsearch

+

If your cluster forwards logs to Elasticsearch, you can configure Airflow to retrieve task logs from it. +See the Elasticsearch providers guide for more details.

+
helm upgrade --install airflow apache-airflow/airflow \
+  --set elasticsearch.enabled=true \
+  --set elasticsearch.secretName=my-es-secret
+  # Other choices exist. Please refer to values.yaml for details.
+
+
+
+
+ + + +
+ +
+
+
+
+
+

Was this entry helpful?

+
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+
+ +
+ + + + + + +
+ + + + + + + + + + + + + + + +
+ + + + +
+ + +
+ + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/docs-archive/helm-chart/1.14.0/objects.inv b/docs-archive/helm-chart/1.14.0/objects.inv new file mode 100644 index 0000000000000000000000000000000000000000..ed3cca1c3097ed2e2eb4dde4c0815fe735e38908 GIT binary patch literal 904 zcmV;319$u*AX9K?X>NERX>N99Zgg*Qc_4OWa&u{KZXhxWBOp+6Z)#;@bUGktWo&IN zV`yP=bP6LNR%LQ?X>V>iATcg6G%hd-BOp|0Wgv28ZDDC{WMy(7Z)PBLXlZjGW@&6? zAZc?TV{dJ6a%FRKWn>_Ab7^j8AbM=KMy!9Kv(RM3eE;#YKjzuicQb=2EU>0D2UM} z<>wMy&82sl!V8yH)T2~{4=zx^lLBTZuR6eWM}&%5GhxTN z3IU`8XlVjP3yiV`o-Cjz74!xXyiRv(%wkIOb)t+L=m!Tx8!pgdM`~Rm%$+i+NZ*?g zbvn@v32y`+u;int({(+c9Yz)MlJYta`MhEa4T;g_*>8(caaj|q-c!|~yQ|fr7ziUR z;D)pkZ|Ko}I|(|{7wbl=#kEA%9Vk6-=k&&%D2<~Scr&vMyJs8%Uc#HP2frXYBFF$r z?+7el6PHROPFfy(Nc%tlt06*M`u%(~fK$*#T!0zw({n zdO@Y$TRFr;xFT&C9#Xm@6_Joh_M(+HVxoB$kT+5<`DAY~iw=5^$SjtZ+}c~hVy)2A z&x3i*t-Hs#-@M9WS;1$0i7EPzR)OGoq=V?r8wqjLE~f2F<|Mm2m@#+PR(#Z7P2S2* zsG} zeKoE^0ugnW4%qoz_S(fueGKSarA$Yq|KYAT!n#j0y{jUW9rdE;as%CFp+lDK{HCm8 elm=qDbo2H}|3bA_(p;e*CIL+eagBc^nuYaNkE>|_ literal 0 HcmV?d00001 diff --git a/docs-archive/helm-chart/1.14.0/output-spelling-results-helm-chart/_sphinx_design_static/design-style.1e8bd061cd6da7fc9cf755528e8ffc24.min.css b/docs-archive/helm-chart/1.14.0/output-spelling-results-helm-chart/_sphinx_design_static/design-style.1e8bd061cd6da7fc9cf755528e8ffc24.min.css new file mode 100644 index 00000000000..eb19f698afc --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/output-spelling-results-helm-chart/_sphinx_design_static/design-style.1e8bd061cd6da7fc9cf755528e8ffc24.min.css @@ -0,0 +1 @@ +.sd-bg-primary{background-color:var(--sd-color-primary) !important}.sd-bg-text-primary{color:var(--sd-color-primary-text) !important}button.sd-bg-primary:focus,button.sd-bg-primary:hover{background-color:var(--sd-color-primary-highlight) !important}a.sd-bg-primary:focus,a.sd-bg-primary:hover{background-color:var(--sd-color-primary-highlight) !important}.sd-bg-secondary{background-color:var(--sd-color-secondary) !important}.sd-bg-text-secondary{color:var(--sd-color-secondary-text) !important}button.sd-bg-secondary:focus,button.sd-bg-secondary:hover{background-color:var(--sd-color-secondary-highlight) !important}a.sd-bg-secondary:focus,a.sd-bg-secondary:hover{background-color:var(--sd-color-secondary-highlight) !important}.sd-bg-success{background-color:var(--sd-color-success) !important}.sd-bg-text-success{color:var(--sd-color-success-text) !important}button.sd-bg-success:focus,button.sd-bg-success:hover{background-color:var(--sd-color-success-highlight) !important}a.sd-bg-success:focus,a.sd-bg-success:hover{background-color:var(--sd-color-success-highlight) !important}.sd-bg-info{background-color:var(--sd-color-info) !important}.sd-bg-text-info{color:var(--sd-color-info-text) !important}button.sd-bg-info:focus,button.sd-bg-info:hover{background-color:var(--sd-color-info-highlight) !important}a.sd-bg-info:focus,a.sd-bg-info:hover{background-color:var(--sd-color-info-highlight) !important}.sd-bg-warning{background-color:var(--sd-color-warning) !important}.sd-bg-text-warning{color:var(--sd-color-warning-text) !important}button.sd-bg-warning:focus,button.sd-bg-warning:hover{background-color:var(--sd-color-warning-highlight) !important}a.sd-bg-warning:focus,a.sd-bg-warning:hover{background-color:var(--sd-color-warning-highlight) !important}.sd-bg-danger{background-color:var(--sd-color-danger) !important}.sd-bg-text-danger{color:var(--sd-color-danger-text) !important}button.sd-bg-danger:focus,button.sd-bg-danger:hover{background-color:var(--sd-color-danger-highlight) !important}a.sd-bg-danger:focus,a.sd-bg-danger:hover{background-color:var(--sd-color-danger-highlight) !important}.sd-bg-light{background-color:var(--sd-color-light) !important}.sd-bg-text-light{color:var(--sd-color-light-text) !important}button.sd-bg-light:focus,button.sd-bg-light:hover{background-color:var(--sd-color-light-highlight) !important}a.sd-bg-light:focus,a.sd-bg-light:hover{background-color:var(--sd-color-light-highlight) !important}.sd-bg-muted{background-color:var(--sd-color-muted) !important}.sd-bg-text-muted{color:var(--sd-color-muted-text) !important}button.sd-bg-muted:focus,button.sd-bg-muted:hover{background-color:var(--sd-color-muted-highlight) !important}a.sd-bg-muted:focus,a.sd-bg-muted:hover{background-color:var(--sd-color-muted-highlight) !important}.sd-bg-dark{background-color:var(--sd-color-dark) !important}.sd-bg-text-dark{color:var(--sd-color-dark-text) !important}button.sd-bg-dark:focus,button.sd-bg-dark:hover{background-color:var(--sd-color-dark-highlight) !important}a.sd-bg-dark:focus,a.sd-bg-dark:hover{background-color:var(--sd-color-dark-highlight) !important}.sd-bg-black{background-color:var(--sd-color-black) !important}.sd-bg-text-black{color:var(--sd-color-black-text) !important}button.sd-bg-black:focus,button.sd-bg-black:hover{background-color:var(--sd-color-black-highlight) !important}a.sd-bg-black:focus,a.sd-bg-black:hover{background-color:var(--sd-color-black-highlight) !important}.sd-bg-white{background-color:var(--sd-color-white) !important}.sd-bg-text-white{color:var(--sd-color-white-text) !important}button.sd-bg-white:focus,button.sd-bg-white:hover{background-color:var(--sd-color-white-highlight) !important}a.sd-bg-white:focus,a.sd-bg-white:hover{background-color:var(--sd-color-white-highlight) !important}.sd-text-primary,.sd-text-primary>p{color:var(--sd-color-primary) !important}a.sd-text-primary:focus,a.sd-text-primary:hover{color:var(--sd-color-primary-highlight) !important}.sd-text-secondary,.sd-text-secondary>p{color:var(--sd-color-secondary) !important}a.sd-text-secondary:focus,a.sd-text-secondary:hover{color:var(--sd-color-secondary-highlight) !important}.sd-text-success,.sd-text-success>p{color:var(--sd-color-success) !important}a.sd-text-success:focus,a.sd-text-success:hover{color:var(--sd-color-success-highlight) !important}.sd-text-info,.sd-text-info>p{color:var(--sd-color-info) !important}a.sd-text-info:focus,a.sd-text-info:hover{color:var(--sd-color-info-highlight) !important}.sd-text-warning,.sd-text-warning>p{color:var(--sd-color-warning) !important}a.sd-text-warning:focus,a.sd-text-warning:hover{color:var(--sd-color-warning-highlight) !important}.sd-text-danger,.sd-text-danger>p{color:var(--sd-color-danger) !important}a.sd-text-danger:focus,a.sd-text-danger:hover{color:var(--sd-color-danger-highlight) !important}.sd-text-light,.sd-text-light>p{color:var(--sd-color-light) !important}a.sd-text-light:focus,a.sd-text-light:hover{color:var(--sd-color-light-highlight) !important}.sd-text-muted,.sd-text-muted>p{color:var(--sd-color-muted) !important}a.sd-text-muted:focus,a.sd-text-muted:hover{color:var(--sd-color-muted-highlight) !important}.sd-text-dark,.sd-text-dark>p{color:var(--sd-color-dark) !important}a.sd-text-dark:focus,a.sd-text-dark:hover{color:var(--sd-color-dark-highlight) !important}.sd-text-black,.sd-text-black>p{color:var(--sd-color-black) !important}a.sd-text-black:focus,a.sd-text-black:hover{color:var(--sd-color-black-highlight) !important}.sd-text-white,.sd-text-white>p{color:var(--sd-color-white) !important}a.sd-text-white:focus,a.sd-text-white:hover{color:var(--sd-color-white-highlight) !important}.sd-outline-primary{border-color:var(--sd-color-primary) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-primary:focus,a.sd-outline-primary:hover{border-color:var(--sd-color-primary-highlight) !important}.sd-outline-secondary{border-color:var(--sd-color-secondary) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-secondary:focus,a.sd-outline-secondary:hover{border-color:var(--sd-color-secondary-highlight) !important}.sd-outline-success{border-color:var(--sd-color-success) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-success:focus,a.sd-outline-success:hover{border-color:var(--sd-color-success-highlight) !important}.sd-outline-info{border-color:var(--sd-color-info) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-info:focus,a.sd-outline-info:hover{border-color:var(--sd-color-info-highlight) !important}.sd-outline-warning{border-color:var(--sd-color-warning) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-warning:focus,a.sd-outline-warning:hover{border-color:var(--sd-color-warning-highlight) !important}.sd-outline-danger{border-color:var(--sd-color-danger) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-danger:focus,a.sd-outline-danger:hover{border-color:var(--sd-color-danger-highlight) !important}.sd-outline-light{border-color:var(--sd-color-light) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-light:focus,a.sd-outline-light:hover{border-color:var(--sd-color-light-highlight) !important}.sd-outline-muted{border-color:var(--sd-color-muted) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-muted:focus,a.sd-outline-muted:hover{border-color:var(--sd-color-muted-highlight) !important}.sd-outline-dark{border-color:var(--sd-color-dark) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-dark:focus,a.sd-outline-dark:hover{border-color:var(--sd-color-dark-highlight) !important}.sd-outline-black{border-color:var(--sd-color-black) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-black:focus,a.sd-outline-black:hover{border-color:var(--sd-color-black-highlight) !important}.sd-outline-white{border-color:var(--sd-color-white) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-white:focus,a.sd-outline-white:hover{border-color:var(--sd-color-white-highlight) !important}.sd-bg-transparent{background-color:transparent !important}.sd-outline-transparent{border-color:transparent !important}.sd-text-transparent{color:transparent !important}.sd-p-0{padding:0 !important}.sd-pt-0,.sd-py-0{padding-top:0 !important}.sd-pr-0,.sd-px-0{padding-right:0 !important}.sd-pb-0,.sd-py-0{padding-bottom:0 !important}.sd-pl-0,.sd-px-0{padding-left:0 !important}.sd-p-1{padding:.25rem !important}.sd-pt-1,.sd-py-1{padding-top:.25rem !important}.sd-pr-1,.sd-px-1{padding-right:.25rem !important}.sd-pb-1,.sd-py-1{padding-bottom:.25rem !important}.sd-pl-1,.sd-px-1{padding-left:.25rem !important}.sd-p-2{padding:.5rem !important}.sd-pt-2,.sd-py-2{padding-top:.5rem !important}.sd-pr-2,.sd-px-2{padding-right:.5rem !important}.sd-pb-2,.sd-py-2{padding-bottom:.5rem !important}.sd-pl-2,.sd-px-2{padding-left:.5rem !important}.sd-p-3{padding:1rem !important}.sd-pt-3,.sd-py-3{padding-top:1rem !important}.sd-pr-3,.sd-px-3{padding-right:1rem !important}.sd-pb-3,.sd-py-3{padding-bottom:1rem !important}.sd-pl-3,.sd-px-3{padding-left:1rem !important}.sd-p-4{padding:1.5rem !important}.sd-pt-4,.sd-py-4{padding-top:1.5rem !important}.sd-pr-4,.sd-px-4{padding-right:1.5rem !important}.sd-pb-4,.sd-py-4{padding-bottom:1.5rem !important}.sd-pl-4,.sd-px-4{padding-left:1.5rem !important}.sd-p-5{padding:3rem !important}.sd-pt-5,.sd-py-5{padding-top:3rem !important}.sd-pr-5,.sd-px-5{padding-right:3rem !important}.sd-pb-5,.sd-py-5{padding-bottom:3rem !important}.sd-pl-5,.sd-px-5{padding-left:3rem !important}.sd-m-auto{margin:auto !important}.sd-mt-auto,.sd-my-auto{margin-top:auto !important}.sd-mr-auto,.sd-mx-auto{margin-right:auto !important}.sd-mb-auto,.sd-my-auto{margin-bottom:auto !important}.sd-ml-auto,.sd-mx-auto{margin-left:auto !important}.sd-m-0{margin:0 !important}.sd-mt-0,.sd-my-0{margin-top:0 !important}.sd-mr-0,.sd-mx-0{margin-right:0 !important}.sd-mb-0,.sd-my-0{margin-bottom:0 !important}.sd-ml-0,.sd-mx-0{margin-left:0 !important}.sd-m-1{margin:.25rem !important}.sd-mt-1,.sd-my-1{margin-top:.25rem !important}.sd-mr-1,.sd-mx-1{margin-right:.25rem !important}.sd-mb-1,.sd-my-1{margin-bottom:.25rem !important}.sd-ml-1,.sd-mx-1{margin-left:.25rem !important}.sd-m-2{margin:.5rem !important}.sd-mt-2,.sd-my-2{margin-top:.5rem !important}.sd-mr-2,.sd-mx-2{margin-right:.5rem !important}.sd-mb-2,.sd-my-2{margin-bottom:.5rem !important}.sd-ml-2,.sd-mx-2{margin-left:.5rem !important}.sd-m-3{margin:1rem !important}.sd-mt-3,.sd-my-3{margin-top:1rem !important}.sd-mr-3,.sd-mx-3{margin-right:1rem !important}.sd-mb-3,.sd-my-3{margin-bottom:1rem !important}.sd-ml-3,.sd-mx-3{margin-left:1rem !important}.sd-m-4{margin:1.5rem !important}.sd-mt-4,.sd-my-4{margin-top:1.5rem !important}.sd-mr-4,.sd-mx-4{margin-right:1.5rem !important}.sd-mb-4,.sd-my-4{margin-bottom:1.5rem !important}.sd-ml-4,.sd-mx-4{margin-left:1.5rem !important}.sd-m-5{margin:3rem !important}.sd-mt-5,.sd-my-5{margin-top:3rem !important}.sd-mr-5,.sd-mx-5{margin-right:3rem !important}.sd-mb-5,.sd-my-5{margin-bottom:3rem !important}.sd-ml-5,.sd-mx-5{margin-left:3rem !important}.sd-w-25{width:25% !important}.sd-w-50{width:50% !important}.sd-w-75{width:75% !important}.sd-w-100{width:100% !important}.sd-w-auto{width:auto !important}.sd-h-25{height:25% !important}.sd-h-50{height:50% !important}.sd-h-75{height:75% !important}.sd-h-100{height:100% !important}.sd-h-auto{height:auto !important}.sd-d-none{display:none !important}.sd-d-inline{display:inline !important}.sd-d-inline-block{display:inline-block !important}.sd-d-block{display:block !important}.sd-d-grid{display:grid !important}.sd-d-flex-row{display:-ms-flexbox !important;display:flex !important;flex-direction:row !important}.sd-d-flex-column{display:-ms-flexbox !important;display:flex !important;flex-direction:column !important}.sd-d-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}@media(min-width: 576px){.sd-d-sm-none{display:none !important}.sd-d-sm-inline{display:inline !important}.sd-d-sm-inline-block{display:inline-block !important}.sd-d-sm-block{display:block !important}.sd-d-sm-grid{display:grid !important}.sd-d-sm-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-sm-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 768px){.sd-d-md-none{display:none !important}.sd-d-md-inline{display:inline !important}.sd-d-md-inline-block{display:inline-block !important}.sd-d-md-block{display:block !important}.sd-d-md-grid{display:grid !important}.sd-d-md-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-md-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 992px){.sd-d-lg-none{display:none !important}.sd-d-lg-inline{display:inline !important}.sd-d-lg-inline-block{display:inline-block !important}.sd-d-lg-block{display:block !important}.sd-d-lg-grid{display:grid !important}.sd-d-lg-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-lg-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 1200px){.sd-d-xl-none{display:none !important}.sd-d-xl-inline{display:inline !important}.sd-d-xl-inline-block{display:inline-block !important}.sd-d-xl-block{display:block !important}.sd-d-xl-grid{display:grid !important}.sd-d-xl-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-xl-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}.sd-align-major-start{justify-content:flex-start !important}.sd-align-major-end{justify-content:flex-end !important}.sd-align-major-center{justify-content:center !important}.sd-align-major-justify{justify-content:space-between !important}.sd-align-major-spaced{justify-content:space-evenly !important}.sd-align-minor-start{align-items:flex-start !important}.sd-align-minor-end{align-items:flex-end !important}.sd-align-minor-center{align-items:center !important}.sd-align-minor-stretch{align-items:stretch !important}.sd-text-justify{text-align:justify !important}.sd-text-left{text-align:left !important}.sd-text-right{text-align:right !important}.sd-text-center{text-align:center !important}.sd-font-weight-light{font-weight:300 !important}.sd-font-weight-lighter{font-weight:lighter !important}.sd-font-weight-normal{font-weight:400 !important}.sd-font-weight-bold{font-weight:700 !important}.sd-font-weight-bolder{font-weight:bolder !important}.sd-font-italic{font-style:italic !important}.sd-text-decoration-none{text-decoration:none !important}.sd-text-lowercase{text-transform:lowercase !important}.sd-text-uppercase{text-transform:uppercase !important}.sd-text-capitalize{text-transform:capitalize !important}.sd-text-wrap{white-space:normal !important}.sd-text-nowrap{white-space:nowrap !important}.sd-text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.sd-fs-1,.sd-fs-1>p{font-size:calc(1.375rem + 1.5vw) !important;line-height:unset !important}.sd-fs-2,.sd-fs-2>p{font-size:calc(1.325rem + 0.9vw) !important;line-height:unset !important}.sd-fs-3,.sd-fs-3>p{font-size:calc(1.3rem + 0.6vw) !important;line-height:unset !important}.sd-fs-4,.sd-fs-4>p{font-size:calc(1.275rem + 0.3vw) !important;line-height:unset !important}.sd-fs-5,.sd-fs-5>p{font-size:1.25rem !important;line-height:unset !important}.sd-fs-6,.sd-fs-6>p{font-size:1rem !important;line-height:unset !important}.sd-border-0{border:0 solid !important}.sd-border-top-0{border-top:0 solid !important}.sd-border-bottom-0{border-bottom:0 solid !important}.sd-border-right-0{border-right:0 solid !important}.sd-border-left-0{border-left:0 solid !important}.sd-border-1{border:1px solid !important}.sd-border-top-1{border-top:1px solid !important}.sd-border-bottom-1{border-bottom:1px solid !important}.sd-border-right-1{border-right:1px solid !important}.sd-border-left-1{border-left:1px solid !important}.sd-border-2{border:2px solid !important}.sd-border-top-2{border-top:2px solid !important}.sd-border-bottom-2{border-bottom:2px solid !important}.sd-border-right-2{border-right:2px solid !important}.sd-border-left-2{border-left:2px solid !important}.sd-border-3{border:3px solid !important}.sd-border-top-3{border-top:3px solid !important}.sd-border-bottom-3{border-bottom:3px solid !important}.sd-border-right-3{border-right:3px solid !important}.sd-border-left-3{border-left:3px solid !important}.sd-border-4{border:4px solid !important}.sd-border-top-4{border-top:4px solid !important}.sd-border-bottom-4{border-bottom:4px solid !important}.sd-border-right-4{border-right:4px solid !important}.sd-border-left-4{border-left:4px solid !important}.sd-border-5{border:5px solid !important}.sd-border-top-5{border-top:5px solid !important}.sd-border-bottom-5{border-bottom:5px solid !important}.sd-border-right-5{border-right:5px solid !important}.sd-border-left-5{border-left:5px solid !important}.sd-rounded-0{border-radius:0 !important}.sd-rounded-1{border-radius:.2rem !important}.sd-rounded-2{border-radius:.3rem !important}.sd-rounded-3{border-radius:.5rem !important}.sd-rounded-pill{border-radius:50rem !important}.sd-rounded-circle{border-radius:50% !important}.shadow-none{box-shadow:none !important}.sd-shadow-sm{box-shadow:0 .125rem .25rem var(--sd-color-shadow) !important}.sd-shadow-md{box-shadow:0 .5rem 1rem var(--sd-color-shadow) !important}.sd-shadow-lg{box-shadow:0 1rem 3rem var(--sd-color-shadow) !important}@keyframes sd-slide-from-left{0%{transform:translateX(-100%)}100%{transform:translateX(0)}}@keyframes sd-slide-from-right{0%{transform:translateX(200%)}100%{transform:translateX(0)}}@keyframes sd-grow100{0%{transform:scale(0);opacity:.5}100%{transform:scale(1);opacity:1}}@keyframes sd-grow50{0%{transform:scale(0.5);opacity:.5}100%{transform:scale(1);opacity:1}}@keyframes sd-grow50-rot20{0%{transform:scale(0.5) rotateZ(-20deg);opacity:.5}75%{transform:scale(1) rotateZ(5deg);opacity:1}95%{transform:scale(1) rotateZ(-1deg);opacity:1}100%{transform:scale(1) rotateZ(0);opacity:1}}.sd-animate-slide-from-left{animation:1s ease-out 0s 1 normal none running sd-slide-from-left}.sd-animate-slide-from-right{animation:1s ease-out 0s 1 normal none running sd-slide-from-right}.sd-animate-grow100{animation:1s ease-out 0s 1 normal none running sd-grow100}.sd-animate-grow50{animation:1s ease-out 0s 1 normal none running sd-grow50}.sd-animate-grow50-rot20{animation:1s ease-out 0s 1 normal none running sd-grow50-rot20}.sd-badge{display:inline-block;padding:.35em .65em;font-size:.75em;font-weight:700;line-height:1;text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:.25rem}.sd-badge:empty{display:none}a.sd-badge{text-decoration:none}.sd-btn .sd-badge{position:relative;top:-1px}.sd-btn{background-color:transparent;border:1px solid transparent;border-radius:.25rem;cursor:pointer;display:inline-block;font-weight:400;font-size:1rem;line-height:1.5;padding:.375rem .75rem;text-align:center;text-decoration:none;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;vertical-align:middle;user-select:none;-moz-user-select:none;-ms-user-select:none;-webkit-user-select:none}.sd-btn:hover{text-decoration:none}@media(prefers-reduced-motion: reduce){.sd-btn{transition:none}}.sd-btn-primary,.sd-btn-outline-primary:hover,.sd-btn-outline-primary:focus{color:var(--sd-color-primary-text) !important;background-color:var(--sd-color-primary) !important;border-color:var(--sd-color-primary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-primary:hover,.sd-btn-primary:focus{color:var(--sd-color-primary-text) !important;background-color:var(--sd-color-primary-highlight) !important;border-color:var(--sd-color-primary-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-primary{color:var(--sd-color-primary) !important;border-color:var(--sd-color-primary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-secondary,.sd-btn-outline-secondary:hover,.sd-btn-outline-secondary:focus{color:var(--sd-color-secondary-text) !important;background-color:var(--sd-color-secondary) !important;border-color:var(--sd-color-secondary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-secondary:hover,.sd-btn-secondary:focus{color:var(--sd-color-secondary-text) !important;background-color:var(--sd-color-secondary-highlight) !important;border-color:var(--sd-color-secondary-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-secondary{color:var(--sd-color-secondary) !important;border-color:var(--sd-color-secondary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-success,.sd-btn-outline-success:hover,.sd-btn-outline-success:focus{color:var(--sd-color-success-text) !important;background-color:var(--sd-color-success) !important;border-color:var(--sd-color-success) !important;border-width:1px !important;border-style:solid !important}.sd-btn-success:hover,.sd-btn-success:focus{color:var(--sd-color-success-text) !important;background-color:var(--sd-color-success-highlight) !important;border-color:var(--sd-color-success-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-success{color:var(--sd-color-success) !important;border-color:var(--sd-color-success) !important;border-width:1px !important;border-style:solid !important}.sd-btn-info,.sd-btn-outline-info:hover,.sd-btn-outline-info:focus{color:var(--sd-color-info-text) !important;background-color:var(--sd-color-info) !important;border-color:var(--sd-color-info) !important;border-width:1px !important;border-style:solid !important}.sd-btn-info:hover,.sd-btn-info:focus{color:var(--sd-color-info-text) !important;background-color:var(--sd-color-info-highlight) !important;border-color:var(--sd-color-info-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-info{color:var(--sd-color-info) !important;border-color:var(--sd-color-info) !important;border-width:1px !important;border-style:solid !important}.sd-btn-warning,.sd-btn-outline-warning:hover,.sd-btn-outline-warning:focus{color:var(--sd-color-warning-text) !important;background-color:var(--sd-color-warning) !important;border-color:var(--sd-color-warning) !important;border-width:1px !important;border-style:solid !important}.sd-btn-warning:hover,.sd-btn-warning:focus{color:var(--sd-color-warning-text) !important;background-color:var(--sd-color-warning-highlight) !important;border-color:var(--sd-color-warning-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-warning{color:var(--sd-color-warning) !important;border-color:var(--sd-color-warning) !important;border-width:1px !important;border-style:solid !important}.sd-btn-danger,.sd-btn-outline-danger:hover,.sd-btn-outline-danger:focus{color:var(--sd-color-danger-text) !important;background-color:var(--sd-color-danger) !important;border-color:var(--sd-color-danger) !important;border-width:1px !important;border-style:solid !important}.sd-btn-danger:hover,.sd-btn-danger:focus{color:var(--sd-color-danger-text) !important;background-color:var(--sd-color-danger-highlight) !important;border-color:var(--sd-color-danger-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-danger{color:var(--sd-color-danger) !important;border-color:var(--sd-color-danger) !important;border-width:1px !important;border-style:solid !important}.sd-btn-light,.sd-btn-outline-light:hover,.sd-btn-outline-light:focus{color:var(--sd-color-light-text) !important;background-color:var(--sd-color-light) !important;border-color:var(--sd-color-light) !important;border-width:1px !important;border-style:solid !important}.sd-btn-light:hover,.sd-btn-light:focus{color:var(--sd-color-light-text) !important;background-color:var(--sd-color-light-highlight) !important;border-color:var(--sd-color-light-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-light{color:var(--sd-color-light) !important;border-color:var(--sd-color-light) !important;border-width:1px !important;border-style:solid !important}.sd-btn-muted,.sd-btn-outline-muted:hover,.sd-btn-outline-muted:focus{color:var(--sd-color-muted-text) !important;background-color:var(--sd-color-muted) !important;border-color:var(--sd-color-muted) !important;border-width:1px !important;border-style:solid !important}.sd-btn-muted:hover,.sd-btn-muted:focus{color:var(--sd-color-muted-text) !important;background-color:var(--sd-color-muted-highlight) !important;border-color:var(--sd-color-muted-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-muted{color:var(--sd-color-muted) !important;border-color:var(--sd-color-muted) !important;border-width:1px !important;border-style:solid !important}.sd-btn-dark,.sd-btn-outline-dark:hover,.sd-btn-outline-dark:focus{color:var(--sd-color-dark-text) !important;background-color:var(--sd-color-dark) !important;border-color:var(--sd-color-dark) !important;border-width:1px !important;border-style:solid !important}.sd-btn-dark:hover,.sd-btn-dark:focus{color:var(--sd-color-dark-text) !important;background-color:var(--sd-color-dark-highlight) !important;border-color:var(--sd-color-dark-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-dark{color:var(--sd-color-dark) !important;border-color:var(--sd-color-dark) !important;border-width:1px !important;border-style:solid !important}.sd-btn-black,.sd-btn-outline-black:hover,.sd-btn-outline-black:focus{color:var(--sd-color-black-text) !important;background-color:var(--sd-color-black) !important;border-color:var(--sd-color-black) !important;border-width:1px !important;border-style:solid !important}.sd-btn-black:hover,.sd-btn-black:focus{color:var(--sd-color-black-text) !important;background-color:var(--sd-color-black-highlight) !important;border-color:var(--sd-color-black-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-black{color:var(--sd-color-black) !important;border-color:var(--sd-color-black) !important;border-width:1px !important;border-style:solid !important}.sd-btn-white,.sd-btn-outline-white:hover,.sd-btn-outline-white:focus{color:var(--sd-color-white-text) !important;background-color:var(--sd-color-white) !important;border-color:var(--sd-color-white) !important;border-width:1px !important;border-style:solid !important}.sd-btn-white:hover,.sd-btn-white:focus{color:var(--sd-color-white-text) !important;background-color:var(--sd-color-white-highlight) !important;border-color:var(--sd-color-white-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-white{color:var(--sd-color-white) !important;border-color:var(--sd-color-white) !important;border-width:1px !important;border-style:solid !important}.sd-stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.sd-hide-link-text{font-size:0}.sd-octicon,.sd-material-icon{display:inline-block;fill:currentColor;vertical-align:middle}.sd-avatar-xs{border-radius:50%;object-fit:cover;object-position:center;width:1rem;height:1rem}.sd-avatar-sm{border-radius:50%;object-fit:cover;object-position:center;width:3rem;height:3rem}.sd-avatar-md{border-radius:50%;object-fit:cover;object-position:center;width:5rem;height:5rem}.sd-avatar-lg{border-radius:50%;object-fit:cover;object-position:center;width:7rem;height:7rem}.sd-avatar-xl{border-radius:50%;object-fit:cover;object-position:center;width:10rem;height:10rem}.sd-avatar-inherit{border-radius:50%;object-fit:cover;object-position:center;width:inherit;height:inherit}.sd-avatar-initial{border-radius:50%;object-fit:cover;object-position:center;width:initial;height:initial}.sd-card{background-clip:border-box;background-color:var(--sd-color-card-background);border:1px solid var(--sd-color-card-border);border-radius:.25rem;color:var(--sd-color-card-text);display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;min-width:0;position:relative;word-wrap:break-word}.sd-card>hr{margin-left:0;margin-right:0}.sd-card-hover:hover{border-color:var(--sd-color-card-border-hover);transform:scale(1.01)}.sd-card-body{-ms-flex:1 1 auto;flex:1 1 auto;padding:1rem 1rem}.sd-card-title{margin-bottom:.5rem}.sd-card-subtitle{margin-top:-0.25rem;margin-bottom:0}.sd-card-text:last-child{margin-bottom:0}.sd-card-link:hover{text-decoration:none}.sd-card-link+.card-link{margin-left:1rem}.sd-card-header{padding:.5rem 1rem;margin-bottom:0;background-color:var(--sd-color-card-header);border-bottom:1px solid var(--sd-color-card-border)}.sd-card-header:first-child{border-radius:calc(0.25rem - 1px) calc(0.25rem - 1px) 0 0}.sd-card-footer{padding:.5rem 1rem;background-color:var(--sd-color-card-footer);border-top:1px solid var(--sd-color-card-border)}.sd-card-footer:last-child{border-radius:0 0 calc(0.25rem - 1px) calc(0.25rem - 1px)}.sd-card-header-tabs{margin-right:-0.5rem;margin-bottom:-0.5rem;margin-left:-0.5rem;border-bottom:0}.sd-card-header-pills{margin-right:-0.5rem;margin-left:-0.5rem}.sd-card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:1rem;border-radius:calc(0.25rem - 1px)}.sd-card-img,.sd-card-img-bottom,.sd-card-img-top{width:100%}.sd-card-img,.sd-card-img-top{border-top-left-radius:calc(0.25rem - 1px);border-top-right-radius:calc(0.25rem - 1px)}.sd-card-img,.sd-card-img-bottom{border-bottom-left-radius:calc(0.25rem - 1px);border-bottom-right-radius:calc(0.25rem - 1px)}.sd-cards-carousel{width:100%;display:flex;flex-wrap:nowrap;-ms-flex-direction:row;flex-direction:row;overflow-x:hidden;scroll-snap-type:x mandatory}.sd-cards-carousel.sd-show-scrollbar{overflow-x:auto}.sd-cards-carousel:hover,.sd-cards-carousel:focus{overflow-x:auto}.sd-cards-carousel>.sd-card{flex-shrink:0;scroll-snap-align:start}.sd-cards-carousel>.sd-card:not(:last-child){margin-right:3px}.sd-card-cols-1>.sd-card{width:90%}.sd-card-cols-2>.sd-card{width:45%}.sd-card-cols-3>.sd-card{width:30%}.sd-card-cols-4>.sd-card{width:22.5%}.sd-card-cols-5>.sd-card{width:18%}.sd-card-cols-6>.sd-card{width:15%}.sd-card-cols-7>.sd-card{width:12.8571428571%}.sd-card-cols-8>.sd-card{width:11.25%}.sd-card-cols-9>.sd-card{width:10%}.sd-card-cols-10>.sd-card{width:9%}.sd-card-cols-11>.sd-card{width:8.1818181818%}.sd-card-cols-12>.sd-card{width:7.5%}.sd-container,.sd-container-fluid,.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container-xl{margin-left:auto;margin-right:auto;padding-left:var(--sd-gutter-x, 0.75rem);padding-right:var(--sd-gutter-x, 0.75rem);width:100%}@media(min-width: 576px){.sd-container-sm,.sd-container{max-width:540px}}@media(min-width: 768px){.sd-container-md,.sd-container-sm,.sd-container{max-width:720px}}@media(min-width: 992px){.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container{max-width:960px}}@media(min-width: 1200px){.sd-container-xl,.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container{max-width:1140px}}.sd-row{--sd-gutter-x: 1.5rem;--sd-gutter-y: 0;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-top:calc(var(--sd-gutter-y) * -1);margin-right:calc(var(--sd-gutter-x) * -0.5);margin-left:calc(var(--sd-gutter-x) * -0.5)}.sd-row>*{box-sizing:border-box;flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--sd-gutter-x) * 0.5);padding-left:calc(var(--sd-gutter-x) * 0.5);margin-top:var(--sd-gutter-y)}.sd-col{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-auto>*{flex:0 0 auto;width:auto}.sd-row-cols-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}@media(min-width: 576px){.sd-col-sm{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-sm-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-sm-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-sm-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-sm-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-sm-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-sm-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-sm-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-sm-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-sm-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-sm-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-sm-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-sm-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-sm-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 768px){.sd-col-md{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-md-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-md-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-md-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-md-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-md-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-md-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-md-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-md-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-md-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-md-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-md-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-md-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-md-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 992px){.sd-col-lg{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-lg-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-lg-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-lg-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-lg-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-lg-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-lg-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-lg-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-lg-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-lg-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-lg-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-lg-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-lg-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-lg-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 1200px){.sd-col-xl{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-xl-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-xl-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-xl-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-xl-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-xl-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-xl-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-xl-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-xl-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-xl-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-xl-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-xl-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-xl-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-xl-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}.sd-col-auto{flex:0 0 auto;-ms-flex:0 0 auto;width:auto}.sd-col-1{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}.sd-col-2{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-col-3{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-col-4{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-col-5{flex:0 0 auto;-ms-flex:0 0 auto;width:41.6666666667%}.sd-col-6{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-col-7{flex:0 0 auto;-ms-flex:0 0 auto;width:58.3333333333%}.sd-col-8{flex:0 0 auto;-ms-flex:0 0 auto;width:66.6666666667%}.sd-col-9{flex:0 0 auto;-ms-flex:0 0 auto;width:75%}.sd-col-10{flex:0 0 auto;-ms-flex:0 0 auto;width:83.3333333333%}.sd-col-11{flex:0 0 auto;-ms-flex:0 0 auto;width:91.6666666667%}.sd-col-12{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-g-0,.sd-gy-0{--sd-gutter-y: 0}.sd-g-0,.sd-gx-0{--sd-gutter-x: 0}.sd-g-1,.sd-gy-1{--sd-gutter-y: 0.25rem}.sd-g-1,.sd-gx-1{--sd-gutter-x: 0.25rem}.sd-g-2,.sd-gy-2{--sd-gutter-y: 0.5rem}.sd-g-2,.sd-gx-2{--sd-gutter-x: 0.5rem}.sd-g-3,.sd-gy-3{--sd-gutter-y: 1rem}.sd-g-3,.sd-gx-3{--sd-gutter-x: 1rem}.sd-g-4,.sd-gy-4{--sd-gutter-y: 1.5rem}.sd-g-4,.sd-gx-4{--sd-gutter-x: 1.5rem}.sd-g-5,.sd-gy-5{--sd-gutter-y: 3rem}.sd-g-5,.sd-gx-5{--sd-gutter-x: 3rem}@media(min-width: 576px){.sd-col-sm-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-sm-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-sm-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-sm-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-sm-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-sm-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-sm-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-sm-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-sm-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-sm-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-sm-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-sm-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-sm-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-sm-0,.sd-gy-sm-0{--sd-gutter-y: 0}.sd-g-sm-0,.sd-gx-sm-0{--sd-gutter-x: 0}.sd-g-sm-1,.sd-gy-sm-1{--sd-gutter-y: 0.25rem}.sd-g-sm-1,.sd-gx-sm-1{--sd-gutter-x: 0.25rem}.sd-g-sm-2,.sd-gy-sm-2{--sd-gutter-y: 0.5rem}.sd-g-sm-2,.sd-gx-sm-2{--sd-gutter-x: 0.5rem}.sd-g-sm-3,.sd-gy-sm-3{--sd-gutter-y: 1rem}.sd-g-sm-3,.sd-gx-sm-3{--sd-gutter-x: 1rem}.sd-g-sm-4,.sd-gy-sm-4{--sd-gutter-y: 1.5rem}.sd-g-sm-4,.sd-gx-sm-4{--sd-gutter-x: 1.5rem}.sd-g-sm-5,.sd-gy-sm-5{--sd-gutter-y: 3rem}.sd-g-sm-5,.sd-gx-sm-5{--sd-gutter-x: 3rem}}@media(min-width: 768px){.sd-col-md-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-md-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-md-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-md-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-md-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-md-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-md-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-md-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-md-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-md-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-md-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-md-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-md-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-md-0,.sd-gy-md-0{--sd-gutter-y: 0}.sd-g-md-0,.sd-gx-md-0{--sd-gutter-x: 0}.sd-g-md-1,.sd-gy-md-1{--sd-gutter-y: 0.25rem}.sd-g-md-1,.sd-gx-md-1{--sd-gutter-x: 0.25rem}.sd-g-md-2,.sd-gy-md-2{--sd-gutter-y: 0.5rem}.sd-g-md-2,.sd-gx-md-2{--sd-gutter-x: 0.5rem}.sd-g-md-3,.sd-gy-md-3{--sd-gutter-y: 1rem}.sd-g-md-3,.sd-gx-md-3{--sd-gutter-x: 1rem}.sd-g-md-4,.sd-gy-md-4{--sd-gutter-y: 1.5rem}.sd-g-md-4,.sd-gx-md-4{--sd-gutter-x: 1.5rem}.sd-g-md-5,.sd-gy-md-5{--sd-gutter-y: 3rem}.sd-g-md-5,.sd-gx-md-5{--sd-gutter-x: 3rem}}@media(min-width: 992px){.sd-col-lg-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-lg-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-lg-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-lg-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-lg-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-lg-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-lg-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-lg-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-lg-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-lg-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-lg-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-lg-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-lg-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-lg-0,.sd-gy-lg-0{--sd-gutter-y: 0}.sd-g-lg-0,.sd-gx-lg-0{--sd-gutter-x: 0}.sd-g-lg-1,.sd-gy-lg-1{--sd-gutter-y: 0.25rem}.sd-g-lg-1,.sd-gx-lg-1{--sd-gutter-x: 0.25rem}.sd-g-lg-2,.sd-gy-lg-2{--sd-gutter-y: 0.5rem}.sd-g-lg-2,.sd-gx-lg-2{--sd-gutter-x: 0.5rem}.sd-g-lg-3,.sd-gy-lg-3{--sd-gutter-y: 1rem}.sd-g-lg-3,.sd-gx-lg-3{--sd-gutter-x: 1rem}.sd-g-lg-4,.sd-gy-lg-4{--sd-gutter-y: 1.5rem}.sd-g-lg-4,.sd-gx-lg-4{--sd-gutter-x: 1.5rem}.sd-g-lg-5,.sd-gy-lg-5{--sd-gutter-y: 3rem}.sd-g-lg-5,.sd-gx-lg-5{--sd-gutter-x: 3rem}}@media(min-width: 1200px){.sd-col-xl-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-xl-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-xl-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-xl-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-xl-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-xl-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-xl-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-xl-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-xl-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-xl-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-xl-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-xl-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-xl-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-xl-0,.sd-gy-xl-0{--sd-gutter-y: 0}.sd-g-xl-0,.sd-gx-xl-0{--sd-gutter-x: 0}.sd-g-xl-1,.sd-gy-xl-1{--sd-gutter-y: 0.25rem}.sd-g-xl-1,.sd-gx-xl-1{--sd-gutter-x: 0.25rem}.sd-g-xl-2,.sd-gy-xl-2{--sd-gutter-y: 0.5rem}.sd-g-xl-2,.sd-gx-xl-2{--sd-gutter-x: 0.5rem}.sd-g-xl-3,.sd-gy-xl-3{--sd-gutter-y: 1rem}.sd-g-xl-3,.sd-gx-xl-3{--sd-gutter-x: 1rem}.sd-g-xl-4,.sd-gy-xl-4{--sd-gutter-y: 1.5rem}.sd-g-xl-4,.sd-gx-xl-4{--sd-gutter-x: 1.5rem}.sd-g-xl-5,.sd-gy-xl-5{--sd-gutter-y: 3rem}.sd-g-xl-5,.sd-gx-xl-5{--sd-gutter-x: 3rem}}.sd-flex-row-reverse{flex-direction:row-reverse !important}details.sd-dropdown{position:relative}details.sd-dropdown .sd-summary-title{font-weight:700;padding-right:3em !important;-moz-user-select:none;-ms-user-select:none;-webkit-user-select:none;user-select:none}details.sd-dropdown:hover{cursor:pointer}details.sd-dropdown .sd-summary-content{cursor:default}details.sd-dropdown summary{list-style:none;padding:1em}details.sd-dropdown summary .sd-octicon.no-title{vertical-align:middle}details.sd-dropdown[open] summary .sd-octicon.no-title{visibility:hidden}details.sd-dropdown summary::-webkit-details-marker{display:none}details.sd-dropdown summary:focus{outline:none}details.sd-dropdown .sd-summary-icon{margin-right:.5em}details.sd-dropdown .sd-summary-icon svg{opacity:.8}details.sd-dropdown summary:hover .sd-summary-up svg,details.sd-dropdown summary:hover .sd-summary-down svg{opacity:1;transform:scale(1.1)}details.sd-dropdown .sd-summary-up svg,details.sd-dropdown .sd-summary-down svg{display:block;opacity:.6}details.sd-dropdown .sd-summary-up,details.sd-dropdown .sd-summary-down{pointer-events:none;position:absolute;right:1em;top:1em}details.sd-dropdown[open]>.sd-summary-title .sd-summary-down{visibility:hidden}details.sd-dropdown:not([open])>.sd-summary-title .sd-summary-up{visibility:hidden}details.sd-dropdown:not([open]).sd-card{border:none}details.sd-dropdown:not([open])>.sd-card-header{border:1px solid var(--sd-color-card-border);border-radius:.25rem}details.sd-dropdown.sd-fade-in[open] summary~*{-moz-animation:sd-fade-in .5s ease-in-out;-webkit-animation:sd-fade-in .5s ease-in-out;animation:sd-fade-in .5s ease-in-out}details.sd-dropdown.sd-fade-in-slide-down[open] summary~*{-moz-animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out;-webkit-animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out;animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out}.sd-col>.sd-dropdown{width:100%}.sd-summary-content>.sd-tab-set:first-child{margin-top:0}@keyframes sd-fade-in{0%{opacity:0}100%{opacity:1}}@keyframes sd-slide-down{0%{transform:translate(0, -10px)}100%{transform:translate(0, 0)}}.sd-tab-set{border-radius:.125rem;display:flex;flex-wrap:wrap;margin:1em 0;position:relative}.sd-tab-set>input{opacity:0;position:absolute}.sd-tab-set>input:checked+label{border-color:var(--sd-color-tabs-underline-active);color:var(--sd-color-tabs-label-active)}.sd-tab-set>input:checked+label+.sd-tab-content{display:block}.sd-tab-set>input:not(:checked)+label:hover{color:var(--sd-color-tabs-label-hover);border-color:var(--sd-color-tabs-underline-hover)}.sd-tab-set>input:focus+label{outline-style:auto}.sd-tab-set>input:not(.focus-visible)+label{outline:none;-webkit-tap-highlight-color:transparent}.sd-tab-set>label{border-bottom:.125rem solid transparent;margin-bottom:0;color:var(--sd-color-tabs-label-inactive);border-color:var(--sd-color-tabs-underline-inactive);cursor:pointer;font-size:var(--sd-fontsize-tabs-label);font-weight:700;padding:1em 1.25em .5em;transition:color 250ms;width:auto;z-index:1}html .sd-tab-set>label:hover{color:var(--sd-color-tabs-label-active)}.sd-col>.sd-tab-set{width:100%}.sd-tab-content{box-shadow:0 -0.0625rem var(--sd-color-tabs-overline),0 .0625rem var(--sd-color-tabs-underline);display:none;order:99;padding-bottom:.75rem;padding-top:.75rem;width:100%}.sd-tab-content>:first-child{margin-top:0 !important}.sd-tab-content>:last-child{margin-bottom:0 !important}.sd-tab-content>.sd-tab-set{margin:0}.sd-sphinx-override,.sd-sphinx-override *{-moz-box-sizing:border-box;-webkit-box-sizing:border-box;box-sizing:border-box}.sd-sphinx-override p{margin-top:0}:root{--sd-color-primary: #0071bc;--sd-color-secondary: #6c757d;--sd-color-success: #28a745;--sd-color-info: #17a2b8;--sd-color-warning: #f0b37e;--sd-color-danger: #dc3545;--sd-color-light: #f8f9fa;--sd-color-muted: #6c757d;--sd-color-dark: #212529;--sd-color-black: black;--sd-color-white: white;--sd-color-primary-highlight: #0060a0;--sd-color-secondary-highlight: #5c636a;--sd-color-success-highlight: #228e3b;--sd-color-info-highlight: #148a9c;--sd-color-warning-highlight: #cc986b;--sd-color-danger-highlight: #bb2d3b;--sd-color-light-highlight: #d3d4d5;--sd-color-muted-highlight: #5c636a;--sd-color-dark-highlight: #1c1f23;--sd-color-black-highlight: black;--sd-color-white-highlight: #d9d9d9;--sd-color-primary-text: #fff;--sd-color-secondary-text: #fff;--sd-color-success-text: #fff;--sd-color-info-text: #fff;--sd-color-warning-text: #212529;--sd-color-danger-text: #fff;--sd-color-light-text: #212529;--sd-color-muted-text: #fff;--sd-color-dark-text: #fff;--sd-color-black-text: #fff;--sd-color-white-text: #212529;--sd-color-shadow: rgba(0, 0, 0, 0.15);--sd-color-card-border: rgba(0, 0, 0, 0.125);--sd-color-card-border-hover: hsla(231, 99%, 66%, 1);--sd-color-card-background: transparent;--sd-color-card-text: inherit;--sd-color-card-header: transparent;--sd-color-card-footer: transparent;--sd-color-tabs-label-active: hsla(231, 99%, 66%, 1);--sd-color-tabs-label-hover: hsla(231, 99%, 66%, 1);--sd-color-tabs-label-inactive: hsl(0, 0%, 66%);--sd-color-tabs-underline-active: hsla(231, 99%, 66%, 1);--sd-color-tabs-underline-hover: rgba(178, 206, 245, 0.62);--sd-color-tabs-underline-inactive: transparent;--sd-color-tabs-overline: rgb(222, 222, 222);--sd-color-tabs-underline: rgb(222, 222, 222);--sd-fontsize-tabs-label: 1rem} diff --git a/docs-archive/helm-chart/1.14.0/output-spelling-results-helm-chart/_sphinx_design_static/design-tabs.js b/docs-archive/helm-chart/1.14.0/output-spelling-results-helm-chart/_sphinx_design_static/design-tabs.js new file mode 100644 index 00000000000..36b38cf0d91 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/output-spelling-results-helm-chart/_sphinx_design_static/design-tabs.js @@ -0,0 +1,27 @@ +var sd_labels_by_text = {}; + +function ready() { + const li = document.getElementsByClassName("sd-tab-label"); + for (const label of li) { + syncId = label.getAttribute("data-sync-id"); + if (syncId) { + label.onclick = onLabelClick; + if (!sd_labels_by_text[syncId]) { + sd_labels_by_text[syncId] = []; + } + sd_labels_by_text[syncId].push(label); + } + } +} + +function onLabelClick() { + // Activate other inputs with the same sync id. + syncId = this.getAttribute("data-sync-id"); + for (label of sd_labels_by_text[syncId]) { + if (label === this) continue; + label.previousElementSibling.checked = true; + } + window.localStorage.setItem("sphinx-design-last-tab", syncId); +} + +document.addEventListener("DOMContentLoaded", ready, false); diff --git a/docs-archive/helm-chart/1.14.0/parameters-ref.html b/docs-archive/helm-chart/1.14.0/parameters-ref.html new file mode 100644 index 00000000000..9fd51e1863f --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/parameters-ref.html @@ -0,0 +1,5516 @@ + + + + + + + + + + + + Parameters reference — helm-chart Documentation + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ + +
+ + +
+ + +
+
+
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+
+
+
+ +
+ + +
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+ + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+
+
+

Parameters reference

+

The following tables lists the configurable parameters of the Airflow chart and their default values.

+
+

Common

+ +++++ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

Parameter

Description

Default

_rpcServer.RPC serverConfig

This string (can be templated) will be mounted into the Airflow RPC server as a custom RPC server_config.py. You can bake a RPC server_config.py in to your image instead or specify a configmap containing the RPC server_config.py.

~

+

Examples:

+
RPC serverConfig: |-
+  from airflow import configuration as conf
+
+  # The SQLAlchemy connection string.
+  SQLALCHEMY_DATABASE_URI = conf.get('database', 'SQL_ALCHEMY_CONN')
+
+  # Flask-WTF flag for CSRF
+  CSRF_ENABLED = True
+
+
+

_rpcServer.RPC serverConfigConfigMapName

The configmap name containing the RPC server_config.py.

~

+

Examples:

+
RPC serverConfigConfigMapName: my-RPC server-configmap
+
+
+

_rpcServer.defaultUser.enabled

Enable default user creation.

True

airflowLocalSettings

airflow_local_settings file as a string (can be templated).

See values.yaml

airflowVersion

Airflow version (Used to make some decisions based on Airflow Version being deployed).

2.9.2

config

Settings to go into the mounted airflow.cfg

See values.yaml

defaultAirflowDigest

Default airflow digest to deploy. Overrides tag.

~

defaultAirflowRepository

Default airflow repository. Overrides all the specific images below.

apache/airflow

defaultAirflowTag

Default airflow tag to deploy.

2.9.2

executor

Airflow executor.

CeleryExecutor

fernetKey

The Fernet key used to encrypt passwords (can only be set during install, not upgrade).

~

pgbouncer.enabled

Enable PgBouncer.

False

schedulerName

Specify kube scheduler name for Pods.

~

webserver.defaultUser.enabled

Enable default user creation.

True

webserver.webserverConfig

This string (can be templated) will be mounted into the Airflow webserver as a custom webserver_config.py. You can bake a webserver_config.py in to your image instead or specify a configmap containing the webserver_config.py.

~

+

Examples:

+
webserverConfig: |-
+  from airflow import configuration as conf
+
+  # The SQLAlchemy connection string.
+  SQLALCHEMY_DATABASE_URI = conf.get('database', 'SQL_ALCHEMY_CONN')
+
+  # Flask-WTF flag for CSRF
+  CSRF_ENABLED = True
+
+
+

webserver.webserverConfigConfigMapName

The configmap name containing the webserver_config.py.

~

+

Examples:

+
webserverConfigConfigMapName: my-webserver-configmap
+
+
+

webserverSecretKey

The Flask secret key for Airflow Webserver to encrypt browser session.

~

+
+
+

Airflow

+ +++++ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

Parameter

Description

Default

airflowHome

Airflow home directory. Used for mount paths.

/opt/airflow

allowPodLaunching

Whether various Airflow components launch pods.

True

dags.gitSync.branch

Git branch

v2-2-stable

dags.gitSync.containerName

Git sync container name.

git-sync

dags.gitSync.credentialsSecret

Name of a Secret containing the repo GIT_SYNC_USERNAME and GIT_SYNC_PASSWORD.

~

dags.gitSync.depth

Repository depth.

1

dags.gitSync.emptyDirConfig

Configuration for dags empty dir volume.

~

dags.gitSync.enabled

Enable Git sync.

False

dags.gitSync.env

Environment variables for git sync container.

[]

+

Examples:

+
env:
+- name: GIT_SYNC_TIMEOUT
+  value: '60'
+
+
+

dags.gitSync.extraVolumeMounts

Mount additional volumes into git sync container.

[]

dags.gitSync.knownHosts

When using a ssh private key, the contents of your known_hosts file.

~

+

Examples:

+
knownHosts: |-
+  <host1>,<ip1> <key1>
+  <host2>,<ip2> <key2>
+knownHosts: <host1>,<ip1> <key1>
+
+
+

dags.gitSync.maxFailures

The number of consecutive failures allowed before aborting.

0

dags.gitSync.period

Interval between git sync attempts in Go-style duration string. High values are more likely to cause DAGs to become out of sync between different components. Low values cause more traffic to the remote git repository.

5s

dags.gitSync.ref

Git revision branch, tag, or hash.

v2-2-stable

dags.gitSync.repo

Git repository.

https://github.com/apache/airflow.git

dags.gitSync.resources

Resources on workers git-sync sidecar

{}

+

Examples:

+
resources:
+  limits:
+    cpu: 100m
+    memory: 128Mi
+  requests:
+    cpu: 100m
+    memory: 128Mi
+
+
+

dags.gitSync.rev

Git revision.

HEAD

dags.gitSync.securityContext

Security context for the gitSync container (deprecated, use securityContexts instead). If not set, the values from securityContext will be used.

{}

+

Examples:

+
securityContext:
+  runAsGroup: 0
+  runAsUser: 50000
+
+
+

dags.gitSync.sshKeySecret

Name of a Secret containing the repo sshKeySecret.

~

dags.gitSync.subPath

Subpath within the repo where dags are located.

tests/dags

dags.gitSync.uid

Git sync container run as user parameter.

65533

dags.gitSync.wait

Interval between git sync attempts in seconds. High values are more likely to cause DAGs to become out of sync between different components. Low values cause more traffic to the remote git repository.

~

dags.mountPath

Where dags volume will be mounted. Works for both persistence and gitSync. If not specified, dags mount path will be set to $AIRFLOW_HOME/dags

~

dags.persistence.accessMode

Access mode of the persistent volume.

ReadWriteOnce

dags.persistence.annotations

Annotations for the dag PVC

{}

dags.persistence.enabled

Enable persistent volume for storing dags.

False

dags.persistence.existingClaim

The name of an existing PVC to use.

~

dags.persistence.size

Volume size for dags.

1Gi

dags.persistence.storageClassName

If using a custom StorageClass, pass name here.

~

dags.persistence.subPath

Subpath within the PVC where dags are located.

~

elasticsearch.connection

Elasticsearch connection configuration.

{}

+

Examples:

+
connection:
+  host: '...'
+  pass: '...'
+  port: '...'
+  scheme: https
+  user: '...'
+
+
+

elasticsearch.connection.host

Host

""

elasticsearch.connection.pass

Password

""

elasticsearch.connection.port

Port

80

elasticsearch.connection.scheme

Scheme

http

elasticsearch.connection.user

Username

""

elasticsearch.enabled

Enable Elasticsearch task logging.

False

elasticsearch.secretName

A secret containing the connection string.

~

enableBuiltInSecretEnvVars.AIRFLOW_CONN_AIRFLOW_DB

Enable AIRFLOW_CONN_AIRFLOW_DB variable to be read from the Metadata Secret

True

enableBuiltInSecretEnvVars.AIRFLOW__CELERY__BROKER_URL

Enable AIRFLOW__CELERY__BROKER_URL variable to be read from the Celery Broker URL Secret

True

enableBuiltInSecretEnvVars.AIRFLOW__CELERY__CELERY_RESULT_BACKEND

Enable AIRFLOW__CELERY__CELERY_RESULT_BACKEND variable to be read from the Celery Result Backend Secret - Airflow 1.10.* variant

True

enableBuiltInSecretEnvVars.AIRFLOW__CELERY__RESULT_BACKEND

Enable AIRFLOW__CELERY__RESULT_BACKEND variable to be read from the Celery Result Backend Secret

True

enableBuiltInSecretEnvVars.AIRFLOW__CORE__FERNET_KEY

Enable AIRFLOW__CORE__FERNET_KEY variable to be read from the Fernet key Secret

True

enableBuiltInSecretEnvVars.AIRFLOW__CORE__SQL_ALCHEMY_CONN

Enable AIRFLOW__CORE__SQL_ALCHEMY_CONN variable to be read from the Metadata Secret

True

enableBuiltInSecretEnvVars.AIRFLOW__DATABASE__SQL_ALCHEMY_CONN

Enable AIRFLOW__DATABASE__SQL_ALCHEMY_CONN variable to be read from the Metadata Secret

True

enableBuiltInSecretEnvVars.AIRFLOW__ELASTICSEARCH__ELASTICSEARCH_HOST

Enable AIRFLOW__ELASTICSEARCH__ELASTICSEARCH_HOST variable to be read from the Elasticsearch Host Secret - Airflow <1.10.4 variant

True

enableBuiltInSecretEnvVars.AIRFLOW__ELASTICSEARCH__HOST

Enable AIRFLOW__ELASTICSEARCH__HOST variable to be read from the Elasticsearch Host Secret

True

enableBuiltInSecretEnvVars.AIRFLOW__WEBSERVER__SECRET_KEY

Enable AIRFLOW__WEBSERVER__SECRET_KEY variable to be read from the Webserver Secret Key Secret

True

env

Environment variables for all Airflow containers.

[]

+

Examples:

+
env:
+- name: MYENVVAR
+  value: something_fun
+
+
+

extraEnv

Extra env ‘items’ that will be added to the definition of Airflow containers; a string is expected (can be templated).

~

+

Examples:

+
extraEnv: |-
+  - name: AIRFLOW__CORE__LOAD_EXAMPLES
+     value: True
+
+
+

extraEnvFrom

Extra envFrom ‘items’ that will be added to the definition of Airflow containers; a string is expected (can be templated).

~

+

Examples:

+
extraEnvFrom: |-
+  - secretRef:
+      name: '{{ .Release.Name }}-airflow-connections'
+extraEnvFrom: |-
+  - configMapRef:
+      name: '{{ .Release.Name }}-airflow-variables'
+
+
+

fernetKeySecretName

The Fernet key secret name.

~

gid

Group of airflow user.

0

logs.emptyDirConfig

Configuration for logs empty dir volume.

~

logs.persistence.annotations

Annotations to add to logs PVC

{}

logs.persistence.enabled

Enable persistent volume for storing logs.

False

logs.persistence.existingClaim

The name of an existing PVC to use.

~

logs.persistence.size

Volume size for logs.

100Gi

logs.persistence.storageClassName

If using a custom StorageClass, pass name here.

~

multiNamespaceMode

Whether Airflow can launch workers and/or pods in multiple namespaces. If true, it creates ClusterRole/ClusterRolebinding (with access to entire cluster)

False

podTemplate

The contents of pod_template_file.yaml used for KubernetesExecutor workers (templated). The default (see files/pod-template-file.kubernetes-helm-yaml) already takes into account normal workers configuration parameters (e.g. workers.resources), so you normally won’t need to override this directly.

~

+

Examples:

+
podTemplate: |-
+  apiVersion: v1
+  kind: Pod
+  metadata:
+    name: placeholder-name
+    labels:
+      tier: airflow
+      component: worker
+      release: {{ .Release.Name }}
+  spec:
+    priorityClassName: high-priority
+    containers:
+      - name: base
+      ...
+
+
+

secret

Secrets for all Airflow containers.

[]

+

Examples:

+
secret:
+- envName: SecretEnvVar
+  secretKey: somekey
+  secretName: somesecret
+
+
+

uid

User of airflow user.

50000

volumeMounts

VolumeMounts for all Airflow containers.

[]

volumes

Volumes for all Airflow containers.

[]

webserverSecretKeySecretName

The Secret name containing Flask secret_key for the Webserver.

~

+
+
+

Images

+ +++++ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

Parameter

Description

Default

images.airflow.digest

The airflow image digest. If set, it will override the tag.

~

images.airflow.pullPolicy

The airflow image pull policy.

IfNotPresent

images.airflow.repository

The airflow image repository.

~

images.airflow.tag

The airflow image tag.

~

images.flower.pullPolicy

The flower image pull policy.

IfNotPresent

images.flower.repository

The flower image repository.

~

images.flower.tag

The flower image tag.

~

images.gitSync.pullPolicy

The gitSync image pull policy.

IfNotPresent

images.gitSync.repository

The gitSync image repository.

registry.k8s.io/git-sync/git-sync

images.gitSync.tag

The gitSync image tag.

v4.1.0

images.migrationsWaitTimeout

The time (in seconds) to wait for the DB migrations to complete.

60

images.pgbouncer.pullPolicy

The PgBouncer image pull policy.

IfNotPresent

images.pgbouncer.repository

The PgBouncer image repository.

apache/airflow

images.pgbouncer.tag

The PgBouncer image tag.

airflow-pgbouncer-2024.01.19-1.21.0

images.pgbouncerExporter.pullPolicy

The PgBouncer exporter image pull policy.

IfNotPresent

images.pgbouncerExporter.repository

The PgBouncer exporter image repository.

apache/airflow

images.pgbouncerExporter.tag

The PgBouncer exporter image tag.

airflow-pgbouncer-exporter-2024.01.19-0.16.0

images.pod_template.pullPolicy

The pod_template image pull policy.

IfNotPresent

images.pod_template.repository

The pod_template image repository. If config.kubernetes.worker_container_repository is set, k8s executor will use config value instead.

~

images.pod_template.tag

The pod_template image tag. If config.kubernetes.worker_container_tag is set, k8s executor will use config value instead.

~

images.redis.pullPolicy

The redis image pull policy.

IfNotPresent

images.redis.repository

The redis image repository.

redis

images.redis.tag

The redis image tag.

7.2-bookworm

images.statsd.pullPolicy

The StatsD image pull policy.

IfNotPresent

images.statsd.repository

The StatsD image repository.

quay.io/prometheus/statsd-exporter

images.statsd.tag

The StatsD image tag.

v0.26.1

images.useDefaultImageForMigration

To avoid images with user code for running and waiting for DB migrations set this to true.

False

+
+
+

Ports

+ +++++ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

Parameter

Description

Default

ports._rpcServer

RPC server port (AIP-44). Experimental / dev purpose only.

9080

ports.airflowUI

Airflow UI port.

8080

ports.flowerUI

Flower UI port.

5555

ports.pgbouncer

PgBouncer port.

6543

ports.pgbouncerScrape

PgBouncer scrape port.

9127

ports.redisDB

Redis port.

6379

ports.statsdIngest

StatsD ingest port.

9125

ports.statsdScrape

StatsD scrape port.

9102

ports.triggererLogs

Triggerer logs port.

8794

ports.workerLogs

Worker logs port.

8793

+
+
+

Database

+ +++++ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

Parameter

Description

Default

data.metadataConnection.db

The name of the database.

postgres

data.metadataConnection.host

The database host.

~

data.metadataConnection.pass

The user’s password.

postgres

data.metadataConnection.port

The database port.

5432

data.metadataConnection.protocol

The database protocol.

postgresql

data.metadataConnection.sslmode

The database SSL parameter.

disable

data.metadataConnection.user

The database user.

postgres

data.metadataSecretName

Metadata connection string secret.

~

data.resultBackendConnection

Result backend connection configuration.

~

data.resultBackendConnection.db

The name of the database.

~

data.resultBackendConnection.host

The database host.

~

data.resultBackendConnection.pass

The database password.

~

data.resultBackendConnection.port

The database port.

~

data.resultBackendConnection.protocol

The database protocol.

~

data.resultBackendConnection.sslmode

The database SSL parameter.

~

data.resultBackendConnection.user

The database user.

~

data.resultBackendSecretName

Result backend connection string secret.

~

postgresql.auth.enablePostgresUser

Assign a password to the ‘postgres’ admin user. Otherwise, remote access will be blocked for this user

True

postgresql.auth.password

Password for the custom user to create.

""

postgresql.auth.postgresPassword

Password for the ‘postgres’ admin user.

postgres

postgresql.auth.username

Name for a custom user to create

""

postgresql.enabled

Enable PostgreSQL subchart.

True

+
+
+

PgBouncer

+ +++++ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

Parameter

Description

Default

pgbouncer.affinity

Specify scheduling constraints for PgBouncer pods.

{}

pgbouncer.annotations

Annotations to add to the PgBouncer deployment

{}

pgbouncer.args

Args to use for PgBouncer (templated).

~

pgbouncer.auth_file

The name of the file to load user names and passwords from

/etc/pgbouncer/users.txt

pgbouncer.auth_type

Method of authenticating users

scram-sha-256

pgbouncer.ciphers

The allowed ciphers, might be ‘fast’, ‘normal’ or list ciphers separated with ‘:’.

normal

pgbouncer.command

Command to use for PgBouncer (templated).

['pgbouncer', '-u', 'nobody', '/etc/pgbouncer/pgbouncer.ini']

pgbouncer.configSecretName

The PgBouncer config Secret name.

~

pgbouncer.env

Add additional env vars to pgbouncer container.

[]

pgbouncer.extraContainers

Launch additional containers into pgbouncer.

[]

pgbouncer.extraIni

Add extra general PgBouncer ini configuration: https://www.pgbouncer.org/config.html

~

pgbouncer.extraIniMetadata

Add extra metadata database specific PgBouncer ini configuration: https://www.pgbouncer.org/config.html#section-databases

~

pgbouncer.extraIniResultBackend

Add extra result backend database specific PgBouncer ini configuration: https://www.pgbouncer.org/config.html#section-databases

~

pgbouncer.extraNetworkPolicies

Additional NetworkPolicies as needed.

[]

pgbouncer.extraVolumeMounts

Mount additional volumes into PgBouncer.

[]

pgbouncer.extraVolumes

Mount additional volumes into PgBouncer.

[]

pgbouncer.logConnections

Log successful logins.

0

pgbouncer.logDisconnections

Log disconnections with reasons.

0

pgbouncer.maxClientConn

Maximum clients that can connect to PgBouncer (higher = more file descriptors).

100

pgbouncer.metadataPoolSize

Metadata pool size.

10

pgbouncer.metricsExporterSidecar.livenessProbe.initialDelaySeconds

Metrics Exporter liveness probe initial delay

10

pgbouncer.metricsExporterSidecar.livenessProbe.periodSeconds

Metrics Exporter liveness probe frequency

10

pgbouncer.metricsExporterSidecar.livenessProbe.timeoutSeconds

Metrics Exporter liveness probe command timeout

1

pgbouncer.metricsExporterSidecar.readinessProbe.initialDelaySeconds

Metrics Exporter readiness probe initial delay

10

pgbouncer.metricsExporterSidecar.readinessProbe.periodSeconds

Metrics Exporter readiness probe frequency

10

pgbouncer.metricsExporterSidecar.readinessProbe.timeoutSeconds

Metrics Exporter readiness probe command timeout

1

pgbouncer.metricsExporterSidecar.resources

Resources for the PgBouncer metric exporter.

{}

+

Examples:

+
resources:
+  limits:
+    cpu: 100m
+    memory: 128Mi
+  requests:
+    cpu: 100m
+    memory: 128Mi
+
+
+

pgbouncer.metricsExporterSidecar.sslmode

SSL mode for metricsExporterSidecar

disable

pgbouncer.metricsExporterSidecar.statsSecretKey

Key referencing the PGBouncer Metrics connection URI within an existing Secrets object. Defaults to connection if left null.

~

pgbouncer.metricsExporterSidecar.statsSecretName

Name of an existing Secrets object containing PgBouncer Metrics secrets.

~

pgbouncer.nodeSelector

Select certain nodes for PgBouncer pods.

{}

pgbouncer.podAnnotations

Add annotations for the PgBouncer Pod.

{}

pgbouncer.podDisruptionBudget.config.maxUnavailable

Max unavailable pods for PgBouncer.

1

pgbouncer.podDisruptionBudget.config.minAvailable

Min available pods for PgBouncer.

1

pgbouncer.podDisruptionBudget.enabled

Enabled PodDistributionBudget.

False

pgbouncer.priorityClassName

Specify priority for PgBouncer pods.

~

pgbouncer.replicas

Number of PgBouncer replicas to run in Deployment.

1

pgbouncer.resources

Resources for the PgBouncer pods.

{}

+

Examples:

+
resources:
+  limits:
+    cpu: 100m
+    memory: 128Mi
+  requests:
+    cpu: 100m
+    memory: 128Mi
+
+
+

pgbouncer.resultBackendPoolSize

Result backend pool size.

5

pgbouncer.service.extraAnnotations

Extra annotations for the PgBouncer Service.

{}

pgbouncer.serviceAccount.annotations

Annotations to add to the worker Kubernetes ServiceAccount.

{}

pgbouncer.serviceAccount.automountServiceAccountToken

Specifies if ServiceAccount’s API credentials should be mounted onto Pods

True

pgbouncer.serviceAccount.create

Specifies whether a ServiceAccount should be created.

True

pgbouncer.serviceAccount.name

The name of the ServiceAccount to use. If not set and create is true, a name is generated using the release name.

~

pgbouncer.ssl.ca

Certificate Authority for server side

~

pgbouncer.ssl.cert

Server Certificate for server side

~

pgbouncer.ssl.key

Private key used to authenticate with the server

~

pgbouncer.sslmode

SSL mode for PgBouncer.

prefer

pgbouncer.tolerations

Specify Tolerations for PgBouncer pods.

[]

pgbouncer.topologySpreadConstraints

Specify topology spread constraints for PgBouncer pods.

[]

pgbouncer.uid

PgBouncer run as user parameter.

65534

pgbouncer.verbose

Increase PgBouncer verbosity.

0

+
+
+

RPC Server

+ +++++ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

Parameter

Description

Default

_rpcServer.affinity

Specify scheduling constraints for RPC server pods.

See values.yaml

_rpcServer.allowPodLogReading

Allow RPC server to read k8s pod logs. Useful when you don’t have an external log store.

True

_rpcServer.annotations

Annotations to add to the RPC server deployment

{}

_rpcServer.args

Args to use when running the Airflow RPC server (templated).

['-c', 'exec airflow internal-api']

_rpcServer.command

Command to use when running the Airflow RPC server (templated).

['bash']

_rpcServer.configMapAnnotations

Extra annotations to apply to the RPC server configmap.

{}

_rpcServer.defaultUser.email

Default user email address.

admin@example.com

_rpcServer.defaultUser.firstName

Default user firstname.

admin

_rpcServer.defaultUser.lastName

Default user lastname.

user

_rpcServer.defaultUser.password

Default user password.

admin

_rpcServer.defaultUser.role

Default user role.

Admin

_rpcServer.defaultUser.username

Default user username.

admin

_rpcServer.enabled

Enable RPC server

False

_rpcServer.env

Add additional env vars to RPC server.

[]

_rpcServer.extraContainers

Launch additional containers into RPC server.

[]

_rpcServer.extraInitContainers

Add additional init containers into RPC server.

[]

_rpcServer.extraNetworkPolicies

Additional NetworkPolicies as needed (Deprecated - renamed to RPC server.networkPolicy.ingress.from).

[]

_rpcServer.extraVolumeMounts

Mount additional volumes into RPC server.

[]

_rpcServer.extraVolumes

Mount additional volumes into RPC server.

[]

_rpcServer.hostAliases

HostAliases for the RPC server pod.

[]

+

Examples:

+
hostAliases:
+- hostnames:
+  - foo.local
+  ip: 127.0.0.1
+hostAliases:
+- hostnames:
+  - foo.remote
+  ip: 10.1.2.3
+
+
+

_rpcServer.labels

Labels to add to the RPC server objects and pods.

{}

_rpcServer.livenessProbe.failureThreshold

RPC server Liveness probe failure threshold.

5

_rpcServer.livenessProbe.initialDelaySeconds

RPC server Liveness probe initial delay.

15

_rpcServer.livenessProbe.periodSeconds

RPC server Liveness probe period seconds.

10

_rpcServer.livenessProbe.scheme

RPC server Liveness probe scheme.

HTTP

_rpcServer.livenessProbe.timeoutSeconds

RPC server Liveness probe timeout seconds.

5

_rpcServer.networkPolicy.ingress.from

Peers for RPC server NetworkPolicyingress.

[]

_rpcServer.networkPolicy.ingress.ports

Ports for RPC server NetworkPolicyingress (if from is set).

[{'port': '{{ .Values.ports._rpcServer }}'}]

+

Examples:

+
ports:
+- port: 9080
+
+
+

_rpcServer.nodeSelector

Select certain nodes for RPC server pods.

{}

_rpcServer.podAnnotations

Annotations to add to the RPC server pods.

{}

_rpcServer.podDisruptionBudget.config.maxUnavailable

Max unavailable pods for RPC server.

1

_rpcServer.podDisruptionBudget.config.minAvailable

Min available pods for RPC server.

1

_rpcServer.podDisruptionBudget.enabled

Enable pod disruption budget.

False

_rpcServer.priorityClassName

Specify priority for RPC server pods.

~

_rpcServer.readinessProbe.failureThreshold

RPC server Readiness probe failure threshold.

5

_rpcServer.readinessProbe.initialDelaySeconds

RPC server Readiness probe initial delay.

15

_rpcServer.readinessProbe.periodSeconds

RPC server Readiness probe period seconds.

10

_rpcServer.readinessProbe.scheme

RPC server Readiness probe scheme.

HTTP

_rpcServer.readinessProbe.timeoutSeconds

RPC server Readiness probe timeout seconds.

5

_rpcServer.replicas

How many Airflow RPC server replicas should run.

1

_rpcServer.resources

Resources for RPC server pods.

{}

+

Examples:

+
resources:
+  limits:
+    cpu: 100m
+    memory: 128Mi
+  requests:
+    cpu: 100m
+    memory: 128Mi
+
+
+

_rpcServer.service.annotations

Annotations for the RPC server Service.

{}

_rpcServer.service.loadBalancerIP

RPC server Service loadBalancerIP.

~

_rpcServer.service.loadBalancerSourceRanges

RPC server Service loadBalancerSourceRanges.

[]

+

Examples:

+
loadBalancerSourceRanges:
+- 10.123.0.0/16
+
+
+

_rpcServer.service.ports

Ports for the RPC server Service.

[{'name': 'rpc-server', 'port': '{{ .Values.ports._rpcServer }}'}]

+

Examples:

+
ports:
+- name: rpc-server
+  port: 9080
+  targetPort: rpc-server
+ports:
+- name: only_sidecar
+  port: 9080
+  targetPort: 8888
+
+
+

_rpcServer.service.type

RPC server Service type.

ClusterIP

_rpcServer.serviceAccount.annotations

Annotations to add to the RPC server Kubernetes ServiceAccount.

{}

_rpcServer.serviceAccount.automountServiceAccountToken

Specifies if ServiceAccount’s API credentials should be mounted onto Pods

True

_rpcServer.serviceAccount.create

Specifies whether a ServiceAccount should be created.

True

_rpcServer.serviceAccount.name

The name of the ServiceAccount to use. If not set and create is true, a name is generated using the release name.

~

_rpcServer.startupProbe.failureThreshold

RPC server Startup probe failure threshold.

6

_rpcServer.startupProbe.periodSeconds

RPC server Startup probe period seconds.

10

_rpcServer.startupProbe.scheme

RPC server Startup probe scheme.

HTTP

_rpcServer.startupProbe.timeoutSeconds

RPC server Startup probe timeout seconds.

20

_rpcServer.strategy

Specifies the strategy used to replace old Pods by new ones.

~

_rpcServer.tolerations

Specify Tolerations for RPC server pods.

[]

_rpcServer.waitForMigrations.enabled

Enable wait-for-airflow-migrations init container.

True

_rpcServer.waitForMigrations.env

Add additional env vars to wait-for-airflow-migrations init container.

[]

+
+
+

Scheduler

+ +++++ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

Parameter

Description

Default

scheduler.affinity

Specify scheduling constraints for scheduler pods.

See values.yaml

scheduler.annotations

Annotations to add to the scheduler deployment

{}

scheduler.args

Args to use when running the Airflow scheduler (templated).

['bash', '-c', 'exec airflow scheduler']

scheduler.command

Command to use when running the Airflow scheduler (templated).

~

scheduler.enabled

Enable scheduler

True

scheduler.env

Add additional env vars to scheduler.

[]

scheduler.extraContainers

Launch additional containers into scheduler (templated).

[]

scheduler.extraInitContainers

Add additional init containers into scheduler (templated).

[]

scheduler.extraVolumeMounts

Mount additional volumes into scheduler.

[]

scheduler.extraVolumes

Mount additional volumes into scheduler.

[]

scheduler.hostAliases

HostAliases for the scheduler pod.

[]

+

Examples:

+
hostAliases:
+- hostnames:
+  - foo.local
+  ip: 127.0.0.1
+hostAliases:
+- hostnames:
+  - foo.remote
+  ip: 10.1.2.3
+
+
+

scheduler.labels

Labels to add to the scheduler objects and pods.

{}

scheduler.livenessProbe.failureThreshold

Minimum consecutive failures for the probe to be considered failed after having succeeded. Minimum value is 1.

5

scheduler.livenessProbe.initialDelaySeconds

Number of seconds after the container has started before liveness probes are initiated.

10

scheduler.livenessProbe.periodSeconds

How often (in seconds) to perform the probe. Minimum value is 1.

60

scheduler.livenessProbe.timeoutSeconds

Number of seconds after which the probe times out. Minimum value is 1 seconds.

20

scheduler.nodeSelector

Select certain nodes for scheduler pods.

{}

scheduler.podAnnotations

Annotations to add to the scheduler pods.

{}

scheduler.podDisruptionBudget.config.maxUnavailable

Max unavailable pods for scheduler.

1

scheduler.podDisruptionBudget.config.minAvailable

Min available pods for scheduler.

1

scheduler.podDisruptionBudget.enabled

Enable pod disruption budget.

False

scheduler.priorityClassName

Specify priority for scheduler pods.

~

scheduler.replicas

Airflow 2.0 allows users to run multiple schedulers. This feature is only recommended for MySQL 8+ and PostgreSQL

1

scheduler.resources

Resources for scheduler pods.

{}

+

Examples:

+
resources:
+  limits:
+    cpu: 100m
+    memory: 128Mi
+  requests:
+    cpu: 100m
+    memory: 128Mi
+
+
+

scheduler.safeToEvict

This setting tells Kubernetes that its ok to evict when it wants to scale a node down.

True

scheduler.securityContext

Security context for the scheduler pod (deprecated, use securityContexts instead). If not set, the values from securityContext will be used.

{}

+

Examples:

+
securityContext:
+  fsGroup: 0
+  runAsGroup: 0
+  runAsUser: 50000
+
+
+

scheduler.serviceAccount.annotations

Annotations to add to the scheduler Kubernetes ServiceAccount.

{}

scheduler.serviceAccount.automountServiceAccountToken

Specifies if ServiceAccount’s API credentials should be mounted onto Pods

True

scheduler.serviceAccount.create

Specifies whether a ServiceAccount should be created.

True

scheduler.serviceAccount.name

The name of the ServiceAccount to use. If not set and create is true, a name is generated using the release name.

~

scheduler.startupProbe.failureThreshold

Minimum consecutive failures for the probe to be considered failed after having succeeded. Minimum value is 1.

6

scheduler.startupProbe.periodSeconds

How often (in seconds) to perform the probe. Minimum value is 1.

10

scheduler.startupProbe.timeoutSeconds

Number of seconds after which the probe times out. Minimum value is 1 seconds.

20

scheduler.strategy

Specifies the strategy used to replace old Pods by new ones when deployed as a Deployment (when not using LocalExecutor and workers.persistence).

~

scheduler.tolerations

Specify Tolerations for scheduler pods.

[]

scheduler.topologySpreadConstraints

Specify topology spread constraints for scheduler pods.

[]

scheduler.updateStrategy

Specifies the strategy used to replace old Pods by new ones when deployed as a StatefulSet (when using LocalExecutor and workers.persistence).

~

scheduler.waitForMigrations.enabled

Enable wait-for-airflow-migrations init container.

True

scheduler.waitForMigrations.env

Add additional env vars to wait-for-airflow-migrations init container.

[]

+
+
+

Webserver

+ +++++ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

Parameter

Description

Default

webserver.affinity

Specify scheduling constraints for webserver pods.

See values.yaml

webserver.allowPodLogReading

Allow webserver to read k8s pod logs. Useful when you don’t have an external log store.

True

webserver.annotations

Annotations to add to the webserver deployment

{}

webserver.args

Args to use when running the Airflow webserver (templated).

['bash', '-c', 'exec airflow webserver']

webserver.command

Command to use when running the Airflow webserver (templated).

~

webserver.configMapAnnotations

Extra annotations to apply to the webserver configmap.

{}

webserver.defaultUser.email

Default user email address.

admin@example.com

webserver.defaultUser.firstName

Default user firstname.

admin

webserver.defaultUser.lastName

Default user lastname.

user

webserver.defaultUser.password

Default user password.

admin

webserver.defaultUser.role

Default user role.

Admin

webserver.defaultUser.username

Default user username.

admin

webserver.enabled

Enable webserver

True

webserver.env

Add additional env vars to webserver.

[]

webserver.extraContainers

Launch additional containers into webserver (templated).

[]

webserver.extraInitContainers

Add additional init containers into webserver (templated).

[]

webserver.extraNetworkPolicies

Additional NetworkPolicies as needed (Deprecated - renamed to webserver.networkPolicy.ingress.from).

[]

webserver.extraVolumeMounts

Mount additional volumes into webserver.

[]

webserver.extraVolumes

Mount additional volumes into webserver.

[]

webserver.hostAliases

HostAliases for the webserver pod.

[]

+

Examples:

+
hostAliases:
+- hostnames:
+  - foo.local
+  ip: 127.0.0.1
+hostAliases:
+- hostnames:
+  - foo.remote
+  ip: 10.1.2.3
+
+
+

webserver.labels

Labels to add to the webserver objects and pods.

{}

webserver.livenessProbe.failureThreshold

Webserver Liveness probe failure threshold.

5

webserver.livenessProbe.initialDelaySeconds

Webserver Liveness probe initial delay.

15

webserver.livenessProbe.periodSeconds

Webserver Liveness probe period seconds.

10

webserver.livenessProbe.scheme

Webserver Liveness probe scheme.

HTTP

webserver.livenessProbe.timeoutSeconds

Webserver Liveness probe timeout seconds.

5

webserver.networkPolicy.ingress.from

Peers for webserver NetworkPolicyingress.

[]

webserver.networkPolicy.ingress.ports

Ports for webserver NetworkPolicyingress (if from is set).

[{'port': '{{ .Values.ports.airflowUI }}'}]

+

Examples:

+
ports:
+- port: 8070
+
+
+

webserver.nodeSelector

Select certain nodes for webserver pods.

{}

webserver.podAnnotations

Annotations to add to the webserver pods.

{}

webserver.podDisruptionBudget.config.maxUnavailable

Max unavailable pods for webserver.

1

webserver.podDisruptionBudget.config.minAvailable

Min available pods for webserver.

1

webserver.podDisruptionBudget.enabled

Enable pod disruption budget.

False

webserver.priorityClassName

Specify priority for webserver pods.

~

webserver.readinessProbe.failureThreshold

Webserver Readiness probe failure threshold.

5

webserver.readinessProbe.initialDelaySeconds

Webserver Readiness probe initial delay.

15

webserver.readinessProbe.periodSeconds

Webserver Readiness probe period seconds.

10

webserver.readinessProbe.scheme

Webserver Readiness probe scheme.

HTTP

webserver.readinessProbe.timeoutSeconds

Webserver Readiness probe timeout seconds.

5

webserver.replicas

How many Airflow webserver replicas should run.

1

webserver.resources

Resources for webserver pods.

{}

+

Examples:

+
resources:
+  limits:
+    cpu: 100m
+    memory: 128Mi
+  requests:
+    cpu: 100m
+    memory: 128Mi
+
+
+

webserver.securityContext

Security context for the webserver job pod (deprecated, use securityContexts instead). If not set, the values from securityContext will be used.

{}

+

Examples:

+
securityContext:
+  fsGroup: 0
+  runAsGroup: 0
+  runAsUser: 50000
+
+
+

webserver.service.annotations

Annotations for the webserver Service.

{}

webserver.service.loadBalancerIP

Webserver Service loadBalancerIP.

~

webserver.service.loadBalancerSourceRanges

Webserver Service loadBalancerSourceRanges.

[]

+

Examples:

+
loadBalancerSourceRanges:
+- 10.123.0.0/16
+
+
+

webserver.service.ports

Ports for the webserver Service.

[{'name': 'airflow-ui', 'port': '{{ .Values.ports.airflowUI }}'}]

+

Examples:

+
ports:
+- name: airflow-ui
+  port: 80
+  targetPort: airflow-ui
+ports:
+- name: only_sidecar
+  port: 80
+  targetPort: 8888
+
+
+

webserver.service.type

Webserver Service type.

ClusterIP

webserver.serviceAccount.annotations

Annotations to add to the webserver Kubernetes ServiceAccount.

{}

webserver.serviceAccount.automountServiceAccountToken

Specifies if ServiceAccount’s API credentials should be mounted onto Pods

True

webserver.serviceAccount.create

Specifies whether a ServiceAccount should be created.

True

webserver.serviceAccount.name

The name of the ServiceAccount to use. If not set and create is true, a name is generated using the release name.

~

webserver.startupProbe.failureThreshold

Webserver Startup probe failure threshold.

6

webserver.startupProbe.periodSeconds

Webserver Startup probe period seconds.

10

webserver.startupProbe.scheme

Webserver Startup probe scheme.

HTTP

webserver.startupProbe.timeoutSeconds

Webserver Startup probe timeout seconds.

20

webserver.strategy

Specifies the strategy used to replace old Pods by new ones.

~

webserver.tolerations

Specify Tolerations for webserver pods.

[]

webserver.waitForMigrations.enabled

Enable wait-for-airflow-migrations init container.

True

webserver.waitForMigrations.env

Add additional env vars to wait-for-airflow-migrations init container.

[]

+
+
+

Workers

+ +++++ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

Parameter

Description

Default

workers.affinity

Specify scheduling constraints for worker pods.

See values.yaml

workers.annotations

Annotations to add to the worker deployment

{}

workers.args

Args to use when running Airflow workers (templated).

['bash', '-c', 'exec \\\nairflow {{ semverCompare ">=2.0.0" .Values.airflowVersion | ternary "celery worker" "worker" }}']

workers.command

Command to use when running Airflow workers (templated).

~

workers.env

Add additional env vars to worker.

[]

workers.extraContainers

Launch additional containers into workers (templated). Note, if used with KubernetesExecutor, you are responsible for signaling sidecars to exit when the main container finishes so Airflow can continue the worker shutdown process!

[]

workers.extraInitContainers

Add additional init containers into workers (templated).

[]

workers.extraVolumeMounts

Mount additional volumes into workers.

[]

workers.extraVolumes

Mount additional volumes into workers.

[]

workers.hostAliases

Specify HostAliases for workers.

[]

+

Examples:

+
hostAliases:
+- hostnames:
+  - test.hostname.one
+  ip: 127.0.0.2
+hostAliases:
+- hostnames:
+  - test.hostname.two
+  ip: 127.0.0.3
+
+
+

workers.hpa.behavior

HorizontalPodAutoscalerBehavior configures the scaling behavior of the target.

{}

workers.hpa.enabled

Allow HPA autoscaling (KEDA must be disabled).

False

workers.hpa.maxReplicaCount

Maximum number of workers created by HPA.

5

workers.hpa.metrics

Specifications for which to use to calculate the desired replica count.

[{'type': 'Resource', 'resource': {'name': 'cpu', 'target': {'type': 'Utilization', 'averageUtilization': 80}}}]

workers.hpa.minReplicaCount

Minimum number of workers created by HPA.

0

workers.keda.advanced

Advanced KEDA configuration.

{}

workers.keda.advanced.horizontalPodAutoscalerConfig

HorizontalPodAutoscalerConfig specifies horizontal scale config.

{}

workers.keda.advanced.horizontalPodAutoscalerConfig.behavior

HorizontalPodAutoscalerBehavior configures the scaling behavior of the target.

{}

workers.keda.cooldownPeriod

How many seconds KEDA will wait before scaling to zero.

30

workers.keda.enabled

Allow KEDA autoscaling.

False

workers.keda.maxReplicaCount

Maximum number of workers created by KEDA.

10

workers.keda.minReplicaCount

Minimum number of workers created by KEDA.

0

workers.keda.namespaceLabels

Labels used in matchLabels for namespace in the PgBouncer NetworkPolicy.

{}

workers.keda.pollingInterval

How often KEDA polls the airflow DB to report new scale requests to the HPA.

5

workers.keda.query

Query to use for KEDA autoscaling. Must return a single integer.

SELECT ceil(COUNT(*)::decimal / {{ .Values.config.celery.worker_concurrency }}) FROM task_instance WHERE (state='running' OR state='queued') {{- if eq .Values.executor "CeleryKubernetesExecutor" }} AND queue != '{{ .Values.config.celery_kubernetes_executor.kubernetes_queue }}' {{- end }}

workers.keda.usePgbouncer

Weather to use PGBouncer to connect to the database or not when it is enabled. This configuration will be ignored if PGBouncer is not enabled.

True

workers.kerberosInitContainer.enabled

Enable Kerberos init container for the worker.

False

workers.kerberosInitContainer.resources

Resources on workers kerberos init container

{}

+

Examples:

+
resources:
+  limits:
+    cpu: 100m
+    memory: 128Mi
+  requests:
+    cpu: 100m
+    memory: 128Mi
+
+
+

workers.kerberosSidecar.enabled

Enable Kerberos sidecar for the worker.

False

workers.kerberosSidecar.resources

Resources on workers kerberos sidecar

{}

+

Examples:

+
resources:
+  limits:
+    cpu: 100m
+    memory: 128Mi
+  requests:
+    cpu: 100m
+    memory: 128Mi
+
+
+

workers.labels

Labels to add to the worker objects and pods.

{}

workers.livenessProbe.enabled

Enable liveness probe for celery workers.

True

workers.livenessProbe.failureThreshold

Minimum consecutive failures for the probe to be considered failed after having succeeded. Minimum value is 1.

5

workers.livenessProbe.initialDelaySeconds

Number of seconds after the container has started before liveness probes are initiated.

10

workers.livenessProbe.periodSeconds

How often (in seconds) to perform the probe. Minimum value is 1.

60

workers.livenessProbe.timeoutSeconds

Number of seconds after which the probe times out. Minimum value is 1 seconds.

20

workers.nodeSelector

Select certain nodes for worker pods.

{}

workers.persistence.annotations

Annotations to add to worker volumes.

{}

workers.persistence.enabled

Enable persistent volumes.

True

workers.persistence.fixPermissions

Execute init container to chown log directory. This is currently only needed in kind, due to usage of local-path provisioner.

False

workers.persistence.size

Volume size for worker StatefulSet.

100Gi

workers.persistence.storageClassName

If using a custom StorageClass, pass name ref to all StatefulSets here.

~

workers.podAnnotations

Annotations to add to the worker pods.

{}

workers.priorityClassName

Specify priority for worker pods.

~

workers.replicas

Number of Airflow Celery workers in StatefulSet.

1

workers.resources

Resources on workers

{}

+

Examples:

+
resources:
+  limits:
+    cpu: 100m
+    memory: 128Mi
+  requests:
+    cpu: 100m
+    memory: 128Mi
+
+
+

workers.runtimeClassName

Specify runtime for worker pods.

~

workers.safeToEvict

This setting tells Kubernetes that it’s ok to evict when it wants to scale a node down.

False

workers.securityContext

Security context for the worker pod (deprecated, use securityContexts instead). If not set, the values from securityContext will be used.

{}

+

Examples:

+
securityContext:
+  fsGroup: 0
+  runAsGroup: 0
+  runAsUser: 50000
+
+
+

workers.serviceAccount.annotations

Annotations to add to the worker Kubernetes ServiceAccount.

{}

workers.serviceAccount.automountServiceAccountToken

Specifies if ServiceAccount’s API credentials should be mounted onto Pods

True

workers.serviceAccount.create

Specifies whether a ServiceAccount should be created.

True

workers.serviceAccount.name

The name of the ServiceAccount to use. If not set and create is true, a name is generated using the release name.

~

workers.strategy

Specifies the strategy used to replace old Pods by new ones when deployed as a Deployment.

{'rollingUpdate': {'maxSurge': '100%', 'maxUnavailable': '50%'}}

workers.terminationGracePeriodSeconds

Grace period for tasks to finish after SIGTERM is sent from Kubernetes.

600

workers.tolerations

Specify Tolerations for worker pods.

[]

workers.topologySpreadConstraints

Specify topology spread constraints for worker pods.

[]

workers.updateStrategy

Specifies the strategy used to replace old Pods by new ones when deployed as a StatefulSet.

~

workers.volumeClaimTemplates

Specify additional volume claim template for workers.

[]

+

Examples:

+
volumeClaimTemplates:
+- accessModes:
+  - ReadWriteOnce
+  name: data-volume-1
+  resources:
+    requests:
+      storage: 10Gi
+  storageClassName: storage-class-1
+volumeClaimTemplates:
+- accessModes:
+  - ReadWriteOnce
+  name: data-volume-2
+  resources:
+    requests:
+      storage: 20Gi
+  storageClassName: storage-class-2
+
+
+

workers.waitForMigrations.enabled

Enable wait-for-airflow-migrations init container.

True

workers.waitForMigrations.env

Add additional env vars to wait-for-airflow-migrations init container.

[]

+
+
+

Triggerer

+ +++++ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

Parameter

Description

Default

triggerer.affinity

Specify scheduling constraints for triggerer pods.

See values.yaml

triggerer.annotations

Annotations to add to the triggerer deployment

{}

triggerer.args

Args to use when running the Airflow triggerer (templated).

['bash', '-c', 'exec airflow triggerer']

triggerer.command

Command to use when running the Airflow triggerer (templated).

~

triggerer.enabled

Enable triggerer

True

triggerer.env

Add additional env vars to triggerer.

[]

triggerer.extraContainers

Launch additional containers into triggerer (templated).

[]

triggerer.extraInitContainers

Add additional init containers into triggerer (templated).

[]

triggerer.extraVolumeMounts

Mount additional volumes into triggerer.

[]

triggerer.extraVolumes

Mount additional volumes into triggerer.

[]

triggerer.keda.advanced

Advanced KEDA configuration.

{}

triggerer.keda.advanced.horizontalPodAutoscalerConfig

HorizontalPodAutoscalerConfig specifies horizontal scale config.

{}

triggerer.keda.advanced.horizontalPodAutoscalerConfig.behavior

HorizontalPodAutoscalerBehavior configures the scaling behavior of the target.

{}

triggerer.keda.cooldownPeriod

How many seconds KEDA will wait before scaling to zero.

30

triggerer.keda.enabled

Allow KEDA autoscaling.

False

triggerer.keda.maxReplicaCount

Maximum number of triggerers created by KEDA.

10

triggerer.keda.minReplicaCount

Minimum number of triggerers created by KEDA.

0

triggerer.keda.namespaceLabels

Labels used in matchLabels for namespace in the PgBouncer NetworkPolicy.

{}

triggerer.keda.pollingInterval

How often KEDA polls the airflow DB to report new scale requests to the HPA.

5

triggerer.keda.query

Query to use for KEDA autoscaling. Must return a single integer.

SELECT ceil(COUNT(*)::decimal / {{ .Values.config.triggerer.default_capacity }}) FROM trigger

triggerer.labels

Labels to add to the triggerer objects and pods.

{}

triggerer.livenessProbe.failureThreshold

Minimum consecutive failures for the probe to be considered failed after having succeeded. Minimum value is 1.

5

triggerer.livenessProbe.initialDelaySeconds

Number of seconds after the container has started before liveness probes are initiated.

10

triggerer.livenessProbe.periodSeconds

How often (in seconds) to perform the probe. Minimum value is 1.

60

triggerer.livenessProbe.timeoutSeconds

Number of seconds after which the probe times out. Minimum value is 1 seconds.

20

triggerer.nodeSelector

Select certain nodes for triggerer pods.

{}

triggerer.persistence.annotations

Annotations to add to triggerer volumes.

{}

triggerer.persistence.enabled

Enable persistent volumes.

True

triggerer.persistence.fixPermissions

Execute init container to chown log directory. This is currently only needed in kind, due to usage of local-path provisioner.

False

triggerer.persistence.size

Volume size for triggerer StatefulSet.

100Gi

triggerer.persistence.storageClassName

If using a custom StorageClass, pass name ref to all StatefulSets here.

~

triggerer.podAnnotations

Annotations to add to the triggerer pods.

{}

triggerer.priorityClassName

Specify priority for triggerer pods.

~

triggerer.replicas

Number of triggerers to run.

1

triggerer.resources

Resources for triggerer pods.

{}

+

Examples:

+
resources:
+  limits:
+    cpu: 100m
+    memory: 128Mi
+  requests:
+    cpu: 100m
+    memory: 128Mi
+
+
+

triggerer.safeToEvict

This setting tells Kubernetes that its ok to evict when it wants to scale a node down.

True

triggerer.securityContext

Security context for the triggerer pod (deprecated, use securityContexts instead). If not set, the values from securityContext will be used.

{}

+

Examples:

+
securityContext:
+  fsGroup: 0
+  runAsGroup: 0
+  runAsUser: 50000
+
+
+

triggerer.serviceAccount.annotations

Annotations to add to the triggerer Kubernetes ServiceAccount.

{}

triggerer.serviceAccount.automountServiceAccountToken

Specifies if ServiceAccount’s API credentials should be mounted onto Pods

True

triggerer.serviceAccount.create

Specifies whether a ServiceAccount should be created.

True

triggerer.serviceAccount.name

The name of the ServiceAccount to use. If not set and create is true, a name is generated using the release name.

~

triggerer.strategy

Specifies the strategy used to replace old Pods by new ones when deployed as a Deployment.

{'rollingUpdate': {'maxSurge': '100%', 'maxUnavailable': '50%'}}

triggerer.terminationGracePeriodSeconds

Grace period for tasks to finish after SIGTERM is sent from Kubernetes.

60

triggerer.tolerations

Specify Tolerations for triggerer pods.

[]

triggerer.topologySpreadConstraints

Specify topology spread constraints for triggerer pods.

[]

triggerer.updateStrategy

Specifies the strategy used to replace old Pods by new ones when deployed as a StatefulSet.

~

triggerer.waitForMigrations.enabled

Enable wait-for-airflow-migrations init container.

True

triggerer.waitForMigrations.env

Add additional env vars to wait-for-airflow-migrations init container.

[]

+
+
+

DagProcessor

+ +++++ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

Parameter

Description

Default

dagProcessor.affinity

Specify scheduling constraints for dag processor pods.

See values.yaml

dagProcessor.annotations

Annotations to add to the dag processor deployment

{}

dagProcessor.args

Args to use when running the Airflow dag processor (templated).

['bash', '-c', 'exec airflow dag-processor']

dagProcessor.command

Command to use when running the Airflow dag processor (templated).

~

dagProcessor.enabled

Enable standalone dag processor (requires Airflow 2.3.0+).

False

dagProcessor.env

Add additional env vars to dag processor.

[]

dagProcessor.extraContainers

Launch additional containers into dag processor (templated).

[]

dagProcessor.extraInitContainers

Add additional init containers into dag processor (templated).

[]

dagProcessor.extraVolumeMounts

Mount additional volumes into dag processor.

[]

dagProcessor.extraVolumes

Mount additional volumes into dag processor.

[]

dagProcessor.livenessProbe.failureThreshold

Minimum consecutive failures for the probe to be considered failed after having succeeded. Minimum value is 1.

5

dagProcessor.livenessProbe.initialDelaySeconds

Number of seconds after the container has started before liveness probes are initiated.

10

dagProcessor.livenessProbe.periodSeconds

How often (in seconds) to perform the probe. Minimum value is 1.

60

dagProcessor.livenessProbe.timeoutSeconds

Number of seconds after which the probe times out. Minimum value is 1 seconds.

20

dagProcessor.nodeSelector

Select certain nodes for dag processor pods.

{}

dagProcessor.podAnnotations

Annotations to add to the dag processor pods.

{}

dagProcessor.priorityClassName

Specify priority for dag processor pods.

~

dagProcessor.replicas

Number of dag processors to run.

1

dagProcessor.resources

Resources for dag processor pods.

{}

+

Examples:

+
resources:
+  limits:
+    cpu: 100m
+    memory: 128Mi
+  requests:
+    cpu: 100m
+    memory: 128Mi
+
+
+

dagProcessor.safeToEvict

This setting tells Kubernetes that its ok to evict when it wants to scale a node down.

True

dagProcessor.securityContext

Security context for the dag processor pod (deprecated, use securityContexts instead). If not set, the values from securityContext will be used.

{}

+

Examples:

+
securityContext:
+  fsGroup: 0
+  runAsGroup: 0
+  runAsUser: 50000
+
+
+

dagProcessor.serviceAccount.annotations

Annotations to add to the dag processor Kubernetes ServiceAccount.

{}

dagProcessor.serviceAccount.automountServiceAccountToken

Specifies if ServiceAccount’s API credentials should be mounted onto Pods

True

dagProcessor.serviceAccount.create

Specifies whether a ServiceAccount should be created.

True

dagProcessor.serviceAccount.name

The name of the ServiceAccount to use. If not set and create is true, a name is generated using the release name.

~

dagProcessor.strategy

Specifies the strategy used to replace old Pods by new ones when deployed as a Deployment.

{'rollingUpdate': {'maxSurge': '100%', 'maxUnavailable': '50%'}}

dagProcessor.terminationGracePeriodSeconds

Grace period for tasks to finish after SIGTERM is sent from Kubernetes.

60

dagProcessor.tolerations

Specify Tolerations for dag processor pods.

[]

dagProcessor.topologySpreadConstraints

Specify topology spread constraints for dag processor pods.

[]

dagProcessor.waitForMigrations.enabled

Enable wait-for-airflow-migrations init container.

True

dagProcessor.waitForMigrations.env

Add additional env vars to wait-for-airflow-migrations init container.

[]

+
+
+

Flower

+ +++++ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

Parameter

Description

Default

flower.affinity

Specify scheduling constraints for Flower pods.

{}

flower.annotations

Annotations to add to the flower deployment

{}

flower.args

Args to use when running flower (templated).

['bash', '-c', 'exec \\\nairflow {{ semverCompare ">=2.0.0" .Values.airflowVersion | ternary "celery flower" "flower" }}']

flower.command

Command to use when running flower (templated).

~

flower.enabled

Enable Flower.

False

flower.env

Add additional env vars to flower.

[]

flower.extraContainers

Launch additional containers into the flower pods.

[]

flower.extraNetworkPolicies

Additional NetworkPolicies as needed (Deprecated - renamed to flower.networkPolicy.ingress.from).

[]

flower.extraVolumeMounts

Mount additional volumes into the flower pods.

[]

flower.extraVolumes

Mount additional volumes into the flower pods.

[]

flower.labels

Labels to add to the flower objects and pods.

{}

flower.livenessProbe.failureThreshold

Flower Liveness probe failure threshold.

10

flower.livenessProbe.initialDelaySeconds

Flower Liveness probe initial delay.

10

flower.livenessProbe.periodSeconds

Flower Liveness probe period seconds.

5

flower.livenessProbe.timeoutSeconds

Flower Liveness probe timeout seconds.

5

flower.networkPolicy.ingress.from

Peers for flower NetworkPolicyingress.

[]

flower.networkPolicy.ingress.ports

Ports for flower NetworkPolicyingress (if from is set).

[{'port': '{{ .Values.ports.flowerUI }}'}]

+

Examples:

+
ports:
+- port: 5565
+
+
+

flower.nodeSelector

Select certain nodes for Flower pods.

{}

flower.password

Password use to access Flower.

~

flower.podAnnotations

Annotations to add to the Flower pods.

{}

flower.priorityClassName

Specify priority for Flower pods.

~

flower.readinessProbe.failureThreshold

Flower Readiness probe failure threshold.

10

flower.readinessProbe.initialDelaySeconds

Flower Readiness probe initial delay.

10

flower.readinessProbe.periodSeconds

Flower Readiness probe period seconds.

5

flower.readinessProbe.timeoutSeconds

Flower Readiness probe timeout seconds.

5

flower.resources

Resources for Flower pods.

{}

+

Examples:

+
resources:
+  limits:
+    cpu: 100m
+    memory: 128Mi
+  requests:
+    cpu: 100m
+    memory: 128Mi
+
+
+

flower.secretName

A secret containing the user and password pair.

~

flower.securityContext

Security context for the flower pod (deprecated, use securityContexts instead). If not set, the values from securityContext will be used.

{}

+

Examples:

+
securityContext:
+  fsGroup: 0
+  runAsGroup: 0
+  runAsUser: 50000
+
+
+

flower.service.annotations

Annotations for the flower Service.

{}

flower.service.loadBalancerIP

Flower Service loadBalancerIP.

~

flower.service.loadBalancerSourceRanges

Flower Service loadBalancerSourceRanges.

[]

+

Examples:

+
loadBalancerSourceRanges:
+- 10.123.0.0/16
+
+
+

flower.service.ports

Ports for the flower Service.

[{'name': 'flower-ui', 'port': '{{ .Values.ports.flowerUI }}'}]

+

Examples:

+
ports:
+- name: flower-ui
+  port: 8080
+  targetPort: flower-ui
+
+
+

flower.service.type

Flower Service type.

ClusterIP

flower.serviceAccount.annotations

Annotations to add to the worker Kubernetes ServiceAccount.

{}

flower.serviceAccount.automountServiceAccountToken

Specifies if ServiceAccount’s API credentials should be mounted onto Pods

True

flower.serviceAccount.create

Specifies whether a ServiceAccount should be created.

True

flower.serviceAccount.name

The name of the ServiceAccount to use. If not set and create is true, a name is generated using the release name.

~

flower.tolerations

Specify Tolerations for Flower pods.

[]

flower.topologySpreadConstraints

Specify topology spread constraints for Flower pods.

[]

flower.username

Username use to access Flower.

~

+
+
+

Redis

+ +++++ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

Parameter

Description

Default

data.brokerUrl

Direct url to the redis broker (when using an external redis instance) (can only be set during install, not upgrade).

~

data.brokerUrlSecretName

Redis broker URL secret.

~

redis.affinity

Specify scheduling constraints for Redis pods.

{}

redis.emptyDirConfig

Configuration for redis empty dir volume.

~

redis.enabled

Enable the Redis provisioned by the chart (you can also use an external Redis instance with data.brokerUrl or data.brokerUrlSecretName).

True

redis.nodeSelector

Select certain nodes for Redis pods.

{}

redis.password

If password is set, create secret with it, else generate a new one on install (can only be set during install, not upgrade).

~

redis.passwordSecretName

Redis password secret.

~

redis.persistence.annotations

Annotations to add to redis volumes.

{}

redis.persistence.enabled

Enable persistent volumes.

True

redis.persistence.size

Volume size for Redis StatefulSet.

1Gi

redis.persistence.storageClassName

If using a custom StorageClass, pass name ref to all StatefulSets here.

~

redis.podAnnotations

Annotations to add to the redis pods.

{}

redis.priorityClassName

Specify priority for redis pods.

~

redis.resources

Resources for the Redis pods

{}

+

Examples:

+
resources:
+  limits:
+    cpu: 100m
+    memory: 128Mi
+  requests:
+    cpu: 100m
+    memory: 128Mi
+
+
+

redis.safeToEvict

This setting tells Kubernetes that its ok to evict when it wants to scale a node down.

True

redis.securityContext

Security context for the cleanup job pod (deprecated, use securityContexts instead). If not set, the values from securityContext will be used.

{}

+

Examples:

+
securityContext:
+  fsGroup: 0
+  runAsGroup: 0
+  runAsUser: 50000
+
+
+

redis.serviceAccount.annotations

Annotations to add to the worker Kubernetes ServiceAccount.

{}

redis.serviceAccount.automountServiceAccountToken

Specifies if ServiceAccount’s API credentials should be mounted onto Pods

True

redis.serviceAccount.create

Specifies whether a ServiceAccount should be created.

True

redis.serviceAccount.name

The name of the ServiceAccount to use. If not set and create is true, a name is generated using the release name.

~

redis.terminationGracePeriodSeconds

Grace period for Redis to exit after SIGTERM is sent from Kubernetes.

600

redis.tolerations

Specify Tolerations for Redis pods.

[]

redis.topologySpreadConstraints

Specify topology spread constraints for Redis pods.

[]

redis.uid

Redis run as user parameter.

0

+
+
+

StatsD

+ +++++ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

Parameter

Description

Default

statsd.affinity

Specify scheduling constraints for StatsD pods.

{}

statsd.annotations

Annotations to add to the StatsD deployment.

{}

statsd.args

Args to use when running statsd-exporter (templated).

['--statsd.mapping-config=/etc/statsd-exporter/mappings.yml']

statsd.configMapAnnotations

Extra annotations to apply to the statsd configmap.

{}

statsd.enabled

Enable StatsD.

True

statsd.env

Add additional env vars to statsd container.

[]

statsd.extraMappings

Additional mappings for StatsD exporter.If set, will merge default mapping and extra mappings, default mapping has higher priority. So, if you want to change some default mapping, please use overrideMappings

[]

statsd.extraNetworkPolicies

Additional NetworkPolicies as needed.

[]

statsd.nodeSelector

Select certain nodes for StatsD pods.

{}

statsd.overrideMappings

Override mappings for StatsD exporter.If set, will ignore setting item in default and extraMappings. So, If you use it, ensure all mapping item contains in it.

[]

statsd.podAnnotations

Annotations to add to the StatsD pods.

{}

statsd.priorityClassName

Specify priority for StatsD pods.

~

statsd.resources

Resources for StatsD pods.

{}

+

Examples:

+
resources:
+  limits:
+    cpu: 100m
+    memory: 128Mi
+  requests:
+    cpu: 100m
+    memory: 128Mi
+
+
+

statsd.securityContext

Security context for the StatsD pod (deprecated, use securityContexts instead).

{}

+

Examples:

+
securityContext:
+  fsGroup: 0
+  runAsGroup: 0
+  runAsUser: 50000
+
+
+

statsd.service.extraAnnotations

Extra annotations for the StatsD Service.

{}

statsd.serviceAccount.annotations

Annotations to add to the StatsD Kubernetes ServiceAccount.

{}

statsd.serviceAccount.automountServiceAccountToken

Specifies if ServiceAccount’s API credentials should be mounted onto Pods

True

statsd.serviceAccount.create

Specifies whether a ServiceAccount should be created.

True

statsd.serviceAccount.name

The name of the ServiceAccount to use. If not set and create is true, a name is generated using the release name.

~

statsd.tolerations

Specify Tolerations for StatsD pods.

[]

statsd.topologySpreadConstraints

Specify topology spread constraints for StatsD pods.

[]

statsd.uid

StatsD run as user parameter.

65534

+
+
+

Jobs

+ +++++ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

Parameter

Description

Default

cleanup.affinity

Specify scheduling constraints for cleanup pods.

{}

cleanup.args

Args to use when running the cleanup cronjob (templated).

['bash', '-c', 'exec airflow kubernetes cleanup-pods --namespace={{ .Release.Namespace }}']

cleanup.command

Command to use when running the cleanup cronjob (templated).

~

cleanup.enabled

Enable cleanup.

False

cleanup.env

Add additional env vars to cleanup.

[]

cleanup.jobAnnotations

Annotations to add to the cleanup cronjob.

{}

cleanup.labels

labels to add to cleanup pods.

{}

cleanup.nodeSelector

Select certain nodes for cleanup pods.

{}

cleanup.podAnnotations

Annotations to add to cleanup pods.

{}

cleanup.priorityClassName

Specify priority for cleanup pods.

~

cleanup.resources

Resources for or cleanup pods

{}

+

Examples:

+
resources:
+  limits:
+    cpu: 100m
+    memory: 128Mi
+  requests:
+    cpu: 100m
+    memory: 128Mi
+
+
+

cleanup.schedule

Cleanup schedule (templated).

*/15 * * * *

cleanup.securityContext

Security context for the cleanup job pod (deprecated, use securityContexts instead). If not set, the values from securityContext will be used.

{}

+

Examples:

+
securityContext:
+  fsGroup: 0
+  runAsGroup: 0
+  runAsUser: 50000
+
+
+

cleanup.serviceAccount.annotations

Annotations to add to the cleanup CronJob Kubernetes ServiceAccount.

{}

cleanup.serviceAccount.automountServiceAccountToken

Specifies if ServiceAccount’s API credentials should be mounted onto Pods

True

cleanup.serviceAccount.create

Specifies whether a ServiceAccount should be created.

True

cleanup.serviceAccount.name

The name of the ServiceAccount to use. If not set and create is true, a name is generated using the release name.

~

cleanup.tolerations

Specify Tolerations for cleanup pods.

[]

cleanup.topologySpreadConstraints

Specify topology spread constraints for cleanup pods.

[]

createUserJob.affinity

Specify scheduling constraints for the create user job pod.

{}

createUserJob.annotations

Annotations to add to the create user job pod.

{}

createUserJob.applyCustomEnv

Specify if you want additional configured env vars applied to this job

True

createUserJob.args

Args to use when running create user job (templated).

['bash', '-c', 'exec \\\nairflow {{ semverCompare ">=2.0.0" .Values.airflowVersion | ternary "users create" "create_user" }} "$@"', '--', '-r', '{{ .Values.webserver.defaultUser.role }}', '-u', '{{ .Values.webserver.defaultUser.username }}', '-e', '{{ .Values.webserver.defaultUser.email }}', '-f', '{{ .Values.webserver.defaultUser.firstName }}', '-l', '{{ .Values.webserver.defaultUser.lastName }}', '-p', '{{ .Values.webserver.defaultUser.password }}']

createUserJob.command

Command to use when running create user job (templated).

~

createUserJob.env

Add additional env vars to the create user job pod.

[]

createUserJob.extraContainers

Launch additional containers for the create user job pod

[]

createUserJob.extraVolumeMounts

Mount additional volumes into create user job

[]

createUserJob.extraVolumes

Mount additional volumes into create user job

[]

createUserJob.jobAnnotations

Annotations to add to the create user job job.

{}

createUserJob.labels

Labels to add to the create user job objects and pods.

{}

createUserJob.nodeSelector

Select certain nodes for the create user job pod.

{}

createUserJob.priorityClassName

Specify priority for the create user job pod.

~

createUserJob.resources

Resources for the create user job pod

{}

+

Examples:

+
resources:
+  limits:
+    cpu: 100m
+    memory: 128Mi
+  requests:
+    cpu: 100m
+    memory: 128Mi
+
+
+

createUserJob.securityContext

Security context for the create user job pod (deprecated, use securityContexts instead). If not set, the values from securityContext will be used.

{}

+

Examples:

+
securityContext:
+  fsGroup: 0
+  runAsGroup: 0
+  runAsUser: 50000
+
+
+

createUserJob.serviceAccount.annotations

Annotations to add to the create user job Kubernetes ServiceAccount.

{}

createUserJob.serviceAccount.automountServiceAccountToken

Specifies if ServiceAccount’s API credentials should be mounted onto Pods

True

createUserJob.serviceAccount.create

Specifies whether a ServiceAccount should be created.

True

createUserJob.serviceAccount.name

The name of the ServiceAccount to use. If not set and create is true, a name is generated using the release name.

~

createUserJob.tolerations

Specify Tolerations for the create user job pod.

[]

createUserJob.topologySpreadConstraints

Specify topology spread constraints for the create user job pod.

[]

createUserJob.ttlSecondsAfterFinished

Limit the lifetime of the job object after it finished execution

300

createUserJob.useHelmHooks

Specify if you want to use the default Helm Hook annotations

True

migrateDatabaseJob.affinity

Specify scheduling constraints for the migrate database job pod.

{}

migrateDatabaseJob.annotations

Annotations to add to the migrate database job pod.

{}

migrateDatabaseJob.applyCustomEnv

Specify if you want additional configured env vars applied to this job

True

migrateDatabaseJob.args

Args to use when running migrate database job (templated).

['bash', '-c', 'exec \\\nairflow {{ semverCompare ">=2.7.0" .Values.airflowVersion | ternary "db migrate" (semverCompare ">=2.0.0" .Values.airflowVersion | ternary "db upgrade" "upgradedb") }}']

migrateDatabaseJob.command

Command to use when running migrate database job (templated).

~

migrateDatabaseJob.enabled

Enable migrate database job.

True

migrateDatabaseJob.extraContainers

Launch additional containers for the migrate database job pod

[]

migrateDatabaseJob.extraVolumeMounts

Mount additional volumes into migrate database job

[]

migrateDatabaseJob.extraVolumes

Mount additional volumes into migrate database job

[]

migrateDatabaseJob.jobAnnotations

Annotations to add to the migrate database job.

{}

migrateDatabaseJob.labels

Labels to add to the migrate database job objects and pods.

{}

migrateDatabaseJob.nodeSelector

Select certain nodes for the migrate database job pod.

{}

migrateDatabaseJob.priorityClassName

Specify priority for the migrate database job pod.

~

migrateDatabaseJob.resources

Resources for the migrate database job pod

{}

+

Examples:

+
resources:
+  limits:
+    cpu: 100m
+    memory: 128Mi
+  requests:
+    cpu: 100m
+    memory: 128Mi
+
+
+

migrateDatabaseJob.securityContext

Security context for the migrate database job pod (deprecated, use securityContexts instead). If not set, the values from securityContext will be used.

{}

+

Examples:

+
securityContext:
+  fsGroup: 0
+  runAsGroup: 0
+  runAsUser: 50000
+
+
+

migrateDatabaseJob.serviceAccount.annotations

Annotations to add to the migrate database job Kubernetes ServiceAccount.

{}

migrateDatabaseJob.serviceAccount.automountServiceAccountToken

Specifies if ServiceAccount’s API credentials should be mounted onto Pods

True

migrateDatabaseJob.serviceAccount.create

Specifies whether a ServiceAccount should be created.

True

migrateDatabaseJob.serviceAccount.name

The name of the ServiceAccount to use. If not set and create is true, a name is generated using the release name.

~

migrateDatabaseJob.tolerations

Specify Tolerations for the migrate database job pod.

[]

migrateDatabaseJob.topologySpreadConstraints

Specify topology spread constraints for migrate database job pod.

[]

migrateDatabaseJob.ttlSecondsAfterFinished

Limit the lifetime of the job object after it finished execution

300

migrateDatabaseJob.useHelmHooks

Specify if you want to use the default Helm Hook annotations

True

+
+
+

Kubernetes

+ +++++ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

Parameter

Description

Default

_rpcServer.containerLifecycleHooks

Container Lifecycle Hooks definition for the RPC server. If not set, the values from global containerLifecycleHooks will be used.

{}

+

Examples:

+
containerLifecycleHooks:
+  postStart:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo postStart handler > /usr/share/message
+  preStop:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo preStop handler > /usr/share/message
+
+
+

_rpcServer.securityContexts.container

Container security context definition for the RPC server.

{}

+

Examples:

+
container:
+  allowPrivilegeEscalation: false
+  capabilities:
+    drop:
+    - ALL
+
+
+

_rpcServer.securityContexts.pod

Pod security context definition for the RPC server.

{}

+

Examples:

+
pod:
+  fsGroup: 0
+  runAsGroup: 0
+  runAsUser: 50000
+
+
+

_rpcServer.topologySpreadConstraints

Specify topology spread constraints for RPC server pods.

[]

_rpcServer.waitForMigrations.securityContexts.container

Container security context definition for the wait for migrations.

{}

+

Examples:

+
container:
+  allowPrivilegeEscalation: false
+  capabilities:
+    drop:
+    - ALL
+
+
+

affinity

Specify scheduling constraints for all pods.

{}

airflowConfigAnnotations

Extra annotations to apply to the main Airflow configmap.

{}

airflowPodAnnotations

Extra annotations to apply to all Airflow pods.

{}

cleanup.containerLifecycleHooks

Container Lifecycle Hooks definition for the cleanup. If not set, the values from global containerLifecycleHooks will be used.

{}

+

Examples:

+
containerLifecycleHooks:
+  postStart:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo postStart handler > /usr/share/message
+  preStop:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo preStop handler > /usr/share/message
+
+
+

cleanup.securityContexts.container

Container security context definition for the cleanup.

{}

+

Examples:

+
container:
+  allowPrivilegeEscalation: false
+  capabilities:
+    drop:
+    - ALL
+
+
+

cleanup.securityContexts.pod

Pod security context definition for the cleanup.

{}

+

Examples:

+
pod:
+  fsGroup: 0
+  runAsGroup: 0
+  runAsUser: 50000
+
+
+

containerLifecycleHooks

Default Container Lifecycle Hooks definition. The values in this parameter will be used when containerLifecycleHooks is not defined for specific containers.

{}

+

Examples:

+
containerLifecycleHooks:
+  postStart:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo postStart handler > /usr/share/message
+  preStop:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo preStop handler > /usr/share/message
+
+
+

createUserJob.containerLifecycleHooks

Container Lifecycle Hooks definition for the create user job. If not set, the values from global containerLifecycleHooks will be used.

{}

+

Examples:

+
containerLifecycleHooks:
+  postStart:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo postStart handler > /usr/share/message
+  preStop:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo preStop handler > /usr/share/message
+
+
+

createUserJob.securityContexts.container

Container security context definition for the create user job.

{}

+

Examples:

+
container:
+  allowPrivilegeEscalation: false
+  capabilities:
+    drop:
+    - ALL
+
+
+

createUserJob.securityContexts.pod

Pod security context definition for the create user job.

{}

+

Examples:

+
pod:
+  fsGroup: 0
+  runAsGroup: 0
+  runAsUser: 50000
+
+
+

dagProcessor.containerLifecycleHooks

Container Lifecycle Hooks definition for the dag processor. If not set, the values from global containerLifecycleHooks will be used.

{}

+

Examples:

+
containerLifecycleHooks:
+  postStart:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo postStart handler > /usr/share/message
+  preStop:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo preStop handler > /usr/share/message
+
+
+

dagProcessor.securityContexts.container

Container security context definition for the dag processor.

{}

+

Examples:

+
container:
+  allowPrivilegeEscalation: false
+  capabilities:
+    drop:
+    - ALL
+
+
+

dagProcessor.securityContexts.pod

Pod security context definition for the dag processor.

{}

+

Examples:

+
pod:
+  fsGroup: 0
+  runAsGroup: 0
+  runAsUser: 50000
+
+
+

dagProcessor.waitForMigrations.securityContexts.container

Container security context definition for the wait for migrations.

{}

+

Examples:

+
container:
+  allowPrivilegeEscalation: false
+  capabilities:
+    drop:
+    - ALL
+
+
+

dags.gitSync.containerLifecycleHooks

Container Lifecycle Hooks definition for the git sync sidecar. If not set, the values from global containerLifecycleHooks will be used.

{}

+

Examples:

+
containerLifecycleHooks:
+  postStart:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo postStart handler > /usr/share/message
+  preStop:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo preStop handler > /usr/share/message
+
+
+

dags.gitSync.securityContexts.container

Container security context definition for the git sync sidecar.

{}

+

Examples:

+
container:
+  allowPrivilegeEscalation: false
+  capabilities:
+    drop:
+    - ALL
+
+
+

extraConfigMaps

Extra ConfigMaps that will be managed by the chart.

{}

+

Examples:

+
extraConfigMaps:
+  '{{ .Release.Name }}-airflow-variables':
+    data: |-
+      AIRFLOW_VAR_HELLO_MESSAGE: 'Hi!'
+      AIRFLOW_VAR_KUBERNETES_NAMESPACE: '{{ .Release.Namespace }}'
+
+
+

extraSecrets

Extra secrets that will be managed by the chart.

{}

+

Examples:

+
extraSecrets:
+  '{{ .Release.Name }}-airflow-connections':
+    data: |-
+      AIRFLOW_CONN_GCP: 'base64_encoded_gcp_conn_string'
+      AIRFLOW_CONN_AWS: 'base64_encoded_aws_conn_string'
+    stringData: 'AIRFLOW_CONN_OTHER: ''other_conn'''
+
+
+

flower.containerLifecycleHooks

Container Lifecycle Hooks definition for the network policy. If not set, the values from global containerLifecycleHooks will be used.

{}

+

Examples:

+
containerLifecycleHooks:
+  postStart:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo postStart handler > /usr/share/message
+  preStop:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo preStop handler > /usr/share/message
+
+
+

flower.securityContexts.container

Container security context definition for the network policy.

{}

+

Examples:

+
container:
+  allowPrivilegeEscalation: false
+  capabilities:
+    drop:
+    - ALL
+
+
+

flower.securityContexts.pod

Pod security context definition for the network policy.

{}

+

Examples:

+
pod:
+  fsGroup: 0
+  runAsGroup: 0
+  runAsUser: 50000
+
+
+

labels

Add common labels to all objects and pods defined in this chart.

{}

limits

Define default/max/min values for pods and containers in namespace.

[]

migrateDatabaseJob.containerLifecycleHooks

Container Lifecycle Hooks definition for the migrate database job. If not set, the values from global containerLifecycleHooks will be used.

{}

+

Examples:

+
containerLifecycleHooks:
+  postStart:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo postStart handler > /usr/share/message
+  preStop:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo preStop handler > /usr/share/message
+
+
+

migrateDatabaseJob.securityContexts.container

Container security context definition for the migrate database job.

{}

+

Examples:

+
container:
+  allowPrivilegeEscalation: false
+  capabilities:
+    drop:
+    - ALL
+
+
+

migrateDatabaseJob.securityContexts.pod

Pod security context definition for the migrate database job.

{}

+

Examples:

+
pod:
+  fsGroup: 0
+  runAsGroup: 0
+  runAsUser: 50000
+
+
+

networkPolicies.enabled

Enabled network policies.

False

nodeSelector

Select certain nodes for all pods.

{}

pgbouncer.containerLifecycleHooks

Container Lifecycle Hooks definition for the PgBouncer. If not set, the values from global containerLifecycleHooks will be used.

{'preStop': {'exec': {'command': ['/bin/sh', '-c', 'killall -INT pgbouncer && sleep 120']}}}

+

Examples:

+
containerLifecycleHooks:
+  postStart:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo postStart handler > /usr/share/message
+  preStop:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo preStop handler > /usr/share/message
+
+
+

pgbouncer.metricsExporterSidecar.containerLifecycleHooks

Container Lifecycle Hooks definition for the metrics exporter sidecar. If not set, the values from global containerLifecycleHooks will be used.

{}

+

Examples:

+
containerLifecycleHooks:
+  postStart:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo postStart handler > /usr/share/message
+  preStop:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo preStop handler > /usr/share/message
+
+
+

pgbouncer.metricsExporterSidecar.securityContexts.container

Container security context definition for the metrics exporter sidecar.

{}

+

Examples:

+
container:
+  allowPrivilegeEscalation: false
+  capabilities:
+    drop:
+    - ALL
+
+
+

pgbouncer.securityContexts.container

Container security context definition for the PgBouncer.

{}

+

Examples:

+
container:
+  allowPrivilegeEscalation: false
+  capabilities:
+    drop:
+    - ALL
+
+
+

pgbouncer.securityContexts.pod

Pod security context definition for the PgBouncer.

{}

+

Examples:

+
pod:
+  fsGroup: 0
+  runAsGroup: 0
+  runAsUser: 65534
+
+
+

priorityClasses

Priority Classes created by helm charts

[]

+

Examples:

+
priorityClasses:
+- name: class1
+  preemptionPolicy: PreemptLowerPriority
+  value: 10000
+priorityClasses:
+- name: class2
+  preemptionPolicy: Never
+  value: 100000
+
+
+

quotas

Define any ResourceQuotas for namespace.

{}

rbac.create

Specifies whether RBAC resources should be created.

True

rbac.createSCCRoleBinding

Specifies whether SCC RoleBinding resource should be created (refer to Production Guide).

False

redis.containerLifecycleHooks

Container Lifecycle Hooks definition for the redis. If not set, the values from global containerLifecycleHooks will be used.

{}

+

Examples:

+
containerLifecycleHooks:
+  postStart:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo postStart handler > /usr/share/message
+  preStop:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo preStop handler > /usr/share/message
+
+
+

redis.securityContexts.container

Container security context definition for the redis.

{}

+

Examples:

+
container:
+  allowPrivilegeEscalation: false
+  capabilities:
+    drop:
+    - ALL
+
+
+

redis.securityContexts.pod

Pod security context definition for the redis.

{}

+

Examples:

+
pod:
+  fsGroup: 0
+  runAsGroup: 0
+  runAsUser: 999
+
+
+

registry.connection

Registry connection configuration.

{}

+

Examples:

+
connection:
+  email: '...'
+  host: '...'
+  pass: '...'
+  user: '...'
+
+
+

registry.connection.email

Email

""

registry.connection.host

Host

""

registry.connection.pass

Password

""

registry.connection.user

Username

""

registry.secretName

Registry connection string secret.

~

scheduler.containerLifecycleHooks

Container Lifecycle Hooks definition for the scheduler. If not set, the values from global containerLifecycleHooks will be used.

{}

+

Examples:

+
containerLifecycleHooks:
+  postStart:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo postStart handler > /usr/share/message
+  preStop:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo preStop handler > /usr/share/message
+
+
+

scheduler.securityContexts.container

Container security context definition for the scheduler.

{}

+

Examples:

+
container:
+  allowPrivilegeEscalation: false
+  capabilities:
+    drop:
+    - ALL
+
+
+

scheduler.securityContexts.pod

Pod security context definition for the scheduler.

{}

+

Examples:

+
pod:
+  fsGroup: 0
+  runAsGroup: 0
+  runAsUser: 50000
+
+
+

scheduler.waitForMigrations.securityContexts.container

Container security context definition for the wait for migrations.

{}

+

Examples:

+
container:
+  allowPrivilegeEscalation: false
+  capabilities:
+    drop:
+    - ALL
+
+
+

securityContext

Default pod security context definition (deprecated, use securityContexts instead). The values in this parameter will be used when securityContext is not defined for specific Pods

{}

+

Examples:

+
securityContext:
+  fsGroup: 0
+  runAsGroup: 0
+  runAsUser: 50000
+
+
+

securityContexts.container

Default container security context definition. The values in this parameter will be used when securityContexts is not defined for specific containers

{}

+

Examples:

+
container:
+  allowPrivilegeEscalation: false
+
+
+

securityContexts.pod

Default pod security context definition. The values in this parameter will be used when securityContexts is not defined for specific Pods.

{}

+

Examples:

+
pod:
+  fsGroup: 0
+  runAsGroup: 0
+  runAsUser: 50000
+
+
+

statsd.containerLifecycleHooks

Container Lifecycle Hooks definition for the statsd. If not set, the values from global containerLifecycleHooks will be used.

{}

+

Examples:

+
containerLifecycleHooks:
+  postStart:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo postStart handler > /usr/share/message
+  preStop:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo preStop handler > /usr/share/message
+
+
+

statsd.securityContexts.container

Container security context definition for the statsd.

{}

+

Examples:

+
container:
+  allowPrivilegeEscalation: false
+  capabilities:
+    drop:
+    - ALL
+
+
+

statsd.securityContexts.pod

Pod security context definition for the statsd.

{}

+

Examples:

+
pod:
+  fsGroup: 0
+  runAsGroup: 0
+  runAsUser: 50000
+
+
+

tolerations

Specify Tolerations for all pods.

[]

topologySpreadConstraints

Specify topology spread constraints for all pods.

[]

triggerer.containerLifecycleHooks

Container Lifecycle Hooks definition for the triggerer. If not set, the values from global containerLifecycleHooks will be used.

{}

+

Examples:

+
containerLifecycleHooks:
+  postStart:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo postStart handler > /usr/share/message
+  preStop:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo preStop handler > /usr/share/message
+
+
+

triggerer.securityContexts.container

Container security context definition for the triggerer.

{}

+

Examples:

+
container:
+  allowPrivilegeEscalation: false
+  capabilities:
+    drop:
+    - ALL
+
+
+

triggerer.securityContexts.pod

Pod security context definition for the triggerer.

{}

+

Examples:

+
pod:
+  fsGroup: 0
+  runAsGroup: 0
+  runAsUser: 50000
+
+
+

triggerer.waitForMigrations.securityContexts.container

Container security context definition for the wait for migrations.

{}

+

Examples:

+
container:
+  allowPrivilegeEscalation: false
+  capabilities:
+    drop:
+    - ALL
+
+
+

webserver.containerLifecycleHooks

Container Lifecycle Hooks definition for the webserver. If not set, the values from global containerLifecycleHooks will be used.

{}

+

Examples:

+
containerLifecycleHooks:
+  postStart:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo postStart handler > /usr/share/message
+  preStop:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo preStop handler > /usr/share/message
+
+
+

webserver.securityContexts.container

Container security context definition for the webserver.

{}

+

Examples:

+
container:
+  allowPrivilegeEscalation: false
+  capabilities:
+    drop:
+    - ALL
+
+
+

webserver.securityContexts.pod

Pod security context definition for the webserver.

{}

+

Examples:

+
pod:
+  fsGroup: 0
+  runAsGroup: 0
+  runAsUser: 50000
+
+
+

webserver.topologySpreadConstraints

Specify topology spread constraints for webserver pods.

[]

webserver.waitForMigrations.securityContexts.container

Container security context definition for the wait for migrations.

{}

+

Examples:

+
container:
+  allowPrivilegeEscalation: false
+  capabilities:
+    drop:
+    - ALL
+
+
+

workers.containerLifecycleHooks

Container Lifecycle Hooks definition for the worker. If not set, the values from global containerLifecycleHooks will be used.

{}

+

Examples:

+
containerLifecycleHooks:
+  postStart:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo postStart handler > /usr/share/message
+  preStop:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo preStop handler > /usr/share/message
+
+
+

workers.kerberosInitContainer.containerLifecycleHooks

Container Lifecycle Hooks definition for the kerberos init container. If not set, the values from global containerLifecycleHooks will be used.

{}

+

Examples:

+
containerLifecycleHooks:
+  postStart:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo postStart handler > /usr/share/message
+  preStop:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo preStop handler > /usr/share/message
+
+
+

workers.kerberosInitContainer.securityContexts.container

Container security context definition for the kerberos init container.

{}

+

Examples:

+
container:
+  allowPrivilegeEscalation: false
+  capabilities:
+    drop:
+    - ALL
+
+
+

workers.kerberosSidecar.containerLifecycleHooks

Container Lifecycle Hooks definition for the kerberos sidecar. If not set, the values from global containerLifecycleHooks will be used.

{}

+

Examples:

+
containerLifecycleHooks:
+  postStart:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo postStart handler > /usr/share/message
+  preStop:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo preStop handler > /usr/share/message
+
+
+

workers.kerberosSidecar.securityContexts.container

Container security context definition for the kerberos sidecar.

{}

+

Examples:

+
container:
+  allowPrivilegeEscalation: false
+  capabilities:
+    drop:
+    - ALL
+
+
+

workers.persistence.containerLifecycleHooks

Container Lifecycle Hooks definition for the persistence. If not set, the values from global containerLifecycleHooks will be used.

{}

+

Examples:

+
containerLifecycleHooks:
+  postStart:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo postStart handler > /usr/share/message
+  preStop:
+    exec:
+      command:
+      - /bin/sh
+      - -c
+      - echo preStop handler > /usr/share/message
+
+
+

workers.persistence.securityContexts.container

Container security context definition for the persistence.

{}

+

Examples:

+
container:
+  allowPrivilegeEscalation: false
+  capabilities:
+    drop:
+    - ALL
+
+
+

workers.securityContexts.container

Container security context definition for the workers.

{}

+

Examples:

+
container:
+  allowPrivilegeEscalation: false
+  capabilities:
+    drop:
+    - ALL
+
+
+

workers.securityContexts.pod

Pod security context definition for the workers.

{}

+

Examples:

+
pod:
+  fsGroup: 0
+  runAsGroup: 0
+  runAsUser: 50000
+
+
+

workers.waitForMigrations.securityContexts.container

Container security context definition for the wait for migrations.

{}

+

Examples:

+
container:
+  allowPrivilegeEscalation: false
+  capabilities:
+    drop:
+    - ALL
+
+
+
+
+
+

Ingress

+ +++++ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

Parameter

Description

Default

ingress.enabled

Enable all ingress resources (deprecated - use ingress.web.enabled and ingress.flower.enabled).

~

ingress.flower.annotations

Annotations for the flower Ingress.

{}

ingress.flower.enabled

Enable flower ingress resource.

False

ingress.flower.host

The hostname for the flower Ingress. (Deprecated - renamed to ingress.flower.hosts)

""

ingress.flower.hosts

The hostnames or hosts configuration for the flower Ingress.

[]

ingress.flower.ingressClassName

The Ingress Class for the flower Ingress.

""

ingress.flower.path

The path for the flower Ingress.

/

ingress.flower.pathType

The pathType for the flower Ingress (required for Kubernetes 1.19 and above).

ImplementationSpecific

ingress.flower.tls.enabled

Enable TLS termination for the flower Ingress.

False

ingress.flower.tls.secretName

The name of a pre-created Secret containing a TLS private key and certificate.

""

ingress.web.annotations

Annotations for the web Ingress.

{}

ingress.web.enabled

Enable web ingress resource.

False

ingress.web.host

The hostname for the web Ingress. (Deprecated - renamed to ingress.web.hosts)

""

ingress.web.hosts

The hostnames or hosts configuration for the web Ingress.

[]

ingress.web.ingressClassName

The Ingress Class for the web Ingress.

""

ingress.web.path

The path for the web Ingress.

/

ingress.web.pathType

The pathType for the web Ingress (required for Kubernetes 1.19 and above).

ImplementationSpecific

ingress.web.precedingPaths

HTTP paths to add to the web Ingress before the default path.

[]

ingress.web.succeedingPaths

HTTP paths to add to the web Ingress after the default path.

[]

ingress.web.tls.enabled

Enable TLS termination for the web Ingress.

False

ingress.web.tls.secretName

The name of a pre-created Secret containing a TLS private key and certificate.

""

+
+
+

Kerberos

+ +++++ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

Parameter

Description

Default

kerberos.ccacheFileName

Name for kerberos credentials cache file.

cache

kerberos.ccacheMountPath

Path to mount shared volume for kerberos credentials cache.

/var/kerberos-ccache

kerberos.config

Contents of krb5.conf.

See values.yaml

kerberos.configPath

Path to mount krb5.conf kerberos configuration file.

/etc/krb5.conf

kerberos.enabled

Enable kerberos.

False

kerberos.keytabBase64Content

Kerberos keytab base64 encoded content.

~

kerberos.keytabPath

Path to mount the keytab for refreshing credentials in the kerberos sidecar.

/etc/airflow.keytab

kerberos.principal

Principal to use when refreshing kerberos credentials.

airflow@FOO.COM

kerberos.reinitFrequency

How often (in seconds) airflow kerberos will reinitialize the credentials cache.

3600

+
+

Specify each parameter using the --set key=value[,key=value] argument to helm install. For example,

+
helm install my-release apache-airflow/airflow \
+  --set executor=CeleryExecutor \
+  --set enablePodLaunching=false .
+
+
+
+ + + +
+ +
+
+
+
+
+

Was this entry helpful?

+
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+
+ +
+ + + + + + +
+ + + + + + + + + + + + + + + +
+ + + + +
+ + +
+ + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/docs-archive/helm-chart/1.14.0/production-guide.html b/docs-archive/helm-chart/1.14.0/production-guide.html new file mode 100644 index 00000000000..0a5cbd14d72 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/production-guide.html @@ -0,0 +1,1470 @@ + + + + + + + + + + + + Production Guide — helm-chart Documentation + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ + +
+ + +
+ + +
+
+
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+
+
+
+ +
+ + +
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+ + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+
+
+

Production Guide

+

The following are things to consider when using this Helm chart in a production environment.

+
+

Database

+

It is advised to set up an external database for the Airflow metastore. The default Helm chart deploys a +Postgres database running in a container. For production usage, a database running on a dedicated machine or +leveraging a cloud provider’s database service such as AWS RDS should be used because the embedded Postgres +lacks stability, monitoring and persistence features that you need for a production database. It is only there to +make it easier to test the Helm Chart in a “standalone” version but you might experience data loss when you +are using it. Supported databases and versions can be found at Set up a Database Backend.

+
+

Note

+

When using the helm chart, you do not need to initialize the db with airflow db migrate +as outlined in Set up a Database Backend.

+
+

First disable Postgres so the chart won’t deploy its own Postgres container:

+
postgresql:
+  enabled: false
+
+
+

To provide the database credentials to Airflow, you have 2 options - in your values file or in a Kubernetes Secret.

+
+

Values file

+

This is the simpler options, as the chart will create a Kubernetes Secret for you. However, keep in mind your credentials will be in your values file.

+
data:
+  metadataConnection:
+    user: <username>
+    pass: <password>
+    protocol: postgresql
+    host: <hostname>
+    port: 5432
+    db: <database name>
+
+
+
+
+

Kubernetes Secret

+

You can also store the credentials in a Kubernetes Secret you create. Note that +special characters in the username/password must be URL encoded.

+
kubectl create secret generic mydatabase --from-literal=connection=postgresql://user:pass@host:5432/db
+
+
+

Finally, configure the chart to use the secret you created:

+
data:
+  metadataSecretName: mydatabase
+
+
+
+

Warning

+

If you use CeleryExecutor and Airflow version < 2.4, keep in mind that resultBackendSecretName expects a url that starts with db+postgresql://, while metadataSecretName expects postgresql:// and won’t work with db+postgresql://. You’ll need to create separate secrets with the correct scheme. For Airflow version >= 2.4 it is possible to omit the result backend secret, as Airflow will use sql_alchemy_conn (specified in metadataSecret) with a db+ scheme prefix by default.

+
+
+
+
+

PgBouncer

+

If you are using PostgreSQL as your database, you will likely want to enable PgBouncer as well. +Airflow can open a lot of database connections due to its distributed nature and using a connection pooler can significantly +reduce the number of open connections on the database.

+
pgbouncer:
+  enabled: true
+
+
+

Depending on the size of your Airflow instance, you may want to adjust the following as well (defaults are shown):

+
pgbouncer:
+  # The maximum number of connections to PgBouncer
+  maxClientConn: 100
+  # The maximum number of server connections to the metadata database from PgBouncer
+  metadataPoolSize: 10
+  # The maximum number of server connections to the result backend database from PgBouncer
+  resultBackendPoolSize: 5
+
+
+
+
+

Webserver Secret Key

+

You should set a static webserver secret key when deploying with this chart as it will help ensure +your Airflow components only restart when necessary.

+
+

Warning

+

You should use a different secret key for every instance you run, as this key is used to sign +session cookies and perform other security related functions!

+
+

First, generate a strong secret key:

+
python3 -c 'import secrets; print(secrets.token_hex(16))'
+
+
+

Now add the secret to your values file:

+
webserverSecretKey: <secret_key>
+
+
+

Alternatively, create a Kubernetes Secret and use webserverSecretKeySecretName:

+
webserverSecretKeySecretName: my-webserver-secret
+# where the random key is under `webserver-secret-key` in the k8s Secret
+
+
+

Example to create a Kubernetes Secret from kubectl:

+
kubectl create secret generic my-webserver-secret --from-literal="webserver-secret-key=$(python3 -c 'import secrets; print(secrets.token_hex(16))')"
+
+
+

The webserver key is also used to authorize requests to Celery workers when logs are retrieved. The token +generated using the secret key has a short expiry time though - make sure that time on ALL the machines +that you run airflow components on is synchronized (for example using ntpd) otherwise you might get +“forbidden” errors when the logs are accessed.

+
+
+

Eviction configuration

+

When running Airflow along with the Kubernetes Cluster Autoscaler, it is important to configure whether pods can be safely evicted. +This setting can be configured in the Airflow chart at different levels:

+
workers:
+  safeToEvict: true
+scheduler:
+  safeToEvict: true
+webserver:
+  safeToEvict: true
+
+
+

When using KubernetesExecutor, workers.safeToEvict should be set to false to avoid them being removed before finishing.

+
+
+

Extending and customizing Airflow Image

+

The Apache Airflow community, releases Docker Images which are reference images for Apache Airflow. +However, Airflow has more than 60 community managed providers (installable via extras) and some of the +default extras/providers installed are not used by everyone, sometimes others extras/providers +are needed, sometimes (very often actually) you need to add your own custom dependencies, +packages or even custom providers, or add custom tools and binaries that are needed in +your deployment.

+

In Kubernetes and Docker terms this means that you need another image with your specific requirements. +This is why you should learn how to build your own Docker (or more properly Container) image.

+

Typical scenarios where you would like to use your custom image:

+
    +

  • Adding apt packages

    • +

  • Adding PyPI packages

    • +

  • Adding binary resources necessary for your deployment

    • +

  • Adding custom tools needed in your deployment

    • +
+

See Building the image for more +details on how you can extend and customize the Airflow image.

+
+
+

Managing DAG Files

+

See Manage DAGs files.

+
+

knownHosts

+

If you are using dags.gitSync.sshKeySecret, you should also set dags.gitSync.knownHosts. Here we will show the process +for GitHub, but the same can be done for any provider:

+

Grab GitHub’s public key:

+
ssh-keyscan -t rsa github.com > github_public_key
+
+
+

Next, print the fingerprint for the public key:

+
ssh-keygen -lf github_public_key
+
+
+

Compare that output with GitHub’s SSH key fingerprints.

+

They match, right? Good. Now, add the public key to your values. It’ll look something like this:

+
dags:
+  gitSync:
+    knownHosts: |
+      github.com ssh-rsa AAAA...1/wsjk=
+
+
+
+
+

External Scheduler

+

To use an external Scheduler instance:

+
scheduler:
+  enabled: false
+
+
+

Ensure that your external webserver/scheduler is connected to the same redis host. This will ensure the scheduler is aware of the workers deployed in the helm-chart.

+
+
+
+

Accessing the Airflow UI

+

How you access the Airflow UI will depend on your environment; however, the chart does support various options:

+
+

External Webserver

+

To use an external Webserver:

+
webserver:
+  enabled: false
+
+
+

Ensure that your external webserver/scheduler is connected to the same redis host. This will ensure the scheduler is aware of the workers deployed in the helm-chart.

+
+
+

Ingress

+

You can create and configure Ingress objects. See the Ingress chart parameters. +For more information on Ingress, see the +Kubernetes Ingress documentation.

+
+
+

LoadBalancer Service

+

You can change the Service type for the webserver to be LoadBalancer, and set any necessary annotations:

+
webserver:
+  service:
+    type: LoadBalancer
+
+
+

For more information on LoadBalancer Services, see the Kubernetes LoadBalancer Service Documentation.

+
+
+
+

Logging

+

Depending on your choice of executor, task logs may not work out of the box. All logging choices can be found +at Manage logs.

+
+
+

Metrics

+

The chart can support sending metrics to an existing StatsD instance or provide a Prometheus endpoint.

+
+

Prometheus

+

The metrics endpoint is available at svc/{{ .Release.Name }}-statsd:9102/metrics.

+
+
+

External StatsD

+

To use an external StatsD instance:

+
statsd:
+  enabled: false
+config:
+  metrics:  # or 'scheduler' for Airflow 1
+    statsd_on: true
+    statsd_host: ...
+    statsd_port: ...
+
+
+
+
+

Datadog

+

If you are using a Datadog agent in your environment, this will enable Airflow to export metrics to the Datadog agent.

+
statsd:
+  enabled: false
+config:
+  metrics: # or 'scheduler' for Airflow 1
+    statsd_on: true
+    statsd_port: 8125
+extraEnv: |-
+  - name: AIRFLOW__METRICS__STATSD_HOST
+    valueFrom:
+      fieldRef:
+        fieldPath: status.hostIP
+
+
+
+
+
+

Celery Backend

+

If you are using CeleryExecutor or CeleryKubernetesExecutor, you can bring your own Celery backend.

+

By default, the chart will deploy Redis. However, you can use any supported Celery backend instead:

+
redis:
+  enabled: false
+data:
+  brokerUrl: redis://redis-user:password@redis-host:6379/0
+
+
+

For more information about setting up a Celery broker, refer to the +exhaustive Celery documentation on the topic.

+
+
+

Security Context Constraints

+

A Security Context Constraint (SCC) is a OpenShift construct that works as a RBAC rule; however, it targets Pods instead of users. +When defining a SCC, one can control actions and resources a POD can perform or access during startup and runtime.

+

The SCCs are split into different levels or categories with the restricted SCC being the default one assigned to Pods. +When deploying Airflow to OpenShift, one can leverage the SCCs and allow the Pods to start containers utilizing the anyuid SCC.

+

In order to enable the usage of SCCs, one must set the parameter rbac.createSCCRoleBinding to true as shown below:

+
rbac:
+  create: true
+  createSCCRoleBinding: true
+
+
+

In this chart, SCCs are bound to the Pods via RoleBindings meaning that the option rbac.create must also be set to true in order to fully enable the SCC usage.

+

For more information about SCCs and what can be achieved with this construct, please refer to Managing security context constraints.

+
+
+

Security Context

+

In Kubernetes a securityContext can be used to define user ids, group ids and capabilities such as running a container in privileged mode.

+

When deploying an application to Kubernetes, it is recommended to give the least privilege to containers so as +to reduce access and protect the host where the container is running.

+

In the Airflow Helm chart, the securityContext can be configured in several ways:

+
+
+
+

The same way one can configure the global securityContexts, it is also possible to configure different values for specific workloads by setting their local securityContexts as follows:

+
workers:
+  securityContexts:
+    pod:
+      runAsUser: 5000
+      fsGroup: 0
+    containers:
+      allowPrivilegeEscalation: false
+
+
+

In the example above, the workers Pod securityContexts will be set to runAsUser: 5000 and fsGroup: 0. The containers pod will be set to allowPrivilegeEscalation: false.

+

As one can see, the local setting will take precedence over the global setting when defined. The following explains the precedence rule for securityContexts options in this chart:

+
uid: 40000
+gid: 0
+
+securityContexts:
+  pod:
+    runAsUser: 50000
+    fsGroup: 0
+
+workers:
+  securityContexts:
+    pod:
+      runAsUser: 1001
+      fsGroup: 0
+
+
+

This will generate the following worker deployment:

+
kind: StatefulSet
+apiVersion: apps/v1
+metadata:
+  name: airflow-worker
+spec:
+  serviceName: airflow-worker
+  template:
+    spec:
+      securityContext:    # As the securityContexts was defined in ``workers``, its value will take priority
+        runAsUser: 1001
+        fsGroup: 0
+
+
+

If we remove both the securityContexts and workers.securityContexts from the example above, the output will be the following:

+
uid: 40000
+gid: 0
+
+securityContexts: {}
+
+workers:
+  securityContexts: {}
+
+
+

This will generate the following worker deployment:

+
kind: StatefulSet
+apiVersion: apps/v1
+metadata:
+  name: airflow-worker
+spec:
+  serviceName: airflow-worker
+  template:
+    spec:
+      securityContext:
+        runAsUser: 40000   # As the securityContext was not defined in ``workers`` or ``podSecurity``, the value from uid will be used
+        fsGroup: 0         # As the securityContext was not defined in ``workers`` or ``podSecurity``, the value from gid will be used
+      initContainers:
+        - name: wait-for-airflow-migrations
+      ...
+      containers:
+        - name: worker
+      ...
+
+
+

And finally if we set securityContexts but not workers.securityContexts:

+
uid: 40000
+gid: 0
+
+securityContexts:
+  pod:
+    runAsUser: 50000
+    fsGroup: 0
+
+workers:
+  securityContexts: {}
+
+
+

This will generate the following worker deployment:

+
kind: StatefulSet
+apiVersion: apps/v1
+metadata:
+  name: airflow-worker
+spec:
+  serviceName: airflow-worker
+  template:
+    spec:
+      securityContext:     # As the securityContexts was not defined in ``workers``, the values from securityContexts will take priority
+        runAsUser: 50000
+        fsGroup: 0
+      initContainers:
+        - name: wait-for-airflow-migrations
+      ...
+      containers:
+        - name: worker
+      ...
+
+
+
+
+

Built-in secrets and environment variables

+

The Helm Chart by default uses Kubernetes Secrets to store secrets that are needed by Airflow. +The contents of those secrets are by default turned into environment variables that are read by +Airflow (some of the environment variables have several variants to support older versions of Airflow).

+

By default, the secret names are determined from the Release Name used when the Helm Chart is deployed, +but you can also use a different secret to set the variables or disable using secrets +entirely and rely on environment variables (specifically if you want to use _CMD or __SECRET variant +of the environment variable.

+

However, Airflow supports other variants of setting secret configuration - you can specify a system +command to retrieve and automatically rotate the secret (by defining variable with _CMD suffix) or +to retrieve a variable from secret backed (by defining the variable with _SECRET suffix).

+

If the <VARIABLE_NAME>> is set, it takes precedence over the _CMD and _SECRET variant, so +if you want to set one of the _CMD or _SECRET variants, you MUST disable the built in +variables retrieved from Kubernetes secrets, by setting .Values.enableBuiltInSecretEnvVars.<VARIABLE_NAME> +to false.

+

For example in order to use a command to retrieve the DB connection you should (in your values.yaml +file) specify:

+
extraEnv:
+  AIRFLOW_CONN_AIRFLOW_DB_CMD: "/usr/local/bin/retrieve_connection_url"
+enableBuiltInSecretEnvVars:
+  AIRFLOW_CONN_AIRFLOW_DB: false
+
+
+

Here is the full list of secrets that can be disabled and replaced by _CMD and _SECRET variants:

+ +++++ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

Default secret name if secret name not specified

Use a different Kubernetes Secret

Airflow Environment Variable

<RELEASE_NAME>-airflow-metadata

.Values.data.metadataSecretName

+
AIRFLOW_CONN_AIRFLOW_DB
+
AIRFLOW__DATABASE__SQL_ALCHEMY_CONN
+
+

<RELEASE_NAME>-fernet-key

.Values.fernetKeySecretName

AIRFLOW__CORE__FERNET_KEY

<RELEASE_NAME>-webserver-secret-key

.Values.webserverSecretKeySecretName

AIRFLOW__WEBSERVER__SECRET_KEY

<RELEASE_NAME>-airflow-result-backend

.Values.data.resultBackendSecretName

+
AIRFLOW__CELERY__CELERY_RESULT_BACKEND
+
AIRFLOW__CELERY__RESULT_BACKEND
+
+

<RELEASE_NAME>-airflow-brokerUrl

.Values.data.brokerUrlSecretName

AIRFLOW__CELERY__BROKER_URL

<RELEASE_NAME>-elasticsearch

.Values.elasticsearch.secretName

+
AIRFLOW__ELASTICSEARCH__HOST
+
AIRFLOW__ELASTICSEARCH__ELASTICSEARCH_HOST
+
+
+

There are also a number of secrets, which names are also determined from the release name, that do not need to +be disabled. This is because either they do not follow the _CMD or _SECRET pattern, are variables +which do not start with AIRFLOW__, or they do not have a corresponding variable.

+

There is also one _AIRFLOW__* variable, AIRFLOW__CELERY__FLOWER_BASIC_AUTH, that does not need to be disabled, +even if you want set the _CMD and _SECRET variant. This variable is not set by default. It is only set +when .Values.flower.secretName is set or when .Values.flower.user and .Values.flower.password +are set. So if you do not set any of the .Values.flower.* variables, you can freely configure +flower Basic Auth using the _CMD or _SECRET variant without disabling the basic variant.

+ +++++ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +

Default secret name if secret name not specified

Use a different Kubernetes Secret

Airflow Environment Variable

<RELEASE_NAME>-redis-password

.Values.redis.passwordSecretName

REDIS_PASSWORD

<RELEASE_NAME>-pgbouncer-config

.Values.pgbouncer.configSecretName

<RELEASE_NAME>-pgbouncer-certificates

<RELEASE_NAME>-registry

.Values.registry.secretName

<RELEASE_NAME>-kerberos-keytab

<RELEASE_NAME>-flower

.Values.flower.secretName

AIRFLOW__CELERY__FLOWER_BASIC_AUTH

+

You can read more about advanced ways of setting configuration variables in the +Setting Configuration Options.

+
+
+ + + +
+ +
+
+
+
+
+

Was this entry helpful?

+
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+
+ +
+ + + + + + +
+ + + + + + + + + + + + + + + +
+ + + + +
+ + +
+ + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/docs-archive/helm-chart/1.14.0/quick-start.html b/docs-archive/helm-chart/1.14.0/quick-start.html new file mode 100644 index 00000000000..05a15205a28 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/quick-start.html @@ -0,0 +1,1094 @@ + + + + + + + + + + + + Quick start with kind — helm-chart Documentation + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ + +
+ + +
+ + +
+
+
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+
+
+
+ +
+ + +
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+ + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+
+
+

Quick start with kind

+

This article will show you how to install Airflow using Helm Chart on Kind

+
+

Install kind, and create a cluster

+

We recommend testing with Kubernetes 1.20+, example:

+
kind create cluster --image kindest/node:v1.21.1
+
+
+

Confirm it’s up:

+
kubectl cluster-info --context kind-kind
+
+
+
+
+

Add Airflow Helm Stable Repo

+
helm repo add apache-airflow https://airflow.apache.org
+helm repo update
+
+
+
+
+

Create namespace

+
export NAMESPACE=example-namespace
+kubectl create namespace $NAMESPACE
+
+
+
+
+

Install the chart

+
export RELEASE_NAME=example-release
+helm install $RELEASE_NAME apache-airflow/airflow --namespace $NAMESPACE
+
+
+

Use the following code to install the chart with Example DAGs:

+
export NAMESPACE=example-namespace
+helm install $RELEASE_NAME apache-airflow/airflow \
+  --namespace $NAMESPACE \
+  --set-string "env[0].name=AIRFLOW__CORE__LOAD_EXAMPLES" \
+  --set-string "env[0].value=True"
+
+
+

It may take a few minutes. Confirm the pods are up:

+
kubectl get pods --namespace $NAMESPACE
+helm list --namespace $NAMESPACE
+
+
+

Run the following command +to port-forward the Airflow UI to http://localhost:8080/ to confirm +Airflow is working.

+
kubectl port-forward svc/$RELEASE_NAME-webserver 8080:8080 --namespace $NAMESPACE
+
+
+
+
+

Extending Airflow Image

+

The Apache Airflow community, releases Docker Images which are reference images for Apache Airflow. +However, when you try it out you want to add your own DAGs, custom dependencies, +packages, or even custom providers.

+
+

Note

+

Creating custom images means that you need to maintain also a level of automation as you need to re-create the images +when either the packages you want to install or Airflow is upgraded. Please do not forget about keeping these scripts. +Also keep in mind, that in cases when you run pure Python tasks, you can use the +Python Virtualenv functions +which will dynamically source and install python dependencies during runtime. With Airflow 2.8.0 Virtualenvs can also be cached.

+
+

The best way to achieve it, is to build your own, custom image.

+
+

Adding DAGs to your image

+
    +

  1. Create a project

    +
    +
    mkdir my-airflow-project && cd my-airflow-project
+mkdir dags  # put dags here
+cat <<EOM > Dockerfile
+FROM apache/airflow
+COPY . .
+EOM
+
    +
    +
    +
    2. +

  2. Then build the image:

    +
    +
    docker build --pull --tag my-dags:0.0.1 .
+
    +
    +
    +
    3. +

  3. Load the image into kind:

    +
    +
    kind load docker-image my-dags:0.0.1
+
    +
    +
    +
    4. +

  4. Upgrade Helm deployment:

    +
    +
    helm upgrade $RELEASE_NAME apache-airflow/airflow --namespace $NAMESPACE \
+    --set images.airflow.repository=my-dags \
+    --set images.airflow.tag=0.0.1
+
    +
    +
    +
    5. +
+
+
+

Adding apt packages to your image

+

Example below adds vim apt package.

+
    +

  1. Create a project

    +
    +
    mkdir my-airflow-project && cd my-airflow-project
+cat <<EOM > Dockerfile
+FROM apache/airflow
+USER root
+RUN apt-get update \
+  && apt-get install -y --no-install-recommends \
+         vim \
+  && apt-get autoremove -yqq --purge \
+  && apt-get clean \
+  && rm -rf /var/lib/apt/lists/*
+USER airflow
+EOM
+
    +
    +
    +
    2. +

  2. Then build the image:

    +
    +
    docker build --pull --tag my-image:0.0.1 .
+
    +
    +
    +
    3. +

  3. Load the image into kind:

    +
    +
    kind load docker-image my-image:0.0.1
+
    +
    +
    +
    4. +

  4. Upgrade Helm deployment:

    +
    +
    helm upgrade $RELEASE_NAME apache-airflow/airflow --namespace $NAMESPACE \
+    --set images.airflow.repository=my-image \
+    --set images.airflow.tag=0.0.1
+
    +
    +
    +
    5. +
+
+
+

Adding PyPI packages to your image

+

Example below adds lxml PyPI package.

+
    +

  1. Create a project

    +
    +
    mkdir my-airflow-project && cd my-airflow-project
+cat <<EOM > Dockerfile
+FROM apache/airflow
+RUN pip install --no-cache-dir lxml
+EOM
+
    +
    +
    +
    2. +

  2. Then build the image:

    +
    +
    docker build --pull --tag my-image:0.0.1 .
+
    +
    +
    +
    3. +

  3. Load the image into kind:

    +
    +
    kind load docker-image my-image:0.0.1
+
    +
    +
    +
    4. +

  4. Upgrade Helm deployment:

    +
    +
    helm upgrade $RELEASE_NAME apache-airflow/airflow --namespace $NAMESPACE \
+    --set images.airflow.repository=my-image \
+    --set images.airflow.tag=0.0.1
+
    +
    +
    +
    5. +
+
+
+

Further extending and customizing the image

+

See Building the image for more +details on how you can extend and customize the Airflow image.

+
+
+
+ + + +
+ +
+
+
+
+
+

Was this entry helpful?

+
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+
+ +
+ + + + + + +
+ + + + + + + + + + + + + + + +
+ + + + +
+ + +
+ + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/docs-archive/helm-chart/1.14.0/release_notes.html b/docs-archive/helm-chart/1.14.0/release_notes.html new file mode 100644 index 00000000000..f3da1b4e2c1 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/release_notes.html @@ -0,0 +1,2556 @@ + + + + + + + + + + + + Release Notes — helm-chart Documentation + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ + +
+ + +
+ + +
+
+
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+
+
+
+ +
+ + +
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+ + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+
+
+

Release Notes

+
+
+ +

Run helm repo update before upgrading the chart to the latest version.

+
+

Airflow Helm Chart 1.14.0 (2024-06-18)

+
+

Significant Changes

+
+

ClusterRole and ClusterRoleBinding names have been updated to be unique (#37197)

+

ClusterRole``s and ``ClusterRoleBinding``s created when ``multiNamespaceMode is enabled have been renamed to ensure unique names:

+
+
    +

  • {{ include "airflow.fullname" . }}-pod-launcher-role has been renamed to {{ .Release.Namespace }}-{{ include "airflow.fullname" . }}-pod-launcher-role

    • +

  • {{ include "airflow.fullname" . }}-pod-launcher-rolebinding has been renamed to {{ .Release.Namespace }}-{{ include "airflow.fullname" . }}-pod-launcher-rolebinding

    • +

  • {{ include "airflow.fullname" . }}-pod-log-reader-role has been renamed to {{ .Release.Namespace }}-{{ include "airflow.fullname" . }}-pod-log-reader-role

    • +

  • {{ include "airflow.fullname" . }}-pod-log-reader-rolebinding has been renamed to {{ .Release.Namespace }}-{{ include "airflow.fullname" . }}-pod-log-reader-rolebinding

    • +

  • {{ include "airflow.fullname" . }}-scc-rolebinding has been renamed to {{ .Release.Namespace }}-{{ include "airflow.fullname" . }}-scc-rolebinding

    • +
+
+
+
+

workers.safeToEvict default changed to False (#40229)

+

The default for workers.safeToEvict now defaults to False. This is a safer default +as it prevents the nodes workers are running on from being scaled down by the +K8s Cluster Autoscaler. +If you would like to retain the previous behavior, you can set this config to True.

+
+
+

Default Airflow image is updated to 2.9.2 (#40160)

+

The default Airflow image that is used with the Chart is now 2.9.2, previously it was 2.8.3.

+
+
+

Default StatsD image is updated to v0.26.1 (#38416)

+

The default StatsD image that is used with the Chart is now v0.26.1, previously it was v0.26.0.

+
+
+
+

New Features

+
    +

  • Enable MySQL KEDA support for triggerer (#37365)

    • +

  • Allow AWS Executors (#38524)

    • +
+
+
+

Improvements

+
    +

  • Allow valueFrom in env config of components (#40135)

    • +

  • Enable templating in extraContainers and extraInitContainers (#38507)

    • +

  • Add safe-to-evict annotation to pod-template-file (#37352)

    • +

  • Support workers.command for KubernetesExecutor (#39132)

    • +

  • Add priorityClassName to Jobs (#39133)

    • +

  • Add Kerberos sidecar to pod-template-file (#38815)

    • +

  • Add templated field support for extra containers (#38510)

    • +
+
+
+

Bug Fixes

+
    +

  • Set workers.safeToEvict default to False (#40229)

    • +
+
+
+

Doc only changes

+
    +

  • Document extraContainers and extraInitContainers that are templated (#40033)

    • +

  • Fix typo in HorizontalPodAutoscaling documentation (#39307)

    • +

  • Fix supported k8s versions in docs (#39172)

    • +

  • Fix typo in YAML path for brokerUrlSecretName (#39115)

    • +
+
+
+

Misc

+
    +

  • Default Airflow version to 2.9.2 (#40160)

    • +

  • Limit Redis image to 7.2 (#38928)

    • +

  • Build Helm values schemas with Kubernetes 1.29 resources (#38460)

    • +

  • Add missing containers to resources docs (#38534)

    • +

  • Upgrade StatsD Exporter image to 0.26.1 (#38416)

    • +

  • Remove K8S 1.25 support (#38367)

    • +
+
+
+
+

Airflow Helm Chart 1.13.1 (2024-03-25)

+
+

Significant Changes

+
+

Default Airflow image is updated to 2.8.3 (#38036)

+

The default Airflow image that is used with the Chart is now 2.8.3, previously it was 2.8.2.

+
+
+
+

Bug Fixes

+
    +

  • Don’t overwrite .Values.airflowPodAnnotations (#37917)

    • +

  • Fix cluster-wide RBAC naming clash when using multiple multiNamespace releases with the same name (#37197)

    • +
+
+
+

Misc

+
    +

  • Chart: Default airflow version to 2.8.3 (#38036)

    • +
+
+
+
+

Airflow Helm Chart 1.13.0 (2024-03-05)

+
+

Significant Changes

+
+

Default Airflow image is updated to 2.8.2 (#37704)

+

The default Airflow image that is used with the Chart is now 2.8.2, previously it was 2.8.1.

+
+
+
+

New Features

+
    +

  • Support labels specific to the database migration objects and pods (#37490)

    • +
+
+
+

Improvements

+
    +

  • Flower K8s Probe config (#37528)

    • +
+
+
+

Bug Fixes

+
    +

  • Remove duplicate ports key in webserver service (#37356)

    • +

  • Add AIRFLOW_HOME env var to log groomer sidecar (#37588)

    • +

  • Skip . path when preparing reproducible packages (#37402)

    • +
+
+
+

Misc

+
    +

  • Default airflow version to 2.8.2 (#37704)

    • +
+
+
+
+

Airflow Helm Chart 1.12.0 (2024-02-11)

+
+

Significant Changes

+
+

The helm chart is now using a newer version of bitnami/postgresql dependency (#34817)

+

The version of bitnami/postgresql subchart upgraded from 12.10.0 to 13.2.24. +The version of PostgreSQL binaries upgraded from 11 to 16.1.0.

+

The change requires existing bitnami/postgresql subchart users to perform manual major version upgrade using pg_dumpall or pg_upgrade.

+

As a reminder, it is recommended to set up an external database in production.

+
+
+

Default Airflow image is updated to 2.8.1 (#36907)

+

The default Airflow image that is used with the Chart is now 2.8.1, previously it was 2.7.1.

+
+
+

Default PgBouncer and PgBouncer Exporter images have been updated (#36898)

+

The PgBouncer and PgBouncer Exporter images are based on newer software/os.

+
+
    +

  • pgbouncer: 1.21.0 based on alpine 3.14 (airflow-pgbouncer-2024.01.19-1.21.0)

    • +

  • pgbouncer-exporter: 0.16.0 based on alpine 3.19 (apache/airflow:airflow-pgbouncer-exporter-2024.01.19-0.16.0)

    • +
+
+
+
+

Default StatsD image is updated to v0.26.0 (#37187)

+

The default StatsD image that is used with the Chart is now v0.26.0, previously it was v0.22.8.

+
+
+

Default Redis image is updated to 7-bookworm (#37187)

+

The default Redis image that is used with the Chart is now 7-bookworm, previously it was 7-bullseye.

+
+
+
+

New Features

+
    +

  • Enable native HPA for Airflow Workers (#36174)

    • +

  • Add init container + sidecar support for Airflow Kerberos (#35548)

    • +

  • Support MySQL backend as KEDA trigger (#36167)

    • +
+
+
+

Improvements

+
    +

  • Improve PriorityClass to improve debuggability (#36365)

    • +

  • Add securityContexts in dag processors log groomer sidecar (#34499)

    • +

  • Add support for securityContexts in dag processors wait-for-migrations container (#35593)

    • +

  • Add templating for PVC storageClassName (#35581)

    • +

  • Add volumeClaimTemplate for worker (#34986)

    • +

  • Add support for priorityClassName on Redis pods (#34879)

    • +

  • Configurable mount path for DAGs volume (#35083)

    • +

  • Add support for custom emptyDir config (#34837)

    • +

  • Added ability to enable/disable scheduler and webserver (#36991)

    • +
+
+
+

Bug Fixes

+
    +

  • Fix StatsD host in Airflow config (#35679)

    • +

  • Set AIRFLOW_HOME env var with airflowHome value (#34839)

    • +

  • Safer worker pod annotations (#35309)

    • +

  • Set worker safeToEvict properly (#35130)

    • +

  • Fix Redis broker URL with useStandardNaming (#34825)

    • +

  • Fix metadata DB & port in KEDA connection when usePgbouncer is false (#34741)

    • +

  • Fix PgBouncer connection with useStandardNaming (#34787)

    • +
+
+
+

Doc only changes

+
    +

  • Add docs about extending the Airflow Helm chart (#36331)

    • +

  • Add comment for Elasticsearch connection scheme (#35588)

    • +

  • Add notes about Virtualenvs preventing the need for custom images (#35306)

    • +
+
+
+

Misc

+
    +

  • Default Airflow version to 2.8.1 (#36907)

    • +

  • Support git-sync v4 (#34731)

    • +

  • Upgrade bitnami/postgresql subchart to 13.2.24 (#36156)

    • +

  • Change git sync container indent to 4 (#35824)

    • +

  • Remove K8S 1.24 support (#35214)

    • +

  • Rebuild pgbouncer and pgbouncer-exporter images with newer versions (#36898)

    • +

  • Update statsd and redis chart images (#37187)

    • +
+
+
+
+

Airflow Helm Chart 1.11.0 (2023-10-02)

+
+

Significant Changes

+
+

Support naming customization on helm chart resources, some resources may be renamed during upgrade (#31066)

+

This is a new opt-in switch useStandardNaming, for backwards compatibility, to leverage the standard naming convention, which allows full use of fullnameOverride and nameOverride in all resources.

+

The following resources will be renamed using default of useStandardNaming=false when upgrading to 1.11.0 or a higher version.

+
    +

  • ConfigMap {release}-airflow-config to {release}-config

    • +

  • Secret {release}-airflow-metadata to {release}-metadata

    • +

  • Secret {release}-airflow-result-backend to {release}-result-backend

    • +

  • Ingress {release}-airflow-ingress to {release}-ingress

    • +
+

For existing installations, all your resources will be recreated with a new name and Helm will delete the previous resources.

+

This won’t delete existing PVCs for logs used by StatefulSet/Deployments, but it will recreate them with brand new PVCs. +If you do want to preserve logs history you’ll need to manually copy the data of these volumes into the new volumes after +deployment. Depending on what storage backend/class you’re using this procedure may vary. If you don’t mind starting +with fresh logs/redis volumes, you can just delete the old PVCs that will be names, for example:

+
kubectl delete pvc -n airflow logs-gta-triggerer-0
+kubectl delete pvc -n airflow logs-gta-worker-0
+kubectl delete pvc -n airflow redis-db-gta-redis-0
+
+
+

If you do not change useStandardNaming or fullnameOverride after upgrade, you can proceed as usual and no unexpected behaviours will be presented.

+
+
+

bitnami/postgresql subchart updated to 12.10.0 (#33747)

+

The PostgreSQL subchart that is used with the Chart is now 12.10.0, previously it was 12.1.9.

+
+
+

Default git-sync image is updated to 3.6.9 (#33748)

+

The default git-sync image that is used with the Chart is now 3.6.9, previously it was 3.6.3.

+
+
+

Default Airflow image is updated to 2.7.1 (#34186)

+

The default Airflow image that is used with the Chart is now 2.7.1, previously it was 2.6.2.

+
+
+
+

New Features

+
    +

  • Add support for scheduler name to PODs templates (#33843)

    • +

  • Support KEDA scaling for triggerer (#32302)

    • +

  • Add support for container lifecycle hooks (#32349, #34677)

    • +

  • Support naming customization on helm chart resources (#31066)

    • +

  • Adding startupProbe to scheduler and webserver (#33107)

    • +

  • Allow disabling token mounts using automountServiceAccountToken (#32808)

    • +

  • Add support for defining custom priority classes (#31615)

    • +

  • Add support for runtimeClassName (#31868)

    • +

  • Add support for custom query in workers KEDA trigger (#32308)

    • +
+
+
+

Improvements

+
    +

  • Add containerSecurityContext for cleanup job (#34351)

    • +

  • Add existing secret support for PGBouncer metrics exporter (#32724)

    • +

  • Allow templating in webserver ingress hostnames (#33142)

    • +

  • Allow templating in flower ingress hostnames (#33363)

    • +

  • Add configmap annotations to StatsD and webserver (#33340)

    • +

  • Add pod security context to PgBouncer (#32662)

    • +

  • Add an option to use a direct DB connection in KEDA when PgBouncer is enabled (#32608)

    • +

  • Allow templating in cleanup.schedule (#32570)

    • +

  • Template dag processor waitformigration containers extraVolumeMounts (#32100)

    • +

  • Ability to inject extra containers into PgBouncer (#33686)

    • +

  • Allowing ability to add custom env into PgBouncer container (#33438)

    • +

  • Add support for env variables in the StatsD container (#33175)

    • +
+
+
+

Bug Fixes

+
    +

  • Add airflow db migrate command to database migration job (#34178)

    • +

  • Pass workers.terminationGracePeriodSeconds into KubeExecutor pod template (#33514)

    • +

  • CeleryExecutor namespace depends on Airflow version (#32753)

    • +

  • Fix dag processor not including webserver config volume (#32644)

    • +

  • Dag processor liveness probe include --local and --job-type args (#32426)

    • +

  • Revising flower_url_prefix considering default value (#33134)

    • +
+
+
+

Doc only changes

+
    +

  • Add more explicit “embedded postgres” exclusion for production (#33034)

    • +

  • Update git-sync description (#32181)

    • +
+
+
+

Misc

+
    +

  • Default Airflow version to 2.7.1 (#34186)

    • +

  • Update PostgreSQL subchart to 12.10.0 (#33747)

    • +

  • Update git-sync to 3.6.9 (#33748)

    • +

  • Remove unnecessary loops to load env from helm values (#33506)

    • +

  • Replace common.tplvalues.render with tpl in ingress template files (#33384)

    • +

  • Remove K8S 1.23 support (#32899)

    • +

  • Fix chart named template comments (#32681)

    • +

  • Remove outdated comment from chart values in the workers KEDA conf section (#32300)

    • +

  • Remove unnecessary or function in template files (#34415)

    • +
+
+
+
+

Airflow Helm Chart 1.10.0 (2023-06-26)

+
+

Significant Changes

+
+

Default Airflow image is updated to 2.6.2 (#31979)

+

The default Airflow image that is used with the Chart is now 2.6.2, previously it was 2.5.3.

+
+
+
+

New Features

+
    +

  • Add support for container security context (#31043)

    • +
+
+
+

Improvements

+
    +

  • Validate executor and config.core.executor match (#30693)

    • +

  • Support minAvailable property for PodDisruptionBudget (#30603)

    • +

  • Add volumeMounts to dag processor waitForMigrations (#30990)

    • +

  • Template extra volumes (#30773)

    • +
+
+
+

Bug Fixes

+
    +

  • Fix webserver probes timeout and period (#30609)

    • +

  • Add missing waitForMigrations for workers (#31625)

    • +

  • Add missing priorityClassName to K8S worker pod template (#31328)

    • +

  • Adding log groomer sidecar to dag processor (#30726)

    • +

  • Do not propagate global security context to statsd and redis (#31865)

    • +
+
+
+

Misc

+
    +

  • Default Airflow version to 2.6.2 (#31979)

    • +

  • Use template comments for the chart license header (#30569)

    • +

  • Align apiVersion and kind order in chart templates (#31850)

    • +

  • Cleanup Kubernetes < 1.23 support (#31847)

    • +
+
+
+
+

Airflow Helm Chart 1.9.0 (2023-04-14)

+
+

Significant Changes

+
+

Default PgBouncer and PgBouncer Exporter images have been updated (#29919)

+

The PgBouncer and PgBouncer Exporter images are based on newer software/os. They are also multi-platform AMD/ARM images:

+
+
    +

  • pgbouncer: 1.16.1 based on alpine 3.14 (airflow-pgbouncer-2023.02.24-1.16.1)

    • +

  • pgbouncer-exporter: 0.14.0 based on alpine 3.17 (apache/airflow:airflow-pgbouncer-exporter-2023.02.21-0.14.0)

    • +
+
+
+
+

Default Airflow image is updated to 2.5.3 (#30411)

+

The default Airflow image that is used with the Chart is now 2.5.3, previously it was 2.5.1.

+
+
+
+

New Features

+
    +

  • Add support for hostAliases for Airflow webserver and scheduler (#30051)

    • +

  • Add support for annotations on StatsD Deployment and cleanup CronJob (#30126)

    • +

  • Add support for annotations in logs PVC (#29270)

    • +

  • Add support for annotations in extra ConfigMap and Secrets (#30303)

    • +

  • Add support for pod annotations to PgBouncer (#30168)

    • +

  • Add support for ttlSecondsAfterFinished on migrateDatabaseJob and createUserJob (#29314)

    • +

  • Add support for using SHA digest of Docker images (#30214)

    • +
+
+
+

Improvements

+
    +

  • Template extra volumes in Helm Chart (#29357)

    • +

  • Make Liveness/Readiness Probe timeouts configurable for PgBouncer Exporter (#29752)

    • +

  • Enable individual trigger logging (#29482)

    • +
+
+
+

Bug Fixes

+
    +

  • Add config.kubernetes_executor to values (#29818)

    • +

  • Block extra properties in image config (#30217)

    • +

  • Remove replicas if KEDA is enabled (#29838)

    • +

  • Mount kerberos.keytab to worker when enabled (#29526)

    • +

  • Fix adding annotations for dag persistence PVC (#29622)

    • +

  • Fix bitnami/postgresql default username and password (#29478)

    • +

  • Add global volumes in pod template file (#29295)

    • +

  • Add log groomer sidecar to triggerer service (#29392)

    • +

  • Helm deployment fails when postgresql.nameOverride is used (#29214)

    • +
+
+
+

Doc only changes

+
    +

  • Add gitSync optional env description (#29378)

    • +

  • Add webserver NodePort example (#29460)

    • +

  • Include Rancher in Helm chart install instructions (#28416)

    • +

  • Change RSA SSH host key to reflect update from Github (#30286)

    • +
+
+
+

Misc

+
    +

  • Update Airflow version to 2.5.3 (#30411)

    • +

  • Switch to newer versions of PgBouncer and PgBouncer Exporter in chart (#29919)

    • +

  • Reformat chart templates (#29917)

    • +

  • Reformat chart templates part 2 (#29941)

    • +

  • Reformat chart templates part 3 (#30312)

    • +

  • Replace deprecated k8s registry references (#29938)

    • +

  • Fix airflow_dags_mount formatting (#29296)

    • +

  • Fix webserver.service.ports formatting (#29297)

    • +
+
+
+
+

Airflow Helm Chart 1.8.0 (2023-02-06)

+
+

Significant Changes

+
+

bitnami/postgresql subchart updated to 12.1.9 (#29071)

+

The version of postgresql installed is still version 11.

+

If you are upgrading an existing helm release with the built-in postgres database, you will either need to delete your release and reinstall fresh, or manually delete these 2 objects:

+
kubectl delete secret {RELEASE_NAME}-postgresql
+kubectl delete statefulset {RELEASE_NAME}-postgresql
+
+
+

As a reminder, it is recommended to set up an external database in production.

+

This version of the chart uses different variable names for setting usernames and passwords in the postgres database.

+
    +

  • postgresql.auth.enablePostgresUser is used to determine if the “postgres” admin account will be created.

    • +

  • postgresql.auth.postgresPassword sets the password for the “postgres” user.

    • +

  • postgresql.auth.username and postrgesql.auth.password are used to set credentials for a non-admin account if desired.

    • +

  • postgresql.postgresqlUsername and postgresql.postresqlPassword, which were used in the previous version of the chart, are no longer used.

    • +
+

Users will need to make those changes in their values files if they are changing the Postgres configuration.

+

Previously the subchart version was 10.5.3.

+
+
+

Default dags.gitSync.wait reduced to 5 seconds (#27625)

+

The default for dags.gitSync.wait has been reduced from 60 seconds to 5 seconds to reduce the likelihood of DAGs +becoming inconsistent between Airflow components. This will, however, increase traffic to the remote git repository.

+
+
+

Default Airflow image is updated to 2.5.1 (#29074)

+

The default Airflow image that is used with the Chart is now 2.5.1, previously it was 2.4.1.

+
+
+

Default git-sync image is updated to 3.6.3 (#27848)

+

The default git-sync image that is used with the Chart is now 3.6.3, previously it was 3.4.0.

+
+
+

Default redis image is updated to 7-bullseye (#27443)

+

The default redis image that is used with the Chart is now 7-bullseye, previously it was 6-bullseye.

+
+
+
+

New Features

+
    +

  • Add annotations on deployments (#28688)

    • +

  • Add global volume & volumeMounts to the chart (#27781)

    • +
+
+
+

Improvements

+
    +

  • Add support for webserverConfigConfigMapName (#27419)

    • +

  • Enhance chart to allow overriding command-line args to statsd exporter (#28041)

    • +

  • Add support for NodePort in Services (#26945)

    • +

  • Add worker log-groomer-sidecar enable option (#27178)

    • +

  • Add HostAliases to Pod template file (#27544)

    • +

  • Allow PgBouncer replicas to be configurable (#27439)

    • +
+
+
+

Bug Fixes

+
    +

  • Create scheduler service to serve task logs for LocalKubernetesExecutor (#28828)

    • +

  • Fix NOTES.txt to show correct URL (#28264)

    • +

  • Add worker service account for LocalKubernetesExecutor (#28813)

    • +

  • Remove checks for 1.19 api checks (#28461)

    • +

  • Add airflow_local_settings to all airflow containers (#27779)

    • +

  • Make custom env vars optional for job templates (#27148)

    • +

  • Decrease default gitSync wait (#27625)

    • +

  • Add extraVolumeMounts to sidecars too (#27420)

    • +

  • Fix PgBouncer after PostgreSQL subchart upgrade (#29207)

    • +
+
+
+

Doc only changes

+
    +

  • Enhance production guide with a few Argo specific guidelines (#29078)

    • +

  • Add doc note about Pod template images (#29032)

    • +

  • Update production guide db section (#28610)

    • +

  • Fix to LoadBalancer snippet (#28014)

    • +

  • Fix gitSync example code (#28083)

    • +

  • Correct repo example for cloning via ssh (#27671)

    • +
+
+
+

Misc

+
    +

  • Update Airflow version to 2.5.1 (#29074)

    • +

  • Update git-sync to 3.6.3 (#27848)

    • +

  • Upgrade bitnami/postgresql subchart to 12.1.9 (#29071)

    • +

  • Update redis to 7 (#27443)

    • +

  • Replace helm chart icon (#27704)

    • +
+
+
+
+

Airflow Helm Chart 1.7.0 (2022-10-14)

+
+

Significant Changes

+
+

Default Airflow image is updated to 2.4.1 (#26485)

+

The default Airflow image that is used with the Chart is now 2.4.1, previously it was 2.3.2.

+
+
+
+

New Features

+
    +

  • Make cleanup job history configurable (#26838)

    • +

  • Added labels to specific Airflow components (#25031)

    • +

  • Add StatsD overrideMappings in Helm chart values (#26598)

    • +

  • Adding podAnnotations to StatsD deployment template (#25732)

    • +

  • Container specific extra environment variables (#24784)

    • +

  • Custom labels for extra Secrets and ConfigMaps (#25283)

    • +

  • Add revisionHistoryLimit to all deployments (#25059)

    • +

  • Adding podAnnotations to Redis StatefulSet (#23708)

    • +

  • Provision Standalone Dag Processor (#23711)

    • +

  • Add configurable scheme for webserver probes (#22815)

    • +

  • Add support for KEDA HPA config to Helm chart (#24220)

    • +
+
+
+

Improvements

+
    +

  • Add ‘executor’ label to Airflow scheduler deployment (#25684)

    • +

  • Add default flower_url_prefix in Helm chart values (#26415)

    • +

  • Add liveness probe to Celery workers (#25561)

    • +

  • Use sql_alchemy_conn for celery result backend when result_backend is not set (#24496)

    • +
+
+
+

Bug Fixes

+
    +

  • Fix pod template imagePullPolicy (#26423)

    • +

  • Do not declare a volume for sshKeySecret if dag persistence is enabled (#22913)

    • +

  • Pass worker annotations to generated pod template (#24647)

    • +

  • Fix semver compare number for jobs check command (#24480)

    • +

  • Use --local flag for liveness probes in Airflow 2.5+ (#24999)

    • +
+
+
+

Doc only changes

+
    +

  • Improve documentation on helm hooks disabling (#26747)

    • +

  • Remove ssh:// prefix from git repo value (#26632)

    • +

  • Fix defaultAirflowRepository comment (#26428)

    • +

  • Baking DAGs into Docker image (#26401)

    • +

  • Reload pods when using the same DAG tag (#24576)

    • +

  • Minor clarifications about result_backend, dag processor, and helm uninstall (#24929)

    • +

  • Add hyperlinks to GitHub PRs for Release Notes (#24532)

    • +

  • Terraform should not use Helm hooks for starting jobs (#26604)

    • +

  • Flux should not use Helm hooks for starting jobs (#24288)

    • +

  • Provide details on how to pull Airflow image from a private repository (#24394)

    • +

  • Helm logo no longer a link (#23977)

    • +

  • Document LocalKubernetesExecutor support in chart (#23876)

    • +

  • Update Production Guide (#23836)

    • +
+
+
+

Misc

+
    +

  • Default Airflow version to 2.4.1 (#26485)

    • +

  • Vendor in the Bitnami chart (#24395)

    • +

  • Remove kubernetes 1.20 support (#25871)

    • +
+
+
+
+

Airflow Helm Chart 1.6.0 (2022-05-20)

+
+

Significant Changes

+
+

Default Airflow image is updated to 2.3.0 (#23386)

+

The default Airflow image that is used with the Chart is now 2.3.0, previously it was 2.2.4.

+
+
+

ingress.enabled is deprecated

+

Instead of having a single flag to control ingress resources for both the webserver and flower, there +are now separate flags to control them individually, ingress.web.enabled and ingress.flower.enabled. +ingress.enabled is now deprecated, but will still continue to control them both.

+
+
+

Flower disabled by default

+

Flower is no longer enabled by default when using CeleryExecutor. If you’d like to deploy it, set +flower.enabled to true in your values file.

+
+
+
+

New Features

+
    +

  • Support annotations on volumeClaimTemplates (#23433)

    • +

  • Add support for topologySpreadConstraints to Helm Chart (#22712)

    • +

  • Helm support for LocalKubernetesExecutor (#22388)

    • +

  • Add securityContext config for Redis to Helm chart (#22182)

    • +

  • Allow annotations on Helm DAG PVC (#22261)

    • +

  • enable optional subPath for DAGs volume mount (#22323)

    • +

  • Added support to override auth_type in auth_file in PgBouncer Helm configuration (#21999)

    • +

  • Add extraVolumeMounts to Flower (#22414)

    • +

  • Add webserver PodDisruptionBudget (#21735)

    • +
+
+
+

Improvements

+
    +

  • Ensure the messages from migration job show up early (#23479)

    • +

  • Allow migration jobs and init containers to be optional (#22195)

    • +

  • Use jobs check command for liveness probe check in Airflow 2 (#22143)

    • +
+
+
+

Doc only changes

+
    +

  • Adds resultBackendSecretName warning in Helm production docs (#23307)

    • +
+
+
+

Misc

+
    +

  • Update default Airflow version to 2.3.0 (#23386)

    • +

  • Move the database configuration to a new section (#22284)

    • +

  • Disable flower in chart by default (#23737)

    • +
+
+
+
+

Airflow Helm Chart 1.5.0, (2022-03-07)

+
+

Significant changes

+
+

Default Airflow image is updated to 2.2.4

+

The default Airflow image that is used with the Chart is now 2.2.4, previously it was 2.2.3.

+
+
+

Removed config.api

+

This section configured the authentication backend for the Airflow API but used the same values as the Airflow default setting, which made it unnecessary to +declare the same again.

+
+
+
+

New Features

+
    +

  • Add support for custom command and args in jobs (#20864)

    • +

  • Support for priorityClassName (#20794)

    • +

  • Add envFrom to the Flower deployment (#21401)

    • +

  • Add annotations to cleanup pods (#21484)

    • +
+
+
+

Improvements

+
    +

  • Speedup liveness probe for scheduler and triggerer (#20833, #21108)

    • +

  • Update git-sync to v3.4.0 (#21309)

    • +

  • Remove default auth backend setting (#21640)

    • +
+
+
+

Bug Fixes

+
    +

  • Fix elasticsearch URL when username/password are empty (#21222)

    • +

  • Mount airflow.cfg in wait-for-airflow-migrations containers (#20609)

    • +

  • Grant pod log reader to triggerer ServiceAccount (#21111)

    • +
+
+
+

Doc only changes

+
    +

  • Simplify chart docs for configuring Airflow (#21747)

    • +

  • Add extra information about time synchronization needed (#21685)

    • +

  • Fix extra containers docs (#20787)

    • +
+
+
+

Misc

+
    +

  • Use 2.2.4 as default Airflow version (#21745)

    • +

  • Change Redis image to bullseye (#21875)

    • +
+
+
+
+

Airflow Helm Chart 1.4.0, (2022-01-10)

+
+

Significant changes

+
+

Default Airflow image is updated to 2.2.3

+

The default Airflow image that is used with the Chart is now 2.2.3, previously it was 2.2.1.

+
+
+

ingress.web.hosts and ingress.flower.hosts parameters data type has changed and ingress.web.tls and ingress.flower.tls have moved

+

ingress.web.hosts and ingress.flower.hosts have had their types have been changed from an array of strings to an array of objects. ingress.web.tls and ingress.flower.tls can now be specified per host in ingress.web.hosts and ingress.flower.hosts respectively.

+

The old parameter names will continue to work, however support for them will be removed in a future release so please update your values file.

+
+
+

Fixed precedence of nodeSelector, affinity and tolerations params

+

nodeSelector, affinity and tolerations params precedence has been fixed on all components. Now component-specific params +(e.g. webserver.affinity) takes precedence over the global param (e.g. affinity).

+
+
+

Default KubernetesExecutor worker affinity removed

+

Previously a default affinity was added to KubernetesExecutor workers to spread the workers out across nodes. This default affinity is no +longer set because, in general, there is no reason to spread task-specific workers across nodes.

+
+
+

Changes in webserver and flower NetworkPolicy default ports

+

The defaults for webserver.networkPolicy.ingress.ports and flower.networkPolicy.ingress.ports moved away from using named ports to numerical ports to avoid issues with OpenShift.

+
+
+

Increase default livenessProbe timeoutSeconds for scheduler and triggerer

+

The default timeout for the scheduler and triggerer livenessProbe has been increased from 10 seconds to 20 seconds.

+
+
+
+

New Features

+
    +

  • Add type to extra secrets param (#20599)

    • +

  • Support elasticsearch connection scheme (#20564)

    • +

  • Allows to disable built-in secret variables individually (#18974)

    • +

  • Add support for securityContext (#18249)

    • +

  • Add extra containers, volumes and volume mounts for jobs (#18808)

    • +

  • Allow ingress multiple hostnames w/diff secrets (#18542)

    • +

  • PgBouncer extra volumes, volume mounts, and sslmode (#19749)

    • +

  • Allow specifying kerberos keytab (#19054)

    • +

  • Allow disabling the Helm hooks (#18776, #20018)

    • +

  • Add migration-wait-timeout (#20069)

    • +
+
+
+

Improvements

+
    +

  • Increase default livenessProbe timeout (#20698)

    • +

  • Strict schema for k8s objects for values.yaml (#19181)

    • +

  • Remove unnecessary pod_template_file defaults (#19690)

    • +

  • Use built-in check-migrations command for Airflow>=2 (#19676)

    • +
+
+
+

Bug Fixes

+
    +

  • Fix precedence of affinity, nodeSelector, and tolerations (#20641)

    • +

  • Fix chart elasticsearch default port 80 to 9200. (#20616)

    • +

  • Fix network policy issue for webserver and flower ui (#20199)

    • +

  • Use local definitions for k8s schema validation (#20544)

    • +

  • Add custom labels for ingresses/PVCs (#20535)

    • +

  • Fix extra secrets/configmaps labels (#20464)

    • +

  • Fix flower restarts on update (#20316)

    • +

  • Properly quote namespace names (#20266)

    • +
+
+
+

Doc only changes

+
    +

  • Add helm dependency update step to chart INSTALL (#20702)

    • +

  • Reword section covering the envvar secrets (#20566)

    • +

  • Add “Customizing Workers” page (#20331)

    • +

  • Include Datadog example in production guide (#17996)

    • +

  • Update production Helm guide database section to use k8s secret (#19892)

    • +

  • Fix multiNamespaceMode docs to also cover KPO (#19879)

    • +

  • Clarify Helm behaviour when it comes to loading default connections (#19708)

    • +
+
+
+

Misc

+
    +

  • Use 2.2.3 as default Airflow version (#20450)

    • +

  • Add ArtifactHUB annotations for docs and screenshots (#20558)

    • +

  • Add kubernetes 1.21 support (#19557)

    • +
+
+
+
+

Airflow Helm Chart 1.3.0 (2021-11-08)

+
+

Significant changes

+
+

Default Airflow image is updated to 2.2.1

+

The default Airflow image that is used with the Chart is now 2.2.1 (which is Python 3.7), previously it was 2.1.4 (which is Python 3.6).

+

The triggerer component requires Python 3.7. If you require Python 3.6 and Airflow 2.2.0 or later, use a 3.6 based image and set triggerer.enabled=False in your values.

+
+
+

Resources made configurable for airflow-run-airflow-migrations job

+

Now it’s possible to set resources requests and limits for migration job through migrateDatabaseJob.resources value.

+
+
+
+

New Features

+
    +

  • Chart: Add resources for cleanup and createuser jobs (#19263)

    • +

  • Chart: Add labels to jobs created by cleanup pods (#19225)

    • +

  • Add migration job resources (#19175)

    • +

  • Allow custom pod annotations to all components (#18481)

    • +

  • Chart: Make PgBouncer cmd/args configurable (#18910)

    • +

  • Chart: Use python 3.7 by default; support disabling triggerer (#18920)

    • +
+
+
+

Improvements

+
    +

  • Chart: Increase default liveness probe timeout (#19003)

    • +

  • Chart: Mount DAGs in triggerer (#18753)

    • +
+
+
+

Bug Fixes

+
    +

  • Allow Airflow UI to create worker pod via Clear > Run (#18272)

    • +

  • Allow Airflow standard images to run in OpenShift utilizing the official Helm chart #18136 (#18147)

    • +
+
+
+

Doc only changes

+
    +

  • Chart: Fix extraEnvFrom examples (#19144)

    • +

  • Chart docs: Update webserver secret key reference configuration (#18595)

    • +

  • Fix helm chart links in source install guide (#18588)

    • +
+
+
+

Misc

+
    +

  • Chart: Update default Airflow version to 2.2.1 (#19326)

    • +

  • Modernize dockerfiles builds (#19327)

    • +

  • Chart: Use strict k8s schemas for template validation (#19379)

    • +
+
+
+
+

Airflow Helm Chart 1.2.0 (2021-09-28)

+
+

Significant Changes

+
+

ingress.web.host and ingress.flower.host parameters have been renamed and data type changed

+

ingress.web.host and ingress.flower.host parameters have been renamed to ingress.web.hosts and ingress.flower.hosts, respectively. Their types have been changed from a string to an array of strings.

+

The old parameter names will continue to work, however support for them will be removed in a future release so please update your values file.

+
+
+

Default Airflow version is updated to 2.1.4

+

The default Airflow version that is installed with the Chart is now 2.1.4, previously it was 2.1.2.

+
+
+

Removed ingress.flower.precedingPaths and ingress.flower.succeedingPaths parameters

+

ingress.flower.precedingPaths and ingress.flower.succeedingPaths parameters have been removed as they had previously had no effect on rendered YAML output.

+
+
+

Change of default path on Ingress

+

With the move to support the stable Kubernetes Ingress API the default path has been changed from being unset to /. For most Ingress controllers this should not change the behavior of the resulting Ingress resource.

+
+
+
+

New Features

+
    +

  • Add Triggerer to Helm Chart (#17743)

    • +

  • Chart: warn when webserver secret key isn’t set (#18306)

    • +

  • add extraContainers for migrateDatabaseJob (#18379)

    • +

  • Labels on job templates (#18403)

    • +

  • Chart: Allow running and waiting for DB Migrations using default image (#18218)

    • +

  • Chart: Make cleanup cronjob cmd/args configurable (#17970)

    • +

  • Chart: configurable number of retention days for log groomers (#17764)

    • +

  • Chart: Add loadBalancerSourceRanges in webserver and flower services (#17666)

    • +

  • Chart: Support extraContainers in k8s workers (#17562)

    • +
+
+
+

Improvements

+
    +

  • Switch to latest version of PGBouncer-Exporter (#18429)

    • +

  • Chart: Ability to access http k8s via multiple hostnames (#18257)

    • +

  • Chart: Use stable API versions where available (#17211)

    • +

  • Chart: Allow podTemplate to be templated (#17560)

    • +
+
+
+

Bug Fixes

+
    +

  • Chart: Fix applying labels on Triggerer (#18299)

    • +

  • Fixes warm shutdown for celery worker. (#18068)

    • +

  • Chart: Fix minor Triggerer issues (#18105)

    • +

  • Chart: fix webserver secret key update (#18079)

    • +

  • Chart: fix running with uid 0 (#17688)

    • +

  • Chart: use ServiceAccount template for log reader RoleBinding (#17645)

    • +

  • Chart: Fix elasticsearch-secret template port default function (#17428)

    • +

  • KEDA task count query should ignore k8s queue (#17433)

    • +
+
+
+

Doc only changes

+
    +

  • Chart Doc: Delete extra space in adding connections doc (#18424)

    • +

  • Improves installing from sources pages for all components (#18251)

    • +

  • Chart docs: Format loadBalancerSourceRanges using code-block (#17763)

    • +

  • Doc: Fix a broken link in an ssh-related warning message (#17294)

    • +

  • Chart: Add instructions to Update Helm Repo before upgrade (#17282)

    • +

  • Chart docs: better note for logs existing PVC permissions (#17177)

    • +
+
+
+

Misc

+
    +

  • Chart: Update the default Airflow version to 2.1.4 (#18354)

    • +
+
+
+
+

Airflow Helm Chart 1.1.0 (2021-07-26)

+
+

Significant Changes

+

Run helm repo update before upgrading the chart to the latest version.

+
+

Default Airflow version is updated to 2.1.2

+

The default Airflow version that is installed with the Chart is now 2.1.2, previously it was 2.0.2.

+
+
+

Helm 2 no longer supported

+

This chart has dropped support for Helm 2 as it has been deprecated and no longer receiving security updates since November 2020.

+
+
+

webserver.extraNetworkPolicies and flower.extraNetworkPolicies parameters have been renamed

+

webserver.extraNetworkPolicies and flower.extraNetworkPolicies have been renamed to webserver.networkPolicy.ingress.from and flower.networkPolicy.ingress.from, respectively. Their values and behavior are the same.

+

The old parameter names will continue to work, however support for them will be removed in a future release so please update your values file.

+
+
+

Removed dags.gitSync.root, dags.gitSync.dest, and dags.gitSync.excludeWebserver parameters

+

The dags.gitSync.root and dags.gitSync.dest parameters did not provide any useful behaviors to chart users so they have been removed. +If you have them set in your values file you can safely remove them.

+

The dags.gitSync.excludeWebserver parameter was mistakenly included in the charts values.schema.json. If you have it set in your values file, +you can safely remove it.

+
+
+

nodeSelector, affinity and tolerations on migrateDatabaseJob and createUserJob jobs

+

The migrateDatabaseJob and createUserJob jobs were incorrectly using the webserver’s nodeSelector, affinity +and tolerations (if set). Each job is now configured separately.

+
+
+
+

New Features

+
    +

  • Chart: Allow using krb5.conf with CeleryExecutor (#16822)

    • +

  • Chart: Refactor webserver and flower NetworkPolicy (#16619)

    • +

  • Chart: Apply worker’s node assigning settings to Pod Template File (#16663)

    • +

  • Chart: Support for overriding webserver and flower service ports (#16572)

    • +

  • Chart: Support extraContainers and extraVolumes in flower (#16515)

    • +

  • Chart: Allow configuration of pod resources in helm chart (#16425)

    • +

  • Chart: Support job level annotations; fix jobs scheduling config (#16331)

    • +

  • feat: Helm chart adding minReplicaCount to the KEDA worker-kedaautoscaler.yaml (#16262)

    • +

  • Chart: Adds support for custom command and args (#16153)

    • +

  • Chart: Add extra ini config to pgbouncer (#16120)

    • +

  • Chart: Add extraInitContainers to scheduler/webserver/workers (#16098)

    • +

  • Configurable resources for git-sync sidecar (#16080)

    • +

  • Chart: Template airflowLocalSettings and webserver.webserverConfig (#16074)

    • +

  • Support strategy/updateStrategy on scheduler (#16069)

    • +

  • Chart: Add both airflow and extra annotations to jobs (#16058)

    • +

  • loadBalancerIP and annotations for both Flower and Webserver (#15972)

    • +
+
+
+

Improvements

+
    +

  • Chart: Update Postgres subchart to 10.5.3 (#17041)

    • +

  • Chart: Update the default Airflow version to 2.1.2 (#17013)

    • +

  • Update default image as 2.1.1 for Helm Chart (#16785)

    • +

  • Chart: warn when using default logging with KubernetesExecutor (#16784)

    • +

  • Drop support for Helm 2 (#16575)

    • +

  • Chart: podAntiAffinity for scheduler, webserver, and workers (#16315)

    • +

  • Chart: Update the default Airflow Version to 2.1.0 (#16273)

    • +

  • Chart: Only mount DAGs in webserver when required (#16229)

    • +

  • Chart: Remove git-sync: root and dest params (#15955)

    • +

  • Chart: Add warning about missing knownHosts (#15950)

    • +
+
+
+

Bug Fixes

+
    +

  • Chart: Create a random secret for Webserver’s flask secret key (#17142)

    • +

  • Chart: fix labels on cleanup ServiceAccount (#16722)

    • +

  • Chart: Fix overriding node assigning settings on Worker Deployment (#16670)

    • +

  • Chart: Always deploy a gitsync init container (#16339)

    • +

  • Chart: Fix updating from KubernetesExecutor to CeleryExecutor (#16242)

    • +

  • Chart: Adds labels to Kubernetes worker pods (#16203)

    • +

  • Chart: Allow webserver.base_url to be templated (#16126)

    • +

  • Chart: Fix PgBouncer exporter sidecar (#16099)

    • +

  • Remove dags.gitSync.excludeWebserver from chart values.schema.json (#16070)

    • +

  • Chart: Fix Elasticsearch secret created without Elasticsearch enabled (#16015)

    • +

  • Handle special characters in passwords for Helm Chart (#16004)

    • +

  • Fix flower ServiceAccount created without flower enable (#16011)

    • +

  • Chart: gitsync Clean Up for KubernetesExecutor (#15925)

    • +

  • Mount DAGs read only when using gitsync (#15953)

    • +
+
+
+

Doc only changes

+
    +

  • Chart docs: note uid write permissions for existing PVC (#17170)

    • +

  • Chart Docs: Add single-line description for multiNamespaceMode (#17147)

    • +

  • Chart: Update description for Helm chart to include ‘official’ (#17040)

    • +

  • Chart: Better comment and example for podTemplate (#16859)

    • +

  • Chart: Add more clear docs for setting pod_template_file.yaml (#16632)

    • +

  • Fix description on scheduler.livenessprobe.periodSeconds (#16486)

    • +

  • Chart docs: Fix extrasecrets example (#16305)

    • +

  • Small improvements for README.md files (#16244)

    • +
+
+
+

Misc

+
    +

  • Removes pylint from our toolchain (#16682)

    • +

  • Update link to match what is in pre-commit (#16408)

    • +

  • Chart: Update the appVersion to 2.1.0 in Chart.yaml (#16337)

    • +

  • Rename the main branch of the Airflow repo to be main (#16149)

    • +

  • Update Chart version to 1.1.0-rc1 (#16124)

    • +
+
+
+
+ + + +
+ +
+
+
+
+
+

Was this entry helpful?

+
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+
+ +
+ + + + + + +
+ + + + + + + + + + + + + + + +
+ + + + +
+ + +
+ + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/docs-archive/helm-chart/1.14.0/search.html b/docs-archive/helm-chart/1.14.0/search.html new file mode 100644 index 00000000000..328208f899a --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/search.html @@ -0,0 +1,875 @@ + + + + + + + + + + + + Search — helm-chart Documentation + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ + +
+ + +
+ + +
+
+
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+
+
+
+ +
+ + +
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+ + + + +
+ + + + + + + + + + +
+
+
+
+
+ +

Search

+ + + + +

+ Searching for multiple words only shows matches that contain + all words. +

+ + +
+ + + +
+ + + +
+ +
+ + + +
+ +
+
+
+
+
+

Was this entry helpful?

+
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+
+ +
+ + + + + + +
+ + + + + + + + + + + + + + + +
+ + + + +
+ + +
+ + + + + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/docs-archive/helm-chart/1.14.0/searchindex.js b/docs-archive/helm-chart/1.14.0/searchindex.js new file mode 100644 index 00000000000..e29aa767e21 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/searchindex.js @@ -0,0 +1 @@ +Search.setIndex({"docnames": ["adding-connections-and-variables", "airflow-configuration", "customizing-workers", "extending-the-chart", "index", "installing-helm-chart-from-sources", "keda", "manage-dags-files", "manage-logs", "parameters-ref", "production-guide", "quick-start", "release_notes", "setting-resources-for-containers", "using-additional-containers"], "filenames": ["adding-connections-and-variables.rst", "airflow-configuration.rst", "customizing-workers.rst", "extending-the-chart.rst", "index.rst", "installing-helm-chart-from-sources.rst", "keda.rst", "manage-dags-files.rst", "manage-logs.rst", "parameters-ref.rst", "production-guide.rst", "quick-start.rst", "release_notes.rst", "setting-resources-for-containers.rst", "using-additional-containers.rst"], "titles": ["Adding Connections, Variables and Environment Variables", "Configuring Airflow", "Customizing Workers", "Extending the Chart", "Helm Chart for Apache Airflow", "Installing Helm Chart from sources", "Autoscaling with KEDA", "Manage DAGs files", "Manage logs", "Parameters reference", "Production Guide", "Quick start with kind", "Release Notes", "Setting resources for containers", "Using additional containers"], "terms": {"you": [0, 1, 2, 3, 4, 5, 7, 8, 9, 10, 11, 12, 13, 14], "can": [0, 1, 2, 3, 4, 5, 7, 8, 9, 10, 11, 12, 13, 14], "programmat": 0, "add": [0, 4, 6, 7, 9, 10, 12, 13, 14], "arbitrari": [0, 1], "your": [0, 2, 4, 6, 7, 8, 9, 10, 12, 14], "airflow": [0, 2, 5, 6, 7, 8, 13, 14], "deploy": [0, 4, 7, 9, 10, 11, 12], "us": [0, 1, 2, 3, 4, 5, 8, 9, 10, 11, 13], "helm": [0, 3, 6, 7, 8, 9, 10], "chart": [0, 1, 6, 7, 8, 9, 10, 13], "under": [0, 1, 7, 10], "secret": [0, 7, 8, 9, 12], "extrasecret": [0, 7, 9, 12], "section": [0, 3, 4, 7, 9, 12], "valu": [0, 1, 4, 6, 7, 8, 9, 11, 12], "yaml": [0, 1, 3, 6, 7, 8, 9, 10, 12], "pass": [0, 7, 8, 9, 10, 12], "string": [0, 7, 9, 11, 12], "To": [0, 4, 5, 9, 10], "illustr": [0, 2], "let": [0, 2], "creat": [0, 4, 6, 7, 8, 9, 10, 12, 14], "file": [0, 3, 5, 9, 12], "call": [0, 3, 7], "overrid": [0, 1, 7, 8, 9, 12], "envnam": [0, 9], "airflow_conn_gcp": [0, 9], "secretnam": [0, 7, 8, 9, 10], "my": [0, 3, 7, 8, 9, 10, 11, 14], "secretkei": [0, 9], "env": [0, 9, 11, 12], "name": [0, 2, 3, 7, 8, 9, 10, 11, 14], "kei": [0, 1, 5, 7, 9, 12], "data": [0, 4, 7, 9, 10], "base64_encoded_gcp_conn_str": [0, 9], "stringdata": [0, 9], "support": [0, 4, 7, 8, 10], "which": [0, 3, 7, 8, 9, 10, 11, 12, 13], "enabl": [0, 3, 4, 6, 9, 10], "user": [0, 1, 5, 6, 7, 8, 9, 10, 11, 12, 14], "craft": 0, "dynam": [0, 11], "dag": [0, 1, 9, 13, 14], "set": [0, 1, 2, 4, 6, 7, 8, 9, 10, 11, 12], "three": 0, "wai": [0, 1, 7, 8, 10, 11], "ui": [0, 1, 9, 11, 12], "command": [0, 3, 4, 6, 9, 10, 11, 12], "line": [0, 3, 12], "within": [0, 1, 9], "see": [0, 1, 2, 8, 9, 10, 11], "manag": [0, 4, 5, 9, 13], "more": [0, 7, 8, 9, 10, 11, 12], "With": [0, 2, 7, 8, 11, 12], "also": [0, 2, 3, 4, 5, 7, 8, 9, 10, 11, 12, 14], "inject": [0, 12], "so": [0, 1, 4, 6, 7, 9, 10, 12, 14], "exampl": [0, 1, 2, 3, 4, 5, 7, 9, 10, 11, 12, 13, 14], "we": [0, 10, 11], "interest": 0, "airflow_var_kei": 0, "value_1": 0, "airflow_var_another_kei": 0, "value_2": 0, "util": [0, 9, 10, 12], "extraenv": [0, 1, 9, 10], "extraenvfrom": [0, 9, 12], "need": [0, 1, 2, 3, 4, 7, 8, 9, 10, 11, 12], "templat": [0, 3, 8, 9, 10, 12], "airflow_var_helm_release_nam": 0, "releas": [0, 2, 4, 7, 9, 10, 11], "configmapref": [0, 9], "extraconfigmap": [0, 9], "airflow_var_hello_messag": [0, 9], "hi": [0, 9], "1": [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 14], "14": [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 14], "0": [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 14], "2": [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 14], "10": [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 14], "dev0": [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14], "thi": [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14], "i": [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 14], "an": [0, 1, 2, 3, 4, 5, 6, 8, 9, 10, 11, 12, 13, 14], "experiment": [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14], "featur": [0, 1, 2, 3, 5, 6, 7, 8, 9, 10, 11, 13, 14], "The": [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 13], "allow": [1, 4, 6, 7, 9, 10, 12], "config": [1, 6, 9, 10], "some": [1, 3, 4, 7, 9, 10], "default": [1, 2, 4, 7, 8, 9, 10, 13], "differ": [1, 2, 5, 7, 9, 10, 12, 13, 14], "from": [1, 6, 8, 9, 10, 11, 12, 14], "those": [1, 3, 7, 10, 12], "core": [1, 12], "found": [1, 7, 8, 10], "As": [1, 2, 8, 10, 12], "follow": [1, 2, 3, 4, 5, 7, 9, 10, 11, 12, 13], "demonstr": 1, "how": [1, 2, 5, 7, 9, 10, 11, 12], "one": [1, 5, 7, 9, 10], "would": [1, 10, 12], "webserv": [1, 7, 11, 13, 14], "view": 1, "expose_config": 1, "true": [1, 3, 4, 6, 7, 8, 9, 10, 11, 12], "fals": [1, 4, 7, 8, 9, 10], "gener": [1, 7, 9, 10, 12], "speak": 1, "familiar": 1, "oneself": 1, "prior": [1, 7], "instal": [1, 3, 6, 7, 8, 9, 10, 12], "deploi": [1, 3, 4, 7, 9, 10, 12, 13, 14], "servic": [1, 4, 7, 9, 12], "recommend": [1, 4, 5, 7, 9, 10, 11, 12], "load": [1, 9, 11, 12], "offici": [1, 3, 5, 12], "docker": [1, 8, 10, 11, 12], "imag": [1, 8, 14], "airflow__core__load_exampl": [1, 9, 11], "environ": [1, 6, 7, 9, 12], "variabl": [1, 6, 9, 12], "paramet": [1, 2, 4, 7, 10, 13, 14], "refer": [1, 4, 7, 8, 10, 11, 12], "ha": [1, 7, 8, 9, 10], "when": [1, 3, 4, 7, 8, 9, 10, 11, 12, 14], "order": [1, 3, 7, 10, 12], "present": [1, 4, 7, 12], "both": [2, 7, 9, 10, 12], "celeryexecutor": [2, 4, 6, 8, 9, 10, 12], "kubernetesexecutor": [2, 3, 4, 7, 9, 10, 14], "highli": [2, 4, 7], "For": [2, 3, 4, 5, 9, 10, 12, 13, 14], "resourc": [2, 4, 9, 10], "request": [2, 9, 10, 12, 13], "cpu": [2, 9, 13], "limit": [2, 7, 9, 12, 13], "complet": [2, 7, 9], "list": [2, 4, 9, 10, 11], "One": [2, 4], "notabl": 2, "except": 2, "anti": 2, "affin": [2, 9], "appli": [2, 3, 4, 9, 12], "spread": [2, 9, 12], "them": [2, 4, 7, 10, 12], "across": [2, 7, 12], "node": [2, 7, 9, 11, 12, 13], "reason": [2, 9, 12], "out": [2, 7, 9, 10, 11, 12], "per": [2, 12], "task": [2, 6, 8, 9, 10, 11, 12], "celerykubernetesexecutor": [2, 4, 9, 10], "provid": [2, 4, 5, 8, 10, 11, 12], "configur": [2, 3, 4, 7, 8, 9, 13], "kubernet": [2, 4, 6, 11, 12], "mai": [2, 4, 10, 11], "between": [2, 7, 9, 12], "type": [2, 4, 9, 10], "someth": [2, 10], "possibl": [2, 7, 10, 12, 13], "alon": 2, "": [2, 5, 9, 10, 11, 12], "sai": [2, 14], "want": [2, 3, 4, 5, 7, 9, 10, 11, 12, 14], "priorityclassnam": [2, 9, 12], "NOT": 2, "function": [2, 7, 10, 11, 12], "meant": 2, "re": [2, 4, 11, 12], "better": [2, 12], "off": [2, 4, 7], "start": [2, 4, 9, 10, 12], "instead": [2, 3, 6, 7, 9, 10, 12], "podtempl": [2, 9, 12], "apivers": [2, 9, 10, 12], "v1": [2, 9, 10, 11], "kind": [2, 9, 10, 12], "pod": [2, 6, 7, 8, 9, 10, 11, 12, 13, 14], "metadata": [2, 6, 9, 10, 12], "placehold": [2, 9], "label": [2, 9, 12], "tier": [2, 9], "compon": [2, 4, 8, 9, 10, 12], "spec": [2, 9, 10], "high": [2, 9], "prioriti": [2, 9, 10, 12], "contain": [2, 3, 5, 7, 9, 10, 12], "base": [2, 6, 7, 9, 12], "In": [3, 7, 8, 10], "case": [3, 7, 11], "e": [3, 4, 6, 7, 8, 9, 12], "g": [3, 4, 7, 9, 12], "mainten": 3, "cronjob": [3, 9, 12], "togeth": [3, 7], "howev": [3, 4, 7, 10, 11, 12], "sometim": [3, 10], "ar": [3, 5, 7, 8, 9, 10, 11, 12, 13, 14], "directli": [3, 5, 9], "relat": [3, 7, 10, 12], "thu": 3, "should": [3, 5, 7, 9, 10, 12], "ad": [3, 9, 10, 12], "easili": 3, "ll": [3, 4, 7, 10, 12], "step": [3, 5, 7, 12], "first": [3, 4, 10], "own": [3, 10, 11, 14], "directori": [3, 5, 7, 9], "do": [3, 4, 5, 7, 10, 11, 12], "run": [3, 4, 5, 6, 7, 9, 10, 11], "structur": 3, "helmignor": 3, "test": [3, 4, 7, 9, 10, 11], "second": [3, 7, 9], "give": [3, 10], "abil": [3, 12], "without": [3, 4, 10, 12], "modifi": [3, 7, 8], "itself": 3, "often": [3, 7, 9, 10], "subchart": [3, 9], "version": [3, 4, 5, 6, 7, 9, 10], "11": [3, 5], "repositori": [3, 9, 11, 12], "http": [3, 4, 6, 9, 11, 12], "apach": [3, 5, 6, 7, 8, 9, 10, 11], "org": [3, 4, 5, 6, 9, 11], "make": [3, 7, 9, 10, 12], "sure": [3, 7, 10], "have": [3, 7, 8, 9, 10], "alreadi": [3, 5, 7, 9], "repo": [3, 4, 5, 6, 9, 12], "local": [3, 7, 8, 9, 10, 12], "url": [3, 9, 10, 12], "replac": [3, 9, 10, 12], "mean": [3, 10, 11], "disabl": [3, 9, 10], "condit": 3, "field": [3, 12], "check": [3, 5, 7, 12], "insid": 3, "If": [3, 4, 5, 7, 8, 9, 10, 12, 14], "otherwis": [3, 9, 10], "onli": [3, 7, 8, 9, 10], "third": 3, "after": [3, 4, 7, 9, 12], "specifi": [3, 7, 9, 10, 12, 13], "build": [3, 5, 7, 10, 11, 12], "save": 3, "specif": [3, 9, 10, 12], "executor": [3, 4, 6, 8, 9, 10, 12], "mani": [3, 7, 9], "like": [3, 7, 9, 10, 12], "bootstrap": 4, "cluster": [4, 7, 8, 9, 10, 12], "packag": [4, 10, 12], "26": [4, 9], "3": [4, 9], "pv": 4, "provision": [4, 9], "underli": 4, "infrastructur": 4, "option": [4, 7, 8, 10, 12], "localexecutor": [4, 9], "localkubernetesexecutor": [4, 12], "databas": [4, 6, 12, 14], "backend": [4, 9, 12], "postgresql": [4, 9, 10], "mysql": [4, 9, 12], "autosc": [4, 9], "keda": [4, 9, 12], "pgbouncer": [4, 13], "battl": 4, "monitor": [4, 7, 10], "statsd": [4, 13], "prometheu": [4, 9], "metric": [4, 9, 12], "flower": [4, 10, 13, 14], "automat": [4, 10], "migrat": [4, 9, 10, 14], "new": [4, 7, 9], "administr": 4, "account": [4, 9, 12], "creation": [4, 9], "dure": [4, 8, 9, 10, 11], "kerbero": [4, 10, 12, 13], "secur": [4, 9, 12], "ani": [4, 9, 10, 12], "don": [4, 7, 9, 12], "t": [4, 7, 9, 10, 12], "other": [4, 7, 8, 10, 13], "redi": [4, 10, 13], "namespac": [4, 6, 9, 12], "all": [4, 7, 8, 9, 10, 12], "updat": [4, 6, 7, 11], "delet": [4, 7, 12], "remov": [4, 10], "associ": 4, "hook": [4, 7, 9, 12], "might": [4, 7, 9, 10], "left": [4, 5, 9], "execut": [4, 9], "brokerurlsecret": 4, "fernetkeysecret": 4, "must": [4, 7, 9, 10], "four": 4, "applic": [4, 10], "createuserjob": [4, 9, 13], "usehelmhook": [4, 9], "applycustomenv": [4, 9], "migratedatabasejob": [4, 9, 13], "ci": 4, "perform": [4, 7, 9, 10, 12], "issu": [4, 12], "preserv": [4, 12], "immut": 4, "job": [4, 13, 14], "manifest": 4, "wait": [4, 9, 10], "while": [4, 7, 10], "encount": 4, "jobannot": [4, 9], "argocd": 4, "argoproj": 4, "io": [4, 6, 9], "sync": [4, 9, 14], "everi": [4, 7, 10], "time": [4, 7, 9, 10, 12], "event": [4, 6], "ideal": 4, "trade": [4, 7], "celeri": [4, 6, 9, 12], "built": [4, 12], "up": [4, 7, 10, 11, 12], "static": [4, 10], "password": [4, 9, 10, 12], "either": [4, 10, 11, 12], "suppli": 4, "passwordsecretnam": [4, 9, 10], "brokerurlsecretnam": [4, 9, 10, 12], "standard": [4, 12], "It": [4, 5, 7, 10, 11, 13], "caus": [4, 7, 9], "unexpect": [4, 7, 12], "behaviour": [4, 12], "exist": [4, 7, 8, 9, 10, 12], "usestandardnam": [4, 12], "recreat": [4, 12], "previou": [4, 5, 12], "won": [4, 7, 9, 10, 12], "pvc": [4, 9, 12], "log": [4, 9, 12], "statefulset": [4, 9, 10, 12], "brand": [4, 12], "histori": [4, 7, 12], "manual": [4, 12], "copi": [4, 7, 11, 12], "volum": [4, 7, 8, 9, 12], "depend": [4, 7, 10, 11], "what": [4, 10, 12], "storag": [4, 9, 12, 14], "class": [4, 9, 12], "procedur": [4, 12], "vari": [4, 12], "mind": [4, 10, 11, 12], "fresh": [4, 12], "just": [4, 12, 14], "old": [4, 7, 9, 12], "persist": [4, 9, 10, 12], "claim": [4, 7, 8, 9], "kubectl": [4, 6, 10, 11, 12], "n": [4, 12], "gta": [4, 12], "trigger": [4, 6, 13, 14], "worker": [4, 6, 7, 10, 13, 14], "db": [4, 9, 10, 12], "chang": [4, 7, 9, 10], "fullnameoverrid": [4, 12], "proce": [4, 12], "usual": [4, 7, 12], "page": [5, 12], "describ": [5, 7], "download": 5, "verifi": 5, "choos": [5, 7], "select": [5, 6, 9], "drop": [5, 7, 9, 12], "down": [5, 9, 12], "top": 5, "origin": 5, "checksum": 5, "signatur": 5, "avail": [5, 7, 8, 9, 10, 12], "via": [5, 7, 10, 12], "softwar": [5, 12], "foundat": 5, "asc": 5, "sha512": 5, "code": [5, 7, 9, 11, 12], "link": [5, 7, 12], "abov": [5, 7, 9, 10], "detail": [5, 7, 8, 10, 11, 12], "pgp": 5, "essenti": 5, "sha": [5, 9, 12], "gpg": 5, "pleas": [5, 7, 8, 9, 10, 11, 12], "well": [5, 7, 10], "relev": 5, "distribut": [5, 7, 10], "get": [5, 7, 9, 10, 11], "main": [5, 9, 12, 13, 14], "mirror": 5, "pgpk": 5, "ka": 5, "binari": [5, 10, 12], "below": [5, 9, 10, 11], "guid": [5, 7, 8, 9, 12], "pgpv": 5, "tgz": 5, "made": 5, "sat": 5, "sep": 5, "12": 5, "49": 5, "54": 5, "2021": 5, "bst": 5, "rsa": [5, 7, 10, 12], "cde15c6e4d3a8ec4ecf4ba4b6674e08ad7de406f": 5, "issuer": 5, "kaxilnaik": 5, "good": [5, 7, 10], "kaxil": 5, "naik": 5, "unknown": 5, "aka": 5, "gmail": 5, "com": [5, 7, 9, 10], "warn": [5, 12], "id": [5, 10], "certifi": 5, "trust": 5, "There": [5, 7, 10], "indic": 5, "belong": 5, "owner": 5, "primari": 5, "fingerprint": [5, 10], "cde1": 5, "5c6e": 5, "4d3a": 5, "8ec4": 5, "ecf4": 5, "ba4b": 5, "6674": 5, "e08a": 5, "d7de": 5, "406f": 5, "correct": [5, 10, 12], "worri": 5, "about": [5, 10, 11, 12], "most": [5, 7, 12], "certif": [5, 9, 10], "self": 5, "sign": [5, 10], "why": [5, 10], "By": [5, 10, 13], "import": [5, 9, 10], "server": [5, 7, 10], "know": 5, "valid": [5, 12], "sum": [5, 13], "shasum": 5, "512": 5, "diff": [5, 12], "match": [5, 10, 12], "still": [6, 7, 12], "stand": 6, "driven": 6, "custom": [6, 9], "control": [6, 7, 10, 12], "bind": 6, "horizont": [6, 9], "autoscal": [6, 10, 12], "adjust": [6, 10], "number": [6, 7, 8, 9, 10, 12], "activ": 6, "queu": [6, 9], "state": [6, 9], "kedacor": 6, "github": [6, 9, 10, 12], "v2": [6, 9], "instanc": [6, 9, 10], "A": [6, 9, 10], "scaledobject": 6, "hpa": [6, 9, 12], "deriv": 6, "desir": [6, 9, 12], "queri": [6, 9, 12], "ceil": [6, 9], "count": [6, 9, 12], "decim": [6, 9], "worker_concurr": [6, 9], "task_inst": [6, 9], "where": [6, 7, 9, 10, 12, 13], "OR": [6, 9], "concurr": 6, "through": [6, 12, 13, 14], "cfg": [6, 9, 12], "consist": [6, 7], "necessari": [7, 10], "basic": [7, 10], "techniqu": 7, "approach": [7, 8], "includ": [7, 12, 13], "method": [7, 9], "requir": [7, 9, 10, 12], "redeploi": 7, "work": [7, 9, 10, 11, 12], "particularli": 7, "expect": [7, 9, 10], "frequent": 7, "pull": [7, 9, 11, 12], "tag": [7, 9, 11, 12], "compani": [7, 14], "8a0da78": 7, "f": [7, 9], "eof": 7, "airflow_hom": [7, 9, 12], "wa": [7, 10, 12], "bug": 7, "bit": 7, "longer": 7, "dockerfil": [7, 11, 12], "remain": 7, "openshift": [7, 10, 12], "compat": [7, 12], "root": [7, 11], "group": [7, 9, 10], "similarli": 7, "been": 7, "fix": 7, "chown": [7, 9], "Then": [7, 11], "publish": 7, "access": [7, 8, 9, 12], "registri": [7, 9, 10, 12], "push": 7, "final": [7, 10], "upgrad": [7, 8, 9, 11], "constant": 7, "develop": 7, "purpos": [7, 9], "bad": 7, "practic": 7, "same": [7, 8, 10, 12], "lose": 7, "pullpolici": [7, 9], "alwai": [7, 12, 14], "airflowpodannot": [7, 9, 12], "random": [7, 10, 12], "r": [7, 9], "uuidgen": 7, "randomli": 7, "annot": [7, 9, 10, 12], "ensur": [7, 8, 9, 10, 12], "refresh": [7, 9], "gitlab": 7, "credenti": [7, 9, 10, 12], "mode": [7, 8, 9, 10], "readwritemani": [7, 8], "schedul": [7, 8, 13, 14], "onto": [7, 8, 9], "read": [7, 9, 10, 12], "Not": [7, 8], "plugin": [7, 8], "gitsync": [7, 9, 10, 13], "airflowvers": [7, 9], "init": [7, 9, 12], "serial": 7, "henc": 7, "doe": [7, 10], "unless": 7, "carefulli": 7, "consid": [7, 9, 10, 12], "bring": [7, 10], "delai": [7, 9], "v": 7, "rate": 7, "mitig": 7, "send": [7, 10], "signal": [7, 9, 14], "web": [7, 9], "commit": [7, 12], "awar": [7, 10], "consequ": 7, "solut": 7, "primarili": 7, "design": 7, "posix": 7, "compliant": 7, "checkout": 7, "part": [7, 12], "process": [7, 9, 10, 14], "involv": 7, "freshli": 7, "folder": 7, "swap": 7, "symbol": 7, "done": [7, 10], "whole": 7, "pars": 7, "singl": [7, 9, 12], "undesir": 7, "side": [7, 9], "effect": [7, 12], "network": [7, 9, 12], "technologi": 7, "behind": 7, "handl": [7, 12], "non": [7, 12], "obviou": 7, "lot": [7, 10], "variou": [7, 9, 10, 13], "k8": [7, 9, 10, 12, 13], "each": [7, 8, 9, 12, 13], "characterist": 7, "filesystem": 7, "affect": 7, "over": [7, 10, 12], "being": [7, 9, 10, 12], "scan": 7, "processor": [7, 9, 12, 14], "complex": 7, "remot": [7, 9, 12], "iop": 7, "alloc": 7, "paid": 7, "factor": 7, "linear": 7, "growth": 7, "throughput": 7, "potenti": 7, "traffic": [7, 9, 12], "come": [7, 8, 12], "burst": 7, "linearli": 7, "proport": 7, "size": [7, 8, 9, 10], "vulner": 7, "pretti": 7, "sudden": 7, "demand": 7, "increas": [7, 9], "enough": 7, "smaller": 7, "shorter": 7, "thei": [7, 10, 12], "outgrow": 7, "certain": [7, 9], "threshold": [7, 9], "much": 7, "capabl": [7, 9, 10], "expens": 7, "difficult": 7, "imposs": 7, "suddenli": 7, "face": 7, "situat": 7, "pai": 7, "keep": [7, 10, 11], "suffici": 7, "avoid": [7, 9, 10, 12], "inconsist": [7, 12], "observ": 7, "commun": [7, 10, 11], "moment": 7, "becaus": [7, 10, 12], "quick": 7, "success": [7, 9], "temporari": 7, "lack": [7, 10], "individu": [7, 12], "visibl": 7, "grow": 7, "amplifi": 7, "permiss": [7, 8, 12], "fulli": [7, 10], "integr": 7, "submodul": 7, "umbrella": 7, "recurs": 7, "stori": 7, "100": [7, 9, 10], "put": [7, 11], "ling": 7, "autom": [7, 11], "simpl": 7, "latest": [7, 12, 14], "share": [7, 9], "librari": 7, "team": 7, "scale": [7, 9, 12], "summit": 7, "readonlymani": 7, "existingclaim": [7, 8, 9], "ssh": [7, 9, 10, 12], "keygen": [7, 10], "b": 7, "4096": 7, "c": [7, 9, 10], "your_email": 7, "public": [7, 10], "convert": 7, "base64": [7, 9], "w": [7, 12], "temp": 7, "txt": [7, 9, 12], "next": [7, 10], "usernam": [7, 9, 10, 12], "branch": [7, 9, 12], "subpath": [7, 9, 12], "sshkeysecret": [7, 9, 10, 12], "gitsshkei": 7, "forget": [7, 11], "context": [7, 9, 11, 12], "everyth": 7, "correctli": 7, "pick": 7, "take": [7, 9, 10, 11, 12], "further": 7, "knownhost": [7, 9, 12], "suscept": 7, "man": 7, "middl": 7, "attack": 7, "document": [7, 8, 10, 12], "product": [7, 9, 12], "lifetim": [8, 9], "volumeclaimtempl": [8, 9, 12], "10gi": [8, 9], "note": [8, 9, 10], "unlik": 8, "persistentvolumeclaim": 8, "writabl": 8, "easiest": 8, "gid": [8, 9, 10], "write": [8, 12], "inform": [8, 10, 12], "entrypoint": 8, "forward": [8, 11], "retriev": [8, 10], "choic": [8, 10], "tabl": 9, "descript": [9, 12], "_rpcserver": 9, "serverconfig": 9, "mount": [9, 12], "server_config": 9, "py": 9, "bake": [9, 12], "configmap": [9, 12], "conf": [9, 12], "sqlalchemi": 9, "connect": [9, 10, 12], "sqlalchemy_database_uri": 9, "sql_alchemy_conn": [9, 10, 12], "flask": [9, 12], "wtf": 9, "flag": [9, 12], "csrf": 9, "csrf_enabl": 9, "serverconfigconfigmapnam": 9, "defaultus": 9, "airflowlocalset": [9, 12], "airflow_local_set": [9, 12], "decis": 9, "9": 9, "go": 9, "defaultairflowdigest": 9, "digest": [9, 12], "defaultairflowrepositori": [9, 12], "defaultairflowtag": 9, "fernetkei": 9, "fernet": [9, 10], "encrypt": 9, "schedulernam": 9, "kube": 9, "webserverconfig": [9, 12], "webserver_config": 9, "webserverconfigconfigmapnam": [9, 12], "webserversecretkei": [9, 10], "browser": 9, "session": [9, 10], "airflowhom": [9, 12], "home": 9, "path": 9, "opt": [9, 12], "allowpodlaunch": 9, "whether": [9, 10], "launch": 9, "git": 9, "stabl": [9, 12], "containernam": 9, "credentialssecret": 9, "git_sync_usernam": 9, "git_sync_password": 9, "depth": 9, "emptydirconfig": 9, "empti": [9, 12], "dir": [9, 11], "git_sync_timeout": 9, "60": [9, 10, 12], "extravolumemount": [9, 12], "addit": 9, "privat": [9, 12], "content": [9, 10], "known_host": 9, "host1": 9, "ip1": 9, "key1": 9, "host2": 9, "ip2": 9, "key2": 9, "maxfailur": 9, "consecut": 9, "failur": 9, "befor": [9, 10, 12], "abort": 9, "period": [9, 12], "interv": 9, "attempt": 9, "style": 9, "durat": 9, "becom": [9, 12], "low": 9, "5": [9, 10], "ref": 9, "revis": [9, 12], "hash": 9, "sidecar": [9, 12, 13], "100m": [9, 13], "memori": [9, 13], "128mi": [9, 13], "rev": 9, "head": 9, "securitycontext": [9, 10, 12], "deprec": 9, "runasgroup": 9, "runasus": [9, 10], "50000": [9, 10], "locat": 9, "uid": [9, 10, 12], "65533": 9, "mountpath": 9, "accessmod": 9, "readwriteonc": 9, "store": [9, 10], "1gi": 9, "storageclassnam": [9, 12], "storageclass": 9, "here": [9, 10, 11], "elasticsearch": [9, 10, 12], "host": [9, 10], "scheme": [9, 10, 12], "80": [9, 12], "enablebuiltinsecretenvvar": [9, 10], "airflow_conn_airflow_db": [9, 10], "airflow__celery__broker_url": [9, 10], "broker": [9, 10, 12], "airflow__celery__celery_result_backend": [9, 10], "result": [9, 10, 12], "variant": [9, 10], "airflow__celery__result_backend": [9, 10], "airflow__core__fernet_kei": [9, 10], "airflow__core__sql_alchemy_conn": 9, "airflow__database__sql_alchemy_conn": [9, 10], "airflow__elasticsearch__elasticsearch_host": [9, 10], "4": [9, 10], "airflow__elasticsearch__host": [9, 10], "airflow__webserver__secret_kei": [9, 10], "myenvvar": 9, "something_fun": 9, "extra": [9, 10, 12, 14], "item": 9, "definit": [9, 12], "envfrom": [9, 12], "secretref": 9, "fernetkeysecretnam": [9, 10], "100gi": 9, "multinamespacemod": [9, 12], "multipl": [9, 12], "clusterrol": 9, "clusterrolebind": 9, "entir": [9, 10], "pod_template_fil": [9, 12], "normal": 9, "secretenvvar": 9, "somekei": 9, "somesecret": 9, "volumemount": [9, 12], "webserversecretkeysecretnam": [9, 10], "secret_kei": [9, 10], "polici": [9, 12], "ifnotpres": 9, "v4": [9, 12], "migrationswaittimeout": 9, "2024": 9, "01": 9, "19": [9, 12], "21": [9, 11, 12], "pgbouncerexport": 9, "export": [9, 10, 11], "16": [9, 10, 12], "pod_templ": 9, "worker_container_repositori": 9, "worker_container_tag": 9, "7": 9, "bookworm": 9, "quai": 9, "v0": 9, "usedefaultimageformigr": 9, "aip": 9, "44": 9, "dev": 9, "9080": 9, "airflowui": 9, "8080": [9, 11], "flowerui": 9, "5555": 9, "6543": 9, "pgbouncerscrap": 9, "scrape": 9, "9127": 9, "redisdb": 9, "6379": [9, 10], "statsdingest": 9, "ingest": 9, "9125": 9, "statsdscrap": 9, "9102": [9, 10], "triggererlog": 9, "8794": 9, "workerlog": 9, "8793": 9, "metadataconnect": [9, 10], "postgr": [9, 10, 12], "5432": [9, 10], "protocol": [9, 10], "sslmode": [9, 12], "ssl": 9, "metadatasecretnam": [9, 10], "resultbackendconnect": 9, "resultbackendsecretnam": [9, 10, 12], "auth": [9, 10, 12], "enablepostgresus": [9, 12], "assign": [9, 10, 12], "admin": [9, 12], "block": [9, 12], "postgrespassword": [9, 12], "constraint": 9, "arg": [9, 12, 14], "auth_fil": [9, 12], "etc": 9, "auth_typ": [9, 12], "authent": [9, 12], "scram": 9, "256": 9, "cipher": 9, "fast": 9, "separ": [9, 10, 12], "u": 9, "nobodi": 9, "ini": [9, 12], "configsecretnam": [9, 10], "var": [9, 11, 12], "extracontain": [9, 12, 14], "extraini": 9, "www": 9, "html": 9, "extrainimetadata": 9, "extrainiresultbackend": 9, "extranetworkpolici": 9, "networkpolici": 9, "extravolum": [9, 12], "logconnect": 9, "login": 9, "logdisconnect": 9, "disconnect": 9, "maxclientconn": [9, 10], "maximum": [9, 10], "client": 9, "higher": [9, 12], "descriptor": 9, "metadatapools": [9, 10], "pool": 9, "metricsexportersidecar": [9, 13], "livenessprob": 9, "initialdelaysecond": 9, "live": [9, 12], "probe": [9, 12], "initi": [9, 10], "periodsecond": [9, 12], "frequenc": 9, "timeoutsecond": 9, "timeout": [9, 12], "readinessprob": 9, "readi": [9, 12], "statssecretkei": 9, "referenc": 9, "uri": 9, "object": [9, 10, 12, 14], "null": 9, "statssecretnam": 9, "nodeselector": 9, "podannot": [9, 12], "poddisruptionbudget": [9, 12], "maxunavail": 9, "max": 9, "unavail": 9, "minavail": [9, 12], "min": 9, "poddistributionbudget": 9, "replica": [9, 12], "resultbackendpools": [9, 10], "extraannot": 9, "serviceaccount": [9, 12], "automountserviceaccounttoken": [9, 12], "api": 9, "ca": 9, "author": [9, 10], "cert": 9, "prefer": 9, "toler": 9, "topologyspreadconstraint": [9, 12], "topologi": 9, "65534": 9, "verbos": 9, "allowpodlogread": 9, "extern": [9, 12], "exec": 9, "intern": 9, "bash": 9, "configmapannot": 9, "email": 9, "address": 9, "firstnam": 9, "lastnam": 9, "role": [9, 12], "extrainitcontain": [9, 12, 14], "renam": 9, "hostalias": [9, 12], "hostnam": [9, 10, 12], "foo": 9, "ip": 9, "127": 9, "failurethreshold": 9, "15": 9, "peer": 9, "networkpolicyingress": 9, "disrupt": 9, "budget": 9, "loadbalancerip": [9, 12], "loadbalancersourcerang": [9, 12], "123": 9, "targetport": 9, "only_sidecar": 9, "8888": 9, "clusterip": 9, "startupprob": [9, 12], "startup": [9, 10], "6": 9, "20": [9, 11], "strategi": [9, 12], "ones": 9, "waitformigr": [9, 12], "minimum": 9, "fail": [9, 12], "succeed": 9, "8": [9, 11], "safetoevict": [9, 10], "tell": 9, "its": [9, 10], "ok": 9, "evict": [9, 12], "fsgroup": [9, 10], "updatestrategi": [9, 12], "8070": 9, "nairflow": 9, "semvercompar": 9, "ternari": 9, "respons": [9, 14], "exit": [9, 14], "finish": [9, 10, 14], "continu": [9, 12, 14], "shutdown": [9, 12, 14], "two": 9, "behavior": [9, 12], "horizontalpodautoscalerbehavior": 9, "target": [9, 10], "maxreplicacount": 9, "calcul": 9, "averageutil": 9, "minreplicacount": [9, 12], "advanc": [9, 10], "horizontalpodautoscalerconfig": 9, "cooldownperiod": 9, "zero": 9, "30": 9, "namespacelabel": 9, "matchlabel": 9, "pollinginterv": 9, "poll": 9, "report": 9, "return": 9, "integ": 9, "eq": 9, "AND": 9, "queue": [9, 12], "celery_kubernetes_executor": 9, "kubernetes_queu": 9, "end": 9, "usepgbounc": [9, 12], "weather": 9, "ignor": [9, 12], "kerberosinitcontain": [9, 13], "kerberossidecar": [9, 13], "fixpermiss": 9, "current": 9, "due": [9, 10], "usag": [9, 10], "runtimeclassnam": [9, 12], "runtim": [9, 10, 11], "rollingupd": 9, "maxsurg": 9, "50": 9, "terminationgraceperiodsecond": [9, 12], "grace": 9, "sigterm": 9, "sent": 9, "600": 9, "20gi": 9, "default_capac": 9, "standalon": [9, 10, 12], "5565": 9, "pair": 9, "brokerurl": [9, 10], "direct": [9, 12], "provis": [9, 12], "els": 9, "cleanup": [9, 12, 13], "map": 9, "yml": 9, "extramap": 9, "merg": 9, "overridemap": [9, 12], "create_us": 9, "l": 9, "p": 9, "ttlsecondsafterfinish": [9, 12], "300": 9, "upgradedb": 9, "containerlifecyclehook": 9, "lifecycl": [9, 12], "global": [9, 10, 12], "poststart": 9, "bin": [9, 10], "sh": 9, "echo": [9, 14], "handler": 9, "usr": [9, 10], "messag": [9, 12], "prestop": 9, "allowprivilegeescal": [9, 10], "airflowconfigannot": 9, "defin": [9, 10, 12, 13, 14], "airflow_var_kubernetes_namespac": 9, "airflow_conn_aw": 9, "base64_encoded_aws_conn_str": 9, "airflow_conn_oth": 9, "other_conn": 9, "killal": 9, "int": 9, "sleep": 9, "120": 9, "priorityclass": [9, 12], "class1": 9, "preemptionpolici": 9, "preemptlowerprior": 9, "10000": 9, "class2": 9, "never": 9, "100000": 9, "quota": 9, "resourcequota": 9, "rbac": [9, 10, 12], "createsccrolebind": [9, 10], "scc": [9, 10, 12], "rolebind": [9, 10, 12], "999": 9, "ingressclassnam": 9, "pathtyp": 9, "implementationspecif": 9, "tl": 9, "termin": 9, "pre": [9, 12], "precedingpath": 9, "succeedingpath": 9, "ccachefilenam": 9, "cach": [9, 11], "ccachemountpath": 9, "ccach": 9, "krb5": [9, 12], "configpath": 9, "keytabbase64cont": 9, "keytab": [9, 10, 12], "encod": [9, 10], "keytabpath": 9, "princip": 9, "reinitfrequ": 9, "reiniti": 9, "3600": 9, "argument": 9, "enablepodlaunch": 9, "thing": 10, "advis": [10, 13], "metastor": 10, "dedic": 10, "machin": 10, "leverag": [10, 12], "cloud": 10, "aw": [10, 12], "rd": 10, "embed": [10, 12], "stabil": 10, "easier": 10, "experi": 10, "loss": 10, "outlin": 10, "simpler": 10, "port": [10, 11], "special": [10, 12], "charact": [10, 12], "mydatabas": 10, "liter": 10, "omit": 10, "metadatasecret": 10, "prefix": [10, 12], "open": 10, "natur": 10, "pooler": 10, "significantli": 10, "reduc": 10, "shown": 10, "help": 10, "restart": [10, 12], "cooki": 10, "strong": 10, "python3": 10, "print": 10, "token_hex": 10, "now": 10, "altern": 10, "token": [10, 12], "short": 10, "expiri": 10, "though": 10, "synchron": [10, 12], "ntpd": 10, "forbidden": 10, "error": 10, "along": 10, "safe": [10, 12], "level": [10, 11, 12], "than": 10, "everyon": 10, "veri": 10, "actual": 10, "even": [10, 11], "tool": 10, "term": 10, "anoth": 10, "learn": 10, "properli": [10, 12], "typic": 10, "scenario": 10, "apt": 10, "pypi": 10, "show": [10, 11, 12], "grab": 10, "keyscan": 10, "github_public_kei": 10, "lf": 10, "compar": [10, 12], "output": [10, 12], "right": 10, "look": 10, "aaaa": 10, "wsjk": 10, "box": 10, "endpoint": 10, "svc": [10, 11], "statsd_on": 10, "statsd_host": 10, "statsd_port": 10, "agent": 10, "8125": 10, "airflow__metrics__statsd_host": 10, "valuefrom": [10, 12], "fieldref": 10, "fieldpath": 10, "statu": 10, "hostip": 10, "exhaust": 10, "topic": 10, "construct": 10, "rule": 10, "action": 10, "split": 10, "categori": 10, "restrict": 10, "anyuid": 10, "bound": 10, "achiev": [10, 11], "privileg": 10, "least": 10, "protect": 10, "sever": 10, "workload": 10, "5000": 10, "preced": 10, "explain": 10, "40000": 10, "1001": 10, "app": 10, "servicenam": 10, "podsecur": 10, "initcontain": 10, "And": 10, "turn": 10, "older": 10, "determin": [10, 12], "reli": 10, "_cmd": 10, "__secret": 10, "system": 10, "rotat": 10, "suffix": 10, "back": 10, "_secret": 10, "variable_nam": 10, "airflow_conn_airflow_db_cmd": 10, "retrieve_connection_url": 10, "full": [10, 12], "release_nam": [10, 11, 12], "pattern": 10, "airflow__": 10, "correspond": 10, "_airflow__": 10, "airflow__celery__flower_basic_auth": 10, "freeli": 10, "redis_password": 10, "articl": 11, "kindest": 11, "confirm": 11, "info": 11, "few": [11, 12], "minut": 11, "localhost": 11, "try": 11, "maintain": 11, "script": 11, "pure": 11, "python": [11, 12], "virtualenv": [11, 12], "sourc": [11, 12], "best": 11, "project": 11, "mkdir": 11, "cd": 11, "cat": 11, "eom": 11, "vim": 11, "y": 11, "autoremov": 11, "yqq": 11, "purg": 11, "clean": [11, 12], "rm": 11, "rf": 11, "lib": 11, "lxml": 11, "pip": 11, "fullnam": 12, "launcher": 12, "reader": 12, "safer": 12, "prevent": 12, "retain": 12, "previous": 12, "37365": 12, "38524": 12, "40135": 12, "38507": 12, "37352": 12, "39132": 12, "39133": 12, "38815": 12, "38510": 12, "40033": 12, "typo": 12, "horizontalpodautosc": 12, "39307": 12, "39172": 12, "39115": 12, "38928": 12, "schema": 12, "29": 12, "38460": 12, "miss": 12, "38534": 12, "38367": 12, "overwrit": 12, "37917": 12, "wide": 12, "clash": 12, "multinamespac": 12, "37490": 12, "37528": 12, "duplic": 12, "37356": 12, "groomer": 12, "37588": 12, "skip": 12, "prepar": 12, "reproduc": 12, "37402": 12, "24": 12, "major": 12, "pg_dumpal": 12, "pg_upgrad": 12, "remind": 12, "o": 12, "alpin": 12, "22": 12, "nativ": 12, "36174": 12, "35548": 12, "36167": 12, "debugg": 12, "36365": 12, "34499": 12, "35593": 12, "35581": 12, "34986": 12, "34879": 12, "35083": 12, "emptydir": 12, "34837": 12, "36991": 12, "35679": 12, "34839": 12, "35309": 12, "35130": 12, "34825": 12, "34741": 12, "34787": 12, "extend": 12, "36331": 12, "comment": 12, "35588": 12, "35306": 12, "34731": 12, "36156": 12, "indent": 12, "35824": 12, "35214": 12, "rebuild": 12, "switch": 12, "backward": 12, "convent": 12, "nameoverrid": 12, "33843": 12, "32302": 12, "32349": 12, "34677": 12, "33107": 12, "32808": 12, "31615": 12, "31868": 12, "32308": 12, "containersecuritycontext": 12, "34351": 12, "32724": 12, "33142": 12, "33363": 12, "33340": 12, "32662": 12, "32608": 12, "32570": 12, "32100": 12, "33686": 12, "33438": 12, "33175": 12, "34178": 12, "kubeexecutor": 12, "33514": 12, "32753": 12, "32644": 12, "32426": 12, "flower_url_prefix": 12, "33134": 12, "explicit": 12, "exclus": 12, "33034": 12, "32181": 12, "unnecessari": 12, "loop": 12, "33506": 12, "common": 12, "tplvalu": 12, "render": 12, "tpl": 12, "33384": 12, "23": 12, "32899": 12, "32681": 12, "outdat": 12, "32300": 12, "34415": 12, "31043": 12, "30693": 12, "properti": 12, "30603": 12, "30990": 12, "30773": 12, "30609": 12, "31625": 12, "31328": 12, "30726": 12, "propag": 12, "31865": 12, "licens": 12, "header": 12, "30569": 12, "align": 12, "31850": 12, "31847": 12, "multi": 12, "platform": 12, "amd": 12, "arm": 12, "17": 12, "30051": 12, "30126": 12, "29270": 12, "30303": 12, "30168": 12, "29314": 12, "30214": 12, "29357": 12, "29752": 12, "29482": 12, "kubernetes_executor": 12, "29818": 12, "30217": 12, "29838": 12, "29526": 12, "29622": 12, "29478": 12, "29295": 12, "29392": 12, "29214": 12, "29378": 12, "nodeport": 12, "29460": 12, "rancher": 12, "instruct": 12, "28416": 12, "reflect": 12, "30286": 12, "reformat": 12, "29917": 12, "29941": 12, "30312": 12, "29938": 12, "airflow_dags_mount": 12, "format": 12, "29296": 12, "29297": 12, "reinstal": 12, "postrgesql": 12, "postgresqlusernam": 12, "postresqlpassword": 12, "were": 12, "likelihood": 12, "28688": 12, "27781": 12, "27419": 12, "enhanc": 12, "28041": 12, "26945": 12, "27178": 12, "27544": 12, "27439": 12, "serv": 12, "28828": 12, "28264": 12, "28813": 12, "28461": 12, "27779": 12, "27148": 12, "decreas": 12, "too": 12, "27420": 12, "29207": 12, "argo": 12, "guidelin": 12, "29078": 12, "29032": 12, "28610": 12, "loadbalanc": 12, "snippet": 12, "28014": 12, "28083": 12, "clone": 12, "27671": 12, "icon": 12, "27704": 12, "26838": 12, "25031": 12, "26598": 12, "25732": 12, "24784": 12, "25283": 12, "revisionhistorylimit": 12, "25059": 12, "23708": 12, "23711": 12, "22815": 12, "24220": 12, "25684": 12, "26415": 12, "25561": 12, "result_backend": 12, "24496": 12, "imagepullpolici": [12, 14], "26423": 12, "declar": 12, "22913": 12, "24647": 12, "semver": 12, "24480": 12, "24999": 12, "26747": 12, "26632": 12, "26428": 12, "26401": 12, "reload": 12, "24576": 12, "minor": 12, "clarif": 12, "uninstal": 12, "24929": 12, "hyperlink": 12, "pr": 12, "24532": 12, "terraform": 12, "26604": 12, "flux": 12, "24288": 12, "24394": 12, "logo": 12, "23977": 12, "23876": 12, "23836": 12, "vendor": 12, "24395": 12, "25871": 12, "d": 12, "23433": 12, "22712": 12, "22388": 12, "22182": 12, "22261": 12, "22323": 12, "21999": 12, "22414": 12, "21735": 12, "earli": 12, "23479": 12, "22195": 12, "22143": 12, "23307": 12, "22284": 12, "23737": 12, "again": 12, "20864": 12, "20794": 12, "21401": 12, "21484": 12, "speedup": 12, "20833": 12, "21108": 12, "v3": 12, "21309": 12, "21640": 12, "21222": 12, "20609": 12, "grant": 12, "21111": 12, "simplifi": 12, "21747": 12, "21685": 12, "20787": 12, "21745": 12, "21875": 12, "had": 12, "arrai": 12, "respect": 12, "futur": 12, "awai": 12, "numer": 12, "20599": 12, "20564": 12, "18974": 12, "18249": 12, "18808": 12, "18542": 12, "19749": 12, "19054": 12, "18776": 12, "20018": 12, "20069": 12, "20698": 12, "strict": 12, "19181": 12, "19690": 12, "19676": 12, "20641": 12, "9200": 12, "20616": 12, "20199": 12, "20544": 12, "20535": 12, "20464": 12, "20316": 12, "quot": 12, "20266": 12, "20702": 12, "reword": 12, "cover": 12, "envvar": 12, "20566": 12, "20331": 12, "datadog": 12, "17996": 12, "19892": 12, "kpo": 12, "19879": 12, "clarifi": 12, "19708": 12, "20450": 12, "artifacthub": 12, "screenshot": 12, "20558": 12, "19557": 12, "later": 12, "createus": 12, "19263": 12, "19225": 12, "19175": 12, "18481": 12, "cmd": 12, "18910": 12, "18920": 12, "19003": 12, "18753": 12, "clear": 12, "18272": 12, "18136": 12, "18147": 12, "19144": 12, "18595": 12, "18588": 12, "19326": 12, "modern": 12, "19327": 12, "19379": 12, "Their": 12, "unset": 12, "17743": 12, "isn": 12, "18306": 12, "18379": 12, "18403": 12, "18218": 12, "17970": 12, "retent": 12, "dai": 12, "17764": 12, "17666": 12, "17562": 12, "18429": 12, "18257": 12, "17211": 12, "17560": 12, "18299": 12, "warm": 12, "18068": 12, "18105": 12, "18079": 12, "17688": 12, "17645": 12, "17428": 12, "17433": 12, "space": 12, "18424": 12, "18251": 12, "17763": 12, "broken": 12, "17294": 12, "17282": 12, "17177": 12, "18354": 12, "receiv": 12, "sinc": [12, 13], "novemb": 12, "2020": 12, "did": 12, "mistakenli": 12, "json": 12, "incorrectli": 12, "16822": 12, "refactor": 12, "16619": 12, "16663": 12, "16572": 12, "16515": 12, "16425": 12, "16331": 12, "feat": 12, "kedaautoscal": 12, "16262": 12, "16153": 12, "16120": 12, "16098": 12, "16080": 12, "16074": 12, "16069": 12, "16058": 12, "15972": 12, "17041": 12, "17013": 12, "16785": 12, "16784": 12, "16575": 12, "podantiaffin": 12, "16315": 12, "16273": 12, "16229": 12, "15955": 12, "15950": 12, "17142": 12, "16722": 12, "16670": 12, "16339": 12, "16242": 12, "16203": 12, "base_url": 12, "16126": 12, "16099": 12, "16070": 12, "16015": 12, "16004": 12, "16011": 12, "15925": 12, "15953": 12, "17170": 12, "17147": 12, "17040": 12, "16859": 12, "16632": 12, "16486": 12, "16305": 12, "small": 12, "readm": 12, "md": 12, "16244": 12, "pylint": 12, "our": 12, "toolchain": 12, "16682": 12, "16408": 12, "appvers": 12, "16337": 12, "16149": 12, "rc1": 12, "16124": 12, "decid": 13, "place": 13, "loggroomersidecar": 13, "dagprocessor": 13, "cron": 13, "200m": 13, "256mi": 13, "s3": 14, "hello": 14, "debian": 14}, "objects": {}, "objtypes": {}, "objnames": {}, "titleterms": {"ad": [0, 11], "connect": 0, "variabl": [0, 10], "environ": [0, 10], "sensit": 0, "configur": [1, 10, 12], "airflow": [1, 3, 4, 9, 10, 11, 12], "custom": [2, 3, 10, 11, 12], "worker": [2, 8, 9, 12], "pod_template_fil": 2, "extend": [3, 10, 11], "chart": [3, 4, 5, 11, 12], "creat": [3, 11], "your": [3, 11], "add": [3, 11], "depend": [3, 12], "download": 3, "overrid": 3, "default": [3, 12], "valu": [3, 10], "helm": [4, 5, 11, 12], "apach": [4, 12], "requir": 4, "featur": [4, 12], "instal": [4, 5, 11], "upgrad": [4, 12], "uninstal": 4, "argo": 4, "cd": 4, "flux": 4, "rancher": 4, "terraform": 4, "name": [4, 12], "convent": 4, "from": [5, 7], "sourc": 5, "releas": [5, 12], "packag": [5, 11], "integr": 5, "autosc": 6, "keda": 6, "manag": [7, 8, 10], "dag": [7, 10, 11, 12], "file": [7, 10], "bake": 7, "docker": 7, "imag": [7, 9, 10, 11, 12], "us": [7, 12, 14], "git": [7, 12], "sync": [7, 12], "mount": 7, "sidecar": [7, 14], "persist": [7, 8], "enabl": [7, 8, 12], "without": 7, "note": [7, 12], "combin": 7, "synchron": 7, "multipl": 7, "repositori": 7, "an": 7, "extern": [7, 8, 10], "popul": 7, "pvc": [7, 8], "privat": 7, "github": 7, "repo": [7, 11], "log": [8, 10], "No": 8, "celeri": [8, 10], "provis": 8, "elasticsearch": 8, "paramet": [9, 12], "refer": 9, "common": 9, "port": [9, 12], "databas": [9, 10], "pgbouncer": [9, 10, 12], "rpc": 9, "server": 9, "schedul": [9, 10, 12], "webserv": [9, 10, 12], "trigger": [9, 12], "dagprocessor": 9, "flower": [9, 12], "redi": [9, 12], "statsd": [9, 10, 12], "job": [9, 12], "kubernet": [9, 10], "ingress": [9, 10, 12], "kerbero": 9, "product": 10, "guid": 10, "secret": 10, "kei": 10, "evict": 10, "knownhost": 10, "access": 10, "ui": 10, "loadbalanc": 10, "servic": 10, "metric": 10, "prometheu": 10, "datadog": 10, "backend": 10, "secur": 10, "context": 10, "constraint": 10, "built": 10, "quick": 11, "start": 11, "kind": 11, "cluster": 11, "stabl": 11, "namespac": 11, "apt": 11, "pypi": 11, "further": 11, "1": 12, "14": 12, "0": 12, "2024": 12, "06": 12, "18": 12, "signific": 12, "chang": 12, "clusterrol": 12, "clusterrolebind": 12, "have": 12, "been": 12, "updat": 12, "uniqu": 12, "37197": 12, "safetoevict": 12, "fals": 12, "40229": 12, "i": 12, "2": 12, "9": 12, "40160": 12, "v0": 12, "26": 12, "38416": 12, "new": 12, "improv": 12, "bug": 12, "fix": 12, "doc": 12, "onli": 12, "misc": 12, "13": 12, "03": 12, "25": 12, "8": 12, "3": 12, "38036": 12, "05": 12, "37704": 12, "12": 12, "02": 12, "11": 12, "The": 12, "now": 12, "newer": 12, "version": 12, "bitnami": 12, "postgresql": 12, "34817": 12, "36907": 12, "export": 12, "36898": 12, "37187": 12, "7": 12, "bookworm": 12, "2023": 12, "10": 12, "support": 12, "resourc": [12, 13], "some": 12, "mai": 12, "renam": 12, "dure": 12, "31066": 12, "subchart": 12, "33747": 12, "6": 12, "33748": 12, "34186": 12, "31979": 12, "04": 12, "29919": 12, "5": 12, "30411": 12, "29071": 12, "gitsync": 12, "wait": 12, "reduc": 12, "second": 12, "27625": 12, "29074": 12, "27848": 12, "bullsey": 12, "27443": 12, "2022": 12, "4": 12, "26485": 12, "20": 12, "23386": 12, "deprec": 12, "disabl": 12, "07": 12, "remov": 12, "config": 12, "api": 12, "01": 12, "web": 12, "host": 12, "data": 12, "type": 12, "ha": 12, "tl": 12, "move": 12, "preced": 12, "nodeselector": 12, "affin": 12, "toler": 12, "param": 12, "kubernetesexecutor": 12, "networkpolici": 12, "increas": 12, "livenessprob": 12, "timeoutsecond": 12, "2021": 12, "08": 12, "made": 12, "run": 12, "migrat": 12, "09": 12, "28": 12, "precedingpath": 12, "succeedingpath": 12, "path": 12, "longer": 12, "extranetworkpolici": 12, "root": 12, "dest": 12, "excludewebserv": 12, "migratedatabasejob": 12, "createuserjob": 12, "set": 13, "contain": [13, 14], "addit": 14, "init": 14}, "envversion": {"sphinx.domains.c": 2, "sphinx.domains.changeset": 1, "sphinx.domains.citation": 1, "sphinx.domains.cpp": 8, "sphinx.domains.index": 1, "sphinx.domains.javascript": 2, "sphinx.domains.math": 2, "sphinx.domains.python": 3, "sphinx.domains.rst": 2, "sphinx.domains.std": 2, "sphinx.ext.viewcode": 1, "sphinx.ext.intersphinx": 1, "sphinx": 57}, "alltitles": {"Adding Connections, Variables and Environment Variables": [[0, "adding-connections-variables-and-environment-variables"]], "Connections and Sensitive Environment Variables": [[0, "connections-and-sensitive-environment-variables"]], "Variables": [[0, "variables"]], "Configuring Airflow": [[1, "configuring-airflow"]], "Customizing Workers": [[2, "customizing-workers"]], "Custom pod_template_file": [[2, "custom-pod-template-file"]], "Extending the Chart": [[3, "extending-the-chart"]], "Create your custom Chart": [[3, "create-your-custom-chart"]], "Add Airflow chart as dependency": [[3, "add-airflow-chart-as-dependency"]], "Download the Airflow Chart": [[3, "download-the-airflow-chart"]], "Overriding default values": [[3, "overriding-default-values"]], "Helm Chart for Apache Airflow": [[4, "helm-chart-for-apache-airflow"]], "Requirements": [[4, "requirements"]], "Features": [[4, "features"]], "Installing the Chart": [[4, "installing-the-chart"]], "Upgrading the Chart": [[4, "upgrading-the-chart"]], "Uninstalling the Chart": [[4, "uninstalling-the-chart"]], "Installing the Chart with Argo CD, Flux, Rancher or Terraform": [[4, "installing-the-chart-with-argo-cd-flux-rancher-or-terraform"]], "Naming Conventions": [[4, "naming-conventions"]], "Installing Helm Chart from sources": [[5, "installing-helm-chart-from-sources"]], "Released packages": [[5, "released-packages"]], "Release integrity": [[5, "release-integrity"]], "Autoscaling with KEDA": [[6, "autoscaling-with-keda"]], "Manage DAGs files": [[7, "manage-dags-files"]], "Bake DAGs in Docker image": [[7, "bake-dags-in-docker-image"]], "Using Git-sync": [[7, "using-git-sync"]], "Mounting DAGs using Git-Sync sidecar with Persistence enabled": [[7, "mounting-dags-using-git-sync-sidecar-with-persistence-enabled"]], "Mounting DAGs using Git-Sync sidecar without Persistence": [[7, "mounting-dags-using-git-sync-sidecar-without-persistence"]], "Notes for combining git-sync and persistence": [[7, "notes-for-combining-git-sync-and-persistence"]], "Synchronizing multiple Git repositories with git-sync": [[7, "synchronizing-multiple-git-repositories-with-git-sync"]], "Mounting DAGs from an externally populated PVC": [[7, "mounting-dags-from-an-externally-populated-pvc"]], "Mounting DAGs from a private GitHub repo using Git-Sync sidecar": [[7, "mounting-dags-from-a-private-github-repo-using-git-sync-sidecar"]], "Manage logs": [[8, "manage-logs"]], "No persistence": [[8, "no-persistence"]], "Celery worker log persistence": [[8, "celery-worker-log-persistence"]], "Log persistence enabled": [[8, "log-persistence-enabled"]], "Externally provisioned PVC": [[8, "externally-provisioned-pvc"]], "Elasticsearch": [[8, "elasticsearch"]], "Parameters reference": [[9, "parameters-reference"]], "Common": [[9, "common"]], "Airflow": [[9, "airflow"]], "Images": [[9, "images"]], "Ports": [[9, "ports"]], "Database": [[9, "database"], [10, "database"]], "PgBouncer": [[9, "pgbouncer"], [10, "pgbouncer"]], "RPC Server": [[9, "rpc-server"]], "Scheduler": [[9, "scheduler"]], "Webserver": [[9, "webserver"]], "Workers": [[9, "workers"]], "Triggerer": [[9, "triggerer"]], "DagProcessor": [[9, "dagprocessor"]], "Flower": [[9, "flower"]], "Redis": [[9, "redis"]], "StatsD": [[9, "statsd"]], "Jobs": [[9, "jobs"]], "Kubernetes": [[9, "kubernetes"]], "Ingress": [[9, "ingress"], [10, "ingress"]], "Kerberos": [[9, "kerberos"]], "Production Guide": [[10, "production-guide"]], "Values file": [[10, "values-file"]], "Kubernetes Secret": [[10, "kubernetes-secret"]], "Webserver Secret Key": [[10, "webserver-secret-key"]], "Eviction configuration": [[10, "eviction-configuration"]], "Extending and customizing Airflow Image": [[10, "extending-and-customizing-airflow-image"]], "Managing DAG Files": [[10, "managing-dag-files"]], "knownHosts": [[10, "knownhosts"]], "External Scheduler": [[10, "external-scheduler"]], "Accessing the Airflow UI": [[10, "accessing-the-airflow-ui"]], "External Webserver": [[10, "external-webserver"]], "LoadBalancer Service": [[10, "loadbalancer-service"]], "Logging": [[10, "logging"]], "Metrics": [[10, "metrics"]], "Prometheus": [[10, "prometheus"]], "External StatsD": [[10, "external-statsd"]], "Datadog": [[10, "datadog"]], "Celery Backend": [[10, "celery-backend"]], "Security Context Constraints": [[10, "security-context-constraints"]], "Security Context": [[10, "security-context"]], "Built-in secrets and environment variables": [[10, "built-in-secrets-and-environment-variables"]], "Quick start with kind": [[11, "quick-start-with-kind"]], "Install kind, and create a cluster": [[11, "install-kind-and-create-a-cluster"]], "Add Airflow Helm Stable Repo": [[11, "add-airflow-helm-stable-repo"]], "Create namespace": [[11, "create-namespace"]], "Install the chart": [[11, "install-the-chart"]], "Extending Airflow Image": [[11, "extending-airflow-image"]], "Adding DAGs to your image": [[11, "adding-dags-to-your-image"]], "Adding apt packages to your image": [[11, "adding-apt-packages-to-your-image"]], "Adding PyPI packages to your image": [[11, "adding-pypi-packages-to-your-image"]], "Further extending and customizing the image": [[11, "further-extending-and-customizing-the-image"]], "Release Notes": [[12, "release-notes"]], "Apache Airflow Helm Chart Releases": [[12, "apache-airflow-helm-chart-releases"]], "Airflow Helm Chart 1.14.0 (2024-06-18)": [[12, "airflow-helm-chart-1-14-0-2024-06-18"]], "Significant Changes": [[12, "significant-changes"], [12, "id1"], [12, "id4"], [12, "id9"], [12, "id15"], [12, "id21"], [12, "id26"], [12, "id32"], [12, "id39"], [12, "id45"], [12, "id68"], [12, "id74"]], "ClusterRole and ClusterRoleBinding names have been updated to be unique (#37197)": [[12, "clusterrole-and-clusterrolebinding-names-have-been-updated-to-be-unique-37197"]], "workers.safeToEvict default changed to False (#40229)": [[12, "workers-safetoevict-default-changed-to-false-40229"]], "Default Airflow image is updated to 2.9.2 (#40160)": [[12, "default-airflow-image-is-updated-to-2-9-2-40160"]], "Default StatsD image is updated to v0.26.1 (#38416)": [[12, "default-statsd-image-is-updated-to-v0-26-1-38416"]], "New Features": [[12, "new-features"], [12, "id5"], [12, "id10"], [12, "id16"], [12, "id22"], [12, "id27"], [12, "id34"], [12, "id40"], [12, "id46"], [12, "id51"], [12, "id57"], [12, "id63"], [12, "id69"], [12, "id75"]], "Improvements": [[12, "improvements"], [12, "id6"], [12, "id11"], [12, "id17"], [12, "id23"], [12, "id28"], [12, "id35"], [12, "id41"], [12, "id47"], [12, "id52"], [12, "id58"], [12, "id64"], [12, "id70"], [12, "id76"]], "Bug Fixes": [[12, "bug-fixes"], [12, "id2"], [12, "id7"], [12, "id12"], [12, "id18"], [12, "id24"], [12, "id29"], [12, "id36"], [12, "id42"], [12, "id53"], [12, "id59"], [12, "id65"], [12, "id71"], [12, "id77"]], "Doc only changes": [[12, "doc-only-changes"], [12, "id13"], [12, "id19"], [12, "id30"], [12, "id37"], [12, "id43"], [12, "id48"], [12, "id54"], [12, "id60"], [12, "id66"], [12, "id72"], [12, "id78"]], "Misc": [[12, "misc"], [12, "id3"], [12, "id8"], [12, "id14"], [12, "id20"], [12, "id25"], [12, "id31"], [12, "id38"], [12, "id44"], [12, "id49"], [12, "id55"], [12, "id61"], [12, "id67"], [12, "id73"], [12, "id79"]], "Airflow Helm Chart 1.13.1 (2024-03-25)": [[12, "airflow-helm-chart-1-13-1-2024-03-25"]], "Default Airflow image is updated to 2.8.3 (#38036)": [[12, "default-airflow-image-is-updated-to-2-8-3-38036"]], "Airflow Helm Chart 1.13.0 (2024-03-05)": [[12, "airflow-helm-chart-1-13-0-2024-03-05"]], "Default Airflow image is updated to 2.8.2 (#37704)": [[12, "default-airflow-image-is-updated-to-2-8-2-37704"]], "Airflow Helm Chart 1.12.0 (2024-02-11)": [[12, "airflow-helm-chart-1-12-0-2024-02-11"]], "The helm chart is now using a newer version of bitnami/postgresql dependency (#34817)": [[12, "the-helm-chart-is-now-using-a-newer-version-of-bitnami-postgresql-dependency-34817"]], "Default Airflow image is updated to 2.8.1 (#36907)": [[12, "default-airflow-image-is-updated-to-2-8-1-36907"]], "Default PgBouncer and PgBouncer Exporter images have been updated (#36898)": [[12, "default-pgbouncer-and-pgbouncer-exporter-images-have-been-updated-36898"]], "Default StatsD image is updated to v0.26.0 (#37187)": [[12, "default-statsd-image-is-updated-to-v0-26-0-37187"]], "Default Redis image is updated to 7-bookworm (#37187)": [[12, "default-redis-image-is-updated-to-7-bookworm-37187"]], "Airflow Helm Chart 1.11.0 (2023-10-02)": [[12, "airflow-helm-chart-1-11-0-2023-10-02"]], "Support naming customization on helm chart resources, some resources may be renamed during upgrade (#31066)": [[12, "support-naming-customization-on-helm-chart-resources-some-resources-may-be-renamed-during-upgrade-31066"]], "bitnami/postgresql subchart updated to 12.10.0 (#33747)": [[12, "bitnami-postgresql-subchart-updated-to-12-10-0-33747"]], "Default git-sync image is updated to 3.6.9 (#33748)": [[12, "default-git-sync-image-is-updated-to-3-6-9-33748"]], "Default Airflow image is updated to 2.7.1 (#34186)": [[12, "default-airflow-image-is-updated-to-2-7-1-34186"]], "Airflow Helm Chart 1.10.0 (2023-06-26)": [[12, "airflow-helm-chart-1-10-0-2023-06-26"]], "Default Airflow image is updated to 2.6.2 (#31979)": [[12, "default-airflow-image-is-updated-to-2-6-2-31979"]], "Airflow Helm Chart 1.9.0 (2023-04-14)": [[12, "airflow-helm-chart-1-9-0-2023-04-14"]], "Default PgBouncer and PgBouncer Exporter images have been updated (#29919)": [[12, "default-pgbouncer-and-pgbouncer-exporter-images-have-been-updated-29919"]], "Default Airflow image is updated to 2.5.3 (#30411)": [[12, "default-airflow-image-is-updated-to-2-5-3-30411"]], "Airflow Helm Chart 1.8.0 (2023-02-06)": [[12, "airflow-helm-chart-1-8-0-2023-02-06"]], "bitnami/postgresql subchart updated to 12.1.9 (#29071)": [[12, "bitnami-postgresql-subchart-updated-to-12-1-9-29071"]], "Default dags.gitSync.wait reduced to 5 seconds (#27625)": [[12, "default-dags-gitsync-wait-reduced-to-5-seconds-27625"]], "Default Airflow image is updated to 2.5.1 (#29074)": [[12, "default-airflow-image-is-updated-to-2-5-1-29074"]], "Default git-sync image is updated to 3.6.3 (#27848)": [[12, "default-git-sync-image-is-updated-to-3-6-3-27848"]], "Default redis image is updated to 7-bullseye (#27443)": [[12, "default-redis-image-is-updated-to-7-bullseye-27443"]], "Airflow Helm Chart 1.7.0 (2022-10-14)": [[12, "airflow-helm-chart-1-7-0-2022-10-14"]], "Default Airflow image is updated to 2.4.1 (#26485)": [[12, "default-airflow-image-is-updated-to-2-4-1-26485"]], "Airflow Helm Chart 1.6.0 (2022-05-20)": [[12, "airflow-helm-chart-1-6-0-2022-05-20"]], "Default Airflow image is updated to 2.3.0 (#23386)": [[12, "default-airflow-image-is-updated-to-2-3-0-23386"]], "ingress.enabled is deprecated": [[12, "ingress-enabled-is-deprecated"]], "Flower disabled by default": [[12, "flower-disabled-by-default"]], "Airflow Helm Chart 1.5.0, (2022-03-07)": [[12, "airflow-helm-chart-1-5-0-2022-03-07"]], "Significant changes": [[12, "id50"], [12, "id56"], [12, "id62"]], "Default Airflow image is updated to 2.2.4": [[12, "default-airflow-image-is-updated-to-2-2-4"]], "Removed config.api": [[12, "removed-config-api"]], "Airflow Helm Chart 1.4.0, (2022-01-10)": [[12, "airflow-helm-chart-1-4-0-2022-01-10"]], "Default Airflow image is updated to 2.2.3": [[12, "default-airflow-image-is-updated-to-2-2-3"]], "ingress.web.hosts and ingress.flower.hosts parameters data type has changed and ingress.web.tls and ingress.flower.tls have moved": [[12, "ingress-web-hosts-and-ingress-flower-hosts-parameters-data-type-has-changed-and-ingress-web-tls-and-ingress-flower-tls-have-moved"]], "Fixed precedence of nodeSelector, affinity and tolerations params": [[12, "fixed-precedence-of-nodeselector-affinity-and-tolerations-params"]], "Default KubernetesExecutor worker affinity removed": [[12, "default-kubernetesexecutor-worker-affinity-removed"]], "Changes in webserver and flower NetworkPolicy default ports": [[12, "changes-in-webserver-and-flower-networkpolicy-default-ports"]], "Increase default livenessProbe timeoutSeconds for scheduler and triggerer": [[12, "increase-default-livenessprobe-timeoutseconds-for-scheduler-and-triggerer"]], "Airflow Helm Chart 1.3.0 (2021-11-08)": [[12, "airflow-helm-chart-1-3-0-2021-11-08"]], "Default Airflow image is updated to 2.2.1": [[12, "default-airflow-image-is-updated-to-2-2-1"]], "Resources made configurable for airflow-run-airflow-migrations job": [[12, "resources-made-configurable-for-airflow-run-airflow-migrations-job"]], "Airflow Helm Chart 1.2.0 (2021-09-28)": [[12, "airflow-helm-chart-1-2-0-2021-09-28"]], "ingress.web.host and ingress.flower.host parameters have been renamed and data type changed": [[12, "ingress-web-host-and-ingress-flower-host-parameters-have-been-renamed-and-data-type-changed"]], "Default Airflow version is updated to 2.1.4": [[12, "default-airflow-version-is-updated-to-2-1-4"]], "Removed ingress.flower.precedingPaths and ingress.flower.succeedingPaths parameters": [[12, "removed-ingress-flower-precedingpaths-and-ingress-flower-succeedingpaths-parameters"]], "Change of default path on Ingress": [[12, "change-of-default-path-on-ingress"]], "Airflow Helm Chart 1.1.0 (2021-07-26)": [[12, "airflow-helm-chart-1-1-0-2021-07-26"]], "Default Airflow version is updated to 2.1.2": [[12, "default-airflow-version-is-updated-to-2-1-2"]], "Helm 2 no longer supported": [[12, "helm-2-no-longer-supported"]], "webserver.extraNetworkPolicies and flower.extraNetworkPolicies parameters have been renamed": [[12, "webserver-extranetworkpolicies-and-flower-extranetworkpolicies-parameters-have-been-renamed"]], "Removed dags.gitSync.root, dags.gitSync.dest, and dags.gitSync.excludeWebserver parameters": [[12, "removed-dags-gitsync-root-dags-gitsync-dest-and-dags-gitsync-excludewebserver-parameters"]], "nodeSelector, affinity and tolerations on migrateDatabaseJob and createUserJob jobs": [[12, "nodeselector-affinity-and-tolerations-on-migratedatabasejob-and-createuserjob-jobs"]], "Setting resources for containers": [[13, "setting-resources-for-containers"]], "Using additional containers": [[14, "using-additional-containers"]], "Sidecar Containers": [[14, "sidecar-containers"]], "Init Containers": [[14, "init-containers"]]}, "indexentries": {}}) \ No newline at end of file diff --git a/docs-archive/helm-chart/1.14.0/setting-resources-for-containers.html b/docs-archive/helm-chart/1.14.0/setting-resources-for-containers.html new file mode 100644 index 00000000000..685189b7224 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/setting-resources-for-containers.html @@ -0,0 +1,914 @@ + + + + + + + + + + + + Setting resources for containers — helm-chart Documentation + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ + +
+ + +
+ + +
+
+
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+
+
+
+ +
+ + +
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+ + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+
+
+

Setting resources for containers

+

It is possible to set resources for the Containers managed by the chart. You can define different resources for various Airflow k8s Containers. By default the resources are not set.

+
+

Note

+

The k8s scheduler can use resources to decide which node to place the Pod on. Since a Pod resource request/limit is the sum of the resource requests/limits for each Container in the Pod, it is advised to specify resources for each Container in the Pod.

+
+

Possible Containers where resources can be configured include:

+
    +

  • Main Airflow Containers and their sidecars. You can add the resources for these Containers through the following parameters:

    +
    +
      +

    • workers.resources

      • +

    • workers.logGroomerSidecar.resources

      • +

    • workers.kerberosSidecar.resources

      • +

    • workers.kerberosInitContainer.resources

      • +

    • scheduler.resources

      • +

    • scheduler.logGroomerSidecar.resources

      • +

    • dags.gitSync.resources

      • +

    • webserver.resources

      • +

    • flower.resources

      • +

    • dagProcessor.resources

      • +

    • dagProcessor.logGroomerSidecar.resources

      • +

    • triggerer.resources

      • +

    • triggerer.logGroomerSidecar.resources

      • +
    +
    +
    • +

  • Containers used for Airflow k8s jobs or cron jobs. You can add the resources for these Containers through the following parameters:

    +
    +
      +

    • cleanup.resources

      • +

    • createUserJob.resources

      • +

    • migrateDatabaseJob.resources

      • +
    +
    +
    • +

  • Other containers that can be deployed by the chart. You can add the resources for these Containers through the following parameters:

    +
    +
      +

    • statsd.resources

      • +

    • pgbouncer.resources

      • +

    • pgbouncer.metricsExporterSidecar.resources

      • +

    • redis.resources

      • +
    +
    +
    • +
+

For example, specifying resources for worker Kerberos sidecar:

+
workers:
+  kerberosSidecar:
+    resources:
+      limits:
+        cpu: 200m
+        memory: 256Mi
+      requests:
+        cpu: 100m
+        memory: 128Mi
+
+
+
+ + + +
+ +
+
+
+
+
+

Was this entry helpful?

+
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+
+ +
+ + + + + + +
+ + + + + + + + + + + + + + + +
+ + + + +
+ + +
+ + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/docs-archive/helm-chart/1.14.0/updating.html b/docs-archive/helm-chart/1.14.0/updating.html new file mode 100644 index 00000000000..327c53bdf40 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/updating.html @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/docs-archive/helm-chart/1.14.0/using-additional-containers.html b/docs-archive/helm-chart/1.14.0/using-additional-containers.html new file mode 100644 index 00000000000..8dda3881b93 --- /dev/null +++ b/docs-archive/helm-chart/1.14.0/using-additional-containers.html @@ -0,0 +1,906 @@ + + + + + + + + + + + + Using additional containers — helm-chart Documentation + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ + +
+ + +
+ + +
+
+
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+
+
+
+ +
+ + +
+ +
+ +
+ +
+ +
+ +
+
+ + + + + +
+
+ + + + + + + + +
+ + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+
+
+

Using additional containers

+
+

Sidecar Containers

+

If you want to deploy your own sidecar container, you can add it through the extraContainers parameter. +You can define different containers for the scheduler, webserver, worker, triggerer, DAG processor, flower, create user Job and migrate database Job Pods.

+

For example, sidecars that sync DAGs from object storage.

+
scheduler:
+  extraContainers:
+    - name: s3-sync
+      image: my-company/s3-sync:latest
+      imagePullPolicy: Always
+workers:
+  extraContainers:
+    - name: s3-sync
+      image: my-company/s3-sync:latest
+      imagePullPolicy: Always
+
+
+
+

Note

+

If you use workers.extraContainers with KubernetesExecutor, you are responsible for signaling +sidecars to exit when the main container finishes so Airflow can continue the worker shutdown process!

+
+
+
+

Init Containers

+

You can also deploy extra init containers through the extraInitContainers parameter. +You can define different containers for the scheduler, webserver, worker, triggerer and DAG processor pods.

+

For example, an init container that just says hello:

+
scheduler:
+  extraInitContainers:
+    - name: hello
+      image: debian
+      args:
+        - echo
+        - hello
+
+
+
+
+ + + +
+ +
+
+
+
+
+

Was this entry helpful?

+
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+
+ +
+ + + + + + +
+ + + + + + + + + + + + + + + +
+ + + + +
+ + +
+ + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/docs-archive/helm-chart/stable.txt b/docs-archive/helm-chart/stable.txt index da38e07b326..cd99d386a8d 100644 --- a/docs-archive/helm-chart/stable.txt +++ b/docs-archive/helm-chart/stable.txt @@ -1 +1 @@ -1.13.1 \ No newline at end of file +1.14.0 \ No newline at end of file diff --git a/landing-pages/site/static/index.yaml b/landing-pages/site/static/index.yaml index 77884f2c3e4..aaff3a5b695 100644 --- a/landing-pages/site/static/index.yaml +++ b/landing-pages/site/static/index.yaml @@ -18,6 +18,159 @@ apiVersion: v1 entries: airflow: + - annotations: + artifacthub.io/changes: | + - description: Enable MySQL KEDA support for triggerer + kind: added + links: + - name: '#37365' + url: https://github.com/apache/airflow/pull/37365 + - description: Allow AWS Executors + kind: added + links: + - name: '#38524' + url: https://github.com/apache/airflow/pull/38524 + - description: Allow ``valueFrom`` in env config of components + kind: changed + links: + - name: '#40135' + url: https://github.com/apache/airflow/pull/40135 + - description: Enable templating in ``extraContainers`` and ``extraInitContainers`` + kind: changed + links: + - name: '#38507' + url: https://github.com/apache/airflow/pull/38507 + - description: Add safe-to-evict annotation to pod-template-file + kind: changed + links: + - name: '#37352' + url: https://github.com/apache/airflow/pull/37352 + - description: Support ``workers.command`` for KubernetesExecutor + kind: changed + links: + - name: '#39132' + url: https://github.com/apache/airflow/pull/39132 + - description: Add ``priorityClassName`` to Jobs + kind: changed + links: + - name: '#39133' + url: https://github.com/apache/airflow/pull/39133 + - description: Add Kerberos sidecar to pod-template-file + kind: changed + links: + - name: '#38815' + url: https://github.com/apache/airflow/pull/38815 + - description: Add templated field support for extra containers + kind: changed + links: + - name: '#38510' + url: https://github.com/apache/airflow/pull/38510 + - description: Set ``workers.safeToEvict`` default to False + kind: fixed + links: + - name: '#40229' + url: https://github.com/apache/airflow/pull/40229 + - description: 'Docs: Document ``extraContainers`` and ``extraInitContainers`` that + are templated' + kind: changed + links: + - name: '#40033' + url: https://github.com/apache/airflow/pull/40033 + - description: 'Docs: Fix typo in HorizontalPodAutoscaling documentation' + kind: changed + links: + - name: '#39307' + url: https://github.com/apache/airflow/pull/39307 + - description: 'Docs: Fix supported k8s versions in docs' + kind: changed + links: + - name: '#39172' + url: https://github.com/apache/airflow/pull/39172 + - description: 'Docs: Fix typo in YAML path for ``brokerUrlSecretName``' + kind: changed + links: + - name: '#39115' + url: https://github.com/apache/airflow/pull/39115 + - description: 'Misc: Default Airflow version to 2.9.2' + kind: changed + links: + - name: '#40160' + url: https://github.com/apache/airflow/pull/40160 + - description: 'Misc: Limit Redis image to 7.2' + kind: changed + links: + - name: '#38928' + url: https://github.com/apache/airflow/pull/38928 + - description: 'Misc: Build Helm values schemas with Kubernetes 1.29 resources' + kind: changed + links: + - name: '#38460' + url: https://github.com/apache/airflow/pull/38460 + - description: 'Misc: Add missing containers to resources docs' + kind: changed + links: + - name: '#38534' + url: https://github.com/apache/airflow/pull/38534 + - description: 'Misc: Upgrade StatsD Exporter image to 0.26.1' + kind: changed + links: + - name: '#38416' + url: https://github.com/apache/airflow/pull/38416 + - description: 'Misc: Remove K8S 1.25 support' + kind: changed + links: + - name: '#38367' + url: https://github.com/apache/airflow/pull/38367 + artifacthub.io/links: | + - name: Documentation + url: https://airflow.apache.org/docs/helm-chart/1.14.0/ + artifacthub.io/screenshots: | + - title: DAGs View + url: https://airflow.apache.org/docs/apache-airflow/2.9.2/_images/dags.png + - title: Datasets View + url: https://airflow.apache.org/docs/apache-airflow/2.9.2/_images/datasets.png + - title: Grid View + url: https://airflow.apache.org/docs/apache-airflow/2.9.2/_images/grid.png + - title: Graph View + url: https://airflow.apache.org/docs/apache-airflow/2.9.2/_images/graph.png + - title: Calendar View + url: https://airflow.apache.org/docs/apache-airflow/2.9.2/_images/calendar.png + - title: Variable View + url: https://airflow.apache.org/docs/apache-airflow/2.9.2/_images/variable_hidden.png + - title: Gantt Chart + url: https://airflow.apache.org/docs/apache-airflow/2.9.2/_images/gantt.png + - title: Task Duration + url: https://airflow.apache.org/docs/apache-airflow/2.9.2/_images/duration.png + - title: Code View + url: https://airflow.apache.org/docs/apache-airflow/2.9.2/_images/code.png + apiVersion: v2 + appVersion: 2.9.2 + created: "2024-06-18T18:15:47.330613-06:00" + dependencies: + - condition: postgresql.enabled + name: postgresql + repository: https://charts.bitnami.com/bitnami + version: 13.2.24 + description: The official Helm chart to deploy Apache Airflow, a platform to programmatically + author, schedule, and monitor workflows + digest: 206d7eae00697bfd2fbe896b58adf9d66f928f70ee75a07e5772be86c9ed6185 + home: https://airflow.apache.org/ + icon: https://airflow.apache.org/images/airflow_dark_bg.png + keywords: + - apache + - airflow + - workflow + - scheduler + maintainers: + - email: dev@airflow.apache.org + name: Apache Airflow PMC + name: airflow + sources: + - https://github.com/apache/airflow + type: application + urls: + - https://downloads.apache.org/airflow/helm-chart/1.14.0/airflow-1.14.0.tgz + version: 1.14.0 - annotations: artifacthub.io/changes: | - description: Don't overwrite ``.Values.airflowPodAnnotations`` @@ -84,7 +237,7 @@ entries: - https://github.com/apache/airflow type: application urls: - - https://downloads.apache.org/airflow/helm-chart/1.13.1/airflow-1.13.1.tgz + - https://archive.apache.org/dist/airflow/helm-chart/1.13.1/airflow-1.13.1.tgz version: 1.13.1 - annotations: artifacthub.io/changes: | @@ -1978,4 +2131,4 @@ entries: urls: - https://archive.apache.org/dist/airflow/helm-chart/1.0.0/airflow-1.0.0.tgz version: 1.0.0 -generated: "2024-03-25T14:32:48.504613-04:00" +generated: "2024-06-18T18:15:47.317129-06:00"