diff --git a/CMakeLists.txt b/CMakeLists.txt
index 0289f55e..89f75d22 100644
--- a/CMakeLists.txt
+++ b/CMakeLists.txt
@@ -5,6 +5,7 @@ option(ENABLE_LOGGING "Enable logging support" ON)
 option(ENABLE_STACKTRACE "Enable stacktrace support" ON)
 option(ENABLE_TESTS "Enable tests" ON)
 option(ENABLE_COMPILER "Enables tracing and backend compilers" ON)
+option(USE_EXTERNAL_FMT "Use a externally provided version of fmt" OFF)
 option(USE_EXTERNAL_SPDLOG "Use a externally provided version of spdlog" OFF)
 option(USE_EXTERNAL_MLIR "Use a externally provided version of MLIR" OFF)
 cmake_dependent_option(ENABLE_TRACING "Enable the tracing" ON "ENABLE_COMPILER" OFF)
@@ -66,17 +67,27 @@ if (ENABLE_TESTS)
     list(APPEND EXPORT_TARGETS Catch2)
 endif ()
 
+if (USE_EXTERNAL_FMT)
+    find_package(fmt CONFIG REQUIRED)
+else ()
+    add_subdirectory(${THIRD_PARTY_DIR}/fmt EXCLUDE_FROM_ALL)
+    disable_target_warnings(fmt)
+    list(APPEND EXPORT_TARGETS fmt)
+endif ()
+
 if (ENABLE_LOGGING)
     if (USE_EXTERNAL_SPDLOG)
         find_package(spdlog CONFIG REQUIRED)
     else ()
         set(SPDLOG_COMPILED_LIB ON)
         set(SPDLOG_BUILD_SHARED OFF)
+        set(SPDLOG_FMT_EXTERNAL ON)
         add_subdirectory(${THIRD_PARTY_DIR}/spdlog)
         list(APPEND EXPORT_TARGETS spdlog)
     endif ()
 endif ()
 
+
 if (ENABLE_STACKTRACE)
     # Also requires one of: libbfd (gnu binutils), libdwarf, libdw (elfutils)
     add_subdirectory(${THIRD_PARTY_DIR}/backward-cpp)
diff --git a/nautilus/CMakeLists.txt b/nautilus/CMakeLists.txt
index bb3d35dd..940ce25c 100644
--- a/nautilus/CMakeLists.txt
+++ b/nautilus/CMakeLists.txt
@@ -32,6 +32,8 @@ set_target_properties(nautilus PROPERTIES
         EXPORT_NAME nautilus
 )
 
+target_link_libraries(nautilus PRIVATE fmt::fmt)
+
 if (ENABLE_LOGGING)
     target_link_libraries(nautilus PRIVATE spdlog::spdlog)
 endif ()
@@ -54,6 +56,7 @@ install(
         TARGETS nautilus ${EXPORT_TARGETS}
         EXPORT ${PROJECT_NAME}-config
         ARCHIVE DESTINATION "${CMAKE_INSTALL_LIBDIR}"
+        PUBLIC_HEADER DESTINATION ${CMAKE_INSTALL_INCLUDEDIR}/
 )
 
 install(
diff --git a/third_party/CMakeLists.txt b/third_party/CMakeLists.txt
index 77c20ac2..da94e1d2 100644
--- a/third_party/CMakeLists.txt
+++ b/third_party/CMakeLists.txt
@@ -8,9 +8,13 @@ endif ()
 if (ENABLE_LOGGING)
     set(SPDLOG_COMPILED_LIB ON)
     set(SPDLOG_BUILD_SHARED OFF)
+    set(SPDLOG_FMT_EXTERNAL ON)
     add_subdirectory(spdlog)
 endif ()
 
+add_subdirectory(fmt)
+disable_target_warnings(fmt)
+
 if (ENABLE_STACKTRACE)
     # Also requires one of: libbfd (gnu binutils), libdwarf, libdw (elfutils)
     add_subdirectory(backward-cpp)
diff --git a/third_party/fmt/CMakeLists.txt b/third_party/fmt/CMakeLists.txt
index 285e5ed1..e3b35110 100644
--- a/third_party/fmt/CMakeLists.txt
+++ b/third_party/fmt/CMakeLists.txt
@@ -1,15 +1,520 @@
-if (POLICY CMP0063)
-    cmake_policy(SET CMP0063 NEW)
+cmake_minimum_required(VERSION 3.8...3.28)
+
+# Fallback for using newer policies on CMake <3.12.
+if (${CMAKE_VERSION} VERSION_LESS 3.12)
+  cmake_policy(VERSION ${CMAKE_MAJOR_VERSION}.${CMAKE_MINOR_VERSION})
+endif ()
+
+# Determine if fmt is built as a subproject (using add_subdirectory)
+# or if it is the master project.
+if (NOT DEFINED FMT_MASTER_PROJECT)
+  set(FMT_MASTER_PROJECT OFF)
+  if (CMAKE_CURRENT_SOURCE_DIR STREQUAL CMAKE_SOURCE_DIR)
+    set(FMT_MASTER_PROJECT ON)
+    message(STATUS "CMake version: ${CMAKE_VERSION}")
+  endif ()
+endif ()
+
+# Joins arguments and places the results in ${result_var}.
+function(join result_var)
+  set(result "")
+  foreach (arg ${ARGN})
+    set(result "${result}${arg}")
+  endforeach ()
+  set(${result_var} "${result}" PARENT_SCOPE)
+endfunction()
+
+# DEPRECATED! Should be merged into add_module_library.
+function(enable_module target)
+  if (MSVC)
+    set(BMI ${CMAKE_CURRENT_BINARY_DIR}/${target}.ifc)
+    target_compile_options(${target}
+      PRIVATE /interface /ifcOutput ${BMI}
+      INTERFACE /reference fmt=${BMI})
+    set_target_properties(${target} PROPERTIES ADDITIONAL_CLEAN_FILES ${BMI})
+    set_source_files_properties(${BMI} PROPERTIES GENERATED ON)
+  endif ()
+endfunction()
+
+set(FMT_USE_CMAKE_MODULES FALSE)
+if (CMAKE_VERSION VERSION_GREATER_EQUAL 3.28 AND
+    CMAKE_GENERATOR STREQUAL "Ninja")
+  set(FMT_USE_CMAKE_MODULES TRUE)
+endif ()
+
+# Adds a library compiled with C++20 module support.
+# `enabled` is a CMake variables that specifies if modules are enabled.
+# If modules are disabled `add_module_library` falls back to creating a
+# non-modular library.
+#
+# Usage:
+#   add_module_library(<name> [sources...] FALLBACK [sources...] [IF enabled])
+function(add_module_library name)
+  cmake_parse_arguments(AML "" "IF" "FALLBACK" ${ARGN})
+  set(sources ${AML_UNPARSED_ARGUMENTS})
+
+  add_library(${name})
+  set_target_properties(${name} PROPERTIES LINKER_LANGUAGE CXX)
+
+  if (NOT ${${AML_IF}})
+    # Create a non-modular library.
+    target_sources(${name} PRIVATE ${AML_FALLBACK})
+    set_target_properties(${name} PROPERTIES CXX_SCAN_FOR_MODULES OFF)
+    return()
+  endif ()
+
+  # Modules require C++20.
+  target_compile_features(${name} PUBLIC cxx_std_20)
+  if (CMAKE_COMPILER_IS_GNUCXX)
+    target_compile_options(${name} PUBLIC -fmodules-ts)
+  endif ()
+
+  target_compile_definitions(${name} PRIVATE FMT_MODULE)
+
+  if (FMT_USE_CMAKE_MODULES)
+    target_sources(${name} PUBLIC FILE_SET fmt TYPE CXX_MODULES
+                   FILES ${sources})
+  else()
+    # `std` is affected by CMake options and may be higher than C++20.
+    get_target_property(std ${name} CXX_STANDARD)
+
+    if (CMAKE_CXX_COMPILER_ID MATCHES "Clang")
+      set(pcms)
+      foreach (src ${sources})
+        get_filename_component(pcm ${src} NAME_WE)
+        set(pcm ${pcm}.pcm)
+
+        # Propagate -fmodule-file=*.pcm to targets that link with this library.
+        target_compile_options(
+          ${name} PUBLIC -fmodule-file=${CMAKE_CURRENT_BINARY_DIR}/${pcm})
+
+        # Use an absolute path to prevent target_link_libraries prepending -l
+        # to it.
+        set(pcms ${pcms} ${CMAKE_CURRENT_BINARY_DIR}/${pcm})
+        add_custom_command(
+          OUTPUT ${pcm}
+          COMMAND ${CMAKE_CXX_COMPILER}
+                  -std=c++${std} -x c++-module --precompile -c
+                  -o ${pcm} ${CMAKE_CURRENT_SOURCE_DIR}/${src}
+                  "-I$<JOIN:$<TARGET_PROPERTY:${name},INCLUDE_DIRECTORIES>,;-I>"
+          # Required by the -I generator expression above.
+          COMMAND_EXPAND_LISTS
+          DEPENDS ${src})
+      endforeach ()
+
+      # Add .pcm files as sources to make sure they are built before the library.
+      set(sources)
+      foreach (pcm ${pcms})
+        get_filename_component(pcm_we ${pcm} NAME_WE)
+        set(obj ${pcm_we}.o)
+        # Use an absolute path to prevent target_link_libraries prepending -l.
+        set(sources ${sources} ${pcm} ${CMAKE_CURRENT_BINARY_DIR}/${obj})
+        add_custom_command(
+          OUTPUT ${obj}
+          COMMAND ${CMAKE_CXX_COMPILER} $<TARGET_PROPERTY:${name},COMPILE_OPTIONS>
+                  -c -o ${obj} ${pcm}
+          DEPENDS ${pcm})
+      endforeach ()
+    endif ()
+    target_sources(${name} PRIVATE ${sources})
+  endif()
+endfunction()
+
+include(CMakeParseArguments)
+
+# Sets a cache variable with a docstring joined from multiple arguments:
+#   set(<variable> <value>... CACHE <type> <docstring>...)
+# This allows splitting a long docstring for readability.
+function(set_verbose)
+  # cmake_parse_arguments is broken in CMake 3.4 (cannot parse CACHE) so use
+  # list instead.
+  list(GET ARGN 0 var)
+  list(REMOVE_AT ARGN 0)
+  list(GET ARGN 0 val)
+  list(REMOVE_AT ARGN 0)
+  list(REMOVE_AT ARGN 0)
+  list(GET ARGN 0 type)
+  list(REMOVE_AT ARGN 0)
+  join(doc ${ARGN})
+  set(${var} ${val} CACHE ${type} ${doc})
+endfunction()
+
+# Set the default CMAKE_BUILD_TYPE to Release.
+# This should be done before the project command since the latter can set
+# CMAKE_BUILD_TYPE itself (it does so for nmake).
+if (FMT_MASTER_PROJECT AND NOT CMAKE_BUILD_TYPE)
+  set_verbose(CMAKE_BUILD_TYPE Release CACHE STRING
+              "Choose the type of build, options are: None(CMAKE_CXX_FLAGS or "
+              "CMAKE_C_FLAGS used) Debug Release RelWithDebInfo MinSizeRel.")
+endif ()
+
+project(FMT CXX)
+include(GNUInstallDirs)
+set_verbose(FMT_INC_DIR ${CMAKE_INSTALL_INCLUDEDIR} CACHE STRING
+            "Installation directory for include files, a relative path that "
+            "will be joined with ${CMAKE_INSTALL_PREFIX} or an absolute path.")
+
+option(FMT_PEDANTIC "Enable extra warnings and expensive tests." OFF)
+option(FMT_WERROR "Halt the compilation with an error on compiler warnings."
+       OFF)
+
+# Options that control generation of various targets.
+option(FMT_DOC "Generate the doc target." ${FMT_MASTER_PROJECT})
+option(FMT_INSTALL "Generate the install target." ON)
+option(FMT_TEST "Generate the test target." ${FMT_MASTER_PROJECT})
+option(FMT_FUZZ "Generate the fuzz target." OFF)
+option(FMT_CUDA_TEST "Generate the cuda-test target." OFF)
+option(FMT_OS "Include OS-specific APIs." ON)
+option(FMT_MODULE "Build a module instead of a traditional library." OFF)
+option(FMT_SYSTEM_HEADERS "Expose headers with marking them as system." OFF)
+option(FMT_UNICODE "Enable Unicode support." ON)
+
+if (FMT_TEST AND FMT_MODULE)
+  # The tests require {fmt} to be compiled as traditional library
+  message(STATUS "Testing is incompatible with build mode 'module'.")
+endif ()
+set(FMT_SYSTEM_HEADERS_ATTRIBUTE "")
+if (FMT_SYSTEM_HEADERS)
+  set(FMT_SYSTEM_HEADERS_ATTRIBUTE SYSTEM)
+endif ()
+if (CMAKE_SYSTEM_NAME STREQUAL "MSDOS")
+  set(FMT_TEST OFF)
+  message(STATUS "MSDOS is incompatible with gtest")
+endif ()
+
+# Get version from base.h
+file(READ include/fmt/base.h base_h)
+if (NOT base_h MATCHES "FMT_VERSION ([0-9]+)([0-9][0-9])([0-9][0-9])")
+  message(FATAL_ERROR "Cannot get FMT_VERSION from base.h.")
+endif ()
+# Use math to skip leading zeros if any.
+math(EXPR CPACK_PACKAGE_VERSION_MAJOR ${CMAKE_MATCH_1})
+math(EXPR CPACK_PACKAGE_VERSION_MINOR ${CMAKE_MATCH_2})
+math(EXPR CPACK_PACKAGE_VERSION_PATCH ${CMAKE_MATCH_3})
+join(FMT_VERSION ${CPACK_PACKAGE_VERSION_MAJOR}.${CPACK_PACKAGE_VERSION_MINOR}.
+                 ${CPACK_PACKAGE_VERSION_PATCH})
+message(STATUS "{fmt} version: ${FMT_VERSION}")
+
+message(STATUS "Build type: ${CMAKE_BUILD_TYPE}")
+
+if (NOT CMAKE_RUNTIME_OUTPUT_DIRECTORY)
+  set(CMAKE_RUNTIME_OUTPUT_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR}/bin)
+endif ()
+
+set(CMAKE_MODULE_PATH ${CMAKE_MODULE_PATH}
+  "${CMAKE_CURRENT_SOURCE_DIR}/support/cmake")
+
+include(CheckCXXCompilerFlag)
+include(JoinPaths)
+
+if (FMT_MASTER_PROJECT AND NOT DEFINED CMAKE_CXX_VISIBILITY_PRESET)
+  set_verbose(CMAKE_CXX_VISIBILITY_PRESET hidden CACHE STRING
+              "Preset for the export of private symbols")
+  set_property(CACHE CMAKE_CXX_VISIBILITY_PRESET PROPERTY STRINGS
+               hidden default)
+endif ()
+
+if (FMT_MASTER_PROJECT AND NOT DEFINED CMAKE_VISIBILITY_INLINES_HIDDEN)
+  set_verbose(CMAKE_VISIBILITY_INLINES_HIDDEN ON CACHE BOOL
+              "Whether to add a compile flag to hide symbols of inline functions")
+endif ()
+
+if (CMAKE_CXX_COMPILER_ID MATCHES "GNU")
+  set(PEDANTIC_COMPILE_FLAGS -pedantic-errors -Wall -Wextra -pedantic
+      -Wold-style-cast -Wundef
+      -Wredundant-decls -Wwrite-strings -Wpointer-arith
+      -Wcast-qual -Wformat=2 -Wmissing-include-dirs
+      -Wcast-align
+      -Wctor-dtor-privacy -Wdisabled-optimization
+      -Winvalid-pch -Woverloaded-virtual
+      -Wconversion -Wundef
+      -Wno-ctor-dtor-privacy -Wno-format-nonliteral)
+  if (NOT CMAKE_CXX_COMPILER_VERSION VERSION_LESS 4.6)
+      set(PEDANTIC_COMPILE_FLAGS ${PEDANTIC_COMPILE_FLAGS}
+         -Wno-dangling-else -Wno-unused-local-typedefs)
+  endif ()
+  if (NOT CMAKE_CXX_COMPILER_VERSION VERSION_LESS 5.0)
+      set(PEDANTIC_COMPILE_FLAGS ${PEDANTIC_COMPILE_FLAGS} -Wdouble-promotion
+          -Wtrampolines -Wzero-as-null-pointer-constant -Wuseless-cast
+          -Wvector-operation-performance -Wsized-deallocation -Wshadow)
+  endif ()
+  if (NOT CMAKE_CXX_COMPILER_VERSION VERSION_LESS 6.0)
+      set(PEDANTIC_COMPILE_FLAGS ${PEDANTIC_COMPILE_FLAGS} -Wshift-overflow=2
+          -Wnull-dereference -Wduplicated-cond)
+  endif ()
+  set(WERROR_FLAG -Werror)
+endif ()
+
+if (CMAKE_CXX_COMPILER_ID MATCHES "Clang")
+  set(PEDANTIC_COMPILE_FLAGS -Wall -Wextra -pedantic -Wconversion -Wundef
+      -Wdeprecated -Wweak-vtables -Wshadow
+      -Wno-gnu-zero-variadic-macro-arguments)
+  check_cxx_compiler_flag(-Wzero-as-null-pointer-constant HAS_NULLPTR_WARNING)
+  if (HAS_NULLPTR_WARNING)
+    set(PEDANTIC_COMPILE_FLAGS ${PEDANTIC_COMPILE_FLAGS}
+        -Wzero-as-null-pointer-constant)
+  endif ()
+  set(WERROR_FLAG -Werror)
+endif ()
+
+if (MSVC)
+  set(PEDANTIC_COMPILE_FLAGS /W3)
+  set(WERROR_FLAG /WX)
+endif ()
+
+if (FMT_MASTER_PROJECT AND CMAKE_GENERATOR MATCHES "Visual Studio")
+  # If Microsoft SDK is installed create script run-msbuild.bat that
+  # calls SetEnv.cmd to set up build environment and runs msbuild.
+  # It is useful when building Visual Studio projects with the SDK
+  # toolchain rather than Visual Studio.
+  include(FindSetEnv)
+  if (WINSDK_SETENV)
+    set(MSBUILD_SETUP "call \"${WINSDK_SETENV}\"")
+  endif ()
+  # Set FrameworkPathOverride to get rid of MSB3644 warnings.
+  join(netfxpath
+       "C:\\Program Files\\Reference Assemblies\\Microsoft\\Framework\\"
+       ".NETFramework\\v4.0")
+  file(WRITE run-msbuild.bat "
+    ${MSBUILD_SETUP}
+    ${CMAKE_MAKE_PROGRAM} -p:FrameworkPathOverride=\"${netfxpath}\" %*")
 endif ()
 
-#add_library(nautilus_fmt STATIC format.cc)
+function(add_headers VAR)
+  set(headers ${${VAR}})
+  foreach (header ${ARGN})
+    set(headers ${headers} include/fmt/${header})
+  endforeach()
+  set(${VAR} ${headers} PARENT_SCOPE)
+endfunction()
 
-#target_include_directories(nautilus_fmt PUBLIC $<BUILD_INTERFACE:${CMAKE_CURRENT_SOURCE_DIR}/include>)
-set_target_properties(nautilus_fmt PROPERTIES EXPORT_NAME nautilus_fmt)
+# Define the fmt library, its includes and the needed defines.
+add_headers(FMT_HEADERS args.h base.h chrono.h color.h compile.h core.h format.h
+                        format-inl.h os.h ostream.h printf.h ranges.h std.h
+                        xchar.h)
+set(FMT_SOURCES src/format.cc)
 
-install(TARGETS nautilus_fmt
-        EXPORT "${NAUTILUS_EXPORT_SET}"
-        LIBRARY DESTINATION "${INSTALL_LIB_DIR}"
-        ARCHIVE DESTINATION "${INSTALL_LIB_DIR}")
+add_module_library(fmt src/fmt.cc FALLBACK
+                   ${FMT_SOURCES} ${FMT_HEADERS} README.md ChangeLog.md
+                   IF FMT_MODULE)
+add_library(fmt::fmt ALIAS fmt)
+if (FMT_MODULE)
+  enable_module(fmt)
+elseif (FMT_OS)
+  target_sources(fmt PRIVATE src/os.cc)
+else()
+  target_compile_definitions(fmt PRIVATE FMT_OS=0)
+endif ()
+
+if (FMT_WERROR)
+  target_compile_options(fmt PRIVATE ${WERROR_FLAG})
+endif ()
+if (FMT_PEDANTIC)
+  target_compile_options(fmt PRIVATE ${PEDANTIC_COMPILE_FLAGS})
+endif ()
+
+if (cxx_std_11 IN_LIST CMAKE_CXX_COMPILE_FEATURES)
+  target_compile_features(fmt PUBLIC cxx_std_11)
+else ()
+  message(WARNING "Feature cxx_std_11 is unknown for the CXX compiler")
+endif ()
+
+target_include_directories(fmt ${FMT_SYSTEM_HEADERS_ATTRIBUTE} PUBLIC
+  $<BUILD_INTERFACE:${PROJECT_SOURCE_DIR}/include>
+  $<INSTALL_INTERFACE:${FMT_INC_DIR}>)
+
+set(FMT_DEBUG_POSTFIX d CACHE STRING "Debug library postfix.")
+
+set_target_properties(fmt PROPERTIES
+  VERSION ${FMT_VERSION} SOVERSION ${CPACK_PACKAGE_VERSION_MAJOR}
+  PUBLIC_HEADER "${FMT_HEADERS}"
+  DEBUG_POSTFIX "${FMT_DEBUG_POSTFIX}"
+
+  # Workaround for Visual Studio 2017:
+  # Ensure the .pdb is created with the same name and in the same directory
+  # as the .lib. Newer VS versions already do this by default, but there is no
+  # harm in setting it for those too. Ignored by other generators.
+  COMPILE_PDB_OUTPUT_DIRECTORY "${CMAKE_BINARY_DIR}"
+  COMPILE_PDB_NAME "fmt"
+  COMPILE_PDB_NAME_DEBUG "fmt${FMT_DEBUG_POSTFIX}")
+
+# Set FMT_LIB_NAME for pkg-config fmt.pc. We cannot use the OUTPUT_NAME target
+# property because it's not set by default.
+set(FMT_LIB_NAME fmt)
+if (CMAKE_BUILD_TYPE STREQUAL "Debug")
+  set(FMT_LIB_NAME ${FMT_LIB_NAME}${FMT_DEBUG_POSTFIX})
+endif ()
+
+if (BUILD_SHARED_LIBS)
+  target_compile_definitions(fmt PRIVATE FMT_LIB_EXPORT INTERFACE FMT_SHARED)
+endif ()
+if (FMT_SAFE_DURATION_CAST)
+  target_compile_definitions(fmt PUBLIC FMT_SAFE_DURATION_CAST)
+endif ()
+
+add_library(fmt-header-only INTERFACE)
+add_library(fmt::fmt-header-only ALIAS fmt-header-only)
+
+if (NOT MSVC)
+  # Unicode is always supported on compilers other than MSVC.
+elseif (FMT_UNICODE)
+  # Unicode support requires compiling with /utf-8.
+  target_compile_options(fmt PUBLIC $<$<COMPILE_LANGUAGE:CXX>:/utf-8>)
+  target_compile_options(fmt-header-only INTERFACE $<$<COMPILE_LANGUAGE:CXX>:/utf-8>)
+else ()
+  target_compile_definitions(fmt PUBLIC FMT_UNICODE=0)
+endif ()
+
+target_compile_definitions(fmt-header-only INTERFACE FMT_HEADER_ONLY=1)
+target_compile_features(fmt-header-only INTERFACE cxx_std_11)
+
+target_include_directories(fmt-header-only
+  ${FMT_SYSTEM_HEADERS_ATTRIBUTE} INTERFACE
+  $<BUILD_INTERFACE:${PROJECT_SOURCE_DIR}/include>
+  $<INSTALL_INTERFACE:${FMT_INC_DIR}>)
+
+# Install targets.
+if (FMT_INSTALL)
+  include(CMakePackageConfigHelpers)
+  set_verbose(FMT_CMAKE_DIR ${CMAKE_INSTALL_LIBDIR}/cmake/fmt CACHE STRING
+              "Installation directory for cmake files, a relative path that "
+              "will be joined with ${CMAKE_INSTALL_PREFIX} or an absolute "
+              "path.")
+  set(version_config ${PROJECT_BINARY_DIR}/fmt-config-version.cmake)
+  set(project_config ${PROJECT_BINARY_DIR}/fmt-config.cmake)
+  set(pkgconfig ${PROJECT_BINARY_DIR}/fmt.pc)
+  set(targets_export_name fmt-targets)
+
+  set_verbose(FMT_LIB_DIR ${CMAKE_INSTALL_LIBDIR} CACHE STRING
+              "Installation directory for libraries, a relative path that "
+              "will be joined to ${CMAKE_INSTALL_PREFIX} or an absolute path.")
+
+  set_verbose(FMT_PKGCONFIG_DIR ${CMAKE_INSTALL_LIBDIR}/pkgconfig CACHE STRING
+              "Installation directory for pkgconfig (.pc) files, a relative "
+              "path that will be joined with ${CMAKE_INSTALL_PREFIX} or an "
+              "absolute path.")
+
+  # Generate the version, config and target files into the build directory.
+  write_basic_package_version_file(
+    ${version_config}
+    VERSION ${FMT_VERSION}
+    COMPATIBILITY AnyNewerVersion)
 
-disable_target_warnings(nautilus_fmt)
+  join_paths(libdir_for_pc_file "\${exec_prefix}" "${FMT_LIB_DIR}")
+  join_paths(includedir_for_pc_file "\${prefix}" "${FMT_INC_DIR}")
+
+  configure_file(
+    "${PROJECT_SOURCE_DIR}/support/cmake/fmt.pc.in"
+    "${pkgconfig}"
+    @ONLY)
+  configure_package_config_file(
+    ${PROJECT_SOURCE_DIR}/support/cmake/fmt-config.cmake.in
+    ${project_config}
+    INSTALL_DESTINATION ${FMT_CMAKE_DIR})
+
+  set(INSTALL_TARGETS fmt fmt-header-only)
+
+  set(INSTALL_FILE_SET)
+  if (FMT_USE_CMAKE_MODULES)
+    set(INSTALL_FILE_SET FILE_SET fmt DESTINATION "${FMT_INC_DIR}/fmt")
+  endif()
+
+  # Install the library and headers.
+  install(TARGETS ${INSTALL_TARGETS} EXPORT ${targets_export_name}
+          LIBRARY DESTINATION ${FMT_LIB_DIR}
+          ARCHIVE DESTINATION ${FMT_LIB_DIR}
+          PUBLIC_HEADER DESTINATION "${FMT_INC_DIR}/fmt"
+          RUNTIME DESTINATION ${CMAKE_INSTALL_BINDIR}
+          ${INSTALL_FILE_SET})
+
+  # Use a namespace because CMake provides better diagnostics for namespaced
+  # imported targets.
+  export(TARGETS ${INSTALL_TARGETS} NAMESPACE fmt::
+         FILE ${PROJECT_BINARY_DIR}/${targets_export_name}.cmake)
+
+  # Install version, config and target files.
+  install(
+    FILES ${project_config} ${version_config}
+    DESTINATION ${FMT_CMAKE_DIR})
+  install(EXPORT ${targets_export_name} DESTINATION ${FMT_CMAKE_DIR}
+          NAMESPACE fmt::)
+
+  install(FILES "${pkgconfig}" DESTINATION "${FMT_PKGCONFIG_DIR}")
+endif ()
+
+function(add_doc_target)
+  find_program(DOXYGEN doxygen
+    PATHS "$ENV{ProgramFiles}/doxygen/bin"
+          "$ENV{ProgramFiles\(x86\)}/doxygen/bin")
+  if (NOT DOXYGEN)
+    message(STATUS "Target 'doc' disabled because doxygen not found")
+    return ()
+  endif ()
+
+  find_program(MKDOCS mkdocs)
+  if (NOT MKDOCS)
+    message(STATUS "Target 'doc' disabled because mkdocs not found")
+    return ()
+  endif ()
+
+  set(sources )
+  foreach (source api.md index.md syntax.md get-started.md fmt.css fmt.js)
+    set(sources ${sources} doc/${source})
+  endforeach()
+
+  add_custom_target(
+    doc
+    COMMAND
+      ${CMAKE_COMMAND}
+        -E env PYTHONPATH=${CMAKE_CURRENT_SOURCE_DIR}/support/python
+        ${MKDOCS} build -f ${CMAKE_CURRENT_SOURCE_DIR}/support/mkdocs.yml
+        # MkDocs requires the site dir to be outside of the doc dir.
+                        --site-dir ${CMAKE_CURRENT_BINARY_DIR}/doc-html
+                        --no-directory-urls
+    SOURCES ${sources})
+
+  include(GNUInstallDirs)
+  install(DIRECTORY ${CMAKE_CURRENT_BINARY_DIR}/doc-html/
+          DESTINATION ${CMAKE_INSTALL_DATAROOTDIR}/doc/fmt OPTIONAL)
+endfunction()
+
+if (FMT_DOC)
+  add_doc_target()
+endif ()
+
+if (FMT_TEST)
+  enable_testing()
+  add_subdirectory(test)
+endif ()
+
+# Control fuzzing independent of the unit tests.
+if (FMT_FUZZ)
+  add_subdirectory(test/fuzzing)
+
+  # The FMT_FUZZ macro is used to prevent resource exhaustion in fuzzing
+  # mode and make fuzzing practically possible. It is similar to
+  # FUZZING_BUILD_MODE_UNSAFE_FOR_PRODUCTION but uses a different name to
+  # avoid interfering with fuzzing of projects that use {fmt}.
+  # See also https://llvm.org/docs/LibFuzzer.html#fuzzer-friendly-build-mode.
+  target_compile_definitions(fmt PUBLIC FMT_FUZZ)
+endif ()
+
+set(gitignore ${PROJECT_SOURCE_DIR}/.gitignore)
+if (FMT_MASTER_PROJECT AND EXISTS ${gitignore})
+  # Get the list of ignored files from .gitignore.
+  file (STRINGS ${gitignore} lines)
+  list(REMOVE_ITEM lines /doc/html)
+  foreach (line ${lines})
+    string(REPLACE "." "[.]" line "${line}")
+    string(REPLACE "*" ".*" line "${line}")
+    set(ignored_files ${ignored_files} "${line}$" "${line}/")
+  endforeach ()
+  set(ignored_files ${ignored_files} /.git /build/doxyxml .vagrant)
+
+  set(CPACK_SOURCE_GENERATOR ZIP)
+  set(CPACK_SOURCE_IGNORE_FILES ${ignored_files})
+  set(CPACK_SOURCE_PACKAGE_FILE_NAME fmt-${FMT_VERSION})
+  set(CPACK_PACKAGE_NAME fmt)
+  set(CPACK_RESOURCE_FILE_README ${PROJECT_SOURCE_DIR}/README.md)
+  include(CPack)
+endif ()
diff --git a/third_party/fmt/CONTRIBUTING.md b/third_party/fmt/CONTRIBUTING.md
new file mode 100644
index 00000000..b82f1450
--- /dev/null
+++ b/third_party/fmt/CONTRIBUTING.md
@@ -0,0 +1,20 @@
+Contributing to {fmt}
+=====================
+
+By submitting a pull request or a patch, you represent that you have the right
+to license your contribution to the {fmt} project owners and the community,
+agree that your contributions are licensed under the {fmt} license, and agree
+to future changes to the licensing.
+
+All C++ code must adhere to [Google C++ Style Guide](
+https://google.github.io/styleguide/cppguide.html) with the following
+exceptions:
+
+* Exceptions are permitted
+* snake_case should be used instead of UpperCamelCase for function and type
+  names
+
+All documentation must adhere to the [Google Developer Documentation Style
+Guide](https://developers.google.com/style).
+
+Thanks for contributing!
diff --git a/third_party/fmt/ChangeLog.md b/third_party/fmt/ChangeLog.md
new file mode 100644
index 00000000..6ba567d1
--- /dev/null
+++ b/third_party/fmt/ChangeLog.md
@@ -0,0 +1,2628 @@
+# 11.0.2 - 2024-07-20
+
+- Fixed compatibility with non-POSIX systems
+  (https://github.com/fmtlib/fmt/issues/4054,
+  https://github.com/fmtlib/fmt/issues/4060).
+
+- Fixed performance regressions when using `std::back_insert_iterator` with
+  `fmt::format_to` (https://github.com/fmtlib/fmt/issues/4070).
+
+- Fixed handling of `std::generator` and move-only iterators
+  (https://github.com/fmtlib/fmt/issues/4053,
+  https://github.com/fmtlib/fmt/pull/4057). Thanks @Arghnews.
+
+- Made `formatter<std::string_view>::parse` work with types convertible to
+  `std::string_view` (https://github.com/fmtlib/fmt/issues/4036,
+  https://github.com/fmtlib/fmt/pull/4055). Thanks @Arghnews.
+
+- Made `volatile void*` formattable
+  (https://github.com/fmtlib/fmt/issues/4049,
+  https://github.com/fmtlib/fmt/pull/4056). Thanks @Arghnews.
+
+- Made `Glib::ustring` not be confused with `std::string`
+  (https://github.com/fmtlib/fmt/issues/4052).
+
+- Made `fmt::context` iterator compatible with STL algorithms that rely on
+  iterator category (https://github.com/fmtlib/fmt/issues/4079).
+
+# 11.0.1 - 2024-07-05
+
+- Fixed version number in the inline namespace
+  (https://github.com/fmtlib/fmt/issues/4047).
+
+- Fixed disabling Unicode support via CMake
+  (https://github.com/fmtlib/fmt/issues/4051).
+
+- Fixed deprecated `visit_format_arg` (https://github.com/fmtlib/fmt/pull/4043).
+  Thanks @nebkat.
+
+- Fixed handling of a sign and improved the `std::complex` formater
+  (https://github.com/fmtlib/fmt/pull/4034,
+  https://github.com/fmtlib/fmt/pull/4050). Thanks @tesch1 and @phprus.
+
+- Fixed ADL issues in `fmt::printf` when using C++20
+  (https://github.com/fmtlib/fmt/pull/4042). Thanks @toge.
+
+- Removed a redundant check in the formatter for `std::expected`
+  (https://github.com/fmtlib/fmt/pull/4040). Thanks @phprus.
+
+# 11.0.0 - 2024-07-01
+
+- Added `fmt/base.h` which provides a subset of the API with minimal include
+  dependencies and enough functionality to replace all uses of the `printf`
+  family of functions. This brings the compile time of code using {fmt} much
+  closer to the equivalent `printf` code as shown on the following benchmark
+  that compiles 100 source files:
+
+  | Method       | Compile Time (s) |
+  |--------------|------------------|
+  | printf       | 1.6              |
+  | IOStreams    | 25.9             |
+  | fmt 10.x     | 19.0             |
+  | fmt 11.0     | 4.8              |
+  | tinyformat   | 29.1             |
+  | Boost Format | 55.0             |
+
+  This gives almost 4x improvement in build speed compared to version 10.
+  Note that the benchmark is purely formatting code and includes. In real
+  projects the difference from `printf` will be smaller partly because common
+  standard headers will be included in almost any translation unit (TU) anyway.
+  In particular, in every case except `printf` above ~1s is spent in total on
+  including `<type_traits>` in all TUs.
+
+- Optimized includes in other headers such as `fmt/format.h` which is now
+  roughly equivalent to the old `fmt/core.h` in terms of build speed.
+
+- Migrated the documentation at https://fmt.dev/ from Sphinx to MkDocs.
+
+- Improved C++20 module support
+  (https://github.com/fmtlib/fmt/issues/3990,
+  https://github.com/fmtlib/fmt/pull/3991,
+  https://github.com/fmtlib/fmt/issues/3993,
+  https://github.com/fmtlib/fmt/pull/3994,
+  https://github.com/fmtlib/fmt/pull/3997,
+  https://github.com/fmtlib/fmt/pull/3998,
+  https://github.com/fmtlib/fmt/pull/4004,
+  https://github.com/fmtlib/fmt/pull/4005,
+  https://github.com/fmtlib/fmt/pull/4006,
+  https://github.com/fmtlib/fmt/pull/4013,
+  https://github.com/fmtlib/fmt/pull/4027,
+  https://github.com/fmtlib/fmt/pull/4029). In particular, native CMake support
+  for modules is now used if available. Thanks @yujincheng08 and @matt77hias.
+
+- Added an option to replace standard includes with `import std` enabled via
+  the `FMT_IMPORT_STD` macro (https://github.com/fmtlib/fmt/issues/3921,
+  https://github.com/fmtlib/fmt/pull/3928). Thanks @matt77hias.
+
+- Exported `fmt::range_format`, `fmt::range_format_kind` and
+  `fmt::compiled_string` from the `fmt` module
+  (https://github.com/fmtlib/fmt/pull/3970,
+  https://github.com/fmtlib/fmt/pull/3999).
+  Thanks @matt77hias and @yujincheng08.
+
+- Improved integration with stdio in `fmt::print`, enabling direct writes
+  into a C stream buffer in common cases. This may give significant
+  performance improvements ranging from tens of percent to [2x](
+  https://stackoverflow.com/a/78457454/471164) and eliminates dynamic memory
+  allocations on the buffer level. It is currently enabled for built-in and
+  string types with wider availability coming up in future releases.
+
+  For example, it gives ~24% improvement on a [simple benchmark](
+  https://isocpp.org/files/papers/P3107R5.html#perf) compiled with Apple clang
+  version 15.0.0 (clang-1500.1.0.2.5) and run on macOS 14.2.1:
+
+  ```
+  -------------------------------------------------------
+  Benchmark             Time             CPU   Iterations
+  -------------------------------------------------------
+  printf             81.8 ns         81.5 ns      8496899
+  fmt::print (10.x)  63.8 ns         61.9 ns     11524151
+  fmt::print (11.0)  51.3 ns         51.0 ns     13846580
+  ```
+
+- Improved safety of `fmt::format_to` when writing to an array
+  (https://github.com/fmtlib/fmt/pull/3805).
+  For example ([godbolt](https://www.godbolt.org/z/cYrn8dWY8)):
+
+  ```c++
+  auto volkswagen = char[4];
+  auto result = fmt::format_to(volkswagen, "elephant");
+  ```
+
+  no longer results in a buffer overflow. Instead the output will be truncated
+  and you can get the end iterator and whether truncation occurred from the
+  `result` object. Thanks @ThePhD.
+
+- Enabled Unicode support by default in MSVC, bringing it on par with other
+  compilers and making it unnecessary for users to enable it explicitly.
+  Most of {fmt} is encoding-agnostic but this prevents mojibake in places
+  where encoding matters such as path formatting and terminal output.
+  You can control the Unicode support via the CMake `FMT_UNICODE` option.
+  Note that some {fmt} packages such as the one in vcpkg have already been
+  compiled with Unicode enabled.
+
+- Added a formatter for `std::expected`
+  (https://github.com/fmtlib/fmt/pull/3834). Thanks @dominicpoeschko.
+
+- Added a formatter for `std::complex`
+  (https://github.com/fmtlib/fmt/issues/1467,
+  https://github.com/fmtlib/fmt/issues/3886,
+  https://github.com/fmtlib/fmt/pull/3892,
+  https://github.com/fmtlib/fmt/pull/3900). Thanks @phprus.
+
+- Added a formatter for `std::type_info`
+  (https://github.com/fmtlib/fmt/pull/3978). Thanks @matt77hias.
+
+- Specialized `formatter` for `std::basic_string` types with custom traits
+  and allocators (https://github.com/fmtlib/fmt/issues/3938,
+  https://github.com/fmtlib/fmt/pull/3943). Thanks @dieram3.
+
+- Added formatters for `std::chrono::day`, `std::chrono::month`,
+  `std::chrono::year` and `std::chrono::year_month_day`
+  (https://github.com/fmtlib/fmt/issues/3758,
+  https://github.com/fmtlib/fmt/issues/3772,
+  https://github.com/fmtlib/fmt/pull/3906,
+  https://github.com/fmtlib/fmt/pull/3913). For example:
+
+  ```c++
+  #include <fmt/chrono.h>
+  #include <fmt/color.h>
+
+  int main() {
+    fmt::print(fg(fmt::color::green), "{}\n", std::chrono::day(7));
+  }
+  ```
+
+  prints a green day:
+
+  <img width="306" alt="image" src="https://github.com/fmtlib/fmt/assets/576385/6e395f8b-451a-4cf7-bccc-ee92ca0dec65">
+
+  Thanks @zivshek.
+
+- Fixed handling of precision in `%S` (https://github.com/fmtlib/fmt/issues/3794,
+  https://github.com/fmtlib/fmt/pull/3814). Thanks @js324.
+
+- Added support for the `-` specifier (glibc `strftime` extension) to day of
+  the month (`%d`) and week of the year (`%W`, `%U`, `%V`) specifiers
+  (https://github.com/fmtlib/fmt/pull/3976). Thanks @ZaheenJ.
+
+- Fixed the scope of the `-` extension in chrono formatting so that it doesn't
+  apply to subsequent specifiers (https://github.com/fmtlib/fmt/issues/3811,
+  https://github.com/fmtlib/fmt/pull/3812). Thanks @phprus.
+
+- Improved handling of `time_point::min()`
+  (https://github.com/fmtlib/fmt/issues/3282).
+
+- Added support for character range formatting
+  (https://github.com/fmtlib/fmt/issues/3857,
+  https://github.com/fmtlib/fmt/pull/3863). Thanks @js324.
+
+- Added `string` and `debug_string` range formatters
+  (https://github.com/fmtlib/fmt/pull/3973,
+  https://github.com/fmtlib/fmt/pull/4024). Thanks @matt77hias.
+
+- Enabled ADL for `begin` and `end` in `fmt::join`
+  (https://github.com/fmtlib/fmt/issues/3813,
+  https://github.com/fmtlib/fmt/pull/3824). Thanks @bbolli.
+
+- Made contiguous iterator optimizations apply to `std::basic_string` iterators
+  (https://github.com/fmtlib/fmt/pull/3798). Thanks @phprus.
+
+- Added support for ranges with mutable `begin` and `end`
+  (https://github.com/fmtlib/fmt/issues/3752,
+  https://github.com/fmtlib/fmt/pull/3800,
+  https://github.com/fmtlib/fmt/pull/3955). Thanks @tcbrindle and @Arghnews.
+
+- Added support for move-only iterators to `fmt::join`
+  (https://github.com/fmtlib/fmt/issues/3802,
+  https://github.com/fmtlib/fmt/pull/3946). Thanks @Arghnews.
+
+- Moved range and iterator overloads of `fmt::join` to `fmt/ranges.h`, next
+  to other overloads.
+
+- Fixed handling of types with `begin` returning `void` such as Eigen matrices
+  (https://github.com/fmtlib/fmt/issues/3839,
+  https://github.com/fmtlib/fmt/pull/3964). Thanks @Arghnews.
+
+- Added an `fmt::formattable` concept (https://github.com/fmtlib/fmt/pull/3974).
+  Thanks @matt77hias.
+
+- Added support for `__float128` (https://github.com/fmtlib/fmt/issues/3494).
+
+- Fixed rounding issues when formatting `long double` with fixed precision
+  (https://github.com/fmtlib/fmt/issues/3539).
+
+- Made `fmt::isnan` not trigger floating-point exception for NaN values
+  (https://github.com/fmtlib/fmt/issues/3948,
+  https://github.com/fmtlib/fmt/pull/3951). Thanks @alexdewar.
+
+- Removed dependency on `<memory>` for `std::allocator_traits` when possible
+  (https://github.com/fmtlib/fmt/pull/3804). Thanks @phprus.
+
+- Enabled compile-time checks in formatting functions that take text colors and
+  styles.
+
+- Deprecated wide stream overloads of `fmt::print` that take text styles.
+
+- Made format string compilation work with clang 12 and later despite
+  only partial non-type template parameter support
+  (https://github.com/fmtlib/fmt/issues/4000,
+  https://github.com/fmtlib/fmt/pull/4001). Thanks @yujincheng08.
+
+- Made `fmt::iterator_buffer`'s move constructor `noexcept`
+  (https://github.com/fmtlib/fmt/pull/3808). Thanks @waywardmonkeys.
+
+- Started enforcing that `formatter::format` is const for compatibility
+  with `std::format` (https://github.com/fmtlib/fmt/issues/3447).
+
+- Added `fmt::basic_format_arg::visit` and deprecated `fmt::visit_format_arg`.
+
+- Made `fmt::basic_string_view` not constructible from `nullptr` for
+  consistency with `std::string_view` in C++23
+  (https://github.com/fmtlib/fmt/pull/3846). Thanks @dalle.
+
+- Fixed `fmt::group_digits` for negative integers
+  (https://github.com/fmtlib/fmt/issues/3891,
+  https://github.com/fmtlib/fmt/pull/3901). Thanks @phprus.
+
+- Fixed handling of negative ids in `fmt::basic_format_args::get`
+  (https://github.com/fmtlib/fmt/pull/3945). Thanks @marlenecota.
+
+- Improved named argument validation
+  (https://github.com/fmtlib/fmt/issues/3817).
+
+- Disabled copy construction/assignment for `fmt::format_arg_store` and
+  fixed moved construction (https://github.com/fmtlib/fmt/pull/3833).
+  Thanks @ivafanas.
+
+- Worked around a locale issue in RHEL/devtoolset
+  (https://github.com/fmtlib/fmt/issues/3858,
+  https://github.com/fmtlib/fmt/pull/3859). Thanks @g199209.
+
+- Added RTTI detection for MSVC (https://github.com/fmtlib/fmt/pull/3821,
+  https://github.com/fmtlib/fmt/pull/3963). Thanks @edo9300.
+
+- Migrated the documentation from Sphinx to MkDocs.
+
+- Improved documentation and README
+  (https://github.com/fmtlib/fmt/issues/3775,
+  https://github.com/fmtlib/fmt/pull/3784,
+  https://github.com/fmtlib/fmt/issues/3788,
+  https://github.com/fmtlib/fmt/pull/3789,
+  https://github.com/fmtlib/fmt/pull/3793,
+  https://github.com/fmtlib/fmt/issues/3818,
+  https://github.com/fmtlib/fmt/pull/3820,
+  https://github.com/fmtlib/fmt/pull/3822,
+  https://github.com/fmtlib/fmt/pull/3843,
+  https://github.com/fmtlib/fmt/pull/3890,
+  https://github.com/fmtlib/fmt/issues/3894,
+  https://github.com/fmtlib/fmt/pull/3895,
+  https://github.com/fmtlib/fmt/pull/3905,
+  https://github.com/fmtlib/fmt/issues/3942,
+  https://github.com/fmtlib/fmt/pull/4008).
+  Thanks @zencatalyst, WolleTD, @tupaschoal, @Dobiasd, @frank-weinberg, @bbolli,
+  @phprus, @waywardmonkeys, @js324 and @tchaikov.
+
+- Improved CI and tests
+  (https://github.com/fmtlib/fmt/issues/3878,
+  https://github.com/fmtlib/fmt/pull/3883,
+  https://github.com/fmtlib/fmt/issues/3897,
+  https://github.com/fmtlib/fmt/pull/3979,
+  https://github.com/fmtlib/fmt/pull/3980,
+  https://github.com/fmtlib/fmt/pull/3988,
+  https://github.com/fmtlib/fmt/pull/4010,
+  https://github.com/fmtlib/fmt/pull/4012,
+  https://github.com/fmtlib/fmt/pull/4038).
+  Thanks @vgorrX, @waywardmonkeys, @tchaikov and @phprus.
+
+- Fixed buffer overflow when using format string compilation with debug format
+  and `std::back_insert_iterator` (https://github.com/fmtlib/fmt/issues/3795,
+  https://github.com/fmtlib/fmt/pull/3797). Thanks @phprus.
+
+- Improved Bazel support
+  (https://github.com/fmtlib/fmt/pull/3792,
+  https://github.com/fmtlib/fmt/pull/3801,
+  https://github.com/fmtlib/fmt/pull/3962,
+  https://github.com/fmtlib/fmt/pull/3965). Thanks @Vertexwahn.
+
+- Improved/fixed the CMake config
+  (https://github.com/fmtlib/fmt/issues/3777,
+  https://github.com/fmtlib/fmt/pull/3783,
+  https://github.com/fmtlib/fmt/issues/3847,
+  https://github.com/fmtlib/fmt/pull/3907). Thanks @phprus and @xTachyon.
+
+- Fixed various warnings and compilation issues
+  (https://github.com/fmtlib/fmt/issues/3685,
+  https://github.com/fmtlib/fmt/issues/3769,
+  https://github.com/fmtlib/fmt/issues/3796,
+  https://github.com/fmtlib/fmt/issues/3803,
+  https://github.com/fmtlib/fmt/pull/3806,
+  https://github.com/fmtlib/fmt/pull/3807,
+  https://github.com/fmtlib/fmt/issues/3809,
+  https://github.com/fmtlib/fmt/pull/3810,
+  https://github.com/fmtlib/fmt/issues/3830,
+  https://github.com/fmtlib/fmt/pull/3832,
+  https://github.com/fmtlib/fmt/issues/3835,
+  https://github.com/fmtlib/fmt/pull/3844,
+  https://github.com/fmtlib/fmt/issues/3854,
+  https://github.com/fmtlib/fmt/pull/3856,
+  https://github.com/fmtlib/fmt/pull/3865,
+  https://github.com/fmtlib/fmt/pull/3866,
+  https://github.com/fmtlib/fmt/pull/3880,
+  https://github.com/fmtlib/fmt/issues/3881,
+  https://github.com/fmtlib/fmt/issues/3884,
+  https://github.com/fmtlib/fmt/issues/3898,
+  https://github.com/fmtlib/fmt/pull/3899,
+  https://github.com/fmtlib/fmt/pull/3909,
+  https://github.com/fmtlib/fmt/pull/3917,
+  https://github.com/fmtlib/fmt/pull/3923,
+  https://github.com/fmtlib/fmt/pull/3924,
+  https://github.com/fmtlib/fmt/issues/3925,
+  https://github.com/fmtlib/fmt/pull/3930,
+  https://github.com/fmtlib/fmt/pull/3931,
+  https://github.com/fmtlib/fmt/pull/3933,
+  https://github.com/fmtlib/fmt/issues/3935,
+  https://github.com/fmtlib/fmt/pull/3937,
+  https://github.com/fmtlib/fmt/pull/3967,
+  https://github.com/fmtlib/fmt/pull/3968,
+  https://github.com/fmtlib/fmt/pull/3972,
+  https://github.com/fmtlib/fmt/pull/3983,
+  https://github.com/fmtlib/fmt/issues/3992,
+  https://github.com/fmtlib/fmt/pull/3995,
+  https://github.com/fmtlib/fmt/pull/4009,
+  https://github.com/fmtlib/fmt/pull/4023).
+  Thanks @hmbj, @phprus, @res2k, @Baardi, @matt77hias, @waywardmonkeys, @hmbj,
+  @yakra, @prlw1, @Arghnews, @mtillmann0, @ShifftC, @eepp, @jimmy-park and
+  @ChristianGebhardt.
+
+# 10.2.1 - 2024-01-04
+
+- Fixed ABI compatibility with earlier 10.x versions
+  (https://github.com/fmtlib/fmt/issues/3785,
+  https://github.com/fmtlib/fmt/pull/3786). Thanks @saraedum.
+
+# 10.2.0 - 2024-01-01
+
+- Added support for the `%j` specifier (the number of days) for
+  `std::chrono::duration` (https://github.com/fmtlib/fmt/issues/3643,
+  https://github.com/fmtlib/fmt/pull/3732). Thanks @intelfx.
+
+- Added support for the chrono suffix for days and changed
+  the suffix for minutes from "m" to the correct "min"
+  (https://github.com/fmtlib/fmt/issues/3662,
+  https://github.com/fmtlib/fmt/pull/3664).
+  For example ([godbolt](https://godbolt.org/z/9KhMnq9ba)):
+
+  ```c++
+  #include <fmt/chrono.h>
+
+  int main() {
+    fmt::print("{}\n", std::chrono::days(42)); // prints "42d"
+  }
+  ```
+
+  Thanks @Richardk2n.
+
+- Fixed an overflow in `std::chrono::time_point` formatting with large dates
+  (https://github.com/fmtlib/fmt/issues/3725,
+  https://github.com/fmtlib/fmt/pull/3727). Thanks @cschreib.
+
+- Added a formatter for `std::source_location`
+  (https://github.com/fmtlib/fmt/pull/3730).
+  For example ([godbolt](https://godbolt.org/z/YajfKjhhr)):
+
+  ```c++
+  #include <source_location>
+  #include <fmt/std.h>
+
+  int main() {
+    fmt::print("{}\n", std::source_location::current());
+  }
+  ```
+
+  prints
+
+  ```
+  /app/example.cpp:5:51: int main()
+  ```
+
+  Thanks @felix642.
+
+- Added a formatter for `std::bitset`
+  (https://github.com/fmtlib/fmt/pull/3660).
+  For example ([godbolt](https://godbolt.org/z/bdEaGeYxe)):
+
+  ```c++
+  #include <bitset>
+  #include <fmt/std.h>
+
+  int main() {
+    fmt::print("{}\n", std::bitset<6>(42)); // prints "101010"
+  }
+  ```
+
+  Thanks @muggenhor.
+
+- Added an experimental `nested_formatter` that provides an easy way of
+  applying a formatter to one or more subobjects while automatically handling
+  width, fill and alignment. For example:
+
+  ```c++
+  #include <fmt/format.h>
+
+  struct point {
+    double x, y;
+  };
+
+  template <>
+  struct fmt::formatter<point> : nested_formatter<double> {
+    auto format(point p, format_context& ctx) const {
+      return write_padded(ctx, [=](auto out) {
+        return format_to(out, "({}, {})", nested(p.x), nested(p.y));
+      });
+    }
+  };
+
+  int main() {
+    fmt::print("[{:>20.2f}]", point{1, 2});
+  }
+  ```
+
+  prints
+
+  ```
+  [          (1.00, 2.00)]
+  ```
+
+- Added the generic representation (`g`) to `std::filesystem::path`
+  (https://github.com/fmtlib/fmt/issues/3715,
+  https://github.com/fmtlib/fmt/pull/3729). For example:
+
+  ```c++
+  #include <filesystem>
+  #include <fmt/std.h>
+
+  int main() {
+    fmt::print("{:g}\n", std::filesystem::path("C:\\foo"));
+  }
+  ```
+
+  prints `"C:/foo"` on Windows.
+
+  Thanks @js324.
+
+- Made `format_as` work with references
+  (https://github.com/fmtlib/fmt/pull/3739). Thanks @tchaikov.
+
+- Fixed formatting of invalid UTF-8 with precision
+  (https://github.com/fmtlib/fmt/issues/3284).
+
+- Fixed an inconsistency between `fmt::to_string` and `fmt::format`
+  (https://github.com/fmtlib/fmt/issues/3684).
+
+- Disallowed unsafe uses of `fmt::styled`
+  (https://github.com/fmtlib/fmt/issues/3625):
+
+  ```c++
+  auto s = fmt::styled(std::string("dangle"), fmt::emphasis::bold);
+  fmt::print("{}\n", s); // compile error
+  ```
+
+  Pass `fmt::styled(...)` as a parameter instead.
+
+- Added a null check when formatting a C string with the `s` specifier
+  (https://github.com/fmtlib/fmt/issues/3706).
+
+- Disallowed the `c` specifier for `bool`
+  (https://github.com/fmtlib/fmt/issues/3726,
+  https://github.com/fmtlib/fmt/pull/3734). Thanks @js324.
+
+- Made the default formatting unlocalized in `fmt::ostream_formatter` for
+  consistency with the rest of the library
+  (https://github.com/fmtlib/fmt/issues/3460).
+
+- Fixed localized formatting in bases other than decimal
+  (https://github.com/fmtlib/fmt/issues/3693,
+  https://github.com/fmtlib/fmt/pull/3750). Thanks @js324.
+
+- Fixed a performance regression in experimental `fmt::ostream::print`
+  (https://github.com/fmtlib/fmt/issues/3674).
+
+- Added synchronization with the underlying output stream when writing to
+  the Windows console
+  (https://github.com/fmtlib/fmt/pull/3668,
+  https://github.com/fmtlib/fmt/issues/3688,
+  https://github.com/fmtlib/fmt/pull/3689).
+  Thanks @Roman-Koshelev and @dimztimz.
+
+- Changed to only export `format_error` when {fmt} is built as a shared
+  library (https://github.com/fmtlib/fmt/issues/3626,
+  https://github.com/fmtlib/fmt/pull/3627). Thanks @phprus.
+
+- Made `fmt::streamed` `constexpr`.
+  (https://github.com/fmtlib/fmt/pull/3650). Thanks @muggenhor.
+
+- Made `fmt::format_int` `constexpr`
+  (https://github.com/fmtlib/fmt/issues/4031,
+  https://github.com/fmtlib/fmt/pull/4032). Thanks @dixlorenz.
+
+- Enabled `consteval` on older versions of MSVC
+  (https://github.com/fmtlib/fmt/pull/3757). Thanks @phprus.
+
+- Added an option to build without `wchar_t` support on Windows
+  (https://github.com/fmtlib/fmt/issues/3631,
+  https://github.com/fmtlib/fmt/pull/3636). Thanks @glebm.
+
+- Improved build and CI configuration
+  (https://github.com/fmtlib/fmt/pull/3679,
+  https://github.com/fmtlib/fmt/issues/3701,
+  https://github.com/fmtlib/fmt/pull/3702,
+  https://github.com/fmtlib/fmt/pull/3749).
+  Thanks @jcar87, @pklima and @tchaikov.
+
+- Fixed various warnings, compilation and test issues
+  (https://github.com/fmtlib/fmt/issues/3607,
+  https://github.com/fmtlib/fmt/pull/3610,
+  https://github.com/fmtlib/fmt/pull/3624,
+  https://github.com/fmtlib/fmt/pull/3630,
+  https://github.com/fmtlib/fmt/pull/3634,
+  https://github.com/fmtlib/fmt/pull/3638,
+  https://github.com/fmtlib/fmt/issues/3645,
+  https://github.com/fmtlib/fmt/issues/3646,
+  https://github.com/fmtlib/fmt/pull/3647,
+  https://github.com/fmtlib/fmt/pull/3652,
+  https://github.com/fmtlib/fmt/issues/3654,
+  https://github.com/fmtlib/fmt/pull/3663,
+  https://github.com/fmtlib/fmt/issues/3670,
+  https://github.com/fmtlib/fmt/pull/3680,
+  https://github.com/fmtlib/fmt/issues/3694,
+  https://github.com/fmtlib/fmt/pull/3695,
+  https://github.com/fmtlib/fmt/pull/3699,
+  https://github.com/fmtlib/fmt/issues/3705,
+  https://github.com/fmtlib/fmt/issues/3710,
+  https://github.com/fmtlib/fmt/issues/3712,
+  https://github.com/fmtlib/fmt/pull/3713,
+  https://github.com/fmtlib/fmt/issues/3714,
+  https://github.com/fmtlib/fmt/pull/3716,
+  https://github.com/fmtlib/fmt/pull/3723,
+  https://github.com/fmtlib/fmt/issues/3738,
+  https://github.com/fmtlib/fmt/issues/3740,
+  https://github.com/fmtlib/fmt/pull/3741,
+  https://github.com/fmtlib/fmt/pull/3743,
+  https://github.com/fmtlib/fmt/issues/3745,
+  https://github.com/fmtlib/fmt/pull/3747,
+  https://github.com/fmtlib/fmt/pull/3748,
+  https://github.com/fmtlib/fmt/pull/3751,
+  https://github.com/fmtlib/fmt/pull/3754,
+  https://github.com/fmtlib/fmt/pull/3755,
+  https://github.com/fmtlib/fmt/issues/3760,
+  https://github.com/fmtlib/fmt/pull/3762,
+  https://github.com/fmtlib/fmt/issues/3763,
+  https://github.com/fmtlib/fmt/pull/3764,
+  https://github.com/fmtlib/fmt/issues/3774,
+  https://github.com/fmtlib/fmt/pull/3779).
+  Thanks @danakj, @vinayyadav3016, @cyyever, @phprus, @qimiko, @saschasc,
+  @gsjaardema, @lazka, @Zhaojun-Liu, @carlsmedstad, @hotwatermorning,
+  @cptFracassa, @kuguma, @PeterJohnson, @H1X4Dev, @asantoni, @eltociear,
+  @msimberg, @tchaikov, @waywardmonkeys.
+
+- Improved documentation and README
+  (https://github.com/fmtlib/fmt/issues/2086,
+  https://github.com/fmtlib/fmt/issues/3637,
+  https://github.com/fmtlib/fmt/pull/3642,
+  https://github.com/fmtlib/fmt/pull/3653,
+  https://github.com/fmtlib/fmt/pull/3655,
+  https://github.com/fmtlib/fmt/pull/3661,
+  https://github.com/fmtlib/fmt/issues/3673,
+  https://github.com/fmtlib/fmt/pull/3677,
+  https://github.com/fmtlib/fmt/pull/3737,
+  https://github.com/fmtlib/fmt/issues/3742,
+  https://github.com/fmtlib/fmt/pull/3744).
+  Thanks @idzm, @perlun, @joycebrum, @fennewald, @reinhardt1053, @GeorgeLS.
+
+- Updated CI dependencies
+  (https://github.com/fmtlib/fmt/pull/3615,
+  https://github.com/fmtlib/fmt/pull/3622,
+  https://github.com/fmtlib/fmt/pull/3623,
+  https://github.com/fmtlib/fmt/pull/3666,
+  https://github.com/fmtlib/fmt/pull/3696,
+  https://github.com/fmtlib/fmt/pull/3697,
+  https://github.com/fmtlib/fmt/pull/3759,
+  https://github.com/fmtlib/fmt/pull/3782).
+
+# 10.1.1 - 2023-08-28
+
+- Added formatters for `std::atomic` and `atomic_flag`
+  (https://github.com/fmtlib/fmt/pull/3574,
+  https://github.com/fmtlib/fmt/pull/3594).
+  Thanks @wangzw and @AlexGuteniev.
+- Fixed an error about partial specialization of `formatter<string>`
+  after instantiation when compiled with gcc and C++20
+  (https://github.com/fmtlib/fmt/issues/3584).
+- Fixed compilation as a C++20 module with gcc and clang
+  (https://github.com/fmtlib/fmt/issues/3587,
+  https://github.com/fmtlib/fmt/pull/3597,
+  https://github.com/fmtlib/fmt/pull/3605).
+  Thanks @MathewBensonCode.
+- Made `fmt::to_string` work with types that have `format_as`
+  overloads (https://github.com/fmtlib/fmt/pull/3575). Thanks @phprus.
+- Made `formatted_size` work with integral format specifiers at
+  compile time (https://github.com/fmtlib/fmt/pull/3591).
+  Thanks @elbeno.
+- Fixed a warning about the `no_unique_address` attribute on clang-cl
+  (https://github.com/fmtlib/fmt/pull/3599). Thanks @lukester1975.
+- Improved compatibility with the legacy GBK encoding
+  (https://github.com/fmtlib/fmt/issues/3598,
+  https://github.com/fmtlib/fmt/pull/3599). Thanks @YuHuanTin.
+- Added OpenSSF Scorecard analysis
+  (https://github.com/fmtlib/fmt/issues/3530,
+  https://github.com/fmtlib/fmt/pull/3571). Thanks @joycebrum.
+- Updated CI dependencies
+  (https://github.com/fmtlib/fmt/pull/3591,
+  https://github.com/fmtlib/fmt/pull/3592,
+  https://github.com/fmtlib/fmt/pull/3593,
+  https://github.com/fmtlib/fmt/pull/3602).
+
+# 10.1.0 - 2023-08-12
+
+- Optimized format string compilation resulting in up to 40% speed up
+  in compiled `format_to` and \~4x speed up in compiled `format_to_n`
+  on a concatenation benchmark
+  (https://github.com/fmtlib/fmt/issues/3133,
+  https://github.com/fmtlib/fmt/issues/3484).
+
+  {fmt} 10.0:
+
+      ---------------------------------------------------------
+      Benchmark               Time             CPU   Iterations
+      ---------------------------------------------------------
+      BM_format_to         78.9 ns         78.9 ns      8881746
+      BM_format_to_n        568 ns          568 ns      1232089
+
+  {fmt} 10.1:
+
+      ---------------------------------------------------------
+      Benchmark               Time             CPU   Iterations
+      ---------------------------------------------------------
+      BM_format_to         54.9 ns         54.9 ns     12727944
+      BM_format_to_n        133 ns          133 ns      5257795
+
+- Optimized storage of an empty allocator in `basic_memory_buffer`
+  (https://github.com/fmtlib/fmt/pull/3485). Thanks @Minty-Meeo.
+
+- Added formatters for proxy references to elements of
+  `std::vector<bool>` and `std::bitset<N>`
+  (https://github.com/fmtlib/fmt/issues/3567,
+  https://github.com/fmtlib/fmt/pull/3570). For example
+  ([godbolt](https://godbolt.org/z/zYb79Pvn8)):
+
+  ```c++
+  #include <vector>
+  #include <fmt/std.h>
+
+  int main() {
+    auto v = std::vector<bool>{true};
+    fmt::print("{}", v[0]);
+  }
+  ```
+
+  Thanks @phprus and @felix642.
+
+- Fixed an ambiguous formatter specialization for containers that look
+  like container adaptors such as `boost::flat_set`
+  (https://github.com/fmtlib/fmt/issues/3556,
+  https://github.com/fmtlib/fmt/pull/3561). Thanks @5chmidti.
+
+- Fixed compilation when formatting durations not convertible from
+  `std::chrono::seconds`
+  (https://github.com/fmtlib/fmt/pull/3430). Thanks @patlkli.
+
+- Made the `formatter` specialization for `char*` const-correct
+  (https://github.com/fmtlib/fmt/pull/3432). Thanks @timsong-cpp.
+
+- Made `{}` and `{:}` handled consistently during compile-time checks
+  (https://github.com/fmtlib/fmt/issues/3526).
+
+- Disallowed passing temporaries to `make_format_args` to improve API
+  safety by preventing dangling references.
+
+- Improved the compile-time error for unformattable types
+  (https://github.com/fmtlib/fmt/pull/3478). Thanks @BRevzin.
+
+- Improved the floating-point formatter
+  (https://github.com/fmtlib/fmt/pull/3448,
+  https://github.com/fmtlib/fmt/pull/3450).
+  Thanks @florimond-collette.
+
+- Fixed handling of precision for `long double` larger than 64 bits.
+  (https://github.com/fmtlib/fmt/issues/3539,
+  https://github.com/fmtlib/fmt/issues/3564).
+
+- Made floating-point and chrono tests less platform-dependent
+  (https://github.com/fmtlib/fmt/issues/3337,
+  https://github.com/fmtlib/fmt/issues/3433,
+  https://github.com/fmtlib/fmt/pull/3434). Thanks @phprus.
+
+- Removed the remnants of the Grisu floating-point formatter that has
+  been replaced by Dragonbox in earlier versions.
+
+- Added `throw_format_error` to the public API
+  (https://github.com/fmtlib/fmt/pull/3551). Thanks @mjerabek.
+
+- Made `FMT_THROW` assert even if assertions are disabled when
+  compiling with exceptions disabled
+  (https://github.com/fmtlib/fmt/issues/3418,
+  https://github.com/fmtlib/fmt/pull/3439). Thanks @BRevzin.
+
+- Made `format_as` and `std::filesystem::path` formatter work with
+  exotic code unit types.
+  (https://github.com/fmtlib/fmt/pull/3457,
+  https://github.com/fmtlib/fmt/pull/3476). Thanks @gix and @hmbj.
+
+- Added support for the `?` format specifier to
+  `std::filesystem::path` and made the default unescaped for
+  consistency with strings.
+
+- Deprecated the wide stream overload of `printf`.
+
+- Removed unused `basic_printf_parse_context`.
+
+- Improved RTTI detection used when formatting exceptions
+  (https://github.com/fmtlib/fmt/pull/3468). Thanks @danakj.
+
+- Improved compatibility with VxWorks7
+  (https://github.com/fmtlib/fmt/pull/3467). Thanks @wenshan1.
+
+- Improved documentation
+  (https://github.com/fmtlib/fmt/issues/3174,
+  https://github.com/fmtlib/fmt/issues/3423,
+  https://github.com/fmtlib/fmt/pull/3454,
+  https://github.com/fmtlib/fmt/issues/3458,
+  https://github.com/fmtlib/fmt/pull/3461,
+  https://github.com/fmtlib/fmt/issues/3487,
+  https://github.com/fmtlib/fmt/pull/3515).
+  Thanks @zencatalyst, @rlalik and @mikecrowe.
+
+- Improved build and CI configurations
+  (https://github.com/fmtlib/fmt/issues/3449,
+  https://github.com/fmtlib/fmt/pull/3451,
+  https://github.com/fmtlib/fmt/pull/3452,
+  https://github.com/fmtlib/fmt/pull/3453,
+  https://github.com/fmtlib/fmt/pull/3459,
+  https://github.com/fmtlib/fmt/issues/3481,
+  https://github.com/fmtlib/fmt/pull/3486,
+  https://github.com/fmtlib/fmt/issues/3489,
+  https://github.com/fmtlib/fmt/pull/3496,
+  https://github.com/fmtlib/fmt/issues/3517,
+  https://github.com/fmtlib/fmt/pull/3523,
+  https://github.com/fmtlib/fmt/pull/3563).
+  Thanks @joycebrum, @glebm, @phprus, @petrmanek, @setoye and @abouvier.
+
+- Fixed various warnings and compilation issues
+  (https://github.com/fmtlib/fmt/issues/3408,
+  https://github.com/fmtlib/fmt/issues/3424,
+  https://github.com/fmtlib/fmt/issues/3444,
+  https://github.com/fmtlib/fmt/pull/3446,
+  https://github.com/fmtlib/fmt/pull/3475,
+  https://github.com/fmtlib/fmt/pull/3482,
+  https://github.com/fmtlib/fmt/issues/3492,
+  https://github.com/fmtlib/fmt/pull/3493,
+  https://github.com/fmtlib/fmt/pull/3508,
+  https://github.com/fmtlib/fmt/issues/3509,
+  https://github.com/fmtlib/fmt/issues/3533,
+  https://github.com/fmtlib/fmt/pull/3542,
+  https://github.com/fmtlib/fmt/issues/3543,
+  https://github.com/fmtlib/fmt/issues/3540,
+  https://github.com/fmtlib/fmt/pull/3544,
+  https://github.com/fmtlib/fmt/issues/3548,
+  https://github.com/fmtlib/fmt/pull/3549,
+  https://github.com/fmtlib/fmt/pull/3550,
+  https://github.com/fmtlib/fmt/pull/3552).
+  Thanks @adesitter, @hmbj, @Minty-Meeo, @phprus, @TobiSchluter,
+  @kieranclancy, @alexeedm, @jurihock, @Ozomahtli and @razaqq.
+
+# 10.0.0 - 2023-05-09
+
+- Replaced Grisu with a new floating-point formatting algorithm for
+  given precision (https://github.com/fmtlib/fmt/issues/3262,
+  https://github.com/fmtlib/fmt/issues/2750,
+  https://github.com/fmtlib/fmt/pull/3269,
+  https://github.com/fmtlib/fmt/pull/3276). The new algorithm
+  is based on Dragonbox already used for the shortest representation
+  and gives substantial performance improvement:
+
+  ![](https://user-images.githubusercontent.com/33922675/211956670-84891a09-6867-47d9-82fc-3230da7abe0f.png)
+
+  -   Red: new algorithm
+  -   Green: new algorithm with `FMT_USE_FULL_CACHE_DRAGONBOX` defined
+      to 1
+  -   Blue: old algorithm
+
+  Thanks @jk-jeon.
+
+- Replaced `snprintf`-based hex float formatter with an internal
+  implementation (https://github.com/fmtlib/fmt/pull/3179,
+  https://github.com/fmtlib/fmt/pull/3203). This removes the
+  last usage of `s(n)printf` in {fmt}. Thanks @phprus.
+
+- Fixed alignment of floating-point numbers with localization
+  (https://github.com/fmtlib/fmt/issues/3263,
+  https://github.com/fmtlib/fmt/pull/3272). Thanks @ShawnZhong.
+
+- Made handling of `#` consistent with `std::format`.
+
+- Improved C++20 module support
+  (https://github.com/fmtlib/fmt/pull/3134,
+  https://github.com/fmtlib/fmt/pull/3254,
+  https://github.com/fmtlib/fmt/pull/3386,
+  https://github.com/fmtlib/fmt/pull/3387,
+  https://github.com/fmtlib/fmt/pull/3388,
+  https://github.com/fmtlib/fmt/pull/3392,
+  https://github.com/fmtlib/fmt/pull/3397,
+  https://github.com/fmtlib/fmt/pull/3399,
+  https://github.com/fmtlib/fmt/pull/3400).
+  Thanks @laitingsheng, @Orvid and @DanielaE.
+  
+- Switched to the [modules CMake library](https://github.com/vitaut/modules)
+  which allows building {fmt} as a C++20 module with clang:
+
+      CXX=clang++ cmake -DFMT_MODULE=ON .
+      make
+
+- Made `format_as` work with any user-defined type and not just enums.
+  For example ([godbolt](https://godbolt.org/z/b7rqhq5Kh)):
+
+  ```c++
+  #include <fmt/format.h>
+
+  struct floaty_mc_floatface {
+    double value;
+  };
+
+  auto format_as(floaty_mc_floatface f) { return f.value; }
+
+  int main() {
+    fmt::print("{:8}\n", floaty_mc_floatface{0.42}); // prints "    0.42"
+  }
+  ```
+
+- Removed deprecated implicit conversions for enums and conversions to
+  primitive types for compatibility with `std::format` and to prevent
+  potential ODR violations. Use `format_as` instead.
+
+- Added support for fill, align and width to the time point formatter
+  (https://github.com/fmtlib/fmt/issues/3237,
+  https://github.com/fmtlib/fmt/pull/3260,
+  https://github.com/fmtlib/fmt/pull/3275). For example
+  ([godbolt](https://godbolt.org/z/rKP6MGz6c)):
+
+  ```c++
+  #include <fmt/chrono.h>
+
+  int main() {
+    // prints "    2023"
+    fmt::print("{:>8%Y}\n", std::chrono::system_clock::now());
+  }
+  ```
+
+  Thanks @ShawnZhong.
+
+- Implemented formatting of subseconds
+  (https://github.com/fmtlib/fmt/issues/2207,
+  https://github.com/fmtlib/fmt/issues/3117,
+  https://github.com/fmtlib/fmt/pull/3115,
+  https://github.com/fmtlib/fmt/pull/3143,
+  https://github.com/fmtlib/fmt/pull/3144,
+  https://github.com/fmtlib/fmt/pull/3349). For example
+  ([godbolt](https://godbolt.org/z/45738oGEo)):
+
+  ```c++
+  #include <fmt/chrono.h>
+
+  int main() {
+    // prints 01.234567
+    fmt::print("{:%S}\n", std::chrono::microseconds(1234567));
+  }
+  ```
+
+  Thanks @patrickroocks @phprus and @BRevzin.
+
+- Added precision support to `%S`
+  (https://github.com/fmtlib/fmt/pull/3148). Thanks @SappyJoy
+
+- Added support for `std::utc_time`
+  (https://github.com/fmtlib/fmt/issues/3098,
+  https://github.com/fmtlib/fmt/pull/3110). Thanks @patrickroocks.
+
+- Switched formatting of `std::chrono::system_clock` from local time
+  to UTC for compatibility with the standard
+  (https://github.com/fmtlib/fmt/issues/3199,
+  https://github.com/fmtlib/fmt/pull/3230). Thanks @ned14.
+
+- Added support for `%Ez` and `%Oz` to chrono formatters.
+  (https://github.com/fmtlib/fmt/issues/3220,
+  https://github.com/fmtlib/fmt/pull/3222). Thanks @phprus.
+
+- Improved validation of format specifiers for `std::chrono::duration`
+  (https://github.com/fmtlib/fmt/issues/3219,
+  https://github.com/fmtlib/fmt/pull/3232). Thanks @ShawnZhong.
+
+- Fixed formatting of time points before the epoch
+  (https://github.com/fmtlib/fmt/issues/3117,
+  https://github.com/fmtlib/fmt/pull/3261). For example
+  ([godbolt](https://godbolt.org/z/f7bcznb3W)):
+
+  ```c++
+  #include <fmt/chrono.h>
+
+  int main() {
+    auto t = std::chrono::system_clock::from_time_t(0) -
+             std::chrono::milliseconds(250);
+    fmt::print("{:%S}\n", t); // prints 59.750000000
+  }
+  ```
+
+  Thanks @ShawnZhong.
+
+- Experimental: implemented glibc extension for padding seconds,
+  minutes and hours
+  (https://github.com/fmtlib/fmt/issues/2959,
+  https://github.com/fmtlib/fmt/pull/3271). Thanks @ShawnZhong.
+
+- Added a formatter for `std::exception`
+  (https://github.com/fmtlib/fmt/issues/2977,
+  https://github.com/fmtlib/fmt/issues/3012,
+  https://github.com/fmtlib/fmt/pull/3062,
+  https://github.com/fmtlib/fmt/pull/3076,
+  https://github.com/fmtlib/fmt/pull/3119). For example
+  ([godbolt](https://godbolt.org/z/8xoWGs9e4)):
+
+  ```c++
+  #include <fmt/std.h>
+  #include <vector>
+
+  int main() {
+    try {
+      std::vector<bool>().at(0);
+    } catch(const std::exception& e) {
+      fmt::print("{}", e);
+    }
+  }
+  ```
+
+  prints:
+
+      vector<bool>::_M_range_check: __n (which is 0) >= this->size() (which is 0)
+
+  on libstdc++. Thanks @zach2good and @phprus.
+
+- Moved `std::error_code` formatter from `fmt/os.h` to `fmt/std.h`.
+  (https://github.com/fmtlib/fmt/pull/3125). Thanks @phprus.
+
+- Added formatters for standard container adapters:
+  `std::priority_queue`, `std::queue` and `std::stack`
+  (https://github.com/fmtlib/fmt/issues/3215,
+  https://github.com/fmtlib/fmt/pull/3279). For example
+  ([godbolt](https://godbolt.org/z/74h1xY9qK)):
+
+  ```c++
+  #include <fmt/ranges.h>
+  #include <stack>
+  #include <vector>
+
+  int main() {
+    auto s = std::stack<bool, std::vector<bool>>();
+    for (auto b: {true, false, true}) s.push(b);
+    fmt::print("{}\n", s); // prints [true, false, true]
+  }
+  ```
+
+  Thanks @ShawnZhong.
+
+- Added a formatter for `std::optional` to `fmt/std.h`
+  (https://github.com/fmtlib/fmt/issues/1367,
+  https://github.com/fmtlib/fmt/pull/3303).
+  Thanks @tom-huntington.
+
+- Fixed formatting of valueless by exception variants
+  (https://github.com/fmtlib/fmt/pull/3347). Thanks @TheOmegaCarrot.
+
+- Made `fmt::ptr` accept `unique_ptr` with a custom deleter
+  (https://github.com/fmtlib/fmt/pull/3177). Thanks @hmbj.
+
+- Fixed formatting of noncopyable ranges and nested ranges of chars
+  (https://github.com/fmtlib/fmt/pull/3158
+  https://github.com/fmtlib/fmt/issues/3286,
+  https://github.com/fmtlib/fmt/pull/3290). Thanks @BRevzin.
+
+- Fixed issues with formatting of paths and ranges of paths
+  (https://github.com/fmtlib/fmt/issues/3319,
+  https://github.com/fmtlib/fmt/pull/3321
+  https://github.com/fmtlib/fmt/issues/3322). Thanks @phprus.
+
+- Improved handling of invalid Unicode in paths.
+
+- Enabled compile-time checks on Apple clang 14 and later
+  (https://github.com/fmtlib/fmt/pull/3331). Thanks @cloyce.
+
+- Improved compile-time checks of named arguments
+  (https://github.com/fmtlib/fmt/issues/3105,
+  https://github.com/fmtlib/fmt/pull/3214). Thanks @rbrich.
+
+- Fixed formatting when both alignment and `0` are given
+  (https://github.com/fmtlib/fmt/issues/3236,
+  https://github.com/fmtlib/fmt/pull/3248). Thanks @ShawnZhong.
+
+- Improved Unicode support in the experimental file API on Windows
+  (https://github.com/fmtlib/fmt/issues/3234,
+  https://github.com/fmtlib/fmt/pull/3293). Thanks @Fros1er.
+
+- Unified UTF transcoding
+  (https://github.com/fmtlib/fmt/pull/3416). Thanks @phprus.
+
+- Added support for UTF-8 digit separators via an experimental locale
+  facet (https://github.com/fmtlib/fmt/issues/1861). For
+  example ([godbolt](https://godbolt.org/z/f7bcznb3W)):
+
+  ```c++
+  auto loc = std::locale(
+    std::locale(), new fmt::format_facet<std::locale>("’"));
+  auto s = fmt::format(loc, "{:L}", 1000);
+  ```
+
+  where `’` is U+2019 used as a digit separator in the de_CH locale.
+
+- Added an overload of `formatted_size` that takes a locale
+  (https://github.com/fmtlib/fmt/issues/3084,
+  https://github.com/fmtlib/fmt/pull/3087). Thanks @gerboengels.
+
+- Removed the deprecated `FMT_DEPRECATED_OSTREAM`.
+
+- Fixed a UB when using a null `std::string_view` with
+  `fmt::to_string` or format string compilation
+  (https://github.com/fmtlib/fmt/issues/3241,
+  https://github.com/fmtlib/fmt/pull/3244). Thanks @phprus.
+
+- Added `starts_with` to the fallback `string_view` implementation
+  (https://github.com/fmtlib/fmt/pull/3080). Thanks @phprus.
+
+- Added `fmt::basic_format_string::get()` for compatibility with
+  `basic_format_string`
+  (https://github.com/fmtlib/fmt/pull/3111). Thanks @huangqinjin.
+
+- Added `println` for compatibility with C++23
+  (https://github.com/fmtlib/fmt/pull/3267). Thanks @ShawnZhong.
+
+- Renamed the `FMT_EXPORT` macro for shared library usage to
+  `FMT_LIB_EXPORT`.
+
+- Improved documentation
+  (https://github.com/fmtlib/fmt/issues/3108,
+  https://github.com/fmtlib/fmt/issues/3169,
+  https://github.com/fmtlib/fmt/pull/3243).
+  https://github.com/fmtlib/fmt/pull/3404,
+  https://github.com/fmtlib/fmt/pull/4002).
+  Thanks @Cleroth, @Vertexwahn and @yujincheng08.
+
+- Improved build configuration and tests
+  (https://github.com/fmtlib/fmt/pull/3118,
+  https://github.com/fmtlib/fmt/pull/3120,
+  https://github.com/fmtlib/fmt/pull/3188,
+  https://github.com/fmtlib/fmt/issues/3189,
+  https://github.com/fmtlib/fmt/pull/3198,
+  https://github.com/fmtlib/fmt/pull/3205,
+  https://github.com/fmtlib/fmt/pull/3207,
+  https://github.com/fmtlib/fmt/pull/3210,
+  https://github.com/fmtlib/fmt/pull/3240,
+  https://github.com/fmtlib/fmt/pull/3256,
+  https://github.com/fmtlib/fmt/pull/3264,
+  https://github.com/fmtlib/fmt/issues/3299,
+  https://github.com/fmtlib/fmt/pull/3302,
+  https://github.com/fmtlib/fmt/pull/3312,
+  https://github.com/fmtlib/fmt/issues/3317,
+  https://github.com/fmtlib/fmt/pull/3328,
+  https://github.com/fmtlib/fmt/pull/3333,
+  https://github.com/fmtlib/fmt/pull/3369,
+  https://github.com/fmtlib/fmt/issues/3373,
+  https://github.com/fmtlib/fmt/pull/3395,
+  https://github.com/fmtlib/fmt/pull/3406,
+  https://github.com/fmtlib/fmt/pull/3411).
+  Thanks @dimztimz, @phprus, @DavidKorczynski, @ChrisThrasher,
+  @FrancoisCarouge, @kennyweiss, @luzpaz, @codeinred, @Mixaill, @joycebrum,
+  @kevinhwang and @Vertexwahn.
+
+- Fixed a regression in handling empty format specifiers after a colon
+  (`{:}`) (https://github.com/fmtlib/fmt/pull/3086). Thanks @oxidase.
+
+- Worked around a broken implementation of
+  `std::is_constant_evaluated` in some versions of libstdc++ on clang
+  (https://github.com/fmtlib/fmt/issues/3247,
+  https://github.com/fmtlib/fmt/pull/3281). Thanks @phprus.
+
+- Fixed formatting of volatile variables
+  (https://github.com/fmtlib/fmt/pull/3068).
+
+- Fixed various warnings and compilation issues
+  (https://github.com/fmtlib/fmt/pull/3057,
+  https://github.com/fmtlib/fmt/pull/3066,
+  https://github.com/fmtlib/fmt/pull/3072,
+  https://github.com/fmtlib/fmt/pull/3082,
+  https://github.com/fmtlib/fmt/pull/3091,
+  https://github.com/fmtlib/fmt/issues/3092,
+  https://github.com/fmtlib/fmt/pull/3093,
+  https://github.com/fmtlib/fmt/pull/3095,
+  https://github.com/fmtlib/fmt/issues/3096,
+  https://github.com/fmtlib/fmt/pull/3097,
+  https://github.com/fmtlib/fmt/issues/3128,
+  https://github.com/fmtlib/fmt/pull/3129,
+  https://github.com/fmtlib/fmt/pull/3137,
+  https://github.com/fmtlib/fmt/pull/3139,
+  https://github.com/fmtlib/fmt/issues/3140,
+  https://github.com/fmtlib/fmt/pull/3142,
+  https://github.com/fmtlib/fmt/issues/3149,
+  https://github.com/fmtlib/fmt/pull/3150,
+  https://github.com/fmtlib/fmt/issues/3154,
+  https://github.com/fmtlib/fmt/issues/3163,
+  https://github.com/fmtlib/fmt/issues/3178,
+  https://github.com/fmtlib/fmt/pull/3184,
+  https://github.com/fmtlib/fmt/pull/3196,
+  https://github.com/fmtlib/fmt/issues/3204,
+  https://github.com/fmtlib/fmt/pull/3206,
+  https://github.com/fmtlib/fmt/pull/3208,
+  https://github.com/fmtlib/fmt/issues/3213,
+  https://github.com/fmtlib/fmt/pull/3216,
+  https://github.com/fmtlib/fmt/issues/3224,
+  https://github.com/fmtlib/fmt/issues/3226,
+  https://github.com/fmtlib/fmt/issues/3228,
+  https://github.com/fmtlib/fmt/pull/3229,
+  https://github.com/fmtlib/fmt/pull/3259,
+  https://github.com/fmtlib/fmt/issues/3274,
+  https://github.com/fmtlib/fmt/issues/3287,
+  https://github.com/fmtlib/fmt/pull/3288,
+  https://github.com/fmtlib/fmt/issues/3292,
+  https://github.com/fmtlib/fmt/pull/3295,
+  https://github.com/fmtlib/fmt/pull/3296,
+  https://github.com/fmtlib/fmt/issues/3298,
+  https://github.com/fmtlib/fmt/issues/3325,
+  https://github.com/fmtlib/fmt/pull/3326,
+  https://github.com/fmtlib/fmt/issues/3334,
+  https://github.com/fmtlib/fmt/issues/3342,
+  https://github.com/fmtlib/fmt/pull/3343,
+  https://github.com/fmtlib/fmt/issues/3351,
+  https://github.com/fmtlib/fmt/pull/3352,
+  https://github.com/fmtlib/fmt/pull/3362,
+  https://github.com/fmtlib/fmt/issues/3365,
+  https://github.com/fmtlib/fmt/pull/3366,
+  https://github.com/fmtlib/fmt/pull/3374,
+  https://github.com/fmtlib/fmt/issues/3377,
+  https://github.com/fmtlib/fmt/pull/3378,
+  https://github.com/fmtlib/fmt/issues/3381,
+  https://github.com/fmtlib/fmt/pull/3398,
+  https://github.com/fmtlib/fmt/pull/3413,
+  https://github.com/fmtlib/fmt/issues/3415).
+  Thanks @phprus, @gsjaardema, @NewbieOrange, @EngineLessCC, @asmaloney,
+  @HazardyKnusperkeks, @sergiud, @Youw, @thesmurph, @czudziakm,
+  @Roman-Koshelev, @chronoxor, @ShawnZhong, @russelltg, @glebm, @tmartin-gh,
+  @Zhaojun-Liu, @louiswins and @mogemimi.
+
+# 9.1.0 - 2022-08-27
+
+- `fmt::formatted_size` now works at compile time
+  (https://github.com/fmtlib/fmt/pull/3026). For example
+  ([godbolt](https://godbolt.org/z/1MW5rMdf8)):
+
+  ```c++
+  #include <fmt/compile.h>
+
+  int main() {
+    using namespace fmt::literals;
+    constexpr size_t n = fmt::formatted_size("{}"_cf, 42);
+    fmt::print("{}\n", n); // prints 2
+  }
+  ```
+
+  Thanks @marksantaniello.
+
+- Fixed handling of invalid UTF-8
+  (https://github.com/fmtlib/fmt/pull/3038,
+  https://github.com/fmtlib/fmt/pull/3044,
+  https://github.com/fmtlib/fmt/pull/3056).
+  Thanks @phprus and @skeeto.
+
+- Improved Unicode support in `ostream` overloads of `print`
+  (https://github.com/fmtlib/fmt/pull/2994,
+  https://github.com/fmtlib/fmt/pull/3001,
+  https://github.com/fmtlib/fmt/pull/3025). Thanks @dimztimz.
+
+- Fixed handling of the sign specifier in localized formatting on
+  systems with 32-bit `wchar_t`
+  (https://github.com/fmtlib/fmt/issues/3041).
+
+- Added support for wide streams to `fmt::streamed`
+  (https://github.com/fmtlib/fmt/pull/2994). Thanks @phprus.
+
+- Added the `n` specifier that disables the output of delimiters when
+  formatting ranges (https://github.com/fmtlib/fmt/pull/2981,
+  https://github.com/fmtlib/fmt/pull/2983). For example
+  ([godbolt](https://godbolt.org/z/roKqGdj8c)):
+
+  ```c++
+  #include <fmt/ranges.h>
+  #include <vector>
+
+  int main() {
+    auto v = std::vector{1, 2, 3};
+    fmt::print("{:n}\n", v); // prints 1, 2, 3
+  }
+  ```
+
+  Thanks @BRevzin.
+
+- Worked around problematic `std::string_view` constructors introduced
+  in C++23 (https://github.com/fmtlib/fmt/issues/3030,
+  https://github.com/fmtlib/fmt/issues/3050). Thanks @strega-nil-ms.
+
+- Improve handling (exclusion) of recursive ranges
+  (https://github.com/fmtlib/fmt/issues/2968,
+  https://github.com/fmtlib/fmt/pull/2974). Thanks @Dani-Hub.
+
+- Improved error reporting in format string compilation
+  (https://github.com/fmtlib/fmt/issues/3055).
+
+- Improved the implementation of
+  [Dragonbox](https://github.com/jk-jeon/dragonbox), the algorithm
+  used for the default floating-point formatting
+  (https://github.com/fmtlib/fmt/pull/2984). Thanks @jk-jeon.
+
+- Fixed issues with floating-point formatting on exotic platforms.
+
+- Improved the implementation of chrono formatting
+  (https://github.com/fmtlib/fmt/pull/3010). Thanks @phprus.
+
+- Improved documentation
+  (https://github.com/fmtlib/fmt/pull/2966,
+  https://github.com/fmtlib/fmt/pull/3009,
+  https://github.com/fmtlib/fmt/issues/3020,
+  https://github.com/fmtlib/fmt/pull/3037).
+  Thanks @mwinterb, @jcelerier and @remiburtin.
+
+- Improved build configuration
+  (https://github.com/fmtlib/fmt/pull/2991,
+  https://github.com/fmtlib/fmt/pull/2995,
+  https://github.com/fmtlib/fmt/issues/3004,
+  https://github.com/fmtlib/fmt/pull/3007,
+  https://github.com/fmtlib/fmt/pull/3040).
+  Thanks @dimztimz and @hwhsu1231.
+
+- Fixed various warnings and compilation issues
+  (https://github.com/fmtlib/fmt/issues/2969,
+  https://github.com/fmtlib/fmt/pull/2971,
+  https://github.com/fmtlib/fmt/issues/2975,
+  https://github.com/fmtlib/fmt/pull/2982,
+  https://github.com/fmtlib/fmt/pull/2985,
+  https://github.com/fmtlib/fmt/issues/2988,
+  https://github.com/fmtlib/fmt/issues/2989,
+  https://github.com/fmtlib/fmt/issues/3000,
+  https://github.com/fmtlib/fmt/issues/3006,
+  https://github.com/fmtlib/fmt/issues/3014,
+  https://github.com/fmtlib/fmt/issues/3015,
+  https://github.com/fmtlib/fmt/pull/3021,
+  https://github.com/fmtlib/fmt/issues/3023,
+  https://github.com/fmtlib/fmt/pull/3024,
+  https://github.com/fmtlib/fmt/pull/3029,
+  https://github.com/fmtlib/fmt/pull/3043,
+  https://github.com/fmtlib/fmt/issues/3052,
+  https://github.com/fmtlib/fmt/pull/3053,
+  https://github.com/fmtlib/fmt/pull/3054).
+  Thanks @h-friederich, @dimztimz, @olupton, @bernhardmgruber and @phprus.
+
+# 9.0.0 - 2022-07-04
+
+- Switched to the internal floating point formatter for all decimal
+  presentation formats. In particular this results in consistent
+  rounding on all platforms and removing the `s[n]printf` fallback for
+  decimal FP formatting.
+
+- Compile-time floating point formatting no longer requires the
+  header-only mode. For example
+  ([godbolt](https://godbolt.org/z/G37PTeG3b)):
+
+  ```c++
+  #include <array>
+  #include <fmt/compile.h>
+
+  consteval auto compile_time_dtoa(double value) -> std::array<char, 10> {
+    auto result = std::array<char, 10>();
+    fmt::format_to(result.data(), FMT_COMPILE("{}"), value);
+    return result;
+  }
+
+  constexpr auto answer = compile_time_dtoa(0.42);
+  ```
+
+  works with the default settings.
+
+- Improved the implementation of
+  [Dragonbox](https://github.com/jk-jeon/dragonbox), the algorithm
+  used for the default floating-point formatting
+  (https://github.com/fmtlib/fmt/pull/2713,
+  https://github.com/fmtlib/fmt/pull/2750). Thanks @jk-jeon.
+
+- Made `fmt::to_string` work with `__float128`. This uses the internal
+  FP formatter and works even on system without `__float128` support
+  in `[s]printf`.
+
+- Disabled automatic `std::ostream` insertion operator (`operator<<`)
+  discovery when `fmt/ostream.h` is included to prevent ODR
+  violations. You can get the old behavior by defining
+  `FMT_DEPRECATED_OSTREAM` but this will be removed in the next major
+  release. Use `fmt::streamed` or `fmt::ostream_formatter` to enable
+  formatting via `std::ostream` instead.
+
+- Added `fmt::ostream_formatter` that can be used to write `formatter`
+  specializations that perform formatting via `std::ostream`. For
+  example ([godbolt](https://godbolt.org/z/5sEc5qMsf)):
+
+  ```c++
+  #include <fmt/ostream.h>
+
+  struct date {
+    int year, month, day;
+
+    friend std::ostream& operator<<(std::ostream& os, const date& d) {
+      return os << d.year << '-' << d.month << '-' << d.day;
+    }
+  };
+
+  template <> struct fmt::formatter<date> : ostream_formatter {};
+
+  std::string s = fmt::format("The date is {}", date{2012, 12, 9});
+  // s == "The date is 2012-12-9"
+  ```
+
+- Added the `fmt::streamed` function that takes an object and formats
+  it via `std::ostream`. For example
+  ([godbolt](https://godbolt.org/z/5G3346G1f)):
+
+  ```c++
+  #include <thread>
+  #include <fmt/ostream.h>
+
+  int main() {
+    fmt::print("Current thread id: {}\n",
+               fmt::streamed(std::this_thread::get_id()));
+  }
+  ```
+
+  Note that `fmt/std.h` provides a `formatter` specialization for
+  `std::thread::id` so you don\'t need to format it via
+  `std::ostream`.
+
+- Deprecated implicit conversions of unscoped enums to integers for
+  consistency with scoped enums.
+
+- Added an argument-dependent lookup based `format_as` extension API
+  to simplify formatting of enums.
+
+- Added experimental `std::variant` formatting support
+  (https://github.com/fmtlib/fmt/pull/2941). For example
+  ([godbolt](https://godbolt.org/z/KG9z6cq68)):
+
+  ```c++
+  #include <variant>
+  #include <fmt/std.h>
+
+  int main() {
+    auto v = std::variant<int, std::string>(42);
+    fmt::print("{}\n", v);
+  }
+  ```
+
+  prints:
+
+      variant(42)
+
+  Thanks @jehelset.
+
+- Added experimental `std::filesystem::path` formatting support
+  (https://github.com/fmtlib/fmt/issues/2865,
+  https://github.com/fmtlib/fmt/pull/2902,
+  https://github.com/fmtlib/fmt/issues/2917,
+  https://github.com/fmtlib/fmt/pull/2918). For example
+  ([godbolt](https://godbolt.org/z/o44dMexEb)):
+
+  ```c++
+  #include <filesystem>
+  #include <fmt/std.h>
+
+  int main() {
+    fmt::print("There is no place like {}.", std::filesystem::path("/home"));
+  }
+  ```
+
+  prints:
+
+      There is no place like "/home".
+
+  Thanks @phprus.
+
+- Added a `std::thread::id` formatter to `fmt/std.h`. For example
+  ([godbolt](https://godbolt.org/z/j1azbYf3E)):
+
+  ```c++
+  #include <thread>
+  #include <fmt/std.h>
+
+  int main() {
+    fmt::print("Current thread id: {}\n", std::this_thread::get_id());
+  }
+  ```
+
+- Added `fmt::styled` that applies a text style to an individual
+  argument (https://github.com/fmtlib/fmt/pull/2793). For
+  example ([godbolt](https://godbolt.org/z/vWGW7v5M6)):
+
+  ```c++
+  #include <fmt/chrono.h>
+  #include <fmt/color.h>
+
+  int main() {
+    auto now = std::chrono::system_clock::now();
+    fmt::print(
+      "[{}] {}: {}\n",
+      fmt::styled(now, fmt::emphasis::bold),
+      fmt::styled("error", fg(fmt::color::red)),
+      "something went wrong");
+  }
+  ```
+
+  prints
+
+  ![](https://user-images.githubusercontent.com/576385/175071215-12809244-dab0-4005-96d8-7cd911c964d5.png)
+
+  Thanks @rbrugo.
+
+- Made `fmt::print` overload for text styles correctly handle UTF-8
+  (https://github.com/fmtlib/fmt/issues/2681,
+  https://github.com/fmtlib/fmt/pull/2701). Thanks @AlexGuteniev.
+
+- Fixed Unicode handling when writing to an ostream.
+
+- Added support for nested specifiers to range formatting
+  (https://github.com/fmtlib/fmt/pull/2673). For example
+  ([godbolt](https://godbolt.org/z/xd3Gj38cf)):
+
+  ```c++
+  #include <vector>
+  #include <fmt/ranges.h>
+
+  int main() {
+    fmt::print("{::#x}\n", std::vector{10, 20, 30});
+  }
+  ```
+
+  prints `[0xa, 0x14, 0x1e]`.
+
+  Thanks @BRevzin.
+
+- Implemented escaping of wide strings in ranges
+  (https://github.com/fmtlib/fmt/pull/2904). Thanks @phprus.
+
+- Added support for ranges with `begin` / `end` found via the
+  argument-dependent lookup
+  (https://github.com/fmtlib/fmt/pull/2807). Thanks @rbrugo.
+
+- Fixed formatting of certain kinds of ranges of ranges
+  (https://github.com/fmtlib/fmt/pull/2787). Thanks @BRevzin.
+
+- Fixed handling of maps with element types other than `std::pair`
+  (https://github.com/fmtlib/fmt/pull/2944). Thanks @BrukerJWD.
+
+- Made tuple formatter enabled only if elements are formattable
+  (https://github.com/fmtlib/fmt/issues/2939,
+  https://github.com/fmtlib/fmt/pull/2940). Thanks @jehelset.
+
+- Made `fmt::join` compatible with format string compilation
+  (https://github.com/fmtlib/fmt/issues/2719,
+  https://github.com/fmtlib/fmt/pull/2720). Thanks @phprus.
+
+- Made compile-time checks work with named arguments of custom types
+  and `std::ostream` `print` overloads
+  (https://github.com/fmtlib/fmt/issues/2816,
+  https://github.com/fmtlib/fmt/issues/2817,
+  https://github.com/fmtlib/fmt/pull/2819). Thanks @timsong-cpp.
+
+- Removed `make_args_checked` because it is no longer needed for
+  compile-time checks
+  (https://github.com/fmtlib/fmt/pull/2760). Thanks @phprus.
+
+- Removed the following deprecated APIs: `_format`, `arg_join`, the
+  `format_to` overload that takes a memory buffer, `[v]fprintf` that
+  takes an `ostream`.
+
+- Removed the deprecated implicit conversion of `[const] signed char*`
+  and `[const] unsigned char*` to C strings.
+
+- Removed the deprecated `fmt/locale.h`.
+
+- Replaced the deprecated `fileno()` with `descriptor()` in
+  `buffered_file`.
+
+- Moved `to_string_view` to the `detail` namespace since it\'s an
+  implementation detail.
+
+- Made access mode of a created file consistent with `fopen` by
+  setting `S_IWGRP` and `S_IWOTH`
+  (https://github.com/fmtlib/fmt/pull/2733). Thanks @arogge.
+
+- Removed a redundant buffer resize when formatting to `std::ostream`
+  (https://github.com/fmtlib/fmt/issues/2842,
+  https://github.com/fmtlib/fmt/pull/2843). Thanks @jcelerier.
+
+- Made precision computation for strings consistent with width
+  (https://github.com/fmtlib/fmt/issues/2888).
+
+- Fixed handling of locale separators in floating point formatting
+  (https://github.com/fmtlib/fmt/issues/2830).
+
+- Made sign specifiers work with `__int128_t`
+  (https://github.com/fmtlib/fmt/issues/2773).
+
+- Improved support for systems such as CHERI with extra data stored in
+  pointers (https://github.com/fmtlib/fmt/pull/2932).
+  Thanks @davidchisnall.
+
+- Improved documentation
+  (https://github.com/fmtlib/fmt/pull/2706,
+  https://github.com/fmtlib/fmt/pull/2712,
+  https://github.com/fmtlib/fmt/pull/2789,
+  https://github.com/fmtlib/fmt/pull/2803,
+  https://github.com/fmtlib/fmt/pull/2805,
+  https://github.com/fmtlib/fmt/pull/2815,
+  https://github.com/fmtlib/fmt/pull/2924).
+  Thanks @BRevzin, @Pokechu22, @setoye, @rtobar, @rbrugo, @anoonD and
+  @leha-bot.
+
+- Improved build configuration
+  (https://github.com/fmtlib/fmt/pull/2766,
+  https://github.com/fmtlib/fmt/pull/2772,
+  https://github.com/fmtlib/fmt/pull/2836,
+  https://github.com/fmtlib/fmt/pull/2852,
+  https://github.com/fmtlib/fmt/pull/2907,
+  https://github.com/fmtlib/fmt/pull/2913,
+  https://github.com/fmtlib/fmt/pull/2914).
+  Thanks @kambala-decapitator, @mattiasljungstrom, @kieselnb, @nathannaveen
+  and @Vertexwahn.
+
+- Fixed various warnings and compilation issues
+  (https://github.com/fmtlib/fmt/issues/2408,
+  https://github.com/fmtlib/fmt/issues/2507,
+  https://github.com/fmtlib/fmt/issues/2697,
+  https://github.com/fmtlib/fmt/issues/2715,
+  https://github.com/fmtlib/fmt/issues/2717,
+  https://github.com/fmtlib/fmt/pull/2722,
+  https://github.com/fmtlib/fmt/pull/2724,
+  https://github.com/fmtlib/fmt/pull/2725,
+  https://github.com/fmtlib/fmt/issues/2726,
+  https://github.com/fmtlib/fmt/pull/2728,
+  https://github.com/fmtlib/fmt/pull/2732,
+  https://github.com/fmtlib/fmt/issues/2738,
+  https://github.com/fmtlib/fmt/pull/2742,
+  https://github.com/fmtlib/fmt/issues/2744,
+  https://github.com/fmtlib/fmt/issues/2745,
+  https://github.com/fmtlib/fmt/issues/2746,
+  https://github.com/fmtlib/fmt/issues/2754,
+  https://github.com/fmtlib/fmt/pull/2755,
+  https://github.com/fmtlib/fmt/issues/2757,
+  https://github.com/fmtlib/fmt/pull/2758,
+  https://github.com/fmtlib/fmt/issues/2761,
+  https://github.com/fmtlib/fmt/pull/2762,
+  https://github.com/fmtlib/fmt/issues/2763,
+  https://github.com/fmtlib/fmt/pull/2765,
+  https://github.com/fmtlib/fmt/issues/2769,
+  https://github.com/fmtlib/fmt/pull/2770,
+  https://github.com/fmtlib/fmt/issues/2771,
+  https://github.com/fmtlib/fmt/issues/2777,
+  https://github.com/fmtlib/fmt/pull/2779,
+  https://github.com/fmtlib/fmt/pull/2782,
+  https://github.com/fmtlib/fmt/pull/2783,
+  https://github.com/fmtlib/fmt/issues/2794,
+  https://github.com/fmtlib/fmt/issues/2796,
+  https://github.com/fmtlib/fmt/pull/2797,
+  https://github.com/fmtlib/fmt/pull/2801,
+  https://github.com/fmtlib/fmt/pull/2802,
+  https://github.com/fmtlib/fmt/issues/2808,
+  https://github.com/fmtlib/fmt/issues/2818,
+  https://github.com/fmtlib/fmt/pull/2819,
+  https://github.com/fmtlib/fmt/issues/2829,
+  https://github.com/fmtlib/fmt/issues/2835,
+  https://github.com/fmtlib/fmt/issues/2848,
+  https://github.com/fmtlib/fmt/issues/2860,
+  https://github.com/fmtlib/fmt/pull/2861,
+  https://github.com/fmtlib/fmt/pull/2882,
+  https://github.com/fmtlib/fmt/issues/2886,
+  https://github.com/fmtlib/fmt/issues/2891,
+  https://github.com/fmtlib/fmt/pull/2892,
+  https://github.com/fmtlib/fmt/issues/2895,
+  https://github.com/fmtlib/fmt/issues/2896,
+  https://github.com/fmtlib/fmt/pull/2903,
+  https://github.com/fmtlib/fmt/issues/2906,
+  https://github.com/fmtlib/fmt/issues/2908,
+  https://github.com/fmtlib/fmt/pull/2909,
+  https://github.com/fmtlib/fmt/issues/2920,
+  https://github.com/fmtlib/fmt/pull/2922,
+  https://github.com/fmtlib/fmt/pull/2927,
+  https://github.com/fmtlib/fmt/pull/2929,
+  https://github.com/fmtlib/fmt/issues/2936,
+  https://github.com/fmtlib/fmt/pull/2937,
+  https://github.com/fmtlib/fmt/pull/2938,
+  https://github.com/fmtlib/fmt/pull/2951,
+  https://github.com/fmtlib/fmt/issues/2954,
+  https://github.com/fmtlib/fmt/pull/2957,
+  https://github.com/fmtlib/fmt/issues/2958,
+  https://github.com/fmtlib/fmt/pull/2960).
+  Thanks @matrackif @Tobi823, @ivan-volnov, @VasiliPupkin256,
+  @federico-busato, @barcharcraz, @jk-jeon, @HazardyKnusperkeks, @dalboris,
+  @seanm, @gsjaardema, @timsong-cpp, @seanm, @frithrah, @chronoxor, @Agga,
+  @madmaxoft, @JurajX, @phprus and @Dani-Hub.
+
+# 8.1.1 - 2022-01-06
+
+- Restored ABI compatibility with version 8.0.x
+  (https://github.com/fmtlib/fmt/issues/2695,
+  https://github.com/fmtlib/fmt/pull/2696). Thanks @saraedum.
+- Fixed chrono formatting on big endian systems
+  (https://github.com/fmtlib/fmt/issues/2698,
+  https://github.com/fmtlib/fmt/pull/2699).
+  Thanks @phprus and @xvitaly.
+- Fixed a linkage error with mingw
+  (https://github.com/fmtlib/fmt/issues/2691,
+  https://github.com/fmtlib/fmt/pull/2692). Thanks @rbberger.
+
+# 8.1.0 - 2022-01-02
+
+- Optimized chrono formatting
+  (https://github.com/fmtlib/fmt/pull/2500,
+  https://github.com/fmtlib/fmt/pull/2537,
+  https://github.com/fmtlib/fmt/issues/2541,
+  https://github.com/fmtlib/fmt/pull/2544,
+  https://github.com/fmtlib/fmt/pull/2550,
+  https://github.com/fmtlib/fmt/pull/2551,
+  https://github.com/fmtlib/fmt/pull/2576,
+  https://github.com/fmtlib/fmt/issues/2577,
+  https://github.com/fmtlib/fmt/pull/2586,
+  https://github.com/fmtlib/fmt/pull/2591,
+  https://github.com/fmtlib/fmt/pull/2594,
+  https://github.com/fmtlib/fmt/pull/2602,
+  https://github.com/fmtlib/fmt/pull/2617,
+  https://github.com/fmtlib/fmt/issues/2628,
+  https://github.com/fmtlib/fmt/pull/2633,
+  https://github.com/fmtlib/fmt/issues/2670,
+  https://github.com/fmtlib/fmt/pull/2671).
+
+  Processing of some specifiers such as `%z` and `%Y` is now up to
+  10-20 times faster, for example on GCC 11 with libstdc++:
+
+      ----------------------------------------------------------------------------
+      Benchmark                                  Before             After
+      ----------------------------------------------------------------------------
+      FMTFormatter_z                             261 ns             26.3 ns
+      FMTFormatterCompile_z                      246 ns             11.6 ns
+      FMTFormatter_Y                             263 ns             26.1 ns
+      FMTFormatterCompile_Y                      244 ns             10.5 ns
+      ----------------------------------------------------------------------------
+
+  Thanks @phprus and @toughengineer.
+
+- Implemented subsecond formatting for chrono durations
+  (https://github.com/fmtlib/fmt/pull/2623). For example
+  ([godbolt](https://godbolt.org/z/es7vWTETe)):
+
+  ```c++
+  #include <fmt/chrono.h>
+
+  int main() {
+    fmt::print("{:%S}", std::chrono::milliseconds(1234));
+  }
+  ```
+
+  prints \"01.234\".
+
+  Thanks @matrackif.
+
+- Fixed handling of precision 0 when formatting chrono durations
+  (https://github.com/fmtlib/fmt/issues/2587,
+  https://github.com/fmtlib/fmt/pull/2588). Thanks @lukester1975.
+
+- Fixed an overflow on invalid inputs in the `tm` formatter
+  (https://github.com/fmtlib/fmt/pull/2564). Thanks @phprus.
+
+- Added `fmt::group_digits` that formats integers with a non-localized
+  digit separator (comma) for groups of three digits. For example
+  ([godbolt](https://godbolt.org/z/TxGxG9Poq)):
+
+  ```c++
+  #include <fmt/format.h>
+
+  int main() {
+    fmt::print("{} dollars", fmt::group_digits(1000000));
+  }
+  ```
+
+  prints \"1,000,000 dollars\".
+
+- Added support for faint, conceal, reverse and blink text styles
+  (https://github.com/fmtlib/fmt/pull/2394):
+
+  <https://user-images.githubusercontent.com/576385/147710227-c68f5317-f8fa-42c3-9123-7c4ba3c398cb.mp4>
+
+  Thanks @benit8 and @data-man.
+
+- Added experimental support for compile-time floating point
+  formatting (https://github.com/fmtlib/fmt/pull/2426,
+  https://github.com/fmtlib/fmt/pull/2470). It is currently
+  limited to the header-only mode. Thanks @alexezeder.
+
+- Added UDL-based named argument support to compile-time format string
+  checks (https://github.com/fmtlib/fmt/issues/2640,
+  https://github.com/fmtlib/fmt/pull/2649). For example
+  ([godbolt](https://godbolt.org/z/ohGbbvonv)):
+
+  ```c++
+  #include <fmt/format.h>
+
+  int main() {
+    using namespace fmt::literals;
+    fmt::print("{answer:s}", "answer"_a=42);
+  }
+  ```
+
+  gives a compile-time error on compilers with C++20 `consteval` and
+  non-type template parameter support (gcc 10+) because `s` is not a
+  valid format specifier for an integer.
+
+  Thanks @alexezeder.
+
+- Implemented escaping of string range elements. For example
+  ([godbolt](https://godbolt.org/z/rKvM1vKf3)):
+
+  ```c++
+  #include <fmt/ranges.h>
+  #include <vector>
+
+  int main() {
+    fmt::print("{}", std::vector<std::string>{"\naan"});
+  }
+  ```
+
+  is now printed as:
+
+      ["\naan"]
+
+  instead of:
+
+      ["
+      aan"]
+
+- Added an experimental `?` specifier for escaping strings.
+  (https://github.com/fmtlib/fmt/pull/2674). Thanks @BRevzin.
+
+- Switched to JSON-like representation of maps and sets for
+  consistency with Python\'s `str.format`. For example
+  ([godbolt](https://godbolt.org/z/seKjoY9W5)):
+
+  ```c++
+  #include <fmt/ranges.h>
+  #include <map>
+
+  int main() {
+    fmt::print("{}", std::map<std::string, int>{{"answer", 42}});
+  }
+  ```
+
+  is now printed as:
+
+      {"answer": 42}
+
+- Extended `fmt::join` to support C++20-only ranges
+  (https://github.com/fmtlib/fmt/pull/2549). Thanks @BRevzin.
+
+- Optimized handling of non-const-iterable ranges and implemented
+  initial support for non-const-formattable types.
+
+- Disabled implicit conversions of scoped enums to integers that was
+  accidentally introduced in earlier versions
+  (https://github.com/fmtlib/fmt/pull/1841).
+
+- Deprecated implicit conversion of `[const] signed char*` and
+  `[const] unsigned char*` to C strings.
+
+- Deprecated `_format`, a legacy UDL-based format API
+  (https://github.com/fmtlib/fmt/pull/2646). Thanks @alexezeder.
+
+- Marked `format`, `formatted_size` and `to_string` as `[[nodiscard]]`
+  (https://github.com/fmtlib/fmt/pull/2612). @0x8000-0000.
+
+- Added missing diagnostic when trying to format function and member
+  pointers as well as objects convertible to pointers which is
+  explicitly disallowed
+  (https://github.com/fmtlib/fmt/issues/2598,
+  https://github.com/fmtlib/fmt/pull/2609,
+  https://github.com/fmtlib/fmt/pull/2610). Thanks @AlexGuteniev.
+
+- Optimized writing to a contiguous buffer with `format_to_n`
+  (https://github.com/fmtlib/fmt/pull/2489). Thanks @Roman-Koshelev.
+
+- Optimized writing to non-`char` buffers
+  (https://github.com/fmtlib/fmt/pull/2477). Thanks @Roman-Koshelev.
+
+- Decimal point is now localized when using the `L` specifier.
+
+- Improved floating point formatter implementation
+  (https://github.com/fmtlib/fmt/pull/2498,
+  https://github.com/fmtlib/fmt/pull/2499). Thanks @Roman-Koshelev.
+
+- Fixed handling of very large precision in fixed format
+  (https://github.com/fmtlib/fmt/pull/2616).
+
+- Made a table of cached powers used in FP formatting static
+  (https://github.com/fmtlib/fmt/pull/2509). Thanks @jk-jeon.
+
+- Resolved a lookup ambiguity with C++20 format-related functions due
+  to ADL (https://github.com/fmtlib/fmt/issues/2639,
+  https://github.com/fmtlib/fmt/pull/2641). Thanks @mkurdej.
+
+- Removed unnecessary inline namespace qualification
+  (https://github.com/fmtlib/fmt/issues/2642,
+  https://github.com/fmtlib/fmt/pull/2643). Thanks @mkurdej.
+
+- Implemented argument forwarding in `format_to_n`
+  (https://github.com/fmtlib/fmt/issues/2462,
+  https://github.com/fmtlib/fmt/pull/2463). Thanks @owent.
+
+- Fixed handling of implicit conversions in `fmt::to_string` and
+  format string compilation
+  (https://github.com/fmtlib/fmt/issues/2565).
+
+- Changed the default access mode of files created by
+  `fmt::output_file` to `-rw-r--r--` for consistency with `fopen`
+  (https://github.com/fmtlib/fmt/issues/2530).
+
+- Make `fmt::ostream::flush` public
+  (https://github.com/fmtlib/fmt/issues/2435).
+
+- Improved C++14/17 attribute detection
+  (https://github.com/fmtlib/fmt/pull/2615). Thanks @AlexGuteniev.
+
+- Improved `consteval` detection for MSVC
+  (https://github.com/fmtlib/fmt/pull/2559). Thanks @DanielaE.
+
+- Improved documentation
+  (https://github.com/fmtlib/fmt/issues/2406,
+  https://github.com/fmtlib/fmt/pull/2446,
+  https://github.com/fmtlib/fmt/issues/2493,
+  https://github.com/fmtlib/fmt/issues/2513,
+  https://github.com/fmtlib/fmt/pull/2515,
+  https://github.com/fmtlib/fmt/issues/2522,
+  https://github.com/fmtlib/fmt/pull/2562,
+  https://github.com/fmtlib/fmt/pull/2575,
+  https://github.com/fmtlib/fmt/pull/2606,
+  https://github.com/fmtlib/fmt/pull/2620,
+  https://github.com/fmtlib/fmt/issues/2676).
+  Thanks @sobolevn, @UnePierre, @zhsj, @phprus, @ericcurtin and @Lounarok.
+
+- Improved fuzzers and added a fuzzer for chrono timepoint formatting
+  (https://github.com/fmtlib/fmt/pull/2461,
+  https://github.com/fmtlib/fmt/pull/2469). @pauldreik,
+
+- Added the `FMT_SYSTEM_HEADERS` CMake option setting which marks
+  {fmt}\'s headers as system. It can be used to suppress warnings
+  (https://github.com/fmtlib/fmt/issues/2644,
+  https://github.com/fmtlib/fmt/pull/2651). Thanks @alexezeder.
+
+- Added the Bazel build system support
+  (https://github.com/fmtlib/fmt/pull/2505,
+  https://github.com/fmtlib/fmt/pull/2516). Thanks @Vertexwahn.
+
+- Improved build configuration and tests
+  (https://github.com/fmtlib/fmt/issues/2437,
+  https://github.com/fmtlib/fmt/pull/2558,
+  https://github.com/fmtlib/fmt/pull/2648,
+  https://github.com/fmtlib/fmt/pull/2650,
+  https://github.com/fmtlib/fmt/pull/2663,
+  https://github.com/fmtlib/fmt/pull/2677).
+  Thanks @DanielaE, @alexezeder and @phprus.
+
+- Fixed various warnings and compilation issues
+  (https://github.com/fmtlib/fmt/pull/2353,
+  https://github.com/fmtlib/fmt/pull/2356,
+  https://github.com/fmtlib/fmt/pull/2399,
+  https://github.com/fmtlib/fmt/issues/2408,
+  https://github.com/fmtlib/fmt/pull/2414,
+  https://github.com/fmtlib/fmt/pull/2427,
+  https://github.com/fmtlib/fmt/pull/2432,
+  https://github.com/fmtlib/fmt/pull/2442,
+  https://github.com/fmtlib/fmt/pull/2434,
+  https://github.com/fmtlib/fmt/issues/2439,
+  https://github.com/fmtlib/fmt/pull/2447,
+  https://github.com/fmtlib/fmt/pull/2450,
+  https://github.com/fmtlib/fmt/issues/2455,
+  https://github.com/fmtlib/fmt/issues/2465,
+  https://github.com/fmtlib/fmt/issues/2472,
+  https://github.com/fmtlib/fmt/issues/2474,
+  https://github.com/fmtlib/fmt/pull/2476,
+  https://github.com/fmtlib/fmt/issues/2478,
+  https://github.com/fmtlib/fmt/issues/2479,
+  https://github.com/fmtlib/fmt/issues/2481,
+  https://github.com/fmtlib/fmt/pull/2482,
+  https://github.com/fmtlib/fmt/pull/2483,
+  https://github.com/fmtlib/fmt/issues/2490,
+  https://github.com/fmtlib/fmt/pull/2491,
+  https://github.com/fmtlib/fmt/pull/2510,
+  https://github.com/fmtlib/fmt/pull/2518,
+  https://github.com/fmtlib/fmt/issues/2528,
+  https://github.com/fmtlib/fmt/pull/2529,
+  https://github.com/fmtlib/fmt/pull/2539,
+  https://github.com/fmtlib/fmt/issues/2540,
+  https://github.com/fmtlib/fmt/pull/2545,
+  https://github.com/fmtlib/fmt/pull/2555,
+  https://github.com/fmtlib/fmt/issues/2557,
+  https://github.com/fmtlib/fmt/issues/2570,
+  https://github.com/fmtlib/fmt/pull/2573,
+  https://github.com/fmtlib/fmt/pull/2582,
+  https://github.com/fmtlib/fmt/issues/2605,
+  https://github.com/fmtlib/fmt/pull/2611,
+  https://github.com/fmtlib/fmt/pull/2647,
+  https://github.com/fmtlib/fmt/issues/2627,
+  https://github.com/fmtlib/fmt/pull/2630,
+  https://github.com/fmtlib/fmt/issues/2635,
+  https://github.com/fmtlib/fmt/issues/2638,
+  https://github.com/fmtlib/fmt/issues/2653,
+  https://github.com/fmtlib/fmt/issues/2654,
+  https://github.com/fmtlib/fmt/issues/2661,
+  https://github.com/fmtlib/fmt/pull/2664,
+  https://github.com/fmtlib/fmt/pull/2684).
+  Thanks @DanielaE, @mwinterb, @cdacamar, @TrebledJ, @bodomartin, @cquammen,
+  @white238, @mmarkeloff, @palacaze, @jcelerier, @mborn-adi, @BrukerJWD,
+  @spyridon97, @phprus, @oliverlee, @joshessman-llnl, @akohlmey, @timkalu,
+  @olupton, @Acretock, @alexezeder, @andrewcorrigan, @lucpelletier and
+  @HazardyKnusperkeks.
+
+# 8.0.1 - 2021-07-02
+
+- Fixed the version number in the inline namespace
+  (https://github.com/fmtlib/fmt/issues/2374).
+- Added a missing presentation type check for `std::string`
+  (https://github.com/fmtlib/fmt/issues/2402).
+- Fixed a linkage error when mixing code built with clang and gcc
+  (https://github.com/fmtlib/fmt/issues/2377).
+- Fixed documentation issues
+  (https://github.com/fmtlib/fmt/pull/2396,
+  https://github.com/fmtlib/fmt/issues/2403,
+  https://github.com/fmtlib/fmt/issues/2406). Thanks @mkurdej.
+- Removed dead code in FP formatter (
+  https://github.com/fmtlib/fmt/pull/2398). Thanks @javierhonduco.
+- Fixed various warnings and compilation issues
+  (https://github.com/fmtlib/fmt/issues/2351,
+  https://github.com/fmtlib/fmt/issues/2359,
+  https://github.com/fmtlib/fmt/pull/2365,
+  https://github.com/fmtlib/fmt/issues/2368,
+  https://github.com/fmtlib/fmt/pull/2370,
+  https://github.com/fmtlib/fmt/pull/2376,
+  https://github.com/fmtlib/fmt/pull/2381,
+  https://github.com/fmtlib/fmt/pull/2382,
+  https://github.com/fmtlib/fmt/issues/2386,
+  https://github.com/fmtlib/fmt/pull/2389,
+  https://github.com/fmtlib/fmt/pull/2395,
+  https://github.com/fmtlib/fmt/pull/2397,
+  https://github.com/fmtlib/fmt/issues/2400,
+  https://github.com/fmtlib/fmt/issues/2401,
+  https://github.com/fmtlib/fmt/pull/2407).
+  Thanks @zx2c4, @AidanSun05, @mattiasljungstrom, @joemmett, @erengy,
+  @patlkli, @gsjaardema and @phprus.
+
+# 8.0.0 - 2021-06-21
+
+- Enabled compile-time format string checks by default. For example
+  ([godbolt](https://godbolt.org/z/sMxcohGjz)):
+
+  ```c++
+  #include <fmt/core.h>
+
+  int main() {
+    fmt::print("{:d}", "I am not a number");
+  }
+  ```
+
+  gives a compile-time error on compilers with C++20 `consteval`
+  support (gcc 10+, clang 11+) because `d` is not a valid format
+  specifier for a string.
+
+  To pass a runtime string wrap it in `fmt::runtime`:
+
+  ```c++
+  fmt::print(fmt::runtime("{:d}"), "I am not a number");
+  ```
+
+- Added compile-time formatting
+  (https://github.com/fmtlib/fmt/pull/2019,
+  https://github.com/fmtlib/fmt/pull/2044,
+  https://github.com/fmtlib/fmt/pull/2056,
+  https://github.com/fmtlib/fmt/pull/2072,
+  https://github.com/fmtlib/fmt/pull/2075,
+  https://github.com/fmtlib/fmt/issues/2078,
+  https://github.com/fmtlib/fmt/pull/2129,
+  https://github.com/fmtlib/fmt/pull/2326). For example
+  ([godbolt](https://godbolt.org/z/Mxx9d89jM)):
+
+  ```c++
+  #include <fmt/compile.h>
+
+  consteval auto compile_time_itoa(int value) -> std::array<char, 10> {
+    auto result = std::array<char, 10>();
+    fmt::format_to(result.data(), FMT_COMPILE("{}"), value);
+    return result;
+  }
+
+  constexpr auto answer = compile_time_itoa(42);
+  ```
+
+  Most of the formatting functionality is available at compile time
+  with a notable exception of floating-point numbers and pointers.
+  Thanks @alexezeder.
+
+- Optimized handling of format specifiers during format string
+  compilation. For example, hexadecimal formatting (`"{:x}"`) is now
+  3-7x faster than before when using `format_to` with format string
+  compilation and a stack-allocated buffer
+  (https://github.com/fmtlib/fmt/issues/1944).
+
+  Before (7.1.3):
+
+      ----------------------------------------------------------------------------
+      Benchmark                                  Time             CPU   Iterations
+      ----------------------------------------------------------------------------
+      FMTCompileOld/0                         15.5 ns         15.5 ns     43302898
+      FMTCompileOld/42                        16.6 ns         16.6 ns     43278267
+      FMTCompileOld/273123                    18.7 ns         18.6 ns     37035861
+      FMTCompileOld/9223372036854775807       19.4 ns         19.4 ns     35243000
+      ----------------------------------------------------------------------------
+
+  After (8.x):
+
+      ----------------------------------------------------------------------------
+      Benchmark                                  Time             CPU   Iterations
+      ----------------------------------------------------------------------------
+      FMTCompileNew/0                         1.99 ns         1.99 ns    360523686
+      FMTCompileNew/42                        2.33 ns         2.33 ns    279865664
+      FMTCompileNew/273123                    3.72 ns         3.71 ns    190230315
+      FMTCompileNew/9223372036854775807       5.28 ns         5.26 ns    130711631
+      ----------------------------------------------------------------------------
+
+  It is even faster than `std::to_chars` from libc++ compiled with
+  clang on macOS:
+
+      ----------------------------------------------------------------------------
+      Benchmark                                  Time             CPU   Iterations
+      ----------------------------------------------------------------------------
+      ToChars/0                               4.42 ns         4.41 ns    160196630
+      ToChars/42                              5.00 ns         4.98 ns    140735201
+      ToChars/273123                          7.26 ns         7.24 ns     95784130
+      ToChars/9223372036854775807             8.77 ns         8.75 ns     75872534
+      ----------------------------------------------------------------------------
+
+  In other cases, especially involving `std::string` construction, the
+  speed up is usually lower because handling format specifiers takes a
+  smaller fraction of the total time.
+
+- Added the `_cf` user-defined literal to represent a compiled format
+  string. It can be used instead of the `FMT_COMPILE` macro
+  (https://github.com/fmtlib/fmt/pull/2043,
+  https://github.com/fmtlib/fmt/pull/2242):
+
+  ```c++
+  #include <fmt/compile.h>
+
+  using namespace fmt::literals;
+  auto s = fmt::format(FMT_COMPILE("{}"), 42); // 🙁 not modern
+  auto s = fmt::format("{}"_cf, 42);           // 🙂 modern as hell
+  ```
+
+  It requires compiler support for class types in non-type template
+  parameters (a C++20 feature) which is available in GCC 9.3+.
+  Thanks @alexezeder.
+
+- Format string compilation now requires `format` functions of
+  `formatter` specializations for user-defined types to be `const`:
+
+  ```c++
+  template <> struct fmt::formatter<my_type>: formatter<string_view> {
+    template <typename FormatContext>
+    auto format(my_type obj, FormatContext& ctx) const {  // Note const here.
+      // ...
+    }
+  };
+  ```
+
+- Added UDL-based named argument support to format string compilation
+  (https://github.com/fmtlib/fmt/pull/2243,
+  https://github.com/fmtlib/fmt/pull/2281). For example:
+
+  ```c++
+  #include <fmt/compile.h>
+
+  using namespace fmt::literals;
+  auto s = fmt::format(FMT_COMPILE("{answer}"), "answer"_a = 42);
+  ```
+
+  Here the argument named \"answer\" is resolved at compile time with
+  no runtime overhead. Thanks @alexezeder.
+
+- Added format string compilation support to `fmt::print`
+  (https://github.com/fmtlib/fmt/issues/2280,
+  https://github.com/fmtlib/fmt/pull/2304). Thanks @alexezeder.
+
+- Added initial support for compiling {fmt} as a C++20 module
+  (https://github.com/fmtlib/fmt/pull/2235,
+  https://github.com/fmtlib/fmt/pull/2240,
+  https://github.com/fmtlib/fmt/pull/2260,
+  https://github.com/fmtlib/fmt/pull/2282,
+  https://github.com/fmtlib/fmt/pull/2283,
+  https://github.com/fmtlib/fmt/pull/2288,
+  https://github.com/fmtlib/fmt/pull/2298,
+  https://github.com/fmtlib/fmt/pull/2306,
+  https://github.com/fmtlib/fmt/pull/2307,
+  https://github.com/fmtlib/fmt/pull/2309,
+  https://github.com/fmtlib/fmt/pull/2318,
+  https://github.com/fmtlib/fmt/pull/2324,
+  https://github.com/fmtlib/fmt/pull/2332,
+  https://github.com/fmtlib/fmt/pull/2340). Thanks @DanielaE.
+
+- Made symbols private by default reducing shared library size
+  (https://github.com/fmtlib/fmt/pull/2301). For example
+  there was a \~15% reported reduction on one platform. Thanks @sergiud.
+
+- Optimized includes making the result of preprocessing `fmt/format.h`
+  \~20% smaller with libstdc++/C++20 and slightly improving build
+  times (https://github.com/fmtlib/fmt/issues/1998).
+
+- Added support of ranges with non-const `begin` / `end`
+  (https://github.com/fmtlib/fmt/pull/1953). Thanks @kitegi.
+
+- Added support of `std::byte` and other formattable types to
+  `fmt::join` (https://github.com/fmtlib/fmt/issues/1981,
+  https://github.com/fmtlib/fmt/issues/2040,
+  https://github.com/fmtlib/fmt/pull/2050,
+  https://github.com/fmtlib/fmt/issues/2262). For example:
+
+  ```c++
+  #include <fmt/format.h>
+  #include <cstddef>
+  #include <vector>
+
+  int main() {
+    auto bytes = std::vector{std::byte(4), std::byte(2)};
+    fmt::print("{}", fmt::join(bytes, ""));
+  }
+  ```
+
+  prints \"42\".
+
+  Thanks @kamibo.
+
+- Implemented the default format for `std::chrono::system_clock`
+  (https://github.com/fmtlib/fmt/issues/2319,
+  https://github.com/fmtlib/fmt/pull/2345). For example:
+
+  ```c++
+  #include <fmt/chrono.h>
+
+  int main() {
+    fmt::print("{}", std::chrono::system_clock::now());
+  }
+  ```
+
+  prints \"2021-06-18 15:22:00\" (the output depends on the current
+  date and time). Thanks @sunmy2019.
+
+- Made more chrono specifiers locale independent by default. Use the
+  `'L'` specifier to get localized formatting. For example:
+
+  ```c++
+  #include <fmt/chrono.h>
+
+  int main() {
+    std::locale::global(std::locale("ru_RU.UTF-8"));
+    auto monday = std::chrono::weekday(1);
+    fmt::print("{}\n", monday);   // prints "Mon"
+    fmt::print("{:L}\n", monday); // prints "пн"
+  }
+  ```
+
+- Improved locale handling in chrono formatting
+  (https://github.com/fmtlib/fmt/issues/2337,
+  https://github.com/fmtlib/fmt/pull/2349,
+  https://github.com/fmtlib/fmt/pull/2350). Thanks @phprus.
+
+- Deprecated `fmt/locale.h` moving the formatting functions that take
+  a locale to `fmt/format.h` (`char`) and `fmt/xchar` (other
+  overloads). This doesn\'t introduce a dependency on `<locale>` so
+  there is virtually no compile time effect.
+
+- Deprecated an undocumented `format_to` overload that takes
+  `basic_memory_buffer`.
+
+- Made parameter order in `vformat_to` consistent with `format_to`
+  (https://github.com/fmtlib/fmt/issues/2327).
+
+- Added support for time points with arbitrary durations
+  (https://github.com/fmtlib/fmt/issues/2208). For example:
+
+  ```c++
+  #include <fmt/chrono.h>
+
+  int main() {
+    using tp = std::chrono::time_point<
+      std::chrono::system_clock, std::chrono::seconds>;
+    fmt::print("{:%S}", tp(std::chrono::seconds(42)));
+  }
+  ```
+
+  prints \"42\".
+
+- Formatting floating-point numbers no longer produces trailing zeros
+  by default for consistency with `std::format`. For example:
+
+  ```c++
+  #include <fmt/core.h>
+
+  int main() {
+    fmt::print("{0:.3}", 1.1);
+  }
+  ```
+
+  prints \"1.1\". Use the `'#'` specifier to keep trailing zeros.
+
+- Dropped a limit on the number of elements in a range and replaced
+  `{}` with `[]` as range delimiters for consistency with Python\'s
+  `str.format`.
+
+- The `'L'` specifier for locale-specific numeric formatting can now
+  be combined with presentation specifiers as in `std::format`. For
+  example:
+
+  ```c++
+  #include <fmt/core.h>
+  #include <locale>
+
+  int main() {
+    std::locale::global(std::locale("fr_FR.UTF-8"));
+    fmt::print("{0:.2Lf}", 0.42);
+  }
+  ```
+
+  prints \"0,42\". The deprecated `'n'` specifier has been removed.
+
+- Made the `0` specifier ignored for infinity and NaN
+  (https://github.com/fmtlib/fmt/issues/2305,
+  https://github.com/fmtlib/fmt/pull/2310). Thanks @Liedtke.
+
+- Made the hexfloat formatting use the right alignment by default
+  (https://github.com/fmtlib/fmt/issues/2308,
+  https://github.com/fmtlib/fmt/pull/2317). Thanks @Liedtke.
+
+- Removed the deprecated numeric alignment (`'='`). Use the `'0'`
+  specifier instead.
+
+- Removed the deprecated `fmt/posix.h` header that has been replaced
+  with `fmt/os.h`.
+
+- Removed the deprecated `format_to_n_context`, `format_to_n_args` and
+  `make_format_to_n_args`. They have been replaced with
+  `format_context`, `` format_args` and ``make_format_args\`\`
+  respectively.
+
+- Moved `wchar_t`-specific functions and types to `fmt/xchar.h`. You
+  can define `FMT_DEPRECATED_INCLUDE_XCHAR` to automatically include
+  `fmt/xchar.h` from `fmt/format.h` but this will be disabled in the
+  next major release.
+
+- Fixed handling of the `'+'` specifier in localized formatting
+  (https://github.com/fmtlib/fmt/issues/2133).
+
+- Added support for the `'s'` format specifier that gives textual
+  representation of `bool`
+  (https://github.com/fmtlib/fmt/issues/2094,
+  https://github.com/fmtlib/fmt/pull/2109). For example:
+
+  ```c++
+  #include <fmt/core.h>
+
+  int main() {
+    fmt::print("{:s}", true);
+  }
+  ```
+
+  prints \"true\". Thanks @powercoderlol.
+
+- Made `fmt::ptr` work with function pointers
+  (https://github.com/fmtlib/fmt/pull/2131). For example:
+
+  ```c++
+  #include <fmt/format.h>
+
+  int main() {
+    fmt::print("My main: {}\n", fmt::ptr(main));
+  }
+  ```
+
+  Thanks @mikecrowe.
+
+- The undocumented support for specializing `formatter` for pointer
+  types has been removed.
+
+- Fixed `fmt::formatted_size` with format string compilation
+  (https://github.com/fmtlib/fmt/pull/2141,
+  https://github.com/fmtlib/fmt/pull/2161). Thanks @alexezeder.
+
+- Fixed handling of empty format strings during format string
+  compilation (https://github.com/fmtlib/fmt/issues/2042):
+
+  ```c++
+  auto s = fmt::format(FMT_COMPILE(""));
+  ```
+
+  Thanks @alexezeder.
+
+- Fixed handling of enums in `fmt::to_string`
+  (https://github.com/fmtlib/fmt/issues/2036).
+
+- Improved width computation
+  (https://github.com/fmtlib/fmt/issues/2033,
+  https://github.com/fmtlib/fmt/issues/2091). For example:
+
+  ```c++
+  #include <fmt/core.h>
+
+  int main() {
+    fmt::print("{:-<10}{}\n", "你好", "世界");
+    fmt::print("{:-<10}{}\n", "hello", "world");
+  }
+  ```
+
+  prints
+
+  ![](https://user-images.githubusercontent.com/576385/119840373-cea3ca80-beb9-11eb-91e0-54266c48e181.png)
+
+  on a modern terminal.
+
+- The experimental fast output stream (`fmt::ostream`) is now
+  truncated by default for consistency with `fopen`
+  (https://github.com/fmtlib/fmt/issues/2018). For example:
+
+  ```c++
+  #include <fmt/os.h>
+
+  int main() {
+    fmt::ostream out1 = fmt::output_file("guide");
+    out1.print("Zaphod");
+    out1.close();
+    fmt::ostream out2 = fmt::output_file("guide");
+    out2.print("Ford");
+  }
+  ```
+
+  writes \"Ford\" to the file \"guide\". To preserve the old file
+  content if any pass `fmt::file::WRONLY | fmt::file::CREATE` flags to
+  `fmt::output_file`.
+
+- Fixed moving of `fmt::ostream` that holds buffered data
+  (https://github.com/fmtlib/fmt/issues/2197,
+  https://github.com/fmtlib/fmt/pull/2198). Thanks @vtta.
+
+- Replaced the `fmt::system_error` exception with a function of the
+  same name that constructs `std::system_error`
+  (https://github.com/fmtlib/fmt/issues/2266).
+
+- Replaced the `fmt::windows_error` exception with a function of the
+  same name that constructs `std::system_error` with the category
+  returned by `fmt::system_category()`
+  (https://github.com/fmtlib/fmt/issues/2274,
+  https://github.com/fmtlib/fmt/pull/2275). The latter is
+  similar to `std::system_category` but correctly handles UTF-8.
+  Thanks @phprus.
+
+- Replaced `fmt::error_code` with `std::error_code` and made it
+  formattable (https://github.com/fmtlib/fmt/issues/2269,
+  https://github.com/fmtlib/fmt/pull/2270,
+  https://github.com/fmtlib/fmt/pull/2273). Thanks @phprus.
+
+- Added speech synthesis support
+  (https://github.com/fmtlib/fmt/pull/2206).
+
+- Made `format_to` work with a memory buffer that has a custom
+  allocator (https://github.com/fmtlib/fmt/pull/2300).
+  Thanks @voxmea.
+
+- Added `Allocator::max_size` support to `basic_memory_buffer`.
+  (https://github.com/fmtlib/fmt/pull/1960). Thanks @phprus.
+
+- Added wide string support to `fmt::join`
+  (https://github.com/fmtlib/fmt/pull/2236). Thanks @crbrz.
+
+- Made iterators passed to `formatter` specializations via a format
+  context satisfy C++20 `std::output_iterator` requirements
+  (https://github.com/fmtlib/fmt/issues/2156,
+  https://github.com/fmtlib/fmt/pull/2158,
+  https://github.com/fmtlib/fmt/issues/2195,
+  https://github.com/fmtlib/fmt/pull/2204). Thanks @randomnetcat.
+
+- Optimized the `printf` implementation
+  (https://github.com/fmtlib/fmt/pull/1982,
+  https://github.com/fmtlib/fmt/pull/1984,
+  https://github.com/fmtlib/fmt/pull/2016,
+  https://github.com/fmtlib/fmt/pull/2164).
+  Thanks @rimathia and @moiwi.
+
+- Improved detection of `constexpr` `char_traits`
+  (https://github.com/fmtlib/fmt/pull/2246,
+  https://github.com/fmtlib/fmt/pull/2257). Thanks @phprus.
+
+- Fixed writing to `stdout` when it is redirected to `NUL` on Windows
+  (https://github.com/fmtlib/fmt/issues/2080).
+
+- Fixed exception propagation from iterators
+  (https://github.com/fmtlib/fmt/issues/2097).
+
+- Improved `strftime` error handling
+  (https://github.com/fmtlib/fmt/issues/2238,
+  https://github.com/fmtlib/fmt/pull/2244). Thanks @yumeyao.
+
+- Stopped using deprecated GCC UDL template extension.
+
+- Added `fmt/args.h` to the install target
+  (https://github.com/fmtlib/fmt/issues/2096).
+
+- Error messages are now passed to assert when exceptions are disabled
+  (https://github.com/fmtlib/fmt/pull/2145). Thanks @NobodyXu.
+
+- Added the `FMT_MASTER_PROJECT` CMake option to control build and
+  install targets when {fmt} is included via `add_subdirectory`
+  (https://github.com/fmtlib/fmt/issues/2098,
+  https://github.com/fmtlib/fmt/pull/2100).
+  Thanks @randomizedthinking.
+
+- Improved build configuration
+  (https://github.com/fmtlib/fmt/pull/2026,
+  https://github.com/fmtlib/fmt/pull/2122).
+  Thanks @luncliff and @ibaned.
+
+- Fixed various warnings and compilation issues
+  (https://github.com/fmtlib/fmt/issues/1947,
+  https://github.com/fmtlib/fmt/pull/1959,
+  https://github.com/fmtlib/fmt/pull/1963,
+  https://github.com/fmtlib/fmt/pull/1965,
+  https://github.com/fmtlib/fmt/issues/1966,
+  https://github.com/fmtlib/fmt/pull/1974,
+  https://github.com/fmtlib/fmt/pull/1975,
+  https://github.com/fmtlib/fmt/pull/1990,
+  https://github.com/fmtlib/fmt/issues/2000,
+  https://github.com/fmtlib/fmt/pull/2001,
+  https://github.com/fmtlib/fmt/issues/2002,
+  https://github.com/fmtlib/fmt/issues/2004,
+  https://github.com/fmtlib/fmt/pull/2006,
+  https://github.com/fmtlib/fmt/pull/2009,
+  https://github.com/fmtlib/fmt/pull/2010,
+  https://github.com/fmtlib/fmt/issues/2038,
+  https://github.com/fmtlib/fmt/issues/2039,
+  https://github.com/fmtlib/fmt/issues/2047,
+  https://github.com/fmtlib/fmt/pull/2053,
+  https://github.com/fmtlib/fmt/issues/2059,
+  https://github.com/fmtlib/fmt/pull/2065,
+  https://github.com/fmtlib/fmt/pull/2067,
+  https://github.com/fmtlib/fmt/pull/2068,
+  https://github.com/fmtlib/fmt/pull/2073,
+  https://github.com/fmtlib/fmt/issues/2103,
+  https://github.com/fmtlib/fmt/issues/2105,
+  https://github.com/fmtlib/fmt/pull/2106,
+  https://github.com/fmtlib/fmt/pull/2107,
+  https://github.com/fmtlib/fmt/issues/2116,
+  https://github.com/fmtlib/fmt/pull/2117,
+  https://github.com/fmtlib/fmt/issues/2118,
+  https://github.com/fmtlib/fmt/pull/2119,
+  https://github.com/fmtlib/fmt/issues/2127,
+  https://github.com/fmtlib/fmt/pull/2128,
+  https://github.com/fmtlib/fmt/issues/2140,
+  https://github.com/fmtlib/fmt/issues/2142,
+  https://github.com/fmtlib/fmt/pull/2143,
+  https://github.com/fmtlib/fmt/pull/2144,
+  https://github.com/fmtlib/fmt/issues/2147,
+  https://github.com/fmtlib/fmt/issues/2148,
+  https://github.com/fmtlib/fmt/issues/2149,
+  https://github.com/fmtlib/fmt/pull/2152,
+  https://github.com/fmtlib/fmt/pull/2160,
+  https://github.com/fmtlib/fmt/issues/2170,
+  https://github.com/fmtlib/fmt/issues/2175,
+  https://github.com/fmtlib/fmt/issues/2176,
+  https://github.com/fmtlib/fmt/pull/2177,
+  https://github.com/fmtlib/fmt/issues/2178,
+  https://github.com/fmtlib/fmt/pull/2179,
+  https://github.com/fmtlib/fmt/issues/2180,
+  https://github.com/fmtlib/fmt/issues/2181,
+  https://github.com/fmtlib/fmt/pull/2183,
+  https://github.com/fmtlib/fmt/issues/2184,
+  https://github.com/fmtlib/fmt/issues/2185,
+  https://github.com/fmtlib/fmt/pull/2186,
+  https://github.com/fmtlib/fmt/pull/2187,
+  https://github.com/fmtlib/fmt/pull/2190,
+  https://github.com/fmtlib/fmt/pull/2192,
+  https://github.com/fmtlib/fmt/pull/2194,
+  https://github.com/fmtlib/fmt/pull/2205,
+  https://github.com/fmtlib/fmt/issues/2210,
+  https://github.com/fmtlib/fmt/pull/2211,
+  https://github.com/fmtlib/fmt/pull/2215,
+  https://github.com/fmtlib/fmt/pull/2216,
+  https://github.com/fmtlib/fmt/pull/2218,
+  https://github.com/fmtlib/fmt/pull/2220,
+  https://github.com/fmtlib/fmt/issues/2228,
+  https://github.com/fmtlib/fmt/pull/2229,
+  https://github.com/fmtlib/fmt/pull/2230,
+  https://github.com/fmtlib/fmt/issues/2233,
+  https://github.com/fmtlib/fmt/pull/2239,
+  https://github.com/fmtlib/fmt/issues/2248,
+  https://github.com/fmtlib/fmt/issues/2252,
+  https://github.com/fmtlib/fmt/pull/2253,
+  https://github.com/fmtlib/fmt/pull/2255,
+  https://github.com/fmtlib/fmt/issues/2261,
+  https://github.com/fmtlib/fmt/issues/2278,
+  https://github.com/fmtlib/fmt/issues/2284,
+  https://github.com/fmtlib/fmt/pull/2287,
+  https://github.com/fmtlib/fmt/pull/2289,
+  https://github.com/fmtlib/fmt/pull/2290,
+  https://github.com/fmtlib/fmt/pull/2293,
+  https://github.com/fmtlib/fmt/issues/2295,
+  https://github.com/fmtlib/fmt/pull/2296,
+  https://github.com/fmtlib/fmt/pull/2297,
+  https://github.com/fmtlib/fmt/issues/2311,
+  https://github.com/fmtlib/fmt/pull/2313,
+  https://github.com/fmtlib/fmt/pull/2315,
+  https://github.com/fmtlib/fmt/issues/2320,
+  https://github.com/fmtlib/fmt/pull/2321,
+  https://github.com/fmtlib/fmt/pull/2323,
+  https://github.com/fmtlib/fmt/issues/2328,
+  https://github.com/fmtlib/fmt/pull/2329,
+  https://github.com/fmtlib/fmt/pull/2333,
+  https://github.com/fmtlib/fmt/pull/2338,
+  https://github.com/fmtlib/fmt/pull/2341).
+  Thanks @darklukee, @fagg, @killerbot242, @jgopel, @yeswalrus, @Finkman,
+  @HazardyKnusperkeks, @dkavolis, @concatime, @chronoxor, @summivox, @yNeo,
+  @Apache-HB, @alexezeder, @toojays, @Brainy0207, @vadz, @imsherlock, @phprus,
+  @white238, @yafshar, @BillyDonahue, @jstaahl, @denchat, @DanielaE,
+  @ilyakurdyukov, @ilmai, @JessyDL, @sergiud, @mwinterb, @sven-herrmann,
+  @jmelas, @twoixter, @crbrz and @upsj.
+
+- Improved documentation
+  (https://github.com/fmtlib/fmt/issues/1986,
+  https://github.com/fmtlib/fmt/pull/2051,
+  https://github.com/fmtlib/fmt/issues/2057,
+  https://github.com/fmtlib/fmt/pull/2081,
+  https://github.com/fmtlib/fmt/issues/2084,
+  https://github.com/fmtlib/fmt/pull/2312).
+  Thanks @imba-tjd, @0x416c69 and @mordante.
+
+- Continuous integration and test improvements
+  (https://github.com/fmtlib/fmt/issues/1969,
+  https://github.com/fmtlib/fmt/pull/1991,
+  https://github.com/fmtlib/fmt/pull/2020,
+  https://github.com/fmtlib/fmt/pull/2110,
+  https://github.com/fmtlib/fmt/pull/2114,
+  https://github.com/fmtlib/fmt/issues/2196,
+  https://github.com/fmtlib/fmt/pull/2217,
+  https://github.com/fmtlib/fmt/pull/2247,
+  https://github.com/fmtlib/fmt/pull/2256,
+  https://github.com/fmtlib/fmt/pull/2336,
+  https://github.com/fmtlib/fmt/pull/2346).
+  Thanks @jgopel, @alexezeder and @DanielaE.
+
+The change log for versions 0.8.0 - 7.1.3 is available [here](
+doc/ChangeLog-old.md).
diff --git a/third_party/fmt/LICENSE b/third_party/fmt/LICENSE
index f0ec3db4..1cd1ef92 100644
--- a/third_party/fmt/LICENSE
+++ b/third_party/fmt/LICENSE
@@ -1,4 +1,4 @@
-Copyright (c) 2012 - present, Victor Zverovich
+Copyright (c) 2012 - present, Victor Zverovich and {fmt} contributors
 
 Permission is hereby granted, free of charge, to any person obtaining
 a copy of this software and associated documentation files (the
diff --git a/third_party/fmt/README.md b/third_party/fmt/README.md
new file mode 100644
index 00000000..5f9249d4
--- /dev/null
+++ b/third_party/fmt/README.md
@@ -0,0 +1,484 @@
+<img src="https://user-images.githubusercontent.com/576385/156254208-f5b743a9-88cf-439d-b0c0-923d53e8d551.png" alt="{fmt}" width="25%"/>
+
+[![image](https://github.com/fmtlib/fmt/workflows/linux/badge.svg)](https://github.com/fmtlib/fmt/actions?query=workflow%3Alinux)
+[![image](https://github.com/fmtlib/fmt/workflows/macos/badge.svg)](https://github.com/fmtlib/fmt/actions?query=workflow%3Amacos)
+[![image](https://github.com/fmtlib/fmt/workflows/windows/badge.svg)](https://github.com/fmtlib/fmt/actions?query=workflow%3Awindows)
+[![fmt is continuously fuzzed at oss-fuzz](https://oss-fuzz-build-logs.storage.googleapis.com/badges/fmt.svg)](https://bugs.chromium.org/p/oss-fuzz/issues/list?\%0Acolspec=ID%20Type%20Component%20Status%20Proj%20Reported%20Owner%20\%0ASummary&q=proj%3Dfmt&can=1)
+[![Ask questions at StackOverflow with the tag fmt](https://img.shields.io/badge/stackoverflow-fmt-blue.svg)](https://stackoverflow.com/questions/tagged/fmt)
+[![image](https://api.securityscorecards.dev/projects/github.com/fmtlib/fmt/badge)](https://securityscorecards.dev/viewer/?uri=github.com/fmtlib/fmt)
+
+**{fmt}** is an open-source formatting library providing a fast and safe
+alternative to C stdio and C++ iostreams.
+
+If you like this project, please consider donating to one of the funds
+that help victims of the war in Ukraine: <https://www.stopputin.net/>.
+
+[Documentation](https://fmt.dev)
+
+[Cheat Sheets](https://hackingcpp.com/cpp/libs/fmt.html)
+
+Q&A: ask questions on [StackOverflow with the tag
+fmt](https://stackoverflow.com/questions/tagged/fmt).
+
+Try {fmt} in [Compiler Explorer](https://godbolt.org/z/8Mx1EW73v).
+
+# Features
+
+- Simple [format API](https://fmt.dev/latest/api/) with positional
+  arguments for localization
+- Implementation of [C++20
+  std::format](https://en.cppreference.com/w/cpp/utility/format) and
+  [C++23 std::print](https://en.cppreference.com/w/cpp/io/print)
+- [Format string syntax](https://fmt.dev/latest/syntax/) similar
+  to Python\'s
+  [format](https://docs.python.org/3/library/stdtypes.html#str.format)
+- Fast IEEE 754 floating-point formatter with correct rounding,
+  shortness and round-trip guarantees using the
+  [Dragonbox](https://github.com/jk-jeon/dragonbox) algorithm
+- Portable Unicode support
+- Safe [printf
+  implementation](https://fmt.dev/latest/api/#printf-formatting)
+  including the POSIX extension for positional arguments
+- Extensibility: [support for user-defined
+  types](https://fmt.dev/latest/api/#formatting-user-defined-types)
+- High performance: faster than common standard library
+  implementations of `(s)printf`, iostreams, `to_string` and
+  `to_chars`, see [Speed tests](#speed-tests) and [Converting a
+  hundred million integers to strings per
+  second](http://www.zverovich.net/2020/06/13/fast-int-to-string-revisited.html)
+- Small code size both in terms of source code with the minimum
+  configuration consisting of just three files, `core.h`, `format.h`
+  and `format-inl.h`, and compiled code; see [Compile time and code
+  bloat](#compile-time-and-code-bloat)
+- Reliability: the library has an extensive set of
+  [tests](https://github.com/fmtlib/fmt/tree/master/test) and is
+  [continuously fuzzed](https://bugs.chromium.org/p/oss-fuzz/issues/list?colspec=ID%20Type%20Component%20Status%20Proj%20Reported%20Owner%20Summary&q=proj%3Dfmt&can=1)
+- Safety: the library is fully type-safe, errors in format strings can
+  be reported at compile time, automatic memory management prevents
+  buffer overflow errors
+- Ease of use: small self-contained code base, no external
+  dependencies, permissive MIT
+  [license](https://github.com/fmtlib/fmt/blob/master/LICENSE)
+- [Portability](https://fmt.dev/latest/#portability) with
+  consistent output across platforms and support for older compilers
+- Clean warning-free codebase even on high warning levels such as
+  `-Wall -Wextra -pedantic`
+- Locale independence by default
+- Optional header-only configuration enabled with the
+  `FMT_HEADER_ONLY` macro
+
+See the [documentation](https://fmt.dev) for more details.
+
+# Examples
+
+**Print to stdout** ([run](https://godbolt.org/z/Tevcjh))
+
+``` c++
+#include <fmt/core.h>
+
+int main() {
+  fmt::print("Hello, world!\n");
+}
+```
+
+**Format a string** ([run](https://godbolt.org/z/oK8h33))
+
+``` c++
+std::string s = fmt::format("The answer is {}.", 42);
+// s == "The answer is 42."
+```
+
+**Format a string using positional arguments**
+([run](https://godbolt.org/z/Yn7Txe))
+
+``` c++
+std::string s = fmt::format("I'd rather be {1} than {0}.", "right", "happy");
+// s == "I'd rather be happy than right."
+```
+
+**Print dates and times** ([run](https://godbolt.org/z/c31ExdY3W))
+
+``` c++
+#include <fmt/chrono.h>
+
+int main() {
+  auto now = std::chrono::system_clock::now();
+  fmt::print("Date and time: {}\n", now);
+  fmt::print("Time: {:%H:%M}\n", now);
+}
+```
+
+Output:
+
+    Date and time: 2023-12-26 19:10:31.557195597
+    Time: 19:10
+
+**Print a container** ([run](https://godbolt.org/z/MxM1YqjE7))
+
+``` c++
+#include <vector>
+#include <fmt/ranges.h>
+
+int main() {
+  std::vector<int> v = {1, 2, 3};
+  fmt::print("{}\n", v);
+}
+```
+
+Output:
+
+    [1, 2, 3]
+
+**Check a format string at compile time**
+
+``` c++
+std::string s = fmt::format("{:d}", "I am not a number");
+```
+
+This gives a compile-time error in C++20 because `d` is an invalid
+format specifier for a string.
+
+**Write a file from a single thread**
+
+``` c++
+#include <fmt/os.h>
+
+int main() {
+  auto out = fmt::output_file("guide.txt");
+  out.print("Don't {}", "Panic");
+}
+```
+
+This can be [5 to 9 times faster than
+fprintf](http://www.zverovich.net/2020/08/04/optimal-file-buffer-size.html).
+
+**Print with colors and text styles**
+
+``` c++
+#include <fmt/color.h>
+
+int main() {
+  fmt::print(fg(fmt::color::crimson) | fmt::emphasis::bold,
+             "Hello, {}!\n", "world");
+  fmt::print(fg(fmt::color::floral_white) | bg(fmt::color::slate_gray) |
+             fmt::emphasis::underline, "Olá, {}!\n", "Mundo");
+  fmt::print(fg(fmt::color::steel_blue) | fmt::emphasis::italic,
+             "你好{}！\n", "世界");
+}
+```
+
+Output on a modern terminal with Unicode support:
+
+![image](https://github.com/fmtlib/fmt/assets/%0A576385/2a93c904-d6fa-4aa6-b453-2618e1c327d7)
+
+# Benchmarks
+
+## Speed tests
+
+| Library           | Method        | Run Time, s |
+|-------------------|---------------|-------------|
+| libc              | printf        |   0.91      |
+| libc++            | std::ostream  |   2.49      |
+| {fmt} 9.1         | fmt::print    |   0.74      |
+| Boost Format 1.80 | boost::format |   6.26      |
+| Folly Format      | folly::format |   1.87      |
+
+{fmt} is the fastest of the benchmarked methods, \~20% faster than
+`printf`.
+
+The above results were generated by building `tinyformat_test.cpp` on
+macOS 12.6.1 with `clang++ -O3 -DNDEBUG -DSPEED_TEST -DHAVE_FORMAT`, and
+taking the best of three runs. In the test, the format string
+`"%0.10f:%04d:%+g:%s:%p:%c:%%\n"` or equivalent is filled 2,000,000
+times with output sent to `/dev/null`; for further details refer to the
+[source](https://github.com/fmtlib/format-benchmark/blob/master/src/tinyformat-test.cc).
+
+{fmt} is up to 20-30x faster than `std::ostringstream` and `sprintf` on
+IEEE754 `float` and `double` formatting
+([dtoa-benchmark](https://github.com/fmtlib/dtoa-benchmark)) and faster
+than [double-conversion](https://github.com/google/double-conversion)
+and [ryu](https://github.com/ulfjack/ryu):
+
+[![image](https://user-images.githubusercontent.com/576385/95684665-11719600-0ba8-11eb-8e5b-972ff4e49428.png)](https://fmt.dev/unknown_mac64_clang12.0.html)
+
+## Compile time and code bloat
+
+The script [bloat-test.py][test] from [format-benchmark][bench] tests compile
+time and code bloat for nontrivial projects. It generates 100 translation units
+and uses `printf()` or its alternative five times in each to simulate a
+medium-sized project. The resulting executable size and compile time (Apple
+clang version 15.0.0 (clang-1500.1.0.2.5), macOS Sonoma, best of three) is shown
+in the following tables.
+
+[test]: https://github.com/fmtlib/format-benchmark/blob/master/bloat-test.py
+[bench]: https://github.com/fmtlib/format-benchmark
+
+**Optimized build (-O3)**
+
+| Method        | Compile Time, s | Executable size, KiB | Stripped size, KiB |
+|---------------|-----------------|----------------------|--------------------|
+| printf        |             1.6 |                   54 |                 50 |
+| IOStreams     |            25.9 |                   98 |                 84 |
+| fmt 83652df   |             4.8 |                   54 |                 50 |
+| tinyformat    |            29.1 |                  161 |                136 |
+| Boost Format  |            55.0 |                  530 |                317 |
+
+{fmt} is fast to compile and is comparable to `printf` in terms of per-call
+binary size (within a rounding error on this system).
+
+**Non-optimized build**
+
+| Method        | Compile Time, s | Executable size, KiB | Stripped size, KiB |
+|---------------|-----------------|----------------------|--------------------|
+| printf        |             1.4 |                   54 |                 50 |
+| IOStreams     |            23.4 |                   92 |                 68 |
+| {fmt} 83652df |             4.4 |                   89 |                 85 |
+| tinyformat    |            24.5 |                  204 |                161 |
+| Boost Format  |            36.4 |                  831 |                462 |
+
+`libc`, `lib(std)c++`, and `libfmt` are all linked as shared libraries
+to compare formatting function overhead only. Boost Format is a
+header-only library so it doesn\'t provide any linkage options.
+
+## Running the tests
+
+Please refer to [Building the
+library](https://fmt.dev/latest/get-started/#building-from-source) for
+instructions on how to build the library and run the unit tests.
+
+Benchmarks reside in a separate repository,
+[format-benchmarks](https://github.com/fmtlib/format-benchmark), so to
+run the benchmarks you first need to clone this repository and generate
+Makefiles with CMake:
+
+    $ git clone --recursive https://github.com/fmtlib/format-benchmark.git
+    $ cd format-benchmark
+    $ cmake .
+
+Then you can run the speed test:
+
+    $ make speed-test
+
+or the bloat test:
+
+    $ make bloat-test
+
+# Migrating code
+
+[clang-tidy](https://clang.llvm.org/extra/clang-tidy/) v18 provides the
+[modernize-use-std-print](https://clang.llvm.org/extra/clang-tidy/checks/modernize/use-std-print.html)
+check that is capable of converting occurrences of `printf` and
+`fprintf` to `fmt::print` if configured to do so. (By default it
+converts to `std::print`.)
+
+# Notable projects using this library
+
+- [0 A.D.](https://play0ad.com/): a free, open-source, cross-platform
+  real-time strategy game
+- [AMPL/MP](https://github.com/ampl/mp): an open-source library for
+  mathematical programming
+- [Apple's FoundationDB](https://github.com/apple/foundationdb): an open-source,
+  distributed, transactional key-value store
+- [Aseprite](https://github.com/aseprite/aseprite): animated sprite
+  editor & pixel art tool
+- [AvioBook](https://www.aviobook.aero/en): a comprehensive aircraft
+  operations suite
+- [Blizzard Battle.net](https://battle.net/): an online gaming
+  platform
+- [Celestia](https://celestia.space/): real-time 3D visualization of
+  space
+- [Ceph](https://ceph.com/): a scalable distributed storage system
+- [ccache](https://ccache.dev/): a compiler cache
+- [ClickHouse](https://github.com/ClickHouse/ClickHouse): an
+  analytical database management system
+- [Contour](https://github.com/contour-terminal/contour/): a modern
+  terminal emulator
+- [CUAUV](https://cuauv.org/): Cornell University\'s autonomous
+  underwater vehicle
+- [Drake](https://drake.mit.edu/): a planning, control, and analysis
+  toolbox for nonlinear dynamical systems (MIT)
+- [Envoy](https://github.com/envoyproxy/envoy): C++ L7 proxy and
+  communication bus (Lyft)
+- [FiveM](https://fivem.net/): a modification framework for GTA V
+- [fmtlog](https://github.com/MengRao/fmtlog): a performant
+  fmtlib-style logging library with latency in nanoseconds
+- [Folly](https://github.com/facebook/folly): Facebook open-source
+  library
+- [GemRB](https://gemrb.org/): a portable open-source implementation
+  of Bioware's Infinity Engine
+- [Grand Mountain
+  Adventure](https://store.steampowered.com/app/1247360/Grand_Mountain_Adventure/):
+  a beautiful open-world ski & snowboarding game
+- [HarpyWar/pvpgn](https://github.com/pvpgn/pvpgn-server): Player vs
+  Player Gaming Network with tweaks
+- [KBEngine](https://github.com/kbengine/kbengine): an open-source
+  MMOG server engine
+- [Keypirinha](https://keypirinha.com/): a semantic launcher for
+  Windows
+- [Kodi](https://kodi.tv/) (formerly xbmc): home theater software
+- [Knuth](https://kth.cash/): high-performance Bitcoin full-node
+- [libunicode](https://github.com/contour-terminal/libunicode/): a
+  modern C++17 Unicode library
+- [MariaDB](https://mariadb.org/): relational database management
+  system
+- [Microsoft Verona](https://github.com/microsoft/verona): research
+  programming language for concurrent ownership
+- [MongoDB](https://mongodb.com/): distributed document database
+- [MongoDB Smasher](https://github.com/duckie/mongo_smasher): a small
+  tool to generate randomized datasets
+- [OpenSpace](https://openspaceproject.com/): an open-source
+  astrovisualization framework
+- [PenUltima Online (POL)](https://www.polserver.com/): an MMO server,
+  compatible with most Ultima Online clients
+- [PyTorch](https://github.com/pytorch/pytorch): an open-source
+  machine learning library
+- [quasardb](https://www.quasardb.net/): a distributed,
+  high-performance, associative database
+- [Quill](https://github.com/odygrd/quill): asynchronous low-latency
+  logging library
+- [QKW](https://github.com/ravijanjam/qkw): generalizing aliasing to
+  simplify navigation, and execute complex multi-line terminal
+  command sequences
+- [redis-cerberus](https://github.com/HunanTV/redis-cerberus): a Redis
+  cluster proxy
+- [redpanda](https://vectorized.io/redpanda): a 10x faster Kafka®
+  replacement for mission-critical systems written in C++
+- [rpclib](http://rpclib.net/): a modern C++ msgpack-RPC server and
+  client library
+- [Salesforce Analytics
+  Cloud](https://www.salesforce.com/analytics-cloud/overview/):
+  business intelligence software
+- [Scylla](https://www.scylladb.com/): a Cassandra-compatible NoSQL
+  data store that can handle 1 million transactions per second on a
+  single server
+- [Seastar](http://www.seastar-project.org/): an advanced, open-source
+  C++ framework for high-performance server applications on modern
+  hardware
+- [spdlog](https://github.com/gabime/spdlog): super fast C++ logging
+  library
+- [Stellar](https://www.stellar.org/): financial platform
+- [Touch Surgery](https://www.touchsurgery.com/): surgery simulator
+- [TrinityCore](https://github.com/TrinityCore/TrinityCore):
+  open-source MMORPG framework
+- [🐙 userver framework](https://userver.tech/): open-source
+  asynchronous framework with a rich set of abstractions and database
+  drivers
+- [Windows Terminal](https://github.com/microsoft/terminal): the new
+  Windows terminal
+
+[More\...](https://github.com/search?q=fmtlib&type=Code)
+
+If you are aware of other projects using this library, please let me
+know by [email](mailto:victor.zverovich@gmail.com) or by submitting an
+[issue](https://github.com/fmtlib/fmt/issues).
+
+# Motivation
+
+So why yet another formatting library?
+
+There are plenty of methods for doing this task, from standard ones like
+the printf family of function and iostreams to Boost Format and
+FastFormat libraries. The reason for creating a new library is that
+every existing solution that I found either had serious issues or
+didn\'t provide all the features I needed.
+
+## printf
+
+The good thing about `printf` is that it is pretty fast and readily
+available being a part of the C standard library. The main drawback is
+that it doesn\'t support user-defined types. `printf` also has safety
+issues although they are somewhat mitigated with [\_\_attribute\_\_
+((format (printf,
+\...))](https://gcc.gnu.org/onlinedocs/gcc/Function-Attributes.html) in
+GCC. There is a POSIX extension that adds positional arguments required
+for
+[i18n](https://en.wikipedia.org/wiki/Internationalization_and_localization)
+to `printf` but it is not a part of C99 and may not be available on some
+platforms.
+
+## iostreams
+
+The main issue with iostreams is best illustrated with an example:
+
+``` c++
+std::cout << std::setprecision(2) << std::fixed << 1.23456 << "\n";
+```
+
+which is a lot of typing compared to printf:
+
+``` c++
+printf("%.2f\n", 1.23456);
+```
+
+Matthew Wilson, the author of FastFormat, called this \"chevron hell\".
+iostreams don\'t support positional arguments by design.
+
+The good part is that iostreams support user-defined types and are safe
+although error handling is awkward.
+
+## Boost Format
+
+This is a very powerful library that supports both `printf`-like format
+strings and positional arguments. Its main drawback is performance.
+According to various benchmarks, it is much slower than other methods
+considered here. Boost Format also has excessive build times and severe
+code bloat issues (see [Benchmarks](#benchmarks)).
+
+## FastFormat
+
+This is an interesting library that is fast, safe and has positional
+arguments. However, it has significant limitations, citing its author:
+
+> Three features that have no hope of being accommodated within the
+> current design are:
+>
+> - Leading zeros (or any other non-space padding)
+> - Octal/hexadecimal encoding
+> - Runtime width/alignment specification
+
+It is also quite big and has a heavy dependency, on STLSoft, which might be
+too restrictive for use in some projects.
+
+## Boost Spirit.Karma
+
+This is not a formatting library but I decided to include it here for
+completeness. As iostreams, it suffers from the problem of mixing
+verbatim text with arguments. The library is pretty fast, but slower on
+integer formatting than `fmt::format_to` with format string compilation
+on Karma\'s own benchmark, see [Converting a hundred million integers to
+strings per
+second](http://www.zverovich.net/2020/06/13/fast-int-to-string-revisited.html).
+
+# License
+
+{fmt} is distributed under the MIT
+[license](https://github.com/fmtlib/fmt/blob/master/LICENSE).
+
+# Documentation License
+
+The [Format String Syntax](https://fmt.dev/latest/syntax/) section
+in the documentation is based on the one from Python [string module
+documentation](https://docs.python.org/3/library/string.html#module-string).
+For this reason, the documentation is distributed under the Python
+Software Foundation license available in
+[doc/python-license.txt](https://raw.github.com/fmtlib/fmt/master/doc/python-license.txt).
+It only applies if you distribute the documentation of {fmt}.
+
+# Maintainers
+
+The {fmt} library is maintained by Victor Zverovich
+([vitaut](https://github.com/vitaut)) with contributions from many other
+people. See
+[Contributors](https://github.com/fmtlib/fmt/graphs/contributors) and
+[Releases](https://github.com/fmtlib/fmt/releases) for some of the
+names. Let us know if your contribution is not listed or mentioned
+incorrectly and we\'ll make it right.
+
+# Security Policy
+
+To report a security issue, please disclose it at [security
+advisory](https://github.com/fmtlib/fmt/security/advisories/new).
+
+This project is maintained by a team of volunteers on a
+reasonable-effort basis. As such, please give us at least *90* days to
+work on a fix before public exposure.
diff --git a/third_party/fmt/format.cc b/third_party/fmt/format.cc
deleted file mode 100644
index da78bb26..00000000
--- a/third_party/fmt/format.cc
+++ /dev/null
@@ -1,166 +0,0 @@
-// Formatting library for C++
-//
-// Copyright (c) 2012 - 2016, Victor Zverovich
-// All rights reserved.
-//
-// For the license information refer to format.h.
-
-#include "fmt/format-inl.h"
-
-FMT_BEGIN_NAMESPACE
-namespace internal {
-
-template <typename T>
-int format_float(char* buf, std::size_t size, const char* format, int precision, T value) {
-#ifdef FUZZING_BUILD_MODE_UNSAFE_FOR_PRODUCTION
-	if (precision > 100000)
-		throw std::runtime_error("fuzz mode - avoid large allocation inside snprintf");
-#endif
-	// Suppress the warning about nonliteral format string.
-	auto snprintf_ptr = FMT_SNPRINTF;
-	return precision < 0 ? snprintf_ptr(buf, size, format, value) : snprintf_ptr(buf, size, format, precision, value);
-}
-
-struct sprintf_specs {
-	int precision;
-	char type;
-	bool alt : 1;
-
-	template <typename Char>
-	constexpr sprintf_specs(basic_format_specs<Char> specs)
-	    : precision(specs.precision), type(specs.type), alt(specs.alt) {
-	}
-
-	constexpr bool has_precision() const {
-		return precision >= 0;
-	}
-};
-
-// This is deprecated and is kept only to preserve ABI compatibility.
-template <typename Double>
-char* sprintf_format(Double value, internal::buffer<char>& buf, sprintf_specs specs) {
-	// Buffer capacity must be non-zero, otherwise MSVC's vsnprintf_s will fail.
-	FMT_ASSERT(buf.capacity() != 0, "empty buffer");
-
-	// Build format string.
-	enum { max_format_size = 10 }; // longest format: %#-*.*Lg
-	char format[max_format_size];
-	char* format_ptr = format;
-	*format_ptr++ = '%';
-	if (specs.alt || !specs.type)
-		*format_ptr++ = '#';
-	if (specs.precision >= 0) {
-		*format_ptr++ = '.';
-		*format_ptr++ = '*';
-	}
-	if (std::is_same<Double, long double>::value)
-		*format_ptr++ = 'L';
-
-	char type = specs.type;
-
-	if (type == '%')
-		type = 'f';
-	else if (type == 0 || type == 'n')
-		type = 'g';
-#if FMT_MSC_VER
-	if (type == 'F') {
-		// MSVC's printf doesn't support 'F'.
-		type = 'f';
-	}
-#endif
-	*format_ptr++ = type;
-	*format_ptr = '\0';
-
-	// Format using snprintf.
-	char* start = nullptr;
-	char* decimal_point_pos = nullptr;
-	for (;;) {
-		std::size_t buffer_size = buf.capacity();
-		start = &buf[0];
-		int result = format_float(start, buffer_size, format, specs.precision, value);
-		if (result >= 0) {
-			unsigned n = internal::to_unsigned(result);
-			if (n < buf.capacity()) {
-				// Find the decimal point.
-				auto p = buf.data(), end = p + n;
-				if (*p == '+' || *p == '-')
-					++p;
-				if (specs.type != 'a' && specs.type != 'A') {
-					while (p < end && *p >= '0' && *p <= '9')
-						++p;
-					if (p < end && *p != 'e' && *p != 'E') {
-						decimal_point_pos = p;
-						if (!specs.type) {
-							// Keep only one trailing zero after the decimal point.
-							++p;
-							if (*p == '0')
-								++p;
-							while (p != end && *p >= '1' && *p <= '9')
-								++p;
-							char* where = p;
-							while (p != end && *p == '0')
-								++p;
-							if (p == end || *p < '0' || *p > '9') {
-								if (p != end)
-									std::memmove(where, p, to_unsigned(end - p));
-								n -= static_cast<unsigned>(p - where);
-							}
-						}
-					}
-				}
-				buf.resize(n);
-				break; // The buffer is large enough - continue with formatting.
-			}
-			buf.reserve(n + 1);
-		} else {
-			// If result is negative we ask to increase the capacity by at least 1,
-			// but as std::vector, the buffer grows exponentially.
-			buf.reserve(buf.capacity() + 1);
-		}
-	}
-	return decimal_point_pos;
-}
-} // namespace internal
-
-template FMT_API char* internal::sprintf_format(double, internal::buffer<char>&, sprintf_specs);
-
-template FMT_API char* internal::sprintf_format(long double, internal::buffer<char>&, sprintf_specs);
-
-template struct FMT_API internal::basic_data<void>;
-
-// Workaround a bug in MSVC2013 that prevents instantiation of format_float.
-int (*instantiate_format_float)(double, int, internal::float_specs, internal::buffer<char>&) = internal::format_float;
-
-// Explicit instantiations for char.
-
-template FMT_API std::string internal::grouping_impl<char>(locale_ref);
-template FMT_API char internal::thousands_sep_impl(locale_ref);
-template FMT_API char internal::decimal_point_impl(locale_ref);
-
-template FMT_API void internal::buffer<char>::append(const char*, const char*);
-
-template FMT_API void internal::arg_map<format_context>::init(const basic_format_args<format_context>& args);
-
-template FMT_API std::string internal::vformat<char>(string_view, basic_format_args<format_context>);
-
-template FMT_API format_context::iterator internal::vformat_to(internal::buffer<char>&, string_view,
-                                                               basic_format_args<format_context>);
-
-template FMT_API int internal::snprintf_float(double, int, internal::float_specs, internal::buffer<char>&);
-
-template FMT_API int internal::snprintf_float(long double, int, internal::float_specs, internal::buffer<char>&);
-
-template FMT_API int internal::format_float(double, int, internal::float_specs, internal::buffer<char>&);
-
-template FMT_API int internal::format_float(long double, int, internal::float_specs, internal::buffer<char>&);
-
-// Explicit instantiations for wchar_t.
-
-template FMT_API std::string internal::grouping_impl<wchar_t>(locale_ref);
-template FMT_API wchar_t internal::thousands_sep_impl(locale_ref);
-template FMT_API wchar_t internal::decimal_point_impl(locale_ref);
-
-template FMT_API void internal::buffer<wchar_t>::append(const wchar_t*, const wchar_t*);
-
-template FMT_API std::wstring internal::vformat<wchar_t>(wstring_view, basic_format_args<wformat_context>);
-FMT_END_NAMESPACE
diff --git a/third_party/fmt/include/fmt/args.h b/third_party/fmt/include/fmt/args.h
new file mode 100644
index 00000000..31a60e8f
--- /dev/null
+++ b/third_party/fmt/include/fmt/args.h
@@ -0,0 +1,228 @@
+// Formatting library for C++ - dynamic argument lists
+//
+// Copyright (c) 2012 - present, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_ARGS_H_
+#define FMT_ARGS_H_
+
+#ifndef FMT_MODULE
+#  include <functional>  // std::reference_wrapper
+#  include <memory>      // std::unique_ptr
+#  include <vector>
+#endif
+
+#include "format.h"  // std_string_view
+
+FMT_BEGIN_NAMESPACE
+
+namespace detail {
+
+template <typename T> struct is_reference_wrapper : std::false_type {};
+template <typename T>
+struct is_reference_wrapper<std::reference_wrapper<T>> : std::true_type {};
+
+template <typename T> auto unwrap(const T& v) -> const T& { return v; }
+template <typename T>
+auto unwrap(const std::reference_wrapper<T>& v) -> const T& {
+  return static_cast<const T&>(v);
+}
+
+// node is defined outside dynamic_arg_list to workaround a C2504 bug in MSVC
+// 2022 (v17.10.0).
+//
+// Workaround for clang's -Wweak-vtables. Unlike for regular classes, for
+// templates it doesn't complain about inability to deduce single translation
+// unit for placing vtable. So node is made a fake template.
+template <typename = void> struct node {
+  virtual ~node() = default;
+  std::unique_ptr<node<>> next;
+};
+
+class dynamic_arg_list {
+  template <typename T> struct typed_node : node<> {
+    T value;
+
+    template <typename Arg>
+    FMT_CONSTEXPR typed_node(const Arg& arg) : value(arg) {}
+
+    template <typename Char>
+    FMT_CONSTEXPR typed_node(const basic_string_view<Char>& arg)
+        : value(arg.data(), arg.size()) {}
+  };
+
+  std::unique_ptr<node<>> head_;
+
+ public:
+  template <typename T, typename Arg> auto push(const Arg& arg) -> const T& {
+    auto new_node = std::unique_ptr<typed_node<T>>(new typed_node<T>(arg));
+    auto& value = new_node->value;
+    new_node->next = std::move(head_);
+    head_ = std::move(new_node);
+    return value;
+  }
+};
+}  // namespace detail
+
+/**
+ * A dynamic list of formatting arguments with storage.
+ *
+ * It can be implicitly converted into `fmt::basic_format_args` for passing
+ * into type-erased formatting functions such as `fmt::vformat`.
+ */
+template <typename Context>
+class dynamic_format_arg_store
+#if FMT_GCC_VERSION && FMT_GCC_VERSION < 409
+    // Workaround a GCC template argument substitution bug.
+    : public basic_format_args<Context>
+#endif
+{
+ private:
+  using char_type = typename Context::char_type;
+
+  template <typename T> struct need_copy {
+    static constexpr detail::type mapped_type =
+        detail::mapped_type_constant<T, Context>::value;
+
+    enum {
+      value = !(detail::is_reference_wrapper<T>::value ||
+                std::is_same<T, basic_string_view<char_type>>::value ||
+                std::is_same<T, detail::std_string_view<char_type>>::value ||
+                (mapped_type != detail::type::cstring_type &&
+                 mapped_type != detail::type::string_type &&
+                 mapped_type != detail::type::custom_type))
+    };
+  };
+
+  template <typename T>
+  using stored_type = conditional_t<
+      std::is_convertible<T, std::basic_string<char_type>>::value &&
+          !detail::is_reference_wrapper<T>::value,
+      std::basic_string<char_type>, T>;
+
+  // Storage of basic_format_arg must be contiguous.
+  std::vector<basic_format_arg<Context>> data_;
+  std::vector<detail::named_arg_info<char_type>> named_info_;
+
+  // Storage of arguments not fitting into basic_format_arg must grow
+  // without relocation because items in data_ refer to it.
+  detail::dynamic_arg_list dynamic_args_;
+
+  friend class basic_format_args<Context>;
+
+  auto get_types() const -> unsigned long long {
+    return detail::is_unpacked_bit | data_.size() |
+           (named_info_.empty()
+                ? 0ULL
+                : static_cast<unsigned long long>(detail::has_named_args_bit));
+  }
+
+  auto data() const -> const basic_format_arg<Context>* {
+    return named_info_.empty() ? data_.data() : data_.data() + 1;
+  }
+
+  template <typename T> void emplace_arg(const T& arg) {
+    data_.emplace_back(detail::make_arg<Context>(arg));
+  }
+
+  template <typename T>
+  void emplace_arg(const detail::named_arg<char_type, T>& arg) {
+    if (named_info_.empty()) {
+      constexpr const detail::named_arg_info<char_type>* zero_ptr{nullptr};
+      data_.insert(data_.begin(), {zero_ptr, 0});
+    }
+    data_.emplace_back(detail::make_arg<Context>(detail::unwrap(arg.value)));
+    auto pop_one = [](std::vector<basic_format_arg<Context>>* data) {
+      data->pop_back();
+    };
+    std::unique_ptr<std::vector<basic_format_arg<Context>>, decltype(pop_one)>
+        guard{&data_, pop_one};
+    named_info_.push_back({arg.name, static_cast<int>(data_.size() - 2u)});
+    data_[0].value_.named_args = {named_info_.data(), named_info_.size()};
+    guard.release();
+  }
+
+ public:
+  constexpr dynamic_format_arg_store() = default;
+
+  /**
+   * Adds an argument into the dynamic store for later passing to a formatting
+   * function.
+   *
+   * Note that custom types and string types (but not string views) are copied
+   * into the store dynamically allocating memory if necessary.
+   *
+   * **Example**:
+   *
+   *     fmt::dynamic_format_arg_store<fmt::format_context> store;
+   *     store.push_back(42);
+   *     store.push_back("abc");
+   *     store.push_back(1.5f);
+   *     std::string result = fmt::vformat("{} and {} and {}", store);
+   */
+  template <typename T> void push_back(const T& arg) {
+    if (detail::const_check(need_copy<T>::value))
+      emplace_arg(dynamic_args_.push<stored_type<T>>(arg));
+    else
+      emplace_arg(detail::unwrap(arg));
+  }
+
+  /**
+   * Adds a reference to the argument into the dynamic store for later passing
+   * to a formatting function.
+   *
+   * **Example**:
+   *
+   *     fmt::dynamic_format_arg_store<fmt::format_context> store;
+   *     char band[] = "Rolling Stones";
+   *     store.push_back(std::cref(band));
+   *     band[9] = 'c'; // Changing str affects the output.
+   *     std::string result = fmt::vformat("{}", store);
+   *     // result == "Rolling Scones"
+   */
+  template <typename T> void push_back(std::reference_wrapper<T> arg) {
+    static_assert(
+        need_copy<T>::value,
+        "objects of built-in types and string views are always copied");
+    emplace_arg(arg.get());
+  }
+
+  /**
+   * Adds named argument into the dynamic store for later passing to a
+   * formatting function. `std::reference_wrapper` is supported to avoid
+   * copying of the argument. The name is always copied into the store.
+   */
+  template <typename T>
+  void push_back(const detail::named_arg<char_type, T>& arg) {
+    const char_type* arg_name =
+        dynamic_args_.push<std::basic_string<char_type>>(arg.name).c_str();
+    if (detail::const_check(need_copy<T>::value)) {
+      emplace_arg(
+          fmt::arg(arg_name, dynamic_args_.push<stored_type<T>>(arg.value)));
+    } else {
+      emplace_arg(fmt::arg(arg_name, arg.value));
+    }
+  }
+
+  /// Erase all elements from the store.
+  void clear() {
+    data_.clear();
+    named_info_.clear();
+    dynamic_args_ = detail::dynamic_arg_list();
+  }
+
+  /// Reserves space to store at least `new_cap` arguments including
+  /// `new_cap_named` named arguments.
+  void reserve(size_t new_cap, size_t new_cap_named) {
+    FMT_ASSERT(new_cap >= new_cap_named,
+               "Set of arguments includes set of named arguments");
+    data_.reserve(new_cap);
+    named_info_.reserve(new_cap_named);
+  }
+};
+
+FMT_END_NAMESPACE
+
+#endif  // FMT_ARGS_H_
diff --git a/third_party/fmt/include/fmt/base.h b/third_party/fmt/include/fmt/base.h
new file mode 100644
index 00000000..5f252c23
--- /dev/null
+++ b/third_party/fmt/include/fmt/base.h
@@ -0,0 +1,3077 @@
+// Formatting library for C++ - the base API for char/UTF-8
+//
+// Copyright (c) 2012 - present, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_BASE_H_
+#define FMT_BASE_H_
+
+#if defined(FMT_IMPORT_STD) && !defined(FMT_MODULE)
+#  define FMT_MODULE
+#endif
+
+#ifndef FMT_MODULE
+#  include <limits.h>  // CHAR_BIT
+#  include <stdio.h>   // FILE
+#  include <string.h>  // strlen
+
+// <cstddef> is also included transitively from <type_traits>.
+#  include <cstddef>      // std::byte
+#  include <type_traits>  // std::enable_if
+#endif
+
+// The fmt library version in the form major * 10000 + minor * 100 + patch.
+#define FMT_VERSION 110002
+
+// Detect compiler versions.
+#if defined(__clang__) && !defined(__ibmxl__)
+#  define FMT_CLANG_VERSION (__clang_major__ * 100 + __clang_minor__)
+#else
+#  define FMT_CLANG_VERSION 0
+#endif
+#if defined(__GNUC__) && !defined(__clang__) && !defined(__INTEL_COMPILER)
+#  define FMT_GCC_VERSION (__GNUC__ * 100 + __GNUC_MINOR__)
+#else
+#  define FMT_GCC_VERSION 0
+#endif
+#if defined(__ICL)
+#  define FMT_ICC_VERSION __ICL
+#elif defined(__INTEL_COMPILER)
+#  define FMT_ICC_VERSION __INTEL_COMPILER
+#else
+#  define FMT_ICC_VERSION 0
+#endif
+#if defined(_MSC_VER)
+#  define FMT_MSC_VERSION _MSC_VER
+#else
+#  define FMT_MSC_VERSION 0
+#endif
+
+// Detect standard library versions.
+#ifdef _GLIBCXX_RELEASE
+#  define FMT_GLIBCXX_RELEASE _GLIBCXX_RELEASE
+#else
+#  define FMT_GLIBCXX_RELEASE 0
+#endif
+#ifdef _LIBCPP_VERSION
+#  define FMT_LIBCPP_VERSION _LIBCPP_VERSION
+#else
+#  define FMT_LIBCPP_VERSION 0
+#endif
+
+#ifdef _MSVC_LANG
+#  define FMT_CPLUSPLUS _MSVC_LANG
+#else
+#  define FMT_CPLUSPLUS __cplusplus
+#endif
+
+// Detect __has_*.
+#ifdef __has_feature
+#  define FMT_HAS_FEATURE(x) __has_feature(x)
+#else
+#  define FMT_HAS_FEATURE(x) 0
+#endif
+#ifdef __has_include
+#  define FMT_HAS_INCLUDE(x) __has_include(x)
+#else
+#  define FMT_HAS_INCLUDE(x) 0
+#endif
+#ifdef __has_cpp_attribute
+#  define FMT_HAS_CPP_ATTRIBUTE(x) __has_cpp_attribute(x)
+#else
+#  define FMT_HAS_CPP_ATTRIBUTE(x) 0
+#endif
+
+#define FMT_HAS_CPP14_ATTRIBUTE(attribute) \
+  (FMT_CPLUSPLUS >= 201402L && FMT_HAS_CPP_ATTRIBUTE(attribute))
+
+#define FMT_HAS_CPP17_ATTRIBUTE(attribute) \
+  (FMT_CPLUSPLUS >= 201703L && FMT_HAS_CPP_ATTRIBUTE(attribute))
+
+// Detect C++14 relaxed constexpr.
+#ifdef FMT_USE_CONSTEXPR
+// Use the provided definition.
+#elif FMT_GCC_VERSION >= 600 && FMT_CPLUSPLUS >= 201402L
+// GCC only allows throw in constexpr since version 6:
+// https://gcc.gnu.org/bugzilla/show_bug.cgi?id=67371.
+#  define FMT_USE_CONSTEXPR 1
+#elif FMT_ICC_VERSION
+#  define FMT_USE_CONSTEXPR 0  // https://github.com/fmtlib/fmt/issues/1628
+#elif FMT_HAS_FEATURE(cxx_relaxed_constexpr) || FMT_MSC_VERSION >= 1912
+#  define FMT_USE_CONSTEXPR 1
+#else
+#  define FMT_USE_CONSTEXPR 0
+#endif
+#if FMT_USE_CONSTEXPR
+#  define FMT_CONSTEXPR constexpr
+#else
+#  define FMT_CONSTEXPR
+#endif
+
+// Detect consteval, C++20 constexpr extensions and std::is_constant_evaluated.
+#if !defined(__cpp_lib_is_constant_evaluated)
+#  define FMT_USE_CONSTEVAL 0
+#elif FMT_CPLUSPLUS < 201709L
+#  define FMT_USE_CONSTEVAL 0
+#elif FMT_GLIBCXX_RELEASE && FMT_GLIBCXX_RELEASE < 10
+#  define FMT_USE_CONSTEVAL 0
+#elif FMT_LIBCPP_VERSION && FMT_LIBCPP_VERSION < 10000
+#  define FMT_USE_CONSTEVAL 0
+#elif defined(__apple_build_version__) && __apple_build_version__ < 14000029L
+#  define FMT_USE_CONSTEVAL 0  // consteval is broken in Apple clang < 14.
+#elif FMT_MSC_VERSION && FMT_MSC_VERSION < 1929
+#  define FMT_USE_CONSTEVAL 0  // consteval is broken in MSVC VS2019 < 16.10.
+#elif defined(__cpp_consteval)
+#  define FMT_USE_CONSTEVAL 1
+#elif FMT_GCC_VERSION >= 1002 || FMT_CLANG_VERSION >= 1101
+#  define FMT_USE_CONSTEVAL 1
+#else
+#  define FMT_USE_CONSTEVAL 0
+#endif
+#if FMT_USE_CONSTEVAL
+#  define FMT_CONSTEVAL consteval
+#  define FMT_CONSTEXPR20 constexpr
+#else
+#  define FMT_CONSTEVAL
+#  define FMT_CONSTEXPR20
+#endif
+
+#if defined(FMT_USE_NONTYPE_TEMPLATE_ARGS)
+// Use the provided definition.
+#elif defined(__NVCOMPILER)
+#  define FMT_USE_NONTYPE_TEMPLATE_ARGS 0
+#elif FMT_GCC_VERSION >= 903 && FMT_CPLUSPLUS >= 201709L
+#  define FMT_USE_NONTYPE_TEMPLATE_ARGS 1
+#elif defined(__cpp_nontype_template_args) && \
+    __cpp_nontype_template_args >= 201911L
+#  define FMT_USE_NONTYPE_TEMPLATE_ARGS 1
+#elif FMT_CLANG_VERSION >= 1200 && FMT_CPLUSPLUS >= 202002L
+#  define FMT_USE_NONTYPE_TEMPLATE_ARGS 1
+#else
+#  define FMT_USE_NONTYPE_TEMPLATE_ARGS 0
+#endif
+
+#ifdef FMT_USE_CONCEPTS
+// Use the provided definition.
+#elif defined(__cpp_concepts)
+#  define FMT_USE_CONCEPTS 1
+#else
+#  define FMT_USE_CONCEPTS 0
+#endif
+
+// Check if exceptions are disabled.
+#ifdef FMT_EXCEPTIONS
+// Use the provided definition.
+#elif defined(__GNUC__) && !defined(__EXCEPTIONS)
+#  define FMT_EXCEPTIONS 0
+#elif FMT_MSC_VERSION && !_HAS_EXCEPTIONS
+#  define FMT_EXCEPTIONS 0
+#else
+#  define FMT_EXCEPTIONS 1
+#endif
+#if FMT_EXCEPTIONS
+#  define FMT_TRY try
+#  define FMT_CATCH(x) catch (x)
+#else
+#  define FMT_TRY if (true)
+#  define FMT_CATCH(x) if (false)
+#endif
+
+#if FMT_HAS_CPP17_ATTRIBUTE(fallthrough)
+#  define FMT_FALLTHROUGH [[fallthrough]]
+#elif defined(__clang__)
+#  define FMT_FALLTHROUGH [[clang::fallthrough]]
+#elif FMT_GCC_VERSION >= 700 && \
+    (!defined(__EDG_VERSION__) || __EDG_VERSION__ >= 520)
+#  define FMT_FALLTHROUGH [[gnu::fallthrough]]
+#else
+#  define FMT_FALLTHROUGH
+#endif
+
+// Disable [[noreturn]] on MSVC/NVCC because of bogus unreachable code warnings.
+#if FMT_HAS_CPP_ATTRIBUTE(noreturn) && !FMT_MSC_VERSION && !defined(__NVCC__)
+#  define FMT_NORETURN [[noreturn]]
+#else
+#  define FMT_NORETURN
+#endif
+
+#ifndef FMT_NODISCARD
+#  if FMT_HAS_CPP17_ATTRIBUTE(nodiscard)
+#    define FMT_NODISCARD [[nodiscard]]
+#  else
+#    define FMT_NODISCARD
+#  endif
+#endif
+
+#ifdef FMT_DEPRECATED
+// Use the provided definition.
+#elif FMT_HAS_CPP14_ATTRIBUTE(deprecated)
+#  define FMT_DEPRECATED [[deprecated]]
+#else
+#  define FMT_DEPRECATED /* deprecated */
+#endif
+
+#ifdef FMT_INLINE
+// Use the provided definition.
+#elif FMT_GCC_VERSION || FMT_CLANG_VERSION
+#  define FMT_ALWAYS_INLINE inline __attribute__((always_inline))
+#else
+#  define FMT_ALWAYS_INLINE inline
+#endif
+// A version of FMT_INLINE to prevent code bloat in debug mode.
+#ifdef NDEBUG
+#  define FMT_INLINE FMT_ALWAYS_INLINE
+#else
+#  define FMT_INLINE inline
+#endif
+
+#if FMT_GCC_VERSION || FMT_CLANG_VERSION
+#  define FMT_VISIBILITY(value) __attribute__((visibility(value)))
+#else
+#  define FMT_VISIBILITY(value)
+#endif
+
+#ifndef FMT_GCC_PRAGMA
+// Workaround a _Pragma bug https://gcc.gnu.org/bugzilla/show_bug.cgi?id=59884
+// and an nvhpc warning: https://github.com/fmtlib/fmt/pull/2582.
+#  if FMT_GCC_VERSION >= 504 && !defined(__NVCOMPILER)
+#    define FMT_GCC_PRAGMA(arg) _Pragma(arg)
+#  else
+#    define FMT_GCC_PRAGMA(arg)
+#  endif
+#endif
+
+// GCC < 5 requires this-> in decltype.
+#if FMT_GCC_VERSION && FMT_GCC_VERSION < 500
+#  define FMT_DECLTYPE_THIS this->
+#else
+#  define FMT_DECLTYPE_THIS
+#endif
+
+#if FMT_MSC_VERSION
+#  define FMT_MSC_WARNING(...) __pragma(warning(__VA_ARGS__))
+#  define FMT_UNCHECKED_ITERATOR(It) \
+    using _Unchecked_type = It  // Mark iterator as checked.
+#else
+#  define FMT_MSC_WARNING(...)
+#  define FMT_UNCHECKED_ITERATOR(It) using unchecked_type = It
+#endif
+
+#ifndef FMT_BEGIN_NAMESPACE
+#  define FMT_BEGIN_NAMESPACE \
+    namespace fmt {           \
+    inline namespace v11 {
+#  define FMT_END_NAMESPACE \
+    }                       \
+    }
+#endif
+
+#ifndef FMT_EXPORT
+#  define FMT_EXPORT
+#  define FMT_BEGIN_EXPORT
+#  define FMT_END_EXPORT
+#endif
+
+#if !defined(FMT_HEADER_ONLY) && defined(_WIN32)
+#  if defined(FMT_LIB_EXPORT)
+#    define FMT_API __declspec(dllexport)
+#  elif defined(FMT_SHARED)
+#    define FMT_API __declspec(dllimport)
+#  endif
+#elif defined(FMT_LIB_EXPORT) || defined(FMT_SHARED)
+#  define FMT_API FMT_VISIBILITY("default")
+#endif
+#ifndef FMT_API
+#  define FMT_API
+#endif
+
+#ifndef FMT_UNICODE
+#  define FMT_UNICODE 1
+#endif
+
+// Check if rtti is available.
+#ifndef FMT_USE_RTTI
+// __RTTI is for EDG compilers. _CPPRTTI is for MSVC.
+#  if defined(__GXX_RTTI) || FMT_HAS_FEATURE(cxx_rtti) || defined(_CPPRTTI) || \
+      defined(__INTEL_RTTI__) || defined(__RTTI)
+#    define FMT_USE_RTTI 1
+#  else
+#    define FMT_USE_RTTI 0
+#  endif
+#endif
+
+#define FMT_FWD(...) static_cast<decltype(__VA_ARGS__)&&>(__VA_ARGS__)
+
+// Enable minimal optimizations for more compact code in debug mode.
+FMT_GCC_PRAGMA("GCC push_options")
+#if !defined(__OPTIMIZE__) && !defined(__CUDACC__)
+FMT_GCC_PRAGMA("GCC optimize(\"Og\")")
+#endif
+
+FMT_BEGIN_NAMESPACE
+
+// Implementations of enable_if_t and other metafunctions for older systems.
+template <bool B, typename T = void>
+using enable_if_t = typename std::enable_if<B, T>::type;
+template <bool B, typename T, typename F>
+using conditional_t = typename std::conditional<B, T, F>::type;
+template <bool B> using bool_constant = std::integral_constant<bool, B>;
+template <typename T>
+using remove_reference_t = typename std::remove_reference<T>::type;
+template <typename T>
+using remove_const_t = typename std::remove_const<T>::type;
+template <typename T>
+using remove_cvref_t = typename std::remove_cv<remove_reference_t<T>>::type;
+template <typename T> struct type_identity {
+  using type = T;
+};
+template <typename T> using type_identity_t = typename type_identity<T>::type;
+template <typename T>
+using make_unsigned_t = typename std::make_unsigned<T>::type;
+template <typename T>
+using underlying_t = typename std::underlying_type<T>::type;
+
+#if FMT_GCC_VERSION && FMT_GCC_VERSION < 500
+// A workaround for gcc 4.8 to make void_t work in a SFINAE context.
+template <typename...> struct void_t_impl {
+  using type = void;
+};
+template <typename... T> using void_t = typename void_t_impl<T...>::type;
+#else
+template <typename...> using void_t = void;
+#endif
+
+struct monostate {
+  constexpr monostate() {}
+};
+
+// An enable_if helper to be used in template parameters which results in much
+// shorter symbols: https://godbolt.org/z/sWw4vP. Extra parentheses are needed
+// to workaround a bug in MSVC 2019 (see #1140 and #1186).
+#ifdef FMT_DOC
+#  define FMT_ENABLE_IF(...)
+#else
+#  define FMT_ENABLE_IF(...) fmt::enable_if_t<(__VA_ARGS__), int> = 0
+#endif
+
+// This is defined in base.h instead of format.h to avoid injecting in std.
+// It is a template to avoid undesirable implicit conversions to std::byte.
+#ifdef __cpp_lib_byte
+template <typename T, FMT_ENABLE_IF(std::is_same<T, std::byte>::value)>
+inline auto format_as(T b) -> unsigned char {
+  return static_cast<unsigned char>(b);
+}
+#endif
+
+namespace detail {
+// Suppresses "unused variable" warnings with the method described in
+// https://herbsutter.com/2009/10/18/mailbag-shutting-up-compiler-warnings/.
+// (void)var does not work on many Intel compilers.
+template <typename... T> FMT_CONSTEXPR void ignore_unused(const T&...) {}
+
+constexpr auto is_constant_evaluated(bool default_value = false) noexcept
+    -> bool {
+// Workaround for incompatibility between libstdc++ consteval-based
+// std::is_constant_evaluated() implementation and clang-14:
+// https://github.com/fmtlib/fmt/issues/3247.
+#if FMT_CPLUSPLUS >= 202002L && FMT_GLIBCXX_RELEASE >= 12 && \
+    (FMT_CLANG_VERSION >= 1400 && FMT_CLANG_VERSION < 1500)
+  ignore_unused(default_value);
+  return __builtin_is_constant_evaluated();
+#elif defined(__cpp_lib_is_constant_evaluated)
+  ignore_unused(default_value);
+  return std::is_constant_evaluated();
+#else
+  return default_value;
+#endif
+}
+
+// Suppresses "conditional expression is constant" warnings.
+template <typename T> constexpr auto const_check(T value) -> T { return value; }
+
+FMT_NORETURN FMT_API void assert_fail(const char* file, int line,
+                                      const char* message);
+
+#if defined(FMT_ASSERT)
+// Use the provided definition.
+#elif defined(NDEBUG)
+// FMT_ASSERT is not empty to avoid -Wempty-body.
+#  define FMT_ASSERT(condition, message) \
+    fmt::detail::ignore_unused((condition), (message))
+#else
+#  define FMT_ASSERT(condition, message)                                    \
+    ((condition) /* void() fails with -Winvalid-constexpr on clang 4.0.1 */ \
+         ? (void)0                                                          \
+         : fmt::detail::assert_fail(__FILE__, __LINE__, (message)))
+#endif
+
+#ifdef FMT_USE_INT128
+// Do nothing.
+#elif defined(__SIZEOF_INT128__) && !defined(__NVCC__) && \
+    !(FMT_CLANG_VERSION && FMT_MSC_VERSION)
+#  define FMT_USE_INT128 1
+using int128_opt = __int128_t;  // An optional native 128-bit integer.
+using uint128_opt = __uint128_t;
+template <typename T> inline auto convert_for_visit(T value) -> T {
+  return value;
+}
+#else
+#  define FMT_USE_INT128 0
+#endif
+#if !FMT_USE_INT128
+enum class int128_opt {};
+enum class uint128_opt {};
+// Reduce template instantiations.
+template <typename T> auto convert_for_visit(T) -> monostate { return {}; }
+#endif
+
+// Casts a nonnegative integer to unsigned.
+template <typename Int>
+FMT_CONSTEXPR auto to_unsigned(Int value) -> make_unsigned_t<Int> {
+  FMT_ASSERT(std::is_unsigned<Int>::value || value >= 0, "negative value");
+  return static_cast<make_unsigned_t<Int>>(value);
+}
+
+// A heuristic to detect std::string and std::[experimental::]string_view.
+// It is mainly used to avoid dependency on <[experimental/]string_view>.
+template <typename T, typename Enable = void>
+struct is_std_string_like : std::false_type {};
+template <typename T>
+struct is_std_string_like<T, void_t<decltype(std::declval<T>().find_first_of(
+                                 typename T::value_type(), 0))>>
+    : std::is_convertible<decltype(std::declval<T>().data()),
+                          const typename T::value_type*> {};
+
+// Returns true iff the literal encoding is UTF-8.
+constexpr auto is_utf8_enabled() -> bool {
+  // Avoid an MSVC sign extension bug: https://github.com/fmtlib/fmt/pull/2297.
+  using uchar = unsigned char;
+  return sizeof("\u00A7") == 3 && uchar("\u00A7"[0]) == 0xC2 &&
+         uchar("\u00A7"[1]) == 0xA7;
+}
+constexpr auto use_utf8() -> bool {
+  return !FMT_MSC_VERSION || is_utf8_enabled();
+}
+
+static_assert(!FMT_UNICODE || use_utf8(),
+              "Unicode support requires compiling with /utf-8");
+
+template <typename Char> FMT_CONSTEXPR auto length(const Char* s) -> size_t {
+  size_t len = 0;
+  while (*s++) ++len;
+  return len;
+}
+
+template <typename Char>
+FMT_CONSTEXPR auto compare(const Char* s1, const Char* s2, std::size_t n)
+    -> int {
+  if (!is_constant_evaluated() && sizeof(Char) == 1) return memcmp(s1, s2, n);
+  for (; n != 0; ++s1, ++s2, --n) {
+    if (*s1 < *s2) return -1;
+    if (*s1 > *s2) return 1;
+  }
+  return 0;
+}
+
+namespace adl {
+using namespace std;
+
+template <typename Container>
+auto invoke_back_inserter()
+    -> decltype(back_inserter(std::declval<Container&>()));
+}  // namespace adl
+
+template <typename It, typename Enable = std::true_type>
+struct is_back_insert_iterator : std::false_type {};
+
+template <typename It>
+struct is_back_insert_iterator<
+    It, bool_constant<std::is_same<
+            decltype(adl::invoke_back_inserter<typename It::container_type>()),
+            It>::value>> : std::true_type {};
+
+// Extracts a reference to the container from *insert_iterator.
+template <typename OutputIt>
+inline auto get_container(OutputIt it) -> typename OutputIt::container_type& {
+  struct accessor : OutputIt {
+    accessor(OutputIt base) : OutputIt(base) {}
+    using OutputIt::container;
+  };
+  return *accessor(it).container;
+}
+}  // namespace detail
+
+// Checks whether T is a container with contiguous storage.
+template <typename T> struct is_contiguous : std::false_type {};
+
+/**
+ * An implementation of `std::basic_string_view` for pre-C++17. It provides a
+ * subset of the API. `fmt::basic_string_view` is used for format strings even
+ * if `std::basic_string_view` is available to prevent issues when a library is
+ * compiled with a different `-std` option than the client code (which is not
+ * recommended).
+ */
+FMT_EXPORT
+template <typename Char> class basic_string_view {
+ private:
+  const Char* data_;
+  size_t size_;
+
+ public:
+  using value_type = Char;
+  using iterator = const Char*;
+
+  constexpr basic_string_view() noexcept : data_(nullptr), size_(0) {}
+
+  /// Constructs a string reference object from a C string and a size.
+  constexpr basic_string_view(const Char* s, size_t count) noexcept
+      : data_(s), size_(count) {}
+
+  constexpr basic_string_view(std::nullptr_t) = delete;
+
+  /// Constructs a string reference object from a C string.
+  FMT_CONSTEXPR20
+  basic_string_view(const Char* s)
+      : data_(s),
+        size_(detail::const_check(std::is_same<Char, char>::value &&
+                                  !detail::is_constant_evaluated(false))
+                  ? strlen(reinterpret_cast<const char*>(s))
+                  : detail::length(s)) {}
+
+  /// Constructs a string reference from a `std::basic_string` or a
+  /// `std::basic_string_view` object.
+  template <typename S,
+            FMT_ENABLE_IF(detail::is_std_string_like<S>::value&& std::is_same<
+                          typename S::value_type, Char>::value)>
+  FMT_CONSTEXPR basic_string_view(const S& s) noexcept
+      : data_(s.data()), size_(s.size()) {}
+
+  /// Returns a pointer to the string data.
+  constexpr auto data() const noexcept -> const Char* { return data_; }
+
+  /// Returns the string size.
+  constexpr auto size() const noexcept -> size_t { return size_; }
+
+  constexpr auto begin() const noexcept -> iterator { return data_; }
+  constexpr auto end() const noexcept -> iterator { return data_ + size_; }
+
+  constexpr auto operator[](size_t pos) const noexcept -> const Char& {
+    return data_[pos];
+  }
+
+  FMT_CONSTEXPR void remove_prefix(size_t n) noexcept {
+    data_ += n;
+    size_ -= n;
+  }
+
+  FMT_CONSTEXPR auto starts_with(basic_string_view<Char> sv) const noexcept
+      -> bool {
+    return size_ >= sv.size_ && detail::compare(data_, sv.data_, sv.size_) == 0;
+  }
+  FMT_CONSTEXPR auto starts_with(Char c) const noexcept -> bool {
+    return size_ >= 1 && *data_ == c;
+  }
+  FMT_CONSTEXPR auto starts_with(const Char* s) const -> bool {
+    return starts_with(basic_string_view<Char>(s));
+  }
+
+  // Lexicographically compare this string reference to other.
+  FMT_CONSTEXPR auto compare(basic_string_view other) const -> int {
+    size_t str_size = size_ < other.size_ ? size_ : other.size_;
+    int result = detail::compare(data_, other.data_, str_size);
+    if (result == 0)
+      result = size_ == other.size_ ? 0 : (size_ < other.size_ ? -1 : 1);
+    return result;
+  }
+
+  FMT_CONSTEXPR friend auto operator==(basic_string_view lhs,
+                                       basic_string_view rhs) -> bool {
+    return lhs.compare(rhs) == 0;
+  }
+  friend auto operator!=(basic_string_view lhs, basic_string_view rhs) -> bool {
+    return lhs.compare(rhs) != 0;
+  }
+  friend auto operator<(basic_string_view lhs, basic_string_view rhs) -> bool {
+    return lhs.compare(rhs) < 0;
+  }
+  friend auto operator<=(basic_string_view lhs, basic_string_view rhs) -> bool {
+    return lhs.compare(rhs) <= 0;
+  }
+  friend auto operator>(basic_string_view lhs, basic_string_view rhs) -> bool {
+    return lhs.compare(rhs) > 0;
+  }
+  friend auto operator>=(basic_string_view lhs, basic_string_view rhs) -> bool {
+    return lhs.compare(rhs) >= 0;
+  }
+};
+
+FMT_EXPORT
+using string_view = basic_string_view<char>;
+
+/// Specifies if `T` is a character type. Can be specialized by users.
+FMT_EXPORT
+template <typename T> struct is_char : std::false_type {};
+template <> struct is_char<char> : std::true_type {};
+
+namespace detail {
+
+// Constructs fmt::basic_string_view<Char> from types implicitly convertible
+// to it, deducing Char. Explicitly convertible types such as the ones returned
+// from FMT_STRING are intentionally excluded.
+template <typename Char, FMT_ENABLE_IF(is_char<Char>::value)>
+constexpr auto to_string_view(const Char* s) -> basic_string_view<Char> {
+  return s;
+}
+template <typename T, FMT_ENABLE_IF(is_std_string_like<T>::value)>
+constexpr auto to_string_view(const T& s)
+    -> basic_string_view<typename T::value_type> {
+  return s;
+}
+template <typename Char>
+constexpr auto to_string_view(basic_string_view<Char> s)
+    -> basic_string_view<Char> {
+  return s;
+}
+
+template <typename T, typename Enable = void>
+struct has_to_string_view : std::false_type {};
+// detail:: is intentional since to_string_view is not an extension point.
+template <typename T>
+struct has_to_string_view<
+    T, void_t<decltype(detail::to_string_view(std::declval<T>()))>>
+    : std::true_type {};
+
+template <typename Char, Char... C> struct string_literal {
+  static constexpr Char value[sizeof...(C)] = {C...};
+  constexpr operator basic_string_view<Char>() const {
+    return {value, sizeof...(C)};
+  }
+};
+#if FMT_CPLUSPLUS < 201703L
+template <typename Char, Char... C>
+constexpr Char string_literal<Char, C...>::value[sizeof...(C)];
+#endif
+
+enum class type {
+  none_type,
+  // Integer types should go first,
+  int_type,
+  uint_type,
+  long_long_type,
+  ulong_long_type,
+  int128_type,
+  uint128_type,
+  bool_type,
+  char_type,
+  last_integer_type = char_type,
+  // followed by floating-point types.
+  float_type,
+  double_type,
+  long_double_type,
+  last_numeric_type = long_double_type,
+  cstring_type,
+  string_type,
+  pointer_type,
+  custom_type
+};
+
+// Maps core type T to the corresponding type enum constant.
+template <typename T, typename Char>
+struct type_constant : std::integral_constant<type, type::custom_type> {};
+
+#define FMT_TYPE_CONSTANT(Type, constant) \
+  template <typename Char>                \
+  struct type_constant<Type, Char>        \
+      : std::integral_constant<type, type::constant> {}
+
+FMT_TYPE_CONSTANT(int, int_type);
+FMT_TYPE_CONSTANT(unsigned, uint_type);
+FMT_TYPE_CONSTANT(long long, long_long_type);
+FMT_TYPE_CONSTANT(unsigned long long, ulong_long_type);
+FMT_TYPE_CONSTANT(int128_opt, int128_type);
+FMT_TYPE_CONSTANT(uint128_opt, uint128_type);
+FMT_TYPE_CONSTANT(bool, bool_type);
+FMT_TYPE_CONSTANT(Char, char_type);
+FMT_TYPE_CONSTANT(float, float_type);
+FMT_TYPE_CONSTANT(double, double_type);
+FMT_TYPE_CONSTANT(long double, long_double_type);
+FMT_TYPE_CONSTANT(const Char*, cstring_type);
+FMT_TYPE_CONSTANT(basic_string_view<Char>, string_type);
+FMT_TYPE_CONSTANT(const void*, pointer_type);
+
+constexpr auto is_integral_type(type t) -> bool {
+  return t > type::none_type && t <= type::last_integer_type;
+}
+constexpr auto is_arithmetic_type(type t) -> bool {
+  return t > type::none_type && t <= type::last_numeric_type;
+}
+
+constexpr auto set(type rhs) -> int { return 1 << static_cast<int>(rhs); }
+constexpr auto in(type t, int set) -> bool {
+  return ((set >> static_cast<int>(t)) & 1) != 0;
+}
+
+// Bitsets of types.
+enum {
+  sint_set =
+      set(type::int_type) | set(type::long_long_type) | set(type::int128_type),
+  uint_set = set(type::uint_type) | set(type::ulong_long_type) |
+             set(type::uint128_type),
+  bool_set = set(type::bool_type),
+  char_set = set(type::char_type),
+  float_set = set(type::float_type) | set(type::double_type) |
+              set(type::long_double_type),
+  string_set = set(type::string_type),
+  cstring_set = set(type::cstring_type),
+  pointer_set = set(type::pointer_type)
+};
+}  // namespace detail
+
+/// Reports a format error at compile time or, via a `format_error` exception,
+/// at runtime.
+// This function is intentionally not constexpr to give a compile-time error.
+FMT_NORETURN FMT_API void report_error(const char* message);
+
+FMT_DEPRECATED FMT_NORETURN inline void throw_format_error(
+    const char* message) {
+  report_error(message);
+}
+
+/// String's character (code unit) type.
+template <typename S,
+          typename V = decltype(detail::to_string_view(std::declval<S>()))>
+using char_t = typename V::value_type;
+
+/**
+ * Parsing context consisting of a format string range being parsed and an
+ * argument counter for automatic indexing.
+ * You can use the `format_parse_context` type alias for `char` instead.
+ */
+FMT_EXPORT
+template <typename Char> class basic_format_parse_context {
+ private:
+  basic_string_view<Char> format_str_;
+  int next_arg_id_;
+
+  FMT_CONSTEXPR void do_check_arg_id(int id);
+
+ public:
+  using char_type = Char;
+  using iterator = const Char*;
+
+  explicit constexpr basic_format_parse_context(
+      basic_string_view<Char> format_str, int next_arg_id = 0)
+      : format_str_(format_str), next_arg_id_(next_arg_id) {}
+
+  /// Returns an iterator to the beginning of the format string range being
+  /// parsed.
+  constexpr auto begin() const noexcept -> iterator {
+    return format_str_.begin();
+  }
+
+  /// Returns an iterator past the end of the format string range being parsed.
+  constexpr auto end() const noexcept -> iterator { return format_str_.end(); }
+
+  /// Advances the begin iterator to `it`.
+  FMT_CONSTEXPR void advance_to(iterator it) {
+    format_str_.remove_prefix(detail::to_unsigned(it - begin()));
+  }
+
+  /// Reports an error if using the manual argument indexing; otherwise returns
+  /// the next argument index and switches to the automatic indexing.
+  FMT_CONSTEXPR auto next_arg_id() -> int {
+    if (next_arg_id_ < 0) {
+      report_error("cannot switch from manual to automatic argument indexing");
+      return 0;
+    }
+    int id = next_arg_id_++;
+    do_check_arg_id(id);
+    return id;
+  }
+
+  /// Reports an error if using the automatic argument indexing; otherwise
+  /// switches to the manual indexing.
+  FMT_CONSTEXPR void check_arg_id(int id) {
+    if (next_arg_id_ > 0) {
+      report_error("cannot switch from automatic to manual argument indexing");
+      return;
+    }
+    next_arg_id_ = -1;
+    do_check_arg_id(id);
+  }
+  FMT_CONSTEXPR void check_arg_id(basic_string_view<Char>) {
+    next_arg_id_ = -1;
+  }
+  FMT_CONSTEXPR void check_dynamic_spec(int arg_id);
+};
+
+FMT_EXPORT
+using format_parse_context = basic_format_parse_context<char>;
+
+namespace detail {
+// A parse context with extra data used only in compile-time checks.
+template <typename Char>
+class compile_parse_context : public basic_format_parse_context<Char> {
+ private:
+  int num_args_;
+  const type* types_;
+  using base = basic_format_parse_context<Char>;
+
+ public:
+  explicit FMT_CONSTEXPR compile_parse_context(
+      basic_string_view<Char> format_str, int num_args, const type* types,
+      int next_arg_id = 0)
+      : base(format_str, next_arg_id), num_args_(num_args), types_(types) {}
+
+  constexpr auto num_args() const -> int { return num_args_; }
+  constexpr auto arg_type(int id) const -> type { return types_[id]; }
+
+  FMT_CONSTEXPR auto next_arg_id() -> int {
+    int id = base::next_arg_id();
+    if (id >= num_args_) report_error("argument not found");
+    return id;
+  }
+
+  FMT_CONSTEXPR void check_arg_id(int id) {
+    base::check_arg_id(id);
+    if (id >= num_args_) report_error("argument not found");
+  }
+  using base::check_arg_id;
+
+  FMT_CONSTEXPR void check_dynamic_spec(int arg_id) {
+    detail::ignore_unused(arg_id);
+    if (arg_id < num_args_ && types_ && !is_integral_type(types_[arg_id]))
+      report_error("width/precision is not integer");
+  }
+};
+
+/// A contiguous memory buffer with an optional growing ability. It is an
+/// internal class and shouldn't be used directly, only via `memory_buffer`.
+template <typename T> class buffer {
+ private:
+  T* ptr_;
+  size_t size_;
+  size_t capacity_;
+
+  using grow_fun = void (*)(buffer& buf, size_t capacity);
+  grow_fun grow_;
+
+ protected:
+  // Don't initialize ptr_ since it is not accessed to save a few cycles.
+  FMT_MSC_WARNING(suppress : 26495)
+  FMT_CONSTEXPR20 buffer(grow_fun grow, size_t sz) noexcept
+      : size_(sz), capacity_(sz), grow_(grow) {}
+
+  constexpr buffer(grow_fun grow, T* p = nullptr, size_t sz = 0,
+                   size_t cap = 0) noexcept
+      : ptr_(p), size_(sz), capacity_(cap), grow_(grow) {}
+
+  FMT_CONSTEXPR20 ~buffer() = default;
+  buffer(buffer&&) = default;
+
+  /// Sets the buffer data and capacity.
+  FMT_CONSTEXPR void set(T* buf_data, size_t buf_capacity) noexcept {
+    ptr_ = buf_data;
+    capacity_ = buf_capacity;
+  }
+
+ public:
+  using value_type = T;
+  using const_reference = const T&;
+
+  buffer(const buffer&) = delete;
+  void operator=(const buffer&) = delete;
+
+  auto begin() noexcept -> T* { return ptr_; }
+  auto end() noexcept -> T* { return ptr_ + size_; }
+
+  auto begin() const noexcept -> const T* { return ptr_; }
+  auto end() const noexcept -> const T* { return ptr_ + size_; }
+
+  /// Returns the size of this buffer.
+  constexpr auto size() const noexcept -> size_t { return size_; }
+
+  /// Returns the capacity of this buffer.
+  constexpr auto capacity() const noexcept -> size_t { return capacity_; }
+
+  /// Returns a pointer to the buffer data (not null-terminated).
+  FMT_CONSTEXPR auto data() noexcept -> T* { return ptr_; }
+  FMT_CONSTEXPR auto data() const noexcept -> const T* { return ptr_; }
+
+  /// Clears this buffer.
+  void clear() { size_ = 0; }
+
+  // Tries resizing the buffer to contain `count` elements. If T is a POD type
+  // the new elements may not be initialized.
+  FMT_CONSTEXPR void try_resize(size_t count) {
+    try_reserve(count);
+    size_ = count <= capacity_ ? count : capacity_;
+  }
+
+  // Tries increasing the buffer capacity to `new_capacity`. It can increase the
+  // capacity by a smaller amount than requested but guarantees there is space
+  // for at least one additional element either by increasing the capacity or by
+  // flushing the buffer if it is full.
+  FMT_CONSTEXPR void try_reserve(size_t new_capacity) {
+    if (new_capacity > capacity_) grow_(*this, new_capacity);
+  }
+
+  FMT_CONSTEXPR void push_back(const T& value) {
+    try_reserve(size_ + 1);
+    ptr_[size_++] = value;
+  }
+
+  /// Appends data to the end of the buffer.
+  template <typename U> void append(const U* begin, const U* end) {
+    while (begin != end) {
+      auto count = to_unsigned(end - begin);
+      try_reserve(size_ + count);
+      auto free_cap = capacity_ - size_;
+      if (free_cap < count) count = free_cap;
+      // A loop is faster than memcpy on small sizes.
+      T* out = ptr_ + size_;
+      for (size_t i = 0; i < count; ++i) out[i] = begin[i];
+      size_ += count;
+      begin += count;
+    }
+  }
+
+  template <typename Idx> FMT_CONSTEXPR auto operator[](Idx index) -> T& {
+    return ptr_[index];
+  }
+  template <typename Idx>
+  FMT_CONSTEXPR auto operator[](Idx index) const -> const T& {
+    return ptr_[index];
+  }
+};
+
+struct buffer_traits {
+  explicit buffer_traits(size_t) {}
+  auto count() const -> size_t { return 0; }
+  auto limit(size_t size) -> size_t { return size; }
+};
+
+class fixed_buffer_traits {
+ private:
+  size_t count_ = 0;
+  size_t limit_;
+
+ public:
+  explicit fixed_buffer_traits(size_t limit) : limit_(limit) {}
+  auto count() const -> size_t { return count_; }
+  auto limit(size_t size) -> size_t {
+    size_t n = limit_ > count_ ? limit_ - count_ : 0;
+    count_ += size;
+    return size < n ? size : n;
+  }
+};
+
+// A buffer that writes to an output iterator when flushed.
+template <typename OutputIt, typename T, typename Traits = buffer_traits>
+class iterator_buffer : public Traits, public buffer<T> {
+ private:
+  OutputIt out_;
+  enum { buffer_size = 256 };
+  T data_[buffer_size];
+
+  static FMT_CONSTEXPR void grow(buffer<T>& buf, size_t) {
+    if (buf.size() == buffer_size) static_cast<iterator_buffer&>(buf).flush();
+  }
+
+  void flush() {
+    auto size = this->size();
+    this->clear();
+    const T* begin = data_;
+    const T* end = begin + this->limit(size);
+    while (begin != end) *out_++ = *begin++;
+  }
+
+ public:
+  explicit iterator_buffer(OutputIt out, size_t n = buffer_size)
+      : Traits(n), buffer<T>(grow, data_, 0, buffer_size), out_(out) {}
+  iterator_buffer(iterator_buffer&& other) noexcept
+      : Traits(other),
+        buffer<T>(grow, data_, 0, buffer_size),
+        out_(other.out_) {}
+  ~iterator_buffer() {
+    // Don't crash if flush fails during unwinding.
+    FMT_TRY { flush(); }
+    FMT_CATCH(...) {}
+  }
+
+  auto out() -> OutputIt {
+    flush();
+    return out_;
+  }
+  auto count() const -> size_t { return Traits::count() + this->size(); }
+};
+
+template <typename T>
+class iterator_buffer<T*, T, fixed_buffer_traits> : public fixed_buffer_traits,
+                                                    public buffer<T> {
+ private:
+  T* out_;
+  enum { buffer_size = 256 };
+  T data_[buffer_size];
+
+  static FMT_CONSTEXPR void grow(buffer<T>& buf, size_t) {
+    if (buf.size() == buf.capacity())
+      static_cast<iterator_buffer&>(buf).flush();
+  }
+
+  void flush() {
+    size_t n = this->limit(this->size());
+    if (this->data() == out_) {
+      out_ += n;
+      this->set(data_, buffer_size);
+    }
+    this->clear();
+  }
+
+ public:
+  explicit iterator_buffer(T* out, size_t n = buffer_size)
+      : fixed_buffer_traits(n), buffer<T>(grow, out, 0, n), out_(out) {}
+  iterator_buffer(iterator_buffer&& other) noexcept
+      : fixed_buffer_traits(other),
+        buffer<T>(static_cast<iterator_buffer&&>(other)),
+        out_(other.out_) {
+    if (this->data() != out_) {
+      this->set(data_, buffer_size);
+      this->clear();
+    }
+  }
+  ~iterator_buffer() { flush(); }
+
+  auto out() -> T* {
+    flush();
+    return out_;
+  }
+  auto count() const -> size_t {
+    return fixed_buffer_traits::count() + this->size();
+  }
+};
+
+template <typename T> class iterator_buffer<T*, T> : public buffer<T> {
+ public:
+  explicit iterator_buffer(T* out, size_t = 0)
+      : buffer<T>([](buffer<T>&, size_t) {}, out, 0, ~size_t()) {}
+
+  auto out() -> T* { return &*this->end(); }
+};
+
+// A buffer that writes to a container with the contiguous storage.
+template <typename OutputIt>
+class iterator_buffer<
+    OutputIt,
+    enable_if_t<detail::is_back_insert_iterator<OutputIt>::value &&
+                    is_contiguous<typename OutputIt::container_type>::value,
+                typename OutputIt::container_type::value_type>>
+    : public buffer<typename OutputIt::container_type::value_type> {
+ private:
+  using container_type = typename OutputIt::container_type;
+  using value_type = typename container_type::value_type;
+  container_type& container_;
+
+  static FMT_CONSTEXPR void grow(buffer<value_type>& buf, size_t capacity) {
+    auto& self = static_cast<iterator_buffer&>(buf);
+    self.container_.resize(capacity);
+    self.set(&self.container_[0], capacity);
+  }
+
+ public:
+  explicit iterator_buffer(container_type& c)
+      : buffer<value_type>(grow, c.size()), container_(c) {}
+  explicit iterator_buffer(OutputIt out, size_t = 0)
+      : iterator_buffer(get_container(out)) {}
+
+  auto out() -> OutputIt { return back_inserter(container_); }
+};
+
+// A buffer that counts the number of code units written discarding the output.
+template <typename T = char> class counting_buffer : public buffer<T> {
+ private:
+  enum { buffer_size = 256 };
+  T data_[buffer_size];
+  size_t count_ = 0;
+
+  static FMT_CONSTEXPR void grow(buffer<T>& buf, size_t) {
+    if (buf.size() != buffer_size) return;
+    static_cast<counting_buffer&>(buf).count_ += buf.size();
+    buf.clear();
+  }
+
+ public:
+  counting_buffer() : buffer<T>(grow, data_, 0, buffer_size) {}
+
+  auto count() -> size_t { return count_ + this->size(); }
+};
+}  // namespace detail
+
+template <typename Char>
+FMT_CONSTEXPR void basic_format_parse_context<Char>::do_check_arg_id(int id) {
+  // Argument id is only checked at compile-time during parsing because
+  // formatting has its own validation.
+  if (detail::is_constant_evaluated() &&
+      (!FMT_GCC_VERSION || FMT_GCC_VERSION >= 1200)) {
+    using context = detail::compile_parse_context<Char>;
+    if (id >= static_cast<context*>(this)->num_args())
+      report_error("argument not found");
+  }
+}
+
+template <typename Char>
+FMT_CONSTEXPR void basic_format_parse_context<Char>::check_dynamic_spec(
+    int arg_id) {
+  if (detail::is_constant_evaluated() &&
+      (!FMT_GCC_VERSION || FMT_GCC_VERSION >= 1200)) {
+    using context = detail::compile_parse_context<Char>;
+    static_cast<context*>(this)->check_dynamic_spec(arg_id);
+  }
+}
+
+FMT_EXPORT template <typename Context> class basic_format_arg;
+FMT_EXPORT template <typename Context> class basic_format_args;
+FMT_EXPORT template <typename Context> class dynamic_format_arg_store;
+
+// A formatter for objects of type T.
+FMT_EXPORT
+template <typename T, typename Char = char, typename Enable = void>
+struct formatter {
+  // A deleted default constructor indicates a disabled formatter.
+  formatter() = delete;
+};
+
+// Specifies if T has an enabled formatter specialization. A type can be
+// formattable even if it doesn't have a formatter e.g. via a conversion.
+template <typename T, typename Context>
+using has_formatter =
+    std::is_constructible<typename Context::template formatter_type<T>>;
+
+// An output iterator that appends to a buffer. It is used instead of
+// back_insert_iterator to reduce symbol sizes and avoid <iterator> dependency.
+template <typename T> class basic_appender {
+ private:
+  detail::buffer<T>* buffer_;
+
+  friend auto get_container(basic_appender app) -> detail::buffer<T>& {
+    return *app.buffer_;
+  }
+
+ public:
+  using iterator_category = int;
+  using value_type = T;
+  using difference_type = ptrdiff_t;
+  using pointer = T*;
+  using reference = T&;
+  using container_type = detail::buffer<T>;
+  FMT_UNCHECKED_ITERATOR(basic_appender);
+
+  FMT_CONSTEXPR basic_appender(detail::buffer<T>& buf) : buffer_(&buf) {}
+
+  auto operator=(T c) -> basic_appender& {
+    buffer_->push_back(c);
+    return *this;
+  }
+  auto operator*() -> basic_appender& { return *this; }
+  auto operator++() -> basic_appender& { return *this; }
+  auto operator++(int) -> basic_appender { return *this; }
+};
+
+using appender = basic_appender<char>;
+
+namespace detail {
+template <typename T>
+struct is_back_insert_iterator<basic_appender<T>> : std::true_type {};
+
+template <typename T, typename Enable = void>
+struct locking : std::true_type {};
+template <typename T>
+struct locking<T, void_t<typename formatter<remove_cvref_t<T>>::nonlocking>>
+    : std::false_type {};
+
+template <typename T = int> FMT_CONSTEXPR inline auto is_locking() -> bool {
+  return locking<T>::value;
+}
+template <typename T1, typename T2, typename... Tail>
+FMT_CONSTEXPR inline auto is_locking() -> bool {
+  return locking<T1>::value || is_locking<T2, Tail...>();
+}
+
+// An optimized version of std::copy with the output value type (T).
+template <typename T, typename InputIt, typename OutputIt,
+          FMT_ENABLE_IF(is_back_insert_iterator<OutputIt>::value)>
+auto copy(InputIt begin, InputIt end, OutputIt out) -> OutputIt {
+  get_container(out).append(begin, end);
+  return out;
+}
+
+template <typename T, typename InputIt, typename OutputIt,
+          FMT_ENABLE_IF(!is_back_insert_iterator<OutputIt>::value)>
+FMT_CONSTEXPR auto copy(InputIt begin, InputIt end, OutputIt out) -> OutputIt {
+  while (begin != end) *out++ = static_cast<T>(*begin++);
+  return out;
+}
+
+template <typename T, typename V, typename OutputIt>
+FMT_CONSTEXPR auto copy(basic_string_view<V> s, OutputIt out) -> OutputIt {
+  return copy<T>(s.begin(), s.end(), out);
+}
+
+template <typename Context, typename T>
+constexpr auto has_const_formatter_impl(T*)
+    -> decltype(typename Context::template formatter_type<T>().format(
+                    std::declval<const T&>(), std::declval<Context&>()),
+                true) {
+  return true;
+}
+template <typename Context>
+constexpr auto has_const_formatter_impl(...) -> bool {
+  return false;
+}
+template <typename T, typename Context>
+constexpr auto has_const_formatter() -> bool {
+  return has_const_formatter_impl<Context>(static_cast<T*>(nullptr));
+}
+
+template <typename It, typename Enable = std::true_type>
+struct is_buffer_appender : std::false_type {};
+template <typename It>
+struct is_buffer_appender<
+    It, bool_constant<
+            is_back_insert_iterator<It>::value &&
+            std::is_base_of<buffer<typename It::container_type::value_type>,
+                            typename It::container_type>::value>>
+    : std::true_type {};
+
+// Maps an output iterator to a buffer.
+template <typename T, typename OutputIt,
+          FMT_ENABLE_IF(!is_buffer_appender<OutputIt>::value)>
+auto get_buffer(OutputIt out) -> iterator_buffer<OutputIt, T> {
+  return iterator_buffer<OutputIt, T>(out);
+}
+template <typename T, typename OutputIt,
+          FMT_ENABLE_IF(is_buffer_appender<OutputIt>::value)>
+auto get_buffer(OutputIt out) -> buffer<T>& {
+  return get_container(out);
+}
+
+template <typename Buf, typename OutputIt>
+auto get_iterator(Buf& buf, OutputIt) -> decltype(buf.out()) {
+  return buf.out();
+}
+template <typename T, typename OutputIt>
+auto get_iterator(buffer<T>&, OutputIt out) -> OutputIt {
+  return out;
+}
+
+struct view {};
+
+template <typename Char, typename T> struct named_arg : view {
+  const Char* name;
+  const T& value;
+  named_arg(const Char* n, const T& v) : name(n), value(v) {}
+};
+
+template <typename Char> struct named_arg_info {
+  const Char* name;
+  int id;
+};
+
+template <typename T> struct is_named_arg : std::false_type {};
+template <typename T> struct is_statically_named_arg : std::false_type {};
+
+template <typename T, typename Char>
+struct is_named_arg<named_arg<Char, T>> : std::true_type {};
+
+template <bool B = false> constexpr auto count() -> size_t { return B ? 1 : 0; }
+template <bool B1, bool B2, bool... Tail> constexpr auto count() -> size_t {
+  return (B1 ? 1 : 0) + count<B2, Tail...>();
+}
+
+template <typename... Args> constexpr auto count_named_args() -> size_t {
+  return count<is_named_arg<Args>::value...>();
+}
+
+template <typename... Args>
+constexpr auto count_statically_named_args() -> size_t {
+  return count<is_statically_named_arg<Args>::value...>();
+}
+
+struct unformattable {};
+struct unformattable_char : unformattable {};
+struct unformattable_pointer : unformattable {};
+
+template <typename Char> struct string_value {
+  const Char* data;
+  size_t size;
+};
+
+template <typename Char> struct named_arg_value {
+  const named_arg_info<Char>* data;
+  size_t size;
+};
+
+template <typename Context> struct custom_value {
+  using parse_context = typename Context::parse_context_type;
+  void* value;
+  void (*format)(void* arg, parse_context& parse_ctx, Context& ctx);
+};
+
+// A formatting argument value.
+template <typename Context> class value {
+ public:
+  using char_type = typename Context::char_type;
+
+  union {
+    monostate no_value;
+    int int_value;
+    unsigned uint_value;
+    long long long_long_value;
+    unsigned long long ulong_long_value;
+    int128_opt int128_value;
+    uint128_opt uint128_value;
+    bool bool_value;
+    char_type char_value;
+    float float_value;
+    double double_value;
+    long double long_double_value;
+    const void* pointer;
+    string_value<char_type> string;
+    custom_value<Context> custom;
+    named_arg_value<char_type> named_args;
+  };
+
+  constexpr FMT_ALWAYS_INLINE value() : no_value() {}
+  constexpr FMT_ALWAYS_INLINE value(int val) : int_value(val) {}
+  constexpr FMT_ALWAYS_INLINE value(unsigned val) : uint_value(val) {}
+  constexpr FMT_ALWAYS_INLINE value(long long val) : long_long_value(val) {}
+  constexpr FMT_ALWAYS_INLINE value(unsigned long long val)
+      : ulong_long_value(val) {}
+  FMT_ALWAYS_INLINE value(int128_opt val) : int128_value(val) {}
+  FMT_ALWAYS_INLINE value(uint128_opt val) : uint128_value(val) {}
+  constexpr FMT_ALWAYS_INLINE value(float val) : float_value(val) {}
+  constexpr FMT_ALWAYS_INLINE value(double val) : double_value(val) {}
+  FMT_ALWAYS_INLINE value(long double val) : long_double_value(val) {}
+  constexpr FMT_ALWAYS_INLINE value(bool val) : bool_value(val) {}
+  constexpr FMT_ALWAYS_INLINE value(char_type val) : char_value(val) {}
+  FMT_CONSTEXPR FMT_ALWAYS_INLINE value(const char_type* val) {
+    string.data = val;
+    if (is_constant_evaluated()) string.size = {};
+  }
+  FMT_CONSTEXPR FMT_ALWAYS_INLINE value(basic_string_view<char_type> val) {
+    string.data = val.data();
+    string.size = val.size();
+  }
+  FMT_ALWAYS_INLINE value(const void* val) : pointer(val) {}
+  FMT_ALWAYS_INLINE value(const named_arg_info<char_type>* args, size_t size)
+      : named_args{args, size} {}
+
+  template <typename T> FMT_CONSTEXPR20 FMT_ALWAYS_INLINE value(T& val) {
+    using value_type = remove_const_t<T>;
+    // T may overload operator& e.g. std::vector<bool>::reference in libc++.
+#if defined(__cpp_if_constexpr)
+    if constexpr (std::is_same<decltype(&val), T*>::value)
+      custom.value = const_cast<value_type*>(&val);
+#endif
+    if (!is_constant_evaluated())
+      custom.value = const_cast<char*>(&reinterpret_cast<const char&>(val));
+    // Get the formatter type through the context to allow different contexts
+    // have different extension points, e.g. `formatter<T>` for `format` and
+    // `printf_formatter<T>` for `printf`.
+    custom.format = format_custom_arg<
+        value_type, typename Context::template formatter_type<value_type>>;
+  }
+  value(unformattable);
+  value(unformattable_char);
+  value(unformattable_pointer);
+
+ private:
+  // Formats an argument of a custom type, such as a user-defined class.
+  template <typename T, typename Formatter>
+  static void format_custom_arg(void* arg,
+                                typename Context::parse_context_type& parse_ctx,
+                                Context& ctx) {
+    auto f = Formatter();
+    parse_ctx.advance_to(f.parse(parse_ctx));
+    using qualified_type =
+        conditional_t<has_const_formatter<T, Context>(), const T, T>;
+    // format must be const for compatibility with std::format and compilation.
+    const auto& cf = f;
+    ctx.advance_to(cf.format(*static_cast<qualified_type*>(arg), ctx));
+  }
+};
+
+// To minimize the number of types we need to deal with, long is translated
+// either to int or to long long depending on its size.
+enum { long_short = sizeof(long) == sizeof(int) };
+using long_type = conditional_t<long_short, int, long long>;
+using ulong_type = conditional_t<long_short, unsigned, unsigned long long>;
+
+template <typename T> struct format_as_result {
+  template <typename U,
+            FMT_ENABLE_IF(std::is_enum<U>::value || std::is_class<U>::value)>
+  static auto map(U*) -> remove_cvref_t<decltype(format_as(std::declval<U>()))>;
+  static auto map(...) -> void;
+
+  using type = decltype(map(static_cast<T*>(nullptr)));
+};
+template <typename T> using format_as_t = typename format_as_result<T>::type;
+
+template <typename T>
+struct has_format_as
+    : bool_constant<!std::is_same<format_as_t<T>, void>::value> {};
+
+#define FMT_MAP_API FMT_CONSTEXPR FMT_ALWAYS_INLINE
+
+// Maps formatting arguments to core types.
+// arg_mapper reports errors by returning unformattable instead of using
+// static_assert because it's used in the is_formattable trait.
+template <typename Context> struct arg_mapper {
+  using char_type = typename Context::char_type;
+
+  FMT_MAP_API auto map(signed char val) -> int { return val; }
+  FMT_MAP_API auto map(unsigned char val) -> unsigned { return val; }
+  FMT_MAP_API auto map(short val) -> int { return val; }
+  FMT_MAP_API auto map(unsigned short val) -> unsigned { return val; }
+  FMT_MAP_API auto map(int val) -> int { return val; }
+  FMT_MAP_API auto map(unsigned val) -> unsigned { return val; }
+  FMT_MAP_API auto map(long val) -> long_type { return val; }
+  FMT_MAP_API auto map(unsigned long val) -> ulong_type { return val; }
+  FMT_MAP_API auto map(long long val) -> long long { return val; }
+  FMT_MAP_API auto map(unsigned long long val) -> unsigned long long {
+    return val;
+  }
+  FMT_MAP_API auto map(int128_opt val) -> int128_opt { return val; }
+  FMT_MAP_API auto map(uint128_opt val) -> uint128_opt { return val; }
+  FMT_MAP_API auto map(bool val) -> bool { return val; }
+
+  template <typename T, FMT_ENABLE_IF(std::is_same<T, char>::value ||
+                                      std::is_same<T, char_type>::value)>
+  FMT_MAP_API auto map(T val) -> char_type {
+    return val;
+  }
+  template <typename T, enable_if_t<(std::is_same<T, wchar_t>::value ||
+#ifdef __cpp_char8_t
+                                     std::is_same<T, char8_t>::value ||
+#endif
+                                     std::is_same<T, char16_t>::value ||
+                                     std::is_same<T, char32_t>::value) &&
+                                        !std::is_same<T, char_type>::value,
+                                    int> = 0>
+  FMT_MAP_API auto map(T) -> unformattable_char {
+    return {};
+  }
+
+  FMT_MAP_API auto map(float val) -> float { return val; }
+  FMT_MAP_API auto map(double val) -> double { return val; }
+  FMT_MAP_API auto map(long double val) -> long double { return val; }
+
+  FMT_MAP_API auto map(char_type* val) -> const char_type* { return val; }
+  FMT_MAP_API auto map(const char_type* val) -> const char_type* { return val; }
+  template <typename T, typename Char = char_t<T>,
+            FMT_ENABLE_IF(std::is_same<Char, char_type>::value &&
+                          !std::is_pointer<T>::value)>
+  FMT_MAP_API auto map(const T& val) -> basic_string_view<Char> {
+    return to_string_view(val);
+  }
+  template <typename T, typename Char = char_t<T>,
+            FMT_ENABLE_IF(!std::is_same<Char, char_type>::value &&
+                          !std::is_pointer<T>::value)>
+  FMT_MAP_API auto map(const T&) -> unformattable_char {
+    return {};
+  }
+
+  FMT_MAP_API auto map(void* val) -> const void* { return val; }
+  FMT_MAP_API auto map(const void* val) -> const void* { return val; }
+  FMT_MAP_API auto map(volatile void* val) -> const void* {
+    return const_cast<const void*>(val);
+  }
+  FMT_MAP_API auto map(const volatile void* val) -> const void* {
+    return const_cast<const void*>(val);
+  }
+  FMT_MAP_API auto map(std::nullptr_t val) -> const void* { return val; }
+
+  // Use SFINAE instead of a const T* parameter to avoid a conflict with the
+  // array overload.
+  template <
+      typename T,
+      FMT_ENABLE_IF(
+          std::is_pointer<T>::value || std::is_member_pointer<T>::value ||
+          std::is_function<typename std::remove_pointer<T>::type>::value ||
+          (std::is_array<T>::value &&
+           !std::is_convertible<T, const char_type*>::value))>
+  FMT_CONSTEXPR auto map(const T&) -> unformattable_pointer {
+    return {};
+  }
+
+  template <typename T, std::size_t N,
+            FMT_ENABLE_IF(!std::is_same<T, wchar_t>::value)>
+  FMT_MAP_API auto map(const T (&values)[N]) -> const T (&)[N] {
+    return values;
+  }
+
+  // Only map owning types because mapping views can be unsafe.
+  template <typename T, typename U = format_as_t<T>,
+            FMT_ENABLE_IF(std::is_arithmetic<U>::value)>
+  FMT_MAP_API auto map(const T& val) -> decltype(FMT_DECLTYPE_THIS map(U())) {
+    return map(format_as(val));
+  }
+
+  template <typename T, typename U = remove_const_t<T>>
+  struct formattable : bool_constant<has_const_formatter<U, Context>() ||
+                                     (has_formatter<U, Context>::value &&
+                                      !std::is_const<T>::value)> {};
+
+  template <typename T, FMT_ENABLE_IF(formattable<T>::value)>
+  FMT_MAP_API auto do_map(T& val) -> T& {
+    return val;
+  }
+  template <typename T, FMT_ENABLE_IF(!formattable<T>::value)>
+  FMT_MAP_API auto do_map(T&) -> unformattable {
+    return {};
+  }
+
+  // is_fundamental is used to allow formatters for extended FP types.
+  template <typename T, typename U = remove_const_t<T>,
+            FMT_ENABLE_IF(
+                (std::is_class<U>::value || std::is_enum<U>::value ||
+                 std::is_union<U>::value || std::is_fundamental<U>::value) &&
+                !has_to_string_view<U>::value && !is_char<U>::value &&
+                !is_named_arg<U>::value && !std::is_integral<U>::value &&
+                !std::is_arithmetic<format_as_t<U>>::value)>
+  FMT_MAP_API auto map(T& val) -> decltype(FMT_DECLTYPE_THIS do_map(val)) {
+    return do_map(val);
+  }
+
+  template <typename T, FMT_ENABLE_IF(is_named_arg<T>::value)>
+  FMT_MAP_API auto map(const T& named_arg)
+      -> decltype(FMT_DECLTYPE_THIS map(named_arg.value)) {
+    return map(named_arg.value);
+  }
+
+  auto map(...) -> unformattable { return {}; }
+};
+
+// A type constant after applying arg_mapper<Context>.
+template <typename T, typename Context>
+using mapped_type_constant =
+    type_constant<decltype(arg_mapper<Context>().map(std::declval<const T&>())),
+                  typename Context::char_type>;
+
+enum { packed_arg_bits = 4 };
+// Maximum number of arguments with packed types.
+enum { max_packed_args = 62 / packed_arg_bits };
+enum : unsigned long long { is_unpacked_bit = 1ULL << 63 };
+enum : unsigned long long { has_named_args_bit = 1ULL << 62 };
+
+template <typename It, typename T, typename Enable = void>
+struct is_output_iterator : std::false_type {};
+
+template <> struct is_output_iterator<appender, char> : std::true_type {};
+
+template <typename It, typename T>
+struct is_output_iterator<
+    It, T, void_t<decltype(*std::declval<It&>()++ = std::declval<T>())>>
+    : std::true_type {};
+
+// A type-erased reference to an std::locale to avoid a heavy <locale> include.
+class locale_ref {
+ private:
+  const void* locale_;  // A type-erased pointer to std::locale.
+
+ public:
+  constexpr locale_ref() : locale_(nullptr) {}
+  template <typename Locale> explicit locale_ref(const Locale& loc);
+
+  explicit operator bool() const noexcept { return locale_ != nullptr; }
+
+  template <typename Locale> auto get() const -> Locale;
+};
+
+template <typename> constexpr auto encode_types() -> unsigned long long {
+  return 0;
+}
+
+template <typename Context, typename Arg, typename... Args>
+constexpr auto encode_types() -> unsigned long long {
+  return static_cast<unsigned>(mapped_type_constant<Arg, Context>::value) |
+         (encode_types<Context, Args...>() << packed_arg_bits);
+}
+
+template <typename Context, typename... T, size_t NUM_ARGS = sizeof...(T)>
+constexpr unsigned long long make_descriptor() {
+  return NUM_ARGS <= max_packed_args ? encode_types<Context, T...>()
+                                     : is_unpacked_bit | NUM_ARGS;
+}
+
+// This type is intentionally undefined, only used for errors.
+template <typename T, typename Char>
+#if FMT_CLANG_VERSION && FMT_CLANG_VERSION <= 1500
+// https://github.com/fmtlib/fmt/issues/3796
+struct type_is_unformattable_for {
+};
+#else
+struct type_is_unformattable_for;
+#endif
+
+template <bool PACKED, typename Context, typename T, FMT_ENABLE_IF(PACKED)>
+FMT_CONSTEXPR auto make_arg(T& val) -> value<Context> {
+  using arg_type = remove_cvref_t<decltype(arg_mapper<Context>().map(val))>;
+
+  // Use enum instead of constexpr because the latter may generate code.
+  enum {
+    formattable_char = !std::is_same<arg_type, unformattable_char>::value
+  };
+  static_assert(formattable_char, "Mixing character types is disallowed.");
+
+  // Formatting of arbitrary pointers is disallowed. If you want to format a
+  // pointer cast it to `void*` or `const void*`. In particular, this forbids
+  // formatting of `[const] volatile char*` printed as bool by iostreams.
+  enum {
+    formattable_pointer = !std::is_same<arg_type, unformattable_pointer>::value
+  };
+  static_assert(formattable_pointer,
+                "Formatting of non-void pointers is disallowed.");
+
+  enum { formattable = !std::is_same<arg_type, unformattable>::value };
+#if defined(__cpp_if_constexpr)
+  if constexpr (!formattable)
+   [[maybe_unused]] type_is_unformattable_for<T, typename Context::char_type> _;
+#endif
+  static_assert(
+      formattable,
+      "Cannot format an argument. To make type T formattable provide a "
+      "formatter<T> specialization: https://fmt.dev/latest/api.html#udt");
+  return {arg_mapper<Context>().map(val)};
+}
+
+template <typename Context, typename T>
+FMT_CONSTEXPR auto make_arg(T& val) -> basic_format_arg<Context> {
+  auto arg = basic_format_arg<Context>();
+  arg.type_ = mapped_type_constant<T, Context>::value;
+  arg.value_ = make_arg<true, Context>(val);
+  return arg;
+}
+
+template <bool PACKED, typename Context, typename T, FMT_ENABLE_IF(!PACKED)>
+FMT_CONSTEXPR inline auto make_arg(T& val) -> basic_format_arg<Context> {
+  return make_arg<Context>(val);
+}
+
+template <typename Context, size_t NUM_ARGS>
+using arg_t = conditional_t<NUM_ARGS <= max_packed_args, value<Context>,
+                            basic_format_arg<Context>>;
+
+template <typename Char, typename T, FMT_ENABLE_IF(!is_named_arg<T>::value)>
+void init_named_arg(named_arg_info<Char>*, int& arg_index, int&, const T&) {
+  ++arg_index;
+}
+template <typename Char, typename T, FMT_ENABLE_IF(is_named_arg<T>::value)>
+void init_named_arg(named_arg_info<Char>* named_args, int& arg_index,
+                    int& named_arg_index, const T& arg) {
+  named_args[named_arg_index++] = {arg.name, arg_index++};
+}
+
+// An array of references to arguments. It can be implicitly converted to
+// `fmt::basic_format_args` for passing into type-erased formatting functions
+// such as `fmt::vformat`.
+template <typename Context, size_t NUM_ARGS, size_t NUM_NAMED_ARGS,
+          unsigned long long DESC>
+struct format_arg_store {
+  // args_[0].named_args points to named_args to avoid bloating format_args.
+  // +1 to workaround a bug in gcc 7.5 that causes duplicated-branches warning.
+  static constexpr size_t ARGS_ARR_SIZE = 1 + (NUM_ARGS != 0 ? NUM_ARGS : +1);
+
+  arg_t<Context, NUM_ARGS> args[ARGS_ARR_SIZE];
+  named_arg_info<typename Context::char_type> named_args[NUM_NAMED_ARGS];
+
+  template <typename... T>
+  FMT_MAP_API format_arg_store(T&... values)
+      : args{{named_args, NUM_NAMED_ARGS},
+             make_arg<NUM_ARGS <= max_packed_args, Context>(values)...} {
+    using dummy = int[];
+    int arg_index = 0, named_arg_index = 0;
+    (void)dummy{
+        0,
+        (init_named_arg(named_args, arg_index, named_arg_index, values), 0)...};
+  }
+
+  format_arg_store(format_arg_store&& rhs) {
+    args[0] = {named_args, NUM_NAMED_ARGS};
+    for (size_t i = 1; i < ARGS_ARR_SIZE; ++i) args[i] = rhs.args[i];
+    for (size_t i = 0; i < NUM_NAMED_ARGS; ++i)
+      named_args[i] = rhs.named_args[i];
+  }
+
+  format_arg_store(const format_arg_store& rhs) = delete;
+  format_arg_store& operator=(const format_arg_store& rhs) = delete;
+  format_arg_store& operator=(format_arg_store&& rhs) = delete;
+};
+
+// A specialization of format_arg_store without named arguments.
+// It is a plain struct to reduce binary size in debug mode.
+template <typename Context, size_t NUM_ARGS, unsigned long long DESC>
+struct format_arg_store<Context, NUM_ARGS, 0, DESC> {
+  // +1 to workaround a bug in gcc 7.5 that causes duplicated-branches warning.
+  arg_t<Context, NUM_ARGS> args[NUM_ARGS != 0 ? NUM_ARGS : +1];
+};
+
+}  // namespace detail
+FMT_BEGIN_EXPORT
+
+// A formatting argument. Context is a template parameter for the compiled API
+// where output can be unbuffered.
+template <typename Context> class basic_format_arg {
+ private:
+  detail::value<Context> value_;
+  detail::type type_;
+
+  template <typename ContextType, typename T>
+  friend FMT_CONSTEXPR auto detail::make_arg(T& value)
+      -> basic_format_arg<ContextType>;
+
+  friend class basic_format_args<Context>;
+  friend class dynamic_format_arg_store<Context>;
+
+  using char_type = typename Context::char_type;
+
+  template <typename, size_t, size_t, unsigned long long>
+  friend struct detail::format_arg_store;
+
+  basic_format_arg(const detail::named_arg_info<char_type>* args, size_t size)
+      : value_(args, size) {}
+
+ public:
+  class handle {
+   public:
+    explicit handle(detail::custom_value<Context> custom) : custom_(custom) {}
+
+    void format(typename Context::parse_context_type& parse_ctx,
+                Context& ctx) const {
+      custom_.format(custom_.value, parse_ctx, ctx);
+    }
+
+   private:
+    detail::custom_value<Context> custom_;
+  };
+
+  constexpr basic_format_arg() : type_(detail::type::none_type) {}
+
+  constexpr explicit operator bool() const noexcept {
+    return type_ != detail::type::none_type;
+  }
+
+  auto type() const -> detail::type { return type_; }
+
+  auto is_integral() const -> bool { return detail::is_integral_type(type_); }
+  auto is_arithmetic() const -> bool {
+    return detail::is_arithmetic_type(type_);
+  }
+
+  /**
+   * Visits an argument dispatching to the appropriate visit method based on
+   * the argument type. For example, if the argument type is `double` then
+   * `vis(value)` will be called with the value of type `double`.
+   */
+  template <typename Visitor>
+  FMT_CONSTEXPR FMT_INLINE auto visit(Visitor&& vis) const -> decltype(vis(0)) {
+    switch (type_) {
+    case detail::type::none_type:
+      break;
+    case detail::type::int_type:
+      return vis(value_.int_value);
+    case detail::type::uint_type:
+      return vis(value_.uint_value);
+    case detail::type::long_long_type:
+      return vis(value_.long_long_value);
+    case detail::type::ulong_long_type:
+      return vis(value_.ulong_long_value);
+    case detail::type::int128_type:
+      return vis(detail::convert_for_visit(value_.int128_value));
+    case detail::type::uint128_type:
+      return vis(detail::convert_for_visit(value_.uint128_value));
+    case detail::type::bool_type:
+      return vis(value_.bool_value);
+    case detail::type::char_type:
+      return vis(value_.char_value);
+    case detail::type::float_type:
+      return vis(value_.float_value);
+    case detail::type::double_type:
+      return vis(value_.double_value);
+    case detail::type::long_double_type:
+      return vis(value_.long_double_value);
+    case detail::type::cstring_type:
+      return vis(value_.string.data);
+    case detail::type::string_type:
+      using sv = basic_string_view<typename Context::char_type>;
+      return vis(sv(value_.string.data, value_.string.size));
+    case detail::type::pointer_type:
+      return vis(value_.pointer);
+    case detail::type::custom_type:
+      return vis(typename basic_format_arg<Context>::handle(value_.custom));
+    }
+    return vis(monostate());
+  }
+
+  auto format_custom(const char_type* parse_begin,
+                     typename Context::parse_context_type& parse_ctx,
+                     Context& ctx) -> bool {
+    if (type_ != detail::type::custom_type) return false;
+    parse_ctx.advance_to(parse_begin);
+    value_.custom.format(value_.custom.value, parse_ctx, ctx);
+    return true;
+  }
+};
+
+template <typename Visitor, typename Context>
+FMT_DEPRECATED FMT_CONSTEXPR auto visit_format_arg(
+    Visitor&& vis, const basic_format_arg<Context>& arg) -> decltype(vis(0)) {
+  return arg.visit(static_cast<Visitor&&>(vis));
+}
+
+/**
+ * A view of a collection of formatting arguments. To avoid lifetime issues it
+ * should only be used as a parameter type in type-erased functions such as
+ * `vformat`:
+ *
+ *     void vlog(fmt::string_view fmt, fmt::format_args args);  // OK
+ *     fmt::format_args args = fmt::make_format_args();  // Dangling reference
+ */
+template <typename Context> class basic_format_args {
+ public:
+  using size_type = int;
+  using format_arg = basic_format_arg<Context>;
+
+ private:
+  // A descriptor that contains information about formatting arguments.
+  // If the number of arguments is less or equal to max_packed_args then
+  // argument types are passed in the descriptor. This reduces binary code size
+  // per formatting function call.
+  unsigned long long desc_;
+  union {
+    // If is_packed() returns true then argument values are stored in values_;
+    // otherwise they are stored in args_. This is done to improve cache
+    // locality and reduce compiled code size since storing larger objects
+    // may require more code (at least on x86-64) even if the same amount of
+    // data is actually copied to stack. It saves ~10% on the bloat test.
+    const detail::value<Context>* values_;
+    const format_arg* args_;
+  };
+
+  constexpr auto is_packed() const -> bool {
+    return (desc_ & detail::is_unpacked_bit) == 0;
+  }
+  constexpr auto has_named_args() const -> bool {
+    return (desc_ & detail::has_named_args_bit) != 0;
+  }
+
+  FMT_CONSTEXPR auto type(int index) const -> detail::type {
+    int shift = index * detail::packed_arg_bits;
+    unsigned int mask = (1 << detail::packed_arg_bits) - 1;
+    return static_cast<detail::type>((desc_ >> shift) & mask);
+  }
+
+ public:
+  constexpr basic_format_args() : desc_(0), args_(nullptr) {}
+
+  /// Constructs a `basic_format_args` object from `format_arg_store`.
+  template <size_t NUM_ARGS, size_t NUM_NAMED_ARGS, unsigned long long DESC,
+            FMT_ENABLE_IF(NUM_ARGS <= detail::max_packed_args)>
+  constexpr FMT_ALWAYS_INLINE basic_format_args(
+      const detail::format_arg_store<Context, NUM_ARGS, NUM_NAMED_ARGS, DESC>&
+          store)
+      : desc_(DESC), values_(store.args + (NUM_NAMED_ARGS != 0 ? 1 : 0)) {}
+
+  template <size_t NUM_ARGS, size_t NUM_NAMED_ARGS, unsigned long long DESC,
+            FMT_ENABLE_IF(NUM_ARGS > detail::max_packed_args)>
+  constexpr basic_format_args(
+      const detail::format_arg_store<Context, NUM_ARGS, NUM_NAMED_ARGS, DESC>&
+          store)
+      : desc_(DESC), args_(store.args + (NUM_NAMED_ARGS != 0 ? 1 : 0)) {}
+
+  /// Constructs a `basic_format_args` object from `dynamic_format_arg_store`.
+  constexpr basic_format_args(const dynamic_format_arg_store<Context>& store)
+      : desc_(store.get_types()), args_(store.data()) {}
+
+  /// Constructs a `basic_format_args` object from a dynamic list of arguments.
+  constexpr basic_format_args(const format_arg* args, int count)
+      : desc_(detail::is_unpacked_bit | detail::to_unsigned(count)),
+        args_(args) {}
+
+  /// Returns the argument with the specified id.
+  FMT_CONSTEXPR auto get(int id) const -> format_arg {
+    format_arg arg;
+    if (!is_packed()) {
+      if (id < max_size()) arg = args_[id];
+      return arg;
+    }
+    if (static_cast<unsigned>(id) >= detail::max_packed_args) return arg;
+    arg.type_ = type(id);
+    if (arg.type_ == detail::type::none_type) return arg;
+    arg.value_ = values_[id];
+    return arg;
+  }
+
+  template <typename Char>
+  auto get(basic_string_view<Char> name) const -> format_arg {
+    int id = get_id(name);
+    return id >= 0 ? get(id) : format_arg();
+  }
+
+  template <typename Char>
+  FMT_CONSTEXPR auto get_id(basic_string_view<Char> name) const -> int {
+    if (!has_named_args()) return -1;
+    const auto& named_args =
+        (is_packed() ? values_[-1] : args_[-1].value_).named_args;
+    for (size_t i = 0; i < named_args.size; ++i) {
+      if (named_args.data[i].name == name) return named_args.data[i].id;
+    }
+    return -1;
+  }
+
+  auto max_size() const -> int {
+    unsigned long long max_packed = detail::max_packed_args;
+    return static_cast<int>(is_packed() ? max_packed
+                                        : desc_ & ~detail::is_unpacked_bit);
+  }
+};
+
+// A formatting context.
+class context {
+ private:
+  appender out_;
+  basic_format_args<context> args_;
+  detail::locale_ref loc_;
+
+ public:
+  /// The character type for the output.
+  using char_type = char;
+
+  using iterator = appender;
+  using format_arg = basic_format_arg<context>;
+  using parse_context_type = basic_format_parse_context<char>;
+  template <typename T> using formatter_type = formatter<T, char>;
+
+  /// Constructs a `basic_format_context` object. References to the arguments
+  /// are stored in the object so make sure they have appropriate lifetimes.
+  FMT_CONSTEXPR context(iterator out, basic_format_args<context> ctx_args,
+                        detail::locale_ref loc = {})
+      : out_(out), args_(ctx_args), loc_(loc) {}
+  context(context&&) = default;
+  context(const context&) = delete;
+  void operator=(const context&) = delete;
+
+  FMT_CONSTEXPR auto arg(int id) const -> format_arg { return args_.get(id); }
+  auto arg(string_view name) -> format_arg { return args_.get(name); }
+  FMT_CONSTEXPR auto arg_id(string_view name) -> int {
+    return args_.get_id(name);
+  }
+  auto args() const -> const basic_format_args<context>& { return args_; }
+
+  // Returns an iterator to the beginning of the output range.
+  FMT_CONSTEXPR auto out() -> iterator { return out_; }
+
+  // Advances the begin iterator to `it`.
+  void advance_to(iterator) {}
+
+  FMT_CONSTEXPR auto locale() -> detail::locale_ref { return loc_; }
+};
+
+template <typename OutputIt, typename Char> class generic_context;
+
+// Longer aliases for C++20 compatibility.
+template <typename OutputIt, typename Char>
+using basic_format_context =
+    conditional_t<std::is_same<OutputIt, appender>::value, context,
+                  generic_context<OutputIt, Char>>;
+using format_context = context;
+
+template <typename Char>
+using buffered_context = basic_format_context<basic_appender<Char>, Char>;
+
+template <typename T, typename Char = char>
+using is_formattable = bool_constant<!std::is_base_of<
+    detail::unformattable, decltype(detail::arg_mapper<buffered_context<Char>>()
+                                        .map(std::declval<T&>()))>::value>;
+
+#if FMT_USE_CONCEPTS
+template <typename T, typename Char = char>
+concept formattable = is_formattable<remove_reference_t<T>, Char>::value;
+#endif
+
+/**
+ * Constructs an object that stores references to arguments and can be
+ * implicitly converted to `format_args`. `Context` can be omitted in which case
+ * it defaults to `format_context`. See `arg` for lifetime considerations.
+ */
+// Take arguments by lvalue references to avoid some lifetime issues, e.g.
+//   auto args = make_format_args(std::string());
+template <typename Context = format_context, typename... T,
+          size_t NUM_ARGS = sizeof...(T),
+          size_t NUM_NAMED_ARGS = detail::count_named_args<T...>(),
+          unsigned long long DESC = detail::make_descriptor<Context, T...>(),
+          FMT_ENABLE_IF(NUM_NAMED_ARGS == 0)>
+constexpr FMT_ALWAYS_INLINE auto make_format_args(T&... args)
+    -> detail::format_arg_store<Context, NUM_ARGS, 0, DESC> {
+  return {{detail::make_arg<NUM_ARGS <= detail::max_packed_args, Context>(
+      args)...}};
+}
+
+#ifndef FMT_DOC
+template <typename Context = format_context, typename... T,
+          size_t NUM_NAMED_ARGS = detail::count_named_args<T...>(),
+          unsigned long long DESC =
+              detail::make_descriptor<Context, T...>() |
+              static_cast<unsigned long long>(detail::has_named_args_bit),
+          FMT_ENABLE_IF(NUM_NAMED_ARGS != 0)>
+constexpr auto make_format_args(T&... args)
+    -> detail::format_arg_store<Context, sizeof...(T), NUM_NAMED_ARGS, DESC> {
+  return {args...};
+}
+#endif
+
+/**
+ * Returns a named argument to be used in a formatting function.
+ * It should only be used in a call to a formatting function or
+ * `dynamic_format_arg_store::push_back`.
+ *
+ * **Example**:
+ *
+ *     fmt::print("The answer is {answer}.", fmt::arg("answer", 42));
+ */
+template <typename Char, typename T>
+inline auto arg(const Char* name, const T& arg) -> detail::named_arg<Char, T> {
+  static_assert(!detail::is_named_arg<T>(), "nested named arguments");
+  return {name, arg};
+}
+FMT_END_EXPORT
+
+/// An alias for `basic_format_args<format_context>`.
+// A separate type would result in shorter symbols but break ABI compatibility
+// between clang and gcc on ARM (#1919).
+FMT_EXPORT using format_args = basic_format_args<format_context>;
+
+// We cannot use enum classes as bit fields because of a gcc bug, so we put them
+// in namespaces instead (https://gcc.gnu.org/bugzilla/show_bug.cgi?id=61414).
+// Additionally, if an underlying type is specified, older gcc incorrectly warns
+// that the type is too small. Both bugs are fixed in gcc 9.3.
+#if FMT_GCC_VERSION && FMT_GCC_VERSION < 903
+#  define FMT_ENUM_UNDERLYING_TYPE(type)
+#else
+#  define FMT_ENUM_UNDERLYING_TYPE(type) : type
+#endif
+namespace align {
+enum type FMT_ENUM_UNDERLYING_TYPE(unsigned char){none, left, right, center,
+                                                  numeric};
+}
+using align_t = align::type;
+namespace sign {
+enum type FMT_ENUM_UNDERLYING_TYPE(unsigned char){none, minus, plus, space};
+}
+using sign_t = sign::type;
+
+namespace detail {
+
+template <typename Char>
+using unsigned_char = typename conditional_t<std::is_integral<Char>::value,
+                                             std::make_unsigned<Char>,
+                                             type_identity<unsigned>>::type;
+
+// Character (code unit) type is erased to prevent template bloat.
+struct fill_t {
+ private:
+  enum { max_size = 4 };
+  char data_[max_size] = {' '};
+  unsigned char size_ = 1;
+
+ public:
+  template <typename Char>
+  FMT_CONSTEXPR void operator=(basic_string_view<Char> s) {
+    auto size = s.size();
+    size_ = static_cast<unsigned char>(size);
+    if (size == 1) {
+      unsigned uchar = static_cast<unsigned_char<Char>>(s[0]);
+      data_[0] = static_cast<char>(uchar);
+      data_[1] = static_cast<char>(uchar >> 8);
+      return;
+    }
+    FMT_ASSERT(size <= max_size, "invalid fill");
+    for (size_t i = 0; i < size; ++i) data_[i] = static_cast<char>(s[i]);
+  }
+
+  FMT_CONSTEXPR void operator=(char c) {
+    data_[0] = c;
+    size_ = 1;
+  }
+
+  constexpr auto size() const -> size_t { return size_; }
+
+  template <typename Char> constexpr auto get() const -> Char {
+    using uchar = unsigned char;
+    return static_cast<Char>(static_cast<uchar>(data_[0]) |
+                             (static_cast<uchar>(data_[1]) << 8));
+  }
+
+  template <typename Char, FMT_ENABLE_IF(std::is_same<Char, char>::value)>
+  constexpr auto data() const -> const Char* {
+    return data_;
+  }
+  template <typename Char, FMT_ENABLE_IF(!std::is_same<Char, char>::value)>
+  constexpr auto data() const -> const Char* {
+    return nullptr;
+  }
+};
+}  // namespace detail
+
+enum class presentation_type : unsigned char {
+  // Common specifiers:
+  none = 0,
+  debug = 1,   // '?'
+  string = 2,  // 's' (string, bool)
+
+  // Integral, bool and character specifiers:
+  dec = 3,  // 'd'
+  hex,      // 'x' or 'X'
+  oct,      // 'o'
+  bin,      // 'b' or 'B'
+  chr,      // 'c'
+
+  // String and pointer specifiers:
+  pointer = 3,  // 'p'
+
+  // Floating-point specifiers:
+  exp = 1,  // 'e' or 'E' (1 since there is no FP debug presentation)
+  fixed,    // 'f' or 'F'
+  general,  // 'g' or 'G'
+  hexfloat  // 'a' or 'A'
+};
+
+// Format specifiers for built-in and string types.
+struct format_specs {
+  int width;
+  int precision;
+  presentation_type type;
+  align_t align : 4;
+  sign_t sign : 3;
+  bool upper : 1;  // An uppercase version e.g. 'X' for 'x'.
+  bool alt : 1;    // Alternate form ('#').
+  bool localized : 1;
+  detail::fill_t fill;
+
+  constexpr format_specs()
+      : width(0),
+        precision(-1),
+        type(presentation_type::none),
+        align(align::none),
+        sign(sign::none),
+        upper(false),
+        alt(false),
+        localized(false) {}
+};
+
+namespace detail {
+
+enum class arg_id_kind { none, index, name };
+
+// An argument reference.
+template <typename Char> struct arg_ref {
+  FMT_CONSTEXPR arg_ref() : kind(arg_id_kind::none), val() {}
+
+  FMT_CONSTEXPR explicit arg_ref(int index)
+      : kind(arg_id_kind::index), val(index) {}
+  FMT_CONSTEXPR explicit arg_ref(basic_string_view<Char> name)
+      : kind(arg_id_kind::name), val(name) {}
+
+  FMT_CONSTEXPR auto operator=(int idx) -> arg_ref& {
+    kind = arg_id_kind::index;
+    val.index = idx;
+    return *this;
+  }
+
+  arg_id_kind kind;
+  union value {
+    FMT_CONSTEXPR value(int idx = 0) : index(idx) {}
+    FMT_CONSTEXPR value(basic_string_view<Char> n) : name(n) {}
+
+    int index;
+    basic_string_view<Char> name;
+  } val;
+};
+
+// Format specifiers with width and precision resolved at formatting rather
+// than parsing time to allow reusing the same parsed specifiers with
+// different sets of arguments (precompilation of format strings).
+template <typename Char = char> struct dynamic_format_specs : format_specs {
+  arg_ref<Char> width_ref;
+  arg_ref<Char> precision_ref;
+};
+
+// Converts a character to ASCII. Returns '\0' on conversion failure.
+template <typename Char, FMT_ENABLE_IF(std::is_integral<Char>::value)>
+constexpr auto to_ascii(Char c) -> char {
+  return c <= 0xff ? static_cast<char>(c) : '\0';
+}
+
+// Returns the number of code units in a code point or 1 on error.
+template <typename Char>
+FMT_CONSTEXPR auto code_point_length(const Char* begin) -> int {
+  if (const_check(sizeof(Char) != 1)) return 1;
+  auto c = static_cast<unsigned char>(*begin);
+  return static_cast<int>((0x3a55000000000000ull >> (2 * (c >> 3))) & 0x3) + 1;
+}
+
+// Return the result via the out param to workaround gcc bug 77539.
+template <bool IS_CONSTEXPR, typename T, typename Ptr = const T*>
+FMT_CONSTEXPR auto find(Ptr first, Ptr last, T value, Ptr& out) -> bool {
+  for (out = first; out != last; ++out) {
+    if (*out == value) return true;
+  }
+  return false;
+}
+
+template <>
+inline auto find<false, char>(const char* first, const char* last, char value,
+                              const char*& out) -> bool {
+  out =
+      static_cast<const char*>(memchr(first, value, to_unsigned(last - first)));
+  return out != nullptr;
+}
+
+// Parses the range [begin, end) as an unsigned integer. This function assumes
+// that the range is non-empty and the first character is a digit.
+template <typename Char>
+FMT_CONSTEXPR auto parse_nonnegative_int(const Char*& begin, const Char* end,
+                                         int error_value) noexcept -> int {
+  FMT_ASSERT(begin != end && '0' <= *begin && *begin <= '9', "");
+  unsigned value = 0, prev = 0;
+  auto p = begin;
+  do {
+    prev = value;
+    value = value * 10 + unsigned(*p - '0');
+    ++p;
+  } while (p != end && '0' <= *p && *p <= '9');
+  auto num_digits = p - begin;
+  begin = p;
+  int digits10 = static_cast<int>(sizeof(int) * CHAR_BIT * 3 / 10);
+  if (num_digits <= digits10) return static_cast<int>(value);
+  // Check for overflow.
+  unsigned max = INT_MAX;
+  return num_digits == digits10 + 1 &&
+                 prev * 10ull + unsigned(p[-1] - '0') <= max
+             ? static_cast<int>(value)
+             : error_value;
+}
+
+FMT_CONSTEXPR inline auto parse_align(char c) -> align_t {
+  switch (c) {
+  case '<':
+    return align::left;
+  case '>':
+    return align::right;
+  case '^':
+    return align::center;
+  }
+  return align::none;
+}
+
+template <typename Char> constexpr auto is_name_start(Char c) -> bool {
+  return ('a' <= c && c <= 'z') || ('A' <= c && c <= 'Z') || c == '_';
+}
+
+template <typename Char, typename Handler>
+FMT_CONSTEXPR auto do_parse_arg_id(const Char* begin, const Char* end,
+                                   Handler&& handler) -> const Char* {
+  Char c = *begin;
+  if (c >= '0' && c <= '9') {
+    int index = 0;
+    if (c != '0')
+      index = parse_nonnegative_int(begin, end, INT_MAX);
+    else
+      ++begin;
+    if (begin == end || (*begin != '}' && *begin != ':'))
+      report_error("invalid format string");
+    else
+      handler.on_index(index);
+    return begin;
+  }
+  if (!is_name_start(c)) {
+    report_error("invalid format string");
+    return begin;
+  }
+  auto it = begin;
+  do {
+    ++it;
+  } while (it != end && (is_name_start(*it) || ('0' <= *it && *it <= '9')));
+  handler.on_name({begin, to_unsigned(it - begin)});
+  return it;
+}
+
+template <typename Char, typename Handler>
+FMT_CONSTEXPR auto parse_arg_id(const Char* begin, const Char* end,
+                                Handler&& handler) -> const Char* {
+  FMT_ASSERT(begin != end, "");
+  Char c = *begin;
+  if (c != '}' && c != ':') return do_parse_arg_id(begin, end, handler);
+  handler.on_auto();
+  return begin;
+}
+
+template <typename Char> struct dynamic_spec_id_handler {
+  basic_format_parse_context<Char>& ctx;
+  arg_ref<Char>& ref;
+
+  FMT_CONSTEXPR void on_auto() {
+    int id = ctx.next_arg_id();
+    ref = arg_ref<Char>(id);
+    ctx.check_dynamic_spec(id);
+  }
+  FMT_CONSTEXPR void on_index(int id) {
+    ref = arg_ref<Char>(id);
+    ctx.check_arg_id(id);
+    ctx.check_dynamic_spec(id);
+  }
+  FMT_CONSTEXPR void on_name(basic_string_view<Char> id) {
+    ref = arg_ref<Char>(id);
+    ctx.check_arg_id(id);
+  }
+};
+
+// Parses [integer | "{" [arg_id] "}"].
+template <typename Char>
+FMT_CONSTEXPR auto parse_dynamic_spec(const Char* begin, const Char* end,
+                                      int& value, arg_ref<Char>& ref,
+                                      basic_format_parse_context<Char>& ctx)
+    -> const Char* {
+  FMT_ASSERT(begin != end, "");
+  if ('0' <= *begin && *begin <= '9') {
+    int val = parse_nonnegative_int(begin, end, -1);
+    if (val != -1)
+      value = val;
+    else
+      report_error("number is too big");
+  } else if (*begin == '{') {
+    ++begin;
+    auto handler = dynamic_spec_id_handler<Char>{ctx, ref};
+    if (begin != end) begin = parse_arg_id(begin, end, handler);
+    if (begin != end && *begin == '}') return ++begin;
+    report_error("invalid format string");
+  }
+  return begin;
+}
+
+template <typename Char>
+FMT_CONSTEXPR auto parse_precision(const Char* begin, const Char* end,
+                                   int& value, arg_ref<Char>& ref,
+                                   basic_format_parse_context<Char>& ctx)
+    -> const Char* {
+  ++begin;
+  if (begin == end || *begin == '}') {
+    report_error("invalid precision");
+    return begin;
+  }
+  return parse_dynamic_spec(begin, end, value, ref, ctx);
+}
+
+enum class state { start, align, sign, hash, zero, width, precision, locale };
+
+// Parses standard format specifiers.
+template <typename Char>
+FMT_CONSTEXPR auto parse_format_specs(const Char* begin, const Char* end,
+                                      dynamic_format_specs<Char>& specs,
+                                      basic_format_parse_context<Char>& ctx,
+                                      type arg_type) -> const Char* {
+  auto c = '\0';
+  if (end - begin > 1) {
+    auto next = to_ascii(begin[1]);
+    c = parse_align(next) == align::none ? to_ascii(*begin) : '\0';
+  } else {
+    if (begin == end) return begin;
+    c = to_ascii(*begin);
+  }
+
+  struct {
+    state current_state = state::start;
+    FMT_CONSTEXPR void operator()(state s, bool valid = true) {
+      if (current_state >= s || !valid)
+        report_error("invalid format specifier");
+      current_state = s;
+    }
+  } enter_state;
+
+  using pres = presentation_type;
+  constexpr auto integral_set = sint_set | uint_set | bool_set | char_set;
+  struct {
+    const Char*& begin;
+    dynamic_format_specs<Char>& specs;
+    type arg_type;
+
+    FMT_CONSTEXPR auto operator()(pres pres_type, int set) -> const Char* {
+      if (!in(arg_type, set)) {
+        if (arg_type == type::none_type) return begin;
+        report_error("invalid format specifier");
+      }
+      specs.type = pres_type;
+      return begin + 1;
+    }
+  } parse_presentation_type{begin, specs, arg_type};
+
+  for (;;) {
+    switch (c) {
+    case '<':
+    case '>':
+    case '^':
+      enter_state(state::align);
+      specs.align = parse_align(c);
+      ++begin;
+      break;
+    case '+':
+    case '-':
+    case ' ':
+      if (arg_type == type::none_type) return begin;
+      enter_state(state::sign, in(arg_type, sint_set | float_set));
+      switch (c) {
+      case '+':
+        specs.sign = sign::plus;
+        break;
+      case '-':
+        specs.sign = sign::minus;
+        break;
+      case ' ':
+        specs.sign = sign::space;
+        break;
+      }
+      ++begin;
+      break;
+    case '#':
+      if (arg_type == type::none_type) return begin;
+      enter_state(state::hash, is_arithmetic_type(arg_type));
+      specs.alt = true;
+      ++begin;
+      break;
+    case '0':
+      enter_state(state::zero);
+      if (!is_arithmetic_type(arg_type)) {
+        if (arg_type == type::none_type) return begin;
+        report_error("format specifier requires numeric argument");
+      }
+      if (specs.align == align::none) {
+        // Ignore 0 if align is specified for compatibility with std::format.
+        specs.align = align::numeric;
+        specs.fill = '0';
+      }
+      ++begin;
+      break;
+    case '1':
+    case '2':
+    case '3':
+    case '4':
+    case '5':
+    case '6':
+    case '7':
+    case '8':
+    case '9':
+    case '{':
+      enter_state(state::width);
+      begin = parse_dynamic_spec(begin, end, specs.width, specs.width_ref, ctx);
+      break;
+    case '.':
+      if (arg_type == type::none_type) return begin;
+      enter_state(state::precision,
+                  in(arg_type, float_set | string_set | cstring_set));
+      begin = parse_precision(begin, end, specs.precision, specs.precision_ref,
+                              ctx);
+      break;
+    case 'L':
+      if (arg_type == type::none_type) return begin;
+      enter_state(state::locale, is_arithmetic_type(arg_type));
+      specs.localized = true;
+      ++begin;
+      break;
+    case 'd':
+      return parse_presentation_type(pres::dec, integral_set);
+    case 'X':
+      specs.upper = true;
+      FMT_FALLTHROUGH;
+    case 'x':
+      return parse_presentation_type(pres::hex, integral_set);
+    case 'o':
+      return parse_presentation_type(pres::oct, integral_set);
+    case 'B':
+      specs.upper = true;
+      FMT_FALLTHROUGH;
+    case 'b':
+      return parse_presentation_type(pres::bin, integral_set);
+    case 'E':
+      specs.upper = true;
+      FMT_FALLTHROUGH;
+    case 'e':
+      return parse_presentation_type(pres::exp, float_set);
+    case 'F':
+      specs.upper = true;
+      FMT_FALLTHROUGH;
+    case 'f':
+      return parse_presentation_type(pres::fixed, float_set);
+    case 'G':
+      specs.upper = true;
+      FMT_FALLTHROUGH;
+    case 'g':
+      return parse_presentation_type(pres::general, float_set);
+    case 'A':
+      specs.upper = true;
+      FMT_FALLTHROUGH;
+    case 'a':
+      return parse_presentation_type(pres::hexfloat, float_set);
+    case 'c':
+      if (arg_type == type::bool_type) report_error("invalid format specifier");
+      return parse_presentation_type(pres::chr, integral_set);
+    case 's':
+      return parse_presentation_type(pres::string,
+                                     bool_set | string_set | cstring_set);
+    case 'p':
+      return parse_presentation_type(pres::pointer, pointer_set | cstring_set);
+    case '?':
+      return parse_presentation_type(pres::debug,
+                                     char_set | string_set | cstring_set);
+    case '}':
+      return begin;
+    default: {
+      if (*begin == '}') return begin;
+      // Parse fill and alignment.
+      auto fill_end = begin + code_point_length(begin);
+      if (end - fill_end <= 0) {
+        report_error("invalid format specifier");
+        return begin;
+      }
+      if (*begin == '{') {
+        report_error("invalid fill character '{'");
+        return begin;
+      }
+      auto align = parse_align(to_ascii(*fill_end));
+      enter_state(state::align, align != align::none);
+      specs.fill =
+          basic_string_view<Char>(begin, to_unsigned(fill_end - begin));
+      specs.align = align;
+      begin = fill_end + 1;
+    }
+    }
+    if (begin == end) return begin;
+    c = to_ascii(*begin);
+  }
+}
+
+template <typename Char, typename Handler>
+FMT_CONSTEXPR auto parse_replacement_field(const Char* begin, const Char* end,
+                                           Handler&& handler) -> const Char* {
+  struct id_adapter {
+    Handler& handler;
+    int arg_id;
+
+    FMT_CONSTEXPR void on_auto() { arg_id = handler.on_arg_id(); }
+    FMT_CONSTEXPR void on_index(int id) { arg_id = handler.on_arg_id(id); }
+    FMT_CONSTEXPR void on_name(basic_string_view<Char> id) {
+      arg_id = handler.on_arg_id(id);
+    }
+  };
+
+  ++begin;
+  if (begin == end) return handler.on_error("invalid format string"), end;
+  if (*begin == '}') {
+    handler.on_replacement_field(handler.on_arg_id(), begin);
+  } else if (*begin == '{') {
+    handler.on_text(begin, begin + 1);
+  } else {
+    auto adapter = id_adapter{handler, 0};
+    begin = parse_arg_id(begin, end, adapter);
+    Char c = begin != end ? *begin : Char();
+    if (c == '}') {
+      handler.on_replacement_field(adapter.arg_id, begin);
+    } else if (c == ':') {
+      begin = handler.on_format_specs(adapter.arg_id, begin + 1, end);
+      if (begin == end || *begin != '}')
+        return handler.on_error("unknown format specifier"), end;
+    } else {
+      return handler.on_error("missing '}' in format string"), end;
+    }
+  }
+  return begin + 1;
+}
+
+template <bool IS_CONSTEXPR, typename Char, typename Handler>
+FMT_CONSTEXPR void parse_format_string(basic_string_view<Char> format_str,
+                                       Handler&& handler) {
+  auto begin = format_str.data();
+  auto end = begin + format_str.size();
+  if (end - begin < 32) {
+    // Use a simple loop instead of memchr for small strings.
+    const Char* p = begin;
+    while (p != end) {
+      auto c = *p++;
+      if (c == '{') {
+        handler.on_text(begin, p - 1);
+        begin = p = parse_replacement_field(p - 1, end, handler);
+      } else if (c == '}') {
+        if (p == end || *p != '}')
+          return handler.on_error("unmatched '}' in format string");
+        handler.on_text(begin, p);
+        begin = ++p;
+      }
+    }
+    handler.on_text(begin, end);
+    return;
+  }
+  struct writer {
+    FMT_CONSTEXPR void operator()(const Char* from, const Char* to) {
+      if (from == to) return;
+      for (;;) {
+        const Char* p = nullptr;
+        if (!find<IS_CONSTEXPR>(from, to, Char('}'), p))
+          return handler_.on_text(from, to);
+        ++p;
+        if (p == to || *p != '}')
+          return handler_.on_error("unmatched '}' in format string");
+        handler_.on_text(from, p);
+        from = p + 1;
+      }
+    }
+    Handler& handler_;
+  } write = {handler};
+  while (begin != end) {
+    // Doing two passes with memchr (one for '{' and another for '}') is up to
+    // 2.5x faster than the naive one-pass implementation on big format strings.
+    const Char* p = begin;
+    if (*begin != '{' && !find<IS_CONSTEXPR>(begin + 1, end, Char('{'), p))
+      return write(begin, end);
+    write(begin, p);
+    begin = parse_replacement_field(p, end, handler);
+  }
+}
+
+template <typename T, bool = is_named_arg<T>::value> struct strip_named_arg {
+  using type = T;
+};
+template <typename T> struct strip_named_arg<T, true> {
+  using type = remove_cvref_t<decltype(T::value)>;
+};
+
+template <typename T, typename ParseContext>
+FMT_VISIBILITY("hidden")  // Suppress an ld warning on macOS (#3769).
+FMT_CONSTEXPR auto parse_format_specs(ParseContext& ctx)
+    -> decltype(ctx.begin()) {
+  using char_type = typename ParseContext::char_type;
+  using context = buffered_context<char_type>;
+  using mapped_type = conditional_t<
+      mapped_type_constant<T, context>::value != type::custom_type,
+      decltype(arg_mapper<context>().map(std::declval<const T&>())),
+      typename strip_named_arg<T>::type>;
+#if defined(__cpp_if_constexpr)
+  if constexpr (std::is_default_constructible<
+                    formatter<mapped_type, char_type>>::value) {
+    return formatter<mapped_type, char_type>().parse(ctx);
+  } else {
+    [[maybe_unused]]type_is_unformattable_for<T, char_type> _;
+    return ctx.begin();
+  }
+#else
+  return formatter<mapped_type, char_type>().parse(ctx);
+#endif
+}
+
+// Checks char specs and returns true iff the presentation type is char-like.
+FMT_CONSTEXPR inline auto check_char_specs(const format_specs& specs) -> bool {
+  if (specs.type != presentation_type::none &&
+      specs.type != presentation_type::chr &&
+      specs.type != presentation_type::debug) {
+    return false;
+  }
+  if (specs.align == align::numeric || specs.sign != sign::none || specs.alt)
+    report_error("invalid format specifier for char");
+  return true;
+}
+
+#if FMT_USE_NONTYPE_TEMPLATE_ARGS
+template <int N, typename T, typename... Args, typename Char>
+constexpr auto get_arg_index_by_name(basic_string_view<Char> name) -> int {
+  if constexpr (is_statically_named_arg<T>()) {
+    if (name == T::name) return N;
+  }
+  if constexpr (sizeof...(Args) > 0)
+    return get_arg_index_by_name<N + 1, Args...>(name);
+  (void)name;  // Workaround an MSVC bug about "unused" parameter.
+  return -1;
+}
+#endif
+
+template <typename... Args, typename Char>
+FMT_CONSTEXPR auto get_arg_index_by_name(basic_string_view<Char> name) -> int {
+#if FMT_USE_NONTYPE_TEMPLATE_ARGS
+  if constexpr (sizeof...(Args) > 0)
+    return get_arg_index_by_name<0, Args...>(name);
+#endif
+  (void)name;
+  return -1;
+}
+
+template <typename Char, typename... Args> class format_string_checker {
+ private:
+  using parse_context_type = compile_parse_context<Char>;
+  static constexpr int num_args = sizeof...(Args);
+
+  // Format specifier parsing function.
+  // In the future basic_format_parse_context will replace compile_parse_context
+  // here and will use is_constant_evaluated and downcasting to access the data
+  // needed for compile-time checks: https://godbolt.org/z/GvWzcTjh1.
+  using parse_func = const Char* (*)(parse_context_type&);
+
+  type types_[num_args > 0 ? static_cast<size_t>(num_args) : 1];
+  parse_context_type context_;
+  parse_func parse_funcs_[num_args > 0 ? static_cast<size_t>(num_args) : 1];
+
+ public:
+  explicit FMT_CONSTEXPR format_string_checker(basic_string_view<Char> fmt)
+      : types_{mapped_type_constant<Args, buffered_context<Char>>::value...},
+        context_(fmt, num_args, types_),
+        parse_funcs_{&parse_format_specs<Args, parse_context_type>...} {}
+
+  FMT_CONSTEXPR void on_text(const Char*, const Char*) {}
+
+  FMT_CONSTEXPR auto on_arg_id() -> int { return context_.next_arg_id(); }
+  FMT_CONSTEXPR auto on_arg_id(int id) -> int {
+    return context_.check_arg_id(id), id;
+  }
+  FMT_CONSTEXPR auto on_arg_id(basic_string_view<Char> id) -> int {
+#if FMT_USE_NONTYPE_TEMPLATE_ARGS
+    auto index = get_arg_index_by_name<Args...>(id);
+    if (index < 0) on_error("named argument is not found");
+    return index;
+#else
+    (void)id;
+    on_error("compile-time checks for named arguments require C++20 support");
+    return 0;
+#endif
+  }
+
+  FMT_CONSTEXPR void on_replacement_field(int id, const Char* begin) {
+    on_format_specs(id, begin, begin);  // Call parse() on empty specs.
+  }
+
+  FMT_CONSTEXPR auto on_format_specs(int id, const Char* begin, const Char*)
+      -> const Char* {
+    context_.advance_to(begin);
+    // id >= 0 check is a workaround for gcc 10 bug (#2065).
+    return id >= 0 && id < num_args ? parse_funcs_[id](context_) : begin;
+  }
+
+  FMT_NORETURN FMT_CONSTEXPR void on_error(const char* message) {
+    report_error(message);
+  }
+};
+
+// A base class for compile-time strings.
+struct compile_string {};
+
+template <typename S>
+using is_compile_string = std::is_base_of<compile_string, S>;
+
+// Reports a compile-time error if S is not a valid format string.
+template <typename..., typename S, FMT_ENABLE_IF(!is_compile_string<S>::value)>
+FMT_ALWAYS_INLINE void check_format_string(const S&) {
+#ifdef FMT_ENFORCE_COMPILE_STRING
+  static_assert(is_compile_string<S>::value,
+                "FMT_ENFORCE_COMPILE_STRING requires all format strings to use "
+                "FMT_STRING.");
+#endif
+}
+template <typename... Args, typename S,
+          FMT_ENABLE_IF(is_compile_string<S>::value)>
+void check_format_string(S format_str) {
+  using char_t = typename S::char_type;
+  FMT_CONSTEXPR auto s = basic_string_view<char_t>(format_str);
+  using checker = format_string_checker<char_t, remove_cvref_t<Args>...>;
+  FMT_CONSTEXPR bool error = (parse_format_string<true>(s, checker(s)), true);
+  ignore_unused(error);
+}
+
+// Report truncation to prevent silent data loss.
+inline void report_truncation(bool truncated) {
+  if (truncated) report_error("output is truncated");
+}
+
+// Use vformat_args and avoid type_identity to keep symbols short and workaround
+// a GCC <= 4.8 bug.
+template <typename Char = char> struct vformat_args {
+  using type = basic_format_args<buffered_context<Char>>;
+};
+template <> struct vformat_args<char> {
+  using type = format_args;
+};
+
+template <typename Char>
+void vformat_to(buffer<Char>& buf, basic_string_view<Char> fmt,
+                typename vformat_args<Char>::type args, locale_ref loc = {});
+
+FMT_API void vprint_mojibake(FILE*, string_view, format_args, bool = false);
+#ifndef _WIN32
+inline void vprint_mojibake(FILE*, string_view, format_args, bool) {}
+#endif
+
+template <typename T, typename Char, type TYPE> struct native_formatter {
+ private:
+  dynamic_format_specs<Char> specs_;
+
+ public:
+  using nonlocking = void;
+
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> const Char* {
+    if (ctx.begin() == ctx.end() || *ctx.begin() == '}') return ctx.begin();
+    auto end = parse_format_specs(ctx.begin(), ctx.end(), specs_, ctx, TYPE);
+    if (const_check(TYPE == type::char_type)) check_char_specs(specs_);
+    return end;
+  }
+
+  template <type U = TYPE,
+            FMT_ENABLE_IF(U == type::string_type || U == type::cstring_type ||
+                          U == type::char_type)>
+  FMT_CONSTEXPR void set_debug_format(bool set = true) {
+    specs_.type = set ? presentation_type::debug : presentation_type::none;
+  }
+
+  template <typename FormatContext>
+  FMT_CONSTEXPR auto format(const T& val, FormatContext& ctx) const
+      -> decltype(ctx.out());
+};
+}  // namespace detail
+
+FMT_BEGIN_EXPORT
+
+// A formatter specialization for natively supported types.
+template <typename T, typename Char>
+struct formatter<T, Char,
+                 enable_if_t<detail::type_constant<T, Char>::value !=
+                             detail::type::custom_type>>
+    : detail::native_formatter<T, Char, detail::type_constant<T, Char>::value> {
+};
+
+template <typename Char = char> struct runtime_format_string {
+  basic_string_view<Char> str;
+};
+
+/// A compile-time format string.
+template <typename Char, typename... Args> class basic_format_string {
+ private:
+  basic_string_view<Char> str_;
+
+ public:
+  template <
+      typename S,
+      FMT_ENABLE_IF(
+          std::is_convertible<const S&, basic_string_view<Char>>::value ||
+          (detail::is_compile_string<S>::value &&
+           std::is_constructible<basic_string_view<Char>, const S&>::value))>
+  FMT_CONSTEVAL FMT_ALWAYS_INLINE basic_format_string(const S& s) : str_(s) {
+    static_assert(
+        detail::count<
+            (std::is_base_of<detail::view, remove_reference_t<Args>>::value &&
+             std::is_reference<Args>::value)...>() == 0,
+        "passing views as lvalues is disallowed");
+#if FMT_USE_CONSTEVAL
+    if constexpr (detail::count_named_args<Args...>() ==
+                  detail::count_statically_named_args<Args...>()) {
+      using checker =
+          detail::format_string_checker<Char, remove_cvref_t<Args>...>;
+      detail::parse_format_string<true>(str_, checker(s));
+    }
+#else
+    detail::check_format_string<Args...>(s);
+#endif
+  }
+  basic_format_string(runtime_format_string<Char> fmt) : str_(fmt.str) {}
+
+  FMT_ALWAYS_INLINE operator basic_string_view<Char>() const { return str_; }
+  auto get() const -> basic_string_view<Char> { return str_; }
+};
+
+#if FMT_GCC_VERSION && FMT_GCC_VERSION < 409
+// Workaround broken conversion on older gcc.
+template <typename...> using format_string = string_view;
+inline auto runtime(string_view s) -> string_view { return s; }
+#else
+template <typename... Args>
+using format_string = basic_format_string<char, type_identity_t<Args>...>;
+/**
+ * Creates a runtime format string.
+ *
+ * **Example**:
+ *
+ *     // Check format string at runtime instead of compile-time.
+ *     fmt::print(fmt::runtime("{:d}"), "I am not a number");
+ */
+inline auto runtime(string_view s) -> runtime_format_string<> { return {{s}}; }
+#endif
+
+/// Formats a string and writes the output to `out`.
+template <typename OutputIt,
+          FMT_ENABLE_IF(detail::is_output_iterator<remove_cvref_t<OutputIt>,
+                                                   char>::value)>
+auto vformat_to(OutputIt&& out, string_view fmt, format_args args)
+    -> remove_cvref_t<OutputIt> {
+  auto&& buf = detail::get_buffer<char>(out);
+  detail::vformat_to(buf, fmt, args, {});
+  return detail::get_iterator(buf, out);
+}
+
+/**
+ * Formats `args` according to specifications in `fmt`, writes the result to
+ * the output iterator `out` and returns the iterator past the end of the output
+ * range. `format_to` does not append a terminating null character.
+ *
+ * **Example**:
+ *
+ *     auto out = std::vector<char>();
+ *     fmt::format_to(std::back_inserter(out), "{}", 42);
+ */
+template <typename OutputIt, typename... T,
+          FMT_ENABLE_IF(detail::is_output_iterator<remove_cvref_t<OutputIt>,
+                                                   char>::value)>
+FMT_INLINE auto format_to(OutputIt&& out, format_string<T...> fmt, T&&... args)
+    -> remove_cvref_t<OutputIt> {
+  return vformat_to(FMT_FWD(out), fmt, fmt::make_format_args(args...));
+}
+
+template <typename OutputIt> struct format_to_n_result {
+  /// Iterator past the end of the output range.
+  OutputIt out;
+  /// Total (not truncated) output size.
+  size_t size;
+};
+
+template <typename OutputIt, typename... T,
+          FMT_ENABLE_IF(detail::is_output_iterator<OutputIt, char>::value)>
+auto vformat_to_n(OutputIt out, size_t n, string_view fmt, format_args args)
+    -> format_to_n_result<OutputIt> {
+  using traits = detail::fixed_buffer_traits;
+  auto buf = detail::iterator_buffer<OutputIt, char, traits>(out, n);
+  detail::vformat_to(buf, fmt, args, {});
+  return {buf.out(), buf.count()};
+}
+
+/**
+ * Formats `args` according to specifications in `fmt`, writes up to `n`
+ * characters of the result to the output iterator `out` and returns the total
+ * (not truncated) output size and the iterator past the end of the output
+ * range. `format_to_n` does not append a terminating null character.
+ */
+template <typename OutputIt, typename... T,
+          FMT_ENABLE_IF(detail::is_output_iterator<OutputIt, char>::value)>
+FMT_INLINE auto format_to_n(OutputIt out, size_t n, format_string<T...> fmt,
+                            T&&... args) -> format_to_n_result<OutputIt> {
+  return vformat_to_n(out, n, fmt, fmt::make_format_args(args...));
+}
+
+template <typename OutputIt, typename Sentinel = OutputIt>
+struct format_to_result {
+  /// Iterator pointing to just after the last successful write in the range.
+  OutputIt out;
+  /// Specifies if the output was truncated.
+  bool truncated;
+
+  FMT_CONSTEXPR operator OutputIt&() & {
+    detail::report_truncation(truncated);
+    return out;
+  }
+  FMT_CONSTEXPR operator const OutputIt&() const& {
+    detail::report_truncation(truncated);
+    return out;
+  }
+  FMT_CONSTEXPR operator OutputIt&&() && {
+    detail::report_truncation(truncated);
+    return static_cast<OutputIt&&>(out);
+  }
+};
+
+template <size_t N>
+auto vformat_to(char (&out)[N], string_view fmt, format_args args)
+    -> format_to_result<char*> {
+  auto result = vformat_to_n(out, N, fmt, args);
+  return {result.out, result.size > N};
+}
+
+template <size_t N, typename... T>
+FMT_INLINE auto format_to(char (&out)[N], format_string<T...> fmt, T&&... args)
+    -> format_to_result<char*> {
+  auto result = fmt::format_to_n(out, N, fmt, static_cast<T&&>(args)...);
+  return {result.out, result.size > N};
+}
+
+/// Returns the number of chars in the output of `format(fmt, args...)`.
+template <typename... T>
+FMT_NODISCARD FMT_INLINE auto formatted_size(format_string<T...> fmt,
+                                             T&&... args) -> size_t {
+  auto buf = detail::counting_buffer<>();
+  detail::vformat_to<char>(buf, fmt, fmt::make_format_args(args...), {});
+  return buf.count();
+}
+
+FMT_API void vprint(string_view fmt, format_args args);
+FMT_API void vprint(FILE* f, string_view fmt, format_args args);
+FMT_API void vprint_buffered(FILE* f, string_view fmt, format_args args);
+FMT_API void vprintln(FILE* f, string_view fmt, format_args args);
+
+/**
+ * Formats `args` according to specifications in `fmt` and writes the output
+ * to `stdout`.
+ *
+ * **Example**:
+ *
+ *     fmt::print("The answer is {}.", 42);
+ */
+template <typename... T>
+FMT_INLINE void print(format_string<T...> fmt, T&&... args) {
+  const auto& vargs = fmt::make_format_args(args...);
+  if (!detail::use_utf8()) return detail::vprint_mojibake(stdout, fmt, vargs);
+  return detail::is_locking<T...>() ? vprint_buffered(stdout, fmt, vargs)
+                                    : vprint(fmt, vargs);
+}
+
+/**
+ * Formats `args` according to specifications in `fmt` and writes the
+ * output to the file `f`.
+ *
+ * **Example**:
+ *
+ *     fmt::print(stderr, "Don't {}!", "panic");
+ */
+template <typename... T>
+FMT_INLINE void print(FILE* f, format_string<T...> fmt, T&&... args) {
+  const auto& vargs = fmt::make_format_args(args...);
+  if (!detail::use_utf8()) return detail::vprint_mojibake(f, fmt, vargs);
+  return detail::is_locking<T...>() ? vprint_buffered(f, fmt, vargs)
+                                    : vprint(f, fmt, vargs);
+}
+
+/// Formats `args` according to specifications in `fmt` and writes the output
+/// to the file `f` followed by a newline.
+template <typename... T>
+FMT_INLINE void println(FILE* f, format_string<T...> fmt, T&&... args) {
+  const auto& vargs = fmt::make_format_args(args...);
+  return detail::use_utf8() ? vprintln(f, fmt, vargs)
+                            : detail::vprint_mojibake(f, fmt, vargs, true);
+}
+
+/// Formats `args` according to specifications in `fmt` and writes the output
+/// to `stdout` followed by a newline.
+template <typename... T>
+FMT_INLINE void println(format_string<T...> fmt, T&&... args) {
+  return fmt::println(stdout, fmt, static_cast<T&&>(args)...);
+}
+
+FMT_END_EXPORT
+FMT_GCC_PRAGMA("GCC pop_options")
+FMT_END_NAMESPACE
+
+#ifdef FMT_HEADER_ONLY
+#  include "format.h"
+#endif
+#endif  // FMT_BASE_H_
diff --git a/third_party/fmt/include/fmt/chrono.h b/third_party/fmt/include/fmt/chrono.h
new file mode 100644
index 00000000..c93123fd
--- /dev/null
+++ b/third_party/fmt/include/fmt/chrono.h
@@ -0,0 +1,2432 @@
+// Formatting library for C++ - chrono support
+//
+// Copyright (c) 2012 - present, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_CHRONO_H_
+#define FMT_CHRONO_H_
+
+#ifndef FMT_MODULE
+#  include <algorithm>
+#  include <chrono>
+#  include <cmath>    // std::isfinite
+#  include <cstring>  // std::memcpy
+#  include <ctime>
+#  include <iterator>
+#  include <locale>
+#  include <ostream>
+#  include <type_traits>
+#endif
+
+#include "format.h"
+
+FMT_BEGIN_NAMESPACE
+
+// Check if std::chrono::local_t is available.
+#ifndef FMT_USE_LOCAL_TIME
+#  ifdef __cpp_lib_chrono
+#    define FMT_USE_LOCAL_TIME (__cpp_lib_chrono >= 201907L)
+#  else
+#    define FMT_USE_LOCAL_TIME 0
+#  endif
+#endif
+
+// Check if std::chrono::utc_timestamp is available.
+#ifndef FMT_USE_UTC_TIME
+#  ifdef __cpp_lib_chrono
+#    define FMT_USE_UTC_TIME (__cpp_lib_chrono >= 201907L)
+#  else
+#    define FMT_USE_UTC_TIME 0
+#  endif
+#endif
+
+// Enable tzset.
+#ifndef FMT_USE_TZSET
+// UWP doesn't provide _tzset.
+#  if FMT_HAS_INCLUDE("winapifamily.h")
+#    include <winapifamily.h>
+#  endif
+#  if defined(_WIN32) && (!defined(WINAPI_FAMILY) || \
+                          (WINAPI_FAMILY == WINAPI_FAMILY_DESKTOP_APP))
+#    define FMT_USE_TZSET 1
+#  else
+#    define FMT_USE_TZSET 0
+#  endif
+#endif
+
+// Enable safe chrono durations, unless explicitly disabled.
+#ifndef FMT_SAFE_DURATION_CAST
+#  define FMT_SAFE_DURATION_CAST 1
+#endif
+#if FMT_SAFE_DURATION_CAST
+
+// For conversion between std::chrono::durations without undefined
+// behaviour or erroneous results.
+// This is a stripped down version of duration_cast, for inclusion in fmt.
+// See https://github.com/pauldreik/safe_duration_cast
+//
+// Copyright Paul Dreik 2019
+namespace safe_duration_cast {
+
+template <typename To, typename From,
+          FMT_ENABLE_IF(!std::is_same<From, To>::value &&
+                        std::numeric_limits<From>::is_signed ==
+                            std::numeric_limits<To>::is_signed)>
+FMT_CONSTEXPR auto lossless_integral_conversion(const From from, int& ec)
+    -> To {
+  ec = 0;
+  using F = std::numeric_limits<From>;
+  using T = std::numeric_limits<To>;
+  static_assert(F::is_integer, "From must be integral");
+  static_assert(T::is_integer, "To must be integral");
+
+  // A and B are both signed, or both unsigned.
+  if (detail::const_check(F::digits <= T::digits)) {
+    // From fits in To without any problem.
+  } else {
+    // From does not always fit in To, resort to a dynamic check.
+    if (from < (T::min)() || from > (T::max)()) {
+      // outside range.
+      ec = 1;
+      return {};
+    }
+  }
+  return static_cast<To>(from);
+}
+
+/// Converts From to To, without loss. If the dynamic value of from
+/// can't be converted to To without loss, ec is set.
+template <typename To, typename From,
+          FMT_ENABLE_IF(!std::is_same<From, To>::value &&
+                        std::numeric_limits<From>::is_signed !=
+                            std::numeric_limits<To>::is_signed)>
+FMT_CONSTEXPR auto lossless_integral_conversion(const From from, int& ec)
+    -> To {
+  ec = 0;
+  using F = std::numeric_limits<From>;
+  using T = std::numeric_limits<To>;
+  static_assert(F::is_integer, "From must be integral");
+  static_assert(T::is_integer, "To must be integral");
+
+  if (detail::const_check(F::is_signed && !T::is_signed)) {
+    // From may be negative, not allowed!
+    if (fmt::detail::is_negative(from)) {
+      ec = 1;
+      return {};
+    }
+    // From is positive. Can it always fit in To?
+    if (detail::const_check(F::digits > T::digits) &&
+        from > static_cast<From>(detail::max_value<To>())) {
+      ec = 1;
+      return {};
+    }
+  }
+
+  if (detail::const_check(!F::is_signed && T::is_signed &&
+                          F::digits >= T::digits) &&
+      from > static_cast<From>(detail::max_value<To>())) {
+    ec = 1;
+    return {};
+  }
+  return static_cast<To>(from);  // Lossless conversion.
+}
+
+template <typename To, typename From,
+          FMT_ENABLE_IF(std::is_same<From, To>::value)>
+FMT_CONSTEXPR auto lossless_integral_conversion(const From from, int& ec)
+    -> To {
+  ec = 0;
+  return from;
+}  // function
+
+// clang-format off
+/**
+ * converts From to To if possible, otherwise ec is set.
+ *
+ * input                            |    output
+ * ---------------------------------|---------------
+ * NaN                              | NaN
+ * Inf                              | Inf
+ * normal, fits in output           | converted (possibly lossy)
+ * normal, does not fit in output   | ec is set
+ * subnormal                        | best effort
+ * -Inf                             | -Inf
+ */
+// clang-format on
+template <typename To, typename From,
+          FMT_ENABLE_IF(!std::is_same<From, To>::value)>
+FMT_CONSTEXPR auto safe_float_conversion(const From from, int& ec) -> To {
+  ec = 0;
+  using T = std::numeric_limits<To>;
+  static_assert(std::is_floating_point<From>::value, "From must be floating");
+  static_assert(std::is_floating_point<To>::value, "To must be floating");
+
+  // catch the only happy case
+  if (std::isfinite(from)) {
+    if (from >= T::lowest() && from <= (T::max)()) {
+      return static_cast<To>(from);
+    }
+    // not within range.
+    ec = 1;
+    return {};
+  }
+
+  // nan and inf will be preserved
+  return static_cast<To>(from);
+}  // function
+
+template <typename To, typename From,
+          FMT_ENABLE_IF(std::is_same<From, To>::value)>
+FMT_CONSTEXPR auto safe_float_conversion(const From from, int& ec) -> To {
+  ec = 0;
+  static_assert(std::is_floating_point<From>::value, "From must be floating");
+  return from;
+}
+
+/// Safe duration cast between integral durations
+template <typename To, typename FromRep, typename FromPeriod,
+          FMT_ENABLE_IF(std::is_integral<FromRep>::value),
+          FMT_ENABLE_IF(std::is_integral<typename To::rep>::value)>
+auto safe_duration_cast(std::chrono::duration<FromRep, FromPeriod> from,
+                        int& ec) -> To {
+  using From = std::chrono::duration<FromRep, FromPeriod>;
+  ec = 0;
+  // the basic idea is that we need to convert from count() in the from type
+  // to count() in the To type, by multiplying it with this:
+  struct Factor
+      : std::ratio_divide<typename From::period, typename To::period> {};
+
+  static_assert(Factor::num > 0, "num must be positive");
+  static_assert(Factor::den > 0, "den must be positive");
+
+  // the conversion is like this: multiply from.count() with Factor::num
+  // /Factor::den and convert it to To::rep, all this without
+  // overflow/underflow. let's start by finding a suitable type that can hold
+  // both To, From and Factor::num
+  using IntermediateRep =
+      typename std::common_type<typename From::rep, typename To::rep,
+                                decltype(Factor::num)>::type;
+
+  // safe conversion to IntermediateRep
+  IntermediateRep count =
+      lossless_integral_conversion<IntermediateRep>(from.count(), ec);
+  if (ec) return {};
+  // multiply with Factor::num without overflow or underflow
+  if (detail::const_check(Factor::num != 1)) {
+    const auto max1 = detail::max_value<IntermediateRep>() / Factor::num;
+    if (count > max1) {
+      ec = 1;
+      return {};
+    }
+    const auto min1 =
+        (std::numeric_limits<IntermediateRep>::min)() / Factor::num;
+    if (detail::const_check(!std::is_unsigned<IntermediateRep>::value) &&
+        count < min1) {
+      ec = 1;
+      return {};
+    }
+    count *= Factor::num;
+  }
+
+  if (detail::const_check(Factor::den != 1)) count /= Factor::den;
+  auto tocount = lossless_integral_conversion<typename To::rep>(count, ec);
+  return ec ? To() : To(tocount);
+}
+
+/// Safe duration_cast between floating point durations
+template <typename To, typename FromRep, typename FromPeriod,
+          FMT_ENABLE_IF(std::is_floating_point<FromRep>::value),
+          FMT_ENABLE_IF(std::is_floating_point<typename To::rep>::value)>
+auto safe_duration_cast(std::chrono::duration<FromRep, FromPeriod> from,
+                        int& ec) -> To {
+  using From = std::chrono::duration<FromRep, FromPeriod>;
+  ec = 0;
+  if (std::isnan(from.count())) {
+    // nan in, gives nan out. easy.
+    return To{std::numeric_limits<typename To::rep>::quiet_NaN()};
+  }
+  // maybe we should also check if from is denormal, and decide what to do about
+  // it.
+
+  // +-inf should be preserved.
+  if (std::isinf(from.count())) {
+    return To{from.count()};
+  }
+
+  // the basic idea is that we need to convert from count() in the from type
+  // to count() in the To type, by multiplying it with this:
+  struct Factor
+      : std::ratio_divide<typename From::period, typename To::period> {};
+
+  static_assert(Factor::num > 0, "num must be positive");
+  static_assert(Factor::den > 0, "den must be positive");
+
+  // the conversion is like this: multiply from.count() with Factor::num
+  // /Factor::den and convert it to To::rep, all this without
+  // overflow/underflow. let's start by finding a suitable type that can hold
+  // both To, From and Factor::num
+  using IntermediateRep =
+      typename std::common_type<typename From::rep, typename To::rep,
+                                decltype(Factor::num)>::type;
+
+  // force conversion of From::rep -> IntermediateRep to be safe,
+  // even if it will never happen be narrowing in this context.
+  IntermediateRep count =
+      safe_float_conversion<IntermediateRep>(from.count(), ec);
+  if (ec) {
+    return {};
+  }
+
+  // multiply with Factor::num without overflow or underflow
+  if (detail::const_check(Factor::num != 1)) {
+    constexpr auto max1 = detail::max_value<IntermediateRep>() /
+                          static_cast<IntermediateRep>(Factor::num);
+    if (count > max1) {
+      ec = 1;
+      return {};
+    }
+    constexpr auto min1 = std::numeric_limits<IntermediateRep>::lowest() /
+                          static_cast<IntermediateRep>(Factor::num);
+    if (count < min1) {
+      ec = 1;
+      return {};
+    }
+    count *= static_cast<IntermediateRep>(Factor::num);
+  }
+
+  // this can't go wrong, right? den>0 is checked earlier.
+  if (detail::const_check(Factor::den != 1)) {
+    using common_t = typename std::common_type<IntermediateRep, intmax_t>::type;
+    count /= static_cast<common_t>(Factor::den);
+  }
+
+  // convert to the to type, safely
+  using ToRep = typename To::rep;
+
+  const ToRep tocount = safe_float_conversion<ToRep>(count, ec);
+  if (ec) {
+    return {};
+  }
+  return To{tocount};
+}
+}  // namespace safe_duration_cast
+#endif
+
+// Prevents expansion of a preceding token as a function-style macro.
+// Usage: f FMT_NOMACRO()
+#define FMT_NOMACRO
+
+namespace detail {
+template <typename T = void> struct null {};
+inline auto localtime_r FMT_NOMACRO(...) -> null<> { return null<>(); }
+inline auto localtime_s(...) -> null<> { return null<>(); }
+inline auto gmtime_r(...) -> null<> { return null<>(); }
+inline auto gmtime_s(...) -> null<> { return null<>(); }
+
+// It is defined here and not in ostream.h because the latter has expensive
+// includes.
+template <typename Streambuf> class formatbuf : public Streambuf {
+ private:
+  using char_type = typename Streambuf::char_type;
+  using streamsize = decltype(std::declval<Streambuf>().sputn(nullptr, 0));
+  using int_type = typename Streambuf::int_type;
+  using traits_type = typename Streambuf::traits_type;
+
+  buffer<char_type>& buffer_;
+
+ public:
+  explicit formatbuf(buffer<char_type>& buf) : buffer_(buf) {}
+
+ protected:
+  // The put area is always empty. This makes the implementation simpler and has
+  // the advantage that the streambuf and the buffer are always in sync and
+  // sputc never writes into uninitialized memory. A disadvantage is that each
+  // call to sputc always results in a (virtual) call to overflow. There is no
+  // disadvantage here for sputn since this always results in a call to xsputn.
+
+  auto overflow(int_type ch) -> int_type override {
+    if (!traits_type::eq_int_type(ch, traits_type::eof()))
+      buffer_.push_back(static_cast<char_type>(ch));
+    return ch;
+  }
+
+  auto xsputn(const char_type* s, streamsize count) -> streamsize override {
+    buffer_.append(s, s + count);
+    return count;
+  }
+};
+
+inline auto get_classic_locale() -> const std::locale& {
+  static const auto& locale = std::locale::classic();
+  return locale;
+}
+
+template <typename CodeUnit> struct codecvt_result {
+  static constexpr const size_t max_size = 32;
+  CodeUnit buf[max_size];
+  CodeUnit* end;
+};
+
+template <typename CodeUnit>
+void write_codecvt(codecvt_result<CodeUnit>& out, string_view in_buf,
+                   const std::locale& loc) {
+#if FMT_CLANG_VERSION
+#  pragma clang diagnostic push
+#  pragma clang diagnostic ignored "-Wdeprecated"
+  auto& f = std::use_facet<std::codecvt<CodeUnit, char, std::mbstate_t>>(loc);
+#  pragma clang diagnostic pop
+#else
+  auto& f = std::use_facet<std::codecvt<CodeUnit, char, std::mbstate_t>>(loc);
+#endif
+  auto mb = std::mbstate_t();
+  const char* from_next = nullptr;
+  auto result = f.in(mb, in_buf.begin(), in_buf.end(), from_next,
+                     std::begin(out.buf), std::end(out.buf), out.end);
+  if (result != std::codecvt_base::ok)
+    FMT_THROW(format_error("failed to format time"));
+}
+
+template <typename OutputIt>
+auto write_encoded_tm_str(OutputIt out, string_view in, const std::locale& loc)
+    -> OutputIt {
+  if (detail::use_utf8() && loc != get_classic_locale()) {
+    // char16_t and char32_t codecvts are broken in MSVC (linkage errors) and
+    // gcc-4.
+#if FMT_MSC_VERSION != 0 ||  \
+    (defined(__GLIBCXX__) && \
+     (!defined(_GLIBCXX_USE_DUAL_ABI) || _GLIBCXX_USE_DUAL_ABI == 0))
+    // The _GLIBCXX_USE_DUAL_ABI macro is always defined in libstdc++ from gcc-5
+    // and newer.
+    using code_unit = wchar_t;
+#else
+    using code_unit = char32_t;
+#endif
+
+    using unit_t = codecvt_result<code_unit>;
+    unit_t unit;
+    write_codecvt(unit, in, loc);
+    // In UTF-8 is used one to four one-byte code units.
+    auto u =
+        to_utf8<code_unit, basic_memory_buffer<char, unit_t::max_size * 4>>();
+    if (!u.convert({unit.buf, to_unsigned(unit.end - unit.buf)}))
+      FMT_THROW(format_error("failed to format time"));
+    return copy<char>(u.c_str(), u.c_str() + u.size(), out);
+  }
+  return copy<char>(in.data(), in.data() + in.size(), out);
+}
+
+template <typename Char, typename OutputIt,
+          FMT_ENABLE_IF(!std::is_same<Char, char>::value)>
+auto write_tm_str(OutputIt out, string_view sv, const std::locale& loc)
+    -> OutputIt {
+  codecvt_result<Char> unit;
+  write_codecvt(unit, sv, loc);
+  return copy<Char>(unit.buf, unit.end, out);
+}
+
+template <typename Char, typename OutputIt,
+          FMT_ENABLE_IF(std::is_same<Char, char>::value)>
+auto write_tm_str(OutputIt out, string_view sv, const std::locale& loc)
+    -> OutputIt {
+  return write_encoded_tm_str(out, sv, loc);
+}
+
+template <typename Char>
+inline void do_write(buffer<Char>& buf, const std::tm& time,
+                     const std::locale& loc, char format, char modifier) {
+  auto&& format_buf = formatbuf<std::basic_streambuf<Char>>(buf);
+  auto&& os = std::basic_ostream<Char>(&format_buf);
+  os.imbue(loc);
+  const auto& facet = std::use_facet<std::time_put<Char>>(loc);
+  auto end = facet.put(os, os, Char(' '), &time, format, modifier);
+  if (end.failed()) FMT_THROW(format_error("failed to format time"));
+}
+
+template <typename Char, typename OutputIt,
+          FMT_ENABLE_IF(!std::is_same<Char, char>::value)>
+auto write(OutputIt out, const std::tm& time, const std::locale& loc,
+           char format, char modifier = 0) -> OutputIt {
+  auto&& buf = get_buffer<Char>(out);
+  do_write<Char>(buf, time, loc, format, modifier);
+  return get_iterator(buf, out);
+}
+
+template <typename Char, typename OutputIt,
+          FMT_ENABLE_IF(std::is_same<Char, char>::value)>
+auto write(OutputIt out, const std::tm& time, const std::locale& loc,
+           char format, char modifier = 0) -> OutputIt {
+  auto&& buf = basic_memory_buffer<Char>();
+  do_write<char>(buf, time, loc, format, modifier);
+  return write_encoded_tm_str(out, string_view(buf.data(), buf.size()), loc);
+}
+
+template <typename Rep1, typename Rep2>
+struct is_same_arithmetic_type
+    : public std::integral_constant<bool,
+                                    (std::is_integral<Rep1>::value &&
+                                     std::is_integral<Rep2>::value) ||
+                                        (std::is_floating_point<Rep1>::value &&
+                                         std::is_floating_point<Rep2>::value)> {
+};
+
+template <
+    typename To, typename FromRep, typename FromPeriod,
+    FMT_ENABLE_IF(is_same_arithmetic_type<FromRep, typename To::rep>::value)>
+auto fmt_duration_cast(std::chrono::duration<FromRep, FromPeriod> from) -> To {
+#if FMT_SAFE_DURATION_CAST
+  // Throwing version of safe_duration_cast is only available for
+  // integer to integer or float to float casts.
+  int ec;
+  To to = safe_duration_cast::safe_duration_cast<To>(from, ec);
+  if (ec) FMT_THROW(format_error("cannot format duration"));
+  return to;
+#else
+  // Standard duration cast, may overflow.
+  return std::chrono::duration_cast<To>(from);
+#endif
+}
+
+template <
+    typename To, typename FromRep, typename FromPeriod,
+    FMT_ENABLE_IF(!is_same_arithmetic_type<FromRep, typename To::rep>::value)>
+auto fmt_duration_cast(std::chrono::duration<FromRep, FromPeriod> from) -> To {
+  // Mixed integer <-> float cast is not supported by safe_duration_cast.
+  return std::chrono::duration_cast<To>(from);
+}
+
+template <typename Duration>
+auto to_time_t(
+    std::chrono::time_point<std::chrono::system_clock, Duration> time_point)
+    -> std::time_t {
+  // Cannot use std::chrono::system_clock::to_time_t since this would first
+  // require a cast to std::chrono::system_clock::time_point, which could
+  // overflow.
+  return fmt_duration_cast<std::chrono::duration<std::time_t>>(
+             time_point.time_since_epoch())
+      .count();
+}
+}  // namespace detail
+
+FMT_BEGIN_EXPORT
+
+/**
+ * Converts given time since epoch as `std::time_t` value into calendar time,
+ * expressed in local time. Unlike `std::localtime`, this function is
+ * thread-safe on most platforms.
+ */
+inline auto localtime(std::time_t time) -> std::tm {
+  struct dispatcher {
+    std::time_t time_;
+    std::tm tm_;
+
+    dispatcher(std::time_t t) : time_(t) {}
+
+    auto run() -> bool {
+      using namespace fmt::detail;
+      return handle(localtime_r(&time_, &tm_));
+    }
+
+    auto handle(std::tm* tm) -> bool { return tm != nullptr; }
+
+    auto handle(detail::null<>) -> bool {
+      using namespace fmt::detail;
+      return fallback(localtime_s(&tm_, &time_));
+    }
+
+    auto fallback(int res) -> bool { return res == 0; }
+
+#if !FMT_MSC_VERSION
+    auto fallback(detail::null<>) -> bool {
+      using namespace fmt::detail;
+      std::tm* tm = std::localtime(&time_);
+      if (tm) tm_ = *tm;
+      return tm != nullptr;
+    }
+#endif
+  };
+  dispatcher lt(time);
+  // Too big time values may be unsupported.
+  if (!lt.run()) FMT_THROW(format_error("time_t value out of range"));
+  return lt.tm_;
+}
+
+#if FMT_USE_LOCAL_TIME
+template <typename Duration>
+inline auto localtime(std::chrono::local_time<Duration> time) -> std::tm {
+  return localtime(
+      detail::to_time_t(std::chrono::current_zone()->to_sys(time)));
+}
+#endif
+
+/**
+ * Converts given time since epoch as `std::time_t` value into calendar time,
+ * expressed in Coordinated Universal Time (UTC). Unlike `std::gmtime`, this
+ * function is thread-safe on most platforms.
+ */
+inline auto gmtime(std::time_t time) -> std::tm {
+  struct dispatcher {
+    std::time_t time_;
+    std::tm tm_;
+
+    dispatcher(std::time_t t) : time_(t) {}
+
+    auto run() -> bool {
+      using namespace fmt::detail;
+      return handle(gmtime_r(&time_, &tm_));
+    }
+
+    auto handle(std::tm* tm) -> bool { return tm != nullptr; }
+
+    auto handle(detail::null<>) -> bool {
+      using namespace fmt::detail;
+      return fallback(gmtime_s(&tm_, &time_));
+    }
+
+    auto fallback(int res) -> bool { return res == 0; }
+
+#if !FMT_MSC_VERSION
+    auto fallback(detail::null<>) -> bool {
+      std::tm* tm = std::gmtime(&time_);
+      if (tm) tm_ = *tm;
+      return tm != nullptr;
+    }
+#endif
+  };
+  auto gt = dispatcher(time);
+  // Too big time values may be unsupported.
+  if (!gt.run()) FMT_THROW(format_error("time_t value out of range"));
+  return gt.tm_;
+}
+
+template <typename Duration>
+inline auto gmtime(
+    std::chrono::time_point<std::chrono::system_clock, Duration> time_point)
+    -> std::tm {
+  return gmtime(detail::to_time_t(time_point));
+}
+
+namespace detail {
+
+// Writes two-digit numbers a, b and c separated by sep to buf.
+// The method by Pavel Novikov based on
+// https://johnnylee-sde.github.io/Fast-unsigned-integer-to-time-string/.
+inline void write_digit2_separated(char* buf, unsigned a, unsigned b,
+                                   unsigned c, char sep) {
+  unsigned long long digits =
+      a | (b << 24) | (static_cast<unsigned long long>(c) << 48);
+  // Convert each value to BCD.
+  // We have x = a * 10 + b and we want to convert it to BCD y = a * 16 + b.
+  // The difference is
+  //   y - x = a * 6
+  // a can be found from x:
+  //   a = floor(x / 10)
+  // then
+  //   y = x + a * 6 = x + floor(x / 10) * 6
+  // floor(x / 10) is (x * 205) >> 11 (needs 16 bits).
+  digits += (((digits * 205) >> 11) & 0x000f00000f00000f) * 6;
+  // Put low nibbles to high bytes and high nibbles to low bytes.
+  digits = ((digits & 0x00f00000f00000f0) >> 4) |
+           ((digits & 0x000f00000f00000f) << 8);
+  auto usep = static_cast<unsigned long long>(sep);
+  // Add ASCII '0' to each digit byte and insert separators.
+  digits |= 0x3030003030003030 | (usep << 16) | (usep << 40);
+
+  constexpr const size_t len = 8;
+  if (const_check(is_big_endian())) {
+    char tmp[len];
+    std::memcpy(tmp, &digits, len);
+    std::reverse_copy(tmp, tmp + len, buf);
+  } else {
+    std::memcpy(buf, &digits, len);
+  }
+}
+
+template <typename Period>
+FMT_CONSTEXPR inline auto get_units() -> const char* {
+  if (std::is_same<Period, std::atto>::value) return "as";
+  if (std::is_same<Period, std::femto>::value) return "fs";
+  if (std::is_same<Period, std::pico>::value) return "ps";
+  if (std::is_same<Period, std::nano>::value) return "ns";
+  if (std::is_same<Period, std::micro>::value) return "µs";
+  if (std::is_same<Period, std::milli>::value) return "ms";
+  if (std::is_same<Period, std::centi>::value) return "cs";
+  if (std::is_same<Period, std::deci>::value) return "ds";
+  if (std::is_same<Period, std::ratio<1>>::value) return "s";
+  if (std::is_same<Period, std::deca>::value) return "das";
+  if (std::is_same<Period, std::hecto>::value) return "hs";
+  if (std::is_same<Period, std::kilo>::value) return "ks";
+  if (std::is_same<Period, std::mega>::value) return "Ms";
+  if (std::is_same<Period, std::giga>::value) return "Gs";
+  if (std::is_same<Period, std::tera>::value) return "Ts";
+  if (std::is_same<Period, std::peta>::value) return "Ps";
+  if (std::is_same<Period, std::exa>::value) return "Es";
+  if (std::is_same<Period, std::ratio<60>>::value) return "min";
+  if (std::is_same<Period, std::ratio<3600>>::value) return "h";
+  if (std::is_same<Period, std::ratio<86400>>::value) return "d";
+  return nullptr;
+}
+
+enum class numeric_system {
+  standard,
+  // Alternative numeric system, e.g. 十二 instead of 12 in ja_JP locale.
+  alternative
+};
+
+// Glibc extensions for formatting numeric values.
+enum class pad_type {
+  // Pad a numeric result string with zeros (the default).
+  zero,
+  // Do not pad a numeric result string.
+  none,
+  // Pad a numeric result string with spaces.
+  space,
+};
+
+template <typename OutputIt>
+auto write_padding(OutputIt out, pad_type pad, int width) -> OutputIt {
+  if (pad == pad_type::none) return out;
+  return detail::fill_n(out, width, pad == pad_type::space ? ' ' : '0');
+}
+
+template <typename OutputIt>
+auto write_padding(OutputIt out, pad_type pad) -> OutputIt {
+  if (pad != pad_type::none) *out++ = pad == pad_type::space ? ' ' : '0';
+  return out;
+}
+
+// Parses a put_time-like format string and invokes handler actions.
+template <typename Char, typename Handler>
+FMT_CONSTEXPR auto parse_chrono_format(const Char* begin, const Char* end,
+                                       Handler&& handler) -> const Char* {
+  if (begin == end || *begin == '}') return begin;
+  if (*begin != '%') FMT_THROW(format_error("invalid format"));
+  auto ptr = begin;
+  while (ptr != end) {
+    pad_type pad = pad_type::zero;
+    auto c = *ptr;
+    if (c == '}') break;
+    if (c != '%') {
+      ++ptr;
+      continue;
+    }
+    if (begin != ptr) handler.on_text(begin, ptr);
+    ++ptr;  // consume '%'
+    if (ptr == end) FMT_THROW(format_error("invalid format"));
+    c = *ptr;
+    switch (c) {
+    case '_':
+      pad = pad_type::space;
+      ++ptr;
+      break;
+    case '-':
+      pad = pad_type::none;
+      ++ptr;
+      break;
+    }
+    if (ptr == end) FMT_THROW(format_error("invalid format"));
+    c = *ptr++;
+    switch (c) {
+    case '%':
+      handler.on_text(ptr - 1, ptr);
+      break;
+    case 'n': {
+      const Char newline[] = {'\n'};
+      handler.on_text(newline, newline + 1);
+      break;
+    }
+    case 't': {
+      const Char tab[] = {'\t'};
+      handler.on_text(tab, tab + 1);
+      break;
+    }
+    // Year:
+    case 'Y':
+      handler.on_year(numeric_system::standard);
+      break;
+    case 'y':
+      handler.on_short_year(numeric_system::standard);
+      break;
+    case 'C':
+      handler.on_century(numeric_system::standard);
+      break;
+    case 'G':
+      handler.on_iso_week_based_year();
+      break;
+    case 'g':
+      handler.on_iso_week_based_short_year();
+      break;
+    // Day of the week:
+    case 'a':
+      handler.on_abbr_weekday();
+      break;
+    case 'A':
+      handler.on_full_weekday();
+      break;
+    case 'w':
+      handler.on_dec0_weekday(numeric_system::standard);
+      break;
+    case 'u':
+      handler.on_dec1_weekday(numeric_system::standard);
+      break;
+    // Month:
+    case 'b':
+    case 'h':
+      handler.on_abbr_month();
+      break;
+    case 'B':
+      handler.on_full_month();
+      break;
+    case 'm':
+      handler.on_dec_month(numeric_system::standard);
+      break;
+    // Day of the year/month:
+    case 'U':
+      handler.on_dec0_week_of_year(numeric_system::standard, pad);
+      break;
+    case 'W':
+      handler.on_dec1_week_of_year(numeric_system::standard, pad);
+      break;
+    case 'V':
+      handler.on_iso_week_of_year(numeric_system::standard, pad);
+      break;
+    case 'j':
+      handler.on_day_of_year();
+      break;
+    case 'd':
+      handler.on_day_of_month(numeric_system::standard, pad);
+      break;
+    case 'e':
+      handler.on_day_of_month(numeric_system::standard, pad_type::space);
+      break;
+    // Hour, minute, second:
+    case 'H':
+      handler.on_24_hour(numeric_system::standard, pad);
+      break;
+    case 'I':
+      handler.on_12_hour(numeric_system::standard, pad);
+      break;
+    case 'M':
+      handler.on_minute(numeric_system::standard, pad);
+      break;
+    case 'S':
+      handler.on_second(numeric_system::standard, pad);
+      break;
+    // Other:
+    case 'c':
+      handler.on_datetime(numeric_system::standard);
+      break;
+    case 'x':
+      handler.on_loc_date(numeric_system::standard);
+      break;
+    case 'X':
+      handler.on_loc_time(numeric_system::standard);
+      break;
+    case 'D':
+      handler.on_us_date();
+      break;
+    case 'F':
+      handler.on_iso_date();
+      break;
+    case 'r':
+      handler.on_12_hour_time();
+      break;
+    case 'R':
+      handler.on_24_hour_time();
+      break;
+    case 'T':
+      handler.on_iso_time();
+      break;
+    case 'p':
+      handler.on_am_pm();
+      break;
+    case 'Q':
+      handler.on_duration_value();
+      break;
+    case 'q':
+      handler.on_duration_unit();
+      break;
+    case 'z':
+      handler.on_utc_offset(numeric_system::standard);
+      break;
+    case 'Z':
+      handler.on_tz_name();
+      break;
+    // Alternative representation:
+    case 'E': {
+      if (ptr == end) FMT_THROW(format_error("invalid format"));
+      c = *ptr++;
+      switch (c) {
+      case 'Y':
+        handler.on_year(numeric_system::alternative);
+        break;
+      case 'y':
+        handler.on_offset_year();
+        break;
+      case 'C':
+        handler.on_century(numeric_system::alternative);
+        break;
+      case 'c':
+        handler.on_datetime(numeric_system::alternative);
+        break;
+      case 'x':
+        handler.on_loc_date(numeric_system::alternative);
+        break;
+      case 'X':
+        handler.on_loc_time(numeric_system::alternative);
+        break;
+      case 'z':
+        handler.on_utc_offset(numeric_system::alternative);
+        break;
+      default:
+        FMT_THROW(format_error("invalid format"));
+      }
+      break;
+    }
+    case 'O':
+      if (ptr == end) FMT_THROW(format_error("invalid format"));
+      c = *ptr++;
+      switch (c) {
+      case 'y':
+        handler.on_short_year(numeric_system::alternative);
+        break;
+      case 'm':
+        handler.on_dec_month(numeric_system::alternative);
+        break;
+      case 'U':
+        handler.on_dec0_week_of_year(numeric_system::alternative, pad);
+        break;
+      case 'W':
+        handler.on_dec1_week_of_year(numeric_system::alternative, pad);
+        break;
+      case 'V':
+        handler.on_iso_week_of_year(numeric_system::alternative, pad);
+        break;
+      case 'd':
+        handler.on_day_of_month(numeric_system::alternative, pad);
+        break;
+      case 'e':
+        handler.on_day_of_month(numeric_system::alternative, pad_type::space);
+        break;
+      case 'w':
+        handler.on_dec0_weekday(numeric_system::alternative);
+        break;
+      case 'u':
+        handler.on_dec1_weekday(numeric_system::alternative);
+        break;
+      case 'H':
+        handler.on_24_hour(numeric_system::alternative, pad);
+        break;
+      case 'I':
+        handler.on_12_hour(numeric_system::alternative, pad);
+        break;
+      case 'M':
+        handler.on_minute(numeric_system::alternative, pad);
+        break;
+      case 'S':
+        handler.on_second(numeric_system::alternative, pad);
+        break;
+      case 'z':
+        handler.on_utc_offset(numeric_system::alternative);
+        break;
+      default:
+        FMT_THROW(format_error("invalid format"));
+      }
+      break;
+    default:
+      FMT_THROW(format_error("invalid format"));
+    }
+    begin = ptr;
+  }
+  if (begin != ptr) handler.on_text(begin, ptr);
+  return ptr;
+}
+
+template <typename Derived> struct null_chrono_spec_handler {
+  FMT_CONSTEXPR void unsupported() {
+    static_cast<Derived*>(this)->unsupported();
+  }
+  FMT_CONSTEXPR void on_year(numeric_system) { unsupported(); }
+  FMT_CONSTEXPR void on_short_year(numeric_system) { unsupported(); }
+  FMT_CONSTEXPR void on_offset_year() { unsupported(); }
+  FMT_CONSTEXPR void on_century(numeric_system) { unsupported(); }
+  FMT_CONSTEXPR void on_iso_week_based_year() { unsupported(); }
+  FMT_CONSTEXPR void on_iso_week_based_short_year() { unsupported(); }
+  FMT_CONSTEXPR void on_abbr_weekday() { unsupported(); }
+  FMT_CONSTEXPR void on_full_weekday() { unsupported(); }
+  FMT_CONSTEXPR void on_dec0_weekday(numeric_system) { unsupported(); }
+  FMT_CONSTEXPR void on_dec1_weekday(numeric_system) { unsupported(); }
+  FMT_CONSTEXPR void on_abbr_month() { unsupported(); }
+  FMT_CONSTEXPR void on_full_month() { unsupported(); }
+  FMT_CONSTEXPR void on_dec_month(numeric_system) { unsupported(); }
+  FMT_CONSTEXPR void on_dec0_week_of_year(numeric_system, pad_type) {
+    unsupported();
+  }
+  FMT_CONSTEXPR void on_dec1_week_of_year(numeric_system, pad_type) {
+    unsupported();
+  }
+  FMT_CONSTEXPR void on_iso_week_of_year(numeric_system, pad_type) {
+    unsupported();
+  }
+  FMT_CONSTEXPR void on_day_of_year() { unsupported(); }
+  FMT_CONSTEXPR void on_day_of_month(numeric_system, pad_type) {
+    unsupported();
+  }
+  FMT_CONSTEXPR void on_24_hour(numeric_system) { unsupported(); }
+  FMT_CONSTEXPR void on_12_hour(numeric_system) { unsupported(); }
+  FMT_CONSTEXPR void on_minute(numeric_system) { unsupported(); }
+  FMT_CONSTEXPR void on_second(numeric_system) { unsupported(); }
+  FMT_CONSTEXPR void on_datetime(numeric_system) { unsupported(); }
+  FMT_CONSTEXPR void on_loc_date(numeric_system) { unsupported(); }
+  FMT_CONSTEXPR void on_loc_time(numeric_system) { unsupported(); }
+  FMT_CONSTEXPR void on_us_date() { unsupported(); }
+  FMT_CONSTEXPR void on_iso_date() { unsupported(); }
+  FMT_CONSTEXPR void on_12_hour_time() { unsupported(); }
+  FMT_CONSTEXPR void on_24_hour_time() { unsupported(); }
+  FMT_CONSTEXPR void on_iso_time() { unsupported(); }
+  FMT_CONSTEXPR void on_am_pm() { unsupported(); }
+  FMT_CONSTEXPR void on_duration_value() { unsupported(); }
+  FMT_CONSTEXPR void on_duration_unit() { unsupported(); }
+  FMT_CONSTEXPR void on_utc_offset(numeric_system) { unsupported(); }
+  FMT_CONSTEXPR void on_tz_name() { unsupported(); }
+};
+
+struct tm_format_checker : null_chrono_spec_handler<tm_format_checker> {
+  FMT_NORETURN void unsupported() { FMT_THROW(format_error("no format")); }
+
+  template <typename Char>
+  FMT_CONSTEXPR void on_text(const Char*, const Char*) {}
+  FMT_CONSTEXPR void on_year(numeric_system) {}
+  FMT_CONSTEXPR void on_short_year(numeric_system) {}
+  FMT_CONSTEXPR void on_offset_year() {}
+  FMT_CONSTEXPR void on_century(numeric_system) {}
+  FMT_CONSTEXPR void on_iso_week_based_year() {}
+  FMT_CONSTEXPR void on_iso_week_based_short_year() {}
+  FMT_CONSTEXPR void on_abbr_weekday() {}
+  FMT_CONSTEXPR void on_full_weekday() {}
+  FMT_CONSTEXPR void on_dec0_weekday(numeric_system) {}
+  FMT_CONSTEXPR void on_dec1_weekday(numeric_system) {}
+  FMT_CONSTEXPR void on_abbr_month() {}
+  FMT_CONSTEXPR void on_full_month() {}
+  FMT_CONSTEXPR void on_dec_month(numeric_system) {}
+  FMT_CONSTEXPR void on_dec0_week_of_year(numeric_system, pad_type) {}
+  FMT_CONSTEXPR void on_dec1_week_of_year(numeric_system, pad_type) {}
+  FMT_CONSTEXPR void on_iso_week_of_year(numeric_system, pad_type) {}
+  FMT_CONSTEXPR void on_day_of_year() {}
+  FMT_CONSTEXPR void on_day_of_month(numeric_system, pad_type) {}
+  FMT_CONSTEXPR void on_24_hour(numeric_system, pad_type) {}
+  FMT_CONSTEXPR void on_12_hour(numeric_system, pad_type) {}
+  FMT_CONSTEXPR void on_minute(numeric_system, pad_type) {}
+  FMT_CONSTEXPR void on_second(numeric_system, pad_type) {}
+  FMT_CONSTEXPR void on_datetime(numeric_system) {}
+  FMT_CONSTEXPR void on_loc_date(numeric_system) {}
+  FMT_CONSTEXPR void on_loc_time(numeric_system) {}
+  FMT_CONSTEXPR void on_us_date() {}
+  FMT_CONSTEXPR void on_iso_date() {}
+  FMT_CONSTEXPR void on_12_hour_time() {}
+  FMT_CONSTEXPR void on_24_hour_time() {}
+  FMT_CONSTEXPR void on_iso_time() {}
+  FMT_CONSTEXPR void on_am_pm() {}
+  FMT_CONSTEXPR void on_utc_offset(numeric_system) {}
+  FMT_CONSTEXPR void on_tz_name() {}
+};
+
+inline auto tm_wday_full_name(int wday) -> const char* {
+  static constexpr const char* full_name_list[] = {
+      "Sunday",   "Monday", "Tuesday", "Wednesday",
+      "Thursday", "Friday", "Saturday"};
+  return wday >= 0 && wday <= 6 ? full_name_list[wday] : "?";
+}
+inline auto tm_wday_short_name(int wday) -> const char* {
+  static constexpr const char* short_name_list[] = {"Sun", "Mon", "Tue", "Wed",
+                                                    "Thu", "Fri", "Sat"};
+  return wday >= 0 && wday <= 6 ? short_name_list[wday] : "???";
+}
+
+inline auto tm_mon_full_name(int mon) -> const char* {
+  static constexpr const char* full_name_list[] = {
+      "January", "February", "March",     "April",   "May",      "June",
+      "July",    "August",   "September", "October", "November", "December"};
+  return mon >= 0 && mon <= 11 ? full_name_list[mon] : "?";
+}
+inline auto tm_mon_short_name(int mon) -> const char* {
+  static constexpr const char* short_name_list[] = {
+      "Jan", "Feb", "Mar", "Apr", "May", "Jun",
+      "Jul", "Aug", "Sep", "Oct", "Nov", "Dec",
+  };
+  return mon >= 0 && mon <= 11 ? short_name_list[mon] : "???";
+}
+
+template <typename T, typename = void>
+struct has_member_data_tm_gmtoff : std::false_type {};
+template <typename T>
+struct has_member_data_tm_gmtoff<T, void_t<decltype(T::tm_gmtoff)>>
+    : std::true_type {};
+
+template <typename T, typename = void>
+struct has_member_data_tm_zone : std::false_type {};
+template <typename T>
+struct has_member_data_tm_zone<T, void_t<decltype(T::tm_zone)>>
+    : std::true_type {};
+
+#if FMT_USE_TZSET
+inline void tzset_once() {
+  static bool init = []() -> bool {
+    _tzset();
+    return true;
+  }();
+  ignore_unused(init);
+}
+#endif
+
+// Converts value to Int and checks that it's in the range [0, upper).
+template <typename T, typename Int, FMT_ENABLE_IF(std::is_integral<T>::value)>
+inline auto to_nonnegative_int(T value, Int upper) -> Int {
+  if (!std::is_unsigned<Int>::value &&
+      (value < 0 || to_unsigned(value) > to_unsigned(upper))) {
+    FMT_THROW(fmt::format_error("chrono value is out of range"));
+  }
+  return static_cast<Int>(value);
+}
+template <typename T, typename Int, FMT_ENABLE_IF(!std::is_integral<T>::value)>
+inline auto to_nonnegative_int(T value, Int upper) -> Int {
+  auto int_value = static_cast<Int>(value);
+  if (int_value < 0 || value > static_cast<T>(upper))
+    FMT_THROW(format_error("invalid value"));
+  return int_value;
+}
+
+constexpr auto pow10(std::uint32_t n) -> long long {
+  return n == 0 ? 1 : 10 * pow10(n - 1);
+}
+
+// Counts the number of fractional digits in the range [0, 18] according to the
+// C++20 spec. If more than 18 fractional digits are required then returns 6 for
+// microseconds precision.
+template <long long Num, long long Den, int N = 0,
+          bool Enabled = (N < 19) && (Num <= max_value<long long>() / 10)>
+struct count_fractional_digits {
+  static constexpr int value =
+      Num % Den == 0 ? N : count_fractional_digits<Num * 10, Den, N + 1>::value;
+};
+
+// Base case that doesn't instantiate any more templates
+// in order to avoid overflow.
+template <long long Num, long long Den, int N>
+struct count_fractional_digits<Num, Den, N, false> {
+  static constexpr int value = (Num % Den == 0) ? N : 6;
+};
+
+// Format subseconds which are given as an integer type with an appropriate
+// number of digits.
+template <typename Char, typename OutputIt, typename Duration>
+void write_fractional_seconds(OutputIt& out, Duration d, int precision = -1) {
+  constexpr auto num_fractional_digits =
+      count_fractional_digits<Duration::period::num,
+                              Duration::period::den>::value;
+
+  using subsecond_precision = std::chrono::duration<
+      typename std::common_type<typename Duration::rep,
+                                std::chrono::seconds::rep>::type,
+      std::ratio<1, detail::pow10(num_fractional_digits)>>;
+
+  const auto fractional = d - fmt_duration_cast<std::chrono::seconds>(d);
+  const auto subseconds =
+      std::chrono::treat_as_floating_point<
+          typename subsecond_precision::rep>::value
+          ? fractional.count()
+          : fmt_duration_cast<subsecond_precision>(fractional).count();
+  auto n = static_cast<uint32_or_64_or_128_t<long long>>(subseconds);
+  const int num_digits = detail::count_digits(n);
+
+  int leading_zeroes = (std::max)(0, num_fractional_digits - num_digits);
+  if (precision < 0) {
+    FMT_ASSERT(!std::is_floating_point<typename Duration::rep>::value, "");
+    if (std::ratio_less<typename subsecond_precision::period,
+                        std::chrono::seconds::period>::value) {
+      *out++ = '.';
+      out = detail::fill_n(out, leading_zeroes, '0');
+      out = format_decimal<Char>(out, n, num_digits).end;
+    }
+  } else if (precision > 0) {
+    *out++ = '.';
+    leading_zeroes = (std::min)(leading_zeroes, precision);
+    int remaining = precision - leading_zeroes;
+    out = detail::fill_n(out, leading_zeroes, '0');
+    if (remaining < num_digits) {
+      int num_truncated_digits = num_digits - remaining;
+      n /= to_unsigned(detail::pow10(to_unsigned(num_truncated_digits)));
+      if (n) {
+        out = format_decimal<Char>(out, n, remaining).end;
+      }
+      return;
+    }
+    if (n) {
+      out = format_decimal<Char>(out, n, num_digits).end;
+      remaining -= num_digits;
+    }
+    out = detail::fill_n(out, remaining, '0');
+  }
+}
+
+// Format subseconds which are given as a floating point type with an
+// appropriate number of digits. We cannot pass the Duration here, as we
+// explicitly need to pass the Rep value in the chrono_formatter.
+template <typename Duration>
+void write_floating_seconds(memory_buffer& buf, Duration duration,
+                            int num_fractional_digits = -1) {
+  using rep = typename Duration::rep;
+  FMT_ASSERT(std::is_floating_point<rep>::value, "");
+
+  auto val = duration.count();
+
+  if (num_fractional_digits < 0) {
+    // For `std::round` with fallback to `round`:
+    // On some toolchains `std::round` is not available (e.g. GCC 6).
+    using namespace std;
+    num_fractional_digits =
+        count_fractional_digits<Duration::period::num,
+                                Duration::period::den>::value;
+    if (num_fractional_digits < 6 && static_cast<rep>(round(val)) != val)
+      num_fractional_digits = 6;
+  }
+
+  fmt::format_to(std::back_inserter(buf), FMT_STRING("{:.{}f}"),
+                 std::fmod(val * static_cast<rep>(Duration::period::num) /
+                               static_cast<rep>(Duration::period::den),
+                           static_cast<rep>(60)),
+                 num_fractional_digits);
+}
+
+template <typename OutputIt, typename Char,
+          typename Duration = std::chrono::seconds>
+class tm_writer {
+ private:
+  static constexpr int days_per_week = 7;
+
+  const std::locale& loc_;
+  const bool is_classic_;
+  OutputIt out_;
+  const Duration* subsecs_;
+  const std::tm& tm_;
+
+  auto tm_sec() const noexcept -> int {
+    FMT_ASSERT(tm_.tm_sec >= 0 && tm_.tm_sec <= 61, "");
+    return tm_.tm_sec;
+  }
+  auto tm_min() const noexcept -> int {
+    FMT_ASSERT(tm_.tm_min >= 0 && tm_.tm_min <= 59, "");
+    return tm_.tm_min;
+  }
+  auto tm_hour() const noexcept -> int {
+    FMT_ASSERT(tm_.tm_hour >= 0 && tm_.tm_hour <= 23, "");
+    return tm_.tm_hour;
+  }
+  auto tm_mday() const noexcept -> int {
+    FMT_ASSERT(tm_.tm_mday >= 1 && tm_.tm_mday <= 31, "");
+    return tm_.tm_mday;
+  }
+  auto tm_mon() const noexcept -> int {
+    FMT_ASSERT(tm_.tm_mon >= 0 && tm_.tm_mon <= 11, "");
+    return tm_.tm_mon;
+  }
+  auto tm_year() const noexcept -> long long { return 1900ll + tm_.tm_year; }
+  auto tm_wday() const noexcept -> int {
+    FMT_ASSERT(tm_.tm_wday >= 0 && tm_.tm_wday <= 6, "");
+    return tm_.tm_wday;
+  }
+  auto tm_yday() const noexcept -> int {
+    FMT_ASSERT(tm_.tm_yday >= 0 && tm_.tm_yday <= 365, "");
+    return tm_.tm_yday;
+  }
+
+  auto tm_hour12() const noexcept -> int {
+    const auto h = tm_hour();
+    const auto z = h < 12 ? h : h - 12;
+    return z == 0 ? 12 : z;
+  }
+
+  // POSIX and the C Standard are unclear or inconsistent about what %C and %y
+  // do if the year is negative or exceeds 9999. Use the convention that %C
+  // concatenated with %y yields the same output as %Y, and that %Y contains at
+  // least 4 characters, with more only if necessary.
+  auto split_year_lower(long long year) const noexcept -> int {
+    auto l = year % 100;
+    if (l < 0) l = -l;  // l in [0, 99]
+    return static_cast<int>(l);
+  }
+
+  // Algorithm: https://en.wikipedia.org/wiki/ISO_week_date.
+  auto iso_year_weeks(long long curr_year) const noexcept -> int {
+    const auto prev_year = curr_year - 1;
+    const auto curr_p =
+        (curr_year + curr_year / 4 - curr_year / 100 + curr_year / 400) %
+        days_per_week;
+    const auto prev_p =
+        (prev_year + prev_year / 4 - prev_year / 100 + prev_year / 400) %
+        days_per_week;
+    return 52 + ((curr_p == 4 || prev_p == 3) ? 1 : 0);
+  }
+  auto iso_week_num(int tm_yday, int tm_wday) const noexcept -> int {
+    return (tm_yday + 11 - (tm_wday == 0 ? days_per_week : tm_wday)) /
+           days_per_week;
+  }
+  auto tm_iso_week_year() const noexcept -> long long {
+    const auto year = tm_year();
+    const auto w = iso_week_num(tm_yday(), tm_wday());
+    if (w < 1) return year - 1;
+    if (w > iso_year_weeks(year)) return year + 1;
+    return year;
+  }
+  auto tm_iso_week_of_year() const noexcept -> int {
+    const auto year = tm_year();
+    const auto w = iso_week_num(tm_yday(), tm_wday());
+    if (w < 1) return iso_year_weeks(year - 1);
+    if (w > iso_year_weeks(year)) return 1;
+    return w;
+  }
+
+  void write1(int value) {
+    *out_++ = static_cast<char>('0' + to_unsigned(value) % 10);
+  }
+  void write2(int value) {
+    const char* d = digits2(to_unsigned(value) % 100);
+    *out_++ = *d++;
+    *out_++ = *d;
+  }
+  void write2(int value, pad_type pad) {
+    unsigned int v = to_unsigned(value) % 100;
+    if (v >= 10) {
+      const char* d = digits2(v);
+      *out_++ = *d++;
+      *out_++ = *d;
+    } else {
+      out_ = detail::write_padding(out_, pad);
+      *out_++ = static_cast<char>('0' + v);
+    }
+  }
+
+  void write_year_extended(long long year) {
+    // At least 4 characters.
+    int width = 4;
+    if (year < 0) {
+      *out_++ = '-';
+      year = 0 - year;
+      --width;
+    }
+    uint32_or_64_or_128_t<long long> n = to_unsigned(year);
+    const int num_digits = count_digits(n);
+    if (width > num_digits)
+      out_ = detail::fill_n(out_, width - num_digits, '0');
+    out_ = format_decimal<Char>(out_, n, num_digits).end;
+  }
+  void write_year(long long year) {
+    if (year >= 0 && year < 10000) {
+      write2(static_cast<int>(year / 100));
+      write2(static_cast<int>(year % 100));
+    } else {
+      write_year_extended(year);
+    }
+  }
+
+  void write_utc_offset(long offset, numeric_system ns) {
+    if (offset < 0) {
+      *out_++ = '-';
+      offset = -offset;
+    } else {
+      *out_++ = '+';
+    }
+    offset /= 60;
+    write2(static_cast<int>(offset / 60));
+    if (ns != numeric_system::standard) *out_++ = ':';
+    write2(static_cast<int>(offset % 60));
+  }
+  template <typename T, FMT_ENABLE_IF(has_member_data_tm_gmtoff<T>::value)>
+  void format_utc_offset_impl(const T& tm, numeric_system ns) {
+    write_utc_offset(tm.tm_gmtoff, ns);
+  }
+  template <typename T, FMT_ENABLE_IF(!has_member_data_tm_gmtoff<T>::value)>
+  void format_utc_offset_impl(const T& tm, numeric_system ns) {
+#if defined(_WIN32) && defined(_UCRT)
+#  if FMT_USE_TZSET
+    tzset_once();
+#  endif
+    long offset = 0;
+    _get_timezone(&offset);
+    if (tm.tm_isdst) {
+      long dstbias = 0;
+      _get_dstbias(&dstbias);
+      offset += dstbias;
+    }
+    write_utc_offset(-offset, ns);
+#else
+    if (ns == numeric_system::standard) return format_localized('z');
+
+    // Extract timezone offset from timezone conversion functions.
+    std::tm gtm = tm;
+    std::time_t gt = std::mktime(&gtm);
+    std::tm ltm = gmtime(gt);
+    std::time_t lt = std::mktime(&ltm);
+    long offset = gt - lt;
+    write_utc_offset(offset, ns);
+#endif
+  }
+
+  template <typename T, FMT_ENABLE_IF(has_member_data_tm_zone<T>::value)>
+  void format_tz_name_impl(const T& tm) {
+    if (is_classic_)
+      out_ = write_tm_str<Char>(out_, tm.tm_zone, loc_);
+    else
+      format_localized('Z');
+  }
+  template <typename T, FMT_ENABLE_IF(!has_member_data_tm_zone<T>::value)>
+  void format_tz_name_impl(const T&) {
+    format_localized('Z');
+  }
+
+  void format_localized(char format, char modifier = 0) {
+    out_ = write<Char>(out_, tm_, loc_, format, modifier);
+  }
+
+ public:
+  tm_writer(const std::locale& loc, OutputIt out, const std::tm& tm,
+            const Duration* subsecs = nullptr)
+      : loc_(loc),
+        is_classic_(loc_ == get_classic_locale()),
+        out_(out),
+        subsecs_(subsecs),
+        tm_(tm) {}
+
+  auto out() const -> OutputIt { return out_; }
+
+  FMT_CONSTEXPR void on_text(const Char* begin, const Char* end) {
+    out_ = copy<Char>(begin, end, out_);
+  }
+
+  void on_abbr_weekday() {
+    if (is_classic_)
+      out_ = write(out_, tm_wday_short_name(tm_wday()));
+    else
+      format_localized('a');
+  }
+  void on_full_weekday() {
+    if (is_classic_)
+      out_ = write(out_, tm_wday_full_name(tm_wday()));
+    else
+      format_localized('A');
+  }
+  void on_dec0_weekday(numeric_system ns) {
+    if (is_classic_ || ns == numeric_system::standard) return write1(tm_wday());
+    format_localized('w', 'O');
+  }
+  void on_dec1_weekday(numeric_system ns) {
+    if (is_classic_ || ns == numeric_system::standard) {
+      auto wday = tm_wday();
+      write1(wday == 0 ? days_per_week : wday);
+    } else {
+      format_localized('u', 'O');
+    }
+  }
+
+  void on_abbr_month() {
+    if (is_classic_)
+      out_ = write(out_, tm_mon_short_name(tm_mon()));
+    else
+      format_localized('b');
+  }
+  void on_full_month() {
+    if (is_classic_)
+      out_ = write(out_, tm_mon_full_name(tm_mon()));
+    else
+      format_localized('B');
+  }
+
+  void on_datetime(numeric_system ns) {
+    if (is_classic_) {
+      on_abbr_weekday();
+      *out_++ = ' ';
+      on_abbr_month();
+      *out_++ = ' ';
+      on_day_of_month(numeric_system::standard, pad_type::space);
+      *out_++ = ' ';
+      on_iso_time();
+      *out_++ = ' ';
+      on_year(numeric_system::standard);
+    } else {
+      format_localized('c', ns == numeric_system::standard ? '\0' : 'E');
+    }
+  }
+  void on_loc_date(numeric_system ns) {
+    if (is_classic_)
+      on_us_date();
+    else
+      format_localized('x', ns == numeric_system::standard ? '\0' : 'E');
+  }
+  void on_loc_time(numeric_system ns) {
+    if (is_classic_)
+      on_iso_time();
+    else
+      format_localized('X', ns == numeric_system::standard ? '\0' : 'E');
+  }
+  void on_us_date() {
+    char buf[8];
+    write_digit2_separated(buf, to_unsigned(tm_mon() + 1),
+                           to_unsigned(tm_mday()),
+                           to_unsigned(split_year_lower(tm_year())), '/');
+    out_ = copy<Char>(std::begin(buf), std::end(buf), out_);
+  }
+  void on_iso_date() {
+    auto year = tm_year();
+    char buf[10];
+    size_t offset = 0;
+    if (year >= 0 && year < 10000) {
+      copy2(buf, digits2(static_cast<size_t>(year / 100)));
+    } else {
+      offset = 4;
+      write_year_extended(year);
+      year = 0;
+    }
+    write_digit2_separated(buf + 2, static_cast<unsigned>(year % 100),
+                           to_unsigned(tm_mon() + 1), to_unsigned(tm_mday()),
+                           '-');
+    out_ = copy<Char>(std::begin(buf) + offset, std::end(buf), out_);
+  }
+
+  void on_utc_offset(numeric_system ns) { format_utc_offset_impl(tm_, ns); }
+  void on_tz_name() { format_tz_name_impl(tm_); }
+
+  void on_year(numeric_system ns) {
+    if (is_classic_ || ns == numeric_system::standard)
+      return write_year(tm_year());
+    format_localized('Y', 'E');
+  }
+  void on_short_year(numeric_system ns) {
+    if (is_classic_ || ns == numeric_system::standard)
+      return write2(split_year_lower(tm_year()));
+    format_localized('y', 'O');
+  }
+  void on_offset_year() {
+    if (is_classic_) return write2(split_year_lower(tm_year()));
+    format_localized('y', 'E');
+  }
+
+  void on_century(numeric_system ns) {
+    if (is_classic_ || ns == numeric_system::standard) {
+      auto year = tm_year();
+      auto upper = year / 100;
+      if (year >= -99 && year < 0) {
+        // Zero upper on negative year.
+        *out_++ = '-';
+        *out_++ = '0';
+      } else if (upper >= 0 && upper < 100) {
+        write2(static_cast<int>(upper));
+      } else {
+        out_ = write<Char>(out_, upper);
+      }
+    } else {
+      format_localized('C', 'E');
+    }
+  }
+
+  void on_dec_month(numeric_system ns) {
+    if (is_classic_ || ns == numeric_system::standard)
+      return write2(tm_mon() + 1);
+    format_localized('m', 'O');
+  }
+
+  void on_dec0_week_of_year(numeric_system ns, pad_type pad) {
+    if (is_classic_ || ns == numeric_system::standard)
+      return write2((tm_yday() + days_per_week - tm_wday()) / days_per_week,
+                    pad);
+    format_localized('U', 'O');
+  }
+  void on_dec1_week_of_year(numeric_system ns, pad_type pad) {
+    if (is_classic_ || ns == numeric_system::standard) {
+      auto wday = tm_wday();
+      write2((tm_yday() + days_per_week -
+              (wday == 0 ? (days_per_week - 1) : (wday - 1))) /
+                 days_per_week,
+             pad);
+    } else {
+      format_localized('W', 'O');
+    }
+  }
+  void on_iso_week_of_year(numeric_system ns, pad_type pad) {
+    if (is_classic_ || ns == numeric_system::standard)
+      return write2(tm_iso_week_of_year(), pad);
+    format_localized('V', 'O');
+  }
+
+  void on_iso_week_based_year() { write_year(tm_iso_week_year()); }
+  void on_iso_week_based_short_year() {
+    write2(split_year_lower(tm_iso_week_year()));
+  }
+
+  void on_day_of_year() {
+    auto yday = tm_yday() + 1;
+    write1(yday / 100);
+    write2(yday % 100);
+  }
+  void on_day_of_month(numeric_system ns, pad_type pad) {
+    if (is_classic_ || ns == numeric_system::standard)
+      return write2(tm_mday(), pad);
+    format_localized('d', 'O');
+  }
+
+  void on_24_hour(numeric_system ns, pad_type pad) {
+    if (is_classic_ || ns == numeric_system::standard)
+      return write2(tm_hour(), pad);
+    format_localized('H', 'O');
+  }
+  void on_12_hour(numeric_system ns, pad_type pad) {
+    if (is_classic_ || ns == numeric_system::standard)
+      return write2(tm_hour12(), pad);
+    format_localized('I', 'O');
+  }
+  void on_minute(numeric_system ns, pad_type pad) {
+    if (is_classic_ || ns == numeric_system::standard)
+      return write2(tm_min(), pad);
+    format_localized('M', 'O');
+  }
+
+  void on_second(numeric_system ns, pad_type pad) {
+    if (is_classic_ || ns == numeric_system::standard) {
+      write2(tm_sec(), pad);
+      if (subsecs_) {
+        if (std::is_floating_point<typename Duration::rep>::value) {
+          auto buf = memory_buffer();
+          write_floating_seconds(buf, *subsecs_);
+          if (buf.size() > 1) {
+            // Remove the leading "0", write something like ".123".
+            out_ = std::copy(buf.begin() + 1, buf.end(), out_);
+          }
+        } else {
+          write_fractional_seconds<Char>(out_, *subsecs_);
+        }
+      }
+    } else {
+      // Currently no formatting of subseconds when a locale is set.
+      format_localized('S', 'O');
+    }
+  }
+
+  void on_12_hour_time() {
+    if (is_classic_) {
+      char buf[8];
+      write_digit2_separated(buf, to_unsigned(tm_hour12()),
+                             to_unsigned(tm_min()), to_unsigned(tm_sec()), ':');
+      out_ = copy<Char>(std::begin(buf), std::end(buf), out_);
+      *out_++ = ' ';
+      on_am_pm();
+    } else {
+      format_localized('r');
+    }
+  }
+  void on_24_hour_time() {
+    write2(tm_hour());
+    *out_++ = ':';
+    write2(tm_min());
+  }
+  void on_iso_time() {
+    on_24_hour_time();
+    *out_++ = ':';
+    on_second(numeric_system::standard, pad_type::zero);
+  }
+
+  void on_am_pm() {
+    if (is_classic_) {
+      *out_++ = tm_hour() < 12 ? 'A' : 'P';
+      *out_++ = 'M';
+    } else {
+      format_localized('p');
+    }
+  }
+
+  // These apply to chrono durations but not tm.
+  void on_duration_value() {}
+  void on_duration_unit() {}
+};
+
+struct chrono_format_checker : null_chrono_spec_handler<chrono_format_checker> {
+  bool has_precision_integral = false;
+
+  FMT_NORETURN void unsupported() { FMT_THROW(format_error("no date")); }
+
+  template <typename Char>
+  FMT_CONSTEXPR void on_text(const Char*, const Char*) {}
+  FMT_CONSTEXPR void on_day_of_year() {}
+  FMT_CONSTEXPR void on_24_hour(numeric_system, pad_type) {}
+  FMT_CONSTEXPR void on_12_hour(numeric_system, pad_type) {}
+  FMT_CONSTEXPR void on_minute(numeric_system, pad_type) {}
+  FMT_CONSTEXPR void on_second(numeric_system, pad_type) {}
+  FMT_CONSTEXPR void on_12_hour_time() {}
+  FMT_CONSTEXPR void on_24_hour_time() {}
+  FMT_CONSTEXPR void on_iso_time() {}
+  FMT_CONSTEXPR void on_am_pm() {}
+  FMT_CONSTEXPR void on_duration_value() const {
+    if (has_precision_integral) {
+      FMT_THROW(format_error("precision not allowed for this argument type"));
+    }
+  }
+  FMT_CONSTEXPR void on_duration_unit() {}
+};
+
+template <typename T,
+          FMT_ENABLE_IF(std::is_integral<T>::value&& has_isfinite<T>::value)>
+inline auto isfinite(T) -> bool {
+  return true;
+}
+
+template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
+inline auto mod(T x, int y) -> T {
+  return x % static_cast<T>(y);
+}
+template <typename T, FMT_ENABLE_IF(std::is_floating_point<T>::value)>
+inline auto mod(T x, int y) -> T {
+  return std::fmod(x, static_cast<T>(y));
+}
+
+// If T is an integral type, maps T to its unsigned counterpart, otherwise
+// leaves it unchanged (unlike std::make_unsigned).
+template <typename T, bool INTEGRAL = std::is_integral<T>::value>
+struct make_unsigned_or_unchanged {
+  using type = T;
+};
+
+template <typename T> struct make_unsigned_or_unchanged<T, true> {
+  using type = typename std::make_unsigned<T>::type;
+};
+
+template <typename Rep, typename Period,
+          FMT_ENABLE_IF(std::is_integral<Rep>::value)>
+inline auto get_milliseconds(std::chrono::duration<Rep, Period> d)
+    -> std::chrono::duration<Rep, std::milli> {
+  // this may overflow and/or the result may not fit in the
+  // target type.
+#if FMT_SAFE_DURATION_CAST
+  using CommonSecondsType =
+      typename std::common_type<decltype(d), std::chrono::seconds>::type;
+  const auto d_as_common = fmt_duration_cast<CommonSecondsType>(d);
+  const auto d_as_whole_seconds =
+      fmt_duration_cast<std::chrono::seconds>(d_as_common);
+  // this conversion should be nonproblematic
+  const auto diff = d_as_common - d_as_whole_seconds;
+  const auto ms =
+      fmt_duration_cast<std::chrono::duration<Rep, std::milli>>(diff);
+  return ms;
+#else
+  auto s = fmt_duration_cast<std::chrono::seconds>(d);
+  return fmt_duration_cast<std::chrono::milliseconds>(d - s);
+#endif
+}
+
+template <typename Char, typename Rep, typename OutputIt,
+          FMT_ENABLE_IF(std::is_integral<Rep>::value)>
+auto format_duration_value(OutputIt out, Rep val, int) -> OutputIt {
+  return write<Char>(out, val);
+}
+
+template <typename Char, typename Rep, typename OutputIt,
+          FMT_ENABLE_IF(std::is_floating_point<Rep>::value)>
+auto format_duration_value(OutputIt out, Rep val, int precision) -> OutputIt {
+  auto specs = format_specs();
+  specs.precision = precision;
+  specs.type =
+      precision >= 0 ? presentation_type::fixed : presentation_type::general;
+  return write<Char>(out, val, specs);
+}
+
+template <typename Char, typename OutputIt>
+auto copy_unit(string_view unit, OutputIt out, Char) -> OutputIt {
+  return std::copy(unit.begin(), unit.end(), out);
+}
+
+template <typename OutputIt>
+auto copy_unit(string_view unit, OutputIt out, wchar_t) -> OutputIt {
+  // This works when wchar_t is UTF-32 because units only contain characters
+  // that have the same representation in UTF-16 and UTF-32.
+  utf8_to_utf16 u(unit);
+  return std::copy(u.c_str(), u.c_str() + u.size(), out);
+}
+
+template <typename Char, typename Period, typename OutputIt>
+auto format_duration_unit(OutputIt out) -> OutputIt {
+  if (const char* unit = get_units<Period>())
+    return copy_unit(string_view(unit), out, Char());
+  *out++ = '[';
+  out = write<Char>(out, Period::num);
+  if (const_check(Period::den != 1)) {
+    *out++ = '/';
+    out = write<Char>(out, Period::den);
+  }
+  *out++ = ']';
+  *out++ = 's';
+  return out;
+}
+
+class get_locale {
+ private:
+  union {
+    std::locale locale_;
+  };
+  bool has_locale_ = false;
+
+ public:
+  get_locale(bool localized, locale_ref loc) : has_locale_(localized) {
+#ifndef FMT_STATIC_THOUSANDS_SEPARATOR
+    if (localized)
+      ::new (&locale_) std::locale(loc.template get<std::locale>());
+#endif
+  }
+  ~get_locale() {
+    if (has_locale_) locale_.~locale();
+  }
+  operator const std::locale&() const {
+    return has_locale_ ? locale_ : get_classic_locale();
+  }
+};
+
+template <typename FormatContext, typename OutputIt, typename Rep,
+          typename Period>
+struct chrono_formatter {
+  FormatContext& context;
+  OutputIt out;
+  int precision;
+  bool localized = false;
+  // rep is unsigned to avoid overflow.
+  using rep =
+      conditional_t<std::is_integral<Rep>::value && sizeof(Rep) < sizeof(int),
+                    unsigned, typename make_unsigned_or_unchanged<Rep>::type>;
+  rep val;
+  using seconds = std::chrono::duration<rep>;
+  seconds s;
+  using milliseconds = std::chrono::duration<rep, std::milli>;
+  bool negative;
+
+  using char_type = typename FormatContext::char_type;
+  using tm_writer_type = tm_writer<OutputIt, char_type>;
+
+  chrono_formatter(FormatContext& ctx, OutputIt o,
+                   std::chrono::duration<Rep, Period> d)
+      : context(ctx),
+        out(o),
+        val(static_cast<rep>(d.count())),
+        negative(false) {
+    if (d.count() < 0) {
+      val = 0 - val;
+      negative = true;
+    }
+
+    // this may overflow and/or the result may not fit in the
+    // target type.
+    // might need checked conversion (rep!=Rep)
+    s = fmt_duration_cast<seconds>(std::chrono::duration<rep, Period>(val));
+  }
+
+  // returns true if nan or inf, writes to out.
+  auto handle_nan_inf() -> bool {
+    if (isfinite(val)) {
+      return false;
+    }
+    if (isnan(val)) {
+      write_nan();
+      return true;
+    }
+    // must be +-inf
+    if (val > 0) {
+      write_pinf();
+    } else {
+      write_ninf();
+    }
+    return true;
+  }
+
+  auto days() const -> Rep { return static_cast<Rep>(s.count() / 86400); }
+  auto hour() const -> Rep {
+    return static_cast<Rep>(mod((s.count() / 3600), 24));
+  }
+
+  auto hour12() const -> Rep {
+    Rep hour = static_cast<Rep>(mod((s.count() / 3600), 12));
+    return hour <= 0 ? 12 : hour;
+  }
+
+  auto minute() const -> Rep {
+    return static_cast<Rep>(mod((s.count() / 60), 60));
+  }
+  auto second() const -> Rep { return static_cast<Rep>(mod(s.count(), 60)); }
+
+  auto time() const -> std::tm {
+    auto time = std::tm();
+    time.tm_hour = to_nonnegative_int(hour(), 24);
+    time.tm_min = to_nonnegative_int(minute(), 60);
+    time.tm_sec = to_nonnegative_int(second(), 60);
+    return time;
+  }
+
+  void write_sign() {
+    if (negative) {
+      *out++ = '-';
+      negative = false;
+    }
+  }
+
+  void write(Rep value, int width, pad_type pad = pad_type::zero) {
+    write_sign();
+    if (isnan(value)) return write_nan();
+    uint32_or_64_or_128_t<int> n =
+        to_unsigned(to_nonnegative_int(value, max_value<int>()));
+    int num_digits = detail::count_digits(n);
+    if (width > num_digits) {
+      out = detail::write_padding(out, pad, width - num_digits);
+    }
+    out = format_decimal<char_type>(out, n, num_digits).end;
+  }
+
+  void write_nan() { std::copy_n("nan", 3, out); }
+  void write_pinf() { std::copy_n("inf", 3, out); }
+  void write_ninf() { std::copy_n("-inf", 4, out); }
+
+  template <typename Callback, typename... Args>
+  void format_tm(const tm& time, Callback cb, Args... args) {
+    if (isnan(val)) return write_nan();
+    get_locale loc(localized, context.locale());
+    auto w = tm_writer_type(loc, out, time);
+    (w.*cb)(args...);
+    out = w.out();
+  }
+
+  void on_text(const char_type* begin, const char_type* end) {
+    std::copy(begin, end, out);
+  }
+
+  // These are not implemented because durations don't have date information.
+  void on_abbr_weekday() {}
+  void on_full_weekday() {}
+  void on_dec0_weekday(numeric_system) {}
+  void on_dec1_weekday(numeric_system) {}
+  void on_abbr_month() {}
+  void on_full_month() {}
+  void on_datetime(numeric_system) {}
+  void on_loc_date(numeric_system) {}
+  void on_loc_time(numeric_system) {}
+  void on_us_date() {}
+  void on_iso_date() {}
+  void on_utc_offset(numeric_system) {}
+  void on_tz_name() {}
+  void on_year(numeric_system) {}
+  void on_short_year(numeric_system) {}
+  void on_offset_year() {}
+  void on_century(numeric_system) {}
+  void on_iso_week_based_year() {}
+  void on_iso_week_based_short_year() {}
+  void on_dec_month(numeric_system) {}
+  void on_dec0_week_of_year(numeric_system, pad_type) {}
+  void on_dec1_week_of_year(numeric_system, pad_type) {}
+  void on_iso_week_of_year(numeric_system, pad_type) {}
+  void on_day_of_month(numeric_system, pad_type) {}
+
+  void on_day_of_year() {
+    if (handle_nan_inf()) return;
+    write(days(), 0);
+  }
+
+  void on_24_hour(numeric_system ns, pad_type pad) {
+    if (handle_nan_inf()) return;
+
+    if (ns == numeric_system::standard) return write(hour(), 2, pad);
+    auto time = tm();
+    time.tm_hour = to_nonnegative_int(hour(), 24);
+    format_tm(time, &tm_writer_type::on_24_hour, ns, pad);
+  }
+
+  void on_12_hour(numeric_system ns, pad_type pad) {
+    if (handle_nan_inf()) return;
+
+    if (ns == numeric_system::standard) return write(hour12(), 2, pad);
+    auto time = tm();
+    time.tm_hour = to_nonnegative_int(hour12(), 12);
+    format_tm(time, &tm_writer_type::on_12_hour, ns, pad);
+  }
+
+  void on_minute(numeric_system ns, pad_type pad) {
+    if (handle_nan_inf()) return;
+
+    if (ns == numeric_system::standard) return write(minute(), 2, pad);
+    auto time = tm();
+    time.tm_min = to_nonnegative_int(minute(), 60);
+    format_tm(time, &tm_writer_type::on_minute, ns, pad);
+  }
+
+  void on_second(numeric_system ns, pad_type pad) {
+    if (handle_nan_inf()) return;
+
+    if (ns == numeric_system::standard) {
+      if (std::is_floating_point<rep>::value) {
+        auto buf = memory_buffer();
+        write_floating_seconds(buf, std::chrono::duration<rep, Period>(val),
+                               precision);
+        if (negative) *out++ = '-';
+        if (buf.size() < 2 || buf[1] == '.') {
+          out = detail::write_padding(out, pad);
+        }
+        out = std::copy(buf.begin(), buf.end(), out);
+      } else {
+        write(second(), 2, pad);
+        write_fractional_seconds<char_type>(
+            out, std::chrono::duration<rep, Period>(val), precision);
+      }
+      return;
+    }
+    auto time = tm();
+    time.tm_sec = to_nonnegative_int(second(), 60);
+    format_tm(time, &tm_writer_type::on_second, ns, pad);
+  }
+
+  void on_12_hour_time() {
+    if (handle_nan_inf()) return;
+    format_tm(time(), &tm_writer_type::on_12_hour_time);
+  }
+
+  void on_24_hour_time() {
+    if (handle_nan_inf()) {
+      *out++ = ':';
+      handle_nan_inf();
+      return;
+    }
+
+    write(hour(), 2);
+    *out++ = ':';
+    write(minute(), 2);
+  }
+
+  void on_iso_time() {
+    on_24_hour_time();
+    *out++ = ':';
+    if (handle_nan_inf()) return;
+    on_second(numeric_system::standard, pad_type::zero);
+  }
+
+  void on_am_pm() {
+    if (handle_nan_inf()) return;
+    format_tm(time(), &tm_writer_type::on_am_pm);
+  }
+
+  void on_duration_value() {
+    if (handle_nan_inf()) return;
+    write_sign();
+    out = format_duration_value<char_type>(out, val, precision);
+  }
+
+  void on_duration_unit() {
+    out = format_duration_unit<char_type, Period>(out);
+  }
+};
+
+}  // namespace detail
+
+#if defined(__cpp_lib_chrono) && __cpp_lib_chrono >= 201907
+using weekday = std::chrono::weekday;
+using day = std::chrono::day;
+using month = std::chrono::month;
+using year = std::chrono::year;
+using year_month_day = std::chrono::year_month_day;
+#else
+// A fallback version of weekday.
+class weekday {
+ private:
+  unsigned char value_;
+
+ public:
+  weekday() = default;
+  constexpr explicit weekday(unsigned wd) noexcept
+      : value_(static_cast<unsigned char>(wd != 7 ? wd : 0)) {}
+  constexpr auto c_encoding() const noexcept -> unsigned { return value_; }
+};
+
+class day {
+ private:
+  unsigned char value_;
+
+ public:
+  day() = default;
+  constexpr explicit day(unsigned d) noexcept
+      : value_(static_cast<unsigned char>(d)) {}
+  constexpr explicit operator unsigned() const noexcept { return value_; }
+};
+
+class month {
+ private:
+  unsigned char value_;
+
+ public:
+  month() = default;
+  constexpr explicit month(unsigned m) noexcept
+      : value_(static_cast<unsigned char>(m)) {}
+  constexpr explicit operator unsigned() const noexcept { return value_; }
+};
+
+class year {
+ private:
+  int value_;
+
+ public:
+  year() = default;
+  constexpr explicit year(int y) noexcept : value_(y) {}
+  constexpr explicit operator int() const noexcept { return value_; }
+};
+
+class year_month_day {
+ private:
+  fmt::year year_;
+  fmt::month month_;
+  fmt::day day_;
+
+ public:
+  year_month_day() = default;
+  constexpr year_month_day(const year& y, const month& m, const day& d) noexcept
+      : year_(y), month_(m), day_(d) {}
+  constexpr auto year() const noexcept -> fmt::year { return year_; }
+  constexpr auto month() const noexcept -> fmt::month { return month_; }
+  constexpr auto day() const noexcept -> fmt::day { return day_; }
+};
+#endif
+
+template <typename Char>
+struct formatter<weekday, Char> : private formatter<std::tm, Char> {
+ private:
+  bool localized_ = false;
+  bool use_tm_formatter_ = false;
+
+ public:
+  FMT_CONSTEXPR auto parse(basic_format_parse_context<Char>& ctx)
+      -> decltype(ctx.begin()) {
+    auto it = ctx.begin(), end = ctx.end();
+    if (it != end && *it == 'L') {
+      ++it;
+      localized_ = true;
+      return it;
+    }
+    use_tm_formatter_ = it != end && *it != '}';
+    return use_tm_formatter_ ? formatter<std::tm, Char>::parse(ctx) : it;
+  }
+
+  template <typename FormatContext>
+  auto format(weekday wd, FormatContext& ctx) const -> decltype(ctx.out()) {
+    auto time = std::tm();
+    time.tm_wday = static_cast<int>(wd.c_encoding());
+    if (use_tm_formatter_) return formatter<std::tm, Char>::format(time, ctx);
+    detail::get_locale loc(localized_, ctx.locale());
+    auto w = detail::tm_writer<decltype(ctx.out()), Char>(loc, ctx.out(), time);
+    w.on_abbr_weekday();
+    return w.out();
+  }
+};
+
+template <typename Char>
+struct formatter<day, Char> : private formatter<std::tm, Char> {
+ private:
+  bool use_tm_formatter_ = false;
+
+ public:
+  FMT_CONSTEXPR auto parse(basic_format_parse_context<Char>& ctx)
+      -> decltype(ctx.begin()) {
+    auto it = ctx.begin(), end = ctx.end();
+    use_tm_formatter_ = it != end && *it != '}';
+    return use_tm_formatter_ ? formatter<std::tm, Char>::parse(ctx) : it;
+  }
+
+  template <typename FormatContext>
+  auto format(day d, FormatContext& ctx) const -> decltype(ctx.out()) {
+    auto time = std::tm();
+    time.tm_mday = static_cast<int>(static_cast<unsigned>(d));
+    if (use_tm_formatter_) return formatter<std::tm, Char>::format(time, ctx);
+    detail::get_locale loc(false, ctx.locale());
+    auto w = detail::tm_writer<decltype(ctx.out()), Char>(loc, ctx.out(), time);
+    w.on_day_of_month(detail::numeric_system::standard, detail::pad_type::zero);
+    return w.out();
+  }
+};
+
+template <typename Char>
+struct formatter<month, Char> : private formatter<std::tm, Char> {
+ private:
+  bool localized_ = false;
+  bool use_tm_formatter_ = false;
+
+ public:
+  FMT_CONSTEXPR auto parse(basic_format_parse_context<Char>& ctx)
+      -> decltype(ctx.begin()) {
+    auto it = ctx.begin(), end = ctx.end();
+    if (it != end && *it == 'L') {
+      ++it;
+      localized_ = true;
+      return it;
+    }
+    use_tm_formatter_ = it != end && *it != '}';
+    return use_tm_formatter_ ? formatter<std::tm, Char>::parse(ctx) : it;
+  }
+
+  template <typename FormatContext>
+  auto format(month m, FormatContext& ctx) const -> decltype(ctx.out()) {
+    auto time = std::tm();
+    time.tm_mon = static_cast<int>(static_cast<unsigned>(m)) - 1;
+    if (use_tm_formatter_) return formatter<std::tm, Char>::format(time, ctx);
+    detail::get_locale loc(localized_, ctx.locale());
+    auto w = detail::tm_writer<decltype(ctx.out()), Char>(loc, ctx.out(), time);
+    w.on_abbr_month();
+    return w.out();
+  }
+};
+
+template <typename Char>
+struct formatter<year, Char> : private formatter<std::tm, Char> {
+ private:
+  bool use_tm_formatter_ = false;
+
+ public:
+  FMT_CONSTEXPR auto parse(basic_format_parse_context<Char>& ctx)
+      -> decltype(ctx.begin()) {
+    auto it = ctx.begin(), end = ctx.end();
+    use_tm_formatter_ = it != end && *it != '}';
+    return use_tm_formatter_ ? formatter<std::tm, Char>::parse(ctx) : it;
+  }
+
+  template <typename FormatContext>
+  auto format(year y, FormatContext& ctx) const -> decltype(ctx.out()) {
+    auto time = std::tm();
+    time.tm_year = static_cast<int>(y) - 1900;
+    if (use_tm_formatter_) return formatter<std::tm, Char>::format(time, ctx);
+    detail::get_locale loc(false, ctx.locale());
+    auto w = detail::tm_writer<decltype(ctx.out()), Char>(loc, ctx.out(), time);
+    w.on_year(detail::numeric_system::standard);
+    return w.out();
+  }
+};
+
+template <typename Char>
+struct formatter<year_month_day, Char> : private formatter<std::tm, Char> {
+ private:
+  bool use_tm_formatter_ = false;
+
+ public:
+  FMT_CONSTEXPR auto parse(basic_format_parse_context<Char>& ctx)
+      -> decltype(ctx.begin()) {
+    auto it = ctx.begin(), end = ctx.end();
+    use_tm_formatter_ = it != end && *it != '}';
+    return use_tm_formatter_ ? formatter<std::tm, Char>::parse(ctx) : it;
+  }
+
+  template <typename FormatContext>
+  auto format(year_month_day val, FormatContext& ctx) const
+      -> decltype(ctx.out()) {
+    auto time = std::tm();
+    time.tm_year = static_cast<int>(val.year()) - 1900;
+    time.tm_mon = static_cast<int>(static_cast<unsigned>(val.month())) - 1;
+    time.tm_mday = static_cast<int>(static_cast<unsigned>(val.day()));
+    if (use_tm_formatter_) return formatter<std::tm, Char>::format(time, ctx);
+    detail::get_locale loc(true, ctx.locale());
+    auto w = detail::tm_writer<decltype(ctx.out()), Char>(loc, ctx.out(), time);
+    w.on_iso_date();
+    return w.out();
+  }
+};
+
+template <typename Rep, typename Period, typename Char>
+struct formatter<std::chrono::duration<Rep, Period>, Char> {
+ private:
+  format_specs specs_;
+  detail::arg_ref<Char> width_ref_;
+  detail::arg_ref<Char> precision_ref_;
+  bool localized_ = false;
+  basic_string_view<Char> format_str_;
+
+ public:
+  FMT_CONSTEXPR auto parse(basic_format_parse_context<Char>& ctx)
+      -> decltype(ctx.begin()) {
+    auto it = ctx.begin(), end = ctx.end();
+    if (it == end || *it == '}') return it;
+
+    it = detail::parse_align(it, end, specs_);
+    if (it == end) return it;
+
+    it = detail::parse_dynamic_spec(it, end, specs_.width, width_ref_, ctx);
+    if (it == end) return it;
+
+    auto checker = detail::chrono_format_checker();
+    if (*it == '.') {
+      checker.has_precision_integral = !std::is_floating_point<Rep>::value;
+      it = detail::parse_precision(it, end, specs_.precision, precision_ref_,
+                                   ctx);
+    }
+    if (it != end && *it == 'L') {
+      localized_ = true;
+      ++it;
+    }
+    end = detail::parse_chrono_format(it, end, checker);
+    format_str_ = {it, detail::to_unsigned(end - it)};
+    return end;
+  }
+
+  template <typename FormatContext>
+  auto format(std::chrono::duration<Rep, Period> d, FormatContext& ctx) const
+      -> decltype(ctx.out()) {
+    auto specs = specs_;
+    auto precision = specs.precision;
+    specs.precision = -1;
+    auto begin = format_str_.begin(), end = format_str_.end();
+    // As a possible future optimization, we could avoid extra copying if width
+    // is not specified.
+    auto buf = basic_memory_buffer<Char>();
+    auto out = std::back_inserter(buf);
+    detail::handle_dynamic_spec<detail::width_checker>(specs.width, width_ref_,
+                                                       ctx);
+    detail::handle_dynamic_spec<detail::precision_checker>(precision,
+                                                           precision_ref_, ctx);
+    if (begin == end || *begin == '}') {
+      out = detail::format_duration_value<Char>(out, d.count(), precision);
+      detail::format_duration_unit<Char, Period>(out);
+    } else {
+      using chrono_formatter =
+          detail::chrono_formatter<FormatContext, decltype(out), Rep, Period>;
+      auto f = chrono_formatter(ctx, out, d);
+      f.precision = precision;
+      f.localized = localized_;
+      detail::parse_chrono_format(begin, end, f);
+    }
+    return detail::write(
+        ctx.out(), basic_string_view<Char>(buf.data(), buf.size()), specs);
+  }
+};
+
+template <typename Char, typename Duration>
+struct formatter<std::chrono::time_point<std::chrono::system_clock, Duration>,
+                 Char> : formatter<std::tm, Char> {
+  FMT_CONSTEXPR formatter() {
+    this->format_str_ = detail::string_literal<Char, '%', 'F', ' ', '%', 'T'>{};
+  }
+
+  template <typename FormatContext>
+  auto format(std::chrono::time_point<std::chrono::system_clock, Duration> val,
+              FormatContext& ctx) const -> decltype(ctx.out()) {
+    std::tm tm = gmtime(val);
+    using period = typename Duration::period;
+    if (detail::const_check(
+            period::num == 1 && period::den == 1 &&
+            !std::is_floating_point<typename Duration::rep>::value)) {
+      return formatter<std::tm, Char>::format(tm, ctx);
+    }
+    Duration epoch = val.time_since_epoch();
+    Duration subsecs = detail::fmt_duration_cast<Duration>(
+        epoch - detail::fmt_duration_cast<std::chrono::seconds>(epoch));
+    if (subsecs.count() < 0) {
+      auto second =
+          detail::fmt_duration_cast<Duration>(std::chrono::seconds(1));
+      if (tm.tm_sec != 0)
+        --tm.tm_sec;
+      else
+        tm = gmtime(val - second);
+      subsecs += detail::fmt_duration_cast<Duration>(std::chrono::seconds(1));
+    }
+    return formatter<std::tm, Char>::do_format(tm, ctx, &subsecs);
+  }
+};
+
+#if FMT_USE_LOCAL_TIME
+template <typename Char, typename Duration>
+struct formatter<std::chrono::local_time<Duration>, Char>
+    : formatter<std::tm, Char> {
+  FMT_CONSTEXPR formatter() {
+    this->format_str_ = detail::string_literal<Char, '%', 'F', ' ', '%', 'T'>{};
+  }
+
+  template <typename FormatContext>
+  auto format(std::chrono::local_time<Duration> val, FormatContext& ctx) const
+      -> decltype(ctx.out()) {
+    using period = typename Duration::period;
+    if (period::num != 1 || period::den != 1 ||
+        std::is_floating_point<typename Duration::rep>::value) {
+      const auto epoch = val.time_since_epoch();
+      const auto subsecs = detail::fmt_duration_cast<Duration>(
+          epoch - detail::fmt_duration_cast<std::chrono::seconds>(epoch));
+
+      return formatter<std::tm, Char>::do_format(localtime(val), ctx, &subsecs);
+    }
+
+    return formatter<std::tm, Char>::format(localtime(val), ctx);
+  }
+};
+#endif
+
+#if FMT_USE_UTC_TIME
+template <typename Char, typename Duration>
+struct formatter<std::chrono::time_point<std::chrono::utc_clock, Duration>,
+                 Char>
+    : formatter<std::chrono::time_point<std::chrono::system_clock, Duration>,
+                Char> {
+  template <typename FormatContext>
+  auto format(std::chrono::time_point<std::chrono::utc_clock, Duration> val,
+              FormatContext& ctx) const -> decltype(ctx.out()) {
+    return formatter<
+        std::chrono::time_point<std::chrono::system_clock, Duration>,
+        Char>::format(std::chrono::utc_clock::to_sys(val), ctx);
+  }
+};
+#endif
+
+template <typename Char> struct formatter<std::tm, Char> {
+ private:
+  format_specs specs_;
+  detail::arg_ref<Char> width_ref_;
+
+ protected:
+  basic_string_view<Char> format_str_;
+
+  template <typename FormatContext, typename Duration>
+  auto do_format(const std::tm& tm, FormatContext& ctx,
+                 const Duration* subsecs) const -> decltype(ctx.out()) {
+    auto specs = specs_;
+    auto buf = basic_memory_buffer<Char>();
+    auto out = std::back_inserter(buf);
+    detail::handle_dynamic_spec<detail::width_checker>(specs.width, width_ref_,
+                                                       ctx);
+
+    auto loc_ref = ctx.locale();
+    detail::get_locale loc(static_cast<bool>(loc_ref), loc_ref);
+    auto w =
+        detail::tm_writer<decltype(out), Char, Duration>(loc, out, tm, subsecs);
+    detail::parse_chrono_format(format_str_.begin(), format_str_.end(), w);
+    return detail::write(
+        ctx.out(), basic_string_view<Char>(buf.data(), buf.size()), specs);
+  }
+
+ public:
+  FMT_CONSTEXPR auto parse(basic_format_parse_context<Char>& ctx)
+      -> decltype(ctx.begin()) {
+    auto it = ctx.begin(), end = ctx.end();
+    if (it == end || *it == '}') return it;
+
+    it = detail::parse_align(it, end, specs_);
+    if (it == end) return it;
+
+    it = detail::parse_dynamic_spec(it, end, specs_.width, width_ref_, ctx);
+    if (it == end) return it;
+
+    end = detail::parse_chrono_format(it, end, detail::tm_format_checker());
+    // Replace the default format_str only if the new spec is not empty.
+    if (end != it) format_str_ = {it, detail::to_unsigned(end - it)};
+    return end;
+  }
+
+  template <typename FormatContext>
+  auto format(const std::tm& tm, FormatContext& ctx) const
+      -> decltype(ctx.out()) {
+    return do_format<FormatContext, std::chrono::seconds>(tm, ctx, nullptr);
+  }
+};
+
+FMT_END_EXPORT
+FMT_END_NAMESPACE
+
+#endif  // FMT_CHRONO_H_
diff --git a/third_party/fmt/include/fmt/color.h b/third_party/fmt/include/fmt/color.h
new file mode 100644
index 00000000..f0e9dd94
--- /dev/null
+++ b/third_party/fmt/include/fmt/color.h
@@ -0,0 +1,612 @@
+// Formatting library for C++ - color support
+//
+// Copyright (c) 2018 - present, Victor Zverovich and fmt contributors
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_COLOR_H_
+#define FMT_COLOR_H_
+
+#include "format.h"
+
+FMT_BEGIN_NAMESPACE
+FMT_BEGIN_EXPORT
+
+enum class color : uint32_t {
+  alice_blue = 0xF0F8FF,               // rgb(240,248,255)
+  antique_white = 0xFAEBD7,            // rgb(250,235,215)
+  aqua = 0x00FFFF,                     // rgb(0,255,255)
+  aquamarine = 0x7FFFD4,               // rgb(127,255,212)
+  azure = 0xF0FFFF,                    // rgb(240,255,255)
+  beige = 0xF5F5DC,                    // rgb(245,245,220)
+  bisque = 0xFFE4C4,                   // rgb(255,228,196)
+  black = 0x000000,                    // rgb(0,0,0)
+  blanched_almond = 0xFFEBCD,          // rgb(255,235,205)
+  blue = 0x0000FF,                     // rgb(0,0,255)
+  blue_violet = 0x8A2BE2,              // rgb(138,43,226)
+  brown = 0xA52A2A,                    // rgb(165,42,42)
+  burly_wood = 0xDEB887,               // rgb(222,184,135)
+  cadet_blue = 0x5F9EA0,               // rgb(95,158,160)
+  chartreuse = 0x7FFF00,               // rgb(127,255,0)
+  chocolate = 0xD2691E,                // rgb(210,105,30)
+  coral = 0xFF7F50,                    // rgb(255,127,80)
+  cornflower_blue = 0x6495ED,          // rgb(100,149,237)
+  cornsilk = 0xFFF8DC,                 // rgb(255,248,220)
+  crimson = 0xDC143C,                  // rgb(220,20,60)
+  cyan = 0x00FFFF,                     // rgb(0,255,255)
+  dark_blue = 0x00008B,                // rgb(0,0,139)
+  dark_cyan = 0x008B8B,                // rgb(0,139,139)
+  dark_golden_rod = 0xB8860B,          // rgb(184,134,11)
+  dark_gray = 0xA9A9A9,                // rgb(169,169,169)
+  dark_green = 0x006400,               // rgb(0,100,0)
+  dark_khaki = 0xBDB76B,               // rgb(189,183,107)
+  dark_magenta = 0x8B008B,             // rgb(139,0,139)
+  dark_olive_green = 0x556B2F,         // rgb(85,107,47)
+  dark_orange = 0xFF8C00,              // rgb(255,140,0)
+  dark_orchid = 0x9932CC,              // rgb(153,50,204)
+  dark_red = 0x8B0000,                 // rgb(139,0,0)
+  dark_salmon = 0xE9967A,              // rgb(233,150,122)
+  dark_sea_green = 0x8FBC8F,           // rgb(143,188,143)
+  dark_slate_blue = 0x483D8B,          // rgb(72,61,139)
+  dark_slate_gray = 0x2F4F4F,          // rgb(47,79,79)
+  dark_turquoise = 0x00CED1,           // rgb(0,206,209)
+  dark_violet = 0x9400D3,              // rgb(148,0,211)
+  deep_pink = 0xFF1493,                // rgb(255,20,147)
+  deep_sky_blue = 0x00BFFF,            // rgb(0,191,255)
+  dim_gray = 0x696969,                 // rgb(105,105,105)
+  dodger_blue = 0x1E90FF,              // rgb(30,144,255)
+  fire_brick = 0xB22222,               // rgb(178,34,34)
+  floral_white = 0xFFFAF0,             // rgb(255,250,240)
+  forest_green = 0x228B22,             // rgb(34,139,34)
+  fuchsia = 0xFF00FF,                  // rgb(255,0,255)
+  gainsboro = 0xDCDCDC,                // rgb(220,220,220)
+  ghost_white = 0xF8F8FF,              // rgb(248,248,255)
+  gold = 0xFFD700,                     // rgb(255,215,0)
+  golden_rod = 0xDAA520,               // rgb(218,165,32)
+  gray = 0x808080,                     // rgb(128,128,128)
+  green = 0x008000,                    // rgb(0,128,0)
+  green_yellow = 0xADFF2F,             // rgb(173,255,47)
+  honey_dew = 0xF0FFF0,                // rgb(240,255,240)
+  hot_pink = 0xFF69B4,                 // rgb(255,105,180)
+  indian_red = 0xCD5C5C,               // rgb(205,92,92)
+  indigo = 0x4B0082,                   // rgb(75,0,130)
+  ivory = 0xFFFFF0,                    // rgb(255,255,240)
+  khaki = 0xF0E68C,                    // rgb(240,230,140)
+  lavender = 0xE6E6FA,                 // rgb(230,230,250)
+  lavender_blush = 0xFFF0F5,           // rgb(255,240,245)
+  lawn_green = 0x7CFC00,               // rgb(124,252,0)
+  lemon_chiffon = 0xFFFACD,            // rgb(255,250,205)
+  light_blue = 0xADD8E6,               // rgb(173,216,230)
+  light_coral = 0xF08080,              // rgb(240,128,128)
+  light_cyan = 0xE0FFFF,               // rgb(224,255,255)
+  light_golden_rod_yellow = 0xFAFAD2,  // rgb(250,250,210)
+  light_gray = 0xD3D3D3,               // rgb(211,211,211)
+  light_green = 0x90EE90,              // rgb(144,238,144)
+  light_pink = 0xFFB6C1,               // rgb(255,182,193)
+  light_salmon = 0xFFA07A,             // rgb(255,160,122)
+  light_sea_green = 0x20B2AA,          // rgb(32,178,170)
+  light_sky_blue = 0x87CEFA,           // rgb(135,206,250)
+  light_slate_gray = 0x778899,         // rgb(119,136,153)
+  light_steel_blue = 0xB0C4DE,         // rgb(176,196,222)
+  light_yellow = 0xFFFFE0,             // rgb(255,255,224)
+  lime = 0x00FF00,                     // rgb(0,255,0)
+  lime_green = 0x32CD32,               // rgb(50,205,50)
+  linen = 0xFAF0E6,                    // rgb(250,240,230)
+  magenta = 0xFF00FF,                  // rgb(255,0,255)
+  maroon = 0x800000,                   // rgb(128,0,0)
+  medium_aquamarine = 0x66CDAA,        // rgb(102,205,170)
+  medium_blue = 0x0000CD,              // rgb(0,0,205)
+  medium_orchid = 0xBA55D3,            // rgb(186,85,211)
+  medium_purple = 0x9370DB,            // rgb(147,112,219)
+  medium_sea_green = 0x3CB371,         // rgb(60,179,113)
+  medium_slate_blue = 0x7B68EE,        // rgb(123,104,238)
+  medium_spring_green = 0x00FA9A,      // rgb(0,250,154)
+  medium_turquoise = 0x48D1CC,         // rgb(72,209,204)
+  medium_violet_red = 0xC71585,        // rgb(199,21,133)
+  midnight_blue = 0x191970,            // rgb(25,25,112)
+  mint_cream = 0xF5FFFA,               // rgb(245,255,250)
+  misty_rose = 0xFFE4E1,               // rgb(255,228,225)
+  moccasin = 0xFFE4B5,                 // rgb(255,228,181)
+  navajo_white = 0xFFDEAD,             // rgb(255,222,173)
+  navy = 0x000080,                     // rgb(0,0,128)
+  old_lace = 0xFDF5E6,                 // rgb(253,245,230)
+  olive = 0x808000,                    // rgb(128,128,0)
+  olive_drab = 0x6B8E23,               // rgb(107,142,35)
+  orange = 0xFFA500,                   // rgb(255,165,0)
+  orange_red = 0xFF4500,               // rgb(255,69,0)
+  orchid = 0xDA70D6,                   // rgb(218,112,214)
+  pale_golden_rod = 0xEEE8AA,          // rgb(238,232,170)
+  pale_green = 0x98FB98,               // rgb(152,251,152)
+  pale_turquoise = 0xAFEEEE,           // rgb(175,238,238)
+  pale_violet_red = 0xDB7093,          // rgb(219,112,147)
+  papaya_whip = 0xFFEFD5,              // rgb(255,239,213)
+  peach_puff = 0xFFDAB9,               // rgb(255,218,185)
+  peru = 0xCD853F,                     // rgb(205,133,63)
+  pink = 0xFFC0CB,                     // rgb(255,192,203)
+  plum = 0xDDA0DD,                     // rgb(221,160,221)
+  powder_blue = 0xB0E0E6,              // rgb(176,224,230)
+  purple = 0x800080,                   // rgb(128,0,128)
+  rebecca_purple = 0x663399,           // rgb(102,51,153)
+  red = 0xFF0000,                      // rgb(255,0,0)
+  rosy_brown = 0xBC8F8F,               // rgb(188,143,143)
+  royal_blue = 0x4169E1,               // rgb(65,105,225)
+  saddle_brown = 0x8B4513,             // rgb(139,69,19)
+  salmon = 0xFA8072,                   // rgb(250,128,114)
+  sandy_brown = 0xF4A460,              // rgb(244,164,96)
+  sea_green = 0x2E8B57,                // rgb(46,139,87)
+  sea_shell = 0xFFF5EE,                // rgb(255,245,238)
+  sienna = 0xA0522D,                   // rgb(160,82,45)
+  silver = 0xC0C0C0,                   // rgb(192,192,192)
+  sky_blue = 0x87CEEB,                 // rgb(135,206,235)
+  slate_blue = 0x6A5ACD,               // rgb(106,90,205)
+  slate_gray = 0x708090,               // rgb(112,128,144)
+  snow = 0xFFFAFA,                     // rgb(255,250,250)
+  spring_green = 0x00FF7F,             // rgb(0,255,127)
+  steel_blue = 0x4682B4,               // rgb(70,130,180)
+  tan = 0xD2B48C,                      // rgb(210,180,140)
+  teal = 0x008080,                     // rgb(0,128,128)
+  thistle = 0xD8BFD8,                  // rgb(216,191,216)
+  tomato = 0xFF6347,                   // rgb(255,99,71)
+  turquoise = 0x40E0D0,                // rgb(64,224,208)
+  violet = 0xEE82EE,                   // rgb(238,130,238)
+  wheat = 0xF5DEB3,                    // rgb(245,222,179)
+  white = 0xFFFFFF,                    // rgb(255,255,255)
+  white_smoke = 0xF5F5F5,              // rgb(245,245,245)
+  yellow = 0xFFFF00,                   // rgb(255,255,0)
+  yellow_green = 0x9ACD32              // rgb(154,205,50)
+};                                     // enum class color
+
+enum class terminal_color : uint8_t {
+  black = 30,
+  red,
+  green,
+  yellow,
+  blue,
+  magenta,
+  cyan,
+  white,
+  bright_black = 90,
+  bright_red,
+  bright_green,
+  bright_yellow,
+  bright_blue,
+  bright_magenta,
+  bright_cyan,
+  bright_white
+};
+
+enum class emphasis : uint8_t {
+  bold = 1,
+  faint = 1 << 1,
+  italic = 1 << 2,
+  underline = 1 << 3,
+  blink = 1 << 4,
+  reverse = 1 << 5,
+  conceal = 1 << 6,
+  strikethrough = 1 << 7,
+};
+
+// rgb is a struct for red, green and blue colors.
+// Using the name "rgb" makes some editors show the color in a tooltip.
+struct rgb {
+  FMT_CONSTEXPR rgb() : r(0), g(0), b(0) {}
+  FMT_CONSTEXPR rgb(uint8_t r_, uint8_t g_, uint8_t b_) : r(r_), g(g_), b(b_) {}
+  FMT_CONSTEXPR rgb(uint32_t hex)
+      : r((hex >> 16) & 0xFF), g((hex >> 8) & 0xFF), b(hex & 0xFF) {}
+  FMT_CONSTEXPR rgb(color hex)
+      : r((uint32_t(hex) >> 16) & 0xFF),
+        g((uint32_t(hex) >> 8) & 0xFF),
+        b(uint32_t(hex) & 0xFF) {}
+  uint8_t r;
+  uint8_t g;
+  uint8_t b;
+};
+
+namespace detail {
+
+// color is a struct of either a rgb color or a terminal color.
+struct color_type {
+  FMT_CONSTEXPR color_type() noexcept : is_rgb(), value{} {}
+  FMT_CONSTEXPR color_type(color rgb_color) noexcept : is_rgb(true), value{} {
+    value.rgb_color = static_cast<uint32_t>(rgb_color);
+  }
+  FMT_CONSTEXPR color_type(rgb rgb_color) noexcept : is_rgb(true), value{} {
+    value.rgb_color = (static_cast<uint32_t>(rgb_color.r) << 16) |
+                      (static_cast<uint32_t>(rgb_color.g) << 8) | rgb_color.b;
+  }
+  FMT_CONSTEXPR color_type(terminal_color term_color) noexcept
+      : is_rgb(), value{} {
+    value.term_color = static_cast<uint8_t>(term_color);
+  }
+  bool is_rgb;
+  union color_union {
+    uint8_t term_color;
+    uint32_t rgb_color;
+  } value;
+};
+}  // namespace detail
+
+/// A text style consisting of foreground and background colors and emphasis.
+class text_style {
+ public:
+  FMT_CONSTEXPR text_style(emphasis em = emphasis()) noexcept
+      : set_foreground_color(), set_background_color(), ems(em) {}
+
+  FMT_CONSTEXPR auto operator|=(const text_style& rhs) -> text_style& {
+    if (!set_foreground_color) {
+      set_foreground_color = rhs.set_foreground_color;
+      foreground_color = rhs.foreground_color;
+    } else if (rhs.set_foreground_color) {
+      if (!foreground_color.is_rgb || !rhs.foreground_color.is_rgb)
+        report_error("can't OR a terminal color");
+      foreground_color.value.rgb_color |= rhs.foreground_color.value.rgb_color;
+    }
+
+    if (!set_background_color) {
+      set_background_color = rhs.set_background_color;
+      background_color = rhs.background_color;
+    } else if (rhs.set_background_color) {
+      if (!background_color.is_rgb || !rhs.background_color.is_rgb)
+        report_error("can't OR a terminal color");
+      background_color.value.rgb_color |= rhs.background_color.value.rgb_color;
+    }
+
+    ems = static_cast<emphasis>(static_cast<uint8_t>(ems) |
+                                static_cast<uint8_t>(rhs.ems));
+    return *this;
+  }
+
+  friend FMT_CONSTEXPR auto operator|(text_style lhs, const text_style& rhs)
+      -> text_style {
+    return lhs |= rhs;
+  }
+
+  FMT_CONSTEXPR auto has_foreground() const noexcept -> bool {
+    return set_foreground_color;
+  }
+  FMT_CONSTEXPR auto has_background() const noexcept -> bool {
+    return set_background_color;
+  }
+  FMT_CONSTEXPR auto has_emphasis() const noexcept -> bool {
+    return static_cast<uint8_t>(ems) != 0;
+  }
+  FMT_CONSTEXPR auto get_foreground() const noexcept -> detail::color_type {
+    FMT_ASSERT(has_foreground(), "no foreground specified for this style");
+    return foreground_color;
+  }
+  FMT_CONSTEXPR auto get_background() const noexcept -> detail::color_type {
+    FMT_ASSERT(has_background(), "no background specified for this style");
+    return background_color;
+  }
+  FMT_CONSTEXPR auto get_emphasis() const noexcept -> emphasis {
+    FMT_ASSERT(has_emphasis(), "no emphasis specified for this style");
+    return ems;
+  }
+
+ private:
+  FMT_CONSTEXPR text_style(bool is_foreground,
+                           detail::color_type text_color) noexcept
+      : set_foreground_color(), set_background_color(), ems() {
+    if (is_foreground) {
+      foreground_color = text_color;
+      set_foreground_color = true;
+    } else {
+      background_color = text_color;
+      set_background_color = true;
+    }
+  }
+
+  friend FMT_CONSTEXPR auto fg(detail::color_type foreground) noexcept
+      -> text_style;
+
+  friend FMT_CONSTEXPR auto bg(detail::color_type background) noexcept
+      -> text_style;
+
+  detail::color_type foreground_color;
+  detail::color_type background_color;
+  bool set_foreground_color;
+  bool set_background_color;
+  emphasis ems;
+};
+
+/// Creates a text style from the foreground (text) color.
+FMT_CONSTEXPR inline auto fg(detail::color_type foreground) noexcept
+    -> text_style {
+  return text_style(true, foreground);
+}
+
+/// Creates a text style from the background color.
+FMT_CONSTEXPR inline auto bg(detail::color_type background) noexcept
+    -> text_style {
+  return text_style(false, background);
+}
+
+FMT_CONSTEXPR inline auto operator|(emphasis lhs, emphasis rhs) noexcept
+    -> text_style {
+  return text_style(lhs) | rhs;
+}
+
+namespace detail {
+
+template <typename Char> struct ansi_color_escape {
+  FMT_CONSTEXPR ansi_color_escape(detail::color_type text_color,
+                                  const char* esc) noexcept {
+    // If we have a terminal color, we need to output another escape code
+    // sequence.
+    if (!text_color.is_rgb) {
+      bool is_background = esc == string_view("\x1b[48;2;");
+      uint32_t value = text_color.value.term_color;
+      // Background ASCII codes are the same as the foreground ones but with
+      // 10 more.
+      if (is_background) value += 10u;
+
+      size_t index = 0;
+      buffer[index++] = static_cast<Char>('\x1b');
+      buffer[index++] = static_cast<Char>('[');
+
+      if (value >= 100u) {
+        buffer[index++] = static_cast<Char>('1');
+        value %= 100u;
+      }
+      buffer[index++] = static_cast<Char>('0' + value / 10u);
+      buffer[index++] = static_cast<Char>('0' + value % 10u);
+
+      buffer[index++] = static_cast<Char>('m');
+      buffer[index++] = static_cast<Char>('\0');
+      return;
+    }
+
+    for (int i = 0; i < 7; i++) {
+      buffer[i] = static_cast<Char>(esc[i]);
+    }
+    rgb color(text_color.value.rgb_color);
+    to_esc(color.r, buffer + 7, ';');
+    to_esc(color.g, buffer + 11, ';');
+    to_esc(color.b, buffer + 15, 'm');
+    buffer[19] = static_cast<Char>(0);
+  }
+  FMT_CONSTEXPR ansi_color_escape(emphasis em) noexcept {
+    uint8_t em_codes[num_emphases] = {};
+    if (has_emphasis(em, emphasis::bold)) em_codes[0] = 1;
+    if (has_emphasis(em, emphasis::faint)) em_codes[1] = 2;
+    if (has_emphasis(em, emphasis::italic)) em_codes[2] = 3;
+    if (has_emphasis(em, emphasis::underline)) em_codes[3] = 4;
+    if (has_emphasis(em, emphasis::blink)) em_codes[4] = 5;
+    if (has_emphasis(em, emphasis::reverse)) em_codes[5] = 7;
+    if (has_emphasis(em, emphasis::conceal)) em_codes[6] = 8;
+    if (has_emphasis(em, emphasis::strikethrough)) em_codes[7] = 9;
+
+    size_t index = 0;
+    for (size_t i = 0; i < num_emphases; ++i) {
+      if (!em_codes[i]) continue;
+      buffer[index++] = static_cast<Char>('\x1b');
+      buffer[index++] = static_cast<Char>('[');
+      buffer[index++] = static_cast<Char>('0' + em_codes[i]);
+      buffer[index++] = static_cast<Char>('m');
+    }
+    buffer[index++] = static_cast<Char>(0);
+  }
+  FMT_CONSTEXPR operator const Char*() const noexcept { return buffer; }
+
+  FMT_CONSTEXPR auto begin() const noexcept -> const Char* { return buffer; }
+  FMT_CONSTEXPR20 auto end() const noexcept -> const Char* {
+    return buffer + basic_string_view<Char>(buffer).size();
+  }
+
+ private:
+  static constexpr size_t num_emphases = 8;
+  Char buffer[7u + 3u * num_emphases + 1u];
+
+  static FMT_CONSTEXPR void to_esc(uint8_t c, Char* out,
+                                   char delimiter) noexcept {
+    out[0] = static_cast<Char>('0' + c / 100);
+    out[1] = static_cast<Char>('0' + c / 10 % 10);
+    out[2] = static_cast<Char>('0' + c % 10);
+    out[3] = static_cast<Char>(delimiter);
+  }
+  static FMT_CONSTEXPR auto has_emphasis(emphasis em, emphasis mask) noexcept
+      -> bool {
+    return static_cast<uint8_t>(em) & static_cast<uint8_t>(mask);
+  }
+};
+
+template <typename Char>
+FMT_CONSTEXPR auto make_foreground_color(detail::color_type foreground) noexcept
+    -> ansi_color_escape<Char> {
+  return ansi_color_escape<Char>(foreground, "\x1b[38;2;");
+}
+
+template <typename Char>
+FMT_CONSTEXPR auto make_background_color(detail::color_type background) noexcept
+    -> ansi_color_escape<Char> {
+  return ansi_color_escape<Char>(background, "\x1b[48;2;");
+}
+
+template <typename Char>
+FMT_CONSTEXPR auto make_emphasis(emphasis em) noexcept
+    -> ansi_color_escape<Char> {
+  return ansi_color_escape<Char>(em);
+}
+
+template <typename Char> inline void reset_color(buffer<Char>& buffer) {
+  auto reset_color = string_view("\x1b[0m");
+  buffer.append(reset_color.begin(), reset_color.end());
+}
+
+template <typename T> struct styled_arg : detail::view {
+  const T& value;
+  text_style style;
+  styled_arg(const T& v, text_style s) : value(v), style(s) {}
+};
+
+template <typename Char>
+void vformat_to(
+    buffer<Char>& buf, const text_style& ts, basic_string_view<Char> format_str,
+    basic_format_args<buffered_context<type_identity_t<Char>>> args) {
+  bool has_style = false;
+  if (ts.has_emphasis()) {
+    has_style = true;
+    auto emphasis = detail::make_emphasis<Char>(ts.get_emphasis());
+    buf.append(emphasis.begin(), emphasis.end());
+  }
+  if (ts.has_foreground()) {
+    has_style = true;
+    auto foreground = detail::make_foreground_color<Char>(ts.get_foreground());
+    buf.append(foreground.begin(), foreground.end());
+  }
+  if (ts.has_background()) {
+    has_style = true;
+    auto background = detail::make_background_color<Char>(ts.get_background());
+    buf.append(background.begin(), background.end());
+  }
+  detail::vformat_to(buf, format_str, args, {});
+  if (has_style) detail::reset_color<Char>(buf);
+}
+
+}  // namespace detail
+
+inline void vprint(FILE* f, const text_style& ts, string_view fmt,
+                   format_args args) {
+  auto buf = memory_buffer();
+  detail::vformat_to(buf, ts, fmt, args);
+  print(f, FMT_STRING("{}"), string_view(buf.begin(), buf.size()));
+}
+
+/**
+ * Formats a string and prints it to the specified file stream using ANSI
+ * escape sequences to specify text formatting.
+ *
+ * **Example**:
+ *
+ *     fmt::print(fmt::emphasis::bold | fg(fmt::color::red),
+ *                "Elapsed time: {0:.2f} seconds", 1.23);
+ */
+template <typename... T>
+void print(FILE* f, const text_style& ts, format_string<T...> fmt,
+           T&&... args) {
+  vprint(f, ts, fmt, fmt::make_format_args(args...));
+}
+
+/**
+ * Formats a string and prints it to stdout using ANSI escape sequences to
+ * specify text formatting.
+ *
+ * **Example**:
+ *
+ *     fmt::print(fmt::emphasis::bold | fg(fmt::color::red),
+ *                "Elapsed time: {0:.2f} seconds", 1.23);
+ */
+template <typename... T>
+void print(const text_style& ts, format_string<T...> fmt, T&&... args) {
+  return print(stdout, ts, fmt, std::forward<T>(args)...);
+}
+
+inline auto vformat(const text_style& ts, string_view fmt, format_args args)
+    -> std::string {
+  auto buf = memory_buffer();
+  detail::vformat_to(buf, ts, fmt, args);
+  return fmt::to_string(buf);
+}
+
+/**
+ * Formats arguments and returns the result as a string using ANSI escape
+ * sequences to specify text formatting.
+ *
+ * **Example**:
+ *
+ * ```
+ * #include <fmt/color.h>
+ * std::string message = fmt::format(fmt::emphasis::bold | fg(fmt::color::red),
+ *                                   "The answer is {}", 42);
+ * ```
+ */
+template <typename... T>
+inline auto format(const text_style& ts, format_string<T...> fmt, T&&... args)
+    -> std::string {
+  return fmt::vformat(ts, fmt, fmt::make_format_args(args...));
+}
+
+/// Formats a string with the given text_style and writes the output to `out`.
+template <typename OutputIt,
+          FMT_ENABLE_IF(detail::is_output_iterator<OutputIt, char>::value)>
+auto vformat_to(OutputIt out, const text_style& ts, string_view fmt,
+                format_args args) -> OutputIt {
+  auto&& buf = detail::get_buffer<char>(out);
+  detail::vformat_to(buf, ts, fmt, args);
+  return detail::get_iterator(buf, out);
+}
+
+/**
+ * Formats arguments with the given text style, writes the result to the output
+ * iterator `out` and returns the iterator past the end of the output range.
+ *
+ * **Example**:
+ *
+ *     std::vector<char> out;
+ *     fmt::format_to(std::back_inserter(out),
+ *                    fmt::emphasis::bold | fg(fmt::color::red), "{}", 42);
+ */
+template <typename OutputIt, typename... T,
+          FMT_ENABLE_IF(detail::is_output_iterator<OutputIt, char>::value)>
+inline auto format_to(OutputIt out, const text_style& ts,
+                      format_string<T...> fmt, T&&... args) -> OutputIt {
+  return vformat_to(out, ts, fmt, fmt::make_format_args(args...));
+}
+
+template <typename T, typename Char>
+struct formatter<detail::styled_arg<T>, Char> : formatter<T, Char> {
+  template <typename FormatContext>
+  auto format(const detail::styled_arg<T>& arg, FormatContext& ctx) const
+      -> decltype(ctx.out()) {
+    const auto& ts = arg.style;
+    const auto& value = arg.value;
+    auto out = ctx.out();
+
+    bool has_style = false;
+    if (ts.has_emphasis()) {
+      has_style = true;
+      auto emphasis = detail::make_emphasis<Char>(ts.get_emphasis());
+      out = std::copy(emphasis.begin(), emphasis.end(), out);
+    }
+    if (ts.has_foreground()) {
+      has_style = true;
+      auto foreground =
+          detail::make_foreground_color<Char>(ts.get_foreground());
+      out = std::copy(foreground.begin(), foreground.end(), out);
+    }
+    if (ts.has_background()) {
+      has_style = true;
+      auto background =
+          detail::make_background_color<Char>(ts.get_background());
+      out = std::copy(background.begin(), background.end(), out);
+    }
+    out = formatter<T, Char>::format(value, ctx);
+    if (has_style) {
+      auto reset_color = string_view("\x1b[0m");
+      out = std::copy(reset_color.begin(), reset_color.end(), out);
+    }
+    return out;
+  }
+};
+
+/**
+ * Returns an argument that will be formatted using ANSI escape sequences,
+ * to be used in a formatting function.
+ *
+ * **Example**:
+ *
+ *     fmt::print("Elapsed time: {0:.2f} seconds",
+ *                fmt::styled(1.23, fmt::fg(fmt::color::green) |
+ *                                  fmt::bg(fmt::color::blue)));
+ */
+template <typename T>
+FMT_CONSTEXPR auto styled(const T& value, text_style ts)
+    -> detail::styled_arg<remove_cvref_t<T>> {
+  return detail::styled_arg<remove_cvref_t<T>>{value, ts};
+}
+
+FMT_END_EXPORT
+FMT_END_NAMESPACE
+
+#endif  // FMT_COLOR_H_
diff --git a/third_party/fmt/include/fmt/compile.h b/third_party/fmt/include/fmt/compile.h
new file mode 100644
index 00000000..b2afc2c3
--- /dev/null
+++ b/third_party/fmt/include/fmt/compile.h
@@ -0,0 +1,529 @@
+// Formatting library for C++ - experimental format string compilation
+//
+// Copyright (c) 2012 - present, Victor Zverovich and fmt contributors
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_COMPILE_H_
+#define FMT_COMPILE_H_
+
+#ifndef FMT_MODULE
+#  include <iterator>  // std::back_inserter
+#endif
+
+#include "format.h"
+
+FMT_BEGIN_NAMESPACE
+
+// A compile-time string which is compiled into fast formatting code.
+FMT_EXPORT class compiled_string {};
+
+namespace detail {
+
+template <typename T, typename InputIt>
+FMT_CONSTEXPR inline auto copy(InputIt begin, InputIt end, counting_iterator it)
+    -> counting_iterator {
+  return it + (end - begin);
+}
+
+template <typename S>
+struct is_compiled_string : std::is_base_of<compiled_string, S> {};
+
+/**
+ * Converts a string literal `s` into a format string that will be parsed at
+ * compile time and converted into efficient formatting code. Requires C++17
+ * `constexpr if` compiler support.
+ *
+ * **Example**:
+ *
+ *     // Converts 42 into std::string using the most efficient method and no
+ *     // runtime format string processing.
+ *     std::string s = fmt::format(FMT_COMPILE("{}"), 42);
+ */
+#if defined(__cpp_if_constexpr) && defined(__cpp_return_type_deduction)
+#  define FMT_COMPILE(s) FMT_STRING_IMPL(s, fmt::compiled_string, explicit)
+#else
+#  define FMT_COMPILE(s) FMT_STRING(s)
+#endif
+
+#if FMT_USE_NONTYPE_TEMPLATE_ARGS
+template <typename Char, size_t N,
+          fmt::detail_exported::fixed_string<Char, N> Str>
+struct udl_compiled_string : compiled_string {
+  using char_type = Char;
+  explicit constexpr operator basic_string_view<char_type>() const {
+    return {Str.data, N - 1};
+  }
+};
+#endif
+
+template <typename T, typename... Tail>
+auto first(const T& value, const Tail&...) -> const T& {
+  return value;
+}
+
+#if defined(__cpp_if_constexpr) && defined(__cpp_return_type_deduction)
+template <typename... Args> struct type_list {};
+
+// Returns a reference to the argument at index N from [first, rest...].
+template <int N, typename T, typename... Args>
+constexpr const auto& get([[maybe_unused]] const T& first,
+                          [[maybe_unused]] const Args&... rest) {
+  static_assert(N < 1 + sizeof...(Args), "index is out of bounds");
+  if constexpr (N == 0)
+    return first;
+  else
+    return detail::get<N - 1>(rest...);
+}
+
+template <typename Char, typename... Args>
+constexpr int get_arg_index_by_name(basic_string_view<Char> name,
+                                    type_list<Args...>) {
+  return get_arg_index_by_name<Args...>(name);
+}
+
+template <int N, typename> struct get_type_impl;
+
+template <int N, typename... Args> struct get_type_impl<N, type_list<Args...>> {
+  using type =
+      remove_cvref_t<decltype(detail::get<N>(std::declval<Args>()...))>;
+};
+
+template <int N, typename T>
+using get_type = typename get_type_impl<N, T>::type;
+
+template <typename T> struct is_compiled_format : std::false_type {};
+
+template <typename Char> struct text {
+  basic_string_view<Char> data;
+  using char_type = Char;
+
+  template <typename OutputIt, typename... Args>
+  constexpr OutputIt format(OutputIt out, const Args&...) const {
+    return write<Char>(out, data);
+  }
+};
+
+template <typename Char>
+struct is_compiled_format<text<Char>> : std::true_type {};
+
+template <typename Char>
+constexpr text<Char> make_text(basic_string_view<Char> s, size_t pos,
+                               size_t size) {
+  return {{&s[pos], size}};
+}
+
+template <typename Char> struct code_unit {
+  Char value;
+  using char_type = Char;
+
+  template <typename OutputIt, typename... Args>
+  constexpr OutputIt format(OutputIt out, const Args&...) const {
+    *out++ = value;
+    return out;
+  }
+};
+
+// This ensures that the argument type is convertible to `const T&`.
+template <typename T, int N, typename... Args>
+constexpr const T& get_arg_checked(const Args&... args) {
+  const auto& arg = detail::get<N>(args...);
+  if constexpr (detail::is_named_arg<remove_cvref_t<decltype(arg)>>()) {
+    return arg.value;
+  } else {
+    return arg;
+  }
+}
+
+template <typename Char>
+struct is_compiled_format<code_unit<Char>> : std::true_type {};
+
+// A replacement field that refers to argument N.
+template <typename Char, typename T, int N> struct field {
+  using char_type = Char;
+
+  template <typename OutputIt, typename... Args>
+  constexpr OutputIt format(OutputIt out, const Args&... args) const {
+    const T& arg = get_arg_checked<T, N>(args...);
+    if constexpr (std::is_convertible<T, basic_string_view<Char>>::value) {
+      auto s = basic_string_view<Char>(arg);
+      return copy<Char>(s.begin(), s.end(), out);
+    }
+    return write<Char>(out, arg);
+  }
+};
+
+template <typename Char, typename T, int N>
+struct is_compiled_format<field<Char, T, N>> : std::true_type {};
+
+// A replacement field that refers to argument with name.
+template <typename Char> struct runtime_named_field {
+  using char_type = Char;
+  basic_string_view<Char> name;
+
+  template <typename OutputIt, typename T>
+  constexpr static bool try_format_argument(
+      OutputIt& out,
+      // [[maybe_unused]] due to unused-but-set-parameter warning in GCC 7,8,9
+      [[maybe_unused]] basic_string_view<Char> arg_name, const T& arg) {
+    if constexpr (is_named_arg<typename std::remove_cv<T>::type>::value) {
+      if (arg_name == arg.name) {
+        out = write<Char>(out, arg.value);
+        return true;
+      }
+    }
+    return false;
+  }
+
+  template <typename OutputIt, typename... Args>
+  constexpr OutputIt format(OutputIt out, const Args&... args) const {
+    bool found = (try_format_argument(out, name, args) || ...);
+    if (!found) {
+      FMT_THROW(format_error("argument with specified name is not found"));
+    }
+    return out;
+  }
+};
+
+template <typename Char>
+struct is_compiled_format<runtime_named_field<Char>> : std::true_type {};
+
+// A replacement field that refers to argument N and has format specifiers.
+template <typename Char, typename T, int N> struct spec_field {
+  using char_type = Char;
+  formatter<T, Char> fmt;
+
+  template <typename OutputIt, typename... Args>
+  constexpr FMT_INLINE OutputIt format(OutputIt out,
+                                       const Args&... args) const {
+    const auto& vargs =
+        fmt::make_format_args<basic_format_context<OutputIt, Char>>(args...);
+    basic_format_context<OutputIt, Char> ctx(out, vargs);
+    return fmt.format(get_arg_checked<T, N>(args...), ctx);
+  }
+};
+
+template <typename Char, typename T, int N>
+struct is_compiled_format<spec_field<Char, T, N>> : std::true_type {};
+
+template <typename L, typename R> struct concat {
+  L lhs;
+  R rhs;
+  using char_type = typename L::char_type;
+
+  template <typename OutputIt, typename... Args>
+  constexpr OutputIt format(OutputIt out, const Args&... args) const {
+    out = lhs.format(out, args...);
+    return rhs.format(out, args...);
+  }
+};
+
+template <typename L, typename R>
+struct is_compiled_format<concat<L, R>> : std::true_type {};
+
+template <typename L, typename R>
+constexpr concat<L, R> make_concat(L lhs, R rhs) {
+  return {lhs, rhs};
+}
+
+struct unknown_format {};
+
+template <typename Char>
+constexpr size_t parse_text(basic_string_view<Char> str, size_t pos) {
+  for (size_t size = str.size(); pos != size; ++pos) {
+    if (str[pos] == '{' || str[pos] == '}') break;
+  }
+  return pos;
+}
+
+template <typename Args, size_t POS, int ID, typename S>
+constexpr auto compile_format_string(S fmt);
+
+template <typename Args, size_t POS, int ID, typename T, typename S>
+constexpr auto parse_tail(T head, S fmt) {
+  if constexpr (POS != basic_string_view<typename S::char_type>(fmt).size()) {
+    constexpr auto tail = compile_format_string<Args, POS, ID>(fmt);
+    if constexpr (std::is_same<remove_cvref_t<decltype(tail)>,
+                               unknown_format>())
+      return tail;
+    else
+      return make_concat(head, tail);
+  } else {
+    return head;
+  }
+}
+
+template <typename T, typename Char> struct parse_specs_result {
+  formatter<T, Char> fmt;
+  size_t end;
+  int next_arg_id;
+};
+
+enum { manual_indexing_id = -1 };
+
+template <typename T, typename Char>
+constexpr parse_specs_result<T, Char> parse_specs(basic_string_view<Char> str,
+                                                  size_t pos, int next_arg_id) {
+  str.remove_prefix(pos);
+  auto ctx =
+      compile_parse_context<Char>(str, max_value<int>(), nullptr, next_arg_id);
+  auto f = formatter<T, Char>();
+  auto end = f.parse(ctx);
+  return {f, pos + fmt::detail::to_unsigned(end - str.data()),
+          next_arg_id == 0 ? manual_indexing_id : ctx.next_arg_id()};
+}
+
+template <typename Char> struct arg_id_handler {
+  arg_ref<Char> arg_id;
+
+  constexpr int on_auto() {
+    FMT_ASSERT(false, "handler cannot be used with automatic indexing");
+    return 0;
+  }
+  constexpr int on_index(int id) {
+    arg_id = arg_ref<Char>(id);
+    return 0;
+  }
+  constexpr int on_name(basic_string_view<Char> id) {
+    arg_id = arg_ref<Char>(id);
+    return 0;
+  }
+};
+
+template <typename Char> struct parse_arg_id_result {
+  arg_ref<Char> arg_id;
+  const Char* arg_id_end;
+};
+
+template <int ID, typename Char>
+constexpr auto parse_arg_id(const Char* begin, const Char* end) {
+  auto handler = arg_id_handler<Char>{arg_ref<Char>{}};
+  auto arg_id_end = parse_arg_id(begin, end, handler);
+  return parse_arg_id_result<Char>{handler.arg_id, arg_id_end};
+}
+
+template <typename T, typename Enable = void> struct field_type {
+  using type = remove_cvref_t<T>;
+};
+
+template <typename T>
+struct field_type<T, enable_if_t<detail::is_named_arg<T>::value>> {
+  using type = remove_cvref_t<decltype(T::value)>;
+};
+
+template <typename T, typename Args, size_t END_POS, int ARG_INDEX, int NEXT_ID,
+          typename S>
+constexpr auto parse_replacement_field_then_tail(S fmt) {
+  using char_type = typename S::char_type;
+  constexpr auto str = basic_string_view<char_type>(fmt);
+  constexpr char_type c = END_POS != str.size() ? str[END_POS] : char_type();
+  if constexpr (c == '}') {
+    return parse_tail<Args, END_POS + 1, NEXT_ID>(
+        field<char_type, typename field_type<T>::type, ARG_INDEX>(), fmt);
+  } else if constexpr (c != ':') {
+    FMT_THROW(format_error("expected ':'"));
+  } else {
+    constexpr auto result = parse_specs<typename field_type<T>::type>(
+        str, END_POS + 1, NEXT_ID == manual_indexing_id ? 0 : NEXT_ID);
+    if constexpr (result.end >= str.size() || str[result.end] != '}') {
+      FMT_THROW(format_error("expected '}'"));
+      return 0;
+    } else {
+      return parse_tail<Args, result.end + 1, result.next_arg_id>(
+          spec_field<char_type, typename field_type<T>::type, ARG_INDEX>{
+              result.fmt},
+          fmt);
+    }
+  }
+}
+
+// Compiles a non-empty format string and returns the compiled representation
+// or unknown_format() on unrecognized input.
+template <typename Args, size_t POS, int ID, typename S>
+constexpr auto compile_format_string(S fmt) {
+  using char_type = typename S::char_type;
+  constexpr auto str = basic_string_view<char_type>(fmt);
+  if constexpr (str[POS] == '{') {
+    if constexpr (POS + 1 == str.size())
+      FMT_THROW(format_error("unmatched '{' in format string"));
+    if constexpr (str[POS + 1] == '{') {
+      return parse_tail<Args, POS + 2, ID>(make_text(str, POS, 1), fmt);
+    } else if constexpr (str[POS + 1] == '}' || str[POS + 1] == ':') {
+      static_assert(ID != manual_indexing_id,
+                    "cannot switch from manual to automatic argument indexing");
+      constexpr auto next_id =
+          ID != manual_indexing_id ? ID + 1 : manual_indexing_id;
+      return parse_replacement_field_then_tail<get_type<ID, Args>, Args,
+                                               POS + 1, ID, next_id>(fmt);
+    } else {
+      constexpr auto arg_id_result =
+          parse_arg_id<ID>(str.data() + POS + 1, str.data() + str.size());
+      constexpr auto arg_id_end_pos = arg_id_result.arg_id_end - str.data();
+      constexpr char_type c =
+          arg_id_end_pos != str.size() ? str[arg_id_end_pos] : char_type();
+      static_assert(c == '}' || c == ':', "missing '}' in format string");
+      if constexpr (arg_id_result.arg_id.kind == arg_id_kind::index) {
+        static_assert(
+            ID == manual_indexing_id || ID == 0,
+            "cannot switch from automatic to manual argument indexing");
+        constexpr auto arg_index = arg_id_result.arg_id.val.index;
+        return parse_replacement_field_then_tail<get_type<arg_index, Args>,
+                                                 Args, arg_id_end_pos,
+                                                 arg_index, manual_indexing_id>(
+            fmt);
+      } else if constexpr (arg_id_result.arg_id.kind == arg_id_kind::name) {
+        constexpr auto arg_index =
+            get_arg_index_by_name(arg_id_result.arg_id.val.name, Args{});
+        if constexpr (arg_index >= 0) {
+          constexpr auto next_id =
+              ID != manual_indexing_id ? ID + 1 : manual_indexing_id;
+          return parse_replacement_field_then_tail<
+              decltype(get_type<arg_index, Args>::value), Args, arg_id_end_pos,
+              arg_index, next_id>(fmt);
+        } else if constexpr (c == '}') {
+          return parse_tail<Args, arg_id_end_pos + 1, ID>(
+              runtime_named_field<char_type>{arg_id_result.arg_id.val.name},
+              fmt);
+        } else if constexpr (c == ':') {
+          return unknown_format();  // no type info for specs parsing
+        }
+      }
+    }
+  } else if constexpr (str[POS] == '}') {
+    if constexpr (POS + 1 == str.size())
+      FMT_THROW(format_error("unmatched '}' in format string"));
+    return parse_tail<Args, POS + 2, ID>(make_text(str, POS, 1), fmt);
+  } else {
+    constexpr auto end = parse_text(str, POS + 1);
+    if constexpr (end - POS > 1) {
+      return parse_tail<Args, end, ID>(make_text(str, POS, end - POS), fmt);
+    } else {
+      return parse_tail<Args, end, ID>(code_unit<char_type>{str[POS]}, fmt);
+    }
+  }
+}
+
+template <typename... Args, typename S,
+          FMT_ENABLE_IF(detail::is_compiled_string<S>::value)>
+constexpr auto compile(S fmt) {
+  constexpr auto str = basic_string_view<typename S::char_type>(fmt);
+  if constexpr (str.size() == 0) {
+    return detail::make_text(str, 0, 0);
+  } else {
+    constexpr auto result =
+        detail::compile_format_string<detail::type_list<Args...>, 0, 0>(fmt);
+    return result;
+  }
+}
+#endif  // defined(__cpp_if_constexpr) && defined(__cpp_return_type_deduction)
+}  // namespace detail
+
+FMT_BEGIN_EXPORT
+
+#if defined(__cpp_if_constexpr) && defined(__cpp_return_type_deduction)
+
+template <typename CompiledFormat, typename... Args,
+          typename Char = typename CompiledFormat::char_type,
+          FMT_ENABLE_IF(detail::is_compiled_format<CompiledFormat>::value)>
+FMT_INLINE std::basic_string<Char> format(const CompiledFormat& cf,
+                                          const Args&... args) {
+  auto s = std::basic_string<Char>();
+  cf.format(std::back_inserter(s), args...);
+  return s;
+}
+
+template <typename OutputIt, typename CompiledFormat, typename... Args,
+          FMT_ENABLE_IF(detail::is_compiled_format<CompiledFormat>::value)>
+constexpr FMT_INLINE OutputIt format_to(OutputIt out, const CompiledFormat& cf,
+                                        const Args&... args) {
+  return cf.format(out, args...);
+}
+
+template <typename S, typename... Args,
+          FMT_ENABLE_IF(detail::is_compiled_string<S>::value)>
+FMT_INLINE std::basic_string<typename S::char_type> format(const S&,
+                                                           Args&&... args) {
+  if constexpr (std::is_same<typename S::char_type, char>::value) {
+    constexpr auto str = basic_string_view<typename S::char_type>(S());
+    if constexpr (str.size() == 2 && str[0] == '{' && str[1] == '}') {
+      const auto& first = detail::first(args...);
+      if constexpr (detail::is_named_arg<
+                        remove_cvref_t<decltype(first)>>::value) {
+        return fmt::to_string(first.value);
+      } else {
+        return fmt::to_string(first);
+      }
+    }
+  }
+  constexpr auto compiled = detail::compile<Args...>(S());
+  if constexpr (std::is_same<remove_cvref_t<decltype(compiled)>,
+                             detail::unknown_format>()) {
+    return fmt::format(
+        static_cast<basic_string_view<typename S::char_type>>(S()),
+        std::forward<Args>(args)...);
+  } else {
+    return fmt::format(compiled, std::forward<Args>(args)...);
+  }
+}
+
+template <typename OutputIt, typename S, typename... Args,
+          FMT_ENABLE_IF(detail::is_compiled_string<S>::value)>
+FMT_CONSTEXPR OutputIt format_to(OutputIt out, const S&, Args&&... args) {
+  constexpr auto compiled = detail::compile<Args...>(S());
+  if constexpr (std::is_same<remove_cvref_t<decltype(compiled)>,
+                             detail::unknown_format>()) {
+    return fmt::format_to(
+        out, static_cast<basic_string_view<typename S::char_type>>(S()),
+        std::forward<Args>(args)...);
+  } else {
+    return fmt::format_to(out, compiled, std::forward<Args>(args)...);
+  }
+}
+#endif
+
+template <typename OutputIt, typename S, typename... Args,
+          FMT_ENABLE_IF(detail::is_compiled_string<S>::value)>
+auto format_to_n(OutputIt out, size_t n, const S& fmt, Args&&... args)
+    -> format_to_n_result<OutputIt> {
+  using traits = detail::fixed_buffer_traits;
+  auto buf = detail::iterator_buffer<OutputIt, char, traits>(out, n);
+  fmt::format_to(std::back_inserter(buf), fmt, std::forward<Args>(args)...);
+  return {buf.out(), buf.count()};
+}
+
+template <typename S, typename... Args,
+          FMT_ENABLE_IF(detail::is_compiled_string<S>::value)>
+FMT_CONSTEXPR20 auto formatted_size(const S& fmt, const Args&... args)
+    -> size_t {
+  return fmt::format_to(detail::counting_iterator(), fmt, args...).count();
+}
+
+template <typename S, typename... Args,
+          FMT_ENABLE_IF(detail::is_compiled_string<S>::value)>
+void print(std::FILE* f, const S& fmt, const Args&... args) {
+  memory_buffer buffer;
+  fmt::format_to(std::back_inserter(buffer), fmt, args...);
+  detail::print(f, {buffer.data(), buffer.size()});
+}
+
+template <typename S, typename... Args,
+          FMT_ENABLE_IF(detail::is_compiled_string<S>::value)>
+void print(const S& fmt, const Args&... args) {
+  print(stdout, fmt, args...);
+}
+
+#if FMT_USE_NONTYPE_TEMPLATE_ARGS
+inline namespace literals {
+template <detail_exported::fixed_string Str> constexpr auto operator""_cf() {
+  using char_t = remove_cvref_t<decltype(Str.data[0])>;
+  return detail::udl_compiled_string<char_t, sizeof(Str.data) / sizeof(char_t),
+                                     Str>();
+}
+}  // namespace literals
+#endif
+
+FMT_END_EXPORT
+FMT_END_NAMESPACE
+
+#endif  // FMT_COMPILE_H_
diff --git a/third_party/fmt/include/fmt/core.h b/third_party/fmt/include/fmt/core.h
index 85407145..8ca735f0 100644
--- a/third_party/fmt/include/fmt/core.h
+++ b/third_party/fmt/include/fmt/core.h
@@ -1,1646 +1,5 @@
-// Formatting library for C++ - the core API
-//
-// Copyright (c) 2012 - present, Victor Zverovich
-// All rights reserved.
-//
-// For the license information refer to format.h.
+// This file is only provided for compatibility and may be removed in future
+// versions. Use fmt/base.h if you don't need fmt::format and fmt/format.h
+// otherwise.
 
-#ifndef FMT_CORE_H_
-#define FMT_CORE_H_
-
-#include <cstdio> // std::FILE
-#include <cstring>
-#include <iterator>
-#include <string>
-#include <type_traits>
-
-// The fmt library version in the form major * 10000 + minor * 100 + patch.
-#define FMT_VERSION 60102
-
-#ifdef __has_feature
-#define FMT_HAS_FEATURE(x) __has_feature(x)
-#else
-#define FMT_HAS_FEATURE(x) 0
-#endif
-
-#if defined(__has_include) && !defined(__INTELLISENSE__) && !(defined(__INTEL_COMPILER) && __INTEL_COMPILER < 1600)
-#define FMT_HAS_INCLUDE(x) __has_include(x)
-#else
-#define FMT_HAS_INCLUDE(x) 0
-#endif
-
-#ifdef __has_cpp_attribute
-#define FMT_HAS_CPP_ATTRIBUTE(x) __has_cpp_attribute(x)
-#else
-#define FMT_HAS_CPP_ATTRIBUTE(x) 0
-#endif
-
-#if defined(__GNUC__) && !defined(__clang__)
-#define FMT_GCC_VERSION (__GNUC__ * 100 + __GNUC_MINOR__)
-#else
-#define FMT_GCC_VERSION 0
-#endif
-
-#if __cplusplus >= 201103L || defined(__GXX_EXPERIMENTAL_CXX0X__)
-#define FMT_HAS_GXX_CXX11 FMT_GCC_VERSION
-#else
-#define FMT_HAS_GXX_CXX11 0
-#endif
-
-#ifdef __NVCC__
-#define FMT_NVCC __NVCC__
-#else
-#define FMT_NVCC 0
-#endif
-
-#ifdef _MSC_VER
-#define FMT_MSC_VER _MSC_VER
-#else
-#define FMT_MSC_VER 0
-#endif
-
-// Check if relaxed C++14 constexpr is supported.
-// GCC doesn't allow throw in constexpr until version 6 (bug 67371).
-#if FMT_USE_CONSTEXPR
-#define FMT_CONSTEXPR inline
-#define FMT_CONSTEXPR_DECL
-#else
-#define FMT_CONSTEXPR inline
-#define FMT_CONSTEXPR_DECL
-#endif
-
-#ifndef FMT_OVERRIDE
-#if FMT_HAS_FEATURE(cxx_override) || (FMT_GCC_VERSION >= 408 && FMT_HAS_GXX_CXX11) || FMT_MSC_VER >= 1900
-#define FMT_OVERRIDE override
-#else
-#define FMT_OVERRIDE
-#endif
-#endif
-
-// Check if exceptions are disabled.
-#ifndef FMT_EXCEPTIONS
-#if (defined(__GNUC__) && !defined(__EXCEPTIONS)) || FMT_MSC_VER && !_HAS_EXCEPTIONS
-#define FMT_EXCEPTIONS 0
-#else
-#define FMT_EXCEPTIONS 1
-#endif
-#endif
-
-// Define FMT_USE_NOEXCEPT to make fmt use noexcept (C++11 feature).
-#ifndef FMT_USE_NOEXCEPT
-#define FMT_USE_NOEXCEPT 0
-#endif
-
-#if FMT_USE_NOEXCEPT || FMT_HAS_FEATURE(cxx_noexcept) || (FMT_GCC_VERSION >= 408 && FMT_HAS_GXX_CXX11) ||              \
-    FMT_MSC_VER >= 1900
-#define FMT_DETECTED_NOEXCEPT noexcept
-#define FMT_HAS_CXX11_NOEXCEPT 1
-#else
-#define FMT_DETECTED_NOEXCEPT throw()
-#define FMT_HAS_CXX11_NOEXCEPT 0
-#endif
-
-#ifndef FMT_NOEXCEPT
-#if FMT_EXCEPTIONS || FMT_HAS_CXX11_NOEXCEPT
-#define FMT_NOEXCEPT FMT_DETECTED_NOEXCEPT
-#else
-#define FMT_NOEXCEPT
-#endif
-#endif
-
-// [[noreturn]] is disabled on MSVC because of bogus unreachable code warnings.
-#if FMT_EXCEPTIONS && FMT_HAS_CPP_ATTRIBUTE(noreturn) && !FMT_MSC_VER
-#define FMT_NORETURN [[noreturn]]
-#else
-#define FMT_NORETURN
-#endif
-
-#ifndef FMT_DEPRECATED
-#if (FMT_HAS_CPP_ATTRIBUTE(deprecated) && __cplusplus >= 201402L) || FMT_MSC_VER >= 1900
-#define FMT_DEPRECATED [[deprecated]]
-#else
-#if defined(__GNUC__) || defined(__clang__)
-#define FMT_DEPRECATED __attribute__((deprecated))
-#elif FMT_MSC_VER
-#define FMT_DEPRECATED __declspec(deprecated)
-#else
-#define FMT_DEPRECATED /* deprecated */
-#endif
-#endif
-#endif
-
-// Workaround broken [[deprecated]] in the Intel compiler and NVCC.
-#if defined(__INTEL_COMPILER) || FMT_NVCC
-#define FMT_DEPRECATED_ALIAS
-#else
-#define FMT_DEPRECATED_ALIAS FMT_DEPRECATED
-#endif
-
-#ifndef FMT_BEGIN_NAMESPACE
-#if FMT_HAS_FEATURE(cxx_inline_namespaces) || FMT_GCC_VERSION >= 404 || FMT_MSC_VER >= 1900
-#define FMT_INLINE_NAMESPACE inline namespace
-#define FMT_END_NAMESPACE                                                                                              \
-	}                                                                                                                  \
-	}
-#else
-#define FMT_INLINE_NAMESPACE namespace
-#define FMT_END_NAMESPACE                                                                                              \
-	}                                                                                                                  \
-	using namespace v6;                                                                                                \
-	}
-#endif
-#define FMT_BEGIN_NAMESPACE                                                                                            \
-	namespace nautilus_fmt {                                                                                           \
-	FMT_INLINE_NAMESPACE v6 {
-#endif
-
-#if !defined(FMT_HEADER_ONLY) && defined(_WIN32)
-#ifdef FMT_EXPORT
-#define FMT_API __declspec(dllexport)
-#elif defined(FMT_SHARED)
-#define FMT_API __declspec(dllimport)
-#define FMT_EXTERN_TEMPLATE_API FMT_API
-#endif
-#endif
-#ifndef FMT_API
-#define FMT_API
-#endif
-#ifndef FMT_EXTERN_TEMPLATE_API
-#define FMT_EXTERN_TEMPLATE_API
-#endif
-
-#ifndef FMT_HEADER_ONLY
-#define FMT_EXTERN extern
-#else
-#define FMT_EXTERN
-#endif
-
-// libc++ supports string_view in pre-c++17.
-#if (FMT_HAS_INCLUDE(<string_view>) && (__cplusplus > 201402L || defined(_LIBCPP_VERSION))) ||                         \
-    (defined(_MSVC_LANG) && _MSVC_LANG > 201402L && _MSC_VER >= 1910)
-
-#include <string_view>
-
-#define FMT_USE_STRING_VIEW
-#elif FMT_HAS_INCLUDE("experimental/string_view") && __cplusplus >= 201402L
-#include <experimental/string_view>
-#define FMT_USE_EXPERIMENTAL_STRING_VIEW
-#endif
-
-FMT_BEGIN_NAMESPACE
-
-// Implementations of enable_if_t and other types for pre-C++14 systems.
-template <bool B, class T = void>
-using enable_if_t = typename std::enable_if<B, T>::type;
-template <bool B, class T, class F>
-using conditional_t = typename std::conditional<B, T, F>::type;
-template <bool B>
-using bool_constant = std::integral_constant<bool, B>;
-template <typename T>
-using remove_reference_t = typename std::remove_reference<T>::type;
-template <typename T>
-using remove_const_t = typename std::remove_const<T>::type;
-template <typename T>
-using remove_cvref_t = typename std::remove_cv<remove_reference_t<T>>::type;
-
-struct monostate {};
-
-// An enable_if helper to be used in template parameters which results in much
-// shorter symbols: https://godbolt.org/z/sWw4vP. Extra parentheses are needed
-// to workaround a bug in MSVC 2019 (see #1140 and #1186).
-#define FMT_ENABLE_IF(...) enable_if_t<(__VA_ARGS__), int> = 0
-
-namespace internal {
-
-// A workaround for gcc 4.8 to make void_t work in a SFINAE context.
-template <typename... Ts>
-struct void_t_impl {
-	using type = void;
-};
-
-#ifndef FMT_ASSERT
-#define FMT_ASSERT(condition, message)
-#endif
-
-#if defined(FMT_USE_STRING_VIEW)
-template <typename Char>
-using std_string_view = std::basic_string_view<Char>;
-#elif defined(FMT_USE_EXPERIMENTAL_STRING_VIEW)
-template <typename Char>
-using std_string_view = std::experimental::basic_string_view<Char>;
-#else
-template <typename T>
-struct std_string_view {};
-#endif
-
-#ifdef FMT_USE_INT128
-// Do nothing.
-#elif defined(__SIZEOF_INT128__)
-#define FMT_USE_INT128 1
-using int128_t = __int128_t;
-using uint128_t = __uint128_t;
-#else
-#define FMT_USE_INT128 0
-#endif
-#if !FMT_USE_INT128
-struct int128_t {};
-struct uint128_t {};
-#endif
-
-// Casts a nonnegative integer to unsigned.
-template <typename Int>
-FMT_CONSTEXPR typename std::make_unsigned<Int>::type to_unsigned(Int value) {
-	FMT_ASSERT(value >= 0, "negative value");
-	return static_cast<typename std::make_unsigned<Int>::type>(value);
-}
-} // namespace internal
-
-template <typename... Ts>
-using void_t = typename internal::void_t_impl<Ts...>::type;
-
-/**
-  An implementation of ``std::basic_string_view`` for pre-C++17. It provides a
-  subset of the API. ``fmt::basic_string_view`` is used for format strings even
-  if ``std::string_view`` is available to prevent issues when a library is
-  compiled with a different ``-std`` option than the client code (which is not
-  recommended).
- */
-template <typename Char>
-class basic_string_view {
-private:
-	const Char* data_;
-	size_t size_;
-
-public:
-	using char_type = Char;
-	using iterator = const Char*;
-
-	FMT_CONSTEXPR basic_string_view() FMT_NOEXCEPT : data_(nullptr), size_(0) {
-	}
-
-	/** Constructs a string reference object from a C string and a size. */
-	FMT_CONSTEXPR basic_string_view(const Char* s, size_t count) FMT_NOEXCEPT : data_(s), size_(count) {
-	}
-
-	/**
-	  \rst
-	  Constructs a string reference object from a C string computing
-	  the size with ``std::char_traits<Char>::length``.
-	  \endrst
-	 */
-	basic_string_view(const Char* s) : data_(s), size_(std::char_traits<Char>::length(s)) {
-	}
-
-	/** Constructs a string reference from a ``std::basic_string`` object. */
-	template <typename Traits, typename Alloc>
-	FMT_CONSTEXPR basic_string_view(const std::basic_string<Char, Traits, Alloc>& s) FMT_NOEXCEPT : data_(s.data()),
-	                                                                                                size_(s.size()) {
-	}
-
-	template <typename S, FMT_ENABLE_IF(std::is_same<S, internal::std_string_view<Char>>::value)>
-	FMT_CONSTEXPR basic_string_view(S s) FMT_NOEXCEPT : data_(s.data()), size_(s.size()) {
-	}
-
-	/** Returns a pointer to the string data. */
-	FMT_CONSTEXPR const Char* data() const {
-		return data_;
-	}
-
-	/** Returns the string size. */
-	FMT_CONSTEXPR size_t size() const {
-		return size_;
-	}
-
-	FMT_CONSTEXPR iterator begin() const {
-		return data_;
-	}
-
-	FMT_CONSTEXPR iterator end() const {
-		return data_ + size_;
-	}
-
-	FMT_CONSTEXPR const Char& operator[](size_t pos) const {
-		return data_[pos];
-	}
-
-	FMT_CONSTEXPR void remove_prefix(size_t n) {
-		data_ += n;
-		size_ -= n;
-	}
-
-	std::string to_string() {
-		return std::string((char*) data(), size());
-	}
-
-	// Lexicographically compare this string reference to other.
-	int compare(basic_string_view other) const {
-		size_t str_size = size_ < other.size_ ? size_ : other.size_;
-		int result = std::char_traits<Char>::compare(data_, other.data_, str_size);
-		if (result == 0)
-			result = size_ == other.size_ ? 0 : (size_ < other.size_ ? -1 : 1);
-		return result;
-	}
-
-	friend bool operator==(basic_string_view lhs, basic_string_view rhs) {
-		return lhs.compare(rhs) == 0;
-	}
-
-	friend bool operator!=(basic_string_view lhs, basic_string_view rhs) {
-		return lhs.compare(rhs) != 0;
-	}
-
-	friend bool operator<(basic_string_view lhs, basic_string_view rhs) {
-		return lhs.compare(rhs) < 0;
-	}
-
-	friend bool operator<=(basic_string_view lhs, basic_string_view rhs) {
-		return lhs.compare(rhs) <= 0;
-	}
-
-	friend bool operator>(basic_string_view lhs, basic_string_view rhs) {
-		return lhs.compare(rhs) > 0;
-	}
-
-	friend bool operator>=(basic_string_view lhs, basic_string_view rhs) {
-		return lhs.compare(rhs) >= 0;
-	}
-};
-
-using string_view = basic_string_view<char>;
-using wstring_view = basic_string_view<wchar_t>;
-
-// A UTF-8 code unit type.
-
-typedef char fmt_char8_t;
-
-/** Specifies if ``T`` is a character type. Can be specialized by users. */
-template <typename T>
-struct is_char : std::false_type {};
-template <>
-struct is_char<wchar_t> : std::true_type {};
-template <>
-struct is_char<fmt_char8_t> : std::true_type {};
-template <>
-struct is_char<char16_t> : std::true_type {};
-template <>
-struct is_char<char32_t> : std::true_type {};
-
-/**
-  \rst
-  Returns a string view of `s`. In order to add custom string type support to
-  {fmt} provide an overload of `to_string_view` for it in the same namespace as
-  the type for the argument-dependent lookup to work.
-
-  **Example**::
-
-    namespace my_ns {
-    inline string_view to_string_view(const my_string& s) {
-      return {s.data(), s.length()};
-    }
-    }
-    std::string message = fmt::format(my_string("The answer is {}"), 42);
-  \endrst
- */
-template <typename Char, FMT_ENABLE_IF(is_char<Char>::value)>
-inline basic_string_view<Char> to_string_view(const Char* s) {
-	return s;
-}
-
-template <typename Char, typename Traits, typename Alloc>
-inline basic_string_view<Char> to_string_view(const std::basic_string<Char, Traits, Alloc>& s) {
-	return s;
-}
-
-template <typename Char>
-inline basic_string_view<Char> to_string_view(basic_string_view<Char> s) {
-	return s;
-}
-
-template <typename Char, FMT_ENABLE_IF(!std::is_empty<internal::std_string_view<Char>>::value)>
-inline basic_string_view<Char> to_string_view(internal::std_string_view<Char> s) {
-	return s;
-}
-
-// A base class for compile-time strings. It is defined in the fmt namespace to
-// make formatting functions visible via ADL, e.g. format(fmt("{}"), 42).
-struct compile_string {};
-
-template <typename S>
-struct is_compile_string : std::is_base_of<compile_string, S> {};
-
-template <typename S, FMT_ENABLE_IF(is_compile_string<S>::value)>
-FMT_CONSTEXPR basic_string_view<typename S::char_type> to_string_view(const S& s) {
-	return s;
-}
-
-namespace internal {
-void to_string_view(...);
-
-using nautilus_fmt::v6::to_string_view;
-
-// Specifies whether S is a string type convertible to fmt::basic_string_view.
-// It should be a constexpr function but MSVC 2017 fails to compile it in
-// enable_if and MSVC 2015 fails to compile it as an alias template.
-template <typename S>
-struct is_string : std::is_class<decltype(to_string_view(std::declval<S>()))> {};
-
-template <typename S, typename = void>
-struct char_t_impl {};
-template <typename S>
-struct char_t_impl<S, enable_if_t<is_string<S>::value>> {
-	using result = decltype(to_string_view(std::declval<S>()));
-	using type = typename result::char_type;
-};
-
-struct error_handler {
-	FMT_CONSTEXPR error_handler() = default;
-
-	FMT_CONSTEXPR error_handler(const error_handler&) = default;
-
-	// This function is intentionally not constexpr to give a compile-time error.
-	FMT_NORETURN FMT_API void on_error(std::string message);
-};
-} // namespace internal
-
-/** String's character type. */
-template <typename S>
-using char_t = typename internal::char_t_impl<S>::type;
-
-/**
-  \rst
-  Parsing context consisting of a format string range being parsed and an
-  argument counter for automatic indexing.
-
-  You can use one of the following type aliases for common character types:
-
-  +-----------------------+-------------------------------------+
-  | Type                  | Definition                          |
-  +=======================+=====================================+
-  | format_parse_context  | basic_format_parse_context<char>    |
-  +-----------------------+-------------------------------------+
-  | wformat_parse_context | basic_format_parse_context<wchar_t> |
-  +-----------------------+-------------------------------------+
-  \endrst
- */
-template <typename Char, typename ErrorHandler = internal::error_handler>
-class basic_format_parse_context : private ErrorHandler {
-private:
-	basic_string_view<Char> format_str_;
-	int next_arg_id_;
-
-public:
-	using char_type = Char;
-	using iterator = typename basic_string_view<Char>::iterator;
-
-	explicit FMT_CONSTEXPR basic_format_parse_context(basic_string_view<Char> format_str,
-	                                                  ErrorHandler eh = ErrorHandler())
-	    : ErrorHandler(eh), format_str_(format_str), next_arg_id_(0) {
-	}
-
-	/**
-	  Returns an iterator to the beginning of the format string range being
-	  parsed.
-	 */
-	FMT_CONSTEXPR iterator begin() const FMT_NOEXCEPT {
-		return format_str_.begin();
-	}
-
-	/**
-	  Returns an iterator past the end of the format string range being parsed.
-	 */
-	FMT_CONSTEXPR iterator end() const FMT_NOEXCEPT {
-		return format_str_.end();
-	}
-
-	/** Advances the begin iterator to ``it``. */
-	FMT_CONSTEXPR void advance_to(iterator it) {
-		format_str_.remove_prefix(internal::to_unsigned(it - begin()));
-	}
-
-	/**
-	  Reports an error if using the manual argument indexing; otherwise returns
-	  the next argument index and switches to the automatic indexing.
-	 */
-	FMT_CONSTEXPR int next_arg_id() {
-		if (next_arg_id_ >= 0)
-			return next_arg_id_++;
-		on_error("cannot switch from manual to automatic argument indexing");
-		return 0;
-	}
-
-	/**
-	  Reports an error if using the automatic argument indexing; otherwise
-	  switches to the manual indexing.
-	 */
-	FMT_CONSTEXPR void check_arg_id(int) {
-		if (next_arg_id_ > 0)
-			on_error("cannot switch from automatic to manual argument indexing");
-		else
-			next_arg_id_ = -1;
-	}
-
-	FMT_CONSTEXPR void check_arg_id(basic_string_view<Char>) {
-	}
-
-	FMT_CONSTEXPR void on_error(std::string message) {
-		ErrorHandler::on_error(message);
-	}
-
-	FMT_CONSTEXPR ErrorHandler error_handler() const {
-		return *this;
-	}
-};
-
-using format_parse_context = basic_format_parse_context<char>;
-using wformat_parse_context = basic_format_parse_context<wchar_t>;
-
-template <typename Char, typename ErrorHandler = internal::error_handler>
-using basic_parse_context FMT_DEPRECATED_ALIAS = basic_format_parse_context<Char, ErrorHandler>;
-using parse_context FMT_DEPRECATED_ALIAS = basic_format_parse_context<char>;
-using wparse_context FMT_DEPRECATED_ALIAS = basic_format_parse_context<wchar_t>;
-
-template <typename Context>
-class basic_format_arg;
-
-template <typename Context>
-class basic_format_args;
-
-// A formatter for objects of type T.
-template <typename T, typename Char = char, typename Enable = void>
-struct formatter {
-	// A deleted default constructor indicates a disabled formatter.
-	formatter() = delete;
-};
-
-template <typename T, typename Char, typename Enable = void>
-struct FMT_DEPRECATED convert_to_int
-    : bool_constant<!std::is_arithmetic<T>::value && std::is_convertible<T, int>::value> {};
-
-// Specifies if T has an enabled formatter specialization. A type can be
-// formattable even if it doesn't have a formatter e.g. via a conversion.
-template <typename T, typename Context>
-using has_formatter = std::is_constructible<typename Context::template formatter_type<T>>;
-
-namespace internal {
-
-/** A contiguous memory buffer with an optional growing ability. */
-template <typename T>
-class buffer {
-private:
-	T* ptr_;
-	std::size_t size_;
-	std::size_t capacity_;
-
-protected:
-	// Don't initialize ptr_ since it is not accessed to save a few cycles.
-	buffer(std::size_t sz) FMT_NOEXCEPT : size_(sz), capacity_(sz) {
-	}
-
-	buffer(T* p = nullptr, std::size_t sz = 0, std::size_t cap = 0) FMT_NOEXCEPT : ptr_(p), size_(sz), capacity_(cap) {
-	}
-
-	/** Sets the buffer data and capacity. */
-	void set(T* buf_data, std::size_t buf_capacity) FMT_NOEXCEPT {
-		ptr_ = buf_data;
-		capacity_ = buf_capacity;
-	}
-
-	/** Increases the buffer capacity to hold at least *capacity* elements. */
-	virtual void grow(std::size_t capacity) = 0;
-
-public:
-	using value_type = T;
-	using const_reference = const T&;
-
-	buffer(const buffer&) = delete;
-
-	void operator=(const buffer&) = delete;
-
-	virtual ~buffer() = default;
-
-	T* begin() FMT_NOEXCEPT {
-		return ptr_;
-	}
-
-	T* end() FMT_NOEXCEPT {
-		return ptr_ + size_;
-	}
-
-	/** Returns the size of this buffer. */
-	std::size_t size() const FMT_NOEXCEPT {
-		return size_;
-	}
-
-	/** Returns the capacity of this buffer. */
-	std::size_t capacity() const FMT_NOEXCEPT {
-		return capacity_;
-	}
-
-	/** Returns a pointer to the buffer data. */
-	T* data() FMT_NOEXCEPT {
-		return ptr_;
-	}
-
-	/** Returns a pointer to the buffer data. */
-	const T* data() const FMT_NOEXCEPT {
-		return ptr_;
-	}
-
-	/**
-	  Resizes the buffer. If T is a POD type new elements may not be initialized.
-	 */
-	void resize(std::size_t new_size) {
-		reserve(new_size);
-		size_ = new_size;
-	}
-
-	/** Clears this buffer. */
-	void clear() {
-		size_ = 0;
-	}
-
-	/** Reserves space to store at least *capacity* elements. */
-	void reserve(std::size_t new_capacity) {
-		if (new_capacity > capacity_)
-			grow(new_capacity);
-	}
-
-	void push_back(const T& value) {
-		reserve(size_ + 1);
-		ptr_[size_++] = value;
-	}
-
-	/** Appends data to the end of the buffer. */
-	template <typename U>
-	void append(const U* begin, const U* end);
-
-	T& operator[](std::size_t index) {
-		return ptr_[index];
-	}
-
-	const T& operator[](std::size_t index) const {
-		return ptr_[index];
-	}
-};
-
-// A container-backed buffer.
-template <typename Container>
-class container_buffer : public buffer<typename Container::value_type> {
-private:
-	Container& container_;
-
-protected:
-	void grow(std::size_t capacity) FMT_OVERRIDE {
-		container_.resize(capacity);
-		this->set(&container_[0], capacity);
-	}
-
-public:
-	explicit container_buffer(Container& c) : buffer<typename Container::value_type>(c.size()), container_(c) {
-	}
-};
-
-// Extracts a reference to the container from back_insert_iterator.
-template <typename Container>
-inline Container& get_container(std::back_insert_iterator<Container> it) {
-	using bi_iterator = std::back_insert_iterator<Container>;
-	struct accessor : bi_iterator {
-		accessor(bi_iterator iter) : bi_iterator(iter) {
-		}
-
-		using bi_iterator::container;
-	};
-	return *accessor(it).container;
-}
-
-template <typename T, typename Char = char, typename Enable = void>
-struct fallback_formatter {
-	fallback_formatter() = delete;
-};
-
-// Specifies if T has an enabled fallback_formatter specialization.
-template <typename T, typename Context>
-using has_fallback_formatter = std::is_constructible<fallback_formatter<T, typename Context::char_type>>;
-
-template <typename Char>
-struct named_arg_base;
-template <typename T, typename Char>
-struct named_arg;
-
-enum type {
-	none_type,
-	named_arg_type,
-	// Integer types should go first,
-	int_type,
-	uint_type,
-	long_long_type,
-	ulong_long_type,
-	int128_type,
-	uint128_type,
-	bool_type,
-	char_type,
-	last_integer_type = char_type,
-	// followed by floating-point types.
-	float_type,
-	double_type,
-	long_double_type,
-	last_numeric_type = long_double_type,
-	cstring_type,
-	string_type,
-	pointer_type,
-	custom_type
-};
-
-// Maps core type T to the corresponding type enum constant.
-template <typename T, typename Char>
-struct type_constant : std::integral_constant<type, custom_type> {};
-
-#define FMT_TYPE_CONSTANT(Type, constant)                                                                              \
-	template <typename Char>                                                                                           \
-	struct type_constant<Type, Char> : std::integral_constant<type, constant> {}
-
-FMT_TYPE_CONSTANT(const named_arg_base<Char>&, named_arg_type);
-FMT_TYPE_CONSTANT(int, int_type);
-FMT_TYPE_CONSTANT(unsigned, uint_type);
-FMT_TYPE_CONSTANT(long long, long_long_type);
-FMT_TYPE_CONSTANT(unsigned long long, ulong_long_type);
-FMT_TYPE_CONSTANT(int128_t, int128_type);
-FMT_TYPE_CONSTANT(uint128_t, uint128_type);
-FMT_TYPE_CONSTANT(bool, bool_type);
-FMT_TYPE_CONSTANT(Char, char_type);
-FMT_TYPE_CONSTANT(float, float_type);
-FMT_TYPE_CONSTANT(double, double_type);
-FMT_TYPE_CONSTANT(long double, long_double_type);
-FMT_TYPE_CONSTANT(const Char*, cstring_type);
-FMT_TYPE_CONSTANT(basic_string_view<Char>, string_type);
-FMT_TYPE_CONSTANT(const void*, pointer_type);
-
-FMT_CONSTEXPR bool is_integral_type(type t) {
-	FMT_ASSERT(t != named_arg_type, "invalid argument type");
-	return t > none_type && t <= last_integer_type;
-}
-
-FMT_CONSTEXPR bool is_arithmetic_type(type t) {
-	FMT_ASSERT(t != named_arg_type, "invalid argument type");
-	return t > none_type && t <= last_numeric_type;
-}
-
-template <typename Char>
-struct string_value {
-	const Char* data;
-	std::size_t size;
-};
-
-template <typename Context>
-struct custom_value {
-	using parse_context = basic_format_parse_context<typename Context::char_type>;
-	const void* value;
-
-	void (*format)(const void* arg, parse_context& parse_ctx, Context& ctx);
-};
-
-// A formatting argument value.
-template <typename Context>
-class value {
-public:
-	using char_type = typename Context::char_type;
-
-	union {
-		int int_value;
-		unsigned uint_value;
-		long long long_long_value;
-		unsigned long long ulong_long_value;
-		int128_t int128_value;
-		uint128_t uint128_value;
-		bool bool_value;
-		char_type char_value;
-		float float_value;
-		double double_value;
-		long double long_double_value;
-		const void* pointer;
-		string_value<char_type> string;
-		custom_value<Context> custom;
-		const named_arg_base<char_type>* named_arg;
-	};
-
-	FMT_CONSTEXPR value(int val = 0) : int_value(val) {
-	}
-
-	FMT_CONSTEXPR value(unsigned val) : uint_value(val) {
-	}
-
-	value(long long val) : long_long_value(val) {
-	}
-
-	value(unsigned long long val) : ulong_long_value(val) {
-	}
-
-	value(int128_t val) : int128_value(val) {
-	}
-
-	value(uint128_t val) : uint128_value(val) {
-	}
-
-	value(float val) : float_value(val) {
-	}
-
-	value(double val) : double_value(val) {
-	}
-
-	value(long double val) : long_double_value(val) {
-	}
-
-	value(bool val) : bool_value(val) {
-	}
-
-	value(char_type val) : char_value(val) {
-	}
-
-	value(const char_type* val) {
-		string.data = val;
-	}
-
-	value(basic_string_view<char_type> val) {
-		string.data = val.data();
-		string.size = val.size();
-	}
-
-	value(const void* val) : pointer(val) {
-	}
-
-	template <typename T>
-	value(const T& val) {
-		custom.value = &val;
-		// Get the formatter type through the context to allow different contexts
-		// have different extension points, e.g. `formatter<T>` for `format` and
-		// `printf_formatter<T>` for `printf`.
-		custom.format = format_custom_arg<
-		    T, conditional_t<has_formatter<T, Context>::value, typename Context::template formatter_type<T>,
-		                     fallback_formatter<T, char_type>>>;
-	}
-
-	value(const named_arg_base<char_type>& val) {
-		named_arg = &val;
-	}
-
-private:
-	// Formats an argument of a custom type, such as a user-defined class.
-	template <typename T, typename Formatter>
-	static void format_custom_arg(const void* arg, basic_format_parse_context<char_type>& parse_ctx, Context& ctx) {
-		Formatter f;
-		parse_ctx.advance_to(f.parse(parse_ctx));
-		ctx.advance_to(f.format(*static_cast<const T*>(arg), ctx));
-	}
-};
-
-template <typename Context, typename T>
-FMT_CONSTEXPR basic_format_arg<Context> make_arg(const T& value);
-
-// To minimize the number of types we need to deal with, long is translated
-// either to int or to long long depending on its size.
-enum { long_short = sizeof(long) == sizeof(int) };
-using long_type = conditional_t<long_short, int, long long>;
-using ulong_type = conditional_t<long_short, unsigned, unsigned long long>;
-
-// Maps formatting arguments to core types.
-template <typename Context>
-struct arg_mapper {
-	using char_type = typename Context::char_type;
-
-	FMT_CONSTEXPR int map(signed char val) {
-		return val;
-	}
-
-	FMT_CONSTEXPR unsigned map(unsigned char val) {
-		return val;
-	}
-
-	FMT_CONSTEXPR int map(short val) {
-		return val;
-	}
-
-	FMT_CONSTEXPR unsigned map(unsigned short val) {
-		return val;
-	}
-
-	FMT_CONSTEXPR int map(int val) {
-		return val;
-	}
-
-	FMT_CONSTEXPR unsigned map(unsigned val) {
-		return val;
-	}
-
-	FMT_CONSTEXPR long_type map(long val) {
-		return val;
-	}
-
-	FMT_CONSTEXPR ulong_type map(unsigned long val) {
-		return val;
-	}
-
-	FMT_CONSTEXPR long long map(long long val) {
-		return val;
-	}
-
-	FMT_CONSTEXPR unsigned long long map(unsigned long long val) {
-		return val;
-	}
-
-	FMT_CONSTEXPR int128_t map(int128_t val) {
-		return val;
-	}
-
-	FMT_CONSTEXPR uint128_t map(uint128_t val) {
-		return val;
-	}
-
-	FMT_CONSTEXPR bool map(bool val) {
-		return val;
-	}
-
-	template <typename T, FMT_ENABLE_IF(is_char<T>::value)>
-	FMT_CONSTEXPR char_type map(T val) {
-		static_assert(std::is_same<T, char>::value || std::is_same<T, char_type>::value,
-		              "mixing character types is disallowed");
-		return val;
-	}
-
-	FMT_CONSTEXPR float map(float val) {
-		return val;
-	}
-
-	FMT_CONSTEXPR double map(double val) {
-		return val;
-	}
-
-	FMT_CONSTEXPR long double map(long double val) {
-		return val;
-	}
-
-	FMT_CONSTEXPR const char_type* map(char_type* val) {
-		return val;
-	}
-
-	FMT_CONSTEXPR const char_type* map(const char_type* val) {
-		return val;
-	}
-
-	template <typename T, FMT_ENABLE_IF(is_string<T>::value)>
-	FMT_CONSTEXPR basic_string_view<char_type> map(const T& val) {
-		static_assert(std::is_same<char_type, char_t<T>>::value, "mixing character types is disallowed");
-		return to_string_view(val);
-	}
-
-	template <typename T,
-	          FMT_ENABLE_IF(std::is_constructible<basic_string_view<char_type>, T>::value && !is_string<T>::value)>
-	FMT_CONSTEXPR basic_string_view<char_type> map(const T& val) {
-		return basic_string_view<char_type>(val);
-	}
-
-	template <typename T, FMT_ENABLE_IF(std::is_constructible<std_string_view<char_type>, T>::value &&
-	                                    !std::is_constructible<basic_string_view<char_type>, T>::value &&
-	                                    !is_string<T>::value && !has_formatter<T, Context>::value)>
-	FMT_CONSTEXPR basic_string_view<char_type> map(const T& val) {
-		return std_string_view<char_type>(val);
-	}
-
-	FMT_CONSTEXPR const char* map(const signed char* val) {
-		static_assert(std::is_same<char_type, char>::value, "invalid string type");
-		return reinterpret_cast<const char*>(val);
-	}
-
-	FMT_CONSTEXPR const char* map(const unsigned char* val) {
-		static_assert(std::is_same<char_type, char>::value, "invalid string type");
-		return reinterpret_cast<const char*>(val);
-	}
-
-	FMT_CONSTEXPR const void* map(void* val) {
-		return val;
-	}
-
-	FMT_CONSTEXPR const void* map(const void* val) {
-		return val;
-	}
-
-	FMT_CONSTEXPR const void* map(std::nullptr_t val) {
-		return val;
-	}
-
-	template <typename T>
-	FMT_CONSTEXPR int map(const T*) {
-		// Formatting of arbitrary pointers is disallowed. If you want to output
-		// a pointer cast it to "void *" or "const void *". In particular, this
-		// forbids formatting of "[const] volatile char *" which is printed as bool
-		// by iostreams.
-		static_assert(!sizeof(T), "formatting of non-void pointers is disallowed");
-		return 0;
-	}
-
-	template <typename T, FMT_ENABLE_IF(std::is_enum<T>::value && !has_formatter<T, Context>::value &&
-	                                    !has_fallback_formatter<T, Context>::value)>
-	FMT_CONSTEXPR auto map(const T& val) -> decltype(map(static_cast<typename std::underlying_type<T>::type>(val))) {
-		return map(static_cast<typename std::underlying_type<T>::type>(val));
-	}
-
-	template <typename T, FMT_ENABLE_IF(!is_string<T>::value && !is_char<T>::value &&
-	                                    !std::is_constructible<basic_string_view<char_type>, T>::value &&
-	                                    (has_formatter<T, Context>::value ||
-	                                     (has_fallback_formatter<T, Context>::value &&
-	                                      !std::is_constructible<std_string_view<char_type>, T>::value)))>
-	FMT_CONSTEXPR const T& map(const T& val) {
-		return val;
-	}
-
-	template <typename T>
-	FMT_CONSTEXPR const named_arg_base<char_type>& map(const named_arg<T, char_type>& val) {
-		auto arg = make_arg<Context>(val.value);
-		std::memcpy(val.data, &arg, sizeof(arg));
-		return val;
-	}
-};
-
-// A type constant after applying arg_mapper<Context>.
-template <typename T, typename Context>
-using mapped_type_constant =
-    type_constant<decltype(arg_mapper<Context>().map(std::declval<const T&>())), typename Context::char_type>;
-
-enum { packed_arg_bits = 5 };
-// Maximum number of arguments with packed types.
-enum { max_packed_args = 63 / packed_arg_bits };
-enum : unsigned long long { is_unpacked_bit = 1ULL << 63 };
-
-template <typename Context>
-class arg_map;
-} // namespace internal
-
-// A formatting argument. It is a trivially copyable/constructible type to
-// allow storage in basic_memory_buffer.
-template <typename Context>
-class basic_format_arg {
-private:
-	internal::value<Context> value_;
-	internal::type type_;
-
-	template <typename ContextType, typename T>
-	friend FMT_CONSTEXPR basic_format_arg<ContextType> internal::make_arg(const T& value);
-
-	template <typename Visitor, typename Ctx>
-	friend FMT_CONSTEXPR auto visit_format_arg(Visitor&& vis, const basic_format_arg<Ctx>& arg) -> decltype(vis(0));
-
-	friend class basic_format_args<Context>;
-
-	friend class internal::arg_map<Context>;
-
-	using char_type = typename Context::char_type;
-
-public:
-	class handle {
-	public:
-		explicit handle(internal::custom_value<Context> custom) : custom_(custom) {
-		}
-
-		void format(basic_format_parse_context<char_type>& parse_ctx, Context& ctx) const {
-			custom_.format(custom_.value, parse_ctx, ctx);
-		}
-
-	private:
-		internal::custom_value<Context> custom_;
-	};
-
-	FMT_CONSTEXPR basic_format_arg() : type_(internal::none_type) {
-	}
-
-	FMT_CONSTEXPR explicit operator bool() const FMT_NOEXCEPT {
-		return type_ != internal::none_type;
-	}
-
-	internal::type type() const {
-		return type_;
-	}
-
-	bool is_integral() const {
-		return internal::is_integral_type(type_);
-	}
-
-	bool is_arithmetic() const {
-		return internal::is_arithmetic_type(type_);
-	}
-};
-
-/**
-  \rst
-  Visits an argument dispatching to the appropriate visit method based on
-  the argument type. For example, if the argument type is ``double`` then
-  ``vis(value)`` will be called with the value of type ``double``.
-  \endrst
- */
-template <typename Visitor, typename Context>
-FMT_CONSTEXPR auto visit_format_arg(Visitor&& vis, const basic_format_arg<Context>& arg) -> decltype(vis(0)) {
-	using char_type = typename Context::char_type;
-	switch (arg.type_) {
-	case internal::none_type:
-		break;
-	case internal::named_arg_type:
-		FMT_ASSERT(false, "invalid argument type");
-		break;
-	case internal::int_type:
-		return vis(arg.value_.int_value);
-	case internal::uint_type:
-		return vis(arg.value_.uint_value);
-	case internal::long_long_type:
-		return vis(arg.value_.long_long_value);
-	case internal::ulong_long_type:
-		return vis(arg.value_.ulong_long_value);
-#if FMT_USE_INT128
-	case internal::int128_type:
-		return vis(arg.value_.int128_value);
-	case internal::uint128_type:
-		return vis(arg.value_.uint128_value);
-#else
-	case internal::int128_type:
-	case internal::uint128_type:
-		break;
-#endif
-	case internal::bool_type:
-		return vis(arg.value_.bool_value);
-	case internal::char_type:
-		return vis(arg.value_.char_value);
-	case internal::float_type:
-		return vis(arg.value_.float_value);
-	case internal::double_type:
-		return vis(arg.value_.double_value);
-	case internal::long_double_type:
-		return vis(arg.value_.long_double_value);
-	case internal::cstring_type:
-		return vis(arg.value_.string.data);
-	case internal::string_type:
-		return vis(basic_string_view<char_type>(arg.value_.string.data, arg.value_.string.size));
-	case internal::pointer_type:
-		return vis(arg.value_.pointer);
-	case internal::custom_type:
-		return vis(typename basic_format_arg<Context>::handle(arg.value_.custom));
-	}
-	return vis(monostate());
-}
-
-namespace internal {
-// A map from argument names to their values for named arguments.
-template <typename Context>
-class arg_map {
-private:
-	using char_type = typename Context::char_type;
-
-	struct entry {
-		basic_string_view<char_type> name;
-		basic_format_arg<Context> arg;
-	};
-
-	entry* map_;
-	unsigned size_;
-
-	void push_back(value<Context> val) {
-		const auto& named = *val.named_arg;
-		map_[size_] = {named.name, named.template deserialize<Context>()};
-		++size_;
-	}
-
-public:
-	arg_map(const arg_map&) = delete;
-
-	void operator=(const arg_map&) = delete;
-
-	arg_map() : map_(nullptr), size_(0) {
-	}
-
-	void init(const basic_format_args<Context>& args);
-
-	~arg_map() {
-		delete[] map_;
-	}
-
-	basic_format_arg<Context> find(basic_string_view<char_type> name) const {
-		// The list is unsorted, so just return the first matching name.
-		for (entry *it = map_, *end = map_ + size_; it != end; ++it) {
-			if (it->name == name)
-				return it->arg;
-		}
-		return {};
-	}
-};
-
-// A type-erased reference to an std::locale to avoid heavy <locale> include.
-class locale_ref {
-private:
-	const void* locale_; // A type-erased pointer to std::locale.
-
-public:
-	locale_ref() : locale_(nullptr) {
-	}
-
-	template <typename Locale>
-	explicit locale_ref(const Locale& loc);
-
-	explicit operator bool() const FMT_NOEXCEPT {
-		return locale_ != nullptr;
-	}
-
-	template <typename Locale>
-	Locale get() const;
-};
-
-template <typename>
-constexpr unsigned long long encode_types() {
-	return 0;
-}
-
-template <typename Context, typename Arg, typename... Args>
-constexpr unsigned long long encode_types() {
-	return mapped_type_constant<Arg, Context>::value | (encode_types<Context, Args...>() << packed_arg_bits);
-}
-
-template <typename Context, typename T>
-FMT_CONSTEXPR basic_format_arg<Context> make_arg(const T& value) {
-	basic_format_arg<Context> arg;
-	arg.type_ = mapped_type_constant<T, Context>::value;
-	arg.value_ = arg_mapper<Context>().map(value);
-	return arg;
-}
-
-template <bool IS_PACKED, typename Context, typename T, FMT_ENABLE_IF(IS_PACKED)>
-inline value<Context> make_arg(const T& val) {
-	return arg_mapper<Context>().map(val);
-}
-
-template <bool IS_PACKED, typename Context, typename T, FMT_ENABLE_IF(!IS_PACKED)>
-inline basic_format_arg<Context> make_arg(const T& value) {
-	return make_arg<Context>(value);
-}
-} // namespace internal
-
-// Formatting context.
-template <typename OutputIt, typename Char>
-class basic_format_context {
-public:
-	/** The character type for the output. */
-	using char_type = Char;
-
-private:
-	OutputIt out_;
-	basic_format_args<basic_format_context> args_;
-	internal::arg_map<basic_format_context> map_;
-	internal::locale_ref loc_;
-
-public:
-	using iterator = OutputIt;
-	using format_arg = basic_format_arg<basic_format_context>;
-	template <typename T>
-	using formatter_type = formatter<T, char_type>;
-
-	basic_format_context(const basic_format_context&) = delete;
-
-	void operator=(const basic_format_context&) = delete;
-
-	/**
-	 Constructs a ``basic_format_context`` object. References to the arguments are
-	 stored in the object so make sure they have appropriate lifetimes.
-	 */
-	basic_format_context(OutputIt out, basic_format_args<basic_format_context> ctx_args,
-	                     internal::locale_ref loc = internal::locale_ref())
-	    : out_(out), args_(ctx_args), loc_(loc) {
-	}
-
-	format_arg arg(int id) const {
-		return args_.get(id);
-	}
-
-	// Checks if manual indexing is used and returns the argument with the
-	// specified name.
-	format_arg arg(basic_string_view<char_type> name);
-
-	internal::error_handler error_handler() {
-		return {};
-	}
-
-	void on_error(std::string message) {
-		error_handler().on_error(message);
-	}
-
-	// Returns an iterator to the beginning of the output range.
-	iterator out() {
-		return out_;
-	}
-
-	// Advances the begin iterator to ``it``.
-	void advance_to(iterator it) {
-		out_ = it;
-	}
-
-	internal::locale_ref locale() {
-		return loc_;
-	}
-};
-
-template <typename Char>
-using buffer_context = basic_format_context<std::back_insert_iterator<internal::buffer<Char>>, Char>;
-using format_context = buffer_context<char>;
-using wformat_context = buffer_context<wchar_t>;
-
-/**
-  \rst
-  An array of references to arguments. It can be implicitly converted into
-  `~fmt::basic_format_args` for passing into type-erased formatting functions
-  such as `~fmt::vformat`.
-  \endrst
- */
-template <typename Context, typename... Args>
-class format_arg_store {
-private:
-	static const size_t num_args = sizeof...(Args);
-	static const bool is_packed = num_args < internal::max_packed_args;
-
-	using value_type = conditional_t<is_packed, internal::value<Context>, basic_format_arg<Context>>;
-
-	// If the arguments are not packed, add one more element to mark the end.
-	value_type data_[num_args + (num_args == 0 ? 1 : 0)];
-
-	friend class basic_format_args<Context>;
-
-public:
-	static constexpr unsigned long long types =
-	    is_packed ? internal::encode_types<Context, Args...>() : internal::is_unpacked_bit | num_args;
-
-	format_arg_store(const Args&... args) : data_ {internal::make_arg<is_packed, Context>(args)...} {
-	}
-};
-
-/**
-  \rst
-  Constructs an `~fmt::format_arg_store` object that contains references to
-  arguments and can be implicitly converted to `~fmt::format_args`. `Context`
-  can be omitted in which case it defaults to `~fmt::context`.
-  See `~fmt::arg` for lifetime considerations.
-  \endrst
- */
-template <typename Context = format_context, typename... Args>
-inline format_arg_store<Context, Args...> make_format_args(const Args&... args) {
-	return {args...};
-}
-
-/** Formatting arguments. */
-template <typename Context>
-class basic_format_args {
-public:
-	using size_type = int;
-	using format_arg = basic_format_arg<Context>;
-
-private:
-	// To reduce compiled code size per formatting function call, types of first
-	// max_packed_args arguments are passed in the types_ field.
-	unsigned long long types_;
-	union {
-		// If the number of arguments is less than max_packed_args, the argument
-		// values are stored in values_, otherwise they are stored in args_.
-		// This is done to reduce compiled code size as storing larger objects
-		// may require more code (at least on x86-64) even if the same amount of
-		// data is actually copied to stack. It saves ~10% on the bloat test.
-		const internal::value<Context>* values_;
-		const format_arg* args_;
-	};
-
-	bool is_packed() const {
-		return (types_ & internal::is_unpacked_bit) == 0;
-	}
-
-	internal::type type(int index) const {
-		int shift = index * internal::packed_arg_bits;
-		unsigned int mask = (1 << internal::packed_arg_bits) - 1;
-		return static_cast<internal::type>((types_ >> shift) & mask);
-	}
-
-	friend class internal::arg_map<Context>;
-
-	void set_data(const internal::value<Context>* values) {
-		values_ = values;
-	}
-
-	void set_data(const format_arg* args) {
-		args_ = args;
-	}
-
-	format_arg do_get(int index) const {
-		format_arg arg;
-		if (!is_packed()) {
-			auto num_args = max_size();
-			if (index < num_args)
-				arg = args_[index];
-			return arg;
-		}
-		if (index > internal::max_packed_args)
-			return arg;
-		arg.type_ = type(index);
-		if (arg.type_ == internal::none_type)
-			return arg;
-		internal::value<Context>& val = arg.value_;
-		val = values_[index];
-		return arg;
-	}
-
-public:
-	basic_format_args() : types_(0) {
-	}
-
-	/**
-	 \rst
-	 Constructs a `basic_format_args` object from `~fmt::format_arg_store`.
-	 \endrst
-	 */
-	template <typename... Args>
-	basic_format_args(const format_arg_store<Context, Args...>& store) : types_(store.types) {
-		set_data(store.data_);
-	}
-
-	/**
-	 \rst
-	 Constructs a `basic_format_args` object from a dynamic set of arguments.
-	 \endrst
-	 */
-	basic_format_args(const format_arg* args, int count)
-	    : types_(internal::is_unpacked_bit | internal::to_unsigned(count)) {
-		set_data(args);
-	}
-
-	/** Returns the argument at specified index. */
-	format_arg get(int index) const {
-		format_arg arg = do_get(index);
-		if (arg.type_ == internal::named_arg_type)
-			arg = arg.value_.named_arg->template deserialize<Context>();
-		return arg;
-	}
-
-	int max_size() const {
-		unsigned long long max_packed = internal::max_packed_args;
-		return static_cast<int>(is_packed() ? max_packed : types_ & ~internal::is_unpacked_bit);
-	}
-};
-
-/** An alias to ``basic_format_args<context>``. */
-// It is a separate type rather than an alias to make symbols readable.
-struct format_args : basic_format_args<format_context> {
-	template <typename... Args>
-	format_args(Args&&... args) : basic_format_args<format_context>(std::forward<Args>(args)...) {
-	}
-};
-
-struct wformat_args : basic_format_args<wformat_context> {
-	template <typename... Args>
-	wformat_args(Args&&... args) : basic_format_args<wformat_context>(std::forward<Args>(args)...) {
-	}
-};
-
-template <typename Container>
-struct is_contiguous : std::false_type {};
-
-template <typename Char>
-struct is_contiguous<std::basic_string<Char>> : std::true_type {};
-
-template <typename Char>
-struct is_contiguous<internal::buffer<Char>> : std::true_type {};
-
-namespace internal {
-
-template <typename OutputIt>
-struct is_contiguous_back_insert_iterator : std::false_type {};
-template <typename Container>
-struct is_contiguous_back_insert_iterator<std::back_insert_iterator<Container>> : is_contiguous<Container> {};
-
-template <typename Char>
-struct named_arg_base {
-	basic_string_view<Char> name;
-
-	// Serialized value<context>.
-	mutable char data[sizeof(basic_format_arg<buffer_context<Char>>)];
-
-	named_arg_base(basic_string_view<Char> nm) : name(nm) {
-	}
-
-	template <typename Context>
-	basic_format_arg<Context> deserialize() const {
-		basic_format_arg<Context> arg;
-		std::memcpy(&arg, data, sizeof(basic_format_arg<Context>));
-		return arg;
-	}
-};
-
-template <typename T, typename Char>
-struct named_arg : named_arg_base<Char> {
-	const T& value;
-
-	named_arg(basic_string_view<Char> name, const T& val) : named_arg_base<Char>(name), value(val) {
-	}
-};
-
-template <typename..., typename S, FMT_ENABLE_IF(!is_compile_string<S>::value)>
-inline void check_format_string(const S&) {
-#if defined(FMT_ENFORCE_COMPILE_STRING)
-	static_assert(is_compile_string<S>::value, "FMT_ENFORCE_COMPILE_STRING requires all format strings to "
-	                                           "utilize FMT_STRING() or fmt().");
-#endif
-}
-
-template <typename..., typename S, FMT_ENABLE_IF(is_compile_string<S>::value)>
-void check_format_string(S);
-
-struct view {};
-template <bool...>
-struct bool_pack;
-template <bool... Args>
-using all_true = std::is_same<bool_pack<Args..., true>, bool_pack<true, Args...>>;
-
-template <typename... Args, typename S, typename Char = char_t<S>>
-inline format_arg_store<buffer_context<Char>, remove_reference_t<Args>...>
-make_args_checked(const S& format_str, const remove_reference_t<Args>&... args) {
-	static_assert(
-	    all_true<(!std::is_base_of<view, remove_reference_t<Args>>() || !std::is_reference<Args>())...>::value,
-	    "passing views as lvalues is disallowed");
-	check_format_string<remove_const_t<remove_reference_t<Args>>...>(format_str);
-	return {args...};
-}
-
-template <typename Char>
-std::basic_string<Char> vformat(basic_string_view<Char> format_str, basic_format_args<buffer_context<Char>> args);
-
-template <typename Char>
-typename buffer_context<Char>::iterator vformat_to(buffer<Char>& buf, basic_string_view<Char> format_str,
-                                                   basic_format_args<buffer_context<Char>> args);
-} // namespace internal
-
-/**
-  \rst
-  Returns a named argument to be used in a formatting function.
-
-  The named argument holds a reference and does not extend the lifetime
-  of its arguments.
-  Consequently, a dangling reference can accidentally be created.
-  The user should take care to only pass this function temporaries when
-  the named argument is itself a temporary, as per the following example.
-
-  **Example**::
-
-    fmt::print("Elapsed time: {s:.2f} seconds", fmt::arg("s", 1.23));
-  \endrst
- */
-template <typename S, typename T, typename Char = char_t<S>>
-inline internal::named_arg<T, Char> arg(const S& name, const T& arg) {
-	static_assert(internal::is_string<S>::value, "");
-	return {name, arg};
-}
-
-// Disable nested named arguments, e.g. ``arg("a", arg("b", 42))``.
-template <typename S, typename T, typename Char>
-void arg(S, internal::named_arg<T, Char>) = delete;
-
-/** Formats a string and writes the output to ``out``. */
-// GCC 8 and earlier cannot handle std::back_insert_iterator<Container> with
-// vformat_to<ArgFormatter>(...) overload, so SFINAE on iterator type instead.
-template <typename OutputIt, typename S, typename Char = char_t<S>,
-          FMT_ENABLE_IF(internal::is_contiguous_back_insert_iterator<OutputIt>::value)>
-OutputIt vformat_to(OutputIt out, const S& format_str, basic_format_args<buffer_context<Char>> args) {
-	using container = remove_reference_t<decltype(internal::get_container(out))>;
-	internal::container_buffer<container> buf((internal::get_container(out)));
-	internal::vformat_to(buf, to_string_view(format_str), args);
-	return out;
-}
-
-template <typename Container, typename S, typename... Args,
-          FMT_ENABLE_IF(is_contiguous<Container>::value&& internal::is_string<S>::value)>
-inline std::back_insert_iterator<Container> format_to(std::back_insert_iterator<Container> out, const S& format_str,
-                                                      Args&&... args) {
-	return vformat_to(out, to_string_view(format_str), {internal::make_args_checked<Args...>(format_str, args...)});
-}
-
-template <typename S, typename Char = char_t<S>>
-inline std::basic_string<Char> vformat(const S& format_str, basic_format_args<buffer_context<Char>> args) {
-	return internal::vformat(to_string_view(format_str), args);
-}
-
-/**
-  \rst
-  Formats arguments and returns the result as a string.
-
-  **Example**::
-
-    #include <fmt/core.h>
-    std::string message = fmt::format("The answer is {}", 42);
-  \endrst
-*/
-// Pass char_t as a default template parameter instead of using
-// std::basic_string<char_t<S>> to reduce the symbol size.
-template <typename S, typename... Args, typename Char = char_t<S>>
-inline std::basic_string<Char> format(const S& format_str, Args&&... args) {
-	return internal::vformat(to_string_view(format_str), {internal::make_args_checked<Args...>(format_str, args...)});
-}
-
-FMT_END_NAMESPACE
-
-#endif // FMT_CORE_H_
+#include "format.h"
diff --git a/third_party/fmt/include/fmt/format-inl.h b/third_party/fmt/include/fmt/format-inl.h
index 9277c946..a887483b 100644
--- a/third_party/fmt/include/fmt/format-inl.h
+++ b/third_party/fmt/include/fmt/format-inl.h
@@ -8,1203 +8,1921 @@
 #ifndef FMT_FORMAT_INL_H_
 #define FMT_FORMAT_INL_H_
 
-#include "fmt/format.h"
-#include <cassert>
-#include <cctype>
-#include <climits>
-#include <cmath>
-#include <cstdarg>
-#include <cstring> // for std::memmove
-#include <cwchar>
-
-#if FMT_EXCEPTIONS
-#define FMT_TRY try
-#define FMT_CATCH(x) catch (x)
-#else
-#define FMT_TRY if (true)
-#define FMT_CATCH(x) if (false)
+#ifndef FMT_MODULE
+#  include <algorithm>
+#  include <cerrno>  // errno
+#  include <climits>
+#  include <cmath>
+#  include <exception>
+
+#  if !defined(FMT_STATIC_THOUSANDS_SEPARATOR)
+#    include <locale>
+#  endif
 #endif
 
-#ifdef _MSC_VER
-#pragma warning(push)
-#pragma warning(disable : 4702) // unreachable code
+#if defined(_WIN32) && !defined(FMT_USE_WRITE_CONSOLE)
+#  include <io.h>  // _isatty
 #endif
 
-// Dummy implementations of strerror_r and strerror_s called if corresponding
-// system functions are not available.
-inline nautilus_fmt::internal::null<> strerror_r(int, char*, ...) {
-	return {};
+#include "format.h"
+
+FMT_BEGIN_NAMESPACE
+namespace detail {
+
+FMT_FUNC void assert_fail(const char* file, int line, const char* message) {
+  // Use unchecked std::fprintf to avoid triggering another assertion when
+  // writing to stderr fails
+  std::fprintf(stderr, "%s:%d: assertion failed: %s", file, line, message);
+  // Chosen instead of std::abort to satisfy Clang in CUDA mode during device
+  // code pass.
+  std::terminate();
 }
 
-inline nautilus_fmt::internal::null<> strerror_s(char*, std::size_t, ...) {
-	return {};
+FMT_FUNC void format_error_code(detail::buffer<char>& out, int error_code,
+                                string_view message) noexcept {
+  // Report error code making sure that the output fits into
+  // inline_buffer_size to avoid dynamic memory allocation and potential
+  // bad_alloc.
+  out.try_resize(0);
+  static const char SEP[] = ": ";
+  static const char ERROR_STR[] = "error ";
+  // Subtract 2 to account for terminating null characters in SEP and ERROR_STR.
+  size_t error_code_size = sizeof(SEP) + sizeof(ERROR_STR) - 2;
+  auto abs_value = static_cast<uint32_or_64_or_128_t<int>>(error_code);
+  if (detail::is_negative(error_code)) {
+    abs_value = 0 - abs_value;
+    ++error_code_size;
+  }
+  error_code_size += detail::to_unsigned(detail::count_digits(abs_value));
+  auto it = appender(out);
+  if (message.size() <= inline_buffer_size - error_code_size)
+    fmt::format_to(it, FMT_STRING("{}{}"), message, SEP);
+  fmt::format_to(it, FMT_STRING("{}{}"), ERROR_STR, error_code);
+  FMT_ASSERT(out.size() <= inline_buffer_size, "");
 }
 
-FMT_BEGIN_NAMESPACE
-namespace internal {
-
-#ifndef _MSC_VER
-#define FMT_SNPRINTF snprintf
-#else // _MSC_VER
-inline int fmt_snprintf(char* buffer, size_t size, const char* format, ...) {
-	va_list args;
-	va_start(args, format);
-	int result = vsnprintf_s(buffer, size, _TRUNCATE, format, args);
-	va_end(args);
-	return result;
+FMT_FUNC void report_error(format_func func, int error_code,
+                           const char* message) noexcept {
+  memory_buffer full_message;
+  func(full_message, error_code, message);
+  // Don't use fwrite_fully because the latter may throw.
+  if (std::fwrite(full_message.data(), full_message.size(), 1, stderr) > 0)
+    std::fputc('\n', stderr);
+}
+
+// A wrapper around fwrite that throws on error.
+inline void fwrite_fully(const void* ptr, size_t count, FILE* stream) {
+  size_t written = std::fwrite(ptr, 1, count, stream);
+  if (written < count)
+    FMT_THROW(system_error(errno, FMT_STRING("cannot write to file")));
+}
+
+#ifndef FMT_STATIC_THOUSANDS_SEPARATOR
+template <typename Locale>
+locale_ref::locale_ref(const Locale& loc) : locale_(&loc) {
+  static_assert(std::is_same<Locale, std::locale>::value, "");
+}
+
+template <typename Locale> auto locale_ref::get() const -> Locale {
+  static_assert(std::is_same<Locale, std::locale>::value, "");
+  return locale_ ? *static_cast<const std::locale*>(locale_) : std::locale();
 }
-#define FMT_SNPRINTF fmt_snprintf
-#endif // _MSC_VER
-
-using format_func = void (*)(internal::buffer<char>&, int, string_view);
-
-// A portable thread-safe version of strerror.
-// Sets buffer to point to a string describing the error code.
-// This can be either a pointer to a string stored in buffer,
-// or a pointer to some static immutable string.
-// Returns one of the following values:
-//   0      - success
-//   ERANGE - buffer is not large enough to store the error message
-//   other  - failure
-// Buffer should be at least of size 1.
-FMT_FUNC int safe_strerror(int error_code, char*& buffer, std::size_t buffer_size) FMT_NOEXCEPT {
-	FMT_ASSERT(buffer != nullptr && buffer_size != 0, "invalid buffer");
-
-	class dispatcher {
-	private:
-		int error_code_;
-		char*& buffer_;
-		std::size_t buffer_size_;
-
-		// A noop assignment operator to avoid bogus warnings.
-		void operator=(const dispatcher&) {
-		}
-
-		// Handle the result of XSI-compliant version of strerror_r.
-		int handle(int result) {
-			// glibc versions before 2.13 return result in errno.
-			return result == -1 ? errno : result;
-		}
-
-		// Handle the result of GNU-specific version of strerror_r.
-		int handle(char* message) {
-			// If the buffer is full then the message is probably truncated.
-			if (message == buffer_ && strlen(buffer_) == buffer_size_ - 1)
-				return ERANGE;
-			buffer_ = message;
-			return 0;
-		}
-
-		// Handle the case when strerror_r is not available.
-		int handle(internal::null<>) {
-			return fallback(strerror_s(buffer_, buffer_size_, error_code_));
-		}
-
-		// Fallback to strerror_s when strerror_r is not available.
-		int fallback(int result) {
-			// If the buffer is full then the message is probably truncated.
-			return result == 0 && strlen(buffer_) == buffer_size_ - 1 ? ERANGE : result;
-		}
-
-#if !FMT_MSC_VER
-
-		// Fallback to strerror if strerror_r and strerror_s are not available.
-		int fallback(internal::null<>) {
-			errno = 0;
-			buffer_ = strerror(error_code_);
-			return errno;
-		}
 
+template <typename Char>
+FMT_FUNC auto thousands_sep_impl(locale_ref loc) -> thousands_sep_result<Char> {
+  auto& facet = std::use_facet<std::numpunct<Char>>(loc.get<std::locale>());
+  auto grouping = facet.grouping();
+  auto thousands_sep = grouping.empty() ? Char() : facet.thousands_sep();
+  return {std::move(grouping), thousands_sep};
+}
+template <typename Char>
+FMT_FUNC auto decimal_point_impl(locale_ref loc) -> Char {
+  return std::use_facet<std::numpunct<Char>>(loc.get<std::locale>())
+      .decimal_point();
+}
+#else
+template <typename Char>
+FMT_FUNC auto thousands_sep_impl(locale_ref) -> thousands_sep_result<Char> {
+  return {"\03", FMT_STATIC_THOUSANDS_SEPARATOR};
+}
+template <typename Char> FMT_FUNC Char decimal_point_impl(locale_ref) {
+  return '.';
+}
 #endif
 
-	public:
-		dispatcher(int err_code, char*& buf, std::size_t buf_size)
-		    : error_code_(err_code), buffer_(buf), buffer_size_(buf_size) {
-		}
+FMT_FUNC auto write_loc(appender out, loc_value value,
+                        const format_specs& specs, locale_ref loc) -> bool {
+#ifdef FMT_STATIC_THOUSANDS_SEPARATOR
+  value.visit(loc_writer<>{
+      out, specs, std::string(1, FMT_STATIC_THOUSANDS_SEPARATOR), "\3", "."});
+  return true;
+#else
+  auto locale = loc.get<std::locale>();
+  // We cannot use the num_put<char> facet because it may produce output in
+  // a wrong encoding.
+  using facet = format_facet<std::locale>;
+  if (std::has_facet<facet>(locale))
+    return std::use_facet<facet>(locale).put(out, value, specs);
+  return facet(locale).put(out, value, specs);
+#endif
+}
+}  // namespace detail
 
-		int run() {
-			return handle(strerror_r(error_code_, buffer_, buffer_size_));
-		}
-	};
-	return dispatcher(error_code, buffer, buffer_size).run();
+FMT_FUNC void report_error(const char* message) {
+  FMT_THROW(format_error(message));
 }
 
-FMT_FUNC void format_error_code(internal::buffer<char>& out, int error_code, string_view message) FMT_NOEXCEPT {
-	// Report error code making sure that the output fits into
-	// inline_buffer_size to avoid dynamic memory allocation and potential
-	// bad_alloc.
-	out.resize(0);
-	static const char SEP[] = ": ";
-	static const char ERROR_STR[] = "error ";
-	// Subtract 2 to account for terminating null characters in SEP and ERROR_STR.
-	std::size_t error_code_size = sizeof(SEP) + sizeof(ERROR_STR) - 2;
-	auto abs_value = static_cast<uint32_or_64_or_128_t<int>>(error_code);
-	if (internal::is_negative(error_code)) {
-		abs_value = 0 - abs_value;
-		++error_code_size;
-	}
-	error_code_size += internal::to_unsigned(internal::count_digits(abs_value));
-	internal::writer w(out);
-	if (message.size() <= inline_buffer_size - error_code_size) {
-		w.write(message);
-		w.write(SEP);
-	}
-	w.write(ERROR_STR);
-	w.write(error_code);
-	assert(out.size() <= inline_buffer_size);
+template <typename Locale> typename Locale::id format_facet<Locale>::id;
+
+#ifndef FMT_STATIC_THOUSANDS_SEPARATOR
+template <typename Locale> format_facet<Locale>::format_facet(Locale& loc) {
+  auto& numpunct = std::use_facet<std::numpunct<char>>(loc);
+  grouping_ = numpunct.grouping();
+  if (!grouping_.empty()) separator_ = std::string(1, numpunct.thousands_sep());
 }
 
-FMT_FUNC void report_error(format_func func, int error_code, string_view message) FMT_NOEXCEPT {
-	memory_buffer full_message;
-	func(full_message, error_code, message);
-	/*// R does not allow us to have a reference to stderr even if we are not using it
-	// Don't use fwrite_fully because the latter may throw.
-	(void)std::fwrite(full_message.data(), full_message.size(), 1, stderr);
-	std::fputc('\n', stderr);
-	*/
+template <>
+FMT_API FMT_FUNC auto format_facet<std::locale>::do_put(
+    appender out, loc_value val, const format_specs& specs) const -> bool {
+  return val.visit(
+      detail::loc_writer<>{out, specs, separator_, grouping_, decimal_point_});
 }
-} // namespace internal
+#endif
 
-template <typename Char>
-FMT_FUNC std::string internal::grouping_impl(locale_ref) {
-	return "\03";
+FMT_FUNC auto vsystem_error(int error_code, string_view fmt, format_args args)
+    -> std::system_error {
+  auto ec = std::error_code(error_code, std::generic_category());
+  return std::system_error(ec, vformat(fmt, args));
 }
 
-template <typename Char>
-FMT_FUNC Char internal::thousands_sep_impl(locale_ref) {
-	return ',';
+namespace detail {
+
+template <typename F>
+inline auto operator==(basic_fp<F> x, basic_fp<F> y) -> bool {
+  return x.f == y.f && x.e == y.e;
 }
 
-template <typename Char>
-FMT_FUNC Char internal::decimal_point_impl(locale_ref) {
-	return '.';
+// Compilers should be able to optimize this into the ror instruction.
+FMT_CONSTEXPR inline auto rotr(uint32_t n, uint32_t r) noexcept -> uint32_t {
+  r &= 31;
+  return (n >> r) | (n << (32 - r));
+}
+FMT_CONSTEXPR inline auto rotr(uint64_t n, uint32_t r) noexcept -> uint64_t {
+  r &= 63;
+  return (n >> r) | (n << (64 - r));
 }
 
-namespace internal {
+// Implementation of Dragonbox algorithm: https://github.com/jk-jeon/dragonbox.
+namespace dragonbox {
+// Computes upper 64 bits of multiplication of a 32-bit unsigned integer and a
+// 64-bit unsigned integer.
+inline auto umul96_upper64(uint32_t x, uint64_t y) noexcept -> uint64_t {
+  return umul128_upper64(static_cast<uint64_t>(x) << 32, y);
+}
 
-template <>
-FMT_FUNC int count_digits<4>(internal::fallback_uintptr n) {
-	// fallback_uintptr is always stored in little endian.
-	int i = static_cast<int>(sizeof(void*)) - 1;
-	while (i > 0 && n.value[i] == 0)
-		--i;
-	auto char_digits = std::numeric_limits<unsigned char>::digits / 4;
-	return i >= 0 ? i * char_digits + count_digits<4, unsigned>(n.value[i]) : 1;
+// Computes lower 128 bits of multiplication of a 64-bit unsigned integer and a
+// 128-bit unsigned integer.
+inline auto umul192_lower128(uint64_t x, uint128_fallback y) noexcept
+    -> uint128_fallback {
+  uint64_t high = x * y.high();
+  uint128_fallback high_low = umul128(x, y.low());
+  return {high + high_low.high(), high_low.low()};
 }
 
-template <typename T>
-const char basic_data<T>::digits[] = "0001020304050607080910111213141516171819"
-                                     "2021222324252627282930313233343536373839"
-                                     "4041424344454647484950515253545556575859"
-                                     "6061626364656667686970717273747576777879"
-                                     "8081828384858687888990919293949596979899";
+// Computes lower 64 bits of multiplication of a 32-bit unsigned integer and a
+// 64-bit unsigned integer.
+inline auto umul96_lower64(uint32_t x, uint64_t y) noexcept -> uint64_t {
+  return x * y;
+}
 
-template <typename T>
-const char basic_data<T>::hex_digits[] = "0123456789abcdef";
+// Various fast log computations.
+inline auto floor_log10_pow2_minus_log10_4_over_3(int e) noexcept -> int {
+  FMT_ASSERT(e <= 2936 && e >= -2985, "too large exponent");
+  return (e * 631305 - 261663) >> 21;
+}
 
-#define FMT_POWERS_OF_10(factor)                                                                                       \
-	factor * 10, (factor) * 100, (factor) * 1000, (factor) * 10000, (factor) * 100000, (factor) * 1000000,             \
-	    (factor) * 10000000, (factor) * 100000000, (factor) * 1000000000
+FMT_INLINE_VARIABLE constexpr struct {
+  uint32_t divisor;
+  int shift_amount;
+} div_small_pow10_infos[] = {{10, 16}, {100, 16}};
+
+// Replaces n by floor(n / pow(10, N)) returning true if and only if n is
+// divisible by pow(10, N).
+// Precondition: n <= pow(10, N + 1).
+template <int N>
+auto check_divisibility_and_divide_by_pow10(uint32_t& n) noexcept -> bool {
+  // The numbers below are chosen such that:
+  //   1. floor(n/d) = floor(nm / 2^k) where d=10 or d=100,
+  //   2. nm mod 2^k < m if and only if n is divisible by d,
+  // where m is magic_number, k is shift_amount
+  // and d is divisor.
+  //
+  // Item 1 is a common technique of replacing division by a constant with
+  // multiplication, see e.g. "Division by Invariant Integers Using
+  // Multiplication" by Granlund and Montgomery (1994). magic_number (m) is set
+  // to ceil(2^k/d) for large enough k.
+  // The idea for item 2 originates from Schubfach.
+  constexpr auto info = div_small_pow10_infos[N - 1];
+  FMT_ASSERT(n <= info.divisor * 10, "n is too large");
+  constexpr uint32_t magic_number =
+      (1u << info.shift_amount) / info.divisor + 1;
+  n *= magic_number;
+  const uint32_t comparison_mask = (1u << info.shift_amount) - 1;
+  bool result = (n & comparison_mask) < magic_number;
+  n >>= info.shift_amount;
+  return result;
+}
 
-template <typename T>
-const uint64_t basic_data<T>::powers_of_10_64[] = {1, FMT_POWERS_OF_10(1), FMT_POWERS_OF_10(1000000000ULL),
-                                                   10000000000000000000ULL};
+// Computes floor(n / pow(10, N)) for small n and N.
+// Precondition: n <= pow(10, N + 1).
+template <int N> auto small_division_by_pow10(uint32_t n) noexcept -> uint32_t {
+  constexpr auto info = div_small_pow10_infos[N - 1];
+  FMT_ASSERT(n <= info.divisor * 10, "n is too large");
+  constexpr uint32_t magic_number =
+      (1u << info.shift_amount) / info.divisor + 1;
+  return (n * magic_number) >> info.shift_amount;
+}
 
-template <typename T>
-const uint32_t basic_data<T>::zero_or_powers_of_10_32[] = {0, FMT_POWERS_OF_10(1)};
+// Computes floor(n / 10^(kappa + 1)) (float)
+inline auto divide_by_10_to_kappa_plus_1(uint32_t n) noexcept -> uint32_t {
+  // 1374389535 = ceil(2^37/100)
+  return static_cast<uint32_t>((static_cast<uint64_t>(n) * 1374389535) >> 37);
+}
+// Computes floor(n / 10^(kappa + 1)) (double)
+inline auto divide_by_10_to_kappa_plus_1(uint64_t n) noexcept -> uint64_t {
+  // 2361183241434822607 = ceil(2^(64+7)/1000)
+  return umul128_upper64(n, 2361183241434822607ull) >> 7;
+}
 
-template <typename T>
-const uint64_t basic_data<T>::zero_or_powers_of_10_64[] = {0, FMT_POWERS_OF_10(1), FMT_POWERS_OF_10(1000000000ULL),
-                                                           10000000000000000000ULL};
+// Various subroutines using pow10 cache
+template <typename T> struct cache_accessor;
+
+template <> struct cache_accessor<float> {
+  using carrier_uint = float_info<float>::carrier_uint;
+  using cache_entry_type = uint64_t;
+
+  static auto get_cached_power(int k) noexcept -> uint64_t {
+    FMT_ASSERT(k >= float_info<float>::min_k && k <= float_info<float>::max_k,
+               "k is out of range");
+    static constexpr const uint64_t pow10_significands[] = {
+        0x81ceb32c4b43fcf5, 0xa2425ff75e14fc32, 0xcad2f7f5359a3b3f,
+        0xfd87b5f28300ca0e, 0x9e74d1b791e07e49, 0xc612062576589ddb,
+        0xf79687aed3eec552, 0x9abe14cd44753b53, 0xc16d9a0095928a28,
+        0xf1c90080baf72cb2, 0x971da05074da7bef, 0xbce5086492111aeb,
+        0xec1e4a7db69561a6, 0x9392ee8e921d5d08, 0xb877aa3236a4b44a,
+        0xe69594bec44de15c, 0x901d7cf73ab0acda, 0xb424dc35095cd810,
+        0xe12e13424bb40e14, 0x8cbccc096f5088cc, 0xafebff0bcb24aaff,
+        0xdbe6fecebdedd5bf, 0x89705f4136b4a598, 0xabcc77118461cefd,
+        0xd6bf94d5e57a42bd, 0x8637bd05af6c69b6, 0xa7c5ac471b478424,
+        0xd1b71758e219652c, 0x83126e978d4fdf3c, 0xa3d70a3d70a3d70b,
+        0xcccccccccccccccd, 0x8000000000000000, 0xa000000000000000,
+        0xc800000000000000, 0xfa00000000000000, 0x9c40000000000000,
+        0xc350000000000000, 0xf424000000000000, 0x9896800000000000,
+        0xbebc200000000000, 0xee6b280000000000, 0x9502f90000000000,
+        0xba43b74000000000, 0xe8d4a51000000000, 0x9184e72a00000000,
+        0xb5e620f480000000, 0xe35fa931a0000000, 0x8e1bc9bf04000000,
+        0xb1a2bc2ec5000000, 0xde0b6b3a76400000, 0x8ac7230489e80000,
+        0xad78ebc5ac620000, 0xd8d726b7177a8000, 0x878678326eac9000,
+        0xa968163f0a57b400, 0xd3c21bcecceda100, 0x84595161401484a0,
+        0xa56fa5b99019a5c8, 0xcecb8f27f4200f3a, 0x813f3978f8940985,
+        0xa18f07d736b90be6, 0xc9f2c9cd04674edf, 0xfc6f7c4045812297,
+        0x9dc5ada82b70b59e, 0xc5371912364ce306, 0xf684df56c3e01bc7,
+        0x9a130b963a6c115d, 0xc097ce7bc90715b4, 0xf0bdc21abb48db21,
+        0x96769950b50d88f5, 0xbc143fa4e250eb32, 0xeb194f8e1ae525fe,
+        0x92efd1b8d0cf37bf, 0xb7abc627050305ae, 0xe596b7b0c643c71a,
+        0x8f7e32ce7bea5c70, 0xb35dbf821ae4f38c, 0xe0352f62a19e306f};
+    return pow10_significands[k - float_info<float>::min_k];
+  }
+
+  struct compute_mul_result {
+    carrier_uint result;
+    bool is_integer;
+  };
+  struct compute_mul_parity_result {
+    bool parity;
+    bool is_integer;
+  };
+
+  static auto compute_mul(carrier_uint u,
+                          const cache_entry_type& cache) noexcept
+      -> compute_mul_result {
+    auto r = umul96_upper64(u, cache);
+    return {static_cast<carrier_uint>(r >> 32),
+            static_cast<carrier_uint>(r) == 0};
+  }
+
+  static auto compute_delta(const cache_entry_type& cache, int beta) noexcept
+      -> uint32_t {
+    return static_cast<uint32_t>(cache >> (64 - 1 - beta));
+  }
+
+  static auto compute_mul_parity(carrier_uint two_f,
+                                 const cache_entry_type& cache,
+                                 int beta) noexcept
+      -> compute_mul_parity_result {
+    FMT_ASSERT(beta >= 1, "");
+    FMT_ASSERT(beta < 64, "");
+
+    auto r = umul96_lower64(two_f, cache);
+    return {((r >> (64 - beta)) & 1) != 0,
+            static_cast<uint32_t>(r >> (32 - beta)) == 0};
+  }
+
+  static auto compute_left_endpoint_for_shorter_interval_case(
+      const cache_entry_type& cache, int beta) noexcept -> carrier_uint {
+    return static_cast<carrier_uint>(
+        (cache - (cache >> (num_significand_bits<float>() + 2))) >>
+        (64 - num_significand_bits<float>() - 1 - beta));
+  }
+
+  static auto compute_right_endpoint_for_shorter_interval_case(
+      const cache_entry_type& cache, int beta) noexcept -> carrier_uint {
+    return static_cast<carrier_uint>(
+        (cache + (cache >> (num_significand_bits<float>() + 1))) >>
+        (64 - num_significand_bits<float>() - 1 - beta));
+  }
+
+  static auto compute_round_up_for_shorter_interval_case(
+      const cache_entry_type& cache, int beta) noexcept -> carrier_uint {
+    return (static_cast<carrier_uint>(
+                cache >> (64 - num_significand_bits<float>() - 2 - beta)) +
+            1) /
+           2;
+  }
+};
 
-// Normalized 64-bit significands of pow(10, k), for k = -348, -340, ..., 340.
-// These are generated by support/compute-powers.py.
-template <typename T>
-const uint64_t basic_data<T>::pow10_significands[] = {
-    0xfa8fd5a0081c0288, 0xbaaee17fa23ebf76, 0x8b16fb203055ac76, 0xcf42894a5dce35ea, 0x9a6bb0aa55653b2d,
-    0xe61acf033d1a45df, 0xab70fe17c79ac6ca, 0xff77b1fcbebcdc4f, 0xbe5691ef416bd60c, 0x8dd01fad907ffc3c,
-    0xd3515c2831559a83, 0x9d71ac8fada6c9b5, 0xea9c227723ee8bcb, 0xaecc49914078536d, 0x823c12795db6ce57,
-    0xc21094364dfb5637, 0x9096ea6f3848984f, 0xd77485cb25823ac7, 0xa086cfcd97bf97f4, 0xef340a98172aace5,
-    0xb23867fb2a35b28e, 0x84c8d4dfd2c63f3b, 0xc5dd44271ad3cdba, 0x936b9fcebb25c996, 0xdbac6c247d62a584,
-    0xa3ab66580d5fdaf6, 0xf3e2f893dec3f126, 0xb5b5ada8aaff80b8, 0x87625f056c7c4a8b, 0xc9bcff6034c13053,
-    0x964e858c91ba2655, 0xdff9772470297ebd, 0xa6dfbd9fb8e5b88f, 0xf8a95fcf88747d94, 0xb94470938fa89bcf,
-    0x8a08f0f8bf0f156b, 0xcdb02555653131b6, 0x993fe2c6d07b7fac, 0xe45c10c42a2b3b06, 0xaa242499697392d3,
-    0xfd87b5f28300ca0e, 0xbce5086492111aeb, 0x8cbccc096f5088cc, 0xd1b71758e219652c, 0x9c40000000000000,
-    0xe8d4a51000000000, 0xad78ebc5ac620000, 0x813f3978f8940984, 0xc097ce7bc90715b3, 0x8f7e32ce7bea5c70,
-    0xd5d238a4abe98068, 0x9f4f2726179a2245, 0xed63a231d4c4fb27, 0xb0de65388cc8ada8, 0x83c7088e1aab65db,
-    0xc45d1df942711d9a, 0x924d692ca61be758, 0xda01ee641a708dea, 0xa26da3999aef774a, 0xf209787bb47d6b85,
-    0xb454e4a179dd1877, 0x865b86925b9bc5c2, 0xc83553c5c8965d3d, 0x952ab45cfa97a0b3, 0xde469fbd99a05fe3,
-    0xa59bc234db398c25, 0xf6c69a72a3989f5c, 0xb7dcbf5354e9bece, 0x88fcf317f22241e2, 0xcc20ce9bd35c78a5,
-    0x98165af37b2153df, 0xe2a0b5dc971f303a, 0xa8d9d1535ce3b396, 0xfb9b7cd9a4a7443c, 0xbb764c4ca7a44410,
-    0x8bab8eefb6409c1a, 0xd01fef10a657842c, 0x9b10a4e5e9913129, 0xe7109bfba19c0c9d, 0xac2820d9623bf429,
-    0x80444b5e7aa7cf85, 0xbf21e44003acdd2d, 0x8e679c2f5e44ff8f, 0xd433179d9c8cb841, 0x9e19db92b4e31ba9,
-    0xeb96bf6ebadf77d9, 0xaf87023b9bf0ee6b,
+template <> struct cache_accessor<double> {
+  using carrier_uint = float_info<double>::carrier_uint;
+  using cache_entry_type = uint128_fallback;
+
+  static auto get_cached_power(int k) noexcept -> uint128_fallback {
+    FMT_ASSERT(k >= float_info<double>::min_k && k <= float_info<double>::max_k,
+               "k is out of range");
+
+    static constexpr const uint128_fallback pow10_significands[] = {
+#if FMT_USE_FULL_CACHE_DRAGONBOX
+      {0xff77b1fcbebcdc4f, 0x25e8e89c13bb0f7b},
+      {0x9faacf3df73609b1, 0x77b191618c54e9ad},
+      {0xc795830d75038c1d, 0xd59df5b9ef6a2418},
+      {0xf97ae3d0d2446f25, 0x4b0573286b44ad1e},
+      {0x9becce62836ac577, 0x4ee367f9430aec33},
+      {0xc2e801fb244576d5, 0x229c41f793cda740},
+      {0xf3a20279ed56d48a, 0x6b43527578c11110},
+      {0x9845418c345644d6, 0x830a13896b78aaaa},
+      {0xbe5691ef416bd60c, 0x23cc986bc656d554},
+      {0xedec366b11c6cb8f, 0x2cbfbe86b7ec8aa9},
+      {0x94b3a202eb1c3f39, 0x7bf7d71432f3d6aa},
+      {0xb9e08a83a5e34f07, 0xdaf5ccd93fb0cc54},
+      {0xe858ad248f5c22c9, 0xd1b3400f8f9cff69},
+      {0x91376c36d99995be, 0x23100809b9c21fa2},
+      {0xb58547448ffffb2d, 0xabd40a0c2832a78b},
+      {0xe2e69915b3fff9f9, 0x16c90c8f323f516d},
+      {0x8dd01fad907ffc3b, 0xae3da7d97f6792e4},
+      {0xb1442798f49ffb4a, 0x99cd11cfdf41779d},
+      {0xdd95317f31c7fa1d, 0x40405643d711d584},
+      {0x8a7d3eef7f1cfc52, 0x482835ea666b2573},
+      {0xad1c8eab5ee43b66, 0xda3243650005eed0},
+      {0xd863b256369d4a40, 0x90bed43e40076a83},
+      {0x873e4f75e2224e68, 0x5a7744a6e804a292},
+      {0xa90de3535aaae202, 0x711515d0a205cb37},
+      {0xd3515c2831559a83, 0x0d5a5b44ca873e04},
+      {0x8412d9991ed58091, 0xe858790afe9486c3},
+      {0xa5178fff668ae0b6, 0x626e974dbe39a873},
+      {0xce5d73ff402d98e3, 0xfb0a3d212dc81290},
+      {0x80fa687f881c7f8e, 0x7ce66634bc9d0b9a},
+      {0xa139029f6a239f72, 0x1c1fffc1ebc44e81},
+      {0xc987434744ac874e, 0xa327ffb266b56221},
+      {0xfbe9141915d7a922, 0x4bf1ff9f0062baa9},
+      {0x9d71ac8fada6c9b5, 0x6f773fc3603db4aa},
+      {0xc4ce17b399107c22, 0xcb550fb4384d21d4},
+      {0xf6019da07f549b2b, 0x7e2a53a146606a49},
+      {0x99c102844f94e0fb, 0x2eda7444cbfc426e},
+      {0xc0314325637a1939, 0xfa911155fefb5309},
+      {0xf03d93eebc589f88, 0x793555ab7eba27cb},
+      {0x96267c7535b763b5, 0x4bc1558b2f3458df},
+      {0xbbb01b9283253ca2, 0x9eb1aaedfb016f17},
+      {0xea9c227723ee8bcb, 0x465e15a979c1cadd},
+      {0x92a1958a7675175f, 0x0bfacd89ec191eca},
+      {0xb749faed14125d36, 0xcef980ec671f667c},
+      {0xe51c79a85916f484, 0x82b7e12780e7401b},
+      {0x8f31cc0937ae58d2, 0xd1b2ecb8b0908811},
+      {0xb2fe3f0b8599ef07, 0x861fa7e6dcb4aa16},
+      {0xdfbdcece67006ac9, 0x67a791e093e1d49b},
+      {0x8bd6a141006042bd, 0xe0c8bb2c5c6d24e1},
+      {0xaecc49914078536d, 0x58fae9f773886e19},
+      {0xda7f5bf590966848, 0xaf39a475506a899f},
+      {0x888f99797a5e012d, 0x6d8406c952429604},
+      {0xaab37fd7d8f58178, 0xc8e5087ba6d33b84},
+      {0xd5605fcdcf32e1d6, 0xfb1e4a9a90880a65},
+      {0x855c3be0a17fcd26, 0x5cf2eea09a550680},
+      {0xa6b34ad8c9dfc06f, 0xf42faa48c0ea481f},
+      {0xd0601d8efc57b08b, 0xf13b94daf124da27},
+      {0x823c12795db6ce57, 0x76c53d08d6b70859},
+      {0xa2cb1717b52481ed, 0x54768c4b0c64ca6f},
+      {0xcb7ddcdda26da268, 0xa9942f5dcf7dfd0a},
+      {0xfe5d54150b090b02, 0xd3f93b35435d7c4d},
+      {0x9efa548d26e5a6e1, 0xc47bc5014a1a6db0},
+      {0xc6b8e9b0709f109a, 0x359ab6419ca1091c},
+      {0xf867241c8cc6d4c0, 0xc30163d203c94b63},
+      {0x9b407691d7fc44f8, 0x79e0de63425dcf1e},
+      {0xc21094364dfb5636, 0x985915fc12f542e5},
+      {0xf294b943e17a2bc4, 0x3e6f5b7b17b2939e},
+      {0x979cf3ca6cec5b5a, 0xa705992ceecf9c43},
+      {0xbd8430bd08277231, 0x50c6ff782a838354},
+      {0xece53cec4a314ebd, 0xa4f8bf5635246429},
+      {0x940f4613ae5ed136, 0x871b7795e136be9a},
+      {0xb913179899f68584, 0x28e2557b59846e40},
+      {0xe757dd7ec07426e5, 0x331aeada2fe589d0},
+      {0x9096ea6f3848984f, 0x3ff0d2c85def7622},
+      {0xb4bca50b065abe63, 0x0fed077a756b53aa},
+      {0xe1ebce4dc7f16dfb, 0xd3e8495912c62895},
+      {0x8d3360f09cf6e4bd, 0x64712dd7abbbd95d},
+      {0xb080392cc4349dec, 0xbd8d794d96aacfb4},
+      {0xdca04777f541c567, 0xecf0d7a0fc5583a1},
+      {0x89e42caaf9491b60, 0xf41686c49db57245},
+      {0xac5d37d5b79b6239, 0x311c2875c522ced6},
+      {0xd77485cb25823ac7, 0x7d633293366b828c},
+      {0x86a8d39ef77164bc, 0xae5dff9c02033198},
+      {0xa8530886b54dbdeb, 0xd9f57f830283fdfd},
+      {0xd267caa862a12d66, 0xd072df63c324fd7c},
+      {0x8380dea93da4bc60, 0x4247cb9e59f71e6e},
+      {0xa46116538d0deb78, 0x52d9be85f074e609},
+      {0xcd795be870516656, 0x67902e276c921f8c},
+      {0x806bd9714632dff6, 0x00ba1cd8a3db53b7},
+      {0xa086cfcd97bf97f3, 0x80e8a40eccd228a5},
+      {0xc8a883c0fdaf7df0, 0x6122cd128006b2ce},
+      {0xfad2a4b13d1b5d6c, 0x796b805720085f82},
+      {0x9cc3a6eec6311a63, 0xcbe3303674053bb1},
+      {0xc3f490aa77bd60fc, 0xbedbfc4411068a9d},
+      {0xf4f1b4d515acb93b, 0xee92fb5515482d45},
+      {0x991711052d8bf3c5, 0x751bdd152d4d1c4b},
+      {0xbf5cd54678eef0b6, 0xd262d45a78a0635e},
+      {0xef340a98172aace4, 0x86fb897116c87c35},
+      {0x9580869f0e7aac0e, 0xd45d35e6ae3d4da1},
+      {0xbae0a846d2195712, 0x8974836059cca10a},
+      {0xe998d258869facd7, 0x2bd1a438703fc94c},
+      {0x91ff83775423cc06, 0x7b6306a34627ddd0},
+      {0xb67f6455292cbf08, 0x1a3bc84c17b1d543},
+      {0xe41f3d6a7377eeca, 0x20caba5f1d9e4a94},
+      {0x8e938662882af53e, 0x547eb47b7282ee9d},
+      {0xb23867fb2a35b28d, 0xe99e619a4f23aa44},
+      {0xdec681f9f4c31f31, 0x6405fa00e2ec94d5},
+      {0x8b3c113c38f9f37e, 0xde83bc408dd3dd05},
+      {0xae0b158b4738705e, 0x9624ab50b148d446},
+      {0xd98ddaee19068c76, 0x3badd624dd9b0958},
+      {0x87f8a8d4cfa417c9, 0xe54ca5d70a80e5d7},
+      {0xa9f6d30a038d1dbc, 0x5e9fcf4ccd211f4d},
+      {0xd47487cc8470652b, 0x7647c32000696720},
+      {0x84c8d4dfd2c63f3b, 0x29ecd9f40041e074},
+      {0xa5fb0a17c777cf09, 0xf468107100525891},
+      {0xcf79cc9db955c2cc, 0x7182148d4066eeb5},
+      {0x81ac1fe293d599bf, 0xc6f14cd848405531},
+      {0xa21727db38cb002f, 0xb8ada00e5a506a7d},
+      {0xca9cf1d206fdc03b, 0xa6d90811f0e4851d},
+      {0xfd442e4688bd304a, 0x908f4a166d1da664},
+      {0x9e4a9cec15763e2e, 0x9a598e4e043287ff},
+      {0xc5dd44271ad3cdba, 0x40eff1e1853f29fe},
+      {0xf7549530e188c128, 0xd12bee59e68ef47d},
+      {0x9a94dd3e8cf578b9, 0x82bb74f8301958cf},
+      {0xc13a148e3032d6e7, 0xe36a52363c1faf02},
+      {0xf18899b1bc3f8ca1, 0xdc44e6c3cb279ac2},
+      {0x96f5600f15a7b7e5, 0x29ab103a5ef8c0ba},
+      {0xbcb2b812db11a5de, 0x7415d448f6b6f0e8},
+      {0xebdf661791d60f56, 0x111b495b3464ad22},
+      {0x936b9fcebb25c995, 0xcab10dd900beec35},
+      {0xb84687c269ef3bfb, 0x3d5d514f40eea743},
+      {0xe65829b3046b0afa, 0x0cb4a5a3112a5113},
+      {0x8ff71a0fe2c2e6dc, 0x47f0e785eaba72ac},
+      {0xb3f4e093db73a093, 0x59ed216765690f57},
+      {0xe0f218b8d25088b8, 0x306869c13ec3532d},
+      {0x8c974f7383725573, 0x1e414218c73a13fc},
+      {0xafbd2350644eeacf, 0xe5d1929ef90898fb},
+      {0xdbac6c247d62a583, 0xdf45f746b74abf3a},
+      {0x894bc396ce5da772, 0x6b8bba8c328eb784},
+      {0xab9eb47c81f5114f, 0x066ea92f3f326565},
+      {0xd686619ba27255a2, 0xc80a537b0efefebe},
+      {0x8613fd0145877585, 0xbd06742ce95f5f37},
+      {0xa798fc4196e952e7, 0x2c48113823b73705},
+      {0xd17f3b51fca3a7a0, 0xf75a15862ca504c6},
+      {0x82ef85133de648c4, 0x9a984d73dbe722fc},
+      {0xa3ab66580d5fdaf5, 0xc13e60d0d2e0ebbb},
+      {0xcc963fee10b7d1b3, 0x318df905079926a9},
+      {0xffbbcfe994e5c61f, 0xfdf17746497f7053},
+      {0x9fd561f1fd0f9bd3, 0xfeb6ea8bedefa634},
+      {0xc7caba6e7c5382c8, 0xfe64a52ee96b8fc1},
+      {0xf9bd690a1b68637b, 0x3dfdce7aa3c673b1},
+      {0x9c1661a651213e2d, 0x06bea10ca65c084f},
+      {0xc31bfa0fe5698db8, 0x486e494fcff30a63},
+      {0xf3e2f893dec3f126, 0x5a89dba3c3efccfb},
+      {0x986ddb5c6b3a76b7, 0xf89629465a75e01d},
+      {0xbe89523386091465, 0xf6bbb397f1135824},
+      {0xee2ba6c0678b597f, 0x746aa07ded582e2d},
+      {0x94db483840b717ef, 0xa8c2a44eb4571cdd},
+      {0xba121a4650e4ddeb, 0x92f34d62616ce414},
+      {0xe896a0d7e51e1566, 0x77b020baf9c81d18},
+      {0x915e2486ef32cd60, 0x0ace1474dc1d122f},
+      {0xb5b5ada8aaff80b8, 0x0d819992132456bb},
+      {0xe3231912d5bf60e6, 0x10e1fff697ed6c6a},
+      {0x8df5efabc5979c8f, 0xca8d3ffa1ef463c2},
+      {0xb1736b96b6fd83b3, 0xbd308ff8a6b17cb3},
+      {0xddd0467c64bce4a0, 0xac7cb3f6d05ddbdf},
+      {0x8aa22c0dbef60ee4, 0x6bcdf07a423aa96c},
+      {0xad4ab7112eb3929d, 0x86c16c98d2c953c7},
+      {0xd89d64d57a607744, 0xe871c7bf077ba8b8},
+      {0x87625f056c7c4a8b, 0x11471cd764ad4973},
+      {0xa93af6c6c79b5d2d, 0xd598e40d3dd89bd0},
+      {0xd389b47879823479, 0x4aff1d108d4ec2c4},
+      {0x843610cb4bf160cb, 0xcedf722a585139bb},
+      {0xa54394fe1eedb8fe, 0xc2974eb4ee658829},
+      {0xce947a3da6a9273e, 0x733d226229feea33},
+      {0x811ccc668829b887, 0x0806357d5a3f5260},
+      {0xa163ff802a3426a8, 0xca07c2dcb0cf26f8},
+      {0xc9bcff6034c13052, 0xfc89b393dd02f0b6},
+      {0xfc2c3f3841f17c67, 0xbbac2078d443ace3},
+      {0x9d9ba7832936edc0, 0xd54b944b84aa4c0e},
+      {0xc5029163f384a931, 0x0a9e795e65d4df12},
+      {0xf64335bcf065d37d, 0x4d4617b5ff4a16d6},
+      {0x99ea0196163fa42e, 0x504bced1bf8e4e46},
+      {0xc06481fb9bcf8d39, 0xe45ec2862f71e1d7},
+      {0xf07da27a82c37088, 0x5d767327bb4e5a4d},
+      {0x964e858c91ba2655, 0x3a6a07f8d510f870},
+      {0xbbe226efb628afea, 0x890489f70a55368c},
+      {0xeadab0aba3b2dbe5, 0x2b45ac74ccea842f},
+      {0x92c8ae6b464fc96f, 0x3b0b8bc90012929e},
+      {0xb77ada0617e3bbcb, 0x09ce6ebb40173745},
+      {0xe55990879ddcaabd, 0xcc420a6a101d0516},
+      {0x8f57fa54c2a9eab6, 0x9fa946824a12232e},
+      {0xb32df8e9f3546564, 0x47939822dc96abfa},
+      {0xdff9772470297ebd, 0x59787e2b93bc56f8},
+      {0x8bfbea76c619ef36, 0x57eb4edb3c55b65b},
+      {0xaefae51477a06b03, 0xede622920b6b23f2},
+      {0xdab99e59958885c4, 0xe95fab368e45ecee},
+      {0x88b402f7fd75539b, 0x11dbcb0218ebb415},
+      {0xaae103b5fcd2a881, 0xd652bdc29f26a11a},
+      {0xd59944a37c0752a2, 0x4be76d3346f04960},
+      {0x857fcae62d8493a5, 0x6f70a4400c562ddc},
+      {0xa6dfbd9fb8e5b88e, 0xcb4ccd500f6bb953},
+      {0xd097ad07a71f26b2, 0x7e2000a41346a7a8},
+      {0x825ecc24c873782f, 0x8ed400668c0c28c9},
+      {0xa2f67f2dfa90563b, 0x728900802f0f32fb},
+      {0xcbb41ef979346bca, 0x4f2b40a03ad2ffba},
+      {0xfea126b7d78186bc, 0xe2f610c84987bfa9},
+      {0x9f24b832e6b0f436, 0x0dd9ca7d2df4d7ca},
+      {0xc6ede63fa05d3143, 0x91503d1c79720dbc},
+      {0xf8a95fcf88747d94, 0x75a44c6397ce912b},
+      {0x9b69dbe1b548ce7c, 0xc986afbe3ee11abb},
+      {0xc24452da229b021b, 0xfbe85badce996169},
+      {0xf2d56790ab41c2a2, 0xfae27299423fb9c4},
+      {0x97c560ba6b0919a5, 0xdccd879fc967d41b},
+      {0xbdb6b8e905cb600f, 0x5400e987bbc1c921},
+      {0xed246723473e3813, 0x290123e9aab23b69},
+      {0x9436c0760c86e30b, 0xf9a0b6720aaf6522},
+      {0xb94470938fa89bce, 0xf808e40e8d5b3e6a},
+      {0xe7958cb87392c2c2, 0xb60b1d1230b20e05},
+      {0x90bd77f3483bb9b9, 0xb1c6f22b5e6f48c3},
+      {0xb4ecd5f01a4aa828, 0x1e38aeb6360b1af4},
+      {0xe2280b6c20dd5232, 0x25c6da63c38de1b1},
+      {0x8d590723948a535f, 0x579c487e5a38ad0f},
+      {0xb0af48ec79ace837, 0x2d835a9df0c6d852},
+      {0xdcdb1b2798182244, 0xf8e431456cf88e66},
+      {0x8a08f0f8bf0f156b, 0x1b8e9ecb641b5900},
+      {0xac8b2d36eed2dac5, 0xe272467e3d222f40},
+      {0xd7adf884aa879177, 0x5b0ed81dcc6abb10},
+      {0x86ccbb52ea94baea, 0x98e947129fc2b4ea},
+      {0xa87fea27a539e9a5, 0x3f2398d747b36225},
+      {0xd29fe4b18e88640e, 0x8eec7f0d19a03aae},
+      {0x83a3eeeef9153e89, 0x1953cf68300424ad},
+      {0xa48ceaaab75a8e2b, 0x5fa8c3423c052dd8},
+      {0xcdb02555653131b6, 0x3792f412cb06794e},
+      {0x808e17555f3ebf11, 0xe2bbd88bbee40bd1},
+      {0xa0b19d2ab70e6ed6, 0x5b6aceaeae9d0ec5},
+      {0xc8de047564d20a8b, 0xf245825a5a445276},
+      {0xfb158592be068d2e, 0xeed6e2f0f0d56713},
+      {0x9ced737bb6c4183d, 0x55464dd69685606c},
+      {0xc428d05aa4751e4c, 0xaa97e14c3c26b887},
+      {0xf53304714d9265df, 0xd53dd99f4b3066a9},
+      {0x993fe2c6d07b7fab, 0xe546a8038efe402a},
+      {0xbf8fdb78849a5f96, 0xde98520472bdd034},
+      {0xef73d256a5c0f77c, 0x963e66858f6d4441},
+      {0x95a8637627989aad, 0xdde7001379a44aa9},
+      {0xbb127c53b17ec159, 0x5560c018580d5d53},
+      {0xe9d71b689dde71af, 0xaab8f01e6e10b4a7},
+      {0x9226712162ab070d, 0xcab3961304ca70e9},
+      {0xb6b00d69bb55c8d1, 0x3d607b97c5fd0d23},
+      {0xe45c10c42a2b3b05, 0x8cb89a7db77c506b},
+      {0x8eb98a7a9a5b04e3, 0x77f3608e92adb243},
+      {0xb267ed1940f1c61c, 0x55f038b237591ed4},
+      {0xdf01e85f912e37a3, 0x6b6c46dec52f6689},
+      {0x8b61313bbabce2c6, 0x2323ac4b3b3da016},
+      {0xae397d8aa96c1b77, 0xabec975e0a0d081b},
+      {0xd9c7dced53c72255, 0x96e7bd358c904a22},
+      {0x881cea14545c7575, 0x7e50d64177da2e55},
+      {0xaa242499697392d2, 0xdde50bd1d5d0b9ea},
+      {0xd4ad2dbfc3d07787, 0x955e4ec64b44e865},
+      {0x84ec3c97da624ab4, 0xbd5af13bef0b113f},
+      {0xa6274bbdd0fadd61, 0xecb1ad8aeacdd58f},
+      {0xcfb11ead453994ba, 0x67de18eda5814af3},
+      {0x81ceb32c4b43fcf4, 0x80eacf948770ced8},
+      {0xa2425ff75e14fc31, 0xa1258379a94d028e},
+      {0xcad2f7f5359a3b3e, 0x096ee45813a04331},
+      {0xfd87b5f28300ca0d, 0x8bca9d6e188853fd},
+      {0x9e74d1b791e07e48, 0x775ea264cf55347e},
+      {0xc612062576589dda, 0x95364afe032a819e},
+      {0xf79687aed3eec551, 0x3a83ddbd83f52205},
+      {0x9abe14cd44753b52, 0xc4926a9672793543},
+      {0xc16d9a0095928a27, 0x75b7053c0f178294},
+      {0xf1c90080baf72cb1, 0x5324c68b12dd6339},
+      {0x971da05074da7bee, 0xd3f6fc16ebca5e04},
+      {0xbce5086492111aea, 0x88f4bb1ca6bcf585},
+      {0xec1e4a7db69561a5, 0x2b31e9e3d06c32e6},
+      {0x9392ee8e921d5d07, 0x3aff322e62439fd0},
+      {0xb877aa3236a4b449, 0x09befeb9fad487c3},
+      {0xe69594bec44de15b, 0x4c2ebe687989a9b4},
+      {0x901d7cf73ab0acd9, 0x0f9d37014bf60a11},
+      {0xb424dc35095cd80f, 0x538484c19ef38c95},
+      {0xe12e13424bb40e13, 0x2865a5f206b06fba},
+      {0x8cbccc096f5088cb, 0xf93f87b7442e45d4},
+      {0xafebff0bcb24aafe, 0xf78f69a51539d749},
+      {0xdbe6fecebdedd5be, 0xb573440e5a884d1c},
+      {0x89705f4136b4a597, 0x31680a88f8953031},
+      {0xabcc77118461cefc, 0xfdc20d2b36ba7c3e},
+      {0xd6bf94d5e57a42bc, 0x3d32907604691b4d},
+      {0x8637bd05af6c69b5, 0xa63f9a49c2c1b110},
+      {0xa7c5ac471b478423, 0x0fcf80dc33721d54},
+      {0xd1b71758e219652b, 0xd3c36113404ea4a9},
+      {0x83126e978d4fdf3b, 0x645a1cac083126ea},
+      {0xa3d70a3d70a3d70a, 0x3d70a3d70a3d70a4},
+      {0xcccccccccccccccc, 0xcccccccccccccccd},
+      {0x8000000000000000, 0x0000000000000000},
+      {0xa000000000000000, 0x0000000000000000},
+      {0xc800000000000000, 0x0000000000000000},
+      {0xfa00000000000000, 0x0000000000000000},
+      {0x9c40000000000000, 0x0000000000000000},
+      {0xc350000000000000, 0x0000000000000000},
+      {0xf424000000000000, 0x0000000000000000},
+      {0x9896800000000000, 0x0000000000000000},
+      {0xbebc200000000000, 0x0000000000000000},
+      {0xee6b280000000000, 0x0000000000000000},
+      {0x9502f90000000000, 0x0000000000000000},
+      {0xba43b74000000000, 0x0000000000000000},
+      {0xe8d4a51000000000, 0x0000000000000000},
+      {0x9184e72a00000000, 0x0000000000000000},
+      {0xb5e620f480000000, 0x0000000000000000},
+      {0xe35fa931a0000000, 0x0000000000000000},
+      {0x8e1bc9bf04000000, 0x0000000000000000},
+      {0xb1a2bc2ec5000000, 0x0000000000000000},
+      {0xde0b6b3a76400000, 0x0000000000000000},
+      {0x8ac7230489e80000, 0x0000000000000000},
+      {0xad78ebc5ac620000, 0x0000000000000000},
+      {0xd8d726b7177a8000, 0x0000000000000000},
+      {0x878678326eac9000, 0x0000000000000000},
+      {0xa968163f0a57b400, 0x0000000000000000},
+      {0xd3c21bcecceda100, 0x0000000000000000},
+      {0x84595161401484a0, 0x0000000000000000},
+      {0xa56fa5b99019a5c8, 0x0000000000000000},
+      {0xcecb8f27f4200f3a, 0x0000000000000000},
+      {0x813f3978f8940984, 0x4000000000000000},
+      {0xa18f07d736b90be5, 0x5000000000000000},
+      {0xc9f2c9cd04674ede, 0xa400000000000000},
+      {0xfc6f7c4045812296, 0x4d00000000000000},
+      {0x9dc5ada82b70b59d, 0xf020000000000000},
+      {0xc5371912364ce305, 0x6c28000000000000},
+      {0xf684df56c3e01bc6, 0xc732000000000000},
+      {0x9a130b963a6c115c, 0x3c7f400000000000},
+      {0xc097ce7bc90715b3, 0x4b9f100000000000},
+      {0xf0bdc21abb48db20, 0x1e86d40000000000},
+      {0x96769950b50d88f4, 0x1314448000000000},
+      {0xbc143fa4e250eb31, 0x17d955a000000000},
+      {0xeb194f8e1ae525fd, 0x5dcfab0800000000},
+      {0x92efd1b8d0cf37be, 0x5aa1cae500000000},
+      {0xb7abc627050305ad, 0xf14a3d9e40000000},
+      {0xe596b7b0c643c719, 0x6d9ccd05d0000000},
+      {0x8f7e32ce7bea5c6f, 0xe4820023a2000000},
+      {0xb35dbf821ae4f38b, 0xdda2802c8a800000},
+      {0xe0352f62a19e306e, 0xd50b2037ad200000},
+      {0x8c213d9da502de45, 0x4526f422cc340000},
+      {0xaf298d050e4395d6, 0x9670b12b7f410000},
+      {0xdaf3f04651d47b4c, 0x3c0cdd765f114000},
+      {0x88d8762bf324cd0f, 0xa5880a69fb6ac800},
+      {0xab0e93b6efee0053, 0x8eea0d047a457a00},
+      {0xd5d238a4abe98068, 0x72a4904598d6d880},
+      {0x85a36366eb71f041, 0x47a6da2b7f864750},
+      {0xa70c3c40a64e6c51, 0x999090b65f67d924},
+      {0xd0cf4b50cfe20765, 0xfff4b4e3f741cf6d},
+      {0x82818f1281ed449f, 0xbff8f10e7a8921a5},
+      {0xa321f2d7226895c7, 0xaff72d52192b6a0e},
+      {0xcbea6f8ceb02bb39, 0x9bf4f8a69f764491},
+      {0xfee50b7025c36a08, 0x02f236d04753d5b5},
+      {0x9f4f2726179a2245, 0x01d762422c946591},
+      {0xc722f0ef9d80aad6, 0x424d3ad2b7b97ef6},
+      {0xf8ebad2b84e0d58b, 0xd2e0898765a7deb3},
+      {0x9b934c3b330c8577, 0x63cc55f49f88eb30},
+      {0xc2781f49ffcfa6d5, 0x3cbf6b71c76b25fc},
+      {0xf316271c7fc3908a, 0x8bef464e3945ef7b},
+      {0x97edd871cfda3a56, 0x97758bf0e3cbb5ad},
+      {0xbde94e8e43d0c8ec, 0x3d52eeed1cbea318},
+      {0xed63a231d4c4fb27, 0x4ca7aaa863ee4bde},
+      {0x945e455f24fb1cf8, 0x8fe8caa93e74ef6b},
+      {0xb975d6b6ee39e436, 0xb3e2fd538e122b45},
+      {0xe7d34c64a9c85d44, 0x60dbbca87196b617},
+      {0x90e40fbeea1d3a4a, 0xbc8955e946fe31ce},
+      {0xb51d13aea4a488dd, 0x6babab6398bdbe42},
+      {0xe264589a4dcdab14, 0xc696963c7eed2dd2},
+      {0x8d7eb76070a08aec, 0xfc1e1de5cf543ca3},
+      {0xb0de65388cc8ada8, 0x3b25a55f43294bcc},
+      {0xdd15fe86affad912, 0x49ef0eb713f39ebf},
+      {0x8a2dbf142dfcc7ab, 0x6e3569326c784338},
+      {0xacb92ed9397bf996, 0x49c2c37f07965405},
+      {0xd7e77a8f87daf7fb, 0xdc33745ec97be907},
+      {0x86f0ac99b4e8dafd, 0x69a028bb3ded71a4},
+      {0xa8acd7c0222311bc, 0xc40832ea0d68ce0d},
+      {0xd2d80db02aabd62b, 0xf50a3fa490c30191},
+      {0x83c7088e1aab65db, 0x792667c6da79e0fb},
+      {0xa4b8cab1a1563f52, 0x577001b891185939},
+      {0xcde6fd5e09abcf26, 0xed4c0226b55e6f87},
+      {0x80b05e5ac60b6178, 0x544f8158315b05b5},
+      {0xa0dc75f1778e39d6, 0x696361ae3db1c722},
+      {0xc913936dd571c84c, 0x03bc3a19cd1e38ea},
+      {0xfb5878494ace3a5f, 0x04ab48a04065c724},
+      {0x9d174b2dcec0e47b, 0x62eb0d64283f9c77},
+      {0xc45d1df942711d9a, 0x3ba5d0bd324f8395},
+      {0xf5746577930d6500, 0xca8f44ec7ee3647a},
+      {0x9968bf6abbe85f20, 0x7e998b13cf4e1ecc},
+      {0xbfc2ef456ae276e8, 0x9e3fedd8c321a67f},
+      {0xefb3ab16c59b14a2, 0xc5cfe94ef3ea101f},
+      {0x95d04aee3b80ece5, 0xbba1f1d158724a13},
+      {0xbb445da9ca61281f, 0x2a8a6e45ae8edc98},
+      {0xea1575143cf97226, 0xf52d09d71a3293be},
+      {0x924d692ca61be758, 0x593c2626705f9c57},
+      {0xb6e0c377cfa2e12e, 0x6f8b2fb00c77836d},
+      {0xe498f455c38b997a, 0x0b6dfb9c0f956448},
+      {0x8edf98b59a373fec, 0x4724bd4189bd5ead},
+      {0xb2977ee300c50fe7, 0x58edec91ec2cb658},
+      {0xdf3d5e9bc0f653e1, 0x2f2967b66737e3ee},
+      {0x8b865b215899f46c, 0xbd79e0d20082ee75},
+      {0xae67f1e9aec07187, 0xecd8590680a3aa12},
+      {0xda01ee641a708de9, 0xe80e6f4820cc9496},
+      {0x884134fe908658b2, 0x3109058d147fdcde},
+      {0xaa51823e34a7eede, 0xbd4b46f0599fd416},
+      {0xd4e5e2cdc1d1ea96, 0x6c9e18ac7007c91b},
+      {0x850fadc09923329e, 0x03e2cf6bc604ddb1},
+      {0xa6539930bf6bff45, 0x84db8346b786151d},
+      {0xcfe87f7cef46ff16, 0xe612641865679a64},
+      {0x81f14fae158c5f6e, 0x4fcb7e8f3f60c07f},
+      {0xa26da3999aef7749, 0xe3be5e330f38f09e},
+      {0xcb090c8001ab551c, 0x5cadf5bfd3072cc6},
+      {0xfdcb4fa002162a63, 0x73d9732fc7c8f7f7},
+      {0x9e9f11c4014dda7e, 0x2867e7fddcdd9afb},
+      {0xc646d63501a1511d, 0xb281e1fd541501b9},
+      {0xf7d88bc24209a565, 0x1f225a7ca91a4227},
+      {0x9ae757596946075f, 0x3375788de9b06959},
+      {0xc1a12d2fc3978937, 0x0052d6b1641c83af},
+      {0xf209787bb47d6b84, 0xc0678c5dbd23a49b},
+      {0x9745eb4d50ce6332, 0xf840b7ba963646e1},
+      {0xbd176620a501fbff, 0xb650e5a93bc3d899},
+      {0xec5d3fa8ce427aff, 0xa3e51f138ab4cebf},
+      {0x93ba47c980e98cdf, 0xc66f336c36b10138},
+      {0xb8a8d9bbe123f017, 0xb80b0047445d4185},
+      {0xe6d3102ad96cec1d, 0xa60dc059157491e6},
+      {0x9043ea1ac7e41392, 0x87c89837ad68db30},
+      {0xb454e4a179dd1877, 0x29babe4598c311fc},
+      {0xe16a1dc9d8545e94, 0xf4296dd6fef3d67b},
+      {0x8ce2529e2734bb1d, 0x1899e4a65f58660d},
+      {0xb01ae745b101e9e4, 0x5ec05dcff72e7f90},
+      {0xdc21a1171d42645d, 0x76707543f4fa1f74},
+      {0x899504ae72497eba, 0x6a06494a791c53a9},
+      {0xabfa45da0edbde69, 0x0487db9d17636893},
+      {0xd6f8d7509292d603, 0x45a9d2845d3c42b7},
+      {0x865b86925b9bc5c2, 0x0b8a2392ba45a9b3},
+      {0xa7f26836f282b732, 0x8e6cac7768d7141f},
+      {0xd1ef0244af2364ff, 0x3207d795430cd927},
+      {0x8335616aed761f1f, 0x7f44e6bd49e807b9},
+      {0xa402b9c5a8d3a6e7, 0x5f16206c9c6209a7},
+      {0xcd036837130890a1, 0x36dba887c37a8c10},
+      {0x802221226be55a64, 0xc2494954da2c978a},
+      {0xa02aa96b06deb0fd, 0xf2db9baa10b7bd6d},
+      {0xc83553c5c8965d3d, 0x6f92829494e5acc8},
+      {0xfa42a8b73abbf48c, 0xcb772339ba1f17fa},
+      {0x9c69a97284b578d7, 0xff2a760414536efc},
+      {0xc38413cf25e2d70d, 0xfef5138519684abb},
+      {0xf46518c2ef5b8cd1, 0x7eb258665fc25d6a},
+      {0x98bf2f79d5993802, 0xef2f773ffbd97a62},
+      {0xbeeefb584aff8603, 0xaafb550ffacfd8fb},
+      {0xeeaaba2e5dbf6784, 0x95ba2a53f983cf39},
+      {0x952ab45cfa97a0b2, 0xdd945a747bf26184},
+      {0xba756174393d88df, 0x94f971119aeef9e5},
+      {0xe912b9d1478ceb17, 0x7a37cd5601aab85e},
+      {0x91abb422ccb812ee, 0xac62e055c10ab33b},
+      {0xb616a12b7fe617aa, 0x577b986b314d600a},
+      {0xe39c49765fdf9d94, 0xed5a7e85fda0b80c},
+      {0x8e41ade9fbebc27d, 0x14588f13be847308},
+      {0xb1d219647ae6b31c, 0x596eb2d8ae258fc9},
+      {0xde469fbd99a05fe3, 0x6fca5f8ed9aef3bc},
+      {0x8aec23d680043bee, 0x25de7bb9480d5855},
+      {0xada72ccc20054ae9, 0xaf561aa79a10ae6b},
+      {0xd910f7ff28069da4, 0x1b2ba1518094da05},
+      {0x87aa9aff79042286, 0x90fb44d2f05d0843},
+      {0xa99541bf57452b28, 0x353a1607ac744a54},
+      {0xd3fa922f2d1675f2, 0x42889b8997915ce9},
+      {0x847c9b5d7c2e09b7, 0x69956135febada12},
+      {0xa59bc234db398c25, 0x43fab9837e699096},
+      {0xcf02b2c21207ef2e, 0x94f967e45e03f4bc},
+      {0x8161afb94b44f57d, 0x1d1be0eebac278f6},
+      {0xa1ba1ba79e1632dc, 0x6462d92a69731733},
+      {0xca28a291859bbf93, 0x7d7b8f7503cfdcff},
+      {0xfcb2cb35e702af78, 0x5cda735244c3d43f},
+      {0x9defbf01b061adab, 0x3a0888136afa64a8},
+      {0xc56baec21c7a1916, 0x088aaa1845b8fdd1},
+      {0xf6c69a72a3989f5b, 0x8aad549e57273d46},
+      {0x9a3c2087a63f6399, 0x36ac54e2f678864c},
+      {0xc0cb28a98fcf3c7f, 0x84576a1bb416a7de},
+      {0xf0fdf2d3f3c30b9f, 0x656d44a2a11c51d6},
+      {0x969eb7c47859e743, 0x9f644ae5a4b1b326},
+      {0xbc4665b596706114, 0x873d5d9f0dde1fef},
+      {0xeb57ff22fc0c7959, 0xa90cb506d155a7eb},
+      {0x9316ff75dd87cbd8, 0x09a7f12442d588f3},
+      {0xb7dcbf5354e9bece, 0x0c11ed6d538aeb30},
+      {0xe5d3ef282a242e81, 0x8f1668c8a86da5fb},
+      {0x8fa475791a569d10, 0xf96e017d694487bd},
+      {0xb38d92d760ec4455, 0x37c981dcc395a9ad},
+      {0xe070f78d3927556a, 0x85bbe253f47b1418},
+      {0x8c469ab843b89562, 0x93956d7478ccec8f},
+      {0xaf58416654a6babb, 0x387ac8d1970027b3},
+      {0xdb2e51bfe9d0696a, 0x06997b05fcc0319f},
+      {0x88fcf317f22241e2, 0x441fece3bdf81f04},
+      {0xab3c2fddeeaad25a, 0xd527e81cad7626c4},
+      {0xd60b3bd56a5586f1, 0x8a71e223d8d3b075},
+      {0x85c7056562757456, 0xf6872d5667844e4a},
+      {0xa738c6bebb12d16c, 0xb428f8ac016561dc},
+      {0xd106f86e69d785c7, 0xe13336d701beba53},
+      {0x82a45b450226b39c, 0xecc0024661173474},
+      {0xa34d721642b06084, 0x27f002d7f95d0191},
+      {0xcc20ce9bd35c78a5, 0x31ec038df7b441f5},
+      {0xff290242c83396ce, 0x7e67047175a15272},
+      {0x9f79a169bd203e41, 0x0f0062c6e984d387},
+      {0xc75809c42c684dd1, 0x52c07b78a3e60869},
+      {0xf92e0c3537826145, 0xa7709a56ccdf8a83},
+      {0x9bbcc7a142b17ccb, 0x88a66076400bb692},
+      {0xc2abf989935ddbfe, 0x6acff893d00ea436},
+      {0xf356f7ebf83552fe, 0x0583f6b8c4124d44},
+      {0x98165af37b2153de, 0xc3727a337a8b704b},
+      {0xbe1bf1b059e9a8d6, 0x744f18c0592e4c5d},
+      {0xeda2ee1c7064130c, 0x1162def06f79df74},
+      {0x9485d4d1c63e8be7, 0x8addcb5645ac2ba9},
+      {0xb9a74a0637ce2ee1, 0x6d953e2bd7173693},
+      {0xe8111c87c5c1ba99, 0xc8fa8db6ccdd0438},
+      {0x910ab1d4db9914a0, 0x1d9c9892400a22a3},
+      {0xb54d5e4a127f59c8, 0x2503beb6d00cab4c},
+      {0xe2a0b5dc971f303a, 0x2e44ae64840fd61e},
+      {0x8da471a9de737e24, 0x5ceaecfed289e5d3},
+      {0xb10d8e1456105dad, 0x7425a83e872c5f48},
+      {0xdd50f1996b947518, 0xd12f124e28f7771a},
+      {0x8a5296ffe33cc92f, 0x82bd6b70d99aaa70},
+      {0xace73cbfdc0bfb7b, 0x636cc64d1001550c},
+      {0xd8210befd30efa5a, 0x3c47f7e05401aa4f},
+      {0x8714a775e3e95c78, 0x65acfaec34810a72},
+      {0xa8d9d1535ce3b396, 0x7f1839a741a14d0e},
+      {0xd31045a8341ca07c, 0x1ede48111209a051},
+      {0x83ea2b892091e44d, 0x934aed0aab460433},
+      {0xa4e4b66b68b65d60, 0xf81da84d56178540},
+      {0xce1de40642e3f4b9, 0x36251260ab9d668f},
+      {0x80d2ae83e9ce78f3, 0xc1d72b7c6b42601a},
+      {0xa1075a24e4421730, 0xb24cf65b8612f820},
+      {0xc94930ae1d529cfc, 0xdee033f26797b628},
+      {0xfb9b7cd9a4a7443c, 0x169840ef017da3b2},
+      {0x9d412e0806e88aa5, 0x8e1f289560ee864f},
+      {0xc491798a08a2ad4e, 0xf1a6f2bab92a27e3},
+      {0xf5b5d7ec8acb58a2, 0xae10af696774b1dc},
+      {0x9991a6f3d6bf1765, 0xacca6da1e0a8ef2a},
+      {0xbff610b0cc6edd3f, 0x17fd090a58d32af4},
+      {0xeff394dcff8a948e, 0xddfc4b4cef07f5b1},
+      {0x95f83d0a1fb69cd9, 0x4abdaf101564f98f},
+      {0xbb764c4ca7a4440f, 0x9d6d1ad41abe37f2},
+      {0xea53df5fd18d5513, 0x84c86189216dc5ee},
+      {0x92746b9be2f8552c, 0x32fd3cf5b4e49bb5},
+      {0xb7118682dbb66a77, 0x3fbc8c33221dc2a2},
+      {0xe4d5e82392a40515, 0x0fabaf3feaa5334b},
+      {0x8f05b1163ba6832d, 0x29cb4d87f2a7400f},
+      {0xb2c71d5bca9023f8, 0x743e20e9ef511013},
+      {0xdf78e4b2bd342cf6, 0x914da9246b255417},
+      {0x8bab8eefb6409c1a, 0x1ad089b6c2f7548f},
+      {0xae9672aba3d0c320, 0xa184ac2473b529b2},
+      {0xda3c0f568cc4f3e8, 0xc9e5d72d90a2741f},
+      {0x8865899617fb1871, 0x7e2fa67c7a658893},
+      {0xaa7eebfb9df9de8d, 0xddbb901b98feeab8},
+      {0xd51ea6fa85785631, 0x552a74227f3ea566},
+      {0x8533285c936b35de, 0xd53a88958f872760},
+      {0xa67ff273b8460356, 0x8a892abaf368f138},
+      {0xd01fef10a657842c, 0x2d2b7569b0432d86},
+      {0x8213f56a67f6b29b, 0x9c3b29620e29fc74},
+      {0xa298f2c501f45f42, 0x8349f3ba91b47b90},
+      {0xcb3f2f7642717713, 0x241c70a936219a74},
+      {0xfe0efb53d30dd4d7, 0xed238cd383aa0111},
+      {0x9ec95d1463e8a506, 0xf4363804324a40ab},
+      {0xc67bb4597ce2ce48, 0xb143c6053edcd0d6},
+      {0xf81aa16fdc1b81da, 0xdd94b7868e94050b},
+      {0x9b10a4e5e9913128, 0xca7cf2b4191c8327},
+      {0xc1d4ce1f63f57d72, 0xfd1c2f611f63a3f1},
+      {0xf24a01a73cf2dccf, 0xbc633b39673c8ced},
+      {0x976e41088617ca01, 0xd5be0503e085d814},
+      {0xbd49d14aa79dbc82, 0x4b2d8644d8a74e19},
+      {0xec9c459d51852ba2, 0xddf8e7d60ed1219f},
+      {0x93e1ab8252f33b45, 0xcabb90e5c942b504},
+      {0xb8da1662e7b00a17, 0x3d6a751f3b936244},
+      {0xe7109bfba19c0c9d, 0x0cc512670a783ad5},
+      {0x906a617d450187e2, 0x27fb2b80668b24c6},
+      {0xb484f9dc9641e9da, 0xb1f9f660802dedf7},
+      {0xe1a63853bbd26451, 0x5e7873f8a0396974},
+      {0x8d07e33455637eb2, 0xdb0b487b6423e1e9},
+      {0xb049dc016abc5e5f, 0x91ce1a9a3d2cda63},
+      {0xdc5c5301c56b75f7, 0x7641a140cc7810fc},
+      {0x89b9b3e11b6329ba, 0xa9e904c87fcb0a9e},
+      {0xac2820d9623bf429, 0x546345fa9fbdcd45},
+      {0xd732290fbacaf133, 0xa97c177947ad4096},
+      {0x867f59a9d4bed6c0, 0x49ed8eabcccc485e},
+      {0xa81f301449ee8c70, 0x5c68f256bfff5a75},
+      {0xd226fc195c6a2f8c, 0x73832eec6fff3112},
+      {0x83585d8fd9c25db7, 0xc831fd53c5ff7eac},
+      {0xa42e74f3d032f525, 0xba3e7ca8b77f5e56},
+      {0xcd3a1230c43fb26f, 0x28ce1bd2e55f35ec},
+      {0x80444b5e7aa7cf85, 0x7980d163cf5b81b4},
+      {0xa0555e361951c366, 0xd7e105bcc3326220},
+      {0xc86ab5c39fa63440, 0x8dd9472bf3fefaa8},
+      {0xfa856334878fc150, 0xb14f98f6f0feb952},
+      {0x9c935e00d4b9d8d2, 0x6ed1bf9a569f33d4},
+      {0xc3b8358109e84f07, 0x0a862f80ec4700c9},
+      {0xf4a642e14c6262c8, 0xcd27bb612758c0fb},
+      {0x98e7e9cccfbd7dbd, 0x8038d51cb897789d},
+      {0xbf21e44003acdd2c, 0xe0470a63e6bd56c4},
+      {0xeeea5d5004981478, 0x1858ccfce06cac75},
+      {0x95527a5202df0ccb, 0x0f37801e0c43ebc9},
+      {0xbaa718e68396cffd, 0xd30560258f54e6bb},
+      {0xe950df20247c83fd, 0x47c6b82ef32a206a},
+      {0x91d28b7416cdd27e, 0x4cdc331d57fa5442},
+      {0xb6472e511c81471d, 0xe0133fe4adf8e953},
+      {0xe3d8f9e563a198e5, 0x58180fddd97723a7},
+      {0x8e679c2f5e44ff8f, 0x570f09eaa7ea7649},
+      {0xb201833b35d63f73, 0x2cd2cc6551e513db},
+      {0xde81e40a034bcf4f, 0xf8077f7ea65e58d2},
+      {0x8b112e86420f6191, 0xfb04afaf27faf783},
+      {0xadd57a27d29339f6, 0x79c5db9af1f9b564},
+      {0xd94ad8b1c7380874, 0x18375281ae7822bd},
+      {0x87cec76f1c830548, 0x8f2293910d0b15b6},
+      {0xa9c2794ae3a3c69a, 0xb2eb3875504ddb23},
+      {0xd433179d9c8cb841, 0x5fa60692a46151ec},
+      {0x849feec281d7f328, 0xdbc7c41ba6bcd334},
+      {0xa5c7ea73224deff3, 0x12b9b522906c0801},
+      {0xcf39e50feae16bef, 0xd768226b34870a01},
+      {0x81842f29f2cce375, 0xe6a1158300d46641},
+      {0xa1e53af46f801c53, 0x60495ae3c1097fd1},
+      {0xca5e89b18b602368, 0x385bb19cb14bdfc5},
+      {0xfcf62c1dee382c42, 0x46729e03dd9ed7b6},
+      {0x9e19db92b4e31ba9, 0x6c07a2c26a8346d2},
+      {0xc5a05277621be293, 0xc7098b7305241886},
+      {0xf70867153aa2db38, 0xb8cbee4fc66d1ea8},
+      {0x9a65406d44a5c903, 0x737f74f1dc043329},
+      {0xc0fe908895cf3b44, 0x505f522e53053ff3},
+      {0xf13e34aabb430a15, 0x647726b9e7c68ff0},
+      {0x96c6e0eab509e64d, 0x5eca783430dc19f6},
+      {0xbc789925624c5fe0, 0xb67d16413d132073},
+      {0xeb96bf6ebadf77d8, 0xe41c5bd18c57e890},
+      {0x933e37a534cbaae7, 0x8e91b962f7b6f15a},
+      {0xb80dc58e81fe95a1, 0x723627bbb5a4adb1},
+      {0xe61136f2227e3b09, 0xcec3b1aaa30dd91d},
+      {0x8fcac257558ee4e6, 0x213a4f0aa5e8a7b2},
+      {0xb3bd72ed2af29e1f, 0xa988e2cd4f62d19e},
+      {0xe0accfa875af45a7, 0x93eb1b80a33b8606},
+      {0x8c6c01c9498d8b88, 0xbc72f130660533c4},
+      {0xaf87023b9bf0ee6a, 0xeb8fad7c7f8680b5},
+      {0xdb68c2ca82ed2a05, 0xa67398db9f6820e2},
+#else
+      {0xff77b1fcbebcdc4f, 0x25e8e89c13bb0f7b},
+      {0xce5d73ff402d98e3, 0xfb0a3d212dc81290},
+      {0xa6b34ad8c9dfc06f, 0xf42faa48c0ea481f},
+      {0x86a8d39ef77164bc, 0xae5dff9c02033198},
+      {0xd98ddaee19068c76, 0x3badd624dd9b0958},
+      {0xafbd2350644eeacf, 0xe5d1929ef90898fb},
+      {0x8df5efabc5979c8f, 0xca8d3ffa1ef463c2},
+      {0xe55990879ddcaabd, 0xcc420a6a101d0516},
+      {0xb94470938fa89bce, 0xf808e40e8d5b3e6a},
+      {0x95a8637627989aad, 0xdde7001379a44aa9},
+      {0xf1c90080baf72cb1, 0x5324c68b12dd6339},
+      {0xc350000000000000, 0x0000000000000000},
+      {0x9dc5ada82b70b59d, 0xf020000000000000},
+      {0xfee50b7025c36a08, 0x02f236d04753d5b5},
+      {0xcde6fd5e09abcf26, 0xed4c0226b55e6f87},
+      {0xa6539930bf6bff45, 0x84db8346b786151d},
+      {0x865b86925b9bc5c2, 0x0b8a2392ba45a9b3},
+      {0xd910f7ff28069da4, 0x1b2ba1518094da05},
+      {0xaf58416654a6babb, 0x387ac8d1970027b3},
+      {0x8da471a9de737e24, 0x5ceaecfed289e5d3},
+      {0xe4d5e82392a40515, 0x0fabaf3feaa5334b},
+      {0xb8da1662e7b00a17, 0x3d6a751f3b936244},
+      {0x95527a5202df0ccb, 0x0f37801e0c43ebc9},
+      {0xf13e34aabb430a15, 0x647726b9e7c68ff0}
+#endif
+    };
+
+#if FMT_USE_FULL_CACHE_DRAGONBOX
+    return pow10_significands[k - float_info<double>::min_k];
+#else
+    static constexpr const uint64_t powers_of_5_64[] = {
+        0x0000000000000001, 0x0000000000000005, 0x0000000000000019,
+        0x000000000000007d, 0x0000000000000271, 0x0000000000000c35,
+        0x0000000000003d09, 0x000000000001312d, 0x000000000005f5e1,
+        0x00000000001dcd65, 0x00000000009502f9, 0x0000000002e90edd,
+        0x000000000e8d4a51, 0x0000000048c27395, 0x000000016bcc41e9,
+        0x000000071afd498d, 0x0000002386f26fc1, 0x000000b1a2bc2ec5,
+        0x000003782dace9d9, 0x00001158e460913d, 0x000056bc75e2d631,
+        0x0001b1ae4d6e2ef5, 0x000878678326eac9, 0x002a5a058fc295ed,
+        0x00d3c21bcecceda1, 0x0422ca8b0a00a425, 0x14adf4b7320334b9};
+
+    static const int compression_ratio = 27;
+
+    // Compute base index.
+    int cache_index = (k - float_info<double>::min_k) / compression_ratio;
+    int kb = cache_index * compression_ratio + float_info<double>::min_k;
+    int offset = k - kb;
+
+    // Get base cache.
+    uint128_fallback base_cache = pow10_significands[cache_index];
+    if (offset == 0) return base_cache;
+
+    // Compute the required amount of bit-shift.
+    int alpha = floor_log2_pow10(kb + offset) - floor_log2_pow10(kb) - offset;
+    FMT_ASSERT(alpha > 0 && alpha < 64, "shifting error detected");
+
+    // Try to recover the real cache.
+    uint64_t pow5 = powers_of_5_64[offset];
+    uint128_fallback recovered_cache = umul128(base_cache.high(), pow5);
+    uint128_fallback middle_low = umul128(base_cache.low(), pow5);
+
+    recovered_cache += middle_low.high();
+
+    uint64_t high_to_middle = recovered_cache.high() << (64 - alpha);
+    uint64_t middle_to_low = recovered_cache.low() << (64 - alpha);
+
+    recovered_cache =
+        uint128_fallback{(recovered_cache.low() >> alpha) | high_to_middle,
+                         ((middle_low.low() >> alpha) | middle_to_low)};
+    FMT_ASSERT(recovered_cache.low() + 1 != 0, "");
+    return {recovered_cache.high(), recovered_cache.low() + 1};
+#endif
+  }
+
+  struct compute_mul_result {
+    carrier_uint result;
+    bool is_integer;
+  };
+  struct compute_mul_parity_result {
+    bool parity;
+    bool is_integer;
+  };
+
+  static auto compute_mul(carrier_uint u,
+                          const cache_entry_type& cache) noexcept
+      -> compute_mul_result {
+    auto r = umul192_upper128(u, cache);
+    return {r.high(), r.low() == 0};
+  }
+
+  static auto compute_delta(cache_entry_type const& cache, int beta) noexcept
+      -> uint32_t {
+    return static_cast<uint32_t>(cache.high() >> (64 - 1 - beta));
+  }
+
+  static auto compute_mul_parity(carrier_uint two_f,
+                                 const cache_entry_type& cache,
+                                 int beta) noexcept
+      -> compute_mul_parity_result {
+    FMT_ASSERT(beta >= 1, "");
+    FMT_ASSERT(beta < 64, "");
+
+    auto r = umul192_lower128(two_f, cache);
+    return {((r.high() >> (64 - beta)) & 1) != 0,
+            ((r.high() << beta) | (r.low() >> (64 - beta))) == 0};
+  }
+
+  static auto compute_left_endpoint_for_shorter_interval_case(
+      const cache_entry_type& cache, int beta) noexcept -> carrier_uint {
+    return (cache.high() -
+            (cache.high() >> (num_significand_bits<double>() + 2))) >>
+           (64 - num_significand_bits<double>() - 1 - beta);
+  }
+
+  static auto compute_right_endpoint_for_shorter_interval_case(
+      const cache_entry_type& cache, int beta) noexcept -> carrier_uint {
+    return (cache.high() +
+            (cache.high() >> (num_significand_bits<double>() + 1))) >>
+           (64 - num_significand_bits<double>() - 1 - beta);
+  }
+
+  static auto compute_round_up_for_shorter_interval_case(
+      const cache_entry_type& cache, int beta) noexcept -> carrier_uint {
+    return ((cache.high() >> (64 - num_significand_bits<double>() - 2 - beta)) +
+            1) /
+           2;
+  }
 };
 
-// Binary exponents of pow(10, k), for k = -348, -340, ..., 340, corresponding
-// to significands above.
-template <typename T>
-const int16_t basic_data<T>::pow10_exponents[] = {
-    -1220, -1193, -1166, -1140, -1113, -1087, -1060, -1034, -1007, -980, -954, -927, -901, -874, -847, -821, -794, -768,
-    -741,  -715,  -688,  -661,  -635,  -608,  -582,  -555,  -529,  -502, -475, -449, -422, -396, -369, -343, -316, -289,
-    -263,  -236,  -210,  -183,  -157,  -130,  -103,  -77,   -50,   -24,  3,    30,   56,   83,   109,  136,  162,  189,
-    216,   242,   269,   295,   322,   348,   375,   402,   428,   455,  481,  508,  534,  561,  588,  614,  641,  667,
-    694,   720,   747,   774,   800,   827,   853,   880,   907,   933,  960,  986,  1013, 1039, 1066};
+FMT_FUNC auto get_cached_power(int k) noexcept -> uint128_fallback {
+  return cache_accessor<double>::get_cached_power(k);
+}
 
+// Various integer checks
 template <typename T>
-const char basic_data<T>::foreground_color[] = "\x1b[38;2;";
-template <typename T>
-const char basic_data<T>::background_color[] = "\x1b[48;2;";
-template <typename T>
-const char basic_data<T>::reset_color[] = "\x1b[0m";
-template <typename T>
-const wchar_t basic_data<T>::wreset_color[] = L"\x1b[0m";
-template <typename T>
-const char basic_data<T>::signs[] = {0, '-', '+', ' '};
+auto is_left_endpoint_integer_shorter_interval(int exponent) noexcept -> bool {
+  const int case_shorter_interval_left_endpoint_lower_threshold = 2;
+  const int case_shorter_interval_left_endpoint_upper_threshold = 3;
+  return exponent >= case_shorter_interval_left_endpoint_lower_threshold &&
+         exponent <= case_shorter_interval_left_endpoint_upper_threshold;
+}
 
-template <typename T>
-struct bits {
-	static FMT_CONSTEXPR_DECL const int value =
-	    static_cast<int>(sizeof(T) * std::numeric_limits<unsigned char>::digits);
-};
+// Remove trailing zeros from n and return the number of zeros removed (float)
+FMT_INLINE int remove_trailing_zeros(uint32_t& n, int s = 0) noexcept {
+  FMT_ASSERT(n != 0, "");
+  // Modular inverse of 5 (mod 2^32): (mod_inv_5 * 5) mod 2^32 = 1.
+  constexpr uint32_t mod_inv_5 = 0xcccccccd;
+  constexpr uint32_t mod_inv_25 = 0xc28f5c29;  // = mod_inv_5 * mod_inv_5
+
+  while (true) {
+    auto q = rotr(n * mod_inv_25, 2);
+    if (q > max_value<uint32_t>() / 100) break;
+    n = q;
+    s += 2;
+  }
+  auto q = rotr(n * mod_inv_5, 1);
+  if (q <= max_value<uint32_t>() / 10) {
+    n = q;
+    s |= 1;
+  }
+  return s;
+}
 
-class fp;
+// Removes trailing zeros and returns the number of zeros removed (double)
+FMT_INLINE int remove_trailing_zeros(uint64_t& n) noexcept {
+  FMT_ASSERT(n != 0, "");
+
+  // This magic number is ceil(2^90 / 10^8).
+  constexpr uint64_t magic_number = 12379400392853802749ull;
+  auto nm = umul128(n, magic_number);
+
+  // Is n is divisible by 10^8?
+  if ((nm.high() & ((1ull << (90 - 64)) - 1)) == 0 && nm.low() < magic_number) {
+    // If yes, work with the quotient...
+    auto n32 = static_cast<uint32_t>(nm.high() >> (90 - 64));
+    // ... and use the 32 bit variant of the function
+    int s = remove_trailing_zeros(n32, 8);
+    n = n32;
+    return s;
+  }
+
+  // If n is not divisible by 10^8, work with n itself.
+  constexpr uint64_t mod_inv_5 = 0xcccccccccccccccd;
+  constexpr uint64_t mod_inv_25 = 0x8f5c28f5c28f5c29;  // mod_inv_5 * mod_inv_5
+
+  int s = 0;
+  while (true) {
+    auto q = rotr(n * mod_inv_25, 2);
+    if (q > max_value<uint64_t>() / 100) break;
+    n = q;
+    s += 2;
+  }
+  auto q = rotr(n * mod_inv_5, 1);
+  if (q <= max_value<uint64_t>() / 10) {
+    n = q;
+    s |= 1;
+  }
+
+  return s;
+}
 
-template <int SHIFT = 0>
-fp normalize(fp value);
+// The main algorithm for shorter interval case
+template <typename T>
+FMT_INLINE decimal_fp<T> shorter_interval_case(int exponent) noexcept {
+  decimal_fp<T> ret_value;
+  // Compute k and beta
+  const int minus_k = floor_log10_pow2_minus_log10_4_over_3(exponent);
+  const int beta = exponent + floor_log2_pow10(-minus_k);
+
+  // Compute xi and zi
+  using cache_entry_type = typename cache_accessor<T>::cache_entry_type;
+  const cache_entry_type cache = cache_accessor<T>::get_cached_power(-minus_k);
+
+  auto xi = cache_accessor<T>::compute_left_endpoint_for_shorter_interval_case(
+      cache, beta);
+  auto zi = cache_accessor<T>::compute_right_endpoint_for_shorter_interval_case(
+      cache, beta);
+
+  // If the left endpoint is not an integer, increase it
+  if (!is_left_endpoint_integer_shorter_interval<T>(exponent)) ++xi;
+
+  // Try bigger divisor
+  ret_value.significand = zi / 10;
+
+  // If succeed, remove trailing zeros if necessary and return
+  if (ret_value.significand * 10 >= xi) {
+    ret_value.exponent = minus_k + 1;
+    ret_value.exponent += remove_trailing_zeros(ret_value.significand);
+    return ret_value;
+  }
+
+  // Otherwise, compute the round-up of y
+  ret_value.significand =
+      cache_accessor<T>::compute_round_up_for_shorter_interval_case(cache,
+                                                                    beta);
+  ret_value.exponent = minus_k;
+
+  // When tie occurs, choose one of them according to the rule
+  if (exponent >= float_info<T>::shorter_interval_tie_lower_threshold &&
+      exponent <= float_info<T>::shorter_interval_tie_upper_threshold) {
+    ret_value.significand = ret_value.significand % 2 == 0
+                                ? ret_value.significand
+                                : ret_value.significand - 1;
+  } else if (ret_value.significand < xi) {
+    ++ret_value.significand;
+  }
+  return ret_value;
+}
 
-// Lower (upper) boundary is a value half way between a floating-point value
-// and its predecessor (successor). Boundaries have the same exponent as the
-// value so only significands are stored.
-struct boundaries {
-	uint64_t lower;
-	uint64_t upper;
+template <typename T> auto to_decimal(T x) noexcept -> decimal_fp<T> {
+  // Step 1: integer promotion & Schubfach multiplier calculation.
+
+  using carrier_uint = typename float_info<T>::carrier_uint;
+  using cache_entry_type = typename cache_accessor<T>::cache_entry_type;
+  auto br = bit_cast<carrier_uint>(x);
+
+  // Extract significand bits and exponent bits.
+  const carrier_uint significand_mask =
+      (static_cast<carrier_uint>(1) << num_significand_bits<T>()) - 1;
+  carrier_uint significand = (br & significand_mask);
+  int exponent =
+      static_cast<int>((br & exponent_mask<T>()) >> num_significand_bits<T>());
+
+  if (exponent != 0) {  // Check if normal.
+    exponent -= exponent_bias<T>() + num_significand_bits<T>();
+
+    // Shorter interval case; proceed like Schubfach.
+    // In fact, when exponent == 1 and significand == 0, the interval is
+    // regular. However, it can be shown that the end-results are anyway same.
+    if (significand == 0) return shorter_interval_case<T>(exponent);
+
+    significand |= (static_cast<carrier_uint>(1) << num_significand_bits<T>());
+  } else {
+    // Subnormal case; the interval is always regular.
+    if (significand == 0) return {0, 0};
+    exponent =
+        std::numeric_limits<T>::min_exponent - num_significand_bits<T>() - 1;
+  }
+
+  const bool include_left_endpoint = (significand % 2 == 0);
+  const bool include_right_endpoint = include_left_endpoint;
+
+  // Compute k and beta.
+  const int minus_k = floor_log10_pow2(exponent) - float_info<T>::kappa;
+  const cache_entry_type cache = cache_accessor<T>::get_cached_power(-minus_k);
+  const int beta = exponent + floor_log2_pow10(-minus_k);
+
+  // Compute zi and deltai.
+  // 10^kappa <= deltai < 10^(kappa + 1)
+  const uint32_t deltai = cache_accessor<T>::compute_delta(cache, beta);
+  const carrier_uint two_fc = significand << 1;
+
+  // For the case of binary32, the result of integer check is not correct for
+  // 29711844 * 2^-82
+  // = 6.1442653300000000008655037797566933477355632930994033813476... * 10^-18
+  // and 29711844 * 2^-81
+  // = 1.2288530660000000001731007559513386695471126586198806762695... * 10^-17,
+  // and they are the unique counterexamples. However, since 29711844 is even,
+  // this does not cause any problem for the endpoints calculations; it can only
+  // cause a problem when we need to perform integer check for the center.
+  // Fortunately, with these inputs, that branch is never executed, so we are
+  // fine.
+  const typename cache_accessor<T>::compute_mul_result z_mul =
+      cache_accessor<T>::compute_mul((two_fc | 1) << beta, cache);
+
+  // Step 2: Try larger divisor; remove trailing zeros if necessary.
+
+  // Using an upper bound on zi, we might be able to optimize the division
+  // better than the compiler; we are computing zi / big_divisor here.
+  decimal_fp<T> ret_value;
+  ret_value.significand = divide_by_10_to_kappa_plus_1(z_mul.result);
+  uint32_t r = static_cast<uint32_t>(z_mul.result - float_info<T>::big_divisor *
+                                                        ret_value.significand);
+
+  if (r < deltai) {
+    // Exclude the right endpoint if necessary.
+    if (r == 0 && (z_mul.is_integer & !include_right_endpoint)) {
+      --ret_value.significand;
+      r = float_info<T>::big_divisor;
+      goto small_divisor_case_label;
+    }
+  } else if (r > deltai) {
+    goto small_divisor_case_label;
+  } else {
+    // r == deltai; compare fractional parts.
+    const typename cache_accessor<T>::compute_mul_parity_result x_mul =
+        cache_accessor<T>::compute_mul_parity(two_fc - 1, cache, beta);
+
+    if (!(x_mul.parity | (x_mul.is_integer & include_left_endpoint)))
+      goto small_divisor_case_label;
+  }
+  ret_value.exponent = minus_k + float_info<T>::kappa + 1;
+
+  // We may need to remove trailing zeros.
+  ret_value.exponent += remove_trailing_zeros(ret_value.significand);
+  return ret_value;
+
+  // Step 3: Find the significand with the smaller divisor.
+
+small_divisor_case_label:
+  ret_value.significand *= 10;
+  ret_value.exponent = minus_k + float_info<T>::kappa;
+
+  uint32_t dist = r - (deltai / 2) + (float_info<T>::small_divisor / 2);
+  const bool approx_y_parity =
+      ((dist ^ (float_info<T>::small_divisor / 2)) & 1) != 0;
+
+  // Is dist divisible by 10^kappa?
+  const bool divisible_by_small_divisor =
+      check_divisibility_and_divide_by_pow10<float_info<T>::kappa>(dist);
+
+  // Add dist / 10^kappa to the significand.
+  ret_value.significand += dist;
+
+  if (!divisible_by_small_divisor) return ret_value;
+
+  // Check z^(f) >= epsilon^(f).
+  // We have either yi == zi - epsiloni or yi == (zi - epsiloni) - 1,
+  // where yi == zi - epsiloni if and only if z^(f) >= epsilon^(f).
+  // Since there are only 2 possibilities, we only need to care about the
+  // parity. Also, zi and r should have the same parity since the divisor
+  // is an even number.
+  const auto y_mul = cache_accessor<T>::compute_mul_parity(two_fc, cache, beta);
+
+  // If z^(f) >= epsilon^(f), we might have a tie when z^(f) == epsilon^(f),
+  // or equivalently, when y is an integer.
+  if (y_mul.parity != approx_y_parity)
+    --ret_value.significand;
+  else if (y_mul.is_integer & (ret_value.significand % 2 != 0))
+    --ret_value.significand;
+  return ret_value;
+}
+}  // namespace dragonbox
+}  // namespace detail
+
+template <> struct formatter<detail::bigint> {
+  FMT_CONSTEXPR auto parse(format_parse_context& ctx)
+      -> format_parse_context::iterator {
+    return ctx.begin();
+  }
+
+  auto format(const detail::bigint& n, format_context& ctx) const
+      -> format_context::iterator {
+    auto out = ctx.out();
+    bool first = true;
+    for (auto i = n.bigits_.size(); i > 0; --i) {
+      auto value = n.bigits_[i - 1u];
+      if (first) {
+        out = fmt::format_to(out, FMT_STRING("{:x}"), value);
+        first = false;
+        continue;
+      }
+      out = fmt::format_to(out, FMT_STRING("{:08x}"), value);
+    }
+    if (n.exp_ > 0)
+      out = fmt::format_to(out, FMT_STRING("p{}"),
+                           n.exp_ * detail::bigint::bigit_bits);
+    return out;
+  }
 };
 
-// A handmade floating-point number f * pow(2, e).
-class fp {
-private:
-	using significand_type = uint64_t;
-
-	// All sizes are in bits.
-	// Subtract 1 to account for an implicit most significant bit in the
-	// normalized form.
-	static FMT_CONSTEXPR_DECL const int double_significand_size = std::numeric_limits<double>::digits - 1;
-	static FMT_CONSTEXPR_DECL const uint64_t implicit_bit = 1ULL << double_significand_size;
-
-public:
-	significand_type f;
-	int e;
-
-	static FMT_CONSTEXPR_DECL const int significand_size = bits<significand_type>::value;
-
-	fp() : f(0), e(0) {
-	}
-
-	fp(uint64_t f_val, int e_val) : f(f_val), e(e_val) {
-	}
-
-	// Constructs fp from an IEEE754 double. It is a template to prevent compile
-	// errors on platforms where double is not IEEE754.
-	template <typename Double>
-	explicit fp(Double d) {
-		assign(d);
-	}
-
-	// Normalizes the value converted from double and multiplied by (1 << SHIFT).
-	template <int SHIFT>
-	friend fp normalize(fp value) {
-		// Handle subnormals.
-		const auto shifted_implicit_bit = fp::implicit_bit << SHIFT;
-		while ((value.f & shifted_implicit_bit) == 0) {
-			value.f <<= 1;
-			--value.e;
-		}
-		// Subtract 1 to account for hidden bit.
-		const auto offset = fp::significand_size - fp::double_significand_size - SHIFT - 1;
-		value.f <<= offset;
-		value.e -= offset;
-		return value;
-	}
-
-	// Assigns d to this and return true iff predecessor is closer than successor.
-	template <typename Double, FMT_ENABLE_IF(sizeof(Double) == sizeof(uint64_t))>
-	bool assign(Double d) {
-		// Assume double is in the format [sign][exponent][significand].
-		using limits = std::numeric_limits<Double>;
-		const int exponent_size = bits<Double>::value - double_significand_size - 1; // -1 for sign
-		const uint64_t significand_mask = implicit_bit - 1;
-		const uint64_t exponent_mask = (~0ULL >> 1) & ~significand_mask;
-		const int exponent_bias = (1 << exponent_size) - limits::max_exponent - 1;
-		auto u = bit_cast<uint64_t>(d);
-		f = u & significand_mask;
-		auto biased_e = (u & exponent_mask) >> double_significand_size;
-		// Predecessor is closer if d is a normalized power of 2 (f == 0) other than
-		// the smallest normalized number (biased_e > 1).
-		bool is_predecessor_closer = f == 0 && biased_e > 1;
-		if (biased_e != 0)
-			f += implicit_bit;
-		else
-			biased_e = 1; // Subnormals use biased exponent 1 (min exponent).
-		e = static_cast<int>(biased_e - exponent_bias - double_significand_size);
-		return is_predecessor_closer;
-	}
-
-	template <typename Double, FMT_ENABLE_IF(sizeof(Double) != sizeof(uint64_t))>
-	bool assign(Double) {
-		*this = fp();
-		return false;
-	}
-
-	// Assigns d to this together with computing lower and upper boundaries,
-	// where a boundary is a value half way between the number and its predecessor
-	// (lower) or successor (upper). The upper boundary is normalized and lower
-	// has the same exponent but may be not normalized.
-	template <typename Double>
-	boundaries assign_with_boundaries(Double d) {
-		bool is_lower_closer = assign(d);
-		fp lower = is_lower_closer ? fp((f << 2) - 1, e - 2) : fp((f << 1) - 1, e - 1);
-		// 1 in normalize accounts for the exponent shift above.
-		fp upper = normalize<1>(fp((f << 1) + 1, e - 1));
-		lower.f <<= lower.e - upper.e;
-		return boundaries {lower.f, upper.f};
-	}
-
-	template <typename Double>
-	boundaries assign_float_with_boundaries(Double d) {
-		assign(d);
-		constexpr int min_normal_e = std::numeric_limits<float>::min_exponent - std::numeric_limits<double>::digits;
-		significand_type half_ulp = 1 << (std::numeric_limits<double>::digits - std::numeric_limits<float>::digits - 1);
-		if (min_normal_e > e)
-			half_ulp <<= min_normal_e - e;
-		fp upper = normalize<0>(fp(f + half_ulp, e));
-		fp lower = fp(f - (half_ulp >> ((f == implicit_bit && e > min_normal_e) ? 1 : 0)), e);
-		lower.f <<= lower.e - upper.e;
-		return boundaries {lower.f, upper.f};
-	}
-};
+FMT_FUNC detail::utf8_to_utf16::utf8_to_utf16(string_view s) {
+  for_each_codepoint(s, [this](uint32_t cp, string_view) {
+    if (cp == invalid_code_point) FMT_THROW(std::runtime_error("invalid utf8"));
+    if (cp <= 0xFFFF) {
+      buffer_.push_back(static_cast<wchar_t>(cp));
+    } else {
+      cp -= 0x10000;
+      buffer_.push_back(static_cast<wchar_t>(0xD800 + (cp >> 10)));
+      buffer_.push_back(static_cast<wchar_t>(0xDC00 + (cp & 0x3FF)));
+    }
+    return true;
+  });
+  buffer_.push_back(0);
+}
 
-inline bool operator==(fp x, fp y) {
-	return x.f == y.f && x.e == y.e;
+FMT_FUNC void format_system_error(detail::buffer<char>& out, int error_code,
+                                  const char* message) noexcept {
+  FMT_TRY {
+    auto ec = std::error_code(error_code, std::generic_category());
+    detail::write(appender(out), std::system_error(ec, message).what());
+    return;
+  }
+  FMT_CATCH(...) {}
+  format_error_code(out, error_code, message);
 }
 
-// Computes lhs * rhs / pow(2, 64) rounded to nearest with half-up tie breaking.
-inline uint64_t multiply(uint64_t lhs, uint64_t rhs) {
-#if FMT_USE_INT128
-	auto product = static_cast<__uint128_t>(lhs) * rhs;
-	auto f = static_cast<uint64_t>(product >> 64);
-	return (static_cast<uint64_t>(product) & (1ULL << 63)) != 0 ? f + 1 : f;
-#else
-	// Multiply 32-bit parts of significands.
-	uint64_t mask = (1ULL << 32) - 1;
-	uint64_t a = lhs >> 32, b = lhs & mask;
-	uint64_t c = rhs >> 32, d = rhs & mask;
-	uint64_t ac = a * c, bc = b * c, ad = a * d, bd = b * d;
-	// Compute mid 64-bit of result and round.
-	uint64_t mid = (bd >> 32) + (ad & mask) + (bc & mask) + (1U << 31);
-	return ac + (ad >> 32) + (bc >> 32) + (mid >> 32);
-#endif
+FMT_FUNC void report_system_error(int error_code,
+                                  const char* message) noexcept {
+  report_error(format_system_error, error_code, message);
 }
 
-inline fp operator*(fp x, fp y) {
-	return {multiply(x.f, y.f), x.e + y.e + 64};
+FMT_FUNC auto vformat(string_view fmt, format_args args) -> std::string {
+  // Don't optimize the "{}" case to keep the binary size small and because it
+  // can be better optimized in fmt::format anyway.
+  auto buffer = memory_buffer();
+  detail::vformat_to(buffer, fmt, args);
+  return to_string(buffer);
 }
 
-// Returns a cached power of 10 `c_k = c_k.f * pow(2, c_k.e)` such that its
-// (binary) exponent satisfies `min_exponent <= c_k.e <= min_exponent + 28`.
-FMT_FUNC fp get_cached_power(int min_exponent, int& pow10_exponent) {
-	const uint64_t one_over_log2_10 = 0x4d104d42; // round(pow(2, 32) / log2(10))
-	int index = static_cast<int>(static_cast<int64_t>((min_exponent + fp::significand_size - 1) * one_over_log2_10 +
-	                                                  ((uint64_t(1) << 32) - 1) // ceil
-	                                                  ) >>
-	                             32 // arithmetic shift
-	);
-	// Decimal exponent of the first (smallest) cached power of 10.
-	const int first_dec_exp = -348;
-	// Difference between 2 consecutive decimal exponents in cached powers of 10.
-	const int dec_exp_step = 8;
-	index = (index - first_dec_exp - 1) / dec_exp_step + 1;
-	pow10_exponent = first_dec_exp + index * dec_exp_step;
-	return {data::pow10_significands[index], data::pow10_exponents[index]};
+namespace detail {
+
+template <typename T> struct span {
+  T* data;
+  size_t size;
+};
+
+template <typename F> auto flockfile(F* f) -> decltype(_lock_file(f)) {
+  _lock_file(f);
+}
+template <typename F> auto funlockfile(F* f) -> decltype(_unlock_file(f)) {
+  _unlock_file(f);
 }
 
-// A simple accumulator to hold the sums of terms in bigint::square if uint128_t
-// is not available.
-struct accumulator {
-	uint64_t lower;
-	uint64_t upper;
-
-	accumulator() : lower(0), upper(0) {
-	}
-
-	explicit operator uint32_t() const {
-		return static_cast<uint32_t>(lower);
-	}
-
-	void operator+=(uint64_t n) {
-		lower += n;
-		if (lower < n)
-			++upper;
-	}
-
-	void operator>>=(int shift) {
-		assert(shift == 32);
-		(void) shift;
-		lower = (upper << 32) | (lower >> 32);
-		upper >>= 32;
-	}
+#ifndef getc_unlocked
+template <typename F> auto getc_unlocked(F* f) -> decltype(_fgetc_nolock(f)) {
+  return _fgetc_nolock(f);
+}
+#endif
+
+template <typename F = FILE, typename Enable = void>
+struct has_flockfile : std::false_type {};
+
+template <typename F>
+struct has_flockfile<F, void_t<decltype(flockfile(&std::declval<F&>()))>>
+    : std::true_type {};
+
+// A FILE wrapper. F is FILE defined as a template parameter to make system API
+// detection work.
+template <typename F> class file_base {
+ public:
+  F* file_;
+
+ public:
+  file_base(F* file) : file_(file) {}
+  operator F*() const { return file_; }
+
+  // Reads a code unit from the stream.
+  auto get() -> int {
+    int result = getc_unlocked(file_);
+    if (result == EOF && ferror(file_) != 0)
+      FMT_THROW(system_error(errno, FMT_STRING("getc failed")));
+    return result;
+  }
+
+  // Puts the code unit back into the stream buffer.
+  void unget(char c) {
+    if (ungetc(c, file_) == EOF)
+      FMT_THROW(system_error(errno, FMT_STRING("ungetc failed")));
+  }
+
+  void flush() { fflush(this->file_); }
 };
 
-class bigint {
-private:
-	// A bigint is stored as an array of bigits (big digits), with bigit at index
-	// 0 being the least significant one.
-	using bigit = uint32_t;
-	using double_bigit = uint64_t;
-	enum { bigits_capacity = 32 };
-	basic_memory_buffer<bigit, bigits_capacity> bigits_;
-	int exp_;
-
-	static FMT_CONSTEXPR_DECL const int bigit_bits = bits<bigit>::value;
-
-	friend struct formatter<bigint>;
-
-	void subtract_bigits(int index, bigit other, bigit& borrow) {
-		auto result = static_cast<double_bigit>(bigits_[index]) - other - borrow;
-		bigits_[index] = static_cast<bigit>(result);
-		borrow = static_cast<bigit>(result >> (bigit_bits * 2 - 1));
-	}
-
-	void remove_leading_zeros() {
-		int num_bigits = static_cast<int>(bigits_.size()) - 1;
-		while (num_bigits > 0 && bigits_[num_bigits] == 0)
-			--num_bigits;
-		bigits_.resize(num_bigits + 1);
-	}
-
-	// Computes *this -= other assuming aligned bigints and *this >= other.
-	void subtract_aligned(const bigint& other) {
-		FMT_ASSERT(other.exp_ >= exp_, "unaligned bigints");
-		FMT_ASSERT(compare(*this, other) >= 0, "");
-		bigit borrow = 0;
-		int i = other.exp_ - exp_;
-		for (int j = 0, n = static_cast<int>(other.bigits_.size()); j != n; ++i, ++j) {
-			subtract_bigits(i, other.bigits_[j], borrow);
-		}
-		while (borrow > 0)
-			subtract_bigits(i, 0, borrow);
-		remove_leading_zeros();
-	}
-
-	void multiply(uint32_t value) {
-		const double_bigit wide_value = value;
-		bigit carry = 0;
-		for (size_t i = 0, n = bigits_.size(); i < n; ++i) {
-			double_bigit result = bigits_[i] * wide_value + carry;
-			bigits_[i] = static_cast<bigit>(result);
-			carry = static_cast<bigit>(result >> bigit_bits);
-		}
-		if (carry != 0)
-			bigits_.push_back(carry);
-	}
-
-	void multiply(uint64_t value) {
-		const bigit mask = ~bigit(0);
-		const double_bigit lower = value & mask;
-		const double_bigit upper = value >> bigit_bits;
-		double_bigit carry = 0;
-		for (size_t i = 0, n = bigits_.size(); i < n; ++i) {
-			double_bigit result = bigits_[i] * lower + (carry & mask);
-			carry = bigits_[i] * upper + (result >> bigit_bits) + (carry >> bigit_bits);
-			bigits_[i] = static_cast<bigit>(result);
-		}
-		while (carry != 0) {
-			bigits_.push_back(carry & mask);
-			carry >>= bigit_bits;
-		}
-	}
-
-public:
-	bigint() : exp_(0) {
-	}
-
-	explicit bigint(uint64_t n) {
-		assign(n);
-	}
-
-	~bigint() {
-		assert(bigits_.capacity() <= bigits_capacity);
-	}
-
-	bigint(const bigint&) = delete;
-
-	void operator=(const bigint&) = delete;
-
-	void assign(const bigint& other) {
-		bigits_.resize(other.bigits_.size());
-		auto data = other.bigits_.data();
-		std::copy(data, data + other.bigits_.size(), bigits_.data());
-		exp_ = other.exp_;
-	}
-
-	void assign(uint64_t n) {
-		int num_bigits = 0;
-		do {
-			bigits_[num_bigits++] = n & ~bigit(0);
-			n >>= bigit_bits;
-		} while (n != 0);
-		bigits_.resize(num_bigits);
-		exp_ = 0;
-	}
-
-	int num_bigits() const {
-		return static_cast<int>(bigits_.size()) + exp_;
-	}
-
-	bigint& operator<<=(int shift) {
-		assert(shift >= 0);
-		exp_ += shift / bigit_bits;
-		shift %= bigit_bits;
-		if (shift == 0)
-			return *this;
-		bigit carry = 0;
-		for (size_t i = 0, n = bigits_.size(); i < n; ++i) {
-			bigit c = bigits_[i] >> (bigit_bits - shift);
-			bigits_[i] = (bigits_[i] << shift) + carry;
-			carry = c;
-		}
-		if (carry != 0)
-			bigits_.push_back(carry);
-		return *this;
-	}
-
-	template <typename Int>
-	bigint& operator*=(Int value) {
-		FMT_ASSERT(value > 0, "");
-		multiply(uint32_or_64_or_128_t<Int>(value));
-		return *this;
-	}
-
-	friend int compare(const bigint& lhs, const bigint& rhs) {
-		int num_lhs_bigits = lhs.num_bigits(), num_rhs_bigits = rhs.num_bigits();
-		if (num_lhs_bigits != num_rhs_bigits)
-			return num_lhs_bigits > num_rhs_bigits ? 1 : -1;
-		int i = static_cast<int>(lhs.bigits_.size()) - 1;
-		int j = static_cast<int>(rhs.bigits_.size()) - 1;
-		int end = i - j;
-		if (end < 0)
-			end = 0;
-		for (; i >= end; --i, --j) {
-			bigit lhs_bigit = lhs.bigits_[i], rhs_bigit = rhs.bigits_[j];
-			if (lhs_bigit != rhs_bigit)
-				return lhs_bigit > rhs_bigit ? 1 : -1;
-		}
-		if (i != j)
-			return i > j ? 1 : -1;
-		return 0;
-	}
-
-	// Returns compare(lhs1 + lhs2, rhs).
-	friend int add_compare(const bigint& lhs1, const bigint& lhs2, const bigint& rhs) {
-		int max_lhs_bigits = (std::max)(lhs1.num_bigits(), lhs2.num_bigits());
-		int num_rhs_bigits = rhs.num_bigits();
-		if (max_lhs_bigits + 1 < num_rhs_bigits)
-			return -1;
-		if (max_lhs_bigits > num_rhs_bigits)
-			return 1;
-		auto get_bigit = [](const bigint& n, int i) -> bigit {
-			return i >= n.exp_ && i < n.num_bigits() ? n.bigits_[i - n.exp_] : 0;
-		};
-		double_bigit borrow = 0;
-		int min_exp = (std::min)((std::min)(lhs1.exp_, lhs2.exp_), rhs.exp_);
-		for (int i = num_rhs_bigits - 1; i >= min_exp; --i) {
-			double_bigit sum = static_cast<double_bigit>(get_bigit(lhs1, i)) + get_bigit(lhs2, i);
-			bigit rhs_bigit = get_bigit(rhs, i);
-			if (sum > rhs_bigit + borrow)
-				return 1;
-			borrow = rhs_bigit + borrow - sum;
-			if (borrow > 1)
-				return -1;
-			borrow <<= bigit_bits;
-		}
-		return borrow != 0 ? -1 : 0;
-	}
-
-	// Assigns pow(10, exp) to this bigint.
-	void assign_pow10(int exp) {
-		assert(exp >= 0);
-		if (exp == 0)
-			return assign(1);
-		// Find the top bit.
-		int bitmask = 1;
-		while (exp >= bitmask)
-			bitmask <<= 1;
-		bitmask >>= 1;
-		// pow(10, exp) = pow(5, exp) * pow(2, exp). First compute pow(5, exp) by
-		// repeated squaring and multiplication.
-		assign(5);
-		bitmask >>= 1;
-		while (bitmask != 0) {
-			square();
-			if ((exp & bitmask) != 0)
-				*this *= 5;
-			bitmask >>= 1;
-		}
-		*this <<= exp; // Multiply by pow(2, exp) by shifting.
-	}
-
-	void square() {
-		basic_memory_buffer<bigit, bigits_capacity> n(std::move(bigits_));
-		int num_bigits = static_cast<int>(bigits_.size());
-		int num_result_bigits = 2 * num_bigits;
-		bigits_.resize(num_result_bigits);
-		using accumulator_t = conditional_t<FMT_USE_INT128, uint128_t, accumulator>;
-		auto sum = accumulator_t();
-		for (int bigit_index = 0; bigit_index < num_bigits; ++bigit_index) {
-			// Compute bigit at position bigit_index of the result by adding
-			// cross-product terms n[i] * n[j] such that i + j == bigit_index.
-			for (int i = 0, j = bigit_index; j >= 0; ++i, --j) {
-				// Most terms are multiplied twice which can be optimized in the future.
-				sum += static_cast<double_bigit>(n[i]) * n[j];
-			}
-			bigits_[bigit_index] = static_cast<bigit>(sum);
-			sum >>= bits<bigit>::value; // Compute the carry.
-		}
-		// Do the same for the top half.
-		for (int bigit_index = num_bigits; bigit_index < num_result_bigits; ++bigit_index) {
-			for (int j = num_bigits - 1, i = bigit_index - j; i < num_bigits;)
-				sum += static_cast<double_bigit>(n[i++]) * n[j--];
-			bigits_[bigit_index] = static_cast<bigit>(sum);
-			sum >>= bits<bigit>::value;
-		}
-		--num_result_bigits;
-		remove_leading_zeros();
-		exp_ *= 2;
-	}
-
-	// Divides this bignum by divisor, assigning the remainder to this and
-	// returning the quotient.
-	int divmod_assign(const bigint& divisor) {
-		FMT_ASSERT(this != &divisor, "");
-		if (compare(*this, divisor) < 0)
-			return 0;
-		int num_bigits = static_cast<int>(bigits_.size());
-		FMT_ASSERT(divisor.bigits_[divisor.bigits_.size() - 1] != 0, "");
-		int exp_difference = exp_ - divisor.exp_;
-		if (exp_difference > 0) {
-			// Align bigints by adding trailing zeros to simplify subtraction.
-			bigits_.resize(num_bigits + exp_difference);
-			for (int i = num_bigits - 1, j = i + exp_difference; i >= 0; --i, --j)
-				bigits_[j] = bigits_[i];
-			std::uninitialized_fill_n(bigits_.data(), exp_difference, 0);
-			exp_ -= exp_difference;
-		}
-		int quotient = 0;
-		do {
-			subtract_aligned(divisor);
-			++quotient;
-		} while (compare(*this, divisor) >= 0);
-		return quotient;
-	}
+// A FILE wrapper for glibc.
+template <typename F> class glibc_file : public file_base<F> {
+ private:
+  enum {
+    line_buffered = 0x200,  // _IO_LINE_BUF
+    unbuffered = 2          // _IO_UNBUFFERED
+  };
+
+ public:
+  using file_base<F>::file_base;
+
+  auto is_buffered() const -> bool {
+    return (this->file_->_flags & unbuffered) == 0;
+  }
+
+  void init_buffer() {
+    if (this->file_->_IO_write_ptr) return;
+    // Force buffer initialization by placing and removing a char in a buffer.
+    putc_unlocked(0, this->file_);
+    --this->file_->_IO_write_ptr;
+  }
+
+  // Returns the file's read buffer.
+  auto get_read_buffer() const -> span<const char> {
+    auto ptr = this->file_->_IO_read_ptr;
+    return {ptr, to_unsigned(this->file_->_IO_read_end - ptr)};
+  }
+
+  // Returns the file's write buffer.
+  auto get_write_buffer() const -> span<char> {
+    auto ptr = this->file_->_IO_write_ptr;
+    return {ptr, to_unsigned(this->file_->_IO_buf_end - ptr)};
+  }
+
+  void advance_write_buffer(size_t size) { this->file_->_IO_write_ptr += size; }
+
+  bool needs_flush() const {
+    if ((this->file_->_flags & line_buffered) == 0) return false;
+    char* end = this->file_->_IO_write_end;
+    return memchr(end, '\n', to_unsigned(this->file_->_IO_write_ptr - end));
+  }
+
+  void flush() { fflush_unlocked(this->file_); }
 };
 
-enum round_direction { unknown, up, down };
-
-// Given the divisor (normally a power of 10), the remainder = v % divisor for
-// some number v and the error, returns whether v should be rounded up, down, or
-// whether the rounding direction can't be determined due to error.
-// error should be less than divisor / 2.
-inline round_direction get_round_direction(uint64_t divisor, uint64_t remainder, uint64_t error) {
-	FMT_ASSERT(remainder < divisor, "");     // divisor - remainder won't overflow.
-	FMT_ASSERT(error < divisor, "");         // divisor - error won't overflow.
-	FMT_ASSERT(error < divisor - error, ""); // error * 2 won't overflow.
-	// Round down if (remainder + error) * 2 <= divisor.
-	if (remainder <= divisor - remainder && error * 2 <= divisor - remainder * 2)
-		return down;
-	// Round up if (remainder - error) * 2 >= divisor.
-	if (remainder >= error && remainder - error >= divisor - (remainder - error)) {
-		return up;
-	}
-	return unknown;
-}
+// A FILE wrapper for Apple's libc.
+template <typename F> class apple_file : public file_base<F> {
+ private:
+  enum {
+    line_buffered = 1,  // __SNBF
+    unbuffered = 2      // __SLBF
+  };
+
+ public:
+  using file_base<F>::file_base;
+
+  auto is_buffered() const -> bool {
+    return (this->file_->_flags & unbuffered) == 0;
+  }
+
+  void init_buffer() {
+    if (this->file_->_p) return;
+    // Force buffer initialization by placing and removing a char in a buffer.
+    putc_unlocked(0, this->file_);
+    --this->file_->_p;
+    ++this->file_->_w;
+  }
+
+  auto get_read_buffer() const -> span<const char> {
+    return {reinterpret_cast<char*>(this->file_->_p),
+            to_unsigned(this->file_->_r)};
+  }
+
+  auto get_write_buffer() const -> span<char> {
+    return {reinterpret_cast<char*>(this->file_->_p),
+            to_unsigned(this->file_->_bf._base + this->file_->_bf._size -
+                        this->file_->_p)};
+  }
+
+  void advance_write_buffer(size_t size) {
+    this->file_->_p += size;
+    this->file_->_w -= size;
+  }
+
+  bool needs_flush() const {
+    if ((this->file_->_flags & line_buffered) == 0) return false;
+    return memchr(this->file_->_p + this->file_->_w, '\n',
+                  to_unsigned(-this->file_->_w));
+  }
+};
+
+// A fallback FILE wrapper.
+template <typename F> class fallback_file : public file_base<F> {
+ private:
+  char next_;  // The next unconsumed character in the buffer.
+  bool has_next_ = false;
+
+ public:
+  using file_base<F>::file_base;
+
+  auto is_buffered() const -> bool { return false; }
+  auto needs_flush() const -> bool { return false; }
+  void init_buffer() {}
+
+  auto get_read_buffer() const -> span<const char> {
+    return {&next_, has_next_ ? 1u : 0u};
+  }
+
+  auto get_write_buffer() const -> span<char> { return {nullptr, 0}; }
+
+  void advance_write_buffer(size_t) {}
 
-namespace digits {
-enum result {
-	more, // Generate more digits.
-	done, // Done generating digits.
-	error // Digit generation cancelled due to an error.
+  auto get() -> int {
+    has_next_ = false;
+    return file_base<F>::get();
+  }
+
+  void unget(char c) {
+    file_base<F>::unget(c);
+    next_ = c;
+    has_next_ = true;
+  }
 };
-}
 
-// Generates output using the Grisu digit-gen algorithm.
-// error: the size of the region (lower, upper) outside of which numbers
-// definitely do not round to value (Delta in Grisu3).
-template <typename Handler>
-FMT_ALWAYS_INLINE digits::result grisu_gen_digits(fp value, uint64_t error, int& exp, Handler& handler) {
-	const fp one(1ULL << -value.e, value.e);
-	// The integral part of scaled value (p1 in Grisu) = value / one. It cannot be
-	// zero because it contains a product of two 64-bit numbers with MSB set (due
-	// to normalization) - 1, shifted right by at most 60 bits.
-	auto integral = static_cast<uint32_t>(value.f >> -one.e);
-	FMT_ASSERT(integral != 0, "");
-	FMT_ASSERT(integral == value.f >> -one.e, "");
-	// The fractional part of scaled value (p2 in Grisu) c = value % one.
-	uint64_t fractional = value.f & (one.f - 1);
-	exp = count_digits(integral); // kappa in Grisu.
-	// Divide by 10 to prevent overflow.
-	auto result = handler.on_start(data::powers_of_10_64[exp - 1] << -one.e, value.f / 10, error * 10, exp);
-	if (result != digits::more)
-		return result;
-	// Generate digits for the integral part. This can produce up to 10 digits.
-	do {
-		uint32_t digit = 0;
-		auto divmod_integral = [&](uint32_t divisor) {
-			digit = integral / divisor;
-			integral %= divisor;
-		};
-		// This optimization by Milo Yip reduces the number of integer divisions by
-		// one per iteration.
-		switch (exp) {
-		case 10:
-			divmod_integral(1000000000);
-			break;
-		case 9:
-			divmod_integral(100000000);
-			break;
-		case 8:
-			divmod_integral(10000000);
-			break;
-		case 7:
-			divmod_integral(1000000);
-			break;
-		case 6:
-			divmod_integral(100000);
-			break;
-		case 5:
-			divmod_integral(10000);
-			break;
-		case 4:
-			divmod_integral(1000);
-			break;
-		case 3:
-			divmod_integral(100);
-			break;
-		case 2:
-			divmod_integral(10);
-			break;
-		case 1:
-			digit = integral;
-			integral = 0;
-			break;
-		default:
-			FMT_ASSERT(false, "invalid number of digits");
-		}
-		--exp;
-		uint64_t remainder = (static_cast<uint64_t>(integral) << -one.e) + fractional;
-		result = handler.on_digit(static_cast<char>('0' + digit), data::powers_of_10_64[exp] << -one.e, remainder,
-		                          error, exp, true);
-		if (result != digits::more)
-			return result;
-	} while (exp > 0);
-	// Generate digits for the fractional part.
-	for (;;) {
-		fractional *= 10;
-		error *= 10;
-		char digit = static_cast<char>('0' + static_cast<char>(fractional >> -one.e));
-		fractional &= one.f - 1;
-		--exp;
-		result = handler.on_digit(digit, one.f, fractional, error, exp, false);
-		if (result != digits::more)
-			return result;
-	}
+#ifndef FMT_USE_FALLBACK_FILE
+#  define FMT_USE_FALLBACK_FILE 1
+#endif
+
+template <typename F,
+          FMT_ENABLE_IF(sizeof(F::_p) != 0 && !FMT_USE_FALLBACK_FILE)>
+auto get_file(F* f, int) -> apple_file<F> {
+  return f;
 }
+template <typename F,
+          FMT_ENABLE_IF(sizeof(F::_IO_read_ptr) != 0 && !FMT_USE_FALLBACK_FILE)>
+inline auto get_file(F* f, int) -> glibc_file<F> {
+  return f;
+}
+
+inline auto get_file(FILE* f, ...) -> fallback_file<FILE> { return f; }
+
+using file_ref = decltype(get_file(static_cast<FILE*>(nullptr), 0));
 
-// The fixed precision digit handler.
-struct fixed_handler {
-	char* buf;
-	int size;
-	int precision;
-	int exp10;
-	bool fixed;
-
-	digits::result on_start(uint64_t divisor, uint64_t remainder, uint64_t error, int& exp) {
-		// Non-fixed formats require at least one digit and no precision adjustment.
-		if (!fixed)
-			return digits::more;
-		// Adjust fixed precision by exponent because it is relative to decimal
-		// point.
-		precision += exp + exp10;
-		// Check if precision is satisfied just by leading zeros, e.g.
-		// format("{:.2f}", 0.001) gives "0.00" without generating any digits.
-		if (precision > 0)
-			return digits::more;
-		if (precision < 0)
-			return digits::done;
-		auto dir = get_round_direction(divisor, remainder, error);
-		if (dir == unknown)
-			return digits::error;
-		buf[size++] = dir == up ? '1' : '0';
-		return digits::done;
-	}
-
-	digits::result on_digit(char digit, uint64_t divisor, uint64_t remainder, uint64_t error, int, bool integral) {
-		FMT_ASSERT(remainder < divisor, "");
-		buf[size++] = digit;
-		if (size < precision)
-			return digits::more;
-		if (!integral) {
-			// Check if error * 2 < divisor with overflow prevention.
-			// The check is not needed for the integral part because error = 1
-			// and divisor > (1 << 32) there.
-			if (error >= divisor || error >= divisor - error)
-				return digits::error;
-		} else {
-			FMT_ASSERT(error == 1 && divisor > 2, "");
-		}
-		auto dir = get_round_direction(divisor, remainder, error);
-		if (dir != up)
-			return dir == down ? digits::done : digits::error;
-		++buf[size - 1];
-		for (int i = size - 1; i > 0 && buf[i] > '9'; --i) {
-			buf[i] = '0';
-			++buf[i - 1];
-		}
-		if (buf[0] > '9') {
-			buf[0] = '1';
-			buf[size++] = '0';
-		}
-		return digits::done;
-	}
+template <typename F = FILE, typename Enable = void>
+class file_print_buffer : public buffer<char> {
+ public:
+  explicit file_print_buffer(F*) : buffer(nullptr, size_t()) {}
 };
 
-// The shortest representation digit handler.
-struct grisu_shortest_handler {
-	char* buf;
-	int size;
-	// Distance between scaled value and upper bound (wp_W in Grisu3).
-	uint64_t diff;
-
-	digits::result on_start(uint64_t, uint64_t, uint64_t, int&) {
-		return digits::more;
-	}
-
-	// Decrement the generated number approaching value from above.
-	void round(uint64_t d, uint64_t divisor, uint64_t& remainder, uint64_t error) {
-		while (remainder < d && error - remainder >= divisor &&
-		       (remainder + divisor < d || d - remainder >= remainder + divisor - d)) {
-			--buf[size - 1];
-			remainder += divisor;
-		}
-	}
-
-	// Implements Grisu's round_weed.
-	digits::result on_digit(char digit, uint64_t divisor, uint64_t remainder, uint64_t error, int exp, bool integral) {
-		buf[size++] = digit;
-		if (remainder >= error)
-			return digits::more;
-		uint64_t unit = integral ? 1 : data::powers_of_10_64[-exp];
-		uint64_t up = (diff - 1) * unit; // wp_Wup
-		round(up, divisor, remainder, error);
-		uint64_t down = (diff + 1) * unit; // wp_Wdown
-		if (remainder < down && error - remainder >= divisor &&
-		    (remainder + divisor < down || down - remainder > remainder + divisor - down)) {
-			return digits::error;
-		}
-		return 2 * unit <= remainder && remainder <= error - 4 * unit ? digits::done : digits::error;
-	}
+template <typename F>
+class file_print_buffer<F, enable_if_t<has_flockfile<F>::value>>
+    : public buffer<char> {
+ private:
+  file_ref file_;
+
+  static void grow(buffer<char>& base, size_t) {
+    auto& self = static_cast<file_print_buffer&>(base);
+    self.file_.advance_write_buffer(self.size());
+    if (self.file_.get_write_buffer().size == 0) self.file_.flush();
+    auto buf = self.file_.get_write_buffer();
+    FMT_ASSERT(buf.size > 0, "");
+    self.set(buf.data, buf.size);
+    self.clear();
+  }
+
+ public:
+  explicit file_print_buffer(F* f) : buffer(grow, size_t()), file_(f) {
+    flockfile(f);
+    file_.init_buffer();
+    auto buf = file_.get_write_buffer();
+    set(buf.data, buf.size);
+  }
+  ~file_print_buffer() {
+    file_.advance_write_buffer(size());
+    bool flush = file_.needs_flush();
+    F* f = file_;    // Make funlockfile depend on the template parameter F
+    funlockfile(f);  // for the system API detection to work.
+    if (flush) fflush(file_);
+  }
 };
 
-// Formats value using a variation of the Fixed-Precision Positive
-// Floating-Point Printout ((FPP)^2) algorithm by Steele & White:
-// https://fmt.dev/p372-steele.pdf.
-template <typename Double>
-void fallback_format(Double d, buffer<char>& buf, int& exp10) {
-	bigint numerator;   // 2 * R in (FPP)^2.
-	bigint denominator; // 2 * S in (FPP)^2.
-	// lower and upper are differences between value and corresponding boundaries.
-	bigint lower;            // (M^- in (FPP)^2).
-	bigint upper_store;      // upper's value if different from lower.
-	bigint* upper = nullptr; // (M^+ in (FPP)^2).
-	fp value;
-	// Shift numerator and denominator by an extra bit or two (if lower boundary
-	// is closer) to make lower and upper integers. This eliminates multiplication
-	// by 2 during later computations.
-	// TODO: handle float
-	int shift = value.assign(d) ? 2 : 1;
-	uint64_t significand = value.f << shift;
-	if (value.e >= 0) {
-		numerator.assign(significand);
-		numerator <<= value.e;
-		lower.assign(1);
-		lower <<= value.e;
-		if (shift != 1) {
-			upper_store.assign(1);
-			upper_store <<= value.e + 1;
-			upper = &upper_store;
-		}
-		denominator.assign_pow10(exp10);
-		denominator <<= 1;
-	} else if (exp10 < 0) {
-		numerator.assign_pow10(-exp10);
-		lower.assign(numerator);
-		if (shift != 1) {
-			upper_store.assign(numerator);
-			upper_store <<= 1;
-			upper = &upper_store;
-		}
-		numerator *= significand;
-		denominator.assign(1);
-		denominator <<= shift - value.e;
-	} else {
-		numerator.assign(significand);
-		denominator.assign_pow10(exp10);
-		denominator <<= shift - value.e;
-		lower.assign(1);
-		if (shift != 1) {
-			upper_store.assign(1ULL << 1);
-			upper = &upper_store;
-		}
-	}
-	if (!upper)
-		upper = &lower;
-	// Invariant: value == (numerator / denominator) * pow(10, exp10).
-	bool even = (value.f & 1) == 0;
-	int num_digits = 0;
-	char* data = buf.data();
-	for (;;) {
-		int digit = numerator.divmod_assign(denominator);
-		bool low = compare(numerator, lower) - even < 0; // numerator <[=] lower.
-		// numerator + upper >[=] pow10:
-		bool high = add_compare(numerator, *upper, denominator) + even > 0;
-		data[num_digits++] = static_cast<char>('0' + digit);
-		if (low || high) {
-			if (!low) {
-				++data[num_digits - 1];
-			} else if (high) {
-				int result = add_compare(numerator, numerator, denominator);
-				// Round half to even.
-				if (result > 0 || (result == 0 && (digit % 2) != 0))
-					++data[num_digits - 1];
-			}
-			buf.resize(num_digits);
-			exp10 -= num_digits - 1;
-			return;
-		}
-		numerator *= 10;
-		lower *= 10;
-		if (upper != &lower)
-			*upper *= 10;
-	}
+#if !defined(_WIN32) || defined(FMT_USE_WRITE_CONSOLE)
+FMT_FUNC auto write_console(int, string_view) -> bool { return false; }
+#else
+using dword = conditional_t<sizeof(long) == 4, unsigned long, unsigned>;
+extern "C" __declspec(dllimport) int __stdcall WriteConsoleW(  //
+    void*, const void*, dword, dword*, void*);
+
+FMT_FUNC bool write_console(int fd, string_view text) {
+  auto u16 = utf8_to_utf16(text);
+  return WriteConsoleW(reinterpret_cast<void*>(_get_osfhandle(fd)), u16.c_str(),
+                       static_cast<dword>(u16.size()), nullptr, nullptr) != 0;
 }
+#endif
 
-// Formats value using the Grisu algorithm
-// (https://www.cs.tufts.edu/~nr/cs257/archive/florian-loitsch/printf.pdf)
-// if T is a IEEE754 binary32 or binary64 and snprintf otherwise.
-template <typename T>
-int format_float(T value, int precision, float_specs specs, buffer<char>& buf) {
-	static_assert(!std::is_same<T, float>(), "");
-	FMT_ASSERT(value >= 0, "value is negative");
-
-	const bool fixed = specs.format == float_format::fixed;
-	if (value <= 0) { // <= instead of == to silence a warning.
-		if (precision <= 0 || !fixed) {
-			buf.push_back('0');
-			return 0;
-		}
-		buf.resize(to_unsigned(precision));
-		std::uninitialized_fill_n(buf.data(), precision, '0');
-		return -precision;
-	}
-
-	if (!specs.use_grisu)
-		return snprintf_float(value, precision, specs, buf);
-
-	int exp = 0;
-	const int min_exp = -60; // alpha in Grisu.
-	int cached_exp10 = 0;    // K in Grisu.
-	if (precision != -1) {
-		if (precision > 17)
-			return snprintf_float(value, precision, specs, buf);
-		fp normalized = normalize(fp(value));
-		const auto cached_pow = get_cached_power(min_exp - (normalized.e + fp::significand_size), cached_exp10);
-		normalized = normalized * cached_pow;
-		fixed_handler handler {buf.data(), 0, precision, -cached_exp10, fixed};
-		if (grisu_gen_digits(normalized, 1, exp, handler) == digits::error)
-			return snprintf_float(value, precision, specs, buf);
-		int num_digits = handler.size;
-		if (!fixed) {
-			// Remove trailing zeros.
-			while (num_digits > 0 && buf[num_digits - 1] == '0') {
-				--num_digits;
-				++exp;
-			}
-		}
-		buf.resize(to_unsigned(num_digits));
-	} else {
-		fp fp_value;
-		auto boundaries =
-		    specs.binary32 ? fp_value.assign_float_with_boundaries(value) : fp_value.assign_with_boundaries(value);
-		fp_value = normalize(fp_value);
-		// Find a cached power of 10 such that multiplying value by it will bring
-		// the exponent in the range [min_exp, -32].
-		const fp cached_pow = get_cached_power(min_exp - (fp_value.e + fp::significand_size), cached_exp10);
-		// Multiply value and boundaries by the cached power of 10.
-		fp_value = fp_value * cached_pow;
-		boundaries.lower = multiply(boundaries.lower, cached_pow.f);
-		boundaries.upper = multiply(boundaries.upper, cached_pow.f);
-		assert(min_exp <= fp_value.e && fp_value.e <= -32);
-		--boundaries.lower; // \tilde{M}^- - 1 ulp -> M^-_{\downarrow}.
-		++boundaries.upper; // \tilde{M}^+ + 1 ulp -> M^+_{\uparrow}.
-		// Numbers outside of (lower, upper) definitely do not round to value.
-		grisu_shortest_handler handler {buf.data(), 0, boundaries.upper - fp_value.f};
-		auto result =
-		    grisu_gen_digits(fp(boundaries.upper, fp_value.e), boundaries.upper - boundaries.lower, exp, handler);
-		if (result == digits::error) {
-			exp += handler.size - cached_exp10 - 1;
-			fallback_format(value, buf, exp);
-			return exp;
-		}
-		buf.resize(to_unsigned(handler.size));
-	}
-	return exp - cached_exp10;
+#ifdef _WIN32
+// Print assuming legacy (non-Unicode) encoding.
+FMT_FUNC void vprint_mojibake(std::FILE* f, string_view fmt, format_args args,
+                              bool newline) {
+  auto buffer = memory_buffer();
+  detail::vformat_to(buffer, fmt, args);
+  if (newline) buffer.push_back('\n');
+  fwrite_fully(buffer.data(), buffer.size(), f);
 }
+#endif
 
-template <typename T>
-int snprintf_float(T value, int precision, float_specs specs, buffer<char>& buf) {
-	// Buffer capacity must be non-zero, otherwise MSVC's vsnprintf_s will fail.
-	FMT_ASSERT(buf.capacity() > buf.size(), "empty buffer");
-	static_assert(!std::is_same<T, float>(), "");
-
-	// Subtract 1 to account for the difference in precision since we use %e for
-	// both general and exponent format.
-	if (specs.format == float_format::general || specs.format == float_format::exp)
-		precision = (precision >= 0 ? precision : 6) - 1;
-
-	// Build the format string.
-	enum { max_format_size = 7 }; // Ths longest format is "%#.*Le".
-	char format[max_format_size];
-	char* format_ptr = format;
-	*format_ptr++ = '%';
-	if (specs.trailing_zeros)
-		*format_ptr++ = '#';
-	if (precision >= 0) {
-		*format_ptr++ = '.';
-		*format_ptr++ = '*';
-	}
-	if (std::is_same<T, long double>())
-		*format_ptr++ = 'L';
-	*format_ptr++ = specs.format != float_format::hex ? (specs.format == float_format::fixed ? 'f' : 'e')
-	                                                  : (specs.upper ? 'A' : 'a');
-	*format_ptr = '\0';
-
-	// Format using snprintf.
-	auto offset = buf.size();
-	for (;;) {
-		auto begin = buf.data() + offset;
-		auto capacity = buf.capacity() - offset;
-#ifdef FUZZING_BUILD_MODE_UNSAFE_FOR_PRODUCTION
-		if (precision > 100000)
-			throw std::runtime_error("fuzz mode - avoid large allocation inside snprintf");
+FMT_FUNC void print(std::FILE* f, string_view text) {
+#if defined(_WIN32) && !defined(FMT_USE_WRITE_CONSOLE)
+  int fd = _fileno(f);
+  if (_isatty(fd)) {
+    std::fflush(f);
+    if (write_console(fd, text)) return;
+  }
 #endif
-		// Suppress the warning about a nonliteral format string.
-		auto snprintf_ptr = FMT_SNPRINTF;
-		int result = precision >= 0 ? snprintf_ptr(begin, capacity, format, precision, value)
-		                            : snprintf_ptr(begin, capacity, format, value);
-		if (result < 0) {
-			buf.reserve(buf.capacity() + 1); // The buffer will grow exponentially.
-			continue;
-		}
-		unsigned size = to_unsigned(result);
-		// Size equal to capacity means that the last character was truncated.
-		if (size >= capacity) {
-			buf.reserve(size + offset + 1); // Add 1 for the terminating '\0'.
-			continue;
-		}
-		auto is_digit = [](char c) {
-			return c >= '0' && c <= '9';
-		};
-		if (specs.format == float_format::fixed) {
-			if (precision == 0) {
-				buf.resize(size);
-				return 0;
-			}
-			// Find and remove the decimal point.
-			auto end = begin + size, p = end;
-			do {
-				--p;
-			} while (is_digit(*p));
-			int fraction_size = static_cast<int>(end - p - 1);
-			std::memmove(p, p + 1, fraction_size);
-			buf.resize(size - 1);
-			return -fraction_size;
-		}
-		if (specs.format == float_format::hex) {
-			buf.resize(size + offset);
-			return 0;
-		}
-		// Find and parse the exponent.
-		auto end = begin + size, exp_pos = end;
-		do {
-			--exp_pos;
-		} while (*exp_pos != 'e');
-		char sign = exp_pos[1];
-		assert(sign == '+' || sign == '-');
-		int exp = 0;
-		auto p = exp_pos + 2; // Skip 'e' and sign.
-		do {
-			assert(is_digit(*p));
-			exp = exp * 10 + (*p++ - '0');
-		} while (p != end);
-		if (sign == '-')
-			exp = -exp;
-		int fraction_size = 0;
-		if (exp_pos != begin + 1) {
-			// Remove trailing zeros.
-			auto fraction_end = exp_pos - 1;
-			while (*fraction_end == '0')
-				--fraction_end;
-			// Move the fractional part left to get rid of the decimal point.
-			fraction_size = static_cast<int>(fraction_end - begin - 1);
-			std::memmove(begin + 1, begin + 2, fraction_size);
-		}
-		buf.resize(fraction_size + offset + 1);
-		return exp - fraction_size;
-	}
+  fwrite_fully(text.data(), text.size(), f);
 }
-} // namespace internal
+}  // namespace detail
 
-template <>
-struct formatter<internal::bigint> {
-	format_parse_context::iterator parse(format_parse_context& ctx) {
-		return ctx.begin();
-	}
-
-	format_context::iterator format(const internal::bigint& n, format_context& ctx) {
-		auto out = ctx.out();
-		bool first = true;
-		for (auto i = n.bigits_.size(); i > 0; --i) {
-			auto value = n.bigits_[i - 1];
-			if (first) {
-				out = format_to(out, "{:x}", value);
-				first = false;
-				continue;
-			}
-			out = format_to(out, "{:08x}", value);
-		}
-		if (n.exp_ > 0)
-			out = format_to(out, "p{}", n.exp_ * internal::bigint::bigit_bits);
-		return out;
-	}
+FMT_FUNC void vprint_buffered(std::FILE* f, string_view fmt, format_args args) {
+  auto buffer = memory_buffer();
+  detail::vformat_to(buffer, fmt, args);
+  detail::print(f, {buffer.data(), buffer.size()});
+}
+
+FMT_FUNC void vprint(std::FILE* f, string_view fmt, format_args args) {
+  if (!detail::file_ref(f).is_buffered() || !detail::has_flockfile<>())
+    return vprint_buffered(f, fmt, args);
+  auto&& buffer = detail::file_print_buffer<>(f);
+  return detail::vformat_to(buffer, fmt, args);
+}
+
+FMT_FUNC void vprintln(std::FILE* f, string_view fmt, format_args args) {
+  auto buffer = memory_buffer();
+  detail::vformat_to(buffer, fmt, args);
+  buffer.push_back('\n');
+  detail::print(f, {buffer.data(), buffer.size()});
+}
+
+FMT_FUNC void vprint(string_view fmt, format_args args) {
+  vprint(stdout, fmt, args);
+}
+
+namespace detail {
+
+struct singleton {
+  unsigned char upper;
+  unsigned char lower_count;
 };
 
-FMT_FUNC void internal::error_handler::on_error(std::string message) {
-	// FMT_THROW(duckdb::InvalidInputException(message));
+inline auto is_printable(uint16_t x, const singleton* singletons,
+                         size_t singletons_size,
+                         const unsigned char* singleton_lowers,
+                         const unsigned char* normal, size_t normal_size)
+    -> bool {
+  auto upper = x >> 8;
+  auto lower_start = 0;
+  for (size_t i = 0; i < singletons_size; ++i) {
+    auto s = singletons[i];
+    auto lower_end = lower_start + s.lower_count;
+    if (upper < s.upper) break;
+    if (upper == s.upper) {
+      for (auto j = lower_start; j < lower_end; ++j) {
+        if (singleton_lowers[j] == (x & 0xff)) return false;
+      }
+    }
+    lower_start = lower_end;
+  }
+
+  auto xsigned = static_cast<int>(x);
+  auto current = true;
+  for (size_t i = 0; i < normal_size; ++i) {
+    auto v = static_cast<int>(normal[i]);
+    auto len = (v & 0x80) != 0 ? (v & 0x7f) << 8 | normal[++i] : v;
+    xsigned -= len;
+    if (xsigned < 0) break;
+    current = !current;
+  }
+  return current;
 }
 
-FMT_END_NAMESPACE
+// This code is generated by support/printable.py.
+FMT_FUNC auto is_printable(uint32_t cp) -> bool {
+  static constexpr singleton singletons0[] = {
+      {0x00, 1},  {0x03, 5},  {0x05, 6},  {0x06, 3},  {0x07, 6},  {0x08, 8},
+      {0x09, 17}, {0x0a, 28}, {0x0b, 25}, {0x0c, 20}, {0x0d, 16}, {0x0e, 13},
+      {0x0f, 4},  {0x10, 3},  {0x12, 18}, {0x13, 9},  {0x16, 1},  {0x17, 5},
+      {0x18, 2},  {0x19, 3},  {0x1a, 7},  {0x1c, 2},  {0x1d, 1},  {0x1f, 22},
+      {0x20, 3},  {0x2b, 3},  {0x2c, 2},  {0x2d, 11}, {0x2e, 1},  {0x30, 3},
+      {0x31, 2},  {0x32, 1},  {0xa7, 2},  {0xa9, 2},  {0xaa, 4},  {0xab, 8},
+      {0xfa, 2},  {0xfb, 5},  {0xfd, 4},  {0xfe, 3},  {0xff, 9},
+  };
+  static constexpr unsigned char singletons0_lower[] = {
+      0xad, 0x78, 0x79, 0x8b, 0x8d, 0xa2, 0x30, 0x57, 0x58, 0x8b, 0x8c, 0x90,
+      0x1c, 0x1d, 0xdd, 0x0e, 0x0f, 0x4b, 0x4c, 0xfb, 0xfc, 0x2e, 0x2f, 0x3f,
+      0x5c, 0x5d, 0x5f, 0xb5, 0xe2, 0x84, 0x8d, 0x8e, 0x91, 0x92, 0xa9, 0xb1,
+      0xba, 0xbb, 0xc5, 0xc6, 0xc9, 0xca, 0xde, 0xe4, 0xe5, 0xff, 0x00, 0x04,
+      0x11, 0x12, 0x29, 0x31, 0x34, 0x37, 0x3a, 0x3b, 0x3d, 0x49, 0x4a, 0x5d,
+      0x84, 0x8e, 0x92, 0xa9, 0xb1, 0xb4, 0xba, 0xbb, 0xc6, 0xca, 0xce, 0xcf,
+      0xe4, 0xe5, 0x00, 0x04, 0x0d, 0x0e, 0x11, 0x12, 0x29, 0x31, 0x34, 0x3a,
+      0x3b, 0x45, 0x46, 0x49, 0x4a, 0x5e, 0x64, 0x65, 0x84, 0x91, 0x9b, 0x9d,
+      0xc9, 0xce, 0xcf, 0x0d, 0x11, 0x29, 0x45, 0x49, 0x57, 0x64, 0x65, 0x8d,
+      0x91, 0xa9, 0xb4, 0xba, 0xbb, 0xc5, 0xc9, 0xdf, 0xe4, 0xe5, 0xf0, 0x0d,
+      0x11, 0x45, 0x49, 0x64, 0x65, 0x80, 0x84, 0xb2, 0xbc, 0xbe, 0xbf, 0xd5,
+      0xd7, 0xf0, 0xf1, 0x83, 0x85, 0x8b, 0xa4, 0xa6, 0xbe, 0xbf, 0xc5, 0xc7,
+      0xce, 0xcf, 0xda, 0xdb, 0x48, 0x98, 0xbd, 0xcd, 0xc6, 0xce, 0xcf, 0x49,
+      0x4e, 0x4f, 0x57, 0x59, 0x5e, 0x5f, 0x89, 0x8e, 0x8f, 0xb1, 0xb6, 0xb7,
+      0xbf, 0xc1, 0xc6, 0xc7, 0xd7, 0x11, 0x16, 0x17, 0x5b, 0x5c, 0xf6, 0xf7,
+      0xfe, 0xff, 0x80, 0x0d, 0x6d, 0x71, 0xde, 0xdf, 0x0e, 0x0f, 0x1f, 0x6e,
+      0x6f, 0x1c, 0x1d, 0x5f, 0x7d, 0x7e, 0xae, 0xaf, 0xbb, 0xbc, 0xfa, 0x16,
+      0x17, 0x1e, 0x1f, 0x46, 0x47, 0x4e, 0x4f, 0x58, 0x5a, 0x5c, 0x5e, 0x7e,
+      0x7f, 0xb5, 0xc5, 0xd4, 0xd5, 0xdc, 0xf0, 0xf1, 0xf5, 0x72, 0x73, 0x8f,
+      0x74, 0x75, 0x96, 0x2f, 0x5f, 0x26, 0x2e, 0x2f, 0xa7, 0xaf, 0xb7, 0xbf,
+      0xc7, 0xcf, 0xd7, 0xdf, 0x9a, 0x40, 0x97, 0x98, 0x30, 0x8f, 0x1f, 0xc0,
+      0xc1, 0xce, 0xff, 0x4e, 0x4f, 0x5a, 0x5b, 0x07, 0x08, 0x0f, 0x10, 0x27,
+      0x2f, 0xee, 0xef, 0x6e, 0x6f, 0x37, 0x3d, 0x3f, 0x42, 0x45, 0x90, 0x91,
+      0xfe, 0xff, 0x53, 0x67, 0x75, 0xc8, 0xc9, 0xd0, 0xd1, 0xd8, 0xd9, 0xe7,
+      0xfe, 0xff,
+  };
+  static constexpr singleton singletons1[] = {
+      {0x00, 6},  {0x01, 1}, {0x03, 1},  {0x04, 2}, {0x08, 8},  {0x09, 2},
+      {0x0a, 5},  {0x0b, 2}, {0x0e, 4},  {0x10, 1}, {0x11, 2},  {0x12, 5},
+      {0x13, 17}, {0x14, 1}, {0x15, 2},  {0x17, 2}, {0x19, 13}, {0x1c, 5},
+      {0x1d, 8},  {0x24, 1}, {0x6a, 3},  {0x6b, 2}, {0xbc, 2},  {0xd1, 2},
+      {0xd4, 12}, {0xd5, 9}, {0xd6, 2},  {0xd7, 2}, {0xda, 1},  {0xe0, 5},
+      {0xe1, 2},  {0xe8, 2}, {0xee, 32}, {0xf0, 4}, {0xf8, 2},  {0xf9, 2},
+      {0xfa, 2},  {0xfb, 1},
+  };
+  static constexpr unsigned char singletons1_lower[] = {
+      0x0c, 0x27, 0x3b, 0x3e, 0x4e, 0x4f, 0x8f, 0x9e, 0x9e, 0x9f, 0x06, 0x07,
+      0x09, 0x36, 0x3d, 0x3e, 0x56, 0xf3, 0xd0, 0xd1, 0x04, 0x14, 0x18, 0x36,
+      0x37, 0x56, 0x57, 0x7f, 0xaa, 0xae, 0xaf, 0xbd, 0x35, 0xe0, 0x12, 0x87,
+      0x89, 0x8e, 0x9e, 0x04, 0x0d, 0x0e, 0x11, 0x12, 0x29, 0x31, 0x34, 0x3a,
+      0x45, 0x46, 0x49, 0x4a, 0x4e, 0x4f, 0x64, 0x65, 0x5c, 0xb6, 0xb7, 0x1b,
+      0x1c, 0x07, 0x08, 0x0a, 0x0b, 0x14, 0x17, 0x36, 0x39, 0x3a, 0xa8, 0xa9,
+      0xd8, 0xd9, 0x09, 0x37, 0x90, 0x91, 0xa8, 0x07, 0x0a, 0x3b, 0x3e, 0x66,
+      0x69, 0x8f, 0x92, 0x6f, 0x5f, 0xee, 0xef, 0x5a, 0x62, 0x9a, 0x9b, 0x27,
+      0x28, 0x55, 0x9d, 0xa0, 0xa1, 0xa3, 0xa4, 0xa7, 0xa8, 0xad, 0xba, 0xbc,
+      0xc4, 0x06, 0x0b, 0x0c, 0x15, 0x1d, 0x3a, 0x3f, 0x45, 0x51, 0xa6, 0xa7,
+      0xcc, 0xcd, 0xa0, 0x07, 0x19, 0x1a, 0x22, 0x25, 0x3e, 0x3f, 0xc5, 0xc6,
+      0x04, 0x20, 0x23, 0x25, 0x26, 0x28, 0x33, 0x38, 0x3a, 0x48, 0x4a, 0x4c,
+      0x50, 0x53, 0x55, 0x56, 0x58, 0x5a, 0x5c, 0x5e, 0x60, 0x63, 0x65, 0x66,
+      0x6b, 0x73, 0x78, 0x7d, 0x7f, 0x8a, 0xa4, 0xaa, 0xaf, 0xb0, 0xc0, 0xd0,
+      0xae, 0xaf, 0x79, 0xcc, 0x6e, 0x6f, 0x93,
+  };
+  static constexpr unsigned char normal0[] = {
+      0x00, 0x20, 0x5f, 0x22, 0x82, 0xdf, 0x04, 0x82, 0x44, 0x08, 0x1b, 0x04,
+      0x06, 0x11, 0x81, 0xac, 0x0e, 0x80, 0xab, 0x35, 0x28, 0x0b, 0x80, 0xe0,
+      0x03, 0x19, 0x08, 0x01, 0x04, 0x2f, 0x04, 0x34, 0x04, 0x07, 0x03, 0x01,
+      0x07, 0x06, 0x07, 0x11, 0x0a, 0x50, 0x0f, 0x12, 0x07, 0x55, 0x07, 0x03,
+      0x04, 0x1c, 0x0a, 0x09, 0x03, 0x08, 0x03, 0x07, 0x03, 0x02, 0x03, 0x03,
+      0x03, 0x0c, 0x04, 0x05, 0x03, 0x0b, 0x06, 0x01, 0x0e, 0x15, 0x05, 0x3a,
+      0x03, 0x11, 0x07, 0x06, 0x05, 0x10, 0x07, 0x57, 0x07, 0x02, 0x07, 0x15,
+      0x0d, 0x50, 0x04, 0x43, 0x03, 0x2d, 0x03, 0x01, 0x04, 0x11, 0x06, 0x0f,
+      0x0c, 0x3a, 0x04, 0x1d, 0x25, 0x5f, 0x20, 0x6d, 0x04, 0x6a, 0x25, 0x80,
+      0xc8, 0x05, 0x82, 0xb0, 0x03, 0x1a, 0x06, 0x82, 0xfd, 0x03, 0x59, 0x07,
+      0x15, 0x0b, 0x17, 0x09, 0x14, 0x0c, 0x14, 0x0c, 0x6a, 0x06, 0x0a, 0x06,
+      0x1a, 0x06, 0x59, 0x07, 0x2b, 0x05, 0x46, 0x0a, 0x2c, 0x04, 0x0c, 0x04,
+      0x01, 0x03, 0x31, 0x0b, 0x2c, 0x04, 0x1a, 0x06, 0x0b, 0x03, 0x80, 0xac,
+      0x06, 0x0a, 0x06, 0x21, 0x3f, 0x4c, 0x04, 0x2d, 0x03, 0x74, 0x08, 0x3c,
+      0x03, 0x0f, 0x03, 0x3c, 0x07, 0x38, 0x08, 0x2b, 0x05, 0x82, 0xff, 0x11,
+      0x18, 0x08, 0x2f, 0x11, 0x2d, 0x03, 0x20, 0x10, 0x21, 0x0f, 0x80, 0x8c,
+      0x04, 0x82, 0x97, 0x19, 0x0b, 0x15, 0x88, 0x94, 0x05, 0x2f, 0x05, 0x3b,
+      0x07, 0x02, 0x0e, 0x18, 0x09, 0x80, 0xb3, 0x2d, 0x74, 0x0c, 0x80, 0xd6,
+      0x1a, 0x0c, 0x05, 0x80, 0xff, 0x05, 0x80, 0xdf, 0x0c, 0xee, 0x0d, 0x03,
+      0x84, 0x8d, 0x03, 0x37, 0x09, 0x81, 0x5c, 0x14, 0x80, 0xb8, 0x08, 0x80,
+      0xcb, 0x2a, 0x38, 0x03, 0x0a, 0x06, 0x38, 0x08, 0x46, 0x08, 0x0c, 0x06,
+      0x74, 0x0b, 0x1e, 0x03, 0x5a, 0x04, 0x59, 0x09, 0x80, 0x83, 0x18, 0x1c,
+      0x0a, 0x16, 0x09, 0x4c, 0x04, 0x80, 0x8a, 0x06, 0xab, 0xa4, 0x0c, 0x17,
+      0x04, 0x31, 0xa1, 0x04, 0x81, 0xda, 0x26, 0x07, 0x0c, 0x05, 0x05, 0x80,
+      0xa5, 0x11, 0x81, 0x6d, 0x10, 0x78, 0x28, 0x2a, 0x06, 0x4c, 0x04, 0x80,
+      0x8d, 0x04, 0x80, 0xbe, 0x03, 0x1b, 0x03, 0x0f, 0x0d,
+  };
+  static constexpr unsigned char normal1[] = {
+      0x5e, 0x22, 0x7b, 0x05, 0x03, 0x04, 0x2d, 0x03, 0x66, 0x03, 0x01, 0x2f,
+      0x2e, 0x80, 0x82, 0x1d, 0x03, 0x31, 0x0f, 0x1c, 0x04, 0x24, 0x09, 0x1e,
+      0x05, 0x2b, 0x05, 0x44, 0x04, 0x0e, 0x2a, 0x80, 0xaa, 0x06, 0x24, 0x04,
+      0x24, 0x04, 0x28, 0x08, 0x34, 0x0b, 0x01, 0x80, 0x90, 0x81, 0x37, 0x09,
+      0x16, 0x0a, 0x08, 0x80, 0x98, 0x39, 0x03, 0x63, 0x08, 0x09, 0x30, 0x16,
+      0x05, 0x21, 0x03, 0x1b, 0x05, 0x01, 0x40, 0x38, 0x04, 0x4b, 0x05, 0x2f,
+      0x04, 0x0a, 0x07, 0x09, 0x07, 0x40, 0x20, 0x27, 0x04, 0x0c, 0x09, 0x36,
+      0x03, 0x3a, 0x05, 0x1a, 0x07, 0x04, 0x0c, 0x07, 0x50, 0x49, 0x37, 0x33,
+      0x0d, 0x33, 0x07, 0x2e, 0x08, 0x0a, 0x81, 0x26, 0x52, 0x4e, 0x28, 0x08,
+      0x2a, 0x56, 0x1c, 0x14, 0x17, 0x09, 0x4e, 0x04, 0x1e, 0x0f, 0x43, 0x0e,
+      0x19, 0x07, 0x0a, 0x06, 0x48, 0x08, 0x27, 0x09, 0x75, 0x0b, 0x3f, 0x41,
+      0x2a, 0x06, 0x3b, 0x05, 0x0a, 0x06, 0x51, 0x06, 0x01, 0x05, 0x10, 0x03,
+      0x05, 0x80, 0x8b, 0x62, 0x1e, 0x48, 0x08, 0x0a, 0x80, 0xa6, 0x5e, 0x22,
+      0x45, 0x0b, 0x0a, 0x06, 0x0d, 0x13, 0x39, 0x07, 0x0a, 0x36, 0x2c, 0x04,
+      0x10, 0x80, 0xc0, 0x3c, 0x64, 0x53, 0x0c, 0x48, 0x09, 0x0a, 0x46, 0x45,
+      0x1b, 0x48, 0x08, 0x53, 0x1d, 0x39, 0x81, 0x07, 0x46, 0x0a, 0x1d, 0x03,
+      0x47, 0x49, 0x37, 0x03, 0x0e, 0x08, 0x0a, 0x06, 0x39, 0x07, 0x0a, 0x81,
+      0x36, 0x19, 0x80, 0xb7, 0x01, 0x0f, 0x32, 0x0d, 0x83, 0x9b, 0x66, 0x75,
+      0x0b, 0x80, 0xc4, 0x8a, 0xbc, 0x84, 0x2f, 0x8f, 0xd1, 0x82, 0x47, 0xa1,
+      0xb9, 0x82, 0x39, 0x07, 0x2a, 0x04, 0x02, 0x60, 0x26, 0x0a, 0x46, 0x0a,
+      0x28, 0x05, 0x13, 0x82, 0xb0, 0x5b, 0x65, 0x4b, 0x04, 0x39, 0x07, 0x11,
+      0x40, 0x05, 0x0b, 0x02, 0x0e, 0x97, 0xf8, 0x08, 0x84, 0xd6, 0x2a, 0x09,
+      0xa2, 0xf7, 0x81, 0x1f, 0x31, 0x03, 0x11, 0x04, 0x08, 0x81, 0x8c, 0x89,
+      0x04, 0x6b, 0x05, 0x0d, 0x03, 0x09, 0x07, 0x10, 0x93, 0x60, 0x80, 0xf6,
+      0x0a, 0x73, 0x08, 0x6e, 0x17, 0x46, 0x80, 0x9a, 0x14, 0x0c, 0x57, 0x09,
+      0x19, 0x80, 0x87, 0x81, 0x47, 0x03, 0x85, 0x42, 0x0f, 0x15, 0x85, 0x50,
+      0x2b, 0x80, 0xd5, 0x2d, 0x03, 0x1a, 0x04, 0x02, 0x81, 0x70, 0x3a, 0x05,
+      0x01, 0x85, 0x00, 0x80, 0xd7, 0x29, 0x4c, 0x04, 0x0a, 0x04, 0x02, 0x83,
+      0x11, 0x44, 0x4c, 0x3d, 0x80, 0xc2, 0x3c, 0x06, 0x01, 0x04, 0x55, 0x05,
+      0x1b, 0x34, 0x02, 0x81, 0x0e, 0x2c, 0x04, 0x64, 0x0c, 0x56, 0x0a, 0x80,
+      0xae, 0x38, 0x1d, 0x0d, 0x2c, 0x04, 0x09, 0x07, 0x02, 0x0e, 0x06, 0x80,
+      0x9a, 0x83, 0xd8, 0x08, 0x0d, 0x03, 0x0d, 0x03, 0x74, 0x0c, 0x59, 0x07,
+      0x0c, 0x14, 0x0c, 0x04, 0x38, 0x08, 0x0a, 0x06, 0x28, 0x08, 0x22, 0x4e,
+      0x81, 0x54, 0x0c, 0x15, 0x03, 0x03, 0x05, 0x07, 0x09, 0x19, 0x07, 0x07,
+      0x09, 0x03, 0x0d, 0x07, 0x29, 0x80, 0xcb, 0x25, 0x0a, 0x84, 0x06,
+  };
+  auto lower = static_cast<uint16_t>(cp);
+  if (cp < 0x10000) {
+    return is_printable(lower, singletons0,
+                        sizeof(singletons0) / sizeof(*singletons0),
+                        singletons0_lower, normal0, sizeof(normal0));
+  }
+  if (cp < 0x20000) {
+    return is_printable(lower, singletons1,
+                        sizeof(singletons1) / sizeof(*singletons1),
+                        singletons1_lower, normal1, sizeof(normal1));
+  }
+  if (0x2a6de <= cp && cp < 0x2a700) return false;
+  if (0x2b735 <= cp && cp < 0x2b740) return false;
+  if (0x2b81e <= cp && cp < 0x2b820) return false;
+  if (0x2cea2 <= cp && cp < 0x2ceb0) return false;
+  if (0x2ebe1 <= cp && cp < 0x2f800) return false;
+  if (0x2fa1e <= cp && cp < 0x30000) return false;
+  if (0x3134b <= cp && cp < 0xe0100) return false;
+  if (0xe01f0 <= cp && cp < 0x110000) return false;
+  return cp < 0x110000;
+}
 
-#ifdef _MSC_VER
-#pragma warning(pop)
-#endif
+}  // namespace detail
+
+FMT_END_NAMESPACE
 
-#endif // FMT_FORMAT_INL_H_
+#endif  // FMT_FORMAT_INL_H_
diff --git a/third_party/fmt/include/fmt/format.h b/third_party/fmt/include/fmt/format.h
index 02e2640d..67f0ab73 100644
--- a/third_party/fmt/include/fmt/format.h
+++ b/third_party/fmt/include/fmt/format.h
@@ -1,3700 +1,4427 @@
 /*
- Formatting library for C++
-
- Copyright (c) 2012 - present, Victor Zverovich
-
- Permission is hereby granted, free of charge, to any person obtaining
- a copy of this software and associated documentation files (the
- "Software"), to deal in the Software without restriction, including
- without limitation the rights to use, copy, modify, merge, publish,
- distribute, sublicense, and/or sell copies of the Software, and to
- permit persons to whom the Software is furnished to do so, subject to
- the following conditions:
-
- The above copyright notice and this permission notice shall be
- included in all copies or substantial portions of the Software.
-
- THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
- EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
- MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
- NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
- LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
- OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
- WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
-
- --- Optional exception to the license ---
-
- As an exception, if, as a result of your compiling your source code, portions
- of this Software are embedded into a machine-executable object form of such
- source code, you may redistribute such embedded portions in such object form
- without including the above copyright and permission notices.
+  Formatting library for C++
+
+  Copyright (c) 2012 - present, Victor Zverovich
+
+  Permission is hereby granted, free of charge, to any person obtaining
+  a copy of this software and associated documentation files (the
+  "Software"), to deal in the Software without restriction, including
+  without limitation the rights to use, copy, modify, merge, publish,
+  distribute, sublicense, and/or sell copies of the Software, and to
+  permit persons to whom the Software is furnished to do so, subject to
+  the following conditions:
+
+  The above copyright notice and this permission notice shall be
+  included in all copies or substantial portions of the Software.
+
+  THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+  EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+  MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+  NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
+  LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
+  OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
+  WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+  --- Optional exception to the license ---
+
+  As an exception, if, as a result of your compiling your source code, portions
+  of this Software are embedded into a machine-executable object form of such
+  source code, you may redistribute such embedded portions in such object form
+  without including the above copyright and permission notices.
  */
 
 #ifndef FMT_FORMAT_H_
 #define FMT_FORMAT_H_
 
-#include "fmt/core.h"
-#include <algorithm>
-#include <cerrno>
-#include <cmath>
-#include <cstdint>
-#include <limits>
-#include <memory>
-#include <stdexcept>
-
-#ifdef __clang__
-#define FMT_CLANG_VERSION (__clang_major__ * 100 + __clang_minor__)
-#else
-#define FMT_CLANG_VERSION 0
+#ifndef _LIBCPP_REMOVE_TRANSITIVE_INCLUDES
+#  define _LIBCPP_REMOVE_TRANSITIVE_INCLUDES
+#  define FMT_REMOVE_TRANSITIVE_INCLUDES
 #endif
 
-#ifdef __INTEL_COMPILER
-#define FMT_ICC_VERSION __INTEL_COMPILER
-#elif defined(__ICL)
-#define FMT_ICC_VERSION __ICL
+#include "base.h"
+
+#ifndef FMT_MODULE
+#  include <cmath>             // std::signbit
+#  include <cstdint>           // uint32_t
+#  include <cstring>           // std::memcpy
+#  include <initializer_list>  // std::initializer_list
+#  include <limits>            // std::numeric_limits
+#  if defined(__GLIBCXX__) && !defined(_GLIBCXX_USE_DUAL_ABI)
+// Workaround for pre gcc 5 libstdc++.
+#    include <memory>  // std::allocator_traits
+#  endif
+#  include <stdexcept>     // std::runtime_error
+#  include <string>        // std::string
+#  include <system_error>  // std::system_error
+
+// Checking FMT_CPLUSPLUS for warning suppression in MSVC.
+#  if FMT_HAS_INCLUDE(<bit>) && FMT_CPLUSPLUS > 201703L
+#    include <bit>  // std::bit_cast
+#  endif
+
+// libc++ supports string_view in pre-c++17.
+#  if FMT_HAS_INCLUDE(<string_view>) && \
+      (FMT_CPLUSPLUS >= 201703L || defined(_LIBCPP_VERSION))
+#    include <string_view>
+#    define FMT_USE_STRING_VIEW
+#  endif
+#endif  // FMT_MODULE
+
+#if defined __cpp_inline_variables && __cpp_inline_variables >= 201606L
+#  define FMT_INLINE_VARIABLE inline
 #else
-#define FMT_ICC_VERSION 0
+#  define FMT_INLINE_VARIABLE
+#endif
+
+#ifndef FMT_NO_UNIQUE_ADDRESS
+#  if FMT_CPLUSPLUS >= 202002L
+#    if FMT_HAS_CPP_ATTRIBUTE(no_unique_address)
+#      define FMT_NO_UNIQUE_ADDRESS [[no_unique_address]]
+// VS2019 v16.10 and later except clang-cl (https://reviews.llvm.org/D110485).
+#    elif (FMT_MSC_VERSION >= 1929) && !FMT_CLANG_VERSION
+#      define FMT_NO_UNIQUE_ADDRESS [[msvc::no_unique_address]]
+#    endif
+#  endif
+#endif
+#ifndef FMT_NO_UNIQUE_ADDRESS
+#  define FMT_NO_UNIQUE_ADDRESS
 #endif
 
-#ifdef __NVCC__
-#define FMT_CUDA_VERSION (__CUDACC_VER_MAJOR__ * 100 + __CUDACC_VER_MINOR__)
+// Visibility when compiled as a shared library/object.
+#if defined(FMT_LIB_EXPORT) || defined(FMT_SHARED)
+#  define FMT_SO_VISIBILITY(value) FMT_VISIBILITY(value)
 #else
-#define FMT_CUDA_VERSION 0
+#  define FMT_SO_VISIBILITY(value)
 #endif
 
 #ifdef __has_builtin
-#define FMT_HAS_BUILTIN(x) __has_builtin(x)
+#  define FMT_HAS_BUILTIN(x) __has_builtin(x)
 #else
-#define FMT_HAS_BUILTIN(x) 0
+#  define FMT_HAS_BUILTIN(x) 0
 #endif
 
-#if FMT_HAS_CPP_ATTRIBUTE(fallthrough) && (__cplusplus >= 201703 || FMT_GCC_VERSION != 0)
-#define FMT_FALLTHROUGH [[fallthrough]]
-#elif defined(DUCKDB_EXPLICIT_FALLTHROUGH)
-#define FMT_FALLTHROUGH DUCKDB_EXPLICIT_FALLTHROUGH
+#if FMT_GCC_VERSION || FMT_CLANG_VERSION
+#  define FMT_NOINLINE __attribute__((noinline))
 #else
-#define FMT_FALLTHROUGH
+#  define FMT_NOINLINE
 #endif
 
+namespace std {
+template <> struct iterator_traits<fmt::appender> {
+  using iterator_category = output_iterator_tag;
+  using value_type = char;
+};
+}  // namespace std
+
 #ifndef FMT_THROW
-#if FMT_EXCEPTIONS
-#if FMT_MSC_VER
+#  if FMT_EXCEPTIONS
+#    if FMT_MSC_VERSION || defined(__NVCC__)
 FMT_BEGIN_NAMESPACE
-namespace internal {
-template <typename Exception>
-inline void do_throw(const Exception& x) {
-	// Silence unreachable code warnings in MSVC because these are nearly
-	// impossible to fix in a generic code.
-	volatile bool b = true;
-	if (b)
-		throw x;
-}
-} // namespace internal
+namespace detail {
+template <typename Exception> inline void do_throw(const Exception& x) {
+  // Silence unreachable code warnings in MSVC and NVCC because these
+  // are nearly impossible to fix in a generic code.
+  volatile bool b = true;
+  if (b) throw x;
+}
+}  // namespace detail
 FMT_END_NAMESPACE
-#define FMT_THROW(x) internal::do_throw(x)
-#else
-#define FMT_THROW(x) throw x
-#endif
-#else
-#define FMT_THROW(x)                                                                                                   \
-	do {                                                                                                               \
-		static_cast<void>(sizeof(x));                                                                                  \
-		FMT_ASSERT(false, "");                                                                                         \
-	} while (false)
+#      define FMT_THROW(x) detail::do_throw(x)
+#    else
+#      define FMT_THROW(x) throw x
+#    endif
+#  else
+#    define FMT_THROW(x) \
+      ::fmt::detail::assert_fail(__FILE__, __LINE__, (x).what())
+#  endif
 #endif
+
+#ifndef FMT_MAYBE_UNUSED
+#  if FMT_HAS_CPP17_ATTRIBUTE(maybe_unused)
+#    define FMT_MAYBE_UNUSED [[maybe_unused]]
+#  else
+#    define FMT_MAYBE_UNUSED
+#  endif
 #endif
 
 #ifndef FMT_USE_USER_DEFINED_LITERALS
-// For Intel and NVIDIA compilers both they and the system gcc/msc support UDLs.
-#if (FMT_HAS_FEATURE(cxx_user_literals) || FMT_GCC_VERSION >= 407 || FMT_MSC_VER >= 1900) &&                           \
-    (!(FMT_ICC_VERSION || FMT_CUDA_VERSION) || FMT_ICC_VERSION >= 1500 || FMT_CUDA_VERSION >= 700)
-#define FMT_USE_USER_DEFINED_LITERALS 1
-#else
-#define FMT_USE_USER_DEFINED_LITERALS 0
-#endif
+// EDG based compilers (Intel, NVIDIA, Elbrus, etc), GCC and MSVC support UDLs.
+//
+// GCC before 4.9 requires a space in `operator"" _a` which is invalid in later
+// compiler versions.
+#  if (FMT_HAS_FEATURE(cxx_user_literals) || FMT_GCC_VERSION >= 409 || \
+       FMT_MSC_VERSION >= 1900) &&                                     \
+      (!defined(__EDG_VERSION__) || __EDG_VERSION__ >= /* UDL feature */ 480)
+#    define FMT_USE_USER_DEFINED_LITERALS 1
+#  else
+#    define FMT_USE_USER_DEFINED_LITERALS 0
+#  endif
 #endif
 
-#ifndef FMT_USE_UDL_TEMPLATE
-#define FMT_USE_UDL_TEMPLATE 0
+// Defining FMT_REDUCE_INT_INSTANTIATIONS to 1, will reduce the number of
+// integer formatter template instantiations to just one by only using the
+// largest integer type. This results in a reduction in binary size but will
+// cause a decrease in integer formatting performance.
+#if !defined(FMT_REDUCE_INT_INSTANTIATIONS)
+#  define FMT_REDUCE_INT_INSTANTIATIONS 0
 #endif
 
 // __builtin_clz is broken in clang with Microsoft CodeGen:
-// https://github.com/fmtlib/fmt/issues/519
-#if (FMT_GCC_VERSION || FMT_HAS_BUILTIN(__builtin_clz)) && !FMT_MSC_VER
-#define FMT_BUILTIN_CLZ(n) __builtin_clz(n)
+// https://github.com/fmtlib/fmt/issues/519.
+#if !FMT_MSC_VERSION
+#  if FMT_HAS_BUILTIN(__builtin_clz) || FMT_GCC_VERSION || FMT_ICC_VERSION
+#    define FMT_BUILTIN_CLZ(n) __builtin_clz(n)
+#  endif
+#  if FMT_HAS_BUILTIN(__builtin_clzll) || FMT_GCC_VERSION || FMT_ICC_VERSION
+#    define FMT_BUILTIN_CLZLL(n) __builtin_clzll(n)
+#  endif
 #endif
-#if (FMT_GCC_VERSION || FMT_HAS_BUILTIN(__builtin_clzll)) && !FMT_MSC_VER
-#define FMT_BUILTIN_CLZLL(n) __builtin_clzll(n)
+
+// __builtin_ctz is broken in Intel Compiler Classic on Windows:
+// https://github.com/fmtlib/fmt/issues/2510.
+#ifndef __ICL
+#  if FMT_HAS_BUILTIN(__builtin_ctz) || FMT_GCC_VERSION || FMT_ICC_VERSION || \
+      defined(__NVCOMPILER)
+#    define FMT_BUILTIN_CTZ(n) __builtin_ctz(n)
+#  endif
+#  if FMT_HAS_BUILTIN(__builtin_ctzll) || FMT_GCC_VERSION || \
+      FMT_ICC_VERSION || defined(__NVCOMPILER)
+#    define FMT_BUILTIN_CTZLL(n) __builtin_ctzll(n)
+#  endif
+#endif
+
+#if FMT_MSC_VERSION
+#  include <intrin.h>  // _BitScanReverse[64], _BitScanForward[64], _umul128
 #endif
 
 // Some compilers masquerade as both MSVC and GCC-likes or otherwise support
 // __builtin_clz and __builtin_clzll, so only define FMT_BUILTIN_CLZ using the
 // MSVC intrinsics if the clz and clzll builtins are not available.
-#if FMT_MSC_VER && !defined(FMT_BUILTIN_CLZLL) && !defined(_MANAGED)
-#include <intrin.h> // _BitScanReverse, _BitScanReverse64
-
+#if FMT_MSC_VERSION && !defined(FMT_BUILTIN_CLZLL) && \
+    !defined(FMT_BUILTIN_CTZLL)
 FMT_BEGIN_NAMESPACE
-namespace internal {
+namespace detail {
 // Avoid Clang with Microsoft CodeGen's -Wunknown-pragmas warning.
-#ifndef __clang__
-#pragma intrinsic(_BitScanReverse)
+#  if !defined(__clang__)
+#    pragma intrinsic(_BitScanForward)
+#    pragma intrinsic(_BitScanReverse)
+#    if defined(_WIN64)
+#      pragma intrinsic(_BitScanForward64)
+#      pragma intrinsic(_BitScanReverse64)
+#    endif
+#  endif
+
+inline auto clz(uint32_t x) -> int {
+  unsigned long r = 0;
+  _BitScanReverse(&r, x);
+  FMT_ASSERT(x != 0, "");
+  // Static analysis complains about using uninitialized data
+  // "r", but the only way that can happen is if "x" is 0,
+  // which the callers guarantee to not happen.
+  FMT_MSC_WARNING(suppress : 6102)
+  return 31 ^ static_cast<int>(r);
+}
+#  define FMT_BUILTIN_CLZ(n) detail::clz(n)
+
+inline auto clzll(uint64_t x) -> int {
+  unsigned long r = 0;
+#  ifdef _WIN64
+  _BitScanReverse64(&r, x);
+#  else
+  // Scan the high 32 bits.
+  if (_BitScanReverse(&r, static_cast<uint32_t>(x >> 32)))
+    return 63 ^ static_cast<int>(r + 32);
+  // Scan the low 32 bits.
+  _BitScanReverse(&r, static_cast<uint32_t>(x));
+#  endif
+  FMT_ASSERT(x != 0, "");
+  FMT_MSC_WARNING(suppress : 6102)  // Suppress a bogus static analysis warning.
+  return 63 ^ static_cast<int>(r);
+}
+#  define FMT_BUILTIN_CLZLL(n) detail::clzll(n)
+
+inline auto ctz(uint32_t x) -> int {
+  unsigned long r = 0;
+  _BitScanForward(&r, x);
+  FMT_ASSERT(x != 0, "");
+  FMT_MSC_WARNING(suppress : 6102)  // Suppress a bogus static analysis warning.
+  return static_cast<int>(r);
+}
+#  define FMT_BUILTIN_CTZ(n) detail::ctz(n)
+
+inline auto ctzll(uint64_t x) -> int {
+  unsigned long r = 0;
+  FMT_ASSERT(x != 0, "");
+  FMT_MSC_WARNING(suppress : 6102)  // Suppress a bogus static analysis warning.
+#  ifdef _WIN64
+  _BitScanForward64(&r, x);
+#  else
+  // Scan the low 32 bits.
+  if (_BitScanForward(&r, static_cast<uint32_t>(x))) return static_cast<int>(r);
+  // Scan the high 32 bits.
+  _BitScanForward(&r, static_cast<uint32_t>(x >> 32));
+  r += 32;
+#  endif
+  return static_cast<int>(r);
+}
+#  define FMT_BUILTIN_CTZLL(n) detail::ctzll(n)
+}  // namespace detail
+FMT_END_NAMESPACE
 #endif
-inline uint32_t clz(uint32_t x) {
-	unsigned long r = 0;
-	_BitScanReverse(&r, x);
 
-	FMT_ASSERT(x != 0, "");
-	// Static analysis complains about using uninitialized data
-	// "r", but the only way that can happen is if "x" is 0,
-	// which the callers guarantee to not happen.
-#pragma warning(suppress : 6102)
-	return 31 - r;
-}
-#define FMT_BUILTIN_CLZ(n) internal::clz(n)
+FMT_BEGIN_NAMESPACE
 
-#if defined(_WIN64) && !defined(__clang__)
-#pragma intrinsic(_BitScanReverse64)
-#endif
+template <typename Char, typename Traits, typename Allocator>
+struct is_contiguous<std::basic_string<Char, Traits, Allocator>>
+    : std::true_type {};
 
-inline uint32_t clzll(uint64_t x) {
-	unsigned long r = 0;
-#ifdef _WIN64
-	_BitScanReverse64(&r, x);
-#else
-	// Scan the high 32 bits.
-	if (_BitScanReverse(&r, static_cast<uint32_t>(x >> 32)))
-		return 63 - (r + 32);
+namespace detail {
 
-	// Scan the low 32 bits.
-	_BitScanReverse(&r, static_cast<uint32_t>(x));
+FMT_CONSTEXPR inline void abort_fuzzing_if(bool condition) {
+  ignore_unused(condition);
+#ifdef FMT_FUZZ
+  if (condition) throw std::runtime_error("fuzzing limit reached");
 #endif
-
-	FMT_ASSERT(x != 0, "");
-	// Static analysis complains about using uninitialized data
-	// "r", but the only way that can happen is if "x" is 0,
-	// which the callers guarantee to not happen.
-#pragma warning(suppress : 6102)
-	return 63 - r;
 }
-#define FMT_BUILTIN_CLZLL(n) internal::clzll(n)
-} // namespace internal
-FMT_END_NAMESPACE
-#endif
 
-// Enable the deprecated numeric alignment.
-#ifndef FMT_NUMERIC_ALIGN
-#define FMT_NUMERIC_ALIGN 1
+#if defined(FMT_USE_STRING_VIEW)
+template <typename Char> using std_string_view = std::basic_string_view<Char>;
+#else
+template <typename T> struct std_string_view {};
 #endif
 
-// Enable the deprecated percent specifier.
-#ifndef FMT_DEPRECATED_PERCENT
-#define FMT_DEPRECATED_PERCENT 0
+// Implementation of std::bit_cast for pre-C++20.
+template <typename To, typename From, FMT_ENABLE_IF(sizeof(To) == sizeof(From))>
+FMT_CONSTEXPR20 auto bit_cast(const From& from) -> To {
+#ifdef __cpp_lib_bit_cast
+  if (is_constant_evaluated()) return std::bit_cast<To>(from);
 #endif
+  auto to = To();
+  // The cast suppresses a bogus -Wclass-memaccess on GCC.
+  std::memcpy(static_cast<void*>(&to), &from, sizeof(to));
+  return to;
+}
 
-FMT_BEGIN_NAMESPACE
-namespace internal {
+inline auto is_big_endian() -> bool {
+#ifdef _WIN32
+  return false;
+#elif defined(__BIG_ENDIAN__)
+  return true;
+#elif defined(__BYTE_ORDER__) && defined(__ORDER_BIG_ENDIAN__)
+  return __BYTE_ORDER__ == __ORDER_BIG_ENDIAN__;
+#else
+  struct bytes {
+    char data[sizeof(int)];
+  };
+  return bit_cast<bytes>(1).data[0] == 0;
+#endif
+}
 
-// A helper function to suppress bogus "conditional expression is constant"
-// warnings.
-template <typename T>
-inline T const_check(T value) {
-	return value;
-}
-
-// An equivalent of `*reinterpret_cast<Dest*>(&source)` that doesn't have
-// undefined behavior (e.g. due to type aliasing).
-// Example: uint64_t d = bit_cast<uint64_t>(2.718);
-template <typename Dest, typename Source>
-inline Dest bit_cast(const Source& source) {
-	static_assert(sizeof(Dest) == sizeof(Source), "size mismatch");
-	Dest dest;
-	std::memcpy(&dest, &source, sizeof(dest));
-	return dest;
-}
-
-inline bool is_big_endian() {
-	auto u = 1u;
-	struct bytes {
-		char data[sizeof(u)];
-	};
-	return bit_cast<bytes>(u).data[0] == 0;
-}
-
-// A fallback implementation of uintptr_t for systems that lack it.
-struct fallback_uintptr {
-	unsigned char value[sizeof(void*)];
-
-	fallback_uintptr() = default;
-
-	explicit fallback_uintptr(const void* p) {
-		*this = bit_cast<fallback_uintptr>(p);
-		if (is_big_endian()) {
-			for (size_t i = 0, j = sizeof(void*) - 1; i < j; ++i, --j)
-				std::swap(value[i], value[j]);
-		}
-	}
+class uint128_fallback {
+ private:
+  uint64_t lo_, hi_;
+
+ public:
+  constexpr uint128_fallback(uint64_t hi, uint64_t lo) : lo_(lo), hi_(hi) {}
+  constexpr uint128_fallback(uint64_t value = 0) : lo_(value), hi_(0) {}
+
+  constexpr auto high() const noexcept -> uint64_t { return hi_; }
+  constexpr auto low() const noexcept -> uint64_t { return lo_; }
+
+  template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
+  constexpr explicit operator T() const {
+    return static_cast<T>(lo_);
+  }
+
+  friend constexpr auto operator==(const uint128_fallback& lhs,
+                                   const uint128_fallback& rhs) -> bool {
+    return lhs.hi_ == rhs.hi_ && lhs.lo_ == rhs.lo_;
+  }
+  friend constexpr auto operator!=(const uint128_fallback& lhs,
+                                   const uint128_fallback& rhs) -> bool {
+    return !(lhs == rhs);
+  }
+  friend constexpr auto operator>(const uint128_fallback& lhs,
+                                  const uint128_fallback& rhs) -> bool {
+    return lhs.hi_ != rhs.hi_ ? lhs.hi_ > rhs.hi_ : lhs.lo_ > rhs.lo_;
+  }
+  friend constexpr auto operator|(const uint128_fallback& lhs,
+                                  const uint128_fallback& rhs)
+      -> uint128_fallback {
+    return {lhs.hi_ | rhs.hi_, lhs.lo_ | rhs.lo_};
+  }
+  friend constexpr auto operator&(const uint128_fallback& lhs,
+                                  const uint128_fallback& rhs)
+      -> uint128_fallback {
+    return {lhs.hi_ & rhs.hi_, lhs.lo_ & rhs.lo_};
+  }
+  friend constexpr auto operator~(const uint128_fallback& n)
+      -> uint128_fallback {
+    return {~n.hi_, ~n.lo_};
+  }
+  friend auto operator+(const uint128_fallback& lhs,
+                        const uint128_fallback& rhs) -> uint128_fallback {
+    auto result = uint128_fallback(lhs);
+    result += rhs;
+    return result;
+  }
+  friend auto operator*(const uint128_fallback& lhs, uint32_t rhs)
+      -> uint128_fallback {
+    FMT_ASSERT(lhs.hi_ == 0, "");
+    uint64_t hi = (lhs.lo_ >> 32) * rhs;
+    uint64_t lo = (lhs.lo_ & ~uint32_t()) * rhs;
+    uint64_t new_lo = (hi << 32) + lo;
+    return {(hi >> 32) + (new_lo < lo ? 1 : 0), new_lo};
+  }
+  friend auto operator-(const uint128_fallback& lhs, uint64_t rhs)
+      -> uint128_fallback {
+    return {lhs.hi_ - (lhs.lo_ < rhs ? 1 : 0), lhs.lo_ - rhs};
+  }
+  FMT_CONSTEXPR auto operator>>(int shift) const -> uint128_fallback {
+    if (shift == 64) return {0, hi_};
+    if (shift > 64) return uint128_fallback(0, hi_) >> (shift - 64);
+    return {hi_ >> shift, (hi_ << (64 - shift)) | (lo_ >> shift)};
+  }
+  FMT_CONSTEXPR auto operator<<(int shift) const -> uint128_fallback {
+    if (shift == 64) return {lo_, 0};
+    if (shift > 64) return uint128_fallback(lo_, 0) << (shift - 64);
+    return {hi_ << shift | (lo_ >> (64 - shift)), (lo_ << shift)};
+  }
+  FMT_CONSTEXPR auto operator>>=(int shift) -> uint128_fallback& {
+    return *this = *this >> shift;
+  }
+  FMT_CONSTEXPR void operator+=(uint128_fallback n) {
+    uint64_t new_lo = lo_ + n.lo_;
+    uint64_t new_hi = hi_ + n.hi_ + (new_lo < lo_ ? 1 : 0);
+    FMT_ASSERT(new_hi >= hi_, "");
+    lo_ = new_lo;
+    hi_ = new_hi;
+  }
+  FMT_CONSTEXPR void operator&=(uint128_fallback n) {
+    lo_ &= n.lo_;
+    hi_ &= n.hi_;
+  }
+
+  FMT_CONSTEXPR20 auto operator+=(uint64_t n) noexcept -> uint128_fallback& {
+    if (is_constant_evaluated()) {
+      lo_ += n;
+      hi_ += (lo_ < n ? 1 : 0);
+      return *this;
+    }
+#if FMT_HAS_BUILTIN(__builtin_addcll) && !defined(__ibmxl__)
+    unsigned long long carry;
+    lo_ = __builtin_addcll(lo_, n, 0, &carry);
+    hi_ += carry;
+#elif FMT_HAS_BUILTIN(__builtin_ia32_addcarryx_u64) && !defined(__ibmxl__)
+    unsigned long long result;
+    auto carry = __builtin_ia32_addcarryx_u64(0, lo_, n, &result);
+    lo_ = result;
+    hi_ += carry;
+#elif defined(_MSC_VER) && defined(_M_X64)
+    auto carry = _addcarry_u64(0, lo_, n, &lo_);
+    _addcarry_u64(carry, hi_, 0, &hi_);
+#else
+    lo_ += n;
+    hi_ += (lo_ < n ? 1 : 0);
+#endif
+    return *this;
+  }
 };
 
+using uint128_t = conditional_t<FMT_USE_INT128, uint128_opt, uint128_fallback>;
+
 #ifdef UINTPTR_MAX
 using uintptr_t = ::uintptr_t;
-
-inline uintptr_t to_uintptr(const void* p) {
-	return bit_cast<uintptr_t>(p);
-}
-
 #else
-using uintptr_t = fallback_uintptr;
-inline fallback_uintptr to_uintptr(const void* p) {
-	return fallback_uintptr(p);
-}
+using uintptr_t = uint128_t;
 #endif
 
 // Returns the largest possible value for type T. Same as
 // std::numeric_limits<T>::max() but shorter and not affected by the max macro.
-template <typename T>
-constexpr T max_value() {
-	return (std::numeric_limits<T>::max)();
+template <typename T> constexpr auto max_value() -> T {
+  return (std::numeric_limits<T>::max)();
+}
+template <typename T> constexpr auto num_bits() -> int {
+  return std::numeric_limits<T>::digits;
+}
+// std::numeric_limits<T>::digits may return 0 for 128-bit ints.
+template <> constexpr auto num_bits<int128_opt>() -> int { return 128; }
+template <> constexpr auto num_bits<uint128_opt>() -> int { return 128; }
+template <> constexpr auto num_bits<uint128_fallback>() -> int { return 128; }
+
+// A heterogeneous bit_cast used for converting 96-bit long double to uint128_t
+// and 128-bit pointers to uint128_fallback.
+template <typename To, typename From, FMT_ENABLE_IF(sizeof(To) > sizeof(From))>
+inline auto bit_cast(const From& from) -> To {
+  constexpr auto size = static_cast<int>(sizeof(From) / sizeof(unsigned));
+  struct data_t {
+    unsigned value[static_cast<unsigned>(size)];
+  } data = bit_cast<data_t>(from);
+  auto result = To();
+  if (const_check(is_big_endian())) {
+    for (int i = 0; i < size; ++i)
+      result = (result << num_bits<unsigned>()) | data.value[i];
+  } else {
+    for (int i = size - 1; i >= 0; --i)
+      result = (result << num_bits<unsigned>()) | data.value[i];
+  }
+  return result;
 }
 
-template <typename T>
-constexpr int num_bits() {
-	return std::numeric_limits<T>::digits;
+template <typename UInt>
+FMT_CONSTEXPR20 inline auto countl_zero_fallback(UInt n) -> int {
+  int lz = 0;
+  constexpr UInt msb_mask = static_cast<UInt>(1) << (num_bits<UInt>() - 1);
+  for (; (n & msb_mask) == 0; n <<= 1) lz++;
+  return lz;
 }
 
-template <>
-constexpr int num_bits<fallback_uintptr>() {
-	return static_cast<int>(sizeof(void*) * std::numeric_limits<unsigned char>::digits);
+FMT_CONSTEXPR20 inline auto countl_zero(uint32_t n) -> int {
+#ifdef FMT_BUILTIN_CLZ
+  if (!is_constant_evaluated()) return FMT_BUILTIN_CLZ(n);
+#endif
+  return countl_zero_fallback(n);
 }
 
-// An approximation of iterator_t for pre-C++20 systems.
-template <typename T>
-using iterator_t = decltype(std::begin(std::declval<T&>()));
+FMT_CONSTEXPR20 inline auto countl_zero(uint64_t n) -> int {
+#ifdef FMT_BUILTIN_CLZLL
+  if (!is_constant_evaluated()) return FMT_BUILTIN_CLZLL(n);
+#endif
+  return countl_zero_fallback(n);
+}
 
-// Detect the iterator category of *any* given type in a SFINAE-friendly way.
-// Unfortunately, older implementations of std::iterator_traits are not safe
-// for use in a SFINAE-context.
-template <typename It, typename Enable = void>
-struct iterator_category : std::false_type {};
+FMT_INLINE void assume(bool condition) {
+  (void)condition;
+#if FMT_HAS_BUILTIN(__builtin_assume) && !FMT_ICC_VERSION
+  __builtin_assume(condition);
+#elif FMT_GCC_VERSION
+  if (!condition) __builtin_unreachable();
+#endif
+}
 
+// An approximation of iterator_t for pre-C++20 systems.
 template <typename T>
-struct iterator_category<T*> {
-	using type = std::random_access_iterator_tag;
-};
-
-template <typename It>
-struct iterator_category<It, void_t<typename It::iterator_category>> {
-	using type = typename It::iterator_category;
-};
-
-// Detect if *any* given type models the OutputIterator concept.
-template <typename It>
-class is_output_iterator {
-	// Check for mutability because all iterator categories derived from
-	// std::input_iterator_tag *may* also meet the requirements of an
-	// OutputIterator, thereby falling into the category of 'mutable iterators'
-	// [iterator.requirements.general] clause 4. The compiler reveals this
-	// property only at the point of *actually dereferencing* the iterator!
-	template <typename U>
-	static decltype(*(std::declval<U>())) test(std::input_iterator_tag);
-
-	template <typename U>
-	static char& test(std::output_iterator_tag);
-
-	template <typename U>
-	static const char& test(...);
-
-	using type = decltype(test<It>(typename iterator_category<It>::type {}));
-
-public:
-	static const bool value = !std::is_const<remove_reference_t<type>>::value;
-};
+using iterator_t = decltype(std::begin(std::declval<T&>()));
+template <typename T> using sentinel_t = decltype(std::end(std::declval<T&>()));
 
 // A workaround for std::string not having mutable data() until C++17.
 template <typename Char>
-inline Char* get_data(std::basic_string<Char>& s) {
-	return &s[0];
+inline auto get_data(std::basic_string<Char>& s) -> Char* {
+  return &s[0];
 }
-
 template <typename Container>
-inline typename Container::value_type* get_data(Container& c) {
-	return c.data();
+inline auto get_data(Container& c) -> typename Container::value_type* {
+  return c.data();
 }
 
-#ifdef _SECURE_SCL
-// Make a checked iterator to avoid MSVC warnings.
-template <typename T>
-using checked_ptr = stdext::checked_array_iterator<T*>;
-template <typename T>
-checked_ptr<T> make_checked(T* p, std::size_t size) {
-	return {p, size};
+// Attempts to reserve space for n extra characters in the output range.
+// Returns a pointer to the reserved range or a reference to it.
+template <typename OutputIt,
+          FMT_ENABLE_IF(is_back_insert_iterator<OutputIt>::value&&
+                            is_contiguous<typename OutputIt::container>::value)>
+#if FMT_CLANG_VERSION >= 307 && !FMT_ICC_VERSION
+__attribute__((no_sanitize("undefined")))
+#endif
+inline auto
+reserve(OutputIt it, size_t n) -> typename OutputIt::value_type* {
+  auto& c = get_container(it);
+  size_t size = c.size();
+  c.resize(size + n);
+  return get_data(c) + size;
 }
-#else
-template <typename T>
-using checked_ptr = T*;
 
 template <typename T>
-inline T* make_checked(T* p, std::size_t) {
-	return p;
-}
-
-#endif
-
-template <typename Container, FMT_ENABLE_IF(is_contiguous<Container>::value)>
-inline checked_ptr<typename Container::value_type> reserve(std::back_insert_iterator<Container>& it, std::size_t n) {
-	Container& c = get_container(it);
-	std::size_t size = c.size();
-	c.resize(size + n);
-	return make_checked(get_data(c) + size, n);
+inline auto reserve(basic_appender<T> it, size_t n) -> basic_appender<T> {
+  buffer<T>& buf = get_container(it);
+  buf.try_reserve(buf.size() + n);
+  return it;
 }
 
 template <typename Iterator>
-inline Iterator& reserve(Iterator& it, std::size_t) {
-	return it;
+constexpr auto reserve(Iterator& it, size_t) -> Iterator& {
+  return it;
 }
 
-// An output iterator that counts the number of objects written to it and
-// discards them.
-class counting_iterator {
-private:
-	std::size_t count_;
-
-public:
-	using iterator_category = std::output_iterator_tag;
-	using difference_type = std::ptrdiff_t;
-	using pointer = void;
-	using reference = void;
-	using _Unchecked_type = counting_iterator; // Mark iterator as checked.
-
-	struct value_type {
-		template <typename T>
-		void operator=(const T&) {
-		}
-	};
-
-	counting_iterator() : count_(0) {
-	}
-
-	std::size_t count() const {
-		return count_;
-	}
-
-	counting_iterator& operator++() {
-		++count_;
-		return *this;
-	}
-
-	counting_iterator operator++(int) {
-		auto it = *this;
-		++*this;
-		return it;
-	}
-
-	value_type operator*() const {
-		return {};
-	}
-};
-
-template <typename OutputIt>
-class truncating_iterator_base {
-protected:
-	OutputIt out_;
-	std::size_t limit_;
-	std::size_t count_;
-
-	truncating_iterator_base(OutputIt out, std::size_t limit) : out_(out), limit_(limit), count_(0) {
-	}
-
-public:
-	using iterator_category = std::output_iterator_tag;
-	using difference_type = void;
-	using pointer = void;
-	using reference = void;
-	using _Unchecked_type = truncating_iterator_base; // Mark iterator as checked.
-
-	OutputIt base() const {
-		return out_;
-	}
-
-	std::size_t count() const {
-		return count_;
-	}
-};
-
-// An output iterator that truncates the output and counts the number of objects
-// written to it.
-template <typename OutputIt,
-          typename Enable = typename std::is_void<typename std::iterator_traits<OutputIt>::value_type>::type>
-class truncating_iterator;
-
 template <typename OutputIt>
-class truncating_iterator<OutputIt, std::false_type> : public truncating_iterator_base<OutputIt> {
-	using traits = std::iterator_traits<OutputIt>;
-
-	mutable typename traits::value_type blackhole_;
-
-public:
-	using value_type = typename traits::value_type;
+using reserve_iterator =
+    remove_reference_t<decltype(reserve(std::declval<OutputIt&>(), 0))>;
 
-	truncating_iterator(OutputIt out, std::size_t limit) : truncating_iterator_base<OutputIt>(out, limit) {
-	}
-
-	truncating_iterator& operator++() {
-		if (this->count_++ < this->limit_)
-			++this->out_;
-		return *this;
-	}
-
-	truncating_iterator operator++(int) {
-		auto it = *this;
-		++*this;
-		return it;
-	}
-
-	value_type& operator*() const {
-		return this->count_ < this->limit_ ? *this->out_ : blackhole_;
-	}
-};
+template <typename T, typename OutputIt>
+constexpr auto to_pointer(OutputIt, size_t) -> T* {
+  return nullptr;
+}
+template <typename T> auto to_pointer(basic_appender<T> it, size_t n) -> T* {
+  buffer<T>& buf = get_container(it);
+  auto size = buf.size();
+  buf.try_reserve(size + n);
+  if (buf.capacity() < size + n) return nullptr;
+  buf.try_resize(size + n);
+  return buf.data() + size;
+}
 
-template <typename OutputIt>
-class truncating_iterator<OutputIt, std::true_type> : public truncating_iterator_base<OutputIt> {
-public:
-	using value_type = typename OutputIt::container_type::value_type;
-
-	truncating_iterator(OutputIt out, std::size_t limit) : truncating_iterator_base<OutputIt>(out, limit) {
-	}
-
-	truncating_iterator& operator=(value_type val) {
-		if (this->count_++ < this->limit_)
-			this->out_ = val;
-		return *this;
-	}
-
-	truncating_iterator& operator++() {
-		return *this;
-	}
-
-	truncating_iterator& operator++(int) {
-		return *this;
-	}
-
-	truncating_iterator& operator*() {
-		return *this;
-	}
-};
+template <typename OutputIt,
+          FMT_ENABLE_IF(is_back_insert_iterator<OutputIt>::value&&
+                            is_contiguous<typename OutputIt::container>::value)>
+inline auto base_iterator(OutputIt it,
+                          typename OutputIt::container_type::value_type*)
+    -> OutputIt {
+  return it;
+}
 
-// A range with the specified output iterator and value type.
-template <typename OutputIt, typename T = typename OutputIt::value_type>
-class output_range {
-private:
-	OutputIt it_;
+template <typename Iterator>
+constexpr auto base_iterator(Iterator, Iterator it) -> Iterator {
+  return it;
+}
 
-public:
-	using value_type = T;
-	using iterator = OutputIt;
-	struct sentinel {};
+// <algorithm> is spectacularly slow to compile in C++20 so use a simple fill_n
+// instead (#1998).
+template <typename OutputIt, typename Size, typename T>
+FMT_CONSTEXPR auto fill_n(OutputIt out, Size count, const T& value)
+    -> OutputIt {
+  for (Size i = 0; i < count; ++i) *out++ = value;
+  return out;
+}
+template <typename T, typename Size>
+FMT_CONSTEXPR20 auto fill_n(T* out, Size count, char value) -> T* {
+  if (is_constant_evaluated()) {
+    return fill_n<T*, Size, T>(out, count, value);
+  }
+  std::memset(out, value, to_unsigned(count));
+  return out + count;
+}
 
-	explicit output_range(OutputIt it) : it_(it) {
-	}
+template <typename OutChar, typename InputIt, typename OutputIt>
+FMT_CONSTEXPR FMT_NOINLINE auto copy_noinline(InputIt begin, InputIt end,
+                                              OutputIt out) -> OutputIt {
+  return copy<OutChar>(begin, end, out);
+}
 
-	OutputIt begin() const {
-		return it_;
-	}
+// A public domain branchless UTF-8 decoder by Christopher Wellons:
+// https://github.com/skeeto/branchless-utf8
+/* Decode the next character, c, from s, reporting errors in e.
+ *
+ * Since this is a branchless decoder, four bytes will be read from the
+ * buffer regardless of the actual length of the next character. This
+ * means the buffer _must_ have at least three bytes of zero padding
+ * following the end of the data stream.
+ *
+ * Errors are reported in e, which will be non-zero if the parsed
+ * character was somehow invalid: invalid byte sequence, non-canonical
+ * encoding, or a surrogate half.
+ *
+ * The function returns a pointer to the next character. When an error
+ * occurs, this pointer will be a guess that depends on the particular
+ * error, but it will always advance at least one byte.
+ */
+FMT_CONSTEXPR inline auto utf8_decode(const char* s, uint32_t* c, int* e)
+    -> const char* {
+  constexpr const int masks[] = {0x00, 0x7f, 0x1f, 0x0f, 0x07};
+  constexpr const uint32_t mins[] = {4194304, 0, 128, 2048, 65536};
+  constexpr const int shiftc[] = {0, 18, 12, 6, 0};
+  constexpr const int shifte[] = {0, 6, 4, 2, 0};
+
+  int len = "\1\1\1\1\1\1\1\1\1\1\1\1\1\1\1\1\0\0\0\0\0\0\0\0\2\2\2\2\3\3\4"
+      [static_cast<unsigned char>(*s) >> 3];
+  // Compute the pointer to the next character early so that the next
+  // iteration can start working on the next character. Neither Clang
+  // nor GCC figure out this reordering on their own.
+  const char* next = s + len + !len;
+
+  using uchar = unsigned char;
+
+  // Assume a four-byte character and load four bytes. Unused bits are
+  // shifted out.
+  *c = uint32_t(uchar(s[0]) & masks[len]) << 18;
+  *c |= uint32_t(uchar(s[1]) & 0x3f) << 12;
+  *c |= uint32_t(uchar(s[2]) & 0x3f) << 6;
+  *c |= uint32_t(uchar(s[3]) & 0x3f) << 0;
+  *c >>= shiftc[len];
+
+  // Accumulate the various error conditions.
+  *e = (*c < mins[len]) << 6;       // non-canonical encoding
+  *e |= ((*c >> 11) == 0x1b) << 7;  // surrogate half?
+  *e |= (*c > 0x10FFFF) << 8;       // out of range?
+  *e |= (uchar(s[1]) & 0xc0) >> 2;
+  *e |= (uchar(s[2]) & 0xc0) >> 4;
+  *e |= uchar(s[3]) >> 6;
+  *e ^= 0x2a;  // top two bits of each tail byte correct?
+  *e >>= shifte[len];
+
+  return next;
+}
 
-	sentinel end() const {
-		return {};
-	} // Sentinel is not used yet.
-};
+constexpr FMT_INLINE_VARIABLE uint32_t invalid_code_point = ~uint32_t();
+
+// Invokes f(cp, sv) for every code point cp in s with sv being the string view
+// corresponding to the code point. cp is invalid_code_point on error.
+template <typename F>
+FMT_CONSTEXPR void for_each_codepoint(string_view s, F f) {
+  auto decode = [f](const char* buf_ptr, const char* ptr) {
+    auto cp = uint32_t();
+    auto error = 0;
+    auto end = utf8_decode(buf_ptr, &cp, &error);
+    bool result = f(error ? invalid_code_point : cp,
+                    string_view(ptr, error ? 1 : to_unsigned(end - buf_ptr)));
+    return result ? (error ? buf_ptr + 1 : end) : nullptr;
+  };
+  auto p = s.data();
+  const size_t block_size = 4;  // utf8_decode always reads blocks of 4 chars.
+  if (s.size() >= block_size) {
+    for (auto end = p + s.size() - block_size + 1; p < end;) {
+      p = decode(p, p);
+      if (!p) return;
+    }
+  }
+  if (auto num_chars_left = s.data() + s.size() - p) {
+    char buf[2 * block_size - 1] = {};
+    copy<char>(p, p + num_chars_left, buf);
+    const char* buf_ptr = buf;
+    do {
+      auto end = decode(buf_ptr, p);
+      if (!end) return;
+      p += end - buf_ptr;
+      buf_ptr = end;
+    } while (buf_ptr - buf < num_chars_left);
+  }
+}
 
 template <typename Char>
-inline size_t count_code_points(basic_string_view<Char> s) {
-	return s.size();
+inline auto compute_width(basic_string_view<Char> s) -> size_t {
+  return s.size();
 }
 
-// Counts the number of code points in a UTF-8 string.
-inline size_t count_code_points(basic_string_view<fmt_char8_t> s) {
-	const fmt_char8_t* data = s.data();
-	size_t num_code_points = 0;
-	for (size_t i = 0, size = s.size(); i != size; ++i) {
-		if ((data[i] & 0xc0) != 0x80)
-			++num_code_points;
-	}
-	return num_code_points;
+// Computes approximate display width of a UTF-8 string.
+FMT_CONSTEXPR inline auto compute_width(string_view s) -> size_t {
+  size_t num_code_points = 0;
+  // It is not a lambda for compatibility with C++14.
+  struct count_code_points {
+    size_t* count;
+    FMT_CONSTEXPR auto operator()(uint32_t cp, string_view) const -> bool {
+      *count += detail::to_unsigned(
+          1 +
+          (cp >= 0x1100 &&
+           (cp <= 0x115f ||  // Hangul Jamo init. consonants
+            cp == 0x2329 ||  // LEFT-POINTING ANGLE BRACKET
+            cp == 0x232a ||  // RIGHT-POINTING ANGLE BRACKET
+            // CJK ... Yi except IDEOGRAPHIC HALF FILL SPACE:
+            (cp >= 0x2e80 && cp <= 0xa4cf && cp != 0x303f) ||
+            (cp >= 0xac00 && cp <= 0xd7a3) ||    // Hangul Syllables
+            (cp >= 0xf900 && cp <= 0xfaff) ||    // CJK Compatibility Ideographs
+            (cp >= 0xfe10 && cp <= 0xfe19) ||    // Vertical Forms
+            (cp >= 0xfe30 && cp <= 0xfe6f) ||    // CJK Compatibility Forms
+            (cp >= 0xff00 && cp <= 0xff60) ||    // Fullwidth Forms
+            (cp >= 0xffe0 && cp <= 0xffe6) ||    // Fullwidth Forms
+            (cp >= 0x20000 && cp <= 0x2fffd) ||  // CJK
+            (cp >= 0x30000 && cp <= 0x3fffd) ||
+            // Miscellaneous Symbols and Pictographs + Emoticons:
+            (cp >= 0x1f300 && cp <= 0x1f64f) ||
+            // Supplemental Symbols and Pictographs:
+            (cp >= 0x1f900 && cp <= 0x1f9ff))));
+      return true;
+    }
+  };
+  // We could avoid branches by using utf8_decode directly.
+  for_each_codepoint(s, count_code_points{&num_code_points});
+  return num_code_points;
 }
 
 template <typename Char>
-inline size_t code_point_index(basic_string_view<Char> s, size_t n) {
-	size_t size = s.size();
-	return n < size ? n : size;
+inline auto code_point_index(basic_string_view<Char> s, size_t n) -> size_t {
+  size_t size = s.size();
+  return n < size ? n : size;
 }
 
 // Calculates the index of the nth code point in a UTF-8 string.
-inline size_t code_point_index(basic_string_view<fmt_char8_t> s, size_t n) {
-	const fmt_char8_t* data = s.data();
-	size_t num_code_points = 0;
-	for (size_t i = 0, size = s.size(); i != size; ++i) {
-		if ((data[i] & 0xc0) != 0x80 && ++num_code_points > n) {
-			return i;
-		}
-	}
-	return s.size();
+inline auto code_point_index(string_view s, size_t n) -> size_t {
+  size_t result = s.size();
+  const char* begin = s.begin();
+  for_each_codepoint(s, [begin, &n, &result](uint32_t, string_view sv) {
+    if (n != 0) {
+      --n;
+      return true;
+    }
+    result = to_unsigned(sv.begin() - begin);
+    return false;
+  });
+  return result;
 }
 
-inline fmt_char8_t to_fmt_char8_t(char c) {
-	return static_cast<fmt_char8_t>(c);
-}
+template <typename T> struct is_integral : std::is_integral<T> {};
+template <> struct is_integral<int128_opt> : std::true_type {};
+template <> struct is_integral<uint128_t> : std::true_type {};
 
-template <typename InputIt, typename OutChar>
-using needs_conversion = bool_constant<std::is_same<typename std::iterator_traits<InputIt>::value_type, char>::value &&
-                                       std::is_same<OutChar, fmt_char8_t>::value>;
+template <typename T>
+using is_signed =
+    std::integral_constant<bool, std::numeric_limits<T>::is_signed ||
+                                     std::is_same<T, int128_opt>::value>;
 
-template <typename OutChar, typename InputIt, typename OutputIt,
-          FMT_ENABLE_IF(!needs_conversion<InputIt, OutChar>::value)>
-OutputIt copy_str(InputIt begin, InputIt end, OutputIt it) {
-	return std::copy(begin, end, it);
-}
+template <typename T>
+using is_integer =
+    bool_constant<is_integral<T>::value && !std::is_same<T, bool>::value &&
+                  !std::is_same<T, char>::value &&
+                  !std::is_same<T, wchar_t>::value>;
 
-template <typename OutChar, typename InputIt, typename OutputIt,
-          FMT_ENABLE_IF(needs_conversion<InputIt, OutChar>::value)>
-OutputIt copy_str(InputIt begin, InputIt end, OutputIt it) {
-	return std::transform(begin, end, it, to_fmt_char8_t);
-}
+#ifndef FMT_USE_FLOAT
+#  define FMT_USE_FLOAT 1
+#endif
+#ifndef FMT_USE_DOUBLE
+#  define FMT_USE_DOUBLE 1
+#endif
+#ifndef FMT_USE_LONG_DOUBLE
+#  define FMT_USE_LONG_DOUBLE 1
+#endif
 
-#ifndef FMT_USE_GRISU
-#define FMT_USE_GRISU 1
+#if defined(FMT_USE_FLOAT128)
+// Use the provided definition.
+#elif FMT_CLANG_VERSION && FMT_HAS_INCLUDE(<quadmath.h>)
+#  define FMT_USE_FLOAT128 1
+#elif FMT_GCC_VERSION && defined(_GLIBCXX_USE_FLOAT128) && \
+    !defined(__STRICT_ANSI__)
+#  define FMT_USE_FLOAT128 1
+#else
+#  define FMT_USE_FLOAT128 0
+#endif
+#if FMT_USE_FLOAT128
+using float128 = __float128;
+#else
+using float128 = void;
 #endif
 
-template <typename T>
-constexpr bool use_grisu() {
-	return FMT_USE_GRISU && std::numeric_limits<double>::is_iec559 && sizeof(T) <= sizeof(double);
-}
+template <typename T> using is_float128 = std::is_same<T, float128>;
 
 template <typename T>
-template <typename U>
-void buffer<T>::append(const U* begin, const U* end) {
-	std::size_t new_size = size_ + to_unsigned(end - begin);
-	reserve(new_size);
-	std::uninitialized_copy(begin, end, make_checked(ptr_, capacity_) + size_);
-	size_ = new_size;
-}
-} // namespace internal
+using is_floating_point =
+    bool_constant<std::is_floating_point<T>::value || is_float128<T>::value>;
 
-// A range with an iterator appending to a buffer.
-template <typename T>
-class buffer_range : public internal::output_range<std::back_insert_iterator<internal::buffer<T>>, T> {
-public:
-	using iterator = std::back_insert_iterator<internal::buffer<T>>;
-	using internal::output_range<iterator, T>::output_range;
+template <typename T, bool = std::is_floating_point<T>::value>
+struct is_fast_float : bool_constant<std::numeric_limits<T>::is_iec559 &&
+                                     sizeof(T) <= sizeof(double)> {};
+template <typename T> struct is_fast_float<T, false> : std::false_type {};
 
-	buffer_range(internal::buffer<T>& buf) : internal::output_range<iterator, T>(std::back_inserter(buf)) {
-	}
-};
+template <typename T>
+using is_double_double = bool_constant<std::numeric_limits<T>::digits == 106>;
 
-// A UTF-8 string view.
-class u8string_view : public basic_string_view<fmt_char8_t> {
-public:
-	u8string_view(const char* s) : basic_string_view<fmt_char8_t>(reinterpret_cast<const fmt_char8_t*>(s)) {
-	}
+#ifndef FMT_USE_FULL_CACHE_DRAGONBOX
+#  define FMT_USE_FULL_CACHE_DRAGONBOX 0
+#endif
 
-	u8string_view(const char* s, size_t count) FMT_NOEXCEPT
-	    : basic_string_view<fmt_char8_t>(reinterpret_cast<const fmt_char8_t*>(s), count) {
-	}
-};
+template <typename T, typename Enable = void>
+struct is_locale : std::false_type {};
+template <typename T>
+struct is_locale<T, void_t<decltype(T::classic())>> : std::true_type {};
+}  // namespace detail
 
-#if FMT_USE_USER_DEFINED_LITERALS
-inline namespace literals {
-inline u8string_view operator"" _u(const char* s, std::size_t n) {
-	return {s, n};
-}
-} // namespace literals
-#endif
+FMT_BEGIN_EXPORT
 
 // The number of characters to store in the basic_memory_buffer object itself
 // to avoid dynamic memory allocation.
 enum { inline_buffer_size = 500 };
 
 /**
-  \rst
-  A dynamically growing memory buffer for trivially copyable/constructible types
-  with the first ``SIZE`` elements stored in the object itself.
-
-  You can use one of the following type aliases for common character types:
-
-  +----------------+------------------------------+
-  | Type           | Definition                   |
-  +================+==============================+
-  | memory_buffer  | basic_memory_buffer<char>    |
-  +----------------+------------------------------+
-  | wmemory_buffer | basic_memory_buffer<wchar_t> |
-  +----------------+------------------------------+
+ * A dynamically growing memory buffer for trivially copyable/constructible
+ * types with the first `SIZE` elements stored in the object itself. Most
+ * commonly used via the `memory_buffer` alias for `char`.
+ *
+ * **Example**:
+ *
+ *     auto out = fmt::memory_buffer();
+ *     fmt::format_to(std::back_inserter(out), "The answer is {}.", 42);
+ *
+ * This will append "The answer is 42." to `out`. The buffer content can be
+ * converted to `std::string` with `to_string(out)`.
+ */
+template <typename T, size_t SIZE = inline_buffer_size,
+          typename Allocator = std::allocator<T>>
+class basic_memory_buffer : public detail::buffer<T> {
+ private:
+  T store_[SIZE];
+
+  // Don't inherit from Allocator to avoid generating type_info for it.
+  FMT_NO_UNIQUE_ADDRESS Allocator alloc_;
+
+  // Deallocate memory allocated by the buffer.
+  FMT_CONSTEXPR20 void deallocate() {
+    T* data = this->data();
+    if (data != store_) alloc_.deallocate(data, this->capacity());
+  }
+
+  static FMT_CONSTEXPR20 void grow(detail::buffer<T>& buf, size_t size) {
+    detail::abort_fuzzing_if(size > 5000);
+    auto& self = static_cast<basic_memory_buffer&>(buf);
+    const size_t max_size =
+        std::allocator_traits<Allocator>::max_size(self.alloc_);
+    size_t old_capacity = buf.capacity();
+    size_t new_capacity = old_capacity + old_capacity / 2;
+    if (size > new_capacity)
+      new_capacity = size;
+    else if (new_capacity > max_size)
+      new_capacity = size > max_size ? size : max_size;
+    T* old_data = buf.data();
+    T* new_data = self.alloc_.allocate(new_capacity);
+    // Suppress a bogus -Wstringop-overflow in gcc 13.1 (#3481).
+    detail::assume(buf.size() <= new_capacity);
+    // The following code doesn't throw, so the raw pointer above doesn't leak.
+    memcpy(new_data, old_data, buf.size() * sizeof(T));
+    self.set(new_data, new_capacity);
+    // deallocate must not throw according to the standard, but even if it does,
+    // the buffer already uses the new storage and will deallocate it in
+    // destructor.
+    if (old_data != self.store_) self.alloc_.deallocate(old_data, old_capacity);
+  }
+
+ public:
+  using value_type = T;
+  using const_reference = const T&;
+
+  FMT_CONSTEXPR20 explicit basic_memory_buffer(
+      const Allocator& alloc = Allocator())
+      : detail::buffer<T>(grow), alloc_(alloc) {
+    this->set(store_, SIZE);
+    if (detail::is_constant_evaluated()) detail::fill_n(store_, SIZE, T());
+  }
+  FMT_CONSTEXPR20 ~basic_memory_buffer() { deallocate(); }
+
+ private:
+  // Move data from other to this buffer.
+  FMT_CONSTEXPR20 void move(basic_memory_buffer& other) {
+    alloc_ = std::move(other.alloc_);
+    T* data = other.data();
+    size_t size = other.size(), capacity = other.capacity();
+    if (data == other.store_) {
+      this->set(store_, capacity);
+      detail::copy<T>(other.store_, other.store_ + size, store_);
+    } else {
+      this->set(data, capacity);
+      // Set pointer to the inline array so that delete is not called
+      // when deallocating.
+      other.set(other.store_, 0);
+      other.clear();
+    }
+    this->resize(size);
+  }
+
+ public:
+  /// Constructs a `basic_memory_buffer` object moving the content of the other
+  /// object to it.
+  FMT_CONSTEXPR20 basic_memory_buffer(basic_memory_buffer&& other) noexcept
+      : detail::buffer<T>(grow) {
+    move(other);
+  }
+
+  /// Moves the content of the other `basic_memory_buffer` object to this one.
+  auto operator=(basic_memory_buffer&& other) noexcept -> basic_memory_buffer& {
+    FMT_ASSERT(this != &other, "");
+    deallocate();
+    move(other);
+    return *this;
+  }
+
+  // Returns a copy of the allocator associated with this buffer.
+  auto get_allocator() const -> Allocator { return alloc_; }
+
+  /// Resizes the buffer to contain `count` elements. If T is a POD type new
+  /// elements may not be initialized.
+  FMT_CONSTEXPR20 void resize(size_t count) { this->try_resize(count); }
+
+  /// Increases the buffer capacity to `new_capacity`.
+  void reserve(size_t new_capacity) { this->try_reserve(new_capacity); }
+
+  using detail::buffer<T>::append;
+  template <typename ContiguousRange>
+  void append(const ContiguousRange& range) {
+    append(range.data(), range.data() + range.size());
+  }
+};
 
-  **Example**::
+using memory_buffer = basic_memory_buffer<char>;
 
-     fmt::memory_buffer out;
-     format_to(out, "The answer is {}.", 42);
+template <typename T, size_t SIZE, typename Allocator>
+struct is_contiguous<basic_memory_buffer<T, SIZE, Allocator>> : std::true_type {
+};
 
-  This will append the following output to the ``out`` object:
+FMT_END_EXPORT
+namespace detail {
+FMT_API auto write_console(int fd, string_view text) -> bool;
+FMT_API void print(std::FILE*, string_view);
+}  // namespace detail
 
-  .. code-block:: none
+FMT_BEGIN_EXPORT
 
-     The answer is 42.
+// Suppress a misleading warning in older versions of clang.
+#if FMT_CLANG_VERSION
+#  pragma clang diagnostic ignored "-Wweak-vtables"
+#endif
 
-  The output can be converted to an ``std::string`` with ``to_string(out)``.
-  \endrst
- */
-template <typename T, std::size_t SIZE = inline_buffer_size, typename Allocator = std::allocator<T>>
-class basic_memory_buffer : private Allocator, public internal::buffer<T> {
-private:
-	T store_[SIZE];
-
-	// Deallocate memory allocated by the buffer.
-	void deallocate() {
-		T* data = this->data();
-		if (data != store_)
-			Allocator::deallocate(data, this->capacity());
-	}
-
-protected:
-	void grow(std::size_t size) FMT_OVERRIDE;
-
-public:
-	using value_type = T;
-	using const_reference = const T&;
-
-	explicit basic_memory_buffer(const Allocator& alloc = Allocator()) : Allocator(alloc) {
-		this->set(store_, SIZE);
-	}
-
-	~basic_memory_buffer() FMT_OVERRIDE {
-		deallocate();
-	}
-
-private:
-	// Move data from other to this buffer.
-	void move(basic_memory_buffer& other) {
-		Allocator &this_alloc = *this, &other_alloc = other;
-		this_alloc = std::move(other_alloc);
-		T* data = other.data();
-		std::size_t size = other.size(), capacity = other.capacity();
-		if (data == other.store_) {
-			this->set(store_, capacity);
-			std::uninitialized_copy(other.store_, other.store_ + size, internal::make_checked(store_, capacity));
-		} else {
-			this->set(data, capacity);
-			// Set pointer to the inline array so that delete is not called
-			// when deallocating.
-			other.set(other.store_, 0);
-		}
-		this->resize(size);
-	}
-
-public:
-	/**
-\rst
-Constructs a :class:`fmt::basic_memory_buffer` object moving the content
-of the other object to it.
-\endrst
-*/
-	basic_memory_buffer(basic_memory_buffer&& other) FMT_NOEXCEPT {
-		move(other);
-	}
-
-	/**
-\rst
-Moves the content of the other ``basic_memory_buffer`` object to this one.
-\endrst
-*/
-	basic_memory_buffer& operator=(basic_memory_buffer&& other) FMT_NOEXCEPT {
-		FMT_ASSERT(this != &other, "");
-		deallocate();
-		move(other);
-		return *this;
-	}
-
-	// Returns a copy of the allocator associated with this buffer.
-	Allocator get_allocator() const {
-		return *this;
-	}
+/// An error reported from a formatting function.
+class FMT_SO_VISIBILITY("default") format_error : public std::runtime_error {
+ public:
+  using std::runtime_error::runtime_error;
 };
 
-template <typename T, std::size_t SIZE, typename Allocator>
-void basic_memory_buffer<T, SIZE, Allocator>::grow(std::size_t size) {
-#ifdef FUZZING_BUILD_MODE_UNSAFE_FOR_PRODUCTION
-	if (size > 1000)
-		throw std::runtime_error("fuzz mode - won't grow that much");
+namespace detail_exported {
+#if FMT_USE_NONTYPE_TEMPLATE_ARGS
+template <typename Char, size_t N> struct fixed_string {
+  constexpr fixed_string(const Char (&str)[N]) {
+    detail::copy<Char, const Char*, Char*>(static_cast<const Char*>(str),
+                                           str + N, data);
+  }
+  Char data[N] = {};
+};
 #endif
-	std::size_t old_capacity = this->capacity();
-	std::size_t new_capacity = old_capacity + old_capacity / 2;
-	if (size > new_capacity)
-		new_capacity = size;
-	T* old_data = this->data();
-	T* new_data = std::allocator_traits<Allocator>::allocate(*this, new_capacity);
-	// The following code doesn't throw, so the raw pointer above doesn't leak.
-	std::uninitialized_copy(old_data, old_data + this->size(), internal::make_checked(new_data, new_capacity));
-	this->set(new_data, new_capacity);
-	// deallocate must not throw according to the standard, but even if it does,
-	// the buffer already uses the new storage and will deallocate it in
-	// destructor.
-	if (old_data != store_)
-		Allocator::deallocate(old_data, old_capacity);
+
+// Converts a compile-time string to basic_string_view.
+template <typename Char, size_t N>
+constexpr auto compile_string_to_view(const Char (&s)[N])
+    -> basic_string_view<Char> {
+  // Remove trailing NUL character if needed. Won't be present if this is used
+  // with a raw character array (i.e. not defined as a string).
+  return {s, N - (std::char_traits<Char>::to_int_type(s[N - 1]) == 0 ? 1 : 0)};
+}
+template <typename Char>
+constexpr auto compile_string_to_view(basic_string_view<Char> s)
+    -> basic_string_view<Char> {
+  return s;
 }
+}  // namespace detail_exported
+
+// A generic formatting context with custom output iterator and character
+// (code unit) support. Char is the format string code unit type which can be
+// different from OutputIt::value_type.
+template <typename OutputIt, typename Char> class generic_context {
+ private:
+  OutputIt out_;
+  basic_format_args<generic_context> args_;
+  detail::locale_ref loc_;
+
+ public:
+  using char_type = Char;
+  using iterator = OutputIt;
+  using parse_context_type = basic_format_parse_context<Char>;
+  template <typename T> using formatter_type = formatter<T, Char>;
+
+  constexpr generic_context(OutputIt out,
+                            basic_format_args<generic_context> ctx_args,
+                            detail::locale_ref loc = {})
+      : out_(out), args_(ctx_args), loc_(loc) {}
+  generic_context(generic_context&&) = default;
+  generic_context(const generic_context&) = delete;
+  void operator=(const generic_context&) = delete;
+
+  constexpr auto arg(int id) const -> basic_format_arg<generic_context> {
+    return args_.get(id);
+  }
+  auto arg(basic_string_view<Char> name) -> basic_format_arg<generic_context> {
+    return args_.get(name);
+  }
+  FMT_CONSTEXPR auto arg_id(basic_string_view<Char> name) -> int {
+    return args_.get_id(name);
+  }
+  auto args() const -> const basic_format_args<generic_context>& {
+    return args_;
+  }
+
+  FMT_CONSTEXPR auto out() -> iterator { return out_; }
+
+  void advance_to(iterator it) {
+    if (!detail::is_back_insert_iterator<iterator>()) out_ = it;
+  }
+
+  FMT_CONSTEXPR auto locale() -> detail::locale_ref { return loc_; }
+};
 
-using memory_buffer = basic_memory_buffer<char>;
-using wmemory_buffer = basic_memory_buffer<wchar_t>;
+class loc_value {
+ private:
+  basic_format_arg<format_context> value_;
 
-namespace internal {
+ public:
+  template <typename T, FMT_ENABLE_IF(!detail::is_float128<T>::value)>
+  loc_value(T value) : value_(detail::make_arg<format_context>(value)) {}
 
-// Returns true if value is negative, false otherwise.
-// Same as `value < 0` but doesn't produce warnings if T is an unsigned type.
-template <typename T, FMT_ENABLE_IF(std::numeric_limits<T>::is_signed)>
-FMT_CONSTEXPR bool is_negative(T value) {
-	return value < 0;
-}
+  template <typename T, FMT_ENABLE_IF(detail::is_float128<T>::value)>
+  loc_value(T) {}
 
-template <typename T, FMT_ENABLE_IF(!std::numeric_limits<T>::is_signed)>
-FMT_CONSTEXPR bool is_negative(T) {
-	return false;
-}
+  template <typename Visitor> auto visit(Visitor&& vis) -> decltype(vis(0)) {
+    return value_.visit(vis);
+  }
+};
 
-// Smallest of uint32_t, uint64_t, uint128_t that is large enough to
-// represent all values of T.
-template <typename T>
-using uint32_or_64_or_128_t = conditional_t<std::numeric_limits<T>::digits <= 32, uint32_t,
-                                            conditional_t<std::numeric_limits<T>::digits <= 64, uint64_t, uint128_t>>;
-
-// Static data is placed in this class template for the header-only config.
-template <typename T = void>
-struct FMT_EXTERN_TEMPLATE_API basic_data {
-	static const uint64_t powers_of_10_64[];
-	static const uint32_t zero_or_powers_of_10_32[];
-	static const uint64_t zero_or_powers_of_10_64[];
-	static const uint64_t pow10_significands[];
-	static const int16_t pow10_exponents[];
-	static const char digits[];
-	static const char hex_digits[];
-	static const char foreground_color[];
-	static const char background_color[];
-	static const char reset_color[5];
-	static const wchar_t wreset_color[5];
-	static const char signs[];
+// A locale facet that formats values in UTF-8.
+// It is parameterized on the locale to avoid the heavy <locale> include.
+template <typename Locale> class format_facet : public Locale::facet {
+ private:
+  std::string separator_;
+  std::string grouping_;
+  std::string decimal_point_;
+
+ protected:
+  virtual auto do_put(appender out, loc_value val,
+                      const format_specs& specs) const -> bool;
+
+ public:
+  static FMT_API typename Locale::id id;
+
+  explicit format_facet(Locale& loc);
+  explicit format_facet(string_view sep = "",
+                        std::initializer_list<unsigned char> g = {3},
+                        std::string decimal_point = ".")
+      : separator_(sep.data(), sep.size()),
+        grouping_(g.begin(), g.end()),
+        decimal_point_(decimal_point) {}
+
+  auto put(appender out, loc_value val, const format_specs& specs) const
+      -> bool {
+    return do_put(out, val, specs);
+  }
 };
 
-FMT_EXTERN template struct basic_data<void>;
+FMT_END_EXPORT
 
-// This is a struct rather than an alias to avoid shadowing warnings in gcc.
-struct data : basic_data<> {};
+namespace detail {
 
-#ifdef FMT_BUILTIN_CLZLL
-// Returns the number of decimal digits in n. Leading zeros are not counted
-// except for n == 0 in which case count_digits returns 1.
-inline int count_digits(uint64_t n) {
-	// Based on http://graphics.stanford.edu/~seander/bithacks.html#IntegerLog10
-	// and the benchmark https://github.com/localvoid/cxx-benchmark-count-digits.
-	int t = (64 - FMT_BUILTIN_CLZLL(n | 1)) * 1233 >> 12;
-	return t - (n < data::zero_or_powers_of_10_64[t]) + 1;
+// Returns true if value is negative, false otherwise.
+// Same as `value < 0` but doesn't produce warnings if T is an unsigned type.
+template <typename T, FMT_ENABLE_IF(is_signed<T>::value)>
+constexpr auto is_negative(T value) -> bool {
+  return value < 0;
+}
+template <typename T, FMT_ENABLE_IF(!is_signed<T>::value)>
+constexpr auto is_negative(T) -> bool {
+  return false;
+}
+
+template <typename T>
+FMT_CONSTEXPR auto is_supported_floating_point(T) -> bool {
+  if (std::is_same<T, float>()) return FMT_USE_FLOAT;
+  if (std::is_same<T, double>()) return FMT_USE_DOUBLE;
+  if (std::is_same<T, long double>()) return FMT_USE_LONG_DOUBLE;
+  return true;
 }
-#else
 
-// Fallback version of count_digits used when __builtin_clz is not available.
-inline int count_digits(uint64_t n) {
-	int count = 1;
-	for (;;) {
-		// Integer division is slow so do it for a group of four digits instead
-		// of for every digit. The idea comes from the talk by Alexandrescu
-		// "Three Optimization Tips for C++". See speed-test for a comparison.
-		if (n < 10)
-			return count;
-		if (n < 100)
-			return count + 1;
-		if (n < 1000)
-			return count + 2;
-		if (n < 10000)
-			return count + 3;
-		n /= 10000u;
-		count += 4;
-	}
+// Smallest of uint32_t, uint64_t, uint128_t that is large enough to
+// represent all values of an integral type T.
+template <typename T>
+using uint32_or_64_or_128_t =
+    conditional_t<num_bits<T>() <= 32 && !FMT_REDUCE_INT_INSTANTIATIONS,
+                  uint32_t,
+                  conditional_t<num_bits<T>() <= 64, uint64_t, uint128_t>>;
+template <typename T>
+using uint64_or_128_t = conditional_t<num_bits<T>() <= 64, uint64_t, uint128_t>;
+
+#define FMT_POWERS_OF_10(factor)                                  \
+  factor * 10, (factor) * 100, (factor) * 1000, (factor) * 10000, \
+      (factor) * 100000, (factor) * 1000000, (factor) * 10000000, \
+      (factor) * 100000000, (factor) * 1000000000
+
+// Converts value in the range [0, 100) to a string.
+constexpr auto digits2(size_t value) -> const char* {
+  // GCC generates slightly better code when value is pointer-size.
+  return &"0001020304050607080910111213141516171819"
+         "2021222324252627282930313233343536373839"
+         "4041424344454647484950515253545556575859"
+         "6061626364656667686970717273747576777879"
+         "8081828384858687888990919293949596979899"[value * 2];
 }
 
+// Sign is a template parameter to workaround a bug in gcc 4.8.
+template <typename Char, typename Sign> constexpr auto sign(Sign s) -> Char {
+#if !FMT_GCC_VERSION || FMT_GCC_VERSION >= 604
+  static_assert(std::is_same<Sign, sign_t>::value, "");
 #endif
+  return static_cast<char>(((' ' << 24) | ('+' << 16) | ('-' << 8)) >> (s * 8));
+}
 
+template <typename T> FMT_CONSTEXPR auto count_digits_fallback(T n) -> int {
+  int count = 1;
+  for (;;) {
+    // Integer division is slow so do it for a group of four digits instead
+    // of for every digit. The idea comes from the talk by Alexandrescu
+    // "Three Optimization Tips for C++". See speed-test for a comparison.
+    if (n < 10) return count;
+    if (n < 100) return count + 1;
+    if (n < 1000) return count + 2;
+    if (n < 10000) return count + 3;
+    n /= 10000u;
+    count += 4;
+  }
+}
 #if FMT_USE_INT128
-
-inline int count_digits(uint128_t n) {
-	int count = 1;
-	for (;;) {
-		// Integer division is slow so do it for a group of four digits instead
-		// of for every digit. The idea comes from the talk by Alexandrescu
-		// "Three Optimization Tips for C++". See speed-test for a comparison.
-		if (n < 10)
-			return count;
-		if (n < 100)
-			return count + 1;
-		if (n < 1000)
-			return count + 2;
-		if (n < 10000)
-			return count + 3;
-		n /= 10000U;
-		count += 4;
-	}
+FMT_CONSTEXPR inline auto count_digits(uint128_opt n) -> int {
+  return count_digits_fallback(n);
 }
-
 #endif
 
-// Counts the number of digits in n. BITS = log2(radix).
-template <unsigned BITS, typename UInt>
-inline int count_digits(UInt n) {
-	int num_digits = 0;
-	do {
-		++num_digits;
-	} while ((n >>= BITS) != 0);
-	return num_digits;
+#ifdef FMT_BUILTIN_CLZLL
+// It is a separate function rather than a part of count_digits to workaround
+// the lack of static constexpr in constexpr functions.
+inline auto do_count_digits(uint64_t n) -> int {
+  // This has comparable performance to the version by Kendall Willets
+  // (https://github.com/fmtlib/format-benchmark/blob/master/digits10)
+  // but uses smaller tables.
+  // Maps bsr(n) to ceil(log10(pow(2, bsr(n) + 1) - 1)).
+  static constexpr uint8_t bsr2log10[] = {
+      1,  1,  1,  2,  2,  2,  3,  3,  3,  4,  4,  4,  4,  5,  5,  5,
+      6,  6,  6,  7,  7,  7,  7,  8,  8,  8,  9,  9,  9,  10, 10, 10,
+      10, 11, 11, 11, 12, 12, 12, 13, 13, 13, 13, 14, 14, 14, 15, 15,
+      15, 16, 16, 16, 16, 17, 17, 17, 18, 18, 18, 19, 19, 19, 19, 20};
+  auto t = bsr2log10[FMT_BUILTIN_CLZLL(n | 1) ^ 63];
+  static constexpr const uint64_t zero_or_powers_of_10[] = {
+      0, 0, FMT_POWERS_OF_10(1U), FMT_POWERS_OF_10(1000000000ULL),
+      10000000000000000000ULL};
+  return t - (n < zero_or_powers_of_10[t]);
 }
+#endif
 
-template <>
-int count_digits<4>(internal::fallback_uintptr n);
+// Returns the number of decimal digits in n. Leading zeros are not counted
+// except for n == 0 in which case count_digits returns 1.
+FMT_CONSTEXPR20 inline auto count_digits(uint64_t n) -> int {
+#ifdef FMT_BUILTIN_CLZLL
+  if (!is_constant_evaluated()) return do_count_digits(n);
+#endif
+  return count_digits_fallback(n);
+}
 
-#if FMT_GCC_VERSION || FMT_CLANG_VERSION
-#define FMT_ALWAYS_INLINE inline __attribute__((always_inline))
-#else
-#define FMT_ALWAYS_INLINE
+// Counts the number of digits in n. BITS = log2(radix).
+template <int BITS, typename UInt>
+FMT_CONSTEXPR auto count_digits(UInt n) -> int {
+#ifdef FMT_BUILTIN_CLZ
+  if (!is_constant_evaluated() && num_bits<UInt>() == 32)
+    return (FMT_BUILTIN_CLZ(static_cast<uint32_t>(n) | 1) ^ 31) / BITS + 1;
 #endif
+  // Lambda avoids unreachable code warnings from NVHPC.
+  return [](UInt m) {
+    int num_digits = 0;
+    do {
+      ++num_digits;
+    } while ((m >>= BITS) != 0);
+    return num_digits;
+  }(n);
+}
 
 #ifdef FMT_BUILTIN_CLZ
-// Optional version of count_digits for better performance on 32-bit platforms.
-inline int count_digits(uint32_t n) {
-	int t = (32 - FMT_BUILTIN_CLZ(n | 1)) * 1233 >> 12;
-	return t - (n < data::zero_or_powers_of_10_32[t]) + 1;
+// It is a separate function rather than a part of count_digits to workaround
+// the lack of static constexpr in constexpr functions.
+FMT_INLINE auto do_count_digits(uint32_t n) -> int {
+// An optimization by Kendall Willets from https://bit.ly/3uOIQrB.
+// This increments the upper 32 bits (log10(T) - 1) when >= T is added.
+#  define FMT_INC(T) (((sizeof(#T) - 1ull) << 32) - T)
+  static constexpr uint64_t table[] = {
+      FMT_INC(0),          FMT_INC(0),          FMT_INC(0),           // 8
+      FMT_INC(10),         FMT_INC(10),         FMT_INC(10),          // 64
+      FMT_INC(100),        FMT_INC(100),        FMT_INC(100),         // 512
+      FMT_INC(1000),       FMT_INC(1000),       FMT_INC(1000),        // 4096
+      FMT_INC(10000),      FMT_INC(10000),      FMT_INC(10000),       // 32k
+      FMT_INC(100000),     FMT_INC(100000),     FMT_INC(100000),      // 256k
+      FMT_INC(1000000),    FMT_INC(1000000),    FMT_INC(1000000),     // 2048k
+      FMT_INC(10000000),   FMT_INC(10000000),   FMT_INC(10000000),    // 16M
+      FMT_INC(100000000),  FMT_INC(100000000),  FMT_INC(100000000),   // 128M
+      FMT_INC(1000000000), FMT_INC(1000000000), FMT_INC(1000000000),  // 1024M
+      FMT_INC(1000000000), FMT_INC(1000000000)                        // 4B
+  };
+  auto inc = table[FMT_BUILTIN_CLZ(n | 1) ^ 31];
+  return static_cast<int>((n + inc) >> 32);
 }
 #endif
 
-template <typename Char>
-FMT_API std::string grouping_impl(locale_ref loc);
-
-template <typename Char>
-inline std::string grouping(locale_ref loc) {
-	return grouping_impl<char>(loc);
+// Optional version of count_digits for better performance on 32-bit platforms.
+FMT_CONSTEXPR20 inline auto count_digits(uint32_t n) -> int {
+#ifdef FMT_BUILTIN_CLZ
+  if (!is_constant_evaluated()) {
+    return do_count_digits(n);
+  }
+#endif
+  return count_digits_fallback(n);
 }
 
-template <>
-inline std::string grouping<wchar_t>(locale_ref loc) {
-	return grouping_impl<wchar_t>(loc);
+template <typename Int> constexpr auto digits10() noexcept -> int {
+  return std::numeric_limits<Int>::digits10;
 }
+template <> constexpr auto digits10<int128_opt>() noexcept -> int { return 38; }
+template <> constexpr auto digits10<uint128_t>() noexcept -> int { return 38; }
 
-template <typename Char>
-FMT_API Char thousands_sep_impl(locale_ref loc);
+template <typename Char> struct thousands_sep_result {
+  std::string grouping;
+  Char thousands_sep;
+};
 
 template <typename Char>
-inline Char thousands_sep(locale_ref loc) {
-	return Char(thousands_sep_impl<char>(loc));
+FMT_API auto thousands_sep_impl(locale_ref loc) -> thousands_sep_result<Char>;
+template <typename Char>
+inline auto thousands_sep(locale_ref loc) -> thousands_sep_result<Char> {
+  auto result = thousands_sep_impl<char>(loc);
+  return {result.grouping, Char(result.thousands_sep)};
 }
-
 template <>
-inline wchar_t thousands_sep(locale_ref loc) {
-	return thousands_sep_impl<wchar_t>(loc);
+inline auto thousands_sep(locale_ref loc) -> thousands_sep_result<wchar_t> {
+  return thousands_sep_impl<wchar_t>(loc);
 }
 
 template <typename Char>
-FMT_API Char decimal_point_impl(locale_ref loc);
-
-template <typename Char>
-inline Char decimal_point(locale_ref loc) {
-	return Char(decimal_point_impl<char>(loc));
+FMT_API auto decimal_point_impl(locale_ref loc) -> Char;
+template <typename Char> inline auto decimal_point(locale_ref loc) -> Char {
+  return Char(decimal_point_impl<char>(loc));
 }
-
-template <>
-inline wchar_t decimal_point(locale_ref loc) {
-	return decimal_point_impl<wchar_t>(loc);
-}
-
-// Formats a decimal unsigned integer value writing into buffer.
-// add_thousands_sep is called after writing each char to add a thousands
-// separator if necessary.
-template <typename UInt, typename Char, typename F>
-inline Char* format_decimal(Char* buffer, UInt value, int num_digits, F add_thousands_sep) {
-	FMT_ASSERT(num_digits >= 0, "invalid digit count");
-	buffer += num_digits;
-	Char* end = buffer;
-	while (value >= 100) {
-		// Integer division is slow so do it for a group of two digits instead
-		// of for every digit. The idea comes from the talk by Alexandrescu
-		// "Three Optimization Tips for C++". See speed-test for a comparison.
-		auto index = static_cast<unsigned>((value % 100) * 2);
-		value /= 100;
-		*--buffer = static_cast<Char>(data::digits[index + 1]);
-		add_thousands_sep(buffer);
-		*--buffer = static_cast<Char>(data::digits[index]);
-		add_thousands_sep(buffer);
-	}
-	if (value < 10) {
-		*--buffer = static_cast<Char>('0' + value);
-		return end;
-	}
-	auto index = static_cast<unsigned>(value * 2);
-	*--buffer = static_cast<Char>(data::digits[index + 1]);
-	add_thousands_sep(buffer);
-	*--buffer = static_cast<Char>(data::digits[index]);
-	return end;
-}
-
-template <typename Int>
-constexpr int digits10() noexcept {
-	return std::numeric_limits<Int>::digits10;
+template <> inline auto decimal_point(locale_ref loc) -> wchar_t {
+  return decimal_point_impl<wchar_t>(loc);
 }
 
-template <>
-constexpr int digits10<int128_t>() noexcept {
-	return 38;
+// Compares two characters for equality.
+template <typename Char> auto equal2(const Char* lhs, const char* rhs) -> bool {
+  return lhs[0] == Char(rhs[0]) && lhs[1] == Char(rhs[1]);
+}
+inline auto equal2(const char* lhs, const char* rhs) -> bool {
+  return memcmp(lhs, rhs, 2) == 0;
 }
 
-template <>
-constexpr int digits10<uint128_t>() noexcept {
-	return 38;
+// Copies two characters from src to dst.
+template <typename Char>
+FMT_CONSTEXPR20 FMT_INLINE void copy2(Char* dst, const char* src) {
+  if (!is_constant_evaluated() && sizeof(Char) == sizeof(char)) {
+    memcpy(dst, src, 2);
+    return;
+  }
+  *dst++ = static_cast<Char>(*src++);
+  *dst = static_cast<Char>(*src);
 }
 
-template <typename Char, typename UInt, typename Iterator, typename F>
-inline Iterator format_decimal(Iterator out, UInt value, int num_digits, F add_thousands_sep) {
-	FMT_ASSERT(num_digits >= 0, "invalid digit count");
-	// Buffer should be large enough to hold all digits (<= digits10 + 1).
-	enum { max_size = digits10<UInt>() + 1 };
-	Char buffer[2 * max_size];
-	auto end = format_decimal(buffer, value, num_digits, add_thousands_sep);
-	return internal::copy_str<Char>(buffer, end, out);
+template <typename Iterator> struct format_decimal_result {
+  Iterator begin;
+  Iterator end;
+};
+
+// Formats a decimal unsigned integer value writing into out pointing to a
+// buffer of specified size. The caller must ensure that the buffer is large
+// enough.
+template <typename Char, typename UInt>
+FMT_CONSTEXPR20 auto format_decimal(Char* out, UInt value, int size)
+    -> format_decimal_result<Char*> {
+  FMT_ASSERT(size >= count_digits(value), "invalid digit count");
+  out += size;
+  Char* end = out;
+  while (value >= 100) {
+    // Integer division is slow so do it for a group of two digits instead
+    // of for every digit. The idea comes from the talk by Alexandrescu
+    // "Three Optimization Tips for C++". See speed-test for a comparison.
+    out -= 2;
+    copy2(out, digits2(static_cast<size_t>(value % 100)));
+    value /= 100;
+  }
+  if (value < 10) {
+    *--out = static_cast<Char>('0' + value);
+    return {out, end};
+  }
+  out -= 2;
+  copy2(out, digits2(static_cast<size_t>(value)));
+  return {out, end};
 }
 
-template <typename Char, typename It, typename UInt>
-inline It format_decimal(It out, UInt value, int num_digits) {
-	return format_decimal<Char>(out, value, num_digits, [](Char*) {});
+template <typename Char, typename UInt, typename Iterator,
+          FMT_ENABLE_IF(!std::is_pointer<remove_cvref_t<Iterator>>::value)>
+FMT_CONSTEXPR inline auto format_decimal(Iterator out, UInt value, int size)
+    -> format_decimal_result<Iterator> {
+  // Buffer is large enough to hold all digits (digits10 + 1).
+  Char buffer[digits10<UInt>() + 1] = {};
+  auto end = format_decimal(buffer, value, size).end;
+  return {out, detail::copy_noinline<Char>(buffer, end, out)};
 }
 
 template <unsigned BASE_BITS, typename Char, typename UInt>
-inline Char* format_uint(Char* buffer, UInt value, int num_digits, bool upper = false) {
-	buffer += num_digits;
-	Char* end = buffer;
-	do {
-		const char* digits = upper ? "0123456789ABCDEF" : data::hex_digits;
-		unsigned digit = (value & ((1 << BASE_BITS) - 1));
-		*--buffer = static_cast<Char>(BASE_BITS < 4 ? static_cast<char>('0' + digit) : digits[digit]);
-	} while ((value >>= BASE_BITS) != 0);
-	return end;
-}
-
-template <unsigned BASE_BITS, typename Char>
-Char* format_uint(Char* buffer, internal::fallback_uintptr n, int num_digits, bool = false) {
-	auto char_digits = std::numeric_limits<unsigned char>::digits / 4;
-	int start = (num_digits + char_digits - 1) / char_digits - 1;
-	if (int start_digits = num_digits % char_digits) {
-		unsigned value = n.value[start--];
-		buffer = format_uint<BASE_BITS>(buffer, value, start_digits);
-	}
-	for (; start >= 0; --start) {
-		unsigned value = n.value[start];
-		buffer += char_digits;
-		auto p = buffer;
-		for (int i = 0; i < char_digits; ++i) {
-			unsigned digit = (value & ((1 << BASE_BITS) - 1));
-			*--p = static_cast<Char>(data::hex_digits[digit]);
-			value >>= BASE_BITS;
-		}
-	}
-	return buffer;
+FMT_CONSTEXPR auto format_uint(Char* buffer, UInt value, int num_digits,
+                               bool upper = false) -> Char* {
+  buffer += num_digits;
+  Char* end = buffer;
+  do {
+    const char* digits = upper ? "0123456789ABCDEF" : "0123456789abcdef";
+    unsigned digit = static_cast<unsigned>(value & ((1 << BASE_BITS) - 1));
+    *--buffer = static_cast<Char>(BASE_BITS < 4 ? static_cast<char>('0' + digit)
+                                                : digits[digit]);
+  } while ((value >>= BASE_BITS) != 0);
+  return end;
 }
 
 template <unsigned BASE_BITS, typename Char, typename It, typename UInt>
-inline It format_uint(It out, UInt value, int num_digits, bool upper = false) {
-	// Buffer should be large enough to hold all digits (digits / BASE_BITS + 1).
-	char buffer[num_bits<UInt>() / BASE_BITS + 1];
-	format_uint<BASE_BITS>(buffer, value, num_digits, upper);
-	return internal::copy_str<Char>(buffer, buffer + num_digits, out);
+FMT_CONSTEXPR inline auto format_uint(It out, UInt value, int num_digits,
+                                      bool upper = false) -> It {
+  if (auto ptr = to_pointer<Char>(out, to_unsigned(num_digits))) {
+    format_uint<BASE_BITS>(ptr, value, num_digits, upper);
+    return out;
+  }
+  // Buffer should be large enough to hold all digits (digits / BASE_BITS + 1).
+  char buffer[num_bits<UInt>() / BASE_BITS + 1] = {};
+  format_uint<BASE_BITS>(buffer, value, num_digits, upper);
+  return detail::copy_noinline<Char>(buffer, buffer + num_digits, out);
 }
 
-template <typename T = void>
-struct null {};
-
-// Workaround an array initialization issue in gcc 4.8.
-template <typename Char>
-struct fill_t {
-private:
-	Char data_[6];
-
-public:
-	FMT_CONSTEXPR Char& operator[](size_t index) {
-		return data_[index];
-	}
-
-	FMT_CONSTEXPR const Char& operator[](size_t index) const {
-		return data_[index];
-	}
-
-	static FMT_CONSTEXPR fill_t<Char> make() {
-		auto fill = fill_t<Char>();
-		fill[0] = Char(' ');
-		return fill;
-	}
+// A converter from UTF-8 to UTF-16.
+class utf8_to_utf16 {
+ private:
+  basic_memory_buffer<wchar_t> buffer_;
+
+ public:
+  FMT_API explicit utf8_to_utf16(string_view s);
+  operator basic_string_view<wchar_t>() const { return {&buffer_[0], size()}; }
+  auto size() const -> size_t { return buffer_.size() - 1; }
+  auto c_str() const -> const wchar_t* { return &buffer_[0]; }
+  auto str() const -> std::wstring { return {&buffer_[0], size()}; }
 };
-} // namespace internal
 
-// We cannot use enum classes as bit fields because of a gcc bug
-// https://gcc.gnu.org/bugzilla/show_bug.cgi?id=61414.
-namespace align {
-enum type { none, left, right, center, numeric };
-}
-using align_t = align::type;
+enum class to_utf8_error_policy { abort, replace };
+
+// A converter from UTF-16/UTF-32 (host endian) to UTF-8.
+template <typename WChar, typename Buffer = memory_buffer> class to_utf8 {
+ private:
+  Buffer buffer_;
+
+ public:
+  to_utf8() {}
+  explicit to_utf8(basic_string_view<WChar> s,
+                   to_utf8_error_policy policy = to_utf8_error_policy::abort) {
+    static_assert(sizeof(WChar) == 2 || sizeof(WChar) == 4,
+                  "Expect utf16 or utf32");
+    if (!convert(s, policy))
+      FMT_THROW(std::runtime_error(sizeof(WChar) == 2 ? "invalid utf16"
+                                                      : "invalid utf32"));
+  }
+  operator string_view() const { return string_view(&buffer_[0], size()); }
+  auto size() const -> size_t { return buffer_.size() - 1; }
+  auto c_str() const -> const char* { return &buffer_[0]; }
+  auto str() const -> std::string { return std::string(&buffer_[0], size()); }
+
+  // Performs conversion returning a bool instead of throwing exception on
+  // conversion error. This method may still throw in case of memory allocation
+  // error.
+  auto convert(basic_string_view<WChar> s,
+               to_utf8_error_policy policy = to_utf8_error_policy::abort)
+      -> bool {
+    if (!convert(buffer_, s, policy)) return false;
+    buffer_.push_back(0);
+    return true;
+  }
+  static auto convert(Buffer& buf, basic_string_view<WChar> s,
+                      to_utf8_error_policy policy = to_utf8_error_policy::abort)
+      -> bool {
+    for (auto p = s.begin(); p != s.end(); ++p) {
+      uint32_t c = static_cast<uint32_t>(*p);
+      if (sizeof(WChar) == 2 && c >= 0xd800 && c <= 0xdfff) {
+        // Handle a surrogate pair.
+        ++p;
+        if (p == s.end() || (c & 0xfc00) != 0xd800 || (*p & 0xfc00) != 0xdc00) {
+          if (policy == to_utf8_error_policy::abort) return false;
+          buf.append(string_view("\xEF\xBF\xBD"));
+          --p;
+        } else {
+          c = (c << 10) + static_cast<uint32_t>(*p) - 0x35fdc00;
+        }
+      } else if (c < 0x80) {
+        buf.push_back(static_cast<char>(c));
+      } else if (c < 0x800) {
+        buf.push_back(static_cast<char>(0xc0 | (c >> 6)));
+        buf.push_back(static_cast<char>(0x80 | (c & 0x3f)));
+      } else if ((c >= 0x800 && c <= 0xd7ff) || (c >= 0xe000 && c <= 0xffff)) {
+        buf.push_back(static_cast<char>(0xe0 | (c >> 12)));
+        buf.push_back(static_cast<char>(0x80 | ((c & 0xfff) >> 6)));
+        buf.push_back(static_cast<char>(0x80 | (c & 0x3f)));
+      } else if (c >= 0x10000 && c <= 0x10ffff) {
+        buf.push_back(static_cast<char>(0xf0 | (c >> 18)));
+        buf.push_back(static_cast<char>(0x80 | ((c & 0x3ffff) >> 12)));
+        buf.push_back(static_cast<char>(0x80 | ((c & 0xfff) >> 6)));
+        buf.push_back(static_cast<char>(0x80 | (c & 0x3f)));
+      } else {
+        return false;
+      }
+    }
+    return true;
+  }
+};
 
-namespace sign {
-enum type { none, minus, plus, space };
-}
-using sign_t = sign::type;
+// Computes 128-bit result of multiplication of two 64-bit unsigned integers.
+inline auto umul128(uint64_t x, uint64_t y) noexcept -> uint128_fallback {
+#if FMT_USE_INT128
+  auto p = static_cast<uint128_opt>(x) * static_cast<uint128_opt>(y);
+  return {static_cast<uint64_t>(p >> 64), static_cast<uint64_t>(p)};
+#elif defined(_MSC_VER) && defined(_M_X64)
+  auto hi = uint64_t();
+  auto lo = _umul128(x, y, &hi);
+  return {hi, lo};
+#else
+  const uint64_t mask = static_cast<uint64_t>(max_value<uint32_t>());
 
-// Format specifiers for built-in and string types.
-template <typename Char>
-struct basic_format_specs {
-	int width;
-	int precision;
-	char type;
-	align_t align : 4;
-	sign_t sign : 3;
-	bool alt : 1; // Alternate form ('#').
-	internal::fill_t<Char> fill;
-	char thousands;
-
-	constexpr basic_format_specs()
-	    : width(0), precision(-1), type(0), align(align::none), sign(sign::none), alt(false),
-	      fill(internal::fill_t<Char>::make()), thousands('\0') {
-	}
-};
+  uint64_t a = x >> 32;
+  uint64_t b = x & mask;
+  uint64_t c = y >> 32;
+  uint64_t d = y & mask;
 
-using format_specs = basic_format_specs<char>;
+  uint64_t ac = a * c;
+  uint64_t bc = b * c;
+  uint64_t ad = a * d;
+  uint64_t bd = b * d;
 
-namespace internal {
+  uint64_t intermediate = (bd >> 32) + (ad & mask) + (bc & mask);
 
-// A floating-point presentation format.
-enum class float_format : unsigned char {
-	general, // General: exponent notation or fixed point based on magnitude.
-	exp,     // Exponent notation with the default precision of 6, e.g. 1.2e-3.
-	fixed,   // Fixed point with the default precision of 6, e.g. 0.0012.
-	hex
-};
+  return {ac + (intermediate >> 32) + (ad >> 32) + (bc >> 32),
+          (intermediate << 32) + (bd & mask)};
+#endif
+}
 
-struct float_specs {
-	int precision;
-	float_format format : 8;
-	sign_t sign : 8;
-	bool upper : 1;
-	bool locale : 1;
-	bool percent : 1;
-	bool binary32 : 1;
-	bool use_grisu : 1;
-	bool trailing_zeros : 1;
-};
+namespace dragonbox {
+// Computes floor(log10(pow(2, e))) for e in [-2620, 2620] using the method from
+// https://fmt.dev/papers/Dragonbox.pdf#page=28, section 6.1.
+inline auto floor_log10_pow2(int e) noexcept -> int {
+  FMT_ASSERT(e <= 2620 && e >= -2620, "too large exponent");
+  static_assert((-1 >> 1) == -1, "right shift is not arithmetic");
+  return (e * 315653) >> 20;
+}
 
-// Writes the exponent exp in the form "[+-]d{2,3}" to buffer.
-template <typename Char, typename It>
-It write_exponent(int exp, It it) {
-	FMT_ASSERT(-10000 < exp && exp < 10000, "exponent out of range");
-	if (exp < 0) {
-		*it++ = static_cast<Char>('-');
-		exp = -exp;
-	} else {
-		*it++ = static_cast<Char>('+');
-	}
-	if (exp >= 100) {
-		const char* top = data::digits + (exp / 100) * 2;
-		if (exp >= 1000)
-			*it++ = static_cast<Char>(top[0]);
-		*it++ = static_cast<Char>(top[1]);
-		exp %= 100;
-	}
-	const char* d = data::digits + exp * 2;
-	*it++ = static_cast<Char>(d[0]);
-	*it++ = static_cast<Char>(d[1]);
-	return it;
+inline auto floor_log2_pow10(int e) noexcept -> int {
+  FMT_ASSERT(e <= 1233 && e >= -1233, "too large exponent");
+  return (e * 1741647) >> 19;
 }
 
-template <typename Char>
-class float_writer {
-private:
-	// The number is given as v = digits_ * pow(10, exp_).
-	const char* digits_;
-	int num_digits_;
-	int exp_;
-	size_t size_;
-	float_specs specs_;
-	Char decimal_point_;
-
-	template <typename It>
-	It prettify(It it) const {
-		// pow(10, full_exp - 1) <= v <= pow(10, full_exp).
-		int full_exp = num_digits_ + exp_;
-		if (specs_.format == float_format::exp) {
-			// Insert a decimal point after the first digit and add an exponent.
-			*it++ = static_cast<Char>(*digits_);
-			int num_zeros = specs_.precision - num_digits_;
-			bool trailing_zeros = num_zeros > 0 && specs_.trailing_zeros;
-			if (num_digits_ > 1 || trailing_zeros)
-				*it++ = decimal_point_;
-			it = copy_str<Char>(digits_ + 1, digits_ + num_digits_, it);
-			if (trailing_zeros)
-				it = std::fill_n(it, num_zeros, static_cast<Char>('0'));
-			*it++ = static_cast<Char>(specs_.upper ? 'E' : 'e');
-			return write_exponent<Char>(full_exp - 1, it);
-		}
-		if (num_digits_ <= full_exp) {
-			// 1234e7 -> 12340000000[.0+]
-			it = copy_str<Char>(digits_, digits_ + num_digits_, it);
-			it = std::fill_n(it, full_exp - num_digits_, static_cast<Char>('0'));
-			if (specs_.trailing_zeros) {
-				*it++ = decimal_point_;
-				int num_zeros = specs_.precision - full_exp;
-				if (num_zeros <= 0) {
-					if (specs_.format != float_format::fixed)
-						*it++ = static_cast<Char>('0');
-					return it;
-				}
-#ifdef FUZZING_BUILD_MODE_UNSAFE_FOR_PRODUCTION
-				if (num_zeros > 1000)
-					throw std::runtime_error("fuzz mode - avoiding excessive cpu use");
+// Computes upper 64 bits of multiplication of two 64-bit unsigned integers.
+inline auto umul128_upper64(uint64_t x, uint64_t y) noexcept -> uint64_t {
+#if FMT_USE_INT128
+  auto p = static_cast<uint128_opt>(x) * static_cast<uint128_opt>(y);
+  return static_cast<uint64_t>(p >> 64);
+#elif defined(_MSC_VER) && defined(_M_X64)
+  return __umulh(x, y);
+#else
+  return umul128(x, y).high();
 #endif
-				it = std::fill_n(it, num_zeros, static_cast<Char>('0'));
-			}
-		} else if (full_exp > 0) {
-			// 1234e-2 -> 12.34[0+]
-			it = copy_str<Char>(digits_, digits_ + full_exp, it);
-			if (!specs_.trailing_zeros) {
-				// Remove trailing zeros.
-				int num_digits = num_digits_;
-				while (num_digits > full_exp && digits_[num_digits - 1] == '0')
-					--num_digits;
-				if (num_digits != full_exp)
-					*it++ = decimal_point_;
-				return copy_str<Char>(digits_ + full_exp, digits_ + num_digits, it);
-			}
-			*it++ = decimal_point_;
-			it = copy_str<Char>(digits_ + full_exp, digits_ + num_digits_, it);
-			if (specs_.precision > num_digits_) {
-				// Add trailing zeros.
-				int num_zeros = specs_.precision - num_digits_;
-				it = std::fill_n(it, num_zeros, static_cast<Char>('0'));
-			}
-		} else {
-			// 1234e-6 -> 0.001234
-			*it++ = static_cast<Char>('0');
-			int num_zeros = -full_exp;
-			if (specs_.precision >= 0 && specs_.precision < num_zeros)
-				num_zeros = specs_.precision;
-			int num_digits = num_digits_;
-			if (!specs_.trailing_zeros)
-				while (num_digits > 0 && digits_[num_digits - 1] == '0')
-					--num_digits;
-			if (num_zeros != 0 || num_digits != 0) {
-				*it++ = decimal_point_;
-				it = std::fill_n(it, num_zeros, static_cast<Char>('0'));
-				it = copy_str<Char>(digits_, digits_ + num_digits, it);
-			}
-		}
-		return it;
-	}
-
-public:
-	float_writer(const char* digits, int num_digits, int exp, float_specs specs, Char decimal_point)
-	    : digits_(digits), num_digits_(num_digits), exp_(exp), specs_(specs), decimal_point_(decimal_point) {
-		int full_exp = num_digits + exp - 1;
-		int precision = specs.precision > 0 ? specs.precision : 16;
-		if (specs_.format == float_format::general && !(full_exp >= -4 && full_exp < precision)) {
-			specs_.format = float_format::exp;
-		}
-		size_ = prettify(counting_iterator()).count();
-		size_ += specs.sign ? 1 : 0;
-	}
-
-	size_t size() const {
-		return size_;
-	}
-
-	size_t width() const {
-		return size();
-	}
-
-	template <typename It>
-	void operator()(It&& it) {
-		if (specs_.sign)
-			*it++ = static_cast<Char>(data::signs[specs_.sign]);
-		it = prettify(it);
-	}
+}
+
+// Computes upper 128 bits of multiplication of a 64-bit unsigned integer and a
+// 128-bit unsigned integer.
+inline auto umul192_upper128(uint64_t x, uint128_fallback y) noexcept
+    -> uint128_fallback {
+  uint128_fallback r = umul128(x, y.high());
+  r += umul128_upper64(x, y.low());
+  return r;
+}
+
+FMT_API auto get_cached_power(int k) noexcept -> uint128_fallback;
+
+// Type-specific information that Dragonbox uses.
+template <typename T, typename Enable = void> struct float_info;
+
+template <> struct float_info<float> {
+  using carrier_uint = uint32_t;
+  static const int exponent_bits = 8;
+  static const int kappa = 1;
+  static const int big_divisor = 100;
+  static const int small_divisor = 10;
+  static const int min_k = -31;
+  static const int max_k = 46;
+  static const int shorter_interval_tie_lower_threshold = -35;
+  static const int shorter_interval_tie_upper_threshold = -35;
 };
 
-template <typename T>
-int format_float(T value, int precision, float_specs specs, buffer<char>& buf);
+template <> struct float_info<double> {
+  using carrier_uint = uint64_t;
+  static const int exponent_bits = 11;
+  static const int kappa = 2;
+  static const int big_divisor = 1000;
+  static const int small_divisor = 100;
+  static const int min_k = -292;
+  static const int max_k = 341;
+  static const int shorter_interval_tie_lower_threshold = -77;
+  static const int shorter_interval_tie_upper_threshold = -77;
+};
 
-// Formats a floating-point number with snprintf.
+// An 80- or 128-bit floating point number.
 template <typename T>
-int snprintf_float(T value, int precision, float_specs specs, buffer<char>& buf);
+struct float_info<T, enable_if_t<std::numeric_limits<T>::digits == 64 ||
+                                 std::numeric_limits<T>::digits == 113 ||
+                                 is_float128<T>::value>> {
+  using carrier_uint = detail::uint128_t;
+  static const int exponent_bits = 15;
+};
 
+// A double-double floating point number.
 template <typename T>
-T promote_float(T value) {
-	return value;
-}
-
-inline double promote_float(float value) {
-	return value;
-}
-
-template <typename Spec, typename Handler>
-FMT_CONSTEXPR void handle_int_type_spec(const Spec& specs, Handler&& handler) {
-	if (specs.thousands != '\0') {
-		handler.on_num();
-		return;
-	}
-	switch (specs.type) {
-	case 0:
-	case 'd':
-		handler.on_dec();
-		break;
-	case 'x':
-	case 'X':
-		handler.on_hex();
-		break;
-	case 'b':
-	case 'B':
-		handler.on_bin();
-		break;
-	case 'o':
-		handler.on_oct();
-		break;
-	case 'n':
-	case 'l':
-	case 'L':
-		handler.on_num();
-		break;
-	default:
-		handler.on_error("Invalid type specifier \"" + std::string(1, specs.type) +
-		                 "\" for formatting a value of type int");
-	}
-}
-
-template <typename ErrorHandler = error_handler, typename Char>
-FMT_CONSTEXPR float_specs parse_float_type_spec(const basic_format_specs<Char>& specs, ErrorHandler&& eh = {}) {
-
-	auto result = float_specs();
-	if (specs.thousands != '\0') {
-		eh.on_error("Thousand separators are not supported for floating point numbers");
-		return result;
-	}
-	result.trailing_zeros = specs.alt;
-	switch (specs.type) {
-	case 0:
-		result.format = float_format::general;
-		result.trailing_zeros |= specs.precision != 0;
-		break;
-	case 'G':
-		result.upper = true;
-		FMT_FALLTHROUGH;
-	case 'g':
-		result.format = float_format::general;
-		break;
-	case 'E':
-		result.upper = true;
-		FMT_FALLTHROUGH;
-	case 'e':
-		result.format = float_format::exp;
-		result.trailing_zeros |= specs.precision != 0;
-		break;
-	case 'F':
-		result.upper = true;
-		FMT_FALLTHROUGH;
-	case 'f':
-		result.format = float_format::fixed;
-		result.trailing_zeros |= specs.precision != 0;
-		break;
-#if FMT_DEPRECATED_PERCENT
-	case '%':
-		result.format = float_format::fixed;
-		result.percent = true;
-		break;
-#endif
-	case 'A':
-		result.upper = true;
-		FMT_FALLTHROUGH;
-	case 'a':
-		result.format = float_format::hex;
-		break;
-	case 'n':
-	case 'l':
-	case 'L':
-		result.locale = true;
-		break;
-	default:
-		eh.on_error("Invalid type specifier \"" + std::string(1, specs.type) +
-		            "\" for formatting a value of type float");
-		break;
-	}
-	return result;
-}
-
-template <typename Char, typename Handler>
-FMT_CONSTEXPR void handle_char_specs(const basic_format_specs<Char>* specs, Handler&& handler) {
-	if (!specs)
-		return handler.on_char();
-	if (specs->type && specs->type != 'c')
-		return handler.on_int();
-	if (specs->align == align::numeric || specs->sign != sign::none || specs->alt)
-		handler.on_error("invalid format specifier for char");
-	handler.on_char();
-}
-
-template <typename Char, typename Handler>
-FMT_CONSTEXPR void handle_cstring_type_spec(Char spec, Handler&& handler) {
-	if (spec == 0 || spec == 's')
-		handler.on_string();
-	else if (spec == 'p')
-		handler.on_pointer();
-	else
-		handler.on_error("Invalid type specifier \"" + std::string(1, spec) +
-		                 "\" for formatting a value of type string");
-}
-
-template <typename Char, typename ErrorHandler>
-FMT_CONSTEXPR void check_string_type_spec(Char spec, ErrorHandler&& eh) {
-	if (spec != 0 && spec != 's')
-		eh.on_error("Invalid type specifier \"" + std::string(1, spec) + "\" for formatting a value of type string");
-}
-
-template <typename Char, typename ErrorHandler>
-FMT_CONSTEXPR void check_pointer_type_spec(Char spec, ErrorHandler&& eh) {
-	if (spec != 0 && spec != 'p')
-		eh.on_error("Invalid type specifier \"" + std::string(1, spec) + "\" for formatting a value of type pointer");
-}
-
-template <typename ErrorHandler>
-class int_type_checker : private ErrorHandler {
-public:
-	FMT_CONSTEXPR explicit int_type_checker(ErrorHandler eh) : ErrorHandler(eh) {
-	}
-
-	FMT_CONSTEXPR void on_dec() {
-	}
-
-	FMT_CONSTEXPR void on_hex() {
-	}
-
-	FMT_CONSTEXPR void on_bin() {
-	}
-
-	FMT_CONSTEXPR void on_oct() {
-	}
-
-	FMT_CONSTEXPR void on_num() {
-	}
-
-	FMT_CONSTEXPR void on_error(std::string error) {
-		ErrorHandler::on_error(error);
-	}
+struct float_info<T, enable_if_t<is_double_double<T>::value>> {
+  using carrier_uint = detail::uint128_t;
 };
 
-template <typename ErrorHandler>
-class char_specs_checker : public ErrorHandler {
-private:
-	char type_;
-
-public:
-	FMT_CONSTEXPR char_specs_checker(char type, ErrorHandler eh) : ErrorHandler(eh), type_(type) {
-	}
-
-	FMT_CONSTEXPR void on_int() {
-		handle_int_type_spec(type_, int_type_checker<ErrorHandler>(*this));
-	}
-
-	FMT_CONSTEXPR void on_char() {
-	}
+template <typename T> struct decimal_fp {
+  using significand_type = typename float_info<T>::carrier_uint;
+  significand_type significand;
+  int exponent;
 };
 
-template <typename ErrorHandler>
-class cstring_type_checker : public ErrorHandler {
-public:
-	FMT_CONSTEXPR explicit cstring_type_checker(ErrorHandler eh) : ErrorHandler(eh) {
-	}
+template <typename T> FMT_API auto to_decimal(T x) noexcept -> decimal_fp<T>;
+}  // namespace dragonbox
 
-	FMT_CONSTEXPR void on_string() {
-	}
+// Returns true iff Float has the implicit bit which is not stored.
+template <typename Float> constexpr auto has_implicit_bit() -> bool {
+  // An 80-bit FP number has a 64-bit significand an no implicit bit.
+  return std::numeric_limits<Float>::digits != 64;
+}
 
-	FMT_CONSTEXPR void on_pointer() {
-	}
-};
+// Returns the number of significand bits stored in Float. The implicit bit is
+// not counted since it is not stored.
+template <typename Float> constexpr auto num_significand_bits() -> int {
+  // std::numeric_limits may not support __float128.
+  return is_float128<Float>() ? 112
+                              : (std::numeric_limits<Float>::digits -
+                                 (has_implicit_bit<Float>() ? 1 : 0));
+}
 
-template <typename Context>
-void arg_map<Context>::init(const basic_format_args<Context>& args) {
-	if (map_)
-		return;
-	map_ = new entry[internal::to_unsigned(args.max_size())];
-	if (args.is_packed()) {
-		for (int i = 0;; ++i) {
-			internal::type arg_type = args.type(i);
-			if (arg_type == internal::none_type)
-				return;
-			if (arg_type == internal::named_arg_type)
-				push_back(args.values_[i]);
-		}
-	}
-	for (int i = 0, n = args.max_size(); i < n; ++i) {
-		auto type = args.args_[i].type_;
-		if (type == internal::named_arg_type)
-			push_back(args.args_[i].value_);
-	}
+template <typename Float>
+constexpr auto exponent_mask() ->
+    typename dragonbox::float_info<Float>::carrier_uint {
+  using float_uint = typename dragonbox::float_info<Float>::carrier_uint;
+  return ((float_uint(1) << dragonbox::float_info<Float>::exponent_bits) - 1)
+         << num_significand_bits<Float>();
+}
+template <typename Float> constexpr auto exponent_bias() -> int {
+  // std::numeric_limits may not support __float128.
+  return is_float128<Float>() ? 16383
+                              : std::numeric_limits<Float>::max_exponent - 1;
 }
 
-template <typename Char>
-struct nonfinite_writer {
-	sign_t sign;
-	const char* str;
-	static constexpr size_t str_size = 3;
-
-	size_t size() const {
-		return str_size + (sign ? 1 : 0);
-	}
-
-	size_t width() const {
-		return size();
-	}
-
-	template <typename It>
-	void operator()(It&& it) const {
-		if (sign)
-			*it++ = static_cast<Char>(data::signs[sign]);
-		it = copy_str<Char>(str, str + str_size, it);
-	}
+// Writes the exponent exp in the form "[+-]d{2,3}" to buffer.
+template <typename Char, typename It>
+FMT_CONSTEXPR auto write_exponent(int exp, It it) -> It {
+  FMT_ASSERT(-10000 < exp && exp < 10000, "exponent out of range");
+  if (exp < 0) {
+    *it++ = static_cast<Char>('-');
+    exp = -exp;
+  } else {
+    *it++ = static_cast<Char>('+');
+  }
+  if (exp >= 100) {
+    const char* top = digits2(to_unsigned(exp / 100));
+    if (exp >= 1000) *it++ = static_cast<Char>(top[0]);
+    *it++ = static_cast<Char>(top[1]);
+    exp %= 100;
+  }
+  const char* d = digits2(to_unsigned(exp));
+  *it++ = static_cast<Char>(d[0]);
+  *it++ = static_cast<Char>(d[1]);
+  return it;
+}
+
+// A floating-point number f * pow(2, e) where F is an unsigned type.
+template <typename F> struct basic_fp {
+  F f;
+  int e;
+
+  static constexpr const int num_significand_bits =
+      static_cast<int>(sizeof(F) * num_bits<unsigned char>());
+
+  constexpr basic_fp() : f(0), e(0) {}
+  constexpr basic_fp(uint64_t f_val, int e_val) : f(f_val), e(e_val) {}
+
+  // Constructs fp from an IEEE754 floating-point number.
+  template <typename Float> FMT_CONSTEXPR basic_fp(Float n) { assign(n); }
+
+  // Assigns n to this and return true iff predecessor is closer than successor.
+  template <typename Float, FMT_ENABLE_IF(!is_double_double<Float>::value)>
+  FMT_CONSTEXPR auto assign(Float n) -> bool {
+    static_assert(std::numeric_limits<Float>::digits <= 113, "unsupported FP");
+    // Assume Float is in the format [sign][exponent][significand].
+    using carrier_uint = typename dragonbox::float_info<Float>::carrier_uint;
+    const auto num_float_significand_bits =
+        detail::num_significand_bits<Float>();
+    const auto implicit_bit = carrier_uint(1) << num_float_significand_bits;
+    const auto significand_mask = implicit_bit - 1;
+    auto u = bit_cast<carrier_uint>(n);
+    f = static_cast<F>(u & significand_mask);
+    auto biased_e = static_cast<int>((u & exponent_mask<Float>()) >>
+                                     num_float_significand_bits);
+    // The predecessor is closer if n is a normalized power of 2 (f == 0)
+    // other than the smallest normalized number (biased_e > 1).
+    auto is_predecessor_closer = f == 0 && biased_e > 1;
+    if (biased_e == 0)
+      biased_e = 1;  // Subnormals use biased exponent 1 (min exponent).
+    else if (has_implicit_bit<Float>())
+      f += static_cast<F>(implicit_bit);
+    e = biased_e - exponent_bias<Float>() - num_float_significand_bits;
+    if (!has_implicit_bit<Float>()) ++e;
+    return is_predecessor_closer;
+  }
+
+  template <typename Float, FMT_ENABLE_IF(is_double_double<Float>::value)>
+  FMT_CONSTEXPR auto assign(Float n) -> bool {
+    static_assert(std::numeric_limits<double>::is_iec559, "unsupported FP");
+    return assign(static_cast<double>(n));
+  }
 };
 
-// This template provides operations for formatting and writing data into a
-// character range.
-template <typename Range>
-class basic_writer {
-public:
-	using char_type = typename Range::value_type;
-	using iterator = typename Range::iterator;
-	using format_specs = basic_format_specs<char_type>;
-
-private:
-	iterator out_; // Output iterator.
-	locale_ref locale_;
-
-	// Attempts to reserve space for n extra characters in the output range.
-	// Returns a pointer to the reserved range or a reference to out_.
-	auto reserve(std::size_t n) -> decltype(internal::reserve(out_, n)) {
-		return internal::reserve(out_, n);
-	}
-
-	template <typename F>
-	struct padded_int_writer {
-		size_t size_;
-		string_view prefix;
-		char_type fill;
-		std::size_t padding;
-		F f;
-
-		size_t size() const {
-			return size_;
-		}
-
-		size_t width() const {
-			return size_;
-		}
-
-		template <typename It>
-		void operator()(It&& it) const {
-			if (prefix.size() != 0)
-				it = copy_str<char_type>(prefix.begin(), prefix.end(), it);
-			it = std::fill_n(it, padding, fill);
-			f(it);
-		}
-	};
-
-	// Writes an integer in the format
-	//   <left-padding><prefix><numeric-padding><digits><right-padding>
-	// where <digits> are written by f(it).
-	template <typename F>
-	void write_int(int num_digits, string_view prefix, format_specs specs, F f) {
-		std::size_t size = prefix.size() + to_unsigned(num_digits);
-		char_type fill = specs.fill[0];
-		std::size_t padding = 0;
-		if (specs.align == align::numeric) {
-			auto unsiged_width = to_unsigned(specs.width);
-			if (unsiged_width > size) {
-				padding = unsiged_width - size;
-				size = unsiged_width;
-			}
-		} else if (specs.precision > num_digits) {
-			size = prefix.size() + to_unsigned(specs.precision);
-			padding = to_unsigned(specs.precision - num_digits);
-			fill = static_cast<char_type>('0');
-		}
-		if (specs.align == align::none)
-			specs.align = align::right;
-		write_padded(specs, padded_int_writer<F> {size, prefix, fill, padding, f});
-	}
-
-	// Writes a decimal integer.
-	template <typename Int>
-	void write_decimal(Int value) {
-		auto abs_value = static_cast<uint32_or_64_or_128_t<Int>>(value);
-		bool negative = is_negative(value);
-		// Don't do -abs_value since it trips unsigned-integer-overflow sanitizer.
-		if (negative)
-			abs_value = ~abs_value + 1;
-		int num_digits = count_digits(abs_value);
-		auto&& it = reserve((negative ? 1 : 0) + static_cast<size_t>(num_digits));
-		if (negative)
-			*it++ = static_cast<char_type>('-');
-		it = format_decimal<char_type>(it, abs_value, num_digits);
-	}
-
-	// The handle_int_type_spec handler that writes an integer.
-	template <typename Int, typename Specs>
-	struct int_writer {
-		using unsigned_type = uint32_or_64_or_128_t<Int>;
-
-		basic_writer<Range>& writer;
-		const Specs& specs;
-		unsigned_type abs_value;
-		char prefix[4];
-		unsigned prefix_size;
-
-		string_view get_prefix() const {
-			return string_view(prefix, prefix_size);
-		}
-
-		int_writer(basic_writer<Range>& w, Int value, const Specs& s)
-		    : writer(w), specs(s), abs_value(static_cast<unsigned_type>(value)), prefix_size(0) {
-			if (is_negative(value)) {
-				prefix[0] = '-';
-				++prefix_size;
-				abs_value = 0 - abs_value;
-			} else if (specs.sign != sign::none && specs.sign != sign::minus) {
-				prefix[0] = specs.sign == sign::plus ? '+' : ' ';
-				++prefix_size;
-			}
-		}
-
-		struct dec_writer {
-			unsigned_type abs_value;
-			int num_digits;
-
-			template <typename It>
-			void operator()(It&& it) const {
-				it = internal::format_decimal<char_type>(it, abs_value, num_digits);
-			}
-		};
-
-		void on_dec() {
-			int num_digits = count_digits(abs_value);
-			writer.write_int(num_digits, get_prefix(), specs, dec_writer {abs_value, num_digits});
-		}
-
-		struct hex_writer {
-			int_writer& self;
-			int num_digits;
-
-			template <typename It>
-			void operator()(It&& it) const {
-				it = format_uint<4, char_type>(it, self.abs_value, num_digits, self.specs.type != 'x');
-			}
-		};
-
-		void on_hex() {
-			if (specs.alt) {
-				prefix[prefix_size++] = '0';
-				prefix[prefix_size++] = specs.type;
-			}
-			int num_digits = count_digits<4>(abs_value);
-			writer.write_int(num_digits, get_prefix(), specs, hex_writer {*this, num_digits});
-		}
-
-		template <int BITS>
-		struct bin_writer {
-			unsigned_type abs_value;
-			int num_digits;
-
-			template <typename It>
-			void operator()(It&& it) const {
-				it = format_uint<BITS, char_type>(it, abs_value, num_digits);
-			}
-		};
-
-		void on_bin() {
-			if (specs.alt) {
-				prefix[prefix_size++] = '0';
-				prefix[prefix_size++] = static_cast<char>(specs.type);
-			}
-			int num_digits = count_digits<1>(abs_value);
-			writer.write_int(num_digits, get_prefix(), specs, bin_writer<1> {abs_value, num_digits});
-		}
-
-		void on_oct() {
-			int num_digits = count_digits<3>(abs_value);
-			if (specs.alt && specs.precision <= num_digits && abs_value != 0) {
-				// Octal prefix '0' is counted as a digit, so only add it if precision
-				// is not greater than the number of digits.
-				prefix[prefix_size++] = '0';
-			}
-			writer.write_int(num_digits, get_prefix(), specs, bin_writer<3> {abs_value, num_digits});
-		}
-
-		enum { sep_size = 1 };
-
-		struct num_writer {
-			unsigned_type abs_value;
-			int size;
-			const std::string& groups;
-			char_type sep;
-
-			template <typename It>
-			void operator()(It&& it) const {
-				basic_string_view<char_type> s(&sep, sep_size);
-				// Index of a decimal digit with the least significant digit having
-				// index 0.
-				int digit_index = 0;
-				std::string::const_iterator group = groups.cbegin();
-				it =
-				    format_decimal<char_type>(it, abs_value, size, [this, s, &group, &digit_index](char_type*& buffer) {
-					    if (*group <= 0 || ++digit_index % *group != 0 || *group == max_value<char>())
-						    return;
-					    if (group + 1 != groups.cend()) {
-						    digit_index = 0;
-						    ++group;
-					    }
-					    buffer -= s.size();
-					    std::uninitialized_copy(s.data(), s.data() + s.size(), make_checked(buffer, s.size()));
-				    });
-			}
-		};
-
-		void on_num() {
-			std::string groups = grouping<char_type>(writer.locale_);
-			if (groups.empty())
-				return on_dec();
-			auto sep = specs.thousands;
-			if (!sep)
-				return on_dec();
-			int num_digits = count_digits(abs_value);
-			int size = num_digits;
-			std::string::const_iterator group = groups.cbegin();
-			while (group != groups.cend() && num_digits > *group && *group > 0 && *group != max_value<char>()) {
-				size += sep_size;
-				num_digits -= *group;
-				++group;
-			}
-			if (group == groups.cend())
-				size += sep_size * ((num_digits - 1) / groups.back());
-			writer.write_int(size, get_prefix(), specs,
-			                 num_writer {abs_value, size, groups, static_cast<char_type>(sep)});
-		}
-
-		FMT_NORETURN void on_error(std::string) {
-			FMT_THROW(std::exception());
-		}
-	};
-
-	template <typename Char>
-	struct str_writer {
-		const Char* s;
-		size_t size_;
-
-		size_t size() const {
-			return size_;
-		}
-
-		size_t width() const {
-			return count_code_points(basic_string_view<Char>(s, size_));
-		}
-
-		template <typename It>
-		void operator()(It&& it) const {
-			it = copy_str<char_type>(s, s + size_, it);
-		}
-	};
-
-	template <typename UIntPtr>
-	struct pointer_writer {
-		UIntPtr value;
-		int num_digits;
-
-		size_t size() const {
-			return to_unsigned(num_digits) + 2;
-		}
-
-		size_t width() const {
-			return size();
-		}
-
-		template <typename It>
-		void operator()(It&& it) const {
-			*it++ = static_cast<char_type>('0');
-			*it++ = static_cast<char_type>('x');
-			it = format_uint<4, char_type>(it, value, num_digits);
-		}
-	};
-
-public:
-	explicit basic_writer(Range out, locale_ref loc = locale_ref()) : out_(out.begin()), locale_(loc) {
-	}
-
-	iterator out() const {
-		return out_;
-	}
-
-	// Writes a value in the format
-	//   <left-padding><value><right-padding>
-	// where <value> is written by f(it).
-	template <typename F>
-	void write_padded(const format_specs& specs, F&& f) {
-		// User-perceived width (in code points).
-		unsigned width = to_unsigned(specs.width);
-		size_t size = f.size(); // The number of code units.
-		size_t num_code_points = width != 0 ? f.width() : size;
-		if (width <= num_code_points)
-			return f(reserve(size));
-		auto&& it = reserve(width + (size - num_code_points));
-		char_type fill = specs.fill[0];
-		std::size_t padding = width - num_code_points;
-		if (specs.align == align::right) {
-			it = std::fill_n(it, padding, fill);
-			f(it);
-		} else if (specs.align == align::center) {
-			std::size_t left_padding = padding / 2;
-			it = std::fill_n(it, left_padding, fill);
-			f(it);
-			it = std::fill_n(it, padding - left_padding, fill);
-		} else {
-			f(it);
-			it = std::fill_n(it, padding, fill);
-		}
-	}
-
-	void write(int value) {
-		write_decimal(value);
-	}
-
-	void write(long value) {
-		write_decimal(value);
-	}
-
-	void write(long long value) {
-		write_decimal(value);
-	}
-
-	void write(unsigned value) {
-		write_decimal(value);
-	}
-
-	void write(unsigned long value) {
-		write_decimal(value);
-	}
-
-	void write(unsigned long long value) {
-		write_decimal(value);
-	}
+using fp = basic_fp<unsigned long long>;
+
+// Normalizes the value converted from double and multiplied by (1 << SHIFT).
+template <int SHIFT = 0, typename F>
+FMT_CONSTEXPR auto normalize(basic_fp<F> value) -> basic_fp<F> {
+  // Handle subnormals.
+  const auto implicit_bit = F(1) << num_significand_bits<double>();
+  const auto shifted_implicit_bit = implicit_bit << SHIFT;
+  while ((value.f & shifted_implicit_bit) == 0) {
+    value.f <<= 1;
+    --value.e;
+  }
+  // Subtract 1 to account for hidden bit.
+  const auto offset = basic_fp<F>::num_significand_bits -
+                      num_significand_bits<double>() - SHIFT - 1;
+  value.f <<= offset;
+  value.e -= offset;
+  return value;
+}
 
+// Computes lhs * rhs / pow(2, 64) rounded to nearest with half-up tie breaking.
+FMT_CONSTEXPR inline auto multiply(uint64_t lhs, uint64_t rhs) -> uint64_t {
 #if FMT_USE_INT128
-
-	void write(int128_t value) {
-		write_decimal(value);
-	}
-
-	void write(uint128_t value) {
-		write_decimal(value);
-	}
-
+  auto product = static_cast<__uint128_t>(lhs) * rhs;
+  auto f = static_cast<uint64_t>(product >> 64);
+  return (static_cast<uint64_t>(product) & (1ULL << 63)) != 0 ? f + 1 : f;
+#else
+  // Multiply 32-bit parts of significands.
+  uint64_t mask = (1ULL << 32) - 1;
+  uint64_t a = lhs >> 32, b = lhs & mask;
+  uint64_t c = rhs >> 32, d = rhs & mask;
+  uint64_t ac = a * c, bc = b * c, ad = a * d, bd = b * d;
+  // Compute mid 64-bit of result and round.
+  uint64_t mid = (bd >> 32) + (ad & mask) + (bc & mask) + (1U << 31);
+  return ac + (ad >> 32) + (bc >> 32) + (mid >> 32);
 #endif
+}
 
-	template <typename T, typename Spec>
-	void write_int(T value, const Spec& spec) {
-		handle_int_type_spec(spec, int_writer<T, Spec>(*this, value, spec));
-	}
-
-	template <typename T, FMT_ENABLE_IF(std::is_floating_point<T>::value)>
-	void write(T value, format_specs specs = {}) {
-		float_specs fspecs = parse_float_type_spec(specs);
-		fspecs.sign = specs.sign;
-		if (std::signbit(value)) { // value < 0 is false for NaN so use signbit.
-			fspecs.sign = sign::minus;
-			value = -value;
-		} else if (fspecs.sign == sign::minus) {
-			fspecs.sign = sign::none;
-		}
-
-		if (!std::isfinite(value)) {
-			auto str = std::isinf(value) ? (fspecs.upper ? "INF" : "inf") : (fspecs.upper ? "NAN" : "nan");
-			return write_padded(specs, nonfinite_writer<char_type> {fspecs.sign, str});
-		}
-
-		if (specs.align == align::none) {
-			specs.align = align::right;
-		} else if (specs.align == align::numeric) {
-			if (fspecs.sign) {
-				auto&& it = reserve(1);
-				*it++ = static_cast<char_type>(data::signs[fspecs.sign]);
-				fspecs.sign = sign::none;
-				if (specs.width != 0)
-					--specs.width;
-			}
-			specs.align = align::right;
-		}
-
-		memory_buffer buffer;
-		if (fspecs.format == float_format::hex) {
-			if (fspecs.sign)
-				buffer.push_back(data::signs[fspecs.sign]);
-			snprintf_float(promote_float(value), specs.precision, fspecs, buffer);
-			write_padded(specs, str_writer<char> {buffer.data(), buffer.size()});
-			return;
-		}
-		int precision = specs.precision >= 0 || !specs.type ? specs.precision : 6;
-		if (fspecs.format == float_format::exp)
-			++precision;
-		if (const_check(std::is_same<T, float>()))
-			fspecs.binary32 = true;
-		fspecs.use_grisu = use_grisu<T>();
-		if (const_check(FMT_DEPRECATED_PERCENT) && fspecs.percent)
-			value *= 100;
-		int exp = format_float(promote_float(value), precision, fspecs, buffer);
-		if (const_check(FMT_DEPRECATED_PERCENT) && fspecs.percent) {
-			buffer.push_back('%');
-			--exp; // Adjust decimal place position.
-		}
-		fspecs.precision = precision;
-		char_type point = fspecs.locale ? decimal_point<char_type>(locale_) : static_cast<char_type>('.');
-		write_padded(specs,
-		             float_writer<char_type>(buffer.data(), static_cast<int>(buffer.size()), exp, fspecs, point));
-	}
-
-	void write(char value) {
-		auto&& it = reserve(1);
-		*it++ = value;
-	}
-
-	template <typename Char, FMT_ENABLE_IF(std::is_same<Char, char_type>::value)>
-	void write(Char value) {
-		auto&& it = reserve(1);
-		*it++ = value;
-	}
-
-	void write(string_view value) {
-		auto&& it = reserve(value.size());
-		it = copy_str<char_type>(value.begin(), value.end(), it);
-	}
-
-	void write(wstring_view value) {
-		static_assert(std::is_same<char_type, wchar_t>::value, "");
-		auto&& it = reserve(value.size());
-		it = std::copy(value.begin(), value.end(), it);
-	}
-
-	template <typename Char>
-	void write(const Char* s, std::size_t size, const format_specs& specs) {
-		write_padded(specs, str_writer<Char> {s, size});
-	}
-
-	template <typename Char>
-	void write(basic_string_view<Char> s, const format_specs& specs = {}) {
-		const Char* data = s.data();
-		std::size_t size = s.size();
-		if (specs.precision >= 0 && to_unsigned(specs.precision) < size)
-			size = code_point_index(s, to_unsigned(specs.precision));
-		write(data, size, specs);
-	}
-
-	template <typename UIntPtr>
-	void write_pointer(UIntPtr value, const format_specs* specs) {
-		int num_digits = count_digits<4>(value);
-		auto pw = pointer_writer<UIntPtr> {value, num_digits};
-		if (!specs)
-			return pw(reserve(to_unsigned(num_digits) + 2));
-		format_specs specs_copy = *specs;
-		if (specs_copy.align == align::none)
-			specs_copy.align = align::right;
-		write_padded(specs_copy, pw);
-	}
-};
-
-using writer = basic_writer<buffer_range<char>>;
-
-template <typename T>
-struct is_integral : std::is_integral<T> {};
-template <>
-struct is_integral<int128_t> : std::true_type {};
-template <>
-struct is_integral<uint128_t> : std::true_type {};
-
-template <typename Range, typename ErrorHandler = internal::error_handler>
-class arg_formatter_base {
-public:
-	using char_type = typename Range::value_type;
-	using iterator = typename Range::iterator;
-	using format_specs = basic_format_specs<char_type>;
-
-private:
-	using writer_type = basic_writer<Range>;
-	writer_type writer_;
-	format_specs* specs_;
-
-	struct char_writer {
-		char_type value;
-
-		size_t size() const {
-			return 1;
-		}
-
-		size_t width() const {
-			return 1;
-		}
-
-		template <typename It>
-		void operator()(It&& it) const {
-			*it++ = value;
-		}
-	};
-
-	void write_char(char_type value) {
-		if (specs_)
-			writer_.write_padded(*specs_, char_writer {value});
-		else
-			writer_.write(value);
-	}
-
-	void write_pointer(const void* p) {
-		writer_.write_pointer(internal::to_uintptr(p), specs_);
-	}
-
-protected:
-	writer_type& writer() {
-		return writer_;
-	}
-
-	FMT_DEPRECATED format_specs* spec() {
-		return specs_;
-	}
-
-	format_specs* specs() {
-		return specs_;
-	}
-
-	iterator out() {
-		return writer_.out();
-	}
-
-	void write(bool value) {
-		string_view sv(value ? "true" : "false");
-		specs_ ? writer_.write(sv, *specs_) : writer_.write(sv);
-	}
-
-	void write(const char_type* value) {
-		if (!value) {
-			// FMT_THROW(duckdb::InternalException("string pointer is null"));
-		} else {
-			auto length = std::char_traits<char_type>::length(value);
-			basic_string_view<char_type> sv(value, length);
-			specs_ ? writer_.write(sv, *specs_) : writer_.write(sv);
-		}
-	}
-
-public:
-	arg_formatter_base(Range r, format_specs* s, locale_ref loc) : writer_(r, loc), specs_(s) {
-	}
-
-	iterator operator()(monostate) {
-		FMT_ASSERT(false, "invalid argument type");
-		return out();
-	}
-
-	template <typename T, FMT_ENABLE_IF(is_integral<T>::value)>
-	iterator operator()(T value) {
-		if (specs_)
-			writer_.write_int(value, *specs_);
-		else
-			writer_.write(value);
-		return out();
-	}
-
-	iterator operator()(char_type value) {
-		internal::handle_char_specs(specs_, char_spec_handler(*this, static_cast<char_type>(value)));
-		return out();
-	}
-
-	iterator operator()(bool value) {
-		if (specs_ && specs_->type)
-			return (*this)(value ? 1 : 0);
-		write(value != 0);
-		return out();
-	}
-
-	template <typename T, FMT_ENABLE_IF(std::is_floating_point<T>::value)>
-	iterator operator()(T value) {
-		writer_.write(value, specs_ ? *specs_ : format_specs());
-		return out();
-	}
-
-	struct char_spec_handler : ErrorHandler {
-		arg_formatter_base& formatter;
-		char_type value;
-
-		char_spec_handler(arg_formatter_base& f, char_type val) : formatter(f), value(val) {
-		}
-
-		void on_int() {
-			if (formatter.specs_)
-				formatter.writer_.write_int(value, *formatter.specs_);
-			else
-				formatter.writer_.write(value);
-		}
-
-		void on_char() {
-			formatter.write_char(value);
-		}
-	};
-
-	struct cstring_spec_handler : internal::error_handler {
-		arg_formatter_base& formatter;
-		const char_type* value;
-
-		cstring_spec_handler(arg_formatter_base& f, const char_type* val) : formatter(f), value(val) {
-		}
-
-		void on_string() {
-			formatter.write(value);
-		}
-
-		void on_pointer() {
-			formatter.write_pointer(value);
-		}
-	};
-
-	iterator operator()(const char_type* value) {
-		if (!specs_)
-			return write(value), out();
-		internal::handle_cstring_type_spec(specs_->type, cstring_spec_handler(*this, value));
-		return out();
-	}
-
-	iterator operator()(basic_string_view<char_type> value) {
-		if (specs_) {
-			internal::check_string_type_spec(specs_->type, internal::error_handler());
-			writer_.write(value, *specs_);
-		} else {
-			writer_.write(value);
-		}
-		return out();
-	}
-
-	iterator operator()(const void* value) {
-		if (specs_)
-			check_pointer_type_spec(specs_->type, internal::error_handler());
-		write_pointer(value);
-		return out();
-	}
-};
+FMT_CONSTEXPR inline auto operator*(fp x, fp y) -> fp {
+  return {multiply(x.f, y.f), x.e + y.e + 64};
+}
 
-template <typename Char>
-FMT_CONSTEXPR bool is_name_start(Char c) {
-	return ('a' <= c && c <= 'z') || ('A' <= c && c <= 'Z') || '_' == c;
-}
-
-// Parses the range [begin, end) as an unsigned integer. This function assumes
-// that the range is non-empty and the first character is a digit.
-template <typename Char, typename ErrorHandler>
-FMT_CONSTEXPR int parse_nonnegative_int(const Char*& begin, const Char* end, ErrorHandler&& eh) {
-	FMT_ASSERT(begin != end && '0' <= *begin && *begin <= '9', "");
-	if (*begin == '0') {
-		++begin;
-		return 0;
-	}
-	unsigned value = 0;
-	// Convert to unsigned to prevent a warning.
-	constexpr unsigned max_int = max_value<int>();
-	unsigned big = max_int / 10;
-	do {
-		// Check for overflow.
-		if (value > big) {
-			value = max_int + 1;
-			break;
-		}
-		value = value * 10 + unsigned(*begin - '0');
-		++begin;
-	} while (begin != end && '0' <= *begin && *begin <= '9');
-	if (value > max_int)
-		eh.on_error("number is too big");
-	return static_cast<int>(value);
-}
-
-template <typename Context>
-class custom_formatter {
-private:
-	using char_type = typename Context::char_type;
-
-	basic_format_parse_context<char_type>& parse_ctx_;
-	Context& ctx_;
-
-public:
-	explicit custom_formatter(basic_format_parse_context<char_type>& parse_ctx, Context& ctx)
-	    : parse_ctx_(parse_ctx), ctx_(ctx) {
-	}
-
-	bool operator()(typename basic_format_arg<Context>::handle h) const {
-		h.format(parse_ctx_, ctx_);
-		return true;
-	}
-
-	template <typename T>
-	bool operator()(T) const {
-		return false;
-	}
-};
+template <typename T, bool doublish = num_bits<T>() == num_bits<double>()>
+using convert_float_result =
+    conditional_t<std::is_same<T, float>::value || doublish, double, T>;
 
 template <typename T>
-using is_integer = bool_constant<is_integral<T>::value && !std::is_same<T, bool>::value &&
-                                 !std::is_same<T, char>::value && !std::is_same<T, wchar_t>::value>;
-
-template <typename ErrorHandler>
-class width_checker {
-public:
-	explicit FMT_CONSTEXPR width_checker(ErrorHandler& eh) : handler_(eh) {
-	}
-
-	template <typename T, FMT_ENABLE_IF(is_integer<T>::value)>
-	FMT_CONSTEXPR unsigned long long operator()(T value) {
-		if (is_negative(value))
-			handler_.on_error("negative width");
-		return static_cast<unsigned long long>(value);
-	}
-
-	template <typename T, FMT_ENABLE_IF(!is_integer<T>::value)>
-	FMT_CONSTEXPR unsigned long long operator()(T) {
-		handler_.on_error("width is not integer");
-		return 0;
-	}
-
-private:
-	ErrorHandler& handler_;
-};
-
-template <typename ErrorHandler>
-class precision_checker {
-public:
-	explicit FMT_CONSTEXPR precision_checker(ErrorHandler& eh) : handler_(eh) {
-	}
-
-	template <typename T, FMT_ENABLE_IF(is_integer<T>::value)>
-	FMT_CONSTEXPR unsigned long long operator()(T value) {
-		if (is_negative(value))
-			handler_.on_error("negative precision");
-		return static_cast<unsigned long long>(value);
-	}
-
-	template <typename T, FMT_ENABLE_IF(!is_integer<T>::value)>
-	FMT_CONSTEXPR unsigned long long operator()(T) {
-		handler_.on_error("precision is not integer");
-		return 0;
-	}
-
-private:
-	ErrorHandler& handler_;
-};
-
-// A format specifier handler that sets fields in basic_format_specs.
-template <typename Char>
-class specs_setter {
-public:
-	explicit FMT_CONSTEXPR specs_setter(basic_format_specs<Char>& specs) : specs_(specs) {
-	}
+constexpr auto convert_float(T value) -> convert_float_result<T> {
+  return static_cast<convert_float_result<T>>(value);
+}
 
-	FMT_CONSTEXPR specs_setter(const specs_setter& other) : specs_(other.specs_) {
-	}
+template <typename Char, typename OutputIt>
+FMT_NOINLINE FMT_CONSTEXPR auto fill(OutputIt it, size_t n, const fill_t& fill)
+    -> OutputIt {
+  auto fill_size = fill.size();
+  if (fill_size == 1) return detail::fill_n(it, n, fill.template get<Char>());
+  if (const Char* data = fill.template data<Char>()) {
+    for (size_t i = 0; i < n; ++i) it = copy<Char>(data, data + fill_size, it);
+  }
+  return it;
+}
 
-	FMT_CONSTEXPR void on_align(align_t align) {
-		specs_.align = align;
-	}
+// Writes the output of f, padded according to format specifications in specs.
+// size: output size in code units.
+// width: output display width in (terminal) column positions.
+template <typename Char, align::type align = align::left, typename OutputIt,
+          typename F>
+FMT_CONSTEXPR auto write_padded(OutputIt out, const format_specs& specs,
+                                size_t size, size_t width, F&& f) -> OutputIt {
+  static_assert(align == align::left || align == align::right, "");
+  unsigned spec_width = to_unsigned(specs.width);
+  size_t padding = spec_width > width ? spec_width - width : 0;
+  // Shifts are encoded as string literals because static constexpr is not
+  // supported in constexpr functions.
+  auto* shifts = align == align::left ? "\x1f\x1f\x00\x01" : "\x00\x1f\x00\x01";
+  size_t left_padding = padding >> shifts[specs.align];
+  size_t right_padding = padding - left_padding;
+  auto it = reserve(out, size + padding * specs.fill.size());
+  if (left_padding != 0) it = fill<Char>(it, left_padding, specs.fill);
+  it = f(it);
+  if (right_padding != 0) it = fill<Char>(it, right_padding, specs.fill);
+  return base_iterator(out, it);
+}
 
-	FMT_CONSTEXPR void on_fill(Char fill) {
-		specs_.fill[0] = fill;
-	}
+template <typename Char, align::type align = align::left, typename OutputIt,
+          typename F>
+constexpr auto write_padded(OutputIt out, const format_specs& specs,
+                            size_t size, F&& f) -> OutputIt {
+  return write_padded<Char, align>(out, specs, size, size, f);
+}
 
-	FMT_CONSTEXPR void on_plus() {
-		specs_.sign = sign::plus;
-	}
+template <typename Char, align::type align = align::left, typename OutputIt>
+FMT_CONSTEXPR auto write_bytes(OutputIt out, string_view bytes,
+                               const format_specs& specs = {}) -> OutputIt {
+  return write_padded<Char, align>(
+      out, specs, bytes.size(), [bytes](reserve_iterator<OutputIt> it) {
+        const char* data = bytes.data();
+        return copy<Char>(data, data + bytes.size(), it);
+      });
+}
 
-	FMT_CONSTEXPR void on_minus() {
-		specs_.sign = sign::minus;
-	}
+template <typename Char, typename OutputIt, typename UIntPtr>
+auto write_ptr(OutputIt out, UIntPtr value, const format_specs* specs)
+    -> OutputIt {
+  int num_digits = count_digits<4>(value);
+  auto size = to_unsigned(num_digits) + size_t(2);
+  auto write = [=](reserve_iterator<OutputIt> it) {
+    *it++ = static_cast<Char>('0');
+    *it++ = static_cast<Char>('x');
+    return format_uint<4, Char>(it, value, num_digits);
+  };
+  return specs ? write_padded<Char, align::right>(out, *specs, size, write)
+               : base_iterator(out, write(reserve(out, size)));
+}
 
-	FMT_CONSTEXPR void on_space() {
-		specs_.sign = sign::space;
-	}
+// Returns true iff the code point cp is printable.
+FMT_API auto is_printable(uint32_t cp) -> bool;
 
-	FMT_CONSTEXPR void on_comma() {
-		specs_.thousands = ',';
-	}
+inline auto needs_escape(uint32_t cp) -> bool {
+  return cp < 0x20 || cp == 0x7f || cp == '"' || cp == '\\' ||
+         !is_printable(cp);
+}
 
-	FMT_CONSTEXPR void on_underscore() {
-		specs_.thousands = '_';
-	}
+template <typename Char> struct find_escape_result {
+  const Char* begin;
+  const Char* end;
+  uint32_t cp;
+};
 
-	FMT_CONSTEXPR void on_single_quote() {
-		specs_.thousands = '\'';
-	}
+template <typename Char>
+auto find_escape(const Char* begin, const Char* end)
+    -> find_escape_result<Char> {
+  for (; begin != end; ++begin) {
+    uint32_t cp = static_cast<unsigned_char<Char>>(*begin);
+    if (const_check(sizeof(Char) == 1) && cp >= 0x80) continue;
+    if (needs_escape(cp)) return {begin, begin + 1, cp};
+  }
+  return {begin, nullptr, 0};
+}
 
-	FMT_CONSTEXPR void on_thousands(char sep) {
-		specs_.thousands = sep;
-	}
+inline auto find_escape(const char* begin, const char* end)
+    -> find_escape_result<char> {
+  if (!use_utf8()) return find_escape<char>(begin, end);
+  auto result = find_escape_result<char>{end, nullptr, 0};
+  for_each_codepoint(string_view(begin, to_unsigned(end - begin)),
+                     [&](uint32_t cp, string_view sv) {
+                       if (needs_escape(cp)) {
+                         result = {sv.begin(), sv.end(), cp};
+                         return false;
+                       }
+                       return true;
+                     });
+  return result;
+}
 
-	FMT_CONSTEXPR void on_hash() {
-		specs_.alt = true;
-	}
+#define FMT_STRING_IMPL(s, base, explicit)                                    \
+  [] {                                                                        \
+    /* Use the hidden visibility as a workaround for a GCC bug (#1973). */    \
+    /* Use a macro-like name to avoid shadowing warnings. */                  \
+    struct FMT_VISIBILITY("hidden") FMT_COMPILE_STRING : base {               \
+      using char_type FMT_MAYBE_UNUSED = fmt::remove_cvref_t<decltype(s[0])>; \
+      FMT_MAYBE_UNUSED FMT_CONSTEXPR explicit                                 \
+      operator fmt::basic_string_view<char_type>() const {                    \
+        return fmt::detail_exported::compile_string_to_view<char_type>(s);    \
+      }                                                                       \
+    };                                                                        \
+    return FMT_COMPILE_STRING();                                              \
+  }()
 
-	FMT_CONSTEXPR void on_zero() {
-		specs_.align = align::numeric;
-		specs_.fill[0] = Char('0');
-	}
+/**
+ * Constructs a compile-time format string from a string literal `s`.
+ *
+ * **Example**:
+ *
+ *     // A compile-time error because 'd' is an invalid specifier for strings.
+ *     std::string s = fmt::format(FMT_STRING("{:d}"), "foo");
+ */
+#define FMT_STRING(s) FMT_STRING_IMPL(s, fmt::detail::compile_string, )
+
+template <size_t width, typename Char, typename OutputIt>
+auto write_codepoint(OutputIt out, char prefix, uint32_t cp) -> OutputIt {
+  *out++ = static_cast<Char>('\\');
+  *out++ = static_cast<Char>(prefix);
+  Char buf[width];
+  fill_n(buf, width, static_cast<Char>('0'));
+  format_uint<4>(buf, cp, width);
+  return copy<Char>(buf, buf + width, out);
+}
 
-	FMT_CONSTEXPR void on_width(int width) {
-		specs_.width = width;
-	}
+template <typename OutputIt, typename Char>
+auto write_escaped_cp(OutputIt out, const find_escape_result<Char>& escape)
+    -> OutputIt {
+  auto c = static_cast<Char>(escape.cp);
+  switch (escape.cp) {
+  case '\n':
+    *out++ = static_cast<Char>('\\');
+    c = static_cast<Char>('n');
+    break;
+  case '\r':
+    *out++ = static_cast<Char>('\\');
+    c = static_cast<Char>('r');
+    break;
+  case '\t':
+    *out++ = static_cast<Char>('\\');
+    c = static_cast<Char>('t');
+    break;
+  case '"':
+    FMT_FALLTHROUGH;
+  case '\'':
+    FMT_FALLTHROUGH;
+  case '\\':
+    *out++ = static_cast<Char>('\\');
+    break;
+  default:
+    if (escape.cp < 0x100) return write_codepoint<2, Char>(out, 'x', escape.cp);
+    if (escape.cp < 0x10000)
+      return write_codepoint<4, Char>(out, 'u', escape.cp);
+    if (escape.cp < 0x110000)
+      return write_codepoint<8, Char>(out, 'U', escape.cp);
+    for (Char escape_char : basic_string_view<Char>(
+             escape.begin, to_unsigned(escape.end - escape.begin))) {
+      out = write_codepoint<2, Char>(out, 'x',
+                                     static_cast<uint32_t>(escape_char) & 0xFF);
+    }
+    return out;
+  }
+  *out++ = c;
+  return out;
+}
 
-	FMT_CONSTEXPR void on_precision(int precision) {
-		specs_.precision = precision;
-	}
+template <typename Char, typename OutputIt>
+auto write_escaped_string(OutputIt out, basic_string_view<Char> str)
+    -> OutputIt {
+  *out++ = static_cast<Char>('"');
+  auto begin = str.begin(), end = str.end();
+  do {
+    auto escape = find_escape(begin, end);
+    out = copy<Char>(begin, escape.begin, out);
+    begin = escape.end;
+    if (!begin) break;
+    out = write_escaped_cp<OutputIt, Char>(out, escape);
+  } while (begin != end);
+  *out++ = static_cast<Char>('"');
+  return out;
+}
 
-	FMT_CONSTEXPR void end_precision() {
-	}
+template <typename Char, typename OutputIt>
+auto write_escaped_char(OutputIt out, Char v) -> OutputIt {
+  Char v_array[1] = {v};
+  *out++ = static_cast<Char>('\'');
+  if ((needs_escape(static_cast<uint32_t>(v)) && v != static_cast<Char>('"')) ||
+      v == static_cast<Char>('\'')) {
+    out = write_escaped_cp(out,
+                           find_escape_result<Char>{v_array, v_array + 1,
+                                                    static_cast<uint32_t>(v)});
+  } else {
+    *out++ = v;
+  }
+  *out++ = static_cast<Char>('\'');
+  return out;
+}
 
-	FMT_CONSTEXPR void on_type(Char type) {
-		specs_.type = static_cast<char>(type);
-	}
+template <typename Char, typename OutputIt>
+FMT_CONSTEXPR auto write_char(OutputIt out, Char value,
+                              const format_specs& specs) -> OutputIt {
+  bool is_debug = specs.type == presentation_type::debug;
+  return write_padded<Char>(out, specs, 1, [=](reserve_iterator<OutputIt> it) {
+    if (is_debug) return write_escaped_char(it, value);
+    *it++ = value;
+    return it;
+  });
+}
+template <typename Char, typename OutputIt>
+FMT_CONSTEXPR auto write(OutputIt out, Char value, const format_specs& specs,
+                         locale_ref loc = {}) -> OutputIt {
+  // char is formatted as unsigned char for consistency across platforms.
+  using unsigned_type =
+      conditional_t<std::is_same<Char, char>::value, unsigned char, unsigned>;
+  return check_char_specs(specs)
+             ? write_char<Char>(out, value, specs)
+             : write<Char>(out, static_cast<unsigned_type>(value), specs, loc);
+}
 
-protected:
-	basic_format_specs<Char>& specs_;
+// Data for write_int that doesn't depend on output iterator type. It is used to
+// avoid template code bloat.
+template <typename Char> struct write_int_data {
+  size_t size;
+  size_t padding;
+
+  FMT_CONSTEXPR write_int_data(int num_digits, unsigned prefix,
+                               const format_specs& specs)
+      : size((prefix >> 24) + to_unsigned(num_digits)), padding(0) {
+    if (specs.align == align::numeric) {
+      auto width = to_unsigned(specs.width);
+      if (width > size) {
+        padding = width - size;
+        size = width;
+      }
+    } else if (specs.precision > num_digits) {
+      size = (prefix >> 24) + to_unsigned(specs.precision);
+      padding = to_unsigned(specs.precision - num_digits);
+    }
+  }
 };
 
-template <typename ErrorHandler>
-class numeric_specs_checker {
-public:
-	FMT_CONSTEXPR numeric_specs_checker(ErrorHandler& eh, internal::type arg_type)
-	    : error_handler_(eh), arg_type_(arg_type) {
-	}
-
-	FMT_CONSTEXPR void require_numeric_argument() {
-		if (!is_arithmetic_type(arg_type_))
-			error_handler_.on_error("format specifier requires numeric argument");
-	}
-
-	FMT_CONSTEXPR void check_sign() {
-		require_numeric_argument();
-		if (is_integral_type(arg_type_) && arg_type_ != int_type && arg_type_ != long_long_type &&
-		    arg_type_ != internal::char_type) {
-			error_handler_.on_error("format specifier requires signed argument");
-		}
-	}
-
-	FMT_CONSTEXPR void check_precision() {
-		if (is_integral_type(arg_type_) || arg_type_ == internal::pointer_type)
-			error_handler_.on_error("precision not allowed for this argument type");
-	}
-
-private:
-	ErrorHandler& error_handler_;
-	internal::type arg_type_;
-};
+// Writes an integer in the format
+//   <left-padding><prefix><numeric-padding><digits><right-padding>
+// where <digits> are written by write_digits(it).
+// prefix contains chars in three lower bytes and the size in the fourth byte.
+template <typename Char, typename OutputIt, typename W>
+FMT_CONSTEXPR FMT_INLINE auto write_int(OutputIt out, int num_digits,
+                                        unsigned prefix,
+                                        const format_specs& specs,
+                                        W write_digits) -> OutputIt {
+  // Slightly faster check for specs.width == 0 && specs.precision == -1.
+  if ((specs.width | (specs.precision + 1)) == 0) {
+    auto it = reserve(out, to_unsigned(num_digits) + (prefix >> 24));
+    if (prefix != 0) {
+      for (unsigned p = prefix & 0xffffff; p != 0; p >>= 8)
+        *it++ = static_cast<Char>(p & 0xff);
+    }
+    return base_iterator(out, write_digits(it));
+  }
+  auto data = write_int_data<Char>(num_digits, prefix, specs);
+  return write_padded<Char, align::right>(
+      out, specs, data.size, [=](reserve_iterator<OutputIt> it) {
+        for (unsigned p = prefix & 0xffffff; p != 0; p >>= 8)
+          *it++ = static_cast<Char>(p & 0xff);
+        it = detail::fill_n(it, data.padding, static_cast<Char>('0'));
+        return write_digits(it);
+      });
+}
 
-// A format specifier handler that checks if specifiers are consistent with the
-// argument type.
-template <typename Handler>
-class specs_checker : public Handler {
-public:
-	FMT_CONSTEXPR specs_checker(const Handler& handler, internal::type arg_type)
-	    : Handler(handler), checker_(*this, arg_type) {
-	}
-
-	FMT_CONSTEXPR specs_checker(const specs_checker& other) : Handler(other), checker_(*this, other.arg_type_) {
-	}
-
-	FMT_CONSTEXPR void on_align(align_t align) {
-		if (align == align::numeric)
-			checker_.require_numeric_argument();
-		Handler::on_align(align);
-	}
-
-	FMT_CONSTEXPR void on_plus() {
-		checker_.check_sign();
-		Handler::on_plus();
-	}
-
-	FMT_CONSTEXPR void on_minus() {
-		checker_.check_sign();
-		Handler::on_minus();
-	}
-
-	FMT_CONSTEXPR void on_space() {
-		checker_.check_sign();
-		Handler::on_space();
-	}
-
-	FMT_CONSTEXPR void on_hash() {
-		checker_.require_numeric_argument();
-		Handler::on_hash();
-	}
-
-	FMT_CONSTEXPR void on_zero() {
-		checker_.require_numeric_argument();
-		Handler::on_zero();
-	}
-
-	FMT_CONSTEXPR void end_precision() {
-		checker_.check_precision();
-	}
-
-private:
-	numeric_specs_checker<Handler> checker_;
+template <typename Char> class digit_grouping {
+ private:
+  std::string grouping_;
+  std::basic_string<Char> thousands_sep_;
+
+  struct next_state {
+    std::string::const_iterator group;
+    int pos;
+  };
+  auto initial_state() const -> next_state { return {grouping_.begin(), 0}; }
+
+  // Returns the next digit group separator position.
+  auto next(next_state& state) const -> int {
+    if (thousands_sep_.empty()) return max_value<int>();
+    if (state.group == grouping_.end()) return state.pos += grouping_.back();
+    if (*state.group <= 0 || *state.group == max_value<char>())
+      return max_value<int>();
+    state.pos += *state.group++;
+    return state.pos;
+  }
+
+ public:
+  explicit digit_grouping(locale_ref loc, bool localized = true) {
+    if (!localized) return;
+    auto sep = thousands_sep<Char>(loc);
+    grouping_ = sep.grouping;
+    if (sep.thousands_sep) thousands_sep_.assign(1, sep.thousands_sep);
+  }
+  digit_grouping(std::string grouping, std::basic_string<Char> sep)
+      : grouping_(std::move(grouping)), thousands_sep_(std::move(sep)) {}
+
+  auto has_separator() const -> bool { return !thousands_sep_.empty(); }
+
+  auto count_separators(int num_digits) const -> int {
+    int count = 0;
+    auto state = initial_state();
+    while (num_digits > next(state)) ++count;
+    return count;
+  }
+
+  // Applies grouping to digits and write the output to out.
+  template <typename Out, typename C>
+  auto apply(Out out, basic_string_view<C> digits) const -> Out {
+    auto num_digits = static_cast<int>(digits.size());
+    auto separators = basic_memory_buffer<int>();
+    separators.push_back(0);
+    auto state = initial_state();
+    while (int i = next(state)) {
+      if (i >= num_digits) break;
+      separators.push_back(i);
+    }
+    for (int i = 0, sep_index = static_cast<int>(separators.size() - 1);
+         i < num_digits; ++i) {
+      if (num_digits - i == separators[sep_index]) {
+        out = copy<Char>(thousands_sep_.data(),
+                         thousands_sep_.data() + thousands_sep_.size(), out);
+        --sep_index;
+      }
+      *out++ = static_cast<Char>(digits[to_unsigned(i)]);
+    }
+    return out;
+  }
 };
 
-template <template <typename> class Handler, typename FormatArg, typename ErrorHandler>
-FMT_CONSTEXPR int get_dynamic_spec(FormatArg arg, ErrorHandler eh) {
-	unsigned long long value = visit_format_arg(Handler<ErrorHandler>(eh), arg);
-	if (value > to_unsigned(max_value<int>()))
-		eh.on_error("number is too big");
-	return static_cast<int>(value);
+FMT_CONSTEXPR inline void prefix_append(unsigned& prefix, unsigned value) {
+  prefix |= prefix != 0 ? value << 8 : value;
+  prefix += (1u + (value > 0xff ? 1 : 0)) << 24;
 }
 
-struct auto_id {};
+// Writes a decimal integer with digit grouping.
+template <typename OutputIt, typename UInt, typename Char>
+auto write_int(OutputIt out, UInt value, unsigned prefix,
+               const format_specs& specs, const digit_grouping<Char>& grouping)
+    -> OutputIt {
+  static_assert(std::is_same<uint64_or_128_t<UInt>, UInt>::value, "");
+  int num_digits = 0;
+  auto buffer = memory_buffer();
+  switch (specs.type) {
+  default:
+    FMT_ASSERT(false, "");
+    FMT_FALLTHROUGH;
+  case presentation_type::none:
+  case presentation_type::dec:
+    num_digits = count_digits(value);
+    format_decimal<char>(appender(buffer), value, num_digits);
+    break;
+  case presentation_type::hex:
+    if (specs.alt)
+      prefix_append(prefix, unsigned(specs.upper ? 'X' : 'x') << 8 | '0');
+    num_digits = count_digits<4>(value);
+    format_uint<4, char>(appender(buffer), value, num_digits, specs.upper);
+    break;
+  case presentation_type::oct:
+    num_digits = count_digits<3>(value);
+    // Octal prefix '0' is counted as a digit, so only add it if precision
+    // is not greater than the number of digits.
+    if (specs.alt && specs.precision <= num_digits && value != 0)
+      prefix_append(prefix, '0');
+    format_uint<3, char>(appender(buffer), value, num_digits);
+    break;
+  case presentation_type::bin:
+    if (specs.alt)
+      prefix_append(prefix, unsigned(specs.upper ? 'B' : 'b') << 8 | '0');
+    num_digits = count_digits<1>(value);
+    format_uint<1, char>(appender(buffer), value, num_digits);
+    break;
+  case presentation_type::chr:
+    return write_char<Char>(out, static_cast<Char>(value), specs);
+  }
+
+  unsigned size = (prefix != 0 ? prefix >> 24 : 0) + to_unsigned(num_digits) +
+                  to_unsigned(grouping.count_separators(num_digits));
+  return write_padded<Char, align::right>(
+      out, specs, size, size, [&](reserve_iterator<OutputIt> it) {
+        for (unsigned p = prefix & 0xffffff; p != 0; p >>= 8)
+          *it++ = static_cast<Char>(p & 0xff);
+        return grouping.apply(it, string_view(buffer.data(), buffer.size()));
+      });
+}
 
-template <typename Context>
-FMT_CONSTEXPR typename Context::format_arg get_arg(Context& ctx, int id) {
-	auto arg = ctx.arg(id);
-	if (!arg)
-		ctx.on_error("Argument index \"" + std::to_string(id) + "\" out of range");
-	return arg;
+// Writes a localized value.
+FMT_API auto write_loc(appender out, loc_value value, const format_specs& specs,
+                       locale_ref loc) -> bool;
+template <typename OutputIt>
+inline auto write_loc(OutputIt, loc_value, const format_specs&, locale_ref)
+    -> bool {
+  return false;
 }
 
-// The standard format specifier handler with checking.
-template <typename ParseContext, typename Context>
-class specs_handler : public specs_setter<typename Context::char_type> {
-public:
-	using char_type = typename Context::char_type;
+template <typename UInt> struct write_int_arg {
+  UInt abs_value;
+  unsigned prefix;
+};
 
-	FMT_CONSTEXPR specs_handler(basic_format_specs<char_type>& specs, ParseContext& parse_ctx, Context& ctx)
-	    : specs_setter<char_type>(specs), parse_context_(parse_ctx), context_(ctx) {
-	}
+template <typename T>
+FMT_CONSTEXPR auto make_write_int_arg(T value, sign_t sign)
+    -> write_int_arg<uint32_or_64_or_128_t<T>> {
+  auto prefix = 0u;
+  auto abs_value = static_cast<uint32_or_64_or_128_t<T>>(value);
+  if (is_negative(value)) {
+    prefix = 0x01000000 | '-';
+    abs_value = 0 - abs_value;
+  } else {
+    constexpr const unsigned prefixes[4] = {0, 0, 0x1000000u | '+',
+                                            0x1000000u | ' '};
+    prefix = prefixes[sign];
+  }
+  return {abs_value, prefix};
+}
 
-	template <typename Id>
-	FMT_CONSTEXPR void on_dynamic_width(Id arg_id) {
-		this->specs_.width = get_dynamic_spec<width_checker>(get_arg(arg_id), context_.error_handler());
-	}
+template <typename Char = char> struct loc_writer {
+  basic_appender<Char> out;
+  const format_specs& specs;
+  std::basic_string<Char> sep;
+  std::string grouping;
+  std::basic_string<Char> decimal_point;
+
+  template <typename T, FMT_ENABLE_IF(is_integer<T>::value)>
+  auto operator()(T value) -> bool {
+    auto arg = make_write_int_arg(value, specs.sign);
+    write_int(out, static_cast<uint64_or_128_t<T>>(arg.abs_value), arg.prefix,
+              specs, digit_grouping<Char>(grouping, sep));
+    return true;
+  }
+
+  template <typename T, FMT_ENABLE_IF(!is_integer<T>::value)>
+  auto operator()(T) -> bool {
+    return false;
+  }
+};
 
-	template <typename Id>
-	FMT_CONSTEXPR void on_dynamic_precision(Id arg_id) {
-		this->specs_.precision = get_dynamic_spec<precision_checker>(get_arg(arg_id), context_.error_handler());
-	}
+template <typename Char, typename OutputIt, typename T>
+FMT_CONSTEXPR FMT_INLINE auto write_int(OutputIt out, write_int_arg<T> arg,
+                                        const format_specs& specs, locale_ref)
+    -> OutputIt {
+  static_assert(std::is_same<T, uint32_or_64_or_128_t<T>>::value, "");
+  auto abs_value = arg.abs_value;
+  auto prefix = arg.prefix;
+  switch (specs.type) {
+  default:
+    FMT_ASSERT(false, "");
+    FMT_FALLTHROUGH;
+  case presentation_type::none:
+  case presentation_type::dec: {
+    int num_digits = count_digits(abs_value);
+    return write_int<Char>(
+        out, num_digits, prefix, specs, [=](reserve_iterator<OutputIt> it) {
+          return format_decimal<Char>(it, abs_value, num_digits).end;
+        });
+  }
+  case presentation_type::hex: {
+    if (specs.alt)
+      prefix_append(prefix, unsigned(specs.upper ? 'X' : 'x') << 8 | '0');
+    int num_digits = count_digits<4>(abs_value);
+    return write_int<Char>(
+        out, num_digits, prefix, specs, [=](reserve_iterator<OutputIt> it) {
+          return format_uint<4, Char>(it, abs_value, num_digits, specs.upper);
+        });
+  }
+  case presentation_type::oct: {
+    int num_digits = count_digits<3>(abs_value);
+    // Octal prefix '0' is counted as a digit, so only add it if precision
+    // is not greater than the number of digits.
+    if (specs.alt && specs.precision <= num_digits && abs_value != 0)
+      prefix_append(prefix, '0');
+    return write_int<Char>(
+        out, num_digits, prefix, specs, [=](reserve_iterator<OutputIt> it) {
+          return format_uint<3, Char>(it, abs_value, num_digits);
+        });
+  }
+  case presentation_type::bin: {
+    if (specs.alt)
+      prefix_append(prefix, unsigned(specs.upper ? 'B' : 'b') << 8 | '0');
+    int num_digits = count_digits<1>(abs_value);
+    return write_int<Char>(
+        out, num_digits, prefix, specs, [=](reserve_iterator<OutputIt> it) {
+          return format_uint<1, Char>(it, abs_value, num_digits);
+        });
+  }
+  case presentation_type::chr:
+    return write_char<Char>(out, static_cast<Char>(abs_value), specs);
+  }
+}
+template <typename Char, typename OutputIt, typename T>
+FMT_CONSTEXPR FMT_NOINLINE auto write_int_noinline(OutputIt out,
+                                                   write_int_arg<T> arg,
+                                                   const format_specs& specs,
+                                                   locale_ref loc) -> OutputIt {
+  return write_int<Char>(out, arg, specs, loc);
+}
+template <typename Char, typename T,
+          FMT_ENABLE_IF(is_integral<T>::value &&
+                        !std::is_same<T, bool>::value &&
+                        !std::is_same<T, Char>::value)>
+FMT_CONSTEXPR FMT_INLINE auto write(basic_appender<Char> out, T value,
+                                    const format_specs& specs, locale_ref loc)
+    -> basic_appender<Char> {
+  if (specs.localized && write_loc(out, value, specs, loc)) return out;
+  return write_int_noinline<Char>(out, make_write_int_arg(value, specs.sign),
+                                  specs, loc);
+}
+// An inlined version of write used in format string compilation.
+template <typename Char, typename OutputIt, typename T,
+          FMT_ENABLE_IF(is_integral<T>::value &&
+                        !std::is_same<T, bool>::value &&
+                        !std::is_same<T, Char>::value &&
+                        !std::is_same<OutputIt, basic_appender<Char>>::value)>
+FMT_CONSTEXPR FMT_INLINE auto write(OutputIt out, T value,
+                                    const format_specs& specs, locale_ref loc)
+    -> OutputIt {
+  if (specs.localized && write_loc(out, value, specs, loc)) return out;
+  return write_int<Char>(out, make_write_int_arg(value, specs.sign), specs,
+                         loc);
+}
 
-	void on_error(std::string message) {
-		context_.on_error(message);
-	}
+// An output iterator that counts the number of objects written to it and
+// discards them.
+class counting_iterator {
+ private:
+  size_t count_;
+
+ public:
+  using iterator_category = std::output_iterator_tag;
+  using difference_type = std::ptrdiff_t;
+  using pointer = void;
+  using reference = void;
+  FMT_UNCHECKED_ITERATOR(counting_iterator);
+
+  struct value_type {
+    template <typename T> FMT_CONSTEXPR void operator=(const T&) {}
+  };
+
+  FMT_CONSTEXPR counting_iterator() : count_(0) {}
+
+  FMT_CONSTEXPR auto count() const -> size_t { return count_; }
+
+  FMT_CONSTEXPR auto operator++() -> counting_iterator& {
+    ++count_;
+    return *this;
+  }
+  FMT_CONSTEXPR auto operator++(int) -> counting_iterator {
+    auto it = *this;
+    ++*this;
+    return it;
+  }
+
+  FMT_CONSTEXPR friend auto operator+(counting_iterator it, difference_type n)
+      -> counting_iterator {
+    it.count_ += static_cast<size_t>(n);
+    return it;
+  }
+
+  FMT_CONSTEXPR auto operator*() const -> value_type { return {}; }
+};
 
-private:
-	// This is only needed for compatibility with gcc 4.4.
-	using format_arg = typename Context::format_arg;
+template <typename Char, typename OutputIt>
+FMT_CONSTEXPR auto write(OutputIt out, basic_string_view<Char> s,
+                         const format_specs& specs) -> OutputIt {
+  auto data = s.data();
+  auto size = s.size();
+  if (specs.precision >= 0 && to_unsigned(specs.precision) < size)
+    size = code_point_index(s, to_unsigned(specs.precision));
+  bool is_debug = specs.type == presentation_type::debug;
+  size_t width = 0;
+
+  if (is_debug) size = write_escaped_string(counting_iterator{}, s).count();
+
+  if (specs.width != 0) {
+    if (is_debug)
+      width = size;
+    else
+      width = compute_width(basic_string_view<Char>(data, size));
+  }
+  return write_padded<Char>(out, specs, size, width,
+                            [=](reserve_iterator<OutputIt> it) {
+                              if (is_debug) return write_escaped_string(it, s);
+                              return copy<Char>(data, data + size, it);
+                            });
+}
+template <typename Char, typename OutputIt>
+FMT_CONSTEXPR auto write(OutputIt out,
+                         basic_string_view<type_identity_t<Char>> s,
+                         const format_specs& specs, locale_ref) -> OutputIt {
+  return write<Char>(out, s, specs);
+}
+template <typename Char, typename OutputIt>
+FMT_CONSTEXPR auto write(OutputIt out, const Char* s, const format_specs& specs,
+                         locale_ref) -> OutputIt {
+  if (specs.type == presentation_type::pointer)
+    return write_ptr<Char>(out, bit_cast<uintptr_t>(s), &specs);
+  if (!s) report_error("string pointer is null");
+  return write<Char>(out, basic_string_view<Char>(s), specs, {});
+}
 
-	FMT_CONSTEXPR format_arg get_arg(auto_id) {
-		return internal::get_arg(context_, parse_context_.next_arg_id());
-	}
+template <typename Char, typename OutputIt, typename T,
+          FMT_ENABLE_IF(is_integral<T>::value &&
+                        !std::is_same<T, bool>::value &&
+                        !std::is_same<T, Char>::value)>
+FMT_CONSTEXPR auto write(OutputIt out, T value) -> OutputIt {
+  auto abs_value = static_cast<uint32_or_64_or_128_t<T>>(value);
+  bool negative = is_negative(value);
+  // Don't do -abs_value since it trips unsigned-integer-overflow sanitizer.
+  if (negative) abs_value = ~abs_value + 1;
+  int num_digits = count_digits(abs_value);
+  auto size = (negative ? 1 : 0) + static_cast<size_t>(num_digits);
+  if (auto ptr = to_pointer<Char>(out, size)) {
+    if (negative) *ptr++ = static_cast<Char>('-');
+    format_decimal<Char>(ptr, abs_value, num_digits);
+    return out;
+  }
+  if (negative) *out++ = static_cast<Char>('-');
+  return format_decimal<Char>(out, abs_value, num_digits).end;
+}
 
-	FMT_CONSTEXPR format_arg get_arg(int arg_id) {
-		parse_context_.check_arg_id(arg_id);
-		return internal::get_arg(context_, arg_id);
-	}
+// DEPRECATED!
+template <typename Char>
+FMT_CONSTEXPR auto parse_align(const Char* begin, const Char* end,
+                               format_specs& specs) -> const Char* {
+  FMT_ASSERT(begin != end, "");
+  auto align = align::none;
+  auto p = begin + code_point_length(begin);
+  if (end - p <= 0) p = begin;
+  for (;;) {
+    switch (to_ascii(*p)) {
+    case '<':
+      align = align::left;
+      break;
+    case '>':
+      align = align::right;
+      break;
+    case '^':
+      align = align::center;
+      break;
+    }
+    if (align != align::none) {
+      if (p != begin) {
+        auto c = *begin;
+        if (c == '}') return begin;
+        if (c == '{') {
+          report_error("invalid fill character '{'");
+          return begin;
+        }
+        specs.fill = basic_string_view<Char>(begin, to_unsigned(p - begin));
+        begin = p + 1;
+      } else {
+        ++begin;
+      }
+      break;
+    } else if (p == begin) {
+      break;
+    }
+    p = begin;
+  }
+  specs.align = align;
+  return begin;
+}
 
-	FMT_CONSTEXPR format_arg get_arg(basic_string_view<char_type> arg_id) {
-		parse_context_.check_arg_id(arg_id);
-		return context_.arg(arg_id);
-	}
+// A floating-point presentation format.
+enum class float_format : unsigned char {
+  general,  // General: exponent notation or fixed point based on magnitude.
+  exp,      // Exponent notation with the default precision of 6, e.g. 1.2e-3.
+  fixed     // Fixed point with the default precision of 6, e.g. 0.0012.
+};
 
-	ParseContext& parse_context_;
-	Context& context_;
+struct float_specs {
+  int precision;
+  float_format format : 8;
+  sign_t sign : 8;
+  bool locale : 1;
+  bool binary32 : 1;
+  bool showpoint : 1;
 };
 
-enum class arg_id_kind { none, index, name };
+// DEPRECATED!
+FMT_CONSTEXPR inline auto parse_float_type_spec(const format_specs& specs)
+    -> float_specs {
+  auto result = float_specs();
+  result.showpoint = specs.alt;
+  result.locale = specs.localized;
+  switch (specs.type) {
+  default:
+    FMT_FALLTHROUGH;
+  case presentation_type::none:
+    result.format = float_format::general;
+    break;
+  case presentation_type::exp:
+    result.format = float_format::exp;
+    result.showpoint |= specs.precision != 0;
+    break;
+  case presentation_type::fixed:
+    result.format = float_format::fixed;
+    result.showpoint |= specs.precision != 0;
+    break;
+  case presentation_type::general:
+    result.format = float_format::general;
+    break;
+  }
+  return result;
+}
 
-// An argument reference.
-template <typename Char>
-struct arg_ref {
-	FMT_CONSTEXPR arg_ref() : kind(arg_id_kind::none), val() {
-	}
+template <typename Char, typename OutputIt>
+FMT_CONSTEXPR20 auto write_nonfinite(OutputIt out, bool isnan,
+                                     format_specs specs, sign_t sign)
+    -> OutputIt {
+  auto str =
+      isnan ? (specs.upper ? "NAN" : "nan") : (specs.upper ? "INF" : "inf");
+  constexpr size_t str_size = 3;
+  auto size = str_size + (sign ? 1 : 0);
+  // Replace '0'-padding with space for non-finite values.
+  const bool is_zero_fill =
+      specs.fill.size() == 1 && specs.fill.template get<Char>() == '0';
+  if (is_zero_fill) specs.fill = ' ';
+  return write_padded<Char>(out, specs, size,
+                            [=](reserve_iterator<OutputIt> it) {
+                              if (sign) *it++ = detail::sign<Char>(sign);
+                              return copy<Char>(str, str + str_size, it);
+                            });
+}
 
-	FMT_CONSTEXPR explicit arg_ref(int index) : kind(arg_id_kind::index), val(index) {
-	}
+// A decimal floating-point number significand * pow(10, exp).
+struct big_decimal_fp {
+  const char* significand;
+  int significand_size;
+  int exponent;
+};
 
-	FMT_CONSTEXPR explicit arg_ref(basic_string_view<Char> name) : kind(arg_id_kind::name), val(name) {
-	}
+constexpr auto get_significand_size(const big_decimal_fp& f) -> int {
+  return f.significand_size;
+}
+template <typename T>
+inline auto get_significand_size(const dragonbox::decimal_fp<T>& f) -> int {
+  return count_digits(f.significand);
+}
 
-	FMT_CONSTEXPR arg_ref& operator=(int idx) {
-		kind = arg_id_kind::index;
-		val.index = idx;
-		return *this;
-	}
+template <typename Char, typename OutputIt>
+constexpr auto write_significand(OutputIt out, const char* significand,
+                                 int significand_size) -> OutputIt {
+  return copy<Char>(significand, significand + significand_size, out);
+}
+template <typename Char, typename OutputIt, typename UInt>
+inline auto write_significand(OutputIt out, UInt significand,
+                              int significand_size) -> OutputIt {
+  return format_decimal<Char>(out, significand, significand_size).end;
+}
+template <typename Char, typename OutputIt, typename T, typename Grouping>
+FMT_CONSTEXPR20 auto write_significand(OutputIt out, T significand,
+                                       int significand_size, int exponent,
+                                       const Grouping& grouping) -> OutputIt {
+  if (!grouping.has_separator()) {
+    out = write_significand<Char>(out, significand, significand_size);
+    return detail::fill_n(out, exponent, static_cast<Char>('0'));
+  }
+  auto buffer = memory_buffer();
+  write_significand<char>(appender(buffer), significand, significand_size);
+  detail::fill_n(appender(buffer), exponent, '0');
+  return grouping.apply(out, string_view(buffer.data(), buffer.size()));
+}
 
-	arg_id_kind kind;
+template <typename Char, typename UInt,
+          FMT_ENABLE_IF(std::is_integral<UInt>::value)>
+inline auto write_significand(Char* out, UInt significand, int significand_size,
+                              int integral_size, Char decimal_point) -> Char* {
+  if (!decimal_point)
+    return format_decimal(out, significand, significand_size).end;
+  out += significand_size + 1;
+  Char* end = out;
+  int floating_size = significand_size - integral_size;
+  for (int i = floating_size / 2; i > 0; --i) {
+    out -= 2;
+    copy2(out, digits2(static_cast<std::size_t>(significand % 100)));
+    significand /= 100;
+  }
+  if (floating_size % 2 != 0) {
+    *--out = static_cast<Char>('0' + significand % 10);
+    significand /= 10;
+  }
+  *--out = decimal_point;
+  format_decimal(out - integral_size, significand, integral_size);
+  return end;
+}
 
-	union value {
-		FMT_CONSTEXPR value(int id = 0) : index {id} {
-		}
+template <typename OutputIt, typename UInt, typename Char,
+          FMT_ENABLE_IF(!std::is_pointer<remove_cvref_t<OutputIt>>::value)>
+inline auto write_significand(OutputIt out, UInt significand,
+                              int significand_size, int integral_size,
+                              Char decimal_point) -> OutputIt {
+  // Buffer is large enough to hold digits (digits10 + 1) and a decimal point.
+  Char buffer[digits10<UInt>() + 2];
+  auto end = write_significand(buffer, significand, significand_size,
+                               integral_size, decimal_point);
+  return detail::copy_noinline<Char>(buffer, end, out);
+}
 
-		FMT_CONSTEXPR value(basic_string_view<Char> n) : name(n) {
-		}
+template <typename OutputIt, typename Char>
+FMT_CONSTEXPR auto write_significand(OutputIt out, const char* significand,
+                                     int significand_size, int integral_size,
+                                     Char decimal_point) -> OutputIt {
+  out = detail::copy_noinline<Char>(significand, significand + integral_size,
+                                    out);
+  if (!decimal_point) return out;
+  *out++ = decimal_point;
+  return detail::copy_noinline<Char>(significand + integral_size,
+                                     significand + significand_size, out);
+}
 
-		int index;
-		basic_string_view<Char> name;
-	} val;
-};
+template <typename OutputIt, typename Char, typename T, typename Grouping>
+FMT_CONSTEXPR20 auto write_significand(OutputIt out, T significand,
+                                       int significand_size, int integral_size,
+                                       Char decimal_point,
+                                       const Grouping& grouping) -> OutputIt {
+  if (!grouping.has_separator()) {
+    return write_significand(out, significand, significand_size, integral_size,
+                             decimal_point);
+  }
+  auto buffer = basic_memory_buffer<Char>();
+  write_significand(basic_appender<Char>(buffer), significand, significand_size,
+                    integral_size, decimal_point);
+  grouping.apply(
+      out, basic_string_view<Char>(buffer.data(), to_unsigned(integral_size)));
+  return detail::copy_noinline<Char>(buffer.data() + integral_size,
+                                     buffer.end(), out);
+}
 
-// Format specifiers with width and precision resolved at formatting rather
-// than parsing time to allow re-using the same parsed specifiers with
-// different sets of arguments (precompilation of format strings).
-template <typename Char>
-struct dynamic_format_specs : basic_format_specs<Char> {
-	arg_ref<Char> width_ref;
-	arg_ref<Char> precision_ref;
-};
+template <typename Char, typename OutputIt, typename DecimalFP,
+          typename Grouping = digit_grouping<Char>>
+FMT_CONSTEXPR20 auto do_write_float(OutputIt out, const DecimalFP& f,
+                                    const format_specs& specs,
+                                    float_specs fspecs, locale_ref loc)
+    -> OutputIt {
+  auto significand = f.significand;
+  int significand_size = get_significand_size(f);
+  const Char zero = static_cast<Char>('0');
+  auto sign = fspecs.sign;
+  size_t size = to_unsigned(significand_size) + (sign ? 1 : 0);
+  using iterator = reserve_iterator<OutputIt>;
+
+  Char decimal_point =
+      fspecs.locale ? detail::decimal_point<Char>(loc) : static_cast<Char>('.');
+
+  int output_exp = f.exponent + significand_size - 1;
+  auto use_exp_format = [=]() {
+    if (fspecs.format == float_format::exp) return true;
+    if (fspecs.format != float_format::general) return false;
+    // Use the fixed notation if the exponent is in [exp_lower, exp_upper),
+    // e.g. 0.0001 instead of 1e-04. Otherwise use the exponent notation.
+    const int exp_lower = -4, exp_upper = 16;
+    return output_exp < exp_lower ||
+           output_exp >= (fspecs.precision > 0 ? fspecs.precision : exp_upper);
+  };
+  if (use_exp_format()) {
+    int num_zeros = 0;
+    if (fspecs.showpoint) {
+      num_zeros = fspecs.precision - significand_size;
+      if (num_zeros < 0) num_zeros = 0;
+      size += to_unsigned(num_zeros);
+    } else if (significand_size == 1) {
+      decimal_point = Char();
+    }
+    auto abs_output_exp = output_exp >= 0 ? output_exp : -output_exp;
+    int exp_digits = 2;
+    if (abs_output_exp >= 100) exp_digits = abs_output_exp >= 1000 ? 4 : 3;
+
+    size += to_unsigned((decimal_point ? 1 : 0) + 2 + exp_digits);
+    char exp_char = specs.upper ? 'E' : 'e';
+    auto write = [=](iterator it) {
+      if (sign) *it++ = detail::sign<Char>(sign);
+      // Insert a decimal point after the first digit and add an exponent.
+      it = write_significand(it, significand, significand_size, 1,
+                             decimal_point);
+      if (num_zeros > 0) it = detail::fill_n(it, num_zeros, zero);
+      *it++ = static_cast<Char>(exp_char);
+      return write_exponent<Char>(output_exp, it);
+    };
+    return specs.width > 0
+               ? write_padded<Char, align::right>(out, specs, size, write)
+               : base_iterator(out, write(reserve(out, size)));
+  }
+
+  int exp = f.exponent + significand_size;
+  if (f.exponent >= 0) {
+    // 1234e5 -> 123400000[.0+]
+    size += to_unsigned(f.exponent);
+    int num_zeros = fspecs.precision - exp;
+    abort_fuzzing_if(num_zeros > 5000);
+    if (fspecs.showpoint) {
+      ++size;
+      if (num_zeros <= 0 && fspecs.format != float_format::fixed) num_zeros = 0;
+      if (num_zeros > 0) size += to_unsigned(num_zeros);
+    }
+    auto grouping = Grouping(loc, fspecs.locale);
+    size += to_unsigned(grouping.count_separators(exp));
+    return write_padded<Char, align::right>(out, specs, size, [&](iterator it) {
+      if (sign) *it++ = detail::sign<Char>(sign);
+      it = write_significand<Char>(it, significand, significand_size,
+                                   f.exponent, grouping);
+      if (!fspecs.showpoint) return it;
+      *it++ = decimal_point;
+      return num_zeros > 0 ? detail::fill_n(it, num_zeros, zero) : it;
+    });
+  } else if (exp > 0) {
+    // 1234e-2 -> 12.34[0+]
+    int num_zeros = fspecs.showpoint ? fspecs.precision - significand_size : 0;
+    size += 1 + to_unsigned(num_zeros > 0 ? num_zeros : 0);
+    auto grouping = Grouping(loc, fspecs.locale);
+    size += to_unsigned(grouping.count_separators(exp));
+    return write_padded<Char, align::right>(out, specs, size, [&](iterator it) {
+      if (sign) *it++ = detail::sign<Char>(sign);
+      it = write_significand(it, significand, significand_size, exp,
+                             decimal_point, grouping);
+      return num_zeros > 0 ? detail::fill_n(it, num_zeros, zero) : it;
+    });
+  }
+  // 1234e-6 -> 0.001234
+  int num_zeros = -exp;
+  if (significand_size == 0 && fspecs.precision >= 0 &&
+      fspecs.precision < num_zeros) {
+    num_zeros = fspecs.precision;
+  }
+  bool pointy = num_zeros != 0 || significand_size != 0 || fspecs.showpoint;
+  size += 1 + (pointy ? 1 : 0) + to_unsigned(num_zeros);
+  return write_padded<Char, align::right>(out, specs, size, [&](iterator it) {
+    if (sign) *it++ = detail::sign<Char>(sign);
+    *it++ = zero;
+    if (!pointy) return it;
+    *it++ = decimal_point;
+    it = detail::fill_n(it, num_zeros, zero);
+    return write_significand<Char>(it, significand, significand_size);
+  });
+}
 
-// Format spec handler that saves references to arguments representing dynamic
-// width and precision to be resolved at formatting time.
-template <typename ParseContext>
-class dynamic_specs_handler : public specs_setter<typename ParseContext::char_type> {
-public:
-	using char_type = typename ParseContext::char_type;
-
-	FMT_CONSTEXPR dynamic_specs_handler(dynamic_format_specs<char_type>& specs, ParseContext& ctx)
-	    : specs_setter<char_type>(specs), specs_(specs), context_(ctx) {
-	}
-
-	FMT_CONSTEXPR dynamic_specs_handler(const dynamic_specs_handler& other)
-	    : specs_setter<char_type>(other), specs_(other.specs_), context_(other.context_) {
-	}
-
-	template <typename Id>
-	FMT_CONSTEXPR void on_dynamic_width(Id arg_id) {
-		specs_.width_ref = make_arg_ref(arg_id);
-	}
-
-	template <typename Id>
-	FMT_CONSTEXPR void on_dynamic_precision(Id arg_id) {
-		specs_.precision_ref = make_arg_ref(arg_id);
-	}
-
-	FMT_CONSTEXPR void on_error(std::string message) {
-		context_.on_error(message);
-	}
-
-private:
-	using arg_ref_type = arg_ref<char_type>;
-
-	FMT_CONSTEXPR arg_ref_type make_arg_ref(int arg_id) {
-		context_.check_arg_id(arg_id);
-		return arg_ref_type(arg_id);
-	}
-
-	FMT_CONSTEXPR arg_ref_type make_arg_ref(auto_id) {
-		return arg_ref_type(context_.next_arg_id());
-	}
-
-	FMT_CONSTEXPR arg_ref_type make_arg_ref(basic_string_view<char_type> arg_id) {
-		context_.check_arg_id(arg_id);
-		basic_string_view<char_type> format_str(context_.begin(), to_unsigned(context_.end() - context_.begin()));
-		return arg_ref_type(arg_id);
-	}
-
-	dynamic_format_specs<char_type>& specs_;
-	ParseContext& context_;
-};
+template <typename Char> class fallback_digit_grouping {
+ public:
+  constexpr fallback_digit_grouping(locale_ref, bool) {}
 
-template <typename Char, typename IDHandler>
-FMT_CONSTEXPR const Char* parse_arg_id(const Char* begin, const Char* end, IDHandler&& handler) {
-	FMT_ASSERT(begin != end, "");
-	Char c = *begin;
-	if (c == '}' || c == ':') {
-		handler();
-		return begin;
-	}
-	if (c >= '0' && c <= '9') {
-		int index = parse_nonnegative_int(begin, end, handler);
-		if (begin == end || (*begin != '}' && *begin != ':'))
-			handler.on_error("invalid format string");
-		else
-			handler(index);
-		return begin;
-	}
-	if (!is_name_start(c)) {
-		handler.on_error("invalid format string");
-		return begin;
-	}
-	auto it = begin;
-	do {
-		++it;
-	} while (it != end && (is_name_start(c = *it) || ('0' <= c && c <= '9')));
-	handler(basic_string_view<Char>(begin, to_unsigned(it - begin)));
-	return it;
-}
-
-// Adapts SpecHandler to IDHandler API for dynamic width.
-template <typename SpecHandler, typename Char>
-struct width_adapter {
-	explicit FMT_CONSTEXPR width_adapter(SpecHandler& h) : handler(h) {
-	}
-
-	FMT_CONSTEXPR void operator()() {
-		handler.on_dynamic_width(auto_id());
-	}
-
-	FMT_CONSTEXPR void operator()(int id) {
-		handler.on_dynamic_width(id);
-	}
-
-	FMT_CONSTEXPR void operator()(basic_string_view<Char> id) {
-		handler.on_dynamic_width(id);
-	}
-
-	FMT_CONSTEXPR void on_error(std::string message) {
-		handler.on_error(message);
-	}
-
-	SpecHandler& handler;
-};
+  constexpr auto has_separator() const -> bool { return false; }
 
-// Adapts SpecHandler to IDHandler API for dynamic precision.
-template <typename SpecHandler, typename Char>
-struct precision_adapter {
-	explicit FMT_CONSTEXPR precision_adapter(SpecHandler& h) : handler(h) {
-	}
+  constexpr auto count_separators(int) const -> int { return 0; }
 
-	FMT_CONSTEXPR void operator()() {
-		handler.on_dynamic_precision(auto_id());
-	}
+  template <typename Out, typename C>
+  constexpr auto apply(Out out, basic_string_view<C>) const -> Out {
+    return out;
+  }
+};
 
-	FMT_CONSTEXPR void operator()(int id) {
-		handler.on_dynamic_precision(id);
-	}
+template <typename Char, typename OutputIt, typename DecimalFP>
+FMT_CONSTEXPR20 auto write_float(OutputIt out, const DecimalFP& f,
+                                 const format_specs& specs, float_specs fspecs,
+                                 locale_ref loc) -> OutputIt {
+  if (is_constant_evaluated()) {
+    return do_write_float<Char, OutputIt, DecimalFP,
+                          fallback_digit_grouping<Char>>(out, f, specs, fspecs,
+                                                         loc);
+  } else {
+    return do_write_float<Char>(out, f, specs, fspecs, loc);
+  }
+}
 
-	FMT_CONSTEXPR void operator()(basic_string_view<Char> id) {
-		handler.on_dynamic_precision(id);
-	}
+template <typename T> constexpr auto isnan(T value) -> bool {
+  return value != value;  // std::isnan doesn't support __float128.
+}
 
-	FMT_CONSTEXPR void on_error(std::string message) {
-		handler.on_error(message);
-	}
+template <typename T, typename Enable = void>
+struct has_isfinite : std::false_type {};
 
-	SpecHandler& handler;
-};
+template <typename T>
+struct has_isfinite<T, enable_if_t<sizeof(std::isfinite(T())) != 0>>
+    : std::true_type {};
+
+template <typename T, FMT_ENABLE_IF(std::is_floating_point<T>::value&&
+                                        has_isfinite<T>::value)>
+FMT_CONSTEXPR20 auto isfinite(T value) -> bool {
+  constexpr T inf = T(std::numeric_limits<double>::infinity());
+  if (is_constant_evaluated())
+    return !detail::isnan(value) && value < inf && value > -inf;
+  return std::isfinite(value);
+}
+template <typename T, FMT_ENABLE_IF(!has_isfinite<T>::value)>
+FMT_CONSTEXPR auto isfinite(T value) -> bool {
+  T inf = T(std::numeric_limits<double>::infinity());
+  // std::isfinite doesn't support __float128.
+  return !detail::isnan(value) && value < inf && value > -inf;
+}
 
-// Parses fill and alignment.
-template <typename Char, typename Handler>
-FMT_CONSTEXPR const Char* parse_align(const Char* begin, const Char* end, Handler&& handler) {
-	FMT_ASSERT(begin != end, "");
-	auto align = align::none;
-	int i = 0;
-	if (begin + 1 != end)
-		++i;
-	do {
-		switch (static_cast<char>(begin[i])) {
-		case '<':
-			align = align::left;
-			break;
-		case '>':
-			align = align::right;
-			break;
-#if FMT_NUMERIC_ALIGN
-		case '=':
-			align = align::numeric;
-			break;
+template <typename T, FMT_ENABLE_IF(is_floating_point<T>::value)>
+FMT_INLINE FMT_CONSTEXPR bool signbit(T value) {
+  if (is_constant_evaluated()) {
+#ifdef __cpp_if_constexpr
+    if constexpr (std::numeric_limits<double>::is_iec559) {
+      auto bits = detail::bit_cast<uint64_t>(static_cast<double>(value));
+      return (bits >> (num_bits<uint64_t>() - 1)) != 0;
+    }
 #endif
-		case '^':
-			align = align::center;
-			break;
-		}
-		if (align != align::none) {
-			if (i > 0) {
-				auto c = *begin;
-				if (c == '{')
-					return handler.on_error("invalid fill character '{'"), begin;
-				begin += 2;
-				handler.on_fill(c);
-			} else
-				++begin;
-			handler.on_align(align);
-			break;
-		}
-	} while (i-- > 0);
-	return begin;
-}
-
-template <typename Char, typename Handler>
-FMT_CONSTEXPR const Char* parse_width(const Char* begin, const Char* end, Handler&& handler) {
-	FMT_ASSERT(begin != end, "");
-	if ('0' <= *begin && *begin <= '9') {
-		handler.on_width(parse_nonnegative_int(begin, end, handler));
-	} else if (*begin == '{') {
-		++begin;
-		if (begin != end)
-			begin = parse_arg_id(begin, end, width_adapter<Handler, Char>(handler));
-		if (begin == end || *begin != '}')
-			return handler.on_error("invalid format string"), begin;
-		++begin;
-	}
-	return begin;
-}
-
-template <typename Char, typename Handler>
-FMT_CONSTEXPR const Char* parse_precision(const Char* begin, const Char* end, Handler&& handler) {
-	++begin;
-	auto c = begin != end ? *begin : Char();
-	if ('0' <= c && c <= '9') {
-		handler.on_precision(parse_nonnegative_int(begin, end, handler));
-	} else if (c == '{') {
-		++begin;
-		if (begin != end) {
-			begin = parse_arg_id(begin, end, precision_adapter<Handler, Char>(handler));
-		}
-		if (begin == end || *begin++ != '}')
-			return handler.on_error("invalid format string"), begin;
-	} else {
-		return handler.on_error("missing precision specifier"), begin;
-	}
-	handler.end_precision();
-	return begin;
-}
-
-// Parses standard format specifiers and sends notifications about parsed
-// components to handler.
-template <typename Char, typename SpecHandler>
-FMT_CONSTEXPR const Char* parse_format_specs(const Char* begin, const Char* end, SpecHandler&& handler) {
-	if (begin == end || *begin == '}')
-		return begin;
-
-	begin = parse_align(begin, end, handler);
-	if (begin == end)
-		return begin;
-
-	// Parse sign.
-	switch (static_cast<char>(*begin)) {
-	case '+':
-		handler.on_plus();
-		++begin;
-		break;
-	case '-':
-		handler.on_minus();
-		++begin;
-		break;
-	case ' ':
-		handler.on_space();
-		++begin;
-		break;
-	case ',':
-		handler.on_comma();
-		++begin;
-		break;
-	case '_':
-		handler.on_underscore();
-		++begin;
-		break;
-	case '\'':
-		handler.on_single_quote();
-		++begin;
-		break;
-	case 't':
-		++begin;
-		if (begin == end)
-			return begin;
-		handler.on_thousands(*begin);
-		++begin;
-		break;
-	}
-	if (begin == end)
-		return begin;
-
-	if (*begin == '#') {
-		handler.on_hash();
-		if (++begin == end)
-			return begin;
-	}
-
-	// Parse zero flag.
-	if (*begin == '0') {
-		handler.on_zero();
-		if (++begin == end)
-			return begin;
-	}
-
-	begin = parse_width(begin, end, handler);
-	if (begin == end)
-		return begin;
-
-	// Parse precision.
-	if (*begin == '.') {
-		begin = parse_precision(begin, end, handler);
-	}
-
-	// Parse type.
-	if (begin != end && *begin != '}')
-		handler.on_type(*begin++);
-	return begin;
-}
-
-// Return the result via the out param to workaround gcc bug 77539.
-template <bool IS_CONSTEXPR, typename T, typename Ptr = const T*>
-FMT_CONSTEXPR bool find(Ptr first, Ptr last, T value, Ptr& out) {
-	for (out = first; out != last; ++out) {
-		if (*out == value)
-			return true;
-	}
-	return false;
+  }
+  return std::signbit(static_cast<double>(value));
 }
 
-template <>
-inline bool find<false, char>(const char* first, const char* last, char value, const char*& out) {
-	out = static_cast<const char*>(std::memchr(first, value, internal::to_unsigned(last - first)));
-	return out != nullptr;
+inline FMT_CONSTEXPR20 void adjust_precision(int& precision, int exp10) {
+  // Adjust fixed precision by exponent because it is relative to decimal
+  // point.
+  if (exp10 > 0 && precision > max_value<int>() - exp10)
+    FMT_THROW(format_error("number is too big"));
+  precision += exp10;
 }
 
-template <typename Handler, typename Char>
-struct id_adapter {
-	FMT_CONSTEXPR void operator()() {
-		handler.on_arg_id();
-	}
+class bigint {
+ private:
+  // A bigint is stored as an array of bigits (big digits), with bigit at index
+  // 0 being the least significant one.
+  using bigit = uint32_t;
+  using double_bigit = uint64_t;
+  enum { bigits_capacity = 32 };
+  basic_memory_buffer<bigit, bigits_capacity> bigits_;
+  int exp_;
+
+  FMT_CONSTEXPR20 auto operator[](int index) const -> bigit {
+    return bigits_[to_unsigned(index)];
+  }
+  FMT_CONSTEXPR20 auto operator[](int index) -> bigit& {
+    return bigits_[to_unsigned(index)];
+  }
+
+  static constexpr const int bigit_bits = num_bits<bigit>();
+
+  friend struct formatter<bigint>;
+
+  FMT_CONSTEXPR20 void subtract_bigits(int index, bigit other, bigit& borrow) {
+    auto result = static_cast<double_bigit>((*this)[index]) - other - borrow;
+    (*this)[index] = static_cast<bigit>(result);
+    borrow = static_cast<bigit>(result >> (bigit_bits * 2 - 1));
+  }
+
+  FMT_CONSTEXPR20 void remove_leading_zeros() {
+    int num_bigits = static_cast<int>(bigits_.size()) - 1;
+    while (num_bigits > 0 && (*this)[num_bigits] == 0) --num_bigits;
+    bigits_.resize(to_unsigned(num_bigits + 1));
+  }
+
+  // Computes *this -= other assuming aligned bigints and *this >= other.
+  FMT_CONSTEXPR20 void subtract_aligned(const bigint& other) {
+    FMT_ASSERT(other.exp_ >= exp_, "unaligned bigints");
+    FMT_ASSERT(compare(*this, other) >= 0, "");
+    bigit borrow = 0;
+    int i = other.exp_ - exp_;
+    for (size_t j = 0, n = other.bigits_.size(); j != n; ++i, ++j)
+      subtract_bigits(i, other.bigits_[j], borrow);
+    while (borrow > 0) subtract_bigits(i, 0, borrow);
+    remove_leading_zeros();
+  }
+
+  FMT_CONSTEXPR20 void multiply(uint32_t value) {
+    const double_bigit wide_value = value;
+    bigit carry = 0;
+    for (size_t i = 0, n = bigits_.size(); i < n; ++i) {
+      double_bigit result = bigits_[i] * wide_value + carry;
+      bigits_[i] = static_cast<bigit>(result);
+      carry = static_cast<bigit>(result >> bigit_bits);
+    }
+    if (carry != 0) bigits_.push_back(carry);
+  }
+
+  template <typename UInt, FMT_ENABLE_IF(std::is_same<UInt, uint64_t>::value ||
+                                         std::is_same<UInt, uint128_t>::value)>
+  FMT_CONSTEXPR20 void multiply(UInt value) {
+    using half_uint =
+        conditional_t<std::is_same<UInt, uint128_t>::value, uint64_t, uint32_t>;
+    const int shift = num_bits<half_uint>() - bigit_bits;
+    const UInt lower = static_cast<half_uint>(value);
+    const UInt upper = value >> num_bits<half_uint>();
+    UInt carry = 0;
+    for (size_t i = 0, n = bigits_.size(); i < n; ++i) {
+      UInt result = lower * bigits_[i] + static_cast<bigit>(carry);
+      carry = (upper * bigits_[i] << shift) + (result >> bigit_bits) +
+              (carry >> bigit_bits);
+      bigits_[i] = static_cast<bigit>(result);
+    }
+    while (carry != 0) {
+      bigits_.push_back(static_cast<bigit>(carry));
+      carry >>= bigit_bits;
+    }
+  }
+
+  template <typename UInt, FMT_ENABLE_IF(std::is_same<UInt, uint64_t>::value ||
+                                         std::is_same<UInt, uint128_t>::value)>
+  FMT_CONSTEXPR20 void assign(UInt n) {
+    size_t num_bigits = 0;
+    do {
+      bigits_[num_bigits++] = static_cast<bigit>(n);
+      n >>= bigit_bits;
+    } while (n != 0);
+    bigits_.resize(num_bigits);
+    exp_ = 0;
+  }
+
+ public:
+  FMT_CONSTEXPR20 bigint() : exp_(0) {}
+  explicit bigint(uint64_t n) { assign(n); }
+
+  bigint(const bigint&) = delete;
+  void operator=(const bigint&) = delete;
+
+  FMT_CONSTEXPR20 void assign(const bigint& other) {
+    auto size = other.bigits_.size();
+    bigits_.resize(size);
+    auto data = other.bigits_.data();
+    copy<bigit>(data, data + size, bigits_.data());
+    exp_ = other.exp_;
+  }
+
+  template <typename Int> FMT_CONSTEXPR20 void operator=(Int n) {
+    FMT_ASSERT(n > 0, "");
+    assign(uint64_or_128_t<Int>(n));
+  }
+
+  FMT_CONSTEXPR20 auto num_bigits() const -> int {
+    return static_cast<int>(bigits_.size()) + exp_;
+  }
+
+  FMT_NOINLINE FMT_CONSTEXPR20 auto operator<<=(int shift) -> bigint& {
+    FMT_ASSERT(shift >= 0, "");
+    exp_ += shift / bigit_bits;
+    shift %= bigit_bits;
+    if (shift == 0) return *this;
+    bigit carry = 0;
+    for (size_t i = 0, n = bigits_.size(); i < n; ++i) {
+      bigit c = bigits_[i] >> (bigit_bits - shift);
+      bigits_[i] = (bigits_[i] << shift) + carry;
+      carry = c;
+    }
+    if (carry != 0) bigits_.push_back(carry);
+    return *this;
+  }
+
+  template <typename Int>
+  FMT_CONSTEXPR20 auto operator*=(Int value) -> bigint& {
+    FMT_ASSERT(value > 0, "");
+    multiply(uint32_or_64_or_128_t<Int>(value));
+    return *this;
+  }
+
+  friend FMT_CONSTEXPR20 auto compare(const bigint& lhs, const bigint& rhs)
+      -> int {
+    int num_lhs_bigits = lhs.num_bigits(), num_rhs_bigits = rhs.num_bigits();
+    if (num_lhs_bigits != num_rhs_bigits)
+      return num_lhs_bigits > num_rhs_bigits ? 1 : -1;
+    int i = static_cast<int>(lhs.bigits_.size()) - 1;
+    int j = static_cast<int>(rhs.bigits_.size()) - 1;
+    int end = i - j;
+    if (end < 0) end = 0;
+    for (; i >= end; --i, --j) {
+      bigit lhs_bigit = lhs[i], rhs_bigit = rhs[j];
+      if (lhs_bigit != rhs_bigit) return lhs_bigit > rhs_bigit ? 1 : -1;
+    }
+    if (i != j) return i > j ? 1 : -1;
+    return 0;
+  }
+
+  // Returns compare(lhs1 + lhs2, rhs).
+  friend FMT_CONSTEXPR20 auto add_compare(const bigint& lhs1,
+                                          const bigint& lhs2, const bigint& rhs)
+      -> int {
+    auto minimum = [](int a, int b) { return a < b ? a : b; };
+    auto maximum = [](int a, int b) { return a > b ? a : b; };
+    int max_lhs_bigits = maximum(lhs1.num_bigits(), lhs2.num_bigits());
+    int num_rhs_bigits = rhs.num_bigits();
+    if (max_lhs_bigits + 1 < num_rhs_bigits) return -1;
+    if (max_lhs_bigits > num_rhs_bigits) return 1;
+    auto get_bigit = [](const bigint& n, int i) -> bigit {
+      return i >= n.exp_ && i < n.num_bigits() ? n[i - n.exp_] : 0;
+    };
+    double_bigit borrow = 0;
+    int min_exp = minimum(minimum(lhs1.exp_, lhs2.exp_), rhs.exp_);
+    for (int i = num_rhs_bigits - 1; i >= min_exp; --i) {
+      double_bigit sum =
+          static_cast<double_bigit>(get_bigit(lhs1, i)) + get_bigit(lhs2, i);
+      bigit rhs_bigit = get_bigit(rhs, i);
+      if (sum > rhs_bigit + borrow) return 1;
+      borrow = rhs_bigit + borrow - sum;
+      if (borrow > 1) return -1;
+      borrow <<= bigit_bits;
+    }
+    return borrow != 0 ? -1 : 0;
+  }
+
+  // Assigns pow(10, exp) to this bigint.
+  FMT_CONSTEXPR20 void assign_pow10(int exp) {
+    FMT_ASSERT(exp >= 0, "");
+    if (exp == 0) return *this = 1;
+    // Find the top bit.
+    int bitmask = 1;
+    while (exp >= bitmask) bitmask <<= 1;
+    bitmask >>= 1;
+    // pow(10, exp) = pow(5, exp) * pow(2, exp). First compute pow(5, exp) by
+    // repeated squaring and multiplication.
+    *this = 5;
+    bitmask >>= 1;
+    while (bitmask != 0) {
+      square();
+      if ((exp & bitmask) != 0) *this *= 5;
+      bitmask >>= 1;
+    }
+    *this <<= exp;  // Multiply by pow(2, exp) by shifting.
+  }
+
+  FMT_CONSTEXPR20 void square() {
+    int num_bigits = static_cast<int>(bigits_.size());
+    int num_result_bigits = 2 * num_bigits;
+    basic_memory_buffer<bigit, bigits_capacity> n(std::move(bigits_));
+    bigits_.resize(to_unsigned(num_result_bigits));
+    auto sum = uint128_t();
+    for (int bigit_index = 0; bigit_index < num_bigits; ++bigit_index) {
+      // Compute bigit at position bigit_index of the result by adding
+      // cross-product terms n[i] * n[j] such that i + j == bigit_index.
+      for (int i = 0, j = bigit_index; j >= 0; ++i, --j) {
+        // Most terms are multiplied twice which can be optimized in the future.
+        sum += static_cast<double_bigit>(n[i]) * n[j];
+      }
+      (*this)[bigit_index] = static_cast<bigit>(sum);
+      sum >>= num_bits<bigit>();  // Compute the carry.
+    }
+    // Do the same for the top half.
+    for (int bigit_index = num_bigits; bigit_index < num_result_bigits;
+         ++bigit_index) {
+      for (int j = num_bigits - 1, i = bigit_index - j; i < num_bigits;)
+        sum += static_cast<double_bigit>(n[i++]) * n[j--];
+      (*this)[bigit_index] = static_cast<bigit>(sum);
+      sum >>= num_bits<bigit>();
+    }
+    remove_leading_zeros();
+    exp_ *= 2;
+  }
+
+  // If this bigint has a bigger exponent than other, adds trailing zero to make
+  // exponents equal. This simplifies some operations such as subtraction.
+  FMT_CONSTEXPR20 void align(const bigint& other) {
+    int exp_difference = exp_ - other.exp_;
+    if (exp_difference <= 0) return;
+    int num_bigits = static_cast<int>(bigits_.size());
+    bigits_.resize(to_unsigned(num_bigits + exp_difference));
+    for (int i = num_bigits - 1, j = i + exp_difference; i >= 0; --i, --j)
+      bigits_[j] = bigits_[i];
+    memset(bigits_.data(), 0, to_unsigned(exp_difference) * sizeof(bigit));
+    exp_ -= exp_difference;
+  }
+
+  // Divides this bignum by divisor, assigning the remainder to this and
+  // returning the quotient.
+  FMT_CONSTEXPR20 auto divmod_assign(const bigint& divisor) -> int {
+    FMT_ASSERT(this != &divisor, "");
+    if (compare(*this, divisor) < 0) return 0;
+    FMT_ASSERT(divisor.bigits_[divisor.bigits_.size() - 1u] != 0, "");
+    align(divisor);
+    int quotient = 0;
+    do {
+      subtract_aligned(divisor);
+      ++quotient;
+    } while (compare(*this, divisor) >= 0);
+    return quotient;
+  }
+};
 
-	FMT_CONSTEXPR void operator()(int id) {
-		handler.on_arg_id(id);
-	}
+// format_dragon flags.
+enum dragon {
+  predecessor_closer = 1,
+  fixup = 2,  // Run fixup to correct exp10 which can be off by one.
+  fixed = 4,
+};
 
-	FMT_CONSTEXPR void operator()(basic_string_view<Char> id) {
-		handler.on_arg_id(id);
-	}
+// Formats a floating-point number using a variation of the Fixed-Precision
+// Positive Floating-Point Printout ((FPP)^2) algorithm by Steele & White:
+// https://fmt.dev/papers/p372-steele.pdf.
+FMT_CONSTEXPR20 inline void format_dragon(basic_fp<uint128_t> value,
+                                          unsigned flags, int num_digits,
+                                          buffer<char>& buf, int& exp10) {
+  bigint numerator;    // 2 * R in (FPP)^2.
+  bigint denominator;  // 2 * S in (FPP)^2.
+  // lower and upper are differences between value and corresponding boundaries.
+  bigint lower;             // (M^- in (FPP)^2).
+  bigint upper_store;       // upper's value if different from lower.
+  bigint* upper = nullptr;  // (M^+ in (FPP)^2).
+  // Shift numerator and denominator by an extra bit or two (if lower boundary
+  // is closer) to make lower and upper integers. This eliminates multiplication
+  // by 2 during later computations.
+  bool is_predecessor_closer = (flags & dragon::predecessor_closer) != 0;
+  int shift = is_predecessor_closer ? 2 : 1;
+  if (value.e >= 0) {
+    numerator = value.f;
+    numerator <<= value.e + shift;
+    lower = 1;
+    lower <<= value.e;
+    if (is_predecessor_closer) {
+      upper_store = 1;
+      upper_store <<= value.e + 1;
+      upper = &upper_store;
+    }
+    denominator.assign_pow10(exp10);
+    denominator <<= shift;
+  } else if (exp10 < 0) {
+    numerator.assign_pow10(-exp10);
+    lower.assign(numerator);
+    if (is_predecessor_closer) {
+      upper_store.assign(numerator);
+      upper_store <<= 1;
+      upper = &upper_store;
+    }
+    numerator *= value.f;
+    numerator <<= shift;
+    denominator = 1;
+    denominator <<= shift - value.e;
+  } else {
+    numerator = value.f;
+    numerator <<= shift;
+    denominator.assign_pow10(exp10);
+    denominator <<= shift - value.e;
+    lower = 1;
+    if (is_predecessor_closer) {
+      upper_store = 1ULL << 1;
+      upper = &upper_store;
+    }
+  }
+  int even = static_cast<int>((value.f & 1) == 0);
+  if (!upper) upper = &lower;
+  bool shortest = num_digits < 0;
+  if ((flags & dragon::fixup) != 0) {
+    if (add_compare(numerator, *upper, denominator) + even <= 0) {
+      --exp10;
+      numerator *= 10;
+      if (num_digits < 0) {
+        lower *= 10;
+        if (upper != &lower) *upper *= 10;
+      }
+    }
+    if ((flags & dragon::fixed) != 0) adjust_precision(num_digits, exp10 + 1);
+  }
+  // Invariant: value == (numerator / denominator) * pow(10, exp10).
+  if (shortest) {
+    // Generate the shortest representation.
+    num_digits = 0;
+    char* data = buf.data();
+    for (;;) {
+      int digit = numerator.divmod_assign(denominator);
+      bool low = compare(numerator, lower) - even < 0;  // numerator <[=] lower.
+      // numerator + upper >[=] pow10:
+      bool high = add_compare(numerator, *upper, denominator) + even > 0;
+      data[num_digits++] = static_cast<char>('0' + digit);
+      if (low || high) {
+        if (!low) {
+          ++data[num_digits - 1];
+        } else if (high) {
+          int result = add_compare(numerator, numerator, denominator);
+          // Round half to even.
+          if (result > 0 || (result == 0 && (digit % 2) != 0))
+            ++data[num_digits - 1];
+        }
+        buf.try_resize(to_unsigned(num_digits));
+        exp10 -= num_digits - 1;
+        return;
+      }
+      numerator *= 10;
+      lower *= 10;
+      if (upper != &lower) *upper *= 10;
+    }
+  }
+  // Generate the given number of digits.
+  exp10 -= num_digits - 1;
+  if (num_digits <= 0) {
+    auto digit = '0';
+    if (num_digits == 0) {
+      denominator *= 10;
+      digit = add_compare(numerator, numerator, denominator) > 0 ? '1' : '0';
+    }
+    buf.push_back(digit);
+    return;
+  }
+  buf.try_resize(to_unsigned(num_digits));
+  for (int i = 0; i < num_digits - 1; ++i) {
+    int digit = numerator.divmod_assign(denominator);
+    buf[i] = static_cast<char>('0' + digit);
+    numerator *= 10;
+  }
+  int digit = numerator.divmod_assign(denominator);
+  auto result = add_compare(numerator, numerator, denominator);
+  if (result > 0 || (result == 0 && (digit % 2) != 0)) {
+    if (digit == 9) {
+      const auto overflow = '0' + 10;
+      buf[num_digits - 1] = overflow;
+      // Propagate the carry.
+      for (int i = num_digits - 1; i > 0 && buf[i] == overflow; --i) {
+        buf[i] = '0';
+        ++buf[i - 1];
+      }
+      if (buf[0] == overflow) {
+        buf[0] = '1';
+        if ((flags & dragon::fixed) != 0)
+          buf.push_back('0');
+        else
+          ++exp10;
+      }
+      return;
+    }
+    ++digit;
+  }
+  buf[num_digits - 1] = static_cast<char>('0' + digit);
+}
 
-	FMT_CONSTEXPR void on_error(std::string message) {
-		handler.on_error(message);
-	}
+// Formats a floating-point number using the hexfloat format.
+template <typename Float, FMT_ENABLE_IF(!is_double_double<Float>::value)>
+FMT_CONSTEXPR20 void format_hexfloat(Float value, format_specs specs,
+                                     buffer<char>& buf) {
+  // float is passed as double to reduce the number of instantiations and to
+  // simplify implementation.
+  static_assert(!std::is_same<Float, float>::value, "");
+
+  using info = dragonbox::float_info<Float>;
+
+  // Assume Float is in the format [sign][exponent][significand].
+  using carrier_uint = typename info::carrier_uint;
+
+  constexpr auto num_float_significand_bits =
+      detail::num_significand_bits<Float>();
+
+  basic_fp<carrier_uint> f(value);
+  f.e += num_float_significand_bits;
+  if (!has_implicit_bit<Float>()) --f.e;
+
+  constexpr auto num_fraction_bits =
+      num_float_significand_bits + (has_implicit_bit<Float>() ? 1 : 0);
+  constexpr auto num_xdigits = (num_fraction_bits + 3) / 4;
+
+  constexpr auto leading_shift = ((num_xdigits - 1) * 4);
+  const auto leading_mask = carrier_uint(0xF) << leading_shift;
+  const auto leading_xdigit =
+      static_cast<uint32_t>((f.f & leading_mask) >> leading_shift);
+  if (leading_xdigit > 1) f.e -= (32 - countl_zero(leading_xdigit) - 1);
+
+  int print_xdigits = num_xdigits - 1;
+  if (specs.precision >= 0 && print_xdigits > specs.precision) {
+    const int shift = ((print_xdigits - specs.precision - 1) * 4);
+    const auto mask = carrier_uint(0xF) << shift;
+    const auto v = static_cast<uint32_t>((f.f & mask) >> shift);
+
+    if (v >= 8) {
+      const auto inc = carrier_uint(1) << (shift + 4);
+      f.f += inc;
+      f.f &= ~(inc - 1);
+    }
+
+    // Check long double overflow
+    if (!has_implicit_bit<Float>()) {
+      const auto implicit_bit = carrier_uint(1) << num_float_significand_bits;
+      if ((f.f & implicit_bit) == implicit_bit) {
+        f.f >>= 4;
+        f.e += 4;
+      }
+    }
+
+    print_xdigits = specs.precision;
+  }
+
+  char xdigits[num_bits<carrier_uint>() / 4];
+  detail::fill_n(xdigits, sizeof(xdigits), '0');
+  format_uint<4>(xdigits, f.f, num_xdigits, specs.upper);
+
+  // Remove zero tail
+  while (print_xdigits > 0 && xdigits[print_xdigits] == '0') --print_xdigits;
+
+  buf.push_back('0');
+  buf.push_back(specs.upper ? 'X' : 'x');
+  buf.push_back(xdigits[0]);
+  if (specs.alt || print_xdigits > 0 || print_xdigits < specs.precision)
+    buf.push_back('.');
+  buf.append(xdigits + 1, xdigits + 1 + print_xdigits);
+  for (; print_xdigits < specs.precision; ++print_xdigits) buf.push_back('0');
+
+  buf.push_back(specs.upper ? 'P' : 'p');
+
+  uint32_t abs_e;
+  if (f.e < 0) {
+    buf.push_back('-');
+    abs_e = static_cast<uint32_t>(-f.e);
+  } else {
+    buf.push_back('+');
+    abs_e = static_cast<uint32_t>(f.e);
+  }
+  format_decimal<char>(appender(buf), abs_e, detail::count_digits(abs_e));
+}
 
-	Handler& handler;
-};
+template <typename Float, FMT_ENABLE_IF(is_double_double<Float>::value)>
+FMT_CONSTEXPR20 void format_hexfloat(Float value, format_specs specs,
+                                     buffer<char>& buf) {
+  format_hexfloat(static_cast<double>(value), specs, buf);
+}
 
-template <bool IS_CONSTEXPR, typename Char, typename Handler>
-FMT_CONSTEXPR void parse_format_string(basic_string_view<Char> format_str, Handler&& handler) {
-	struct pfs_writer {
-		FMT_CONSTEXPR void operator()(const Char* begin, const Char* end) {
-			if (begin == end)
-				return;
-			for (;;) {
-				const Char* p = nullptr;
-				if (!find<IS_CONSTEXPR>(begin, end, '}', p))
-					return handler_.on_text(begin, end);
-				++p;
-				if (p == end || *p != '}')
-					return handler_.on_error("unmatched '}' in format string");
-				handler_.on_text(begin, p);
-				begin = p + 1;
-			}
-		}
-
-		Handler& handler_;
-	} write {handler};
-	auto begin = format_str.data();
-	auto end = begin + format_str.size();
-	while (begin != end) {
-		// Doing two passes with memchr (one for '{' and another for '}') is up to
-		// 2.5x faster than the naive one-pass implementation on big format strings.
-		const Char* p = begin;
-		if (*begin != '{' && !find<IS_CONSTEXPR>(begin, end, '{', p))
-			return write(begin, end);
-		write(begin, p);
-		++p;
-		if (p == end)
-			return handler.on_error("invalid format string");
-		if (static_cast<char>(*p) == '}') {
-			handler.on_arg_id();
-			handler.on_replacement_field(p);
-		} else if (*p == '{') {
-			handler.on_text(p, p + 1);
-		} else {
-			p = parse_arg_id(p, end, id_adapter<Handler, Char> {handler});
-			Char c = p != end ? *p : Char();
-			if (c == '}') {
-				handler.on_replacement_field(p);
-			} else if (c == ':') {
-				p = handler.on_format_specs(p + 1, end);
-				if (p == end || *p != '}')
-					return handler.on_error("unknown format specifier");
-			} else {
-				return handler.on_error("missing '}' in format string");
-			}
-		}
-		begin = p + 1;
-	}
-}
-
-template <typename T, typename ParseContext>
-FMT_CONSTEXPR const typename ParseContext::char_type* parse_format_specs(ParseContext& ctx) {
-	using char_type = typename ParseContext::char_type;
-	using context = buffer_context<char_type>;
-	using mapped_type = conditional_t<internal::mapped_type_constant<T, context>::value != internal::custom_type,
-	                                  decltype(arg_mapper<context>().map(std::declval<T>())), T>;
-	auto f = conditional_t<has_formatter<mapped_type, context>::value, formatter<mapped_type, char_type>,
-	                       internal::fallback_formatter<T, char_type>>();
-	return f.parse(ctx);
-}
-
-template <typename Char, typename ErrorHandler, typename... Args>
-class format_string_checker {
-public:
-	explicit FMT_CONSTEXPR format_string_checker(basic_string_view<Char> format_str, ErrorHandler eh)
-	    : arg_id_(-1), context_(format_str, eh), parse_funcs_ {&parse_format_specs<Args, parse_context_type>...} {
-	}
-
-	FMT_CONSTEXPR void on_text(const Char*, const Char*) {
-	}
-
-	FMT_CONSTEXPR void on_arg_id() {
-		arg_id_ = context_.next_arg_id();
-		check_arg_id();
-	}
-
-	FMT_CONSTEXPR void on_arg_id(int id) {
-		arg_id_ = id;
-		context_.check_arg_id(id);
-		check_arg_id();
-	}
-
-	FMT_CONSTEXPR void on_arg_id(basic_string_view<Char>) {
-		on_error("compile-time checks don't support named arguments");
-	}
-
-	FMT_CONSTEXPR void on_replacement_field(const Char*) {
-	}
-
-	FMT_CONSTEXPR const Char* on_format_specs(const Char* begin, const Char*) {
-		advance_to(context_, begin);
-		return arg_id_ < num_args ? parse_funcs_[arg_id_](context_) : begin;
-	}
-
-	FMT_CONSTEXPR void on_error(std::string message) {
-		context_.on_error(message);
-	}
-
-private:
-	using parse_context_type = basic_format_parse_context<Char, ErrorHandler>;
-	enum { num_args = sizeof...(Args) };
-
-	FMT_CONSTEXPR void check_arg_id() {
-		if (arg_id_ >= num_args)
-			context_.on_error("argument index out of range");
-	}
-
-	// Format specifier parsing function.
-	using parse_func = const Char* (*) (parse_context_type&);
-
-	int arg_id_;
-	parse_context_type context_;
-	parse_func parse_funcs_[num_args > 0 ? num_args : 1];
-};
+constexpr auto fractional_part_rounding_thresholds(int index) -> uint32_t {
+  // For checking rounding thresholds.
+  // The kth entry is chosen to be the smallest integer such that the
+  // upper 32-bits of 10^(k+1) times it is strictly bigger than 5 * 10^k.
+  // It is equal to ceil(2^31 + 2^32/10^(k + 1)).
+  // These are stored in a string literal because we cannot have static arrays
+  // in constexpr functions and non-static ones are poorly optimized.
+  return U"\x9999999a\x828f5c29\x80418938\x80068db9\x8000a7c6\x800010c7"
+         U"\x800001ae\x8000002b"[index];
+}
 
-template <typename Char, typename ErrorHandler, typename... Args>
-FMT_CONSTEXPR bool do_check_format_string(basic_string_view<Char> s, ErrorHandler eh = ErrorHandler()) {
-	format_string_checker<Char, ErrorHandler, Args...> checker(s, eh);
-	parse_format_string<true>(s, checker);
-	return true;
-}
-
-template <typename... Args, typename S, enable_if_t<(is_compile_string<S>::value), int>>
-void check_format_string(S format_str) {
-	FMT_CONSTEXPR_DECL bool invalid_format =
-	    internal::do_check_format_string<typename S::char_type, internal::error_handler, Args...>(
-	        to_string_view(format_str));
-	(void) invalid_format;
-}
-
-template <template <typename> class Handler, typename Context>
-void handle_dynamic_spec(int& value, arg_ref<typename Context::char_type> ref, Context& ctx) {
-	switch (ref.kind) {
-	case arg_id_kind::none:
-		break;
-	case arg_id_kind::index:
-		value = internal::get_dynamic_spec<Handler>(ctx.arg(ref.val.index), ctx.error_handler());
-		break;
-	case arg_id_kind::name:
-		value = internal::get_dynamic_spec<Handler>(ctx.arg(ref.val.name), ctx.error_handler());
-		break;
-	}
-}
-} // namespace internal
-
-template <typename Range>
-using basic_writer FMT_DEPRECATED_ALIAS = internal::basic_writer<Range>;
-using writer FMT_DEPRECATED_ALIAS = internal::writer;
-using wwriter FMT_DEPRECATED_ALIAS = internal::basic_writer<buffer_range<wchar_t>>;
-
-/** The default argument formatter. */
-template <typename Range>
-class arg_formatter : public internal::arg_formatter_base<Range> {
-private:
-	using char_type = typename Range::value_type;
-	using base = internal::arg_formatter_base<Range>;
-	using context_type = basic_format_context<typename base::iterator, char_type>;
-
-	context_type& ctx_;
-	basic_format_parse_context<char_type>* parse_ctx_;
-
-public:
-	using range = Range;
-	using iterator = typename base::iterator;
-	using format_specs = typename base::format_specs;
-
-	/**
-\rst
-Constructs an argument formatter object.
-*ctx* is a reference to the formatting context,
-*specs* contains format specifier information for standard argument types.
-\endrst
-*/
-	explicit arg_formatter(context_type& ctx, basic_format_parse_context<char_type>* parse_ctx = nullptr,
-	                       format_specs* specs = nullptr)
-	    : base(Range(ctx.out()), specs, ctx.locale()), ctx_(ctx), parse_ctx_(parse_ctx) {
-	}
-
-	using base::operator();
-
-	/** Formats an argument of a user-defined type. */
-	iterator operator()(typename basic_format_arg<context_type>::handle handle) {
-		handle.format(*parse_ctx_, ctx_);
-		return ctx_.out();
-	}
-};
+template <typename Float>
+FMT_CONSTEXPR20 auto format_float(Float value, int precision, float_specs specs,
+                                  buffer<char>& buf) -> int {
+  // float is passed as double to reduce the number of instantiations.
+  static_assert(!std::is_same<Float, float>::value, "");
+  FMT_ASSERT(value >= 0, "value is negative");
+  auto converted_value = convert_float(value);
+
+  const bool fixed = specs.format == float_format::fixed;
+  if (value <= 0) {  // <= instead of == to silence a warning.
+    if (precision <= 0 || !fixed) {
+      buf.push_back('0');
+      return 0;
+    }
+    buf.try_resize(to_unsigned(precision));
+    fill_n(buf.data(), precision, '0');
+    return -precision;
+  }
+
+  int exp = 0;
+  bool use_dragon = true;
+  unsigned dragon_flags = 0;
+  if (!is_fast_float<Float>() || is_constant_evaluated()) {
+    const auto inv_log2_10 = 0.3010299956639812;  // 1 / log2(10)
+    using info = dragonbox::float_info<decltype(converted_value)>;
+    const auto f = basic_fp<typename info::carrier_uint>(converted_value);
+    // Compute exp, an approximate power of 10, such that
+    //   10^(exp - 1) <= value < 10^exp or 10^exp <= value < 10^(exp + 1).
+    // This is based on log10(value) == log2(value) / log2(10) and approximation
+    // of log2(value) by e + num_fraction_bits idea from double-conversion.
+    auto e = (f.e + count_digits<1>(f.f) - 1) * inv_log2_10 - 1e-10;
+    exp = static_cast<int>(e);
+    if (e > exp) ++exp;  // Compute ceil.
+    dragon_flags = dragon::fixup;
+  } else if (precision < 0) {
+    // Use Dragonbox for the shortest format.
+    if (specs.binary32) {
+      auto dec = dragonbox::to_decimal(static_cast<float>(value));
+      write<char>(appender(buf), dec.significand);
+      return dec.exponent;
+    }
+    auto dec = dragonbox::to_decimal(static_cast<double>(value));
+    write<char>(appender(buf), dec.significand);
+    return dec.exponent;
+  } else {
+    // Extract significand bits and exponent bits.
+    using info = dragonbox::float_info<double>;
+    auto br = bit_cast<uint64_t>(static_cast<double>(value));
+
+    const uint64_t significand_mask =
+        (static_cast<uint64_t>(1) << num_significand_bits<double>()) - 1;
+    uint64_t significand = (br & significand_mask);
+    int exponent = static_cast<int>((br & exponent_mask<double>()) >>
+                                    num_significand_bits<double>());
+
+    if (exponent != 0) {  // Check if normal.
+      exponent -= exponent_bias<double>() + num_significand_bits<double>();
+      significand |=
+          (static_cast<uint64_t>(1) << num_significand_bits<double>());
+      significand <<= 1;
+    } else {
+      // Normalize subnormal inputs.
+      FMT_ASSERT(significand != 0, "zeros should not appear here");
+      int shift = countl_zero(significand);
+      FMT_ASSERT(shift >= num_bits<uint64_t>() - num_significand_bits<double>(),
+                 "");
+      shift -= (num_bits<uint64_t>() - num_significand_bits<double>() - 2);
+      exponent = (std::numeric_limits<double>::min_exponent -
+                  num_significand_bits<double>()) -
+                 shift;
+      significand <<= shift;
+    }
+
+    // Compute the first several nonzero decimal significand digits.
+    // We call the number we get the first segment.
+    const int k = info::kappa - dragonbox::floor_log10_pow2(exponent);
+    exp = -k;
+    const int beta = exponent + dragonbox::floor_log2_pow10(k);
+    uint64_t first_segment;
+    bool has_more_segments;
+    int digits_in_the_first_segment;
+    {
+      const auto r = dragonbox::umul192_upper128(
+          significand << beta, dragonbox::get_cached_power(k));
+      first_segment = r.high();
+      has_more_segments = r.low() != 0;
+
+      // The first segment can have 18 ~ 19 digits.
+      if (first_segment >= 1000000000000000000ULL) {
+        digits_in_the_first_segment = 19;
+      } else {
+        // When it is of 18-digits, we align it to 19-digits by adding a bogus
+        // zero at the end.
+        digits_in_the_first_segment = 18;
+        first_segment *= 10;
+      }
+    }
+
+    // Compute the actual number of decimal digits to print.
+    if (fixed) adjust_precision(precision, exp + digits_in_the_first_segment);
+
+    // Use Dragon4 only when there might be not enough digits in the first
+    // segment.
+    if (digits_in_the_first_segment > precision) {
+      use_dragon = false;
+
+      if (precision <= 0) {
+        exp += digits_in_the_first_segment;
+
+        if (precision < 0) {
+          // Nothing to do, since all we have are just leading zeros.
+          buf.try_resize(0);
+        } else {
+          // We may need to round-up.
+          buf.try_resize(1);
+          if ((first_segment | static_cast<uint64_t>(has_more_segments)) >
+              5000000000000000000ULL) {
+            buf[0] = '1';
+          } else {
+            buf[0] = '0';
+          }
+        }
+      }  // precision <= 0
+      else {
+        exp += digits_in_the_first_segment - precision;
+
+        // When precision > 0, we divide the first segment into three
+        // subsegments, each with 9, 9, and 0 ~ 1 digits so that each fits
+        // in 32-bits which usually allows faster calculation than in
+        // 64-bits. Since some compiler (e.g. MSVC) doesn't know how to optimize
+        // division-by-constant for large 64-bit divisors, we do it here
+        // manually. The magic number 7922816251426433760 below is equal to
+        // ceil(2^(64+32) / 10^10).
+        const uint32_t first_subsegment = static_cast<uint32_t>(
+            dragonbox::umul128_upper64(first_segment, 7922816251426433760ULL) >>
+            32);
+        const uint64_t second_third_subsegments =
+            first_segment - first_subsegment * 10000000000ULL;
+
+        uint64_t prod;
+        uint32_t digits;
+        bool should_round_up;
+        int number_of_digits_to_print = precision > 9 ? 9 : precision;
+
+        // Print a 9-digits subsegment, either the first or the second.
+        auto print_subsegment = [&](uint32_t subsegment, char* buffer) {
+          int number_of_digits_printed = 0;
+
+          // If we want to print an odd number of digits from the subsegment,
+          if ((number_of_digits_to_print & 1) != 0) {
+            // Convert to 64-bit fixed-point fractional form with 1-digit
+            // integer part. The magic number 720575941 is a good enough
+            // approximation of 2^(32 + 24) / 10^8; see
+            // https://jk-jeon.github.io/posts/2022/12/fixed-precision-formatting/#fixed-length-case
+            // for details.
+            prod = ((subsegment * static_cast<uint64_t>(720575941)) >> 24) + 1;
+            digits = static_cast<uint32_t>(prod >> 32);
+            *buffer = static_cast<char>('0' + digits);
+            number_of_digits_printed++;
+          }
+          // If we want to print an even number of digits from the
+          // first_subsegment,
+          else {
+            // Convert to 64-bit fixed-point fractional form with 2-digits
+            // integer part. The magic number 450359963 is a good enough
+            // approximation of 2^(32 + 20) / 10^7; see
+            // https://jk-jeon.github.io/posts/2022/12/fixed-precision-formatting/#fixed-length-case
+            // for details.
+            prod = ((subsegment * static_cast<uint64_t>(450359963)) >> 20) + 1;
+            digits = static_cast<uint32_t>(prod >> 32);
+            copy2(buffer, digits2(digits));
+            number_of_digits_printed += 2;
+          }
+
+          // Print all digit pairs.
+          while (number_of_digits_printed < number_of_digits_to_print) {
+            prod = static_cast<uint32_t>(prod) * static_cast<uint64_t>(100);
+            digits = static_cast<uint32_t>(prod >> 32);
+            copy2(buffer + number_of_digits_printed, digits2(digits));
+            number_of_digits_printed += 2;
+          }
+        };
+
+        // Print first subsegment.
+        print_subsegment(first_subsegment, buf.data());
+
+        // Perform rounding if the first subsegment is the last subsegment to
+        // print.
+        if (precision <= 9) {
+          // Rounding inside the subsegment.
+          // We round-up if:
+          //  - either the fractional part is strictly larger than 1/2, or
+          //  - the fractional part is exactly 1/2 and the last digit is odd.
+          // We rely on the following observations:
+          //  - If fractional_part >= threshold, then the fractional part is
+          //    strictly larger than 1/2.
+          //  - If the MSB of fractional_part is set, then the fractional part
+          //    must be at least 1/2.
+          //  - When the MSB of fractional_part is set, either
+          //    second_third_subsegments being nonzero or has_more_segments
+          //    being true means there are further digits not printed, so the
+          //    fractional part is strictly larger than 1/2.
+          if (precision < 9) {
+            uint32_t fractional_part = static_cast<uint32_t>(prod);
+            should_round_up =
+                fractional_part >= fractional_part_rounding_thresholds(
+                                       8 - number_of_digits_to_print) ||
+                ((fractional_part >> 31) &
+                 ((digits & 1) | (second_third_subsegments != 0) |
+                  has_more_segments)) != 0;
+          }
+          // Rounding at the subsegment boundary.
+          // In this case, the fractional part is at least 1/2 if and only if
+          // second_third_subsegments >= 5000000000ULL, and is strictly larger
+          // than 1/2 if we further have either second_third_subsegments >
+          // 5000000000ULL or has_more_segments == true.
+          else {
+            should_round_up = second_third_subsegments > 5000000000ULL ||
+                              (second_third_subsegments == 5000000000ULL &&
+                               ((digits & 1) != 0 || has_more_segments));
+          }
+        }
+        // Otherwise, print the second subsegment.
+        else {
+          // Compilers are not aware of how to leverage the maximum value of
+          // second_third_subsegments to find out a better magic number which
+          // allows us to eliminate an additional shift. 1844674407370955162 =
+          // ceil(2^64/10) < ceil(2^64*(10^9/(10^10 - 1))).
+          const uint32_t second_subsegment =
+              static_cast<uint32_t>(dragonbox::umul128_upper64(
+                  second_third_subsegments, 1844674407370955162ULL));
+          const uint32_t third_subsegment =
+              static_cast<uint32_t>(second_third_subsegments) -
+              second_subsegment * 10;
+
+          number_of_digits_to_print = precision - 9;
+          print_subsegment(second_subsegment, buf.data() + 9);
+
+          // Rounding inside the subsegment.
+          if (precision < 18) {
+            // The condition third_subsegment != 0 implies that the segment was
+            // of 19 digits, so in this case the third segment should be
+            // consisting of a genuine digit from the input.
+            uint32_t fractional_part = static_cast<uint32_t>(prod);
+            should_round_up =
+                fractional_part >= fractional_part_rounding_thresholds(
+                                       8 - number_of_digits_to_print) ||
+                ((fractional_part >> 31) &
+                 ((digits & 1) | (third_subsegment != 0) |
+                  has_more_segments)) != 0;
+          }
+          // Rounding at the subsegment boundary.
+          else {
+            // In this case, the segment must be of 19 digits, thus
+            // the third subsegment should be consisting of a genuine digit from
+            // the input.
+            should_round_up = third_subsegment > 5 ||
+                              (third_subsegment == 5 &&
+                               ((digits & 1) != 0 || has_more_segments));
+          }
+        }
+
+        // Round-up if necessary.
+        if (should_round_up) {
+          ++buf[precision - 1];
+          for (int i = precision - 1; i > 0 && buf[i] > '9'; --i) {
+            buf[i] = '0';
+            ++buf[i - 1];
+          }
+          if (buf[0] > '9') {
+            buf[0] = '1';
+            if (fixed)
+              buf[precision++] = '0';
+            else
+              ++exp;
+          }
+        }
+        buf.try_resize(to_unsigned(precision));
+      }
+    }  // if (digits_in_the_first_segment > precision)
+    else {
+      // Adjust the exponent for its use in Dragon4.
+      exp += digits_in_the_first_segment - 1;
+    }
+  }
+  if (use_dragon) {
+    auto f = basic_fp<uint128_t>();
+    bool is_predecessor_closer = specs.binary32
+                                     ? f.assign(static_cast<float>(value))
+                                     : f.assign(converted_value);
+    if (is_predecessor_closer) dragon_flags |= dragon::predecessor_closer;
+    if (fixed) dragon_flags |= dragon::fixed;
+    // Limit precision to the maximum possible number of significant digits in
+    // an IEEE754 double because we don't need to generate zeros.
+    const int max_double_digits = 767;
+    if (precision > max_double_digits) precision = max_double_digits;
+    format_dragon(f, dragon_flags, precision, buf, exp);
+  }
+  if (!fixed && !specs.showpoint) {
+    // Remove trailing zeros.
+    auto num_digits = buf.size();
+    while (num_digits > 0 && buf[num_digits - 1] == '0') {
+      --num_digits;
+      ++exp;
+    }
+    buf.try_resize(num_digits);
+  }
+  return exp;
+}
 
-/** Fast integer formatter. */
-class format_int {
-private:
-	// Buffer should be large enough to hold all digits (digits10 + 1),
-	// a sign and a null character.
-	enum { buffer_size = std::numeric_limits<unsigned long long>::digits10 + 3 };
-	mutable char buffer_[buffer_size];
-	char* str_;
-
-	// Formats value in reverse and returns a pointer to the beginning.
-	char* format_decimal(unsigned long long value) {
-		char* ptr = buffer_ + (buffer_size - 1); // Parens to workaround MSVC bug.
-		while (value >= 100) {
-			// Integer division is slow so do it for a group of two digits instead
-			// of for every digit. The idea comes from the talk by Alexandrescu
-			// "Three Optimization Tips for C++". See speed-test for a comparison.
-			auto index = static_cast<unsigned>((value % 100) * 2);
-			value /= 100;
-			*--ptr = internal::data::digits[index + 1];
-			*--ptr = internal::data::digits[index];
-		}
-		if (value < 10) {
-			*--ptr = static_cast<char>('0' + value);
-			return ptr;
-		}
-		auto index = static_cast<unsigned>(value * 2);
-		*--ptr = internal::data::digits[index + 1];
-		*--ptr = internal::data::digits[index];
-		return ptr;
-	}
-
-	void format_signed(long long value) {
-		auto abs_value = static_cast<unsigned long long>(value);
-		bool negative = value < 0;
-		if (negative)
-			abs_value = 0 - abs_value;
-		str_ = format_decimal(abs_value);
-		if (negative)
-			*--str_ = '-';
-	}
-
-public:
-	explicit format_int(int value) {
-		format_signed(value);
-	}
-
-	explicit format_int(long value) {
-		format_signed(value);
-	}
-
-	explicit format_int(long long value) {
-		format_signed(value);
-	}
-
-	explicit format_int(unsigned value) : str_(format_decimal(value)) {
-	}
-
-	explicit format_int(unsigned long value) : str_(format_decimal(value)) {
-	}
-
-	explicit format_int(unsigned long long value) : str_(format_decimal(value)) {
-	}
-
-	/** Returns the number of characters written to the output buffer. */
-	std::size_t size() const {
-		return internal::to_unsigned(buffer_ - str_ + buffer_size - 1);
-	}
-
-	/**
-Returns a pointer to the output buffer content. No terminating null
-character is appended.
-*/
-	const char* data() const {
-		return str_;
-	}
-
-	/**
-Returns a pointer to the output buffer content with terminating null
-character appended.
-*/
-	const char* c_str() const {
-		buffer_[buffer_size - 1] = '\0';
-		return str_;
-	}
-
-	/**
-\rst
-Returns the content of the output buffer as an ``std::string``.
-\endrst
-*/
-	std::string str() const {
-		return std::string(str_, size());
-	}
-};
+template <typename Char, typename OutputIt, typename T>
+FMT_CONSTEXPR20 auto write_float(OutputIt out, T value, format_specs specs,
+                                 locale_ref loc) -> OutputIt {
+  sign_t sign = specs.sign;
+  if (detail::signbit(value)) {  // value < 0 is false for NaN so use signbit.
+    sign = sign::minus;
+    value = -value;
+  } else if (sign == sign::minus) {
+    sign = sign::none;
+  }
+
+  if (!detail::isfinite(value))
+    return write_nonfinite<Char>(out, detail::isnan(value), specs, sign);
+
+  if (specs.align == align::numeric && sign) {
+    auto it = reserve(out, 1);
+    *it++ = detail::sign<Char>(sign);
+    out = base_iterator(out, it);
+    sign = sign::none;
+    if (specs.width != 0) --specs.width;
+  }
+
+  memory_buffer buffer;
+  if (specs.type == presentation_type::hexfloat) {
+    if (sign) buffer.push_back(detail::sign<char>(sign));
+    format_hexfloat(convert_float(value), specs, buffer);
+    return write_bytes<Char, align::right>(out, {buffer.data(), buffer.size()},
+                                           specs);
+  }
+
+  int precision = specs.precision >= 0 || specs.type == presentation_type::none
+                      ? specs.precision
+                      : 6;
+  if (specs.type == presentation_type::exp) {
+    if (precision == max_value<int>())
+      report_error("number is too big");
+    else
+      ++precision;
+  } else if (specs.type != presentation_type::fixed && precision == 0) {
+    precision = 1;
+  }
+  float_specs fspecs = parse_float_type_spec(specs);
+  fspecs.sign = sign;
+  if (const_check(std::is_same<T, float>())) fspecs.binary32 = true;
+  int exp = format_float(convert_float(value), precision, fspecs, buffer);
+  fspecs.precision = precision;
+  auto f = big_decimal_fp{buffer.data(), static_cast<int>(buffer.size()), exp};
+  return write_float<Char>(out, f, specs, fspecs, loc);
+}
 
-// A formatter specialization for the core types corresponding to internal::type
-// constants.
-template <typename T, typename Char>
-struct formatter<T, Char, enable_if_t<internal::type_constant<T, Char>::value != internal::custom_type>> {
-	FMT_CONSTEXPR formatter() = default;
-
-	// Parses format specifiers stopping either at the end of the range or at the
-	// terminating '}'.
-	template <typename ParseContext>
-	FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
-		using handler_type = internal::dynamic_specs_handler<ParseContext>;
-		auto type = internal::type_constant<T, Char>::value;
-		internal::specs_checker<handler_type> handler(handler_type(specs_, ctx), type);
-		auto it = parse_format_specs(ctx.begin(), ctx.end(), handler);
-		auto eh = ctx.error_handler();
-		switch (type) {
-		case internal::none_type:
-		case internal::named_arg_type:
-			FMT_ASSERT(false, "invalid argument type");
-			break;
-		case internal::int_type:
-		case internal::uint_type:
-		case internal::long_long_type:
-		case internal::ulong_long_type:
-		case internal::int128_type:
-		case internal::uint128_type:
-		case internal::bool_type:
-			handle_int_type_spec(specs_.type, internal::int_type_checker<decltype(eh)>(eh));
-			break;
-		case internal::char_type:
-			handle_char_specs(&specs_, internal::char_specs_checker<decltype(eh)>(specs_.type, eh));
-			break;
-		case internal::float_type:
-		case internal::double_type:
-		case internal::long_double_type:
-			internal::parse_float_type_spec(specs_, eh);
-			break;
-		case internal::cstring_type:
-			internal::handle_cstring_type_spec(specs_.type, internal::cstring_type_checker<decltype(eh)>(eh));
-			break;
-		case internal::string_type:
-			internal::check_string_type_spec(specs_.type, eh);
-			break;
-		case internal::pointer_type:
-			internal::check_pointer_type_spec(specs_.type, eh);
-			break;
-		case internal::custom_type:
-			// Custom format specifiers should be checked in parse functions of
-			// formatter specializations.
-			break;
-		}
-		return it;
-	}
-
-	template <typename FormatContext>
-	auto format(const T& val, FormatContext& ctx) -> decltype(ctx.out()) {
-		internal::handle_dynamic_spec<internal::width_checker>(specs_.width, specs_.width_ref, ctx);
-		internal::handle_dynamic_spec<internal::precision_checker>(specs_.precision, specs_.precision_ref, ctx);
-		using range_type = internal::output_range<typename FormatContext::iterator, typename FormatContext::char_type>;
-		return visit_format_arg(arg_formatter<range_type>(ctx, nullptr, &specs_),
-		                        internal::make_arg<FormatContext>(val));
-	}
-
-private:
-	internal::dynamic_format_specs<Char> specs_;
-};
+template <typename Char, typename OutputIt, typename T,
+          FMT_ENABLE_IF(is_floating_point<T>::value)>
+FMT_CONSTEXPR20 auto write(OutputIt out, T value, format_specs specs,
+                           locale_ref loc = {}) -> OutputIt {
+  if (const_check(!is_supported_floating_point(value))) return out;
+  return specs.localized && write_loc(out, value, specs, loc)
+             ? out
+             : write_float<Char>(out, value, specs, loc);
+}
 
-#define FMT_FORMAT_AS(Type, Base)                                                                                      \
-	template <typename Char>                                                                                           \
-	struct formatter<Type, Char> : formatter<Base, Char> {                                                             \
-		template <typename FormatContext>                                                                              \
-		auto format(const Type& val, FormatContext& ctx) -> decltype(ctx.out()) {                                      \
-			return formatter<Base, Char>::format(val, ctx);                                                            \
-		}                                                                                                              \
-	}
+template <typename Char, typename OutputIt, typename T,
+          FMT_ENABLE_IF(is_fast_float<T>::value)>
+FMT_CONSTEXPR20 auto write(OutputIt out, T value) -> OutputIt {
+  if (is_constant_evaluated()) return write<Char>(out, value, format_specs());
+  if (const_check(!is_supported_floating_point(value))) return out;
+
+  auto sign = sign_t::none;
+  if (detail::signbit(value)) {
+    sign = sign::minus;
+    value = -value;
+  }
+
+  constexpr auto specs = format_specs();
+  using floaty = conditional_t<std::is_same<T, long double>::value, double, T>;
+  using floaty_uint = typename dragonbox::float_info<floaty>::carrier_uint;
+  floaty_uint mask = exponent_mask<floaty>();
+  if ((bit_cast<floaty_uint>(value) & mask) == mask)
+    return write_nonfinite<Char>(out, std::isnan(value), specs, sign);
+
+  auto fspecs = float_specs();
+  fspecs.sign = sign;
+  auto dec = dragonbox::to_decimal(static_cast<floaty>(value));
+  return write_float<Char>(out, dec, specs, fspecs, {});
+}
 
-FMT_FORMAT_AS(signed char, int);
+template <typename Char, typename OutputIt, typename T,
+          FMT_ENABLE_IF(is_floating_point<T>::value &&
+                        !is_fast_float<T>::value)>
+inline auto write(OutputIt out, T value) -> OutputIt {
+  return write<Char>(out, value, format_specs());
+}
 
-FMT_FORMAT_AS(unsigned char, unsigned);
+template <typename Char, typename OutputIt>
+auto write(OutputIt out, monostate, format_specs = {}, locale_ref = {})
+    -> OutputIt {
+  FMT_ASSERT(false, "");
+  return out;
+}
 
-FMT_FORMAT_AS(short, int);
+template <typename Char, typename OutputIt>
+FMT_CONSTEXPR auto write(OutputIt out, basic_string_view<Char> value)
+    -> OutputIt {
+  return copy_noinline<Char>(value.begin(), value.end(), out);
+}
 
-FMT_FORMAT_AS(unsigned short, unsigned);
+template <typename Char, typename OutputIt, typename T,
+          FMT_ENABLE_IF(has_to_string_view<T>::value)>
+constexpr auto write(OutputIt out, const T& value) -> OutputIt {
+  return write<Char>(out, to_string_view(value));
+}
+
+// FMT_ENABLE_IF() condition separated to workaround an MSVC bug.
+template <
+    typename Char, typename OutputIt, typename T,
+    bool check =
+        std::is_enum<T>::value && !std::is_same<T, Char>::value &&
+        mapped_type_constant<T, basic_format_context<OutputIt, Char>>::value !=
+            type::custom_type,
+    FMT_ENABLE_IF(check)>
+FMT_CONSTEXPR auto write(OutputIt out, T value) -> OutputIt {
+  return write<Char>(out, static_cast<underlying_t<T>>(value));
+}
 
-FMT_FORMAT_AS(long, long long);
+template <typename Char, typename OutputIt, typename T,
+          FMT_ENABLE_IF(std::is_same<T, bool>::value)>
+FMT_CONSTEXPR auto write(OutputIt out, T value, const format_specs& specs = {},
+                         locale_ref = {}) -> OutputIt {
+  return specs.type != presentation_type::none &&
+                 specs.type != presentation_type::string
+             ? write<Char>(out, value ? 1 : 0, specs, {})
+             : write_bytes<Char>(out, value ? "true" : "false", specs);
+}
 
-FMT_FORMAT_AS(unsigned long, unsigned long long);
+template <typename Char, typename OutputIt>
+FMT_CONSTEXPR auto write(OutputIt out, Char value) -> OutputIt {
+  auto it = reserve(out, 1);
+  *it++ = value;
+  return base_iterator(out, it);
+}
 
-FMT_FORMAT_AS(Char*, const Char*);
+template <typename Char, typename OutputIt>
+FMT_CONSTEXPR20 auto write(OutputIt out, const Char* value) -> OutputIt {
+  if (value) return write(out, basic_string_view<Char>(value));
+  report_error("string pointer is null");
+  return out;
+}
 
-FMT_FORMAT_AS(std::basic_string<Char>, basic_string_view<Char>);
+template <typename Char, typename OutputIt, typename T,
+          FMT_ENABLE_IF(std::is_same<T, void>::value)>
+auto write(OutputIt out, const T* value, const format_specs& specs = {},
+           locale_ref = {}) -> OutputIt {
+  return write_ptr<Char>(out, bit_cast<uintptr_t>(value), &specs);
+}
 
-FMT_FORMAT_AS(std::nullptr_t, const void*);
+// A write overload that handles implicit conversions.
+template <typename Char, typename OutputIt, typename T,
+          typename Context = basic_format_context<OutputIt, Char>>
+FMT_CONSTEXPR auto write(OutputIt out, const T& value) -> enable_if_t<
+    std::is_class<T>::value && !has_to_string_view<T>::value &&
+        !is_floating_point<T>::value && !std::is_same<T, Char>::value &&
+        !std::is_same<T, remove_cvref_t<decltype(arg_mapper<Context>().map(
+                             value))>>::value,
+    OutputIt> {
+  return write<Char>(out, arg_mapper<Context>().map(value));
+}
 
-FMT_FORMAT_AS(internal::std_string_view<Char>, basic_string_view<Char>);
+template <typename Char, typename OutputIt, typename T,
+          typename Context = basic_format_context<OutputIt, Char>>
+FMT_CONSTEXPR auto write(OutputIt out, const T& value)
+    -> enable_if_t<mapped_type_constant<T, Context>::value ==
+                           type::custom_type &&
+                       !std::is_fundamental<T>::value,
+                   OutputIt> {
+  auto formatter = typename Context::template formatter_type<T>();
+  auto parse_ctx = typename Context::parse_context_type({});
+  formatter.parse(parse_ctx);
+  auto ctx = Context(out, {}, {});
+  return formatter.format(value, ctx);
+}
 
-template <typename Char>
-struct formatter<void*, Char> : formatter<const void*, Char> {
-	template <typename FormatContext>
-	auto format(void* val, FormatContext& ctx) -> decltype(ctx.out()) {
-		return formatter<const void*, Char>::format(val, ctx);
-	}
+// An argument visitor that formats the argument and writes it via the output
+// iterator. It's a class and not a generic lambda for compatibility with C++11.
+template <typename Char> struct default_arg_formatter {
+  using iterator = basic_appender<Char>;
+  using context = buffered_context<Char>;
+
+  iterator out;
+  basic_format_args<context> args;
+  locale_ref loc;
+
+  template <typename T> auto operator()(T value) -> iterator {
+    return write<Char>(out, value);
+  }
+  auto operator()(typename basic_format_arg<context>::handle h) -> iterator {
+    basic_format_parse_context<Char> parse_ctx({});
+    context format_ctx(out, args, loc);
+    h.format(parse_ctx, format_ctx);
+    return format_ctx.out();
+  }
 };
 
-template <typename Char, size_t N>
-struct formatter<Char[N], Char> : formatter<basic_string_view<Char>, Char> {
-	template <typename FormatContext>
-	auto format(const Char* val, FormatContext& ctx) -> decltype(ctx.out()) {
-		return formatter<basic_string_view<Char>, Char>::format(val, ctx);
-	}
+template <typename Char> struct arg_formatter {
+  using iterator = basic_appender<Char>;
+  using context = buffered_context<Char>;
+
+  iterator out;
+  const format_specs& specs;
+  locale_ref locale;
+
+  template <typename T>
+  FMT_CONSTEXPR FMT_INLINE auto operator()(T value) -> iterator {
+    return detail::write<Char>(out, value, specs, locale);
+  }
+  auto operator()(typename basic_format_arg<context>::handle) -> iterator {
+    // User-defined types are handled separately because they require access
+    // to the parse context.
+    return out;
+  }
 };
 
-// A formatter for types known only at run time such as variant alternatives.
-//
-// Usage:
-//   using variant = std::variant<int, std::string>;
-//   template <>
-//   struct formatter<variant>: dynamic_formatter<> {
-//     void format(buffer &buf, const variant &v, context &ctx) {
-//       visit([&](const auto &val) { format(buf, val, ctx); }, v);
-//     }
-//   };
-template <typename Char = char>
-class dynamic_formatter {
-private:
-	struct null_handler : internal::error_handler {
-		void on_align(align_t) {
-		}
-
-		void on_plus() {
-		}
-
-		void on_minus() {
-		}
-
-		void on_space() {
-		}
-
-		void on_hash() {
-		}
-	};
-
-public:
-	template <typename ParseContext>
-	auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
-		format_str_ = ctx.begin();
-		// Checks are deferred to formatting time when the argument type is known.
-		internal::dynamic_specs_handler<ParseContext> handler(specs_, ctx);
-		return parse_format_specs(ctx.begin(), ctx.end(), handler);
-	}
-
-	template <typename T, typename FormatContext>
-	auto format(const T& val, FormatContext& ctx) -> decltype(ctx.out()) {
-		handle_specs(ctx);
-		internal::specs_checker<null_handler> checker(null_handler(),
-		                                              internal::mapped_type_constant<T, FormatContext>::value);
-		checker.on_align(specs_.align);
-		switch (specs_.sign) {
-		case sign::none:
-			break;
-		case sign::plus:
-			checker.on_plus();
-			break;
-		case sign::minus:
-			checker.on_minus();
-			break;
-		case sign::space:
-			checker.on_space();
-			break;
-		}
-		if (specs_.alt)
-			checker.on_hash();
-		if (specs_.precision >= 0)
-			checker.end_precision();
-		using range = internal::output_range<typename FormatContext::iterator, typename FormatContext::char_type>;
-		visit_format_arg(arg_formatter<range>(ctx, nullptr, &specs_), internal::make_arg<FormatContext>(val));
-		return ctx.out();
-	}
-
-private:
-	template <typename Context>
-	void handle_specs(Context& ctx) {
-		internal::handle_dynamic_spec<internal::width_checker>(specs_.width, specs_.width_ref, ctx);
-		internal::handle_dynamic_spec<internal::precision_checker>(specs_.precision, specs_.precision_ref, ctx);
-	}
-
-	internal::dynamic_format_specs<Char> specs_;
-	const Char* format_str_;
+struct width_checker {
+  template <typename T, FMT_ENABLE_IF(is_integer<T>::value)>
+  FMT_CONSTEXPR auto operator()(T value) -> unsigned long long {
+    if (is_negative(value)) report_error("negative width");
+    return static_cast<unsigned long long>(value);
+  }
+
+  template <typename T, FMT_ENABLE_IF(!is_integer<T>::value)>
+  FMT_CONSTEXPR auto operator()(T) -> unsigned long long {
+    report_error("width is not integer");
+    return 0;
+  }
 };
 
-template <typename Range, typename Char>
-typename basic_format_context<Range, Char>::format_arg
-basic_format_context<Range, Char>::arg(basic_string_view<char_type> name) {
-	map_.init(args_);
-	format_arg arg = map_.find(name);
-	if (arg.type() == internal::none_type)
-		this->on_error("Argument with name \"" + name.to_string() +
-		               "\" not found, did you mean to use it as a format specifier (e.g. {:" + name.to_string() + "}");
-	return arg;
-}
-
-template <typename Char, typename ErrorHandler>
-FMT_CONSTEXPR void advance_to(basic_format_parse_context<Char, ErrorHandler>& ctx, const Char* p) {
-	ctx.advance_to(ctx.begin() + (p - &*ctx.begin()));
-}
-
-template <typename ArgFormatter, typename Char, typename Context>
-struct format_handler : internal::error_handler {
-	using range = typename ArgFormatter::range;
-
-	format_handler(range r, basic_string_view<Char> str, basic_format_args<Context> format_args,
-	               internal::locale_ref loc)
-	    : parse_context(str), context(r.begin(), format_args, loc) {
-	}
-
-	void on_text(const Char* begin, const Char* end) {
-		auto size = internal::to_unsigned(end - begin);
-		auto out = context.out();
-		auto&& it = internal::reserve(out, size);
-		it = std::copy_n(begin, size, it);
-		context.advance_to(out);
-	}
-
-	void get_arg(int id) {
-		arg = internal::get_arg(context, id);
-	}
-
-	void on_arg_id() {
-		get_arg(parse_context.next_arg_id());
-	}
-
-	void on_arg_id(int id) {
-		parse_context.check_arg_id(id);
-		get_arg(id);
-	}
-
-	void on_arg_id(basic_string_view<Char> id) {
-		arg = context.arg(id);
-	}
-
-	void on_replacement_field(const Char* p) {
-		advance_to(parse_context, p);
-		context.advance_to(visit_format_arg(ArgFormatter(context, &parse_context), arg));
-	}
-
-	const Char* on_format_specs(const Char* begin, const Char* end) {
-		advance_to(parse_context, begin);
-		internal::custom_formatter<Context> f(parse_context, context);
-		if (visit_format_arg(f, arg))
-			return parse_context.begin();
-		basic_format_specs<Char> specs;
-		using internal::specs_handler;
-		using parse_context_t = basic_format_parse_context<Char>;
-		internal::specs_checker<specs_handler<parse_context_t, Context>> handler(
-		    specs_handler<parse_context_t, Context>(specs, parse_context, context), arg.type());
-		begin = parse_format_specs(begin, end, handler);
-		if (begin == end || *begin != '}')
-			on_error("missing '}' in format string");
-		advance_to(parse_context, begin);
-		context.advance_to(visit_format_arg(ArgFormatter(context, &parse_context, &specs), arg));
-		return begin;
-	}
-
-	basic_format_parse_context<Char> parse_context;
-	Context context;
-	basic_format_arg<Context> arg;
+struct precision_checker {
+  template <typename T, FMT_ENABLE_IF(is_integer<T>::value)>
+  FMT_CONSTEXPR auto operator()(T value) -> unsigned long long {
+    if (is_negative(value)) report_error("negative precision");
+    return static_cast<unsigned long long>(value);
+  }
+
+  template <typename T, FMT_ENABLE_IF(!is_integer<T>::value)>
+  FMT_CONSTEXPR auto operator()(T) -> unsigned long long {
+    report_error("precision is not integer");
+    return 0;
+  }
 };
 
-/** Formats arguments and writes the output to the range. */
-template <typename ArgFormatter, typename Char, typename Context>
-typename Context::iterator vformat_to(typename ArgFormatter::range out, basic_string_view<Char> format_str,
-                                      basic_format_args<Context> args,
-                                      internal::locale_ref loc = internal::locale_ref()) {
-	format_handler<ArgFormatter, Char, Context> h(out, format_str, args, loc);
-	internal::parse_format_string<false>(format_str, h);
-	return h.context.out();
+template <typename Handler, typename FormatArg>
+FMT_CONSTEXPR auto get_dynamic_spec(FormatArg arg) -> int {
+  unsigned long long value = arg.visit(Handler());
+  if (value > to_unsigned(max_value<int>())) report_error("number is too big");
+  return static_cast<int>(value);
 }
 
-// Casts ``p`` to ``const void*`` for pointer formatting.
-// Example:
-//   auto s = format("{}", ptr(p));
-template <typename T>
-inline const void* ptr(const T* p) {
-	return p;
+template <typename Context, typename ID>
+FMT_CONSTEXPR auto get_arg(Context& ctx, ID id) -> decltype(ctx.arg(id)) {
+  auto arg = ctx.arg(id);
+  if (!arg) report_error("argument not found");
+  return arg;
 }
 
-template <typename T>
-inline const void* ptr(const std::unique_ptr<T>& p) {
-	return p.get();
+template <typename Handler, typename Context>
+FMT_CONSTEXPR void handle_dynamic_spec(int& value,
+                                       arg_ref<typename Context::char_type> ref,
+                                       Context& ctx) {
+  switch (ref.kind) {
+  case arg_id_kind::none:
+    break;
+  case arg_id_kind::index:
+    value = detail::get_dynamic_spec<Handler>(get_arg(ctx, ref.val.index));
+    break;
+  case arg_id_kind::name:
+    value = detail::get_dynamic_spec<Handler>(get_arg(ctx, ref.val.name));
+    break;
+  }
 }
 
-template <typename T>
-inline const void* ptr(const std::shared_ptr<T>& p) {
-	return p.get();
-}
+#if FMT_USE_USER_DEFINED_LITERALS
+#  if FMT_USE_NONTYPE_TEMPLATE_ARGS
+template <typename T, typename Char, size_t N,
+          fmt::detail_exported::fixed_string<Char, N> Str>
+struct statically_named_arg : view {
+  static constexpr auto name = Str.data;
+
+  const T& value;
+  statically_named_arg(const T& v) : value(v) {}
+};
+
+template <typename T, typename Char, size_t N,
+          fmt::detail_exported::fixed_string<Char, N> Str>
+struct is_named_arg<statically_named_arg<T, Char, N, Str>> : std::true_type {};
 
-template <typename It, typename Char>
-struct arg_join : internal::view {
-	It begin;
-	It end;
-	basic_string_view<Char> sep;
+template <typename T, typename Char, size_t N,
+          fmt::detail_exported::fixed_string<Char, N> Str>
+struct is_statically_named_arg<statically_named_arg<T, Char, N, Str>>
+    : std::true_type {};
 
-	arg_join(It b, It e, basic_string_view<Char> s) : begin(b), end(e), sep(s) {
-	}
+template <typename Char, size_t N,
+          fmt::detail_exported::fixed_string<Char, N> Str>
+struct udl_arg {
+  template <typename T> auto operator=(T&& value) const {
+    return statically_named_arg<T, Char, N, Str>(std::forward<T>(value));
+  }
 };
+#  else
+template <typename Char> struct udl_arg {
+  const Char* str;
 
-template <typename It, typename Char>
-struct formatter<arg_join<It, Char>, Char> : formatter<typename std::iterator_traits<It>::value_type, Char> {
-	template <typename FormatContext>
-	auto format(const arg_join<It, Char>& value, FormatContext& ctx) -> decltype(ctx.out()) {
-		using base = formatter<typename std::iterator_traits<It>::value_type, Char>;
-		auto it = value.begin;
-		auto out = ctx.out();
-		if (it != value.end) {
-			out = base::format(*it++, ctx);
-			while (it != value.end) {
-				out = std::copy(value.sep.begin(), value.sep.end(), out);
-				ctx.advance_to(out);
-				out = base::format(*it++, ctx);
-			}
-		}
-		return out;
-	}
+  template <typename T> auto operator=(T&& value) const -> named_arg<Char, T> {
+    return {str, std::forward<T>(value)};
+  }
 };
+#  endif
+#endif  // FMT_USE_USER_DEFINED_LITERALS
+
+template <typename Locale, typename Char>
+auto vformat(const Locale& loc, basic_string_view<Char> fmt,
+             typename detail::vformat_args<Char>::type args)
+    -> std::basic_string<Char> {
+  auto buf = basic_memory_buffer<Char>();
+  detail::vformat_to(buf, fmt, args, detail::locale_ref(loc));
+  return {buf.data(), buf.size()};
+}
+
+using format_func = void (*)(detail::buffer<char>&, int, const char*);
+
+FMT_API void format_error_code(buffer<char>& out, int error_code,
+                               string_view message) noexcept;
+
+using fmt::report_error;
+FMT_API void report_error(format_func func, int error_code,
+                          const char* message) noexcept;
+}  // namespace detail
+
+FMT_BEGIN_EXPORT
+FMT_API auto vsystem_error(int error_code, string_view format_str,
+                           format_args args) -> std::system_error;
 
 /**
-  Returns an object that formats the iterator range `[begin, end)` with elements
-  separated by `sep`.
+ * Constructs `std::system_error` with a message formatted with
+ * `fmt::format(fmt, args...)`.
+ * `error_code` is a system error code as given by `errno`.
+ *
+ * **Example**:
+ *
+ *     // This throws std::system_error with the description
+ *     //   cannot open file 'madeup': No such file or directory
+ *     // or similar (system message may vary).
+ *     const char* filename = "madeup";
+ *     std::FILE* file = std::fopen(filename, "r");
+ *     if (!file)
+ *       throw fmt::system_error(errno, "cannot open file '{}'", filename);
  */
-template <typename It>
-arg_join<It, char> join(It begin, It end, string_view sep) {
-	return {begin, end, sep};
-}
-
-template <typename It>
-arg_join<It, wchar_t> join(It begin, It end, wstring_view sep) {
-	return {begin, end, sep};
+template <typename... T>
+auto system_error(int error_code, format_string<T...> fmt, T&&... args)
+    -> std::system_error {
+  return vsystem_error(error_code, fmt, fmt::make_format_args(args...));
 }
 
 /**
-  \rst
-  Returns an object that formats `range` with elements separated by `sep`.
+ * Formats an error message for an error returned by an operating system or a
+ * language runtime, for example a file opening error, and writes it to `out`.
+ * The format is the same as the one used by `std::system_error(ec, message)`
+ * where `ec` is `std::error_code(error_code, std::generic_category())`.
+ * It is implementation-defined but normally looks like:
+ *
+ *     <message>: <system-message>
+ *
+ * where `<message>` is the passed message and `<system-message>` is the system
+ * message corresponding to the error code.
+ * `error_code` is a system error code as given by `errno`.
+ */
+FMT_API void format_system_error(detail::buffer<char>& out, int error_code,
+                                 const char* message) noexcept;
 
-  **Example**::
+// Reports a system error without throwing an exception.
+// Can be used to report errors from destructors.
+FMT_API void report_system_error(int error_code, const char* message) noexcept;
 
-    std::vector<int> v = {1, 2, 3};
-    fmt::print("{}", fmt::join(v, ", "));
-    // Output: "1, 2, 3"
-  \endrst
- */
-template <typename Range>
-arg_join<internal::iterator_t<const Range>, char> join(const Range& range, string_view sep) {
-	return join(std::begin(range), std::end(range), sep);
-}
+/// A fast integer formatter.
+class format_int {
+ private:
+  // Buffer should be large enough to hold all digits (digits10 + 1),
+  // a sign and a null character.
+  enum { buffer_size = std::numeric_limits<unsigned long long>::digits10 + 3 };
+  mutable char buffer_[buffer_size];
+  char* str_;
+
+  template <typename UInt>
+  FMT_CONSTEXPR20 auto format_unsigned(UInt value) -> char* {
+    auto n = static_cast<detail::uint32_or_64_or_128_t<UInt>>(value);
+    return detail::format_decimal(buffer_, n, buffer_size - 1).begin;
+  }
+
+  template <typename Int>
+  FMT_CONSTEXPR20 auto format_signed(Int value) -> char* {
+    auto abs_value = static_cast<detail::uint32_or_64_or_128_t<Int>>(value);
+    bool negative = value < 0;
+    if (negative) abs_value = 0 - abs_value;
+    auto begin = format_unsigned(abs_value);
+    if (negative) *--begin = '-';
+    return begin;
+  }
+
+ public:
+  explicit FMT_CONSTEXPR20 format_int(int value) : str_(format_signed(value)) {}
+  explicit FMT_CONSTEXPR20 format_int(long value)
+      : str_(format_signed(value)) {}
+  explicit FMT_CONSTEXPR20 format_int(long long value)
+      : str_(format_signed(value)) {}
+  explicit FMT_CONSTEXPR20 format_int(unsigned value)
+      : str_(format_unsigned(value)) {}
+  explicit FMT_CONSTEXPR20 format_int(unsigned long value)
+      : str_(format_unsigned(value)) {}
+  explicit FMT_CONSTEXPR20 format_int(unsigned long long value)
+      : str_(format_unsigned(value)) {}
+
+  /// Returns the number of characters written to the output buffer.
+  FMT_CONSTEXPR20 auto size() const -> size_t {
+    return detail::to_unsigned(buffer_ - str_ + buffer_size - 1);
+  }
+
+  /// Returns a pointer to the output buffer content. No terminating null
+  /// character is appended.
+  FMT_CONSTEXPR20 auto data() const -> const char* { return str_; }
+
+  /// Returns a pointer to the output buffer content with terminating null
+  /// character appended.
+  FMT_CONSTEXPR20 auto c_str() const -> const char* {
+    buffer_[buffer_size - 1] = '\0';
+    return str_;
+  }
+
+  /// Returns the content of the output buffer as an `std::string`.
+  auto str() const -> std::string { return std::string(str_, size()); }
+};
 
-template <typename Range>
-arg_join<internal::iterator_t<const Range>, wchar_t> join(const Range& range, wstring_view sep) {
-	return join(std::begin(range), std::end(range), sep);
-}
+template <typename T, typename Char>
+struct formatter<T, Char, enable_if_t<detail::has_format_as<T>::value>>
+    : formatter<detail::format_as_t<T>, Char> {
+  template <typename FormatContext>
+  auto format(const T& value, FormatContext& ctx) const -> decltype(ctx.out()) {
+    auto&& val = format_as(value);  // Make an lvalue reference for format.
+    return formatter<detail::format_as_t<T>, Char>::format(val, ctx);
+  }
+};
 
-/**
-  \rst
-  Converts *value* to ``std::string`` using the default format for type *T*.
-  It doesn't support user-defined types with custom formatters.
+#define FMT_FORMAT_AS(Type, Base)                                              \
+  template <typename Char>                                                     \
+  struct formatter<Type, Char> : formatter<Base, Char> {                       \
+    template <typename FormatContext>                                          \
+    auto format(Type value, FormatContext& ctx) const -> decltype(ctx.out()) { \
+      return formatter<Base, Char>::format(value, ctx);                        \
+    }                                                                          \
+  }
 
-  **Example**::
+FMT_FORMAT_AS(signed char, int);
+FMT_FORMAT_AS(unsigned char, unsigned);
+FMT_FORMAT_AS(short, int);
+FMT_FORMAT_AS(unsigned short, unsigned);
+FMT_FORMAT_AS(long, detail::long_type);
+FMT_FORMAT_AS(unsigned long, detail::ulong_type);
+FMT_FORMAT_AS(Char*, const Char*);
+FMT_FORMAT_AS(std::nullptr_t, const void*);
+FMT_FORMAT_AS(detail::std_string_view<Char>, basic_string_view<Char>);
+FMT_FORMAT_AS(void*, const void*);
 
-    #include <fmt/format.h>
+template <typename Char, typename Traits, typename Allocator>
+class formatter<std::basic_string<Char, Traits, Allocator>, Char>
+    : public formatter<basic_string_view<Char>, Char> {};
 
-    std::string answer = fmt::to_string(42);
-  \endrst
- */
-template <typename T>
-inline std::string to_string(const T& value) {
-	return format("{}", value);
-}
+template <typename Char, size_t N>
+struct formatter<Char[N], Char> : formatter<basic_string_view<Char>, Char> {};
 
 /**
-  Converts *value* to ``std::wstring`` using the default format for type *T*.
+ * Converts `p` to `const void*` for pointer formatting.
+ *
+ * **Example**:
+ *
+ *     auto s = fmt::format("{}", fmt::ptr(p));
  */
-template <typename T>
-inline std::wstring to_wstring(const T& value) {
-	return format(L"{}", value);
-}
-
-template <typename Char, std::size_t SIZE>
-std::basic_string<Char> to_string(const basic_memory_buffer<Char, SIZE>& buf) {
-	return std::basic_string<Char>(buf.data(), buf.size());
+template <typename T> auto ptr(T p) -> const void* {
+  static_assert(std::is_pointer<T>::value, "");
+  return detail::bit_cast<const void*>(p);
 }
 
-template <typename Char>
-typename buffer_context<Char>::iterator internal::vformat_to(internal::buffer<Char>& buf,
-                                                             basic_string_view<Char> format_str,
-                                                             basic_format_args<buffer_context<Char>> args) {
-	using range = buffer_range<Char>;
-	return vformat_to<arg_formatter<range>>(buf, to_string_view(format_str), args);
+/**
+ * Converts `e` to the underlying type.
+ *
+ * **Example**:
+ *
+ *     enum class color { red, green, blue };
+ *     auto s = fmt::format("{}", fmt::underlying(color::red));
+ */
+template <typename Enum>
+constexpr auto underlying(Enum e) noexcept -> underlying_t<Enum> {
+  return static_cast<underlying_t<Enum>>(e);
 }
 
-template <typename S, typename Char = char_t<S>, FMT_ENABLE_IF(internal::is_string<S>::value)>
-inline typename buffer_context<Char>::iterator vformat_to(internal::buffer<Char>& buf, const S& format_str,
-                                                          basic_format_args<buffer_context<Char>> args) {
-	return internal::vformat_to(buf, to_string_view(format_str), args);
+namespace enums {
+template <typename Enum, FMT_ENABLE_IF(std::is_enum<Enum>::value)>
+constexpr auto format_as(Enum e) noexcept -> underlying_t<Enum> {
+  return static_cast<underlying_t<Enum>>(e);
 }
+}  // namespace enums
 
-template <typename S, typename... Args, std::size_t SIZE = inline_buffer_size,
-          typename Char = enable_if_t<internal::is_string<S>::value, char_t<S>>>
-inline typename buffer_context<Char>::iterator format_to(basic_memory_buffer<Char, SIZE>& buf, const S& format_str,
-                                                         Args&&... args) {
-	internal::check_format_string<Args...>(format_str);
-	using context = buffer_context<Char>;
-	return internal::vformat_to(buf, to_string_view(format_str), {make_format_args<context>(args...)});
-}
+class bytes {
+ private:
+  string_view data_;
+  friend struct formatter<bytes>;
 
-template <typename OutputIt, typename Char = char>
-using format_context_t = basic_format_context<OutputIt, Char>;
+ public:
+  explicit bytes(string_view data) : data_(data) {}
+};
 
-template <typename OutputIt, typename Char = char>
-using format_args_t = basic_format_args<format_context_t<OutputIt, Char>>;
+template <> struct formatter<bytes> {
+ private:
+  detail::dynamic_format_specs<> specs_;
+
+ public:
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> const char* {
+    return parse_format_specs(ctx.begin(), ctx.end(), specs_, ctx,
+                              detail::type::string_type);
+  }
+
+  template <typename FormatContext>
+  auto format(bytes b, FormatContext& ctx) const -> decltype(ctx.out()) {
+    auto specs = specs_;
+    detail::handle_dynamic_spec<detail::width_checker>(specs.width,
+                                                       specs.width_ref, ctx);
+    detail::handle_dynamic_spec<detail::precision_checker>(
+        specs.precision, specs.precision_ref, ctx);
+    return detail::write_bytes<char>(ctx.out(), b.data_, specs);
+  }
+};
 
-template <typename S, typename OutputIt, typename... Args,
-          FMT_ENABLE_IF(internal::is_output_iterator<OutputIt>::value &&
-                        !internal::is_contiguous_back_insert_iterator<OutputIt>::value)>
-inline OutputIt vformat_to(OutputIt out, const S& format_str, format_args_t<OutputIt, char_t<S>> args) {
-	using range = internal::output_range<OutputIt, char_t<S>>;
-	return vformat_to<arg_formatter<range>>(range(out), to_string_view(format_str), args);
-}
+// group_digits_view is not derived from view because it copies the argument.
+template <typename T> struct group_digits_view {
+  T value;
+};
 
 /**
- \rst
- Formats arguments, writes the result to the output iterator ``out`` and returns
- the iterator past the end of the output range.
-
- **Example**::
-
-   std::vector<char> out;
-   fmt::format_to(std::back_inserter(out), "{}", 42);
- \endrst
+ * Returns a view that formats an integer value using ',' as a
+ * locale-independent thousands separator.
+ *
+ * **Example**:
+ *
+ *     fmt::print("{}", fmt::group_digits(12345));
+ *     // Output: "12,345"
  */
-template <typename OutputIt, typename S, typename... Args,
-          FMT_ENABLE_IF(internal::is_output_iterator<OutputIt>::value &&
-                        !internal::is_contiguous_back_insert_iterator<OutputIt>::value &&
-                        internal::is_string<S>::value)>
-inline OutputIt format_to(OutputIt out, const S& format_str, Args&&... args) {
-	internal::check_format_string<Args...>(format_str);
-	using context = format_context_t<OutputIt, char_t<S>>;
-	return vformat_to(out, to_string_view(format_str), {make_format_args<context>(args...)});
+template <typename T> auto group_digits(T value) -> group_digits_view<T> {
+  return {value};
 }
 
-template <typename OutputIt>
-struct format_to_n_result {
-	/** Iterator past the end of the output range. */
-	OutputIt out;
-	/** Total (not truncated) output size. */
-	std::size_t size;
+template <typename T> struct formatter<group_digits_view<T>> : formatter<T> {
+ private:
+  detail::dynamic_format_specs<> specs_;
+
+ public:
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> const char* {
+    return parse_format_specs(ctx.begin(), ctx.end(), specs_, ctx,
+                              detail::type::int_type);
+  }
+
+  template <typename FormatContext>
+  auto format(group_digits_view<T> t, FormatContext& ctx) const
+      -> decltype(ctx.out()) {
+    auto specs = specs_;
+    detail::handle_dynamic_spec<detail::width_checker>(specs.width,
+                                                       specs.width_ref, ctx);
+    detail::handle_dynamic_spec<detail::precision_checker>(
+        specs.precision, specs.precision_ref, ctx);
+    auto arg = detail::make_write_int_arg(t.value, specs.sign);
+    return detail::write_int(
+        ctx.out(), static_cast<detail::uint64_or_128_t<T>>(arg.abs_value),
+        arg.prefix, specs, detail::digit_grouping<char>("\3", ","));
+  }
 };
 
-template <typename OutputIt, typename Char = typename OutputIt::value_type>
-using format_to_n_context = format_context_t<internal::truncating_iterator<OutputIt>, Char>;
-
-template <typename OutputIt, typename Char = typename OutputIt::value_type>
-using format_to_n_args = basic_format_args<format_to_n_context<OutputIt, Char>>;
+template <typename T, typename Char> struct nested_view {
+  const formatter<T, Char>* fmt;
+  const T* value;
+};
 
-template <typename OutputIt, typename Char, typename... Args>
-inline format_arg_store<format_to_n_context<OutputIt, Char>, Args...> make_format_to_n_args(const Args&... args) {
-	return format_arg_store<format_to_n_context<OutputIt, Char>, Args...>(args...);
-}
+template <typename T, typename Char>
+struct formatter<nested_view<T, Char>, Char> {
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+    return ctx.begin();
+  }
+  template <typename FormatContext>
+  auto format(nested_view<T, Char> view, FormatContext& ctx) const
+      -> decltype(ctx.out()) {
+    return view.fmt->format(*view.value, ctx);
+  }
+};
 
-template <typename OutputIt, typename Char, typename... Args,
-          FMT_ENABLE_IF(internal::is_output_iterator<OutputIt>::value)>
-inline format_to_n_result<OutputIt> vformat_to_n(OutputIt out, std::size_t n, basic_string_view<Char> format_str,
-                                                 format_to_n_args<OutputIt, Char> args) {
-	auto it = vformat_to(internal::truncating_iterator<OutputIt>(out, n), format_str, args);
-	return {it.base(), it.count()};
-}
+template <typename T, typename Char = char> struct nested_formatter {
+ private:
+  int width_;
+  detail::fill_t fill_;
+  align_t align_ : 4;
+  formatter<T, Char> formatter_;
+
+ public:
+  constexpr nested_formatter() : width_(0), align_(align_t::none) {}
+
+  FMT_CONSTEXPR auto parse(basic_format_parse_context<Char>& ctx)
+      -> decltype(ctx.begin()) {
+    auto specs = detail::dynamic_format_specs<Char>();
+    auto it = parse_format_specs(ctx.begin(), ctx.end(), specs, ctx,
+                                 detail::type::none_type);
+    width_ = specs.width;
+    fill_ = specs.fill;
+    align_ = specs.align;
+    ctx.advance_to(it);
+    return formatter_.parse(ctx);
+  }
+
+  template <typename FormatContext, typename F>
+  auto write_padded(FormatContext& ctx, F write) const -> decltype(ctx.out()) {
+    if (width_ == 0) return write(ctx.out());
+    auto buf = basic_memory_buffer<Char>();
+    write(basic_appender<Char>(buf));
+    auto specs = format_specs();
+    specs.width = width_;
+    specs.fill = fill_;
+    specs.align = align_;
+    return detail::write<Char>(
+        ctx.out(), basic_string_view<Char>(buf.data(), buf.size()), specs);
+  }
+
+  auto nested(const T& value) const -> nested_view<T, Char> {
+    return nested_view<T, Char>{&formatter_, &value};
+  }
+};
 
 /**
- \rst
- Formats arguments, writes up to ``n`` characters of the result to the output
- iterator ``out`` and returns the total output size and the iterator past the
- end of the output range.
- \endrst
+ * Converts `value` to `std::string` using the default format for type `T`.
+ *
+ * **Example**:
+ *
+ *     std::string answer = fmt::to_string(42);
  */
-template <typename OutputIt, typename S, typename... Args,
-          FMT_ENABLE_IF(internal::is_string<S>::value&& internal::is_output_iterator<OutputIt>::value)>
-inline format_to_n_result<OutputIt> format_to_n(OutputIt out, std::size_t n, const S& format_str, const Args&... args) {
-	internal::check_format_string<Args...>(format_str);
-	using context = format_to_n_context<OutputIt, char_t<S>>;
-	return vformat_to_n(out, n, to_string_view(format_str), {make_format_args<context>(args...)});
+template <typename T, FMT_ENABLE_IF(!std::is_integral<T>::value &&
+                                    !detail::has_format_as<T>::value)>
+inline auto to_string(const T& value) -> std::string {
+  auto buffer = memory_buffer();
+  detail::write<char>(appender(buffer), value);
+  return {buffer.data(), buffer.size()};
 }
 
-template <typename Char>
-inline std::basic_string<Char> internal::vformat(basic_string_view<Char> format_str,
-                                                 basic_format_args<buffer_context<Char>> args) {
-	basic_memory_buffer<Char> buffer;
-	internal::vformat_to(buffer, format_str, args);
-	return to_string(buffer);
+template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
+FMT_NODISCARD inline auto to_string(T value) -> std::string {
+  // The buffer should be large enough to store the number including the sign
+  // or "false" for bool.
+  constexpr int max_size = detail::digits10<T>() + 2;
+  char buffer[max_size > 5 ? static_cast<unsigned>(max_size) : 5];
+  char* begin = buffer;
+  return std::string(begin, detail::write<char>(begin, value));
 }
 
-/**
-  Returns the number of characters in the output of
-  ``format(format_str, args...)``.
- */
-template <typename... Args>
-inline std::size_t formatted_size(string_view format_str, const Args&... args) {
-	return format_to(internal::counting_iterator(), format_str, args...).count();
+template <typename Char, size_t SIZE>
+FMT_NODISCARD auto to_string(const basic_memory_buffer<Char, SIZE>& buf)
+    -> std::basic_string<Char> {
+  auto size = buf.size();
+  detail::assume(size < std::basic_string<Char>().max_size());
+  return std::basic_string<Char>(buf.data(), size);
 }
 
-#if FMT_USE_USER_DEFINED_LITERALS
-namespace internal {
-
-#if FMT_USE_UDL_TEMPLATE
-template <typename Char, Char... CHARS>
-class udl_formatter {
-public:
-	template <typename... Args>
-	std::basic_string<Char> operator()(Args&&... args) const {
-		FMT_CONSTEXPR_DECL Char s[] = {CHARS..., '\0'};
-		FMT_CONSTEXPR_DECL bool invalid_format = do_check_format_string<Char, error_handler, remove_cvref_t<Args>...>(
-		    basic_string_view<Char>(s, sizeof...(CHARS)));
-		(void) invalid_format;
-		return format(s, std::forward<Args>(args)...);
-	}
-};
-#else
-
-template <typename Char>
-struct udl_formatter {
-	basic_string_view<Char> str;
+template <typename T, FMT_ENABLE_IF(!std::is_integral<T>::value &&
+                                    detail::has_format_as<T>::value)>
+inline auto to_string(const T& value) -> std::string {
+  return to_string(format_as(value));
+}
 
-	template <typename... Args>
-	std::basic_string<Char> operator()(Args&&... args) const {
-		return format(str, std::forward<Args>(args)...);
-	}
-};
+FMT_END_EXPORT
 
-#endif // FMT_USE_UDL_TEMPLATE
+namespace detail {
 
 template <typename Char>
-struct udl_arg {
-	basic_string_view<Char> str;
+void vformat_to(buffer<Char>& buf, basic_string_view<Char> fmt,
+                typename vformat_args<Char>::type args, locale_ref loc) {
+  auto out = basic_appender<Char>(buf);
+  if (fmt.size() == 2 && equal2(fmt.data(), "{}")) {
+    auto arg = args.get(0);
+    if (!arg) report_error("argument not found");
+    arg.visit(default_arg_formatter<Char>{out, args, loc});
+    return;
+  }
+
+  struct format_handler {
+    basic_format_parse_context<Char> parse_context;
+    buffered_context<Char> context;
+
+    format_handler(basic_appender<Char> p_out, basic_string_view<Char> str,
+                   basic_format_args<buffered_context<Char>> p_args,
+                   locale_ref p_loc)
+        : parse_context(str), context(p_out, p_args, p_loc) {}
+
+    void on_text(const Char* begin, const Char* end) {
+      auto text = basic_string_view<Char>(begin, to_unsigned(end - begin));
+      context.advance_to(write<Char>(context.out(), text));
+    }
+
+    FMT_CONSTEXPR auto on_arg_id() -> int {
+      return parse_context.next_arg_id();
+    }
+    FMT_CONSTEXPR auto on_arg_id(int id) -> int {
+      parse_context.check_arg_id(id);
+      return id;
+    }
+    FMT_CONSTEXPR auto on_arg_id(basic_string_view<Char> id) -> int {
+      parse_context.check_arg_id(id);
+      int arg_id = context.arg_id(id);
+      if (arg_id < 0) report_error("argument not found");
+      return arg_id;
+    }
+
+    FMT_INLINE void on_replacement_field(int id, const Char*) {
+      auto arg = get_arg(context, id);
+      context.advance_to(arg.visit(default_arg_formatter<Char>{
+          context.out(), context.args(), context.locale()}));
+    }
+
+    auto on_format_specs(int id, const Char* begin, const Char* end)
+        -> const Char* {
+      auto arg = get_arg(context, id);
+      // Not using a visitor for custom types gives better codegen.
+      if (arg.format_custom(begin, parse_context, context))
+        return parse_context.begin();
+      auto specs = detail::dynamic_format_specs<Char>();
+      begin = parse_format_specs(begin, end, specs, parse_context, arg.type());
+      detail::handle_dynamic_spec<detail::width_checker>(
+          specs.width, specs.width_ref, context);
+      detail::handle_dynamic_spec<detail::precision_checker>(
+          specs.precision, specs.precision_ref, context);
+      if (begin == end || *begin != '}')
+        report_error("missing '}' in format string");
+      context.advance_to(arg.visit(
+          arg_formatter<Char>{context.out(), specs, context.locale()}));
+      return begin;
+    }
+
+    FMT_NORETURN void on_error(const char* message) { report_error(message); }
+  };
+  detail::parse_format_string<false>(fmt, format_handler(out, fmt, args, loc));
+}
 
-	template <typename T>
-	named_arg<T, Char> operator=(T&& value) const {
-		return {str, std::forward<T>(value)};
-	}
-};
+FMT_BEGIN_EXPORT
+
+#ifndef FMT_HEADER_ONLY
+extern template FMT_API void vformat_to(buffer<char>&, string_view,
+                                        typename vformat_args<>::type,
+                                        locale_ref);
+extern template FMT_API auto thousands_sep_impl<char>(locale_ref)
+    -> thousands_sep_result<char>;
+extern template FMT_API auto thousands_sep_impl<wchar_t>(locale_ref)
+    -> thousands_sep_result<wchar_t>;
+extern template FMT_API auto decimal_point_impl(locale_ref) -> char;
+extern template FMT_API auto decimal_point_impl(locale_ref) -> wchar_t;
+#endif  // FMT_HEADER_ONLY
+
+FMT_END_EXPORT
+
+template <typename T, typename Char, type TYPE>
+template <typename FormatContext>
+FMT_CONSTEXPR FMT_INLINE auto native_formatter<T, Char, TYPE>::format(
+    const T& val, FormatContext& ctx) const -> decltype(ctx.out()) {
+  if (specs_.width_ref.kind == arg_id_kind::none &&
+      specs_.precision_ref.kind == arg_id_kind::none) {
+    return write<Char>(ctx.out(), val, specs_, ctx.locale());
+  }
+  auto specs = specs_;
+  handle_dynamic_spec<width_checker>(specs.width, specs.width_ref, ctx);
+  handle_dynamic_spec<precision_checker>(specs.precision, specs.precision_ref,
+                                         ctx);
+  return write<Char>(ctx.out(), val, specs, ctx.locale());
+}
 
-} // namespace internal
+}  // namespace detail
 
-inline namespace literals {
-#if FMT_USE_UDL_TEMPLATE
-template <typename Char, Char... CHARS>
-FMT_CONSTEXPR internal::udl_formatter<Char, CHARS...> operator""_format() {
-	return {};
-}
-#else
-/**
-  \rst
-  User-defined literal equivalent of :func:`fmt::format`.
+FMT_BEGIN_EXPORT
 
-  **Example**::
+template <typename Char>
+struct formatter<detail::float128, Char>
+    : detail::native_formatter<detail::float128, Char,
+                               detail::type::float_type> {};
 
-    using namespace fmt::literals;
-    std::string message = "The answer is {}"_format(42);
-  \endrst
+#if FMT_USE_USER_DEFINED_LITERALS
+inline namespace literals {
+/**
+ * User-defined literal equivalent of `fmt::arg`.
+ *
+ * **Example**:
+ *
+ *     using namespace fmt::literals;
+ *     fmt::print("The answer is {answer}.", "answer"_a=42);
  */
-FMT_CONSTEXPR internal::udl_formatter<char> operator"" _format(const char* s, std::size_t n) {
-	return {{s, n}};
+#  if FMT_USE_NONTYPE_TEMPLATE_ARGS
+template <detail_exported::fixed_string Str> constexpr auto operator""_a() {
+  using char_t = remove_cvref_t<decltype(Str.data[0])>;
+  return detail::udl_arg<char_t, sizeof(Str.data) / sizeof(char_t), Str>();
 }
-
-FMT_CONSTEXPR internal::udl_formatter<wchar_t> operator"" _format(const wchar_t * s, std::size_t n) {
-	return {{s, n}};
+#  else
+constexpr auto operator""_a(const char* s, size_t) -> detail::udl_arg<char> {
+  return {s};
 }
+#  endif
+}  // namespace literals
+#endif  // FMT_USE_USER_DEFINED_LITERALS
 
-#endif // FMT_USE_UDL_TEMPLATE
+FMT_API auto vformat(string_view fmt, format_args args) -> std::string;
 
 /**
-  \rst
-  User-defined literal equivalent of :func:`fmt::arg`.
-
-  **Example**::
-
-    using namespace fmt::literals;
-    fmt::print("Elapsed time: {s:.2f} seconds", "s"_a=1.23);
-  \endrst
+ * Formats `args` according to specifications in `fmt` and returns the result
+ * as a string.
+ *
+ * **Example**:
+ *
+ *     #include <fmt/format.h>
+ *     std::string message = fmt::format("The answer is {}.", 42);
  */
-FMT_CONSTEXPR internal::udl_arg<char> operator"" _a(const char* s, std::size_t n) {
-	return {{s, n}};
+template <typename... T>
+FMT_NODISCARD FMT_INLINE auto format(format_string<T...> fmt, T&&... args)
+    -> std::string {
+  return vformat(fmt, fmt::make_format_args(args...));
 }
 
-FMT_CONSTEXPR internal::udl_arg<wchar_t> operator"" _a(const wchar_t * s, std::size_t n) {
-	return {{s, n}};
+template <typename Locale, FMT_ENABLE_IF(detail::is_locale<Locale>::value)>
+inline auto vformat(const Locale& loc, string_view fmt, format_args args)
+    -> std::string {
+  return detail::vformat(loc, fmt, args);
 }
-} // namespace literals
-#endif // FMT_USE_USER_DEFINED_LITERALS
-FMT_END_NAMESPACE
 
-#define FMT_STRING_IMPL(s, ...)                                                                                        \
-	[] {                                                                                                               \
-		struct str : nautilus_fmt::compile_string {                                                                    \
-			using char_type =                                                                                          \
-			    typename std::remove_cv<std::remove_pointer<typename std::decay<decltype(s)>::type>::type>::type;      \
-			__VA_ARGS__ FMT_CONSTEXPR operator nautilus_fmt::basic_string_view<char_type>() const {                    \
-				return {s, sizeof(s) / sizeof(char_type) - 1};                                                         \
-			}                                                                                                          \
-		} result;                                                                                                      \
-		/* Suppress Qt Creator warning about unused operator. */                                                       \
-		(void) static_cast<nautilus_fmt::basic_string_view<typename str::char_type>>(result);                          \
-		return result;                                                                                                 \
-	}()
+template <typename Locale, typename... T,
+          FMT_ENABLE_IF(detail::is_locale<Locale>::value)>
+inline auto format(const Locale& loc, format_string<T...> fmt, T&&... args)
+    -> std::string {
+  return fmt::vformat(loc, string_view(fmt), fmt::make_format_args(args...));
+}
 
-/**
-  \rst
-  Constructs a compile-time format string.
+template <typename OutputIt, typename Locale,
+          FMT_ENABLE_IF(detail::is_output_iterator<OutputIt, char>::value&&
+                            detail::is_locale<Locale>::value)>
+auto vformat_to(OutputIt out, const Locale& loc, string_view fmt,
+                format_args args) -> OutputIt {
+  using detail::get_buffer;
+  auto&& buf = get_buffer<char>(out);
+  detail::vformat_to(buf, fmt, args, detail::locale_ref(loc));
+  return detail::get_iterator(buf, out);
+}
+
+template <typename OutputIt, typename Locale, typename... T,
+          FMT_ENABLE_IF(detail::is_output_iterator<OutputIt, char>::value&&
+                            detail::is_locale<Locale>::value)>
+FMT_INLINE auto format_to(OutputIt out, const Locale& loc,
+                          format_string<T...> fmt, T&&... args) -> OutputIt {
+  return vformat_to(out, loc, fmt, fmt::make_format_args(args...));
+}
 
-  **Example**::
+template <typename Locale, typename... T,
+          FMT_ENABLE_IF(detail::is_locale<Locale>::value)>
+FMT_NODISCARD FMT_INLINE auto formatted_size(const Locale& loc,
+                                             format_string<T...> fmt,
+                                             T&&... args) -> size_t {
+  auto buf = detail::counting_buffer<>();
+  detail::vformat_to<char>(buf, fmt, fmt::make_format_args(args...),
+                           detail::locale_ref(loc));
+  return buf.count();
+}
 
-    // A compile-time error because 'd' is an invalid specifier for strings.
-    std::string s = format(FMT_STRING("{:d}"), "foo");
-  \endrst
- */
-#define FMT_STRING(s) FMT_STRING_IMPL(s, )
+FMT_END_EXPORT
 
-#if defined(FMT_STRING_ALIAS) && FMT_STRING_ALIAS
-#define fmt(s) FMT_STRING_IMPL(s, [[deprecated]])
-#endif
+FMT_END_NAMESPACE
 
 #ifdef FMT_HEADER_ONLY
-#define FMT_FUNC inline
-// #  include "format-inl.h"
+#  define FMT_FUNC inline
+#  include "format-inl.h"
 #else
-#define FMT_FUNC
+#  define FMT_FUNC
+#endif
+
+// Restore _LIBCPP_REMOVE_TRANSITIVE_INCLUDES.
+#ifdef FMT_REMOVE_TRANSITIVE_INCLUDES
+#  undef _LIBCPP_REMOVE_TRANSITIVE_INCLUDES
 #endif
 
-#endif // FMT_FORMAT_H_
+#endif  // FMT_FORMAT_H_
diff --git a/third_party/fmt/include/fmt/os.h b/third_party/fmt/include/fmt/os.h
new file mode 100644
index 00000000..5c85ea08
--- /dev/null
+++ b/third_party/fmt/include/fmt/os.h
@@ -0,0 +1,439 @@
+// Formatting library for C++ - optional OS-specific functionality
+//
+// Copyright (c) 2012 - present, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_OS_H_
+#define FMT_OS_H_
+
+#include "format.h"
+
+#ifndef FMT_MODULE
+#  include <cerrno>
+#  include <cstddef>
+#  include <cstdio>
+#  include <system_error>  // std::system_error
+
+#  if FMT_HAS_INCLUDE(<xlocale.h>)
+#    include <xlocale.h>  // LC_NUMERIC_MASK on macOS
+#  endif
+#endif  // FMT_MODULE
+
+#ifndef FMT_USE_FCNTL
+// UWP doesn't provide _pipe.
+#  if FMT_HAS_INCLUDE("winapifamily.h")
+#    include <winapifamily.h>
+#  endif
+#  if (FMT_HAS_INCLUDE(<fcntl.h>) || defined(__APPLE__) || \
+       defined(__linux__)) &&                              \
+      (!defined(WINAPI_FAMILY) ||                          \
+       (WINAPI_FAMILY == WINAPI_FAMILY_DESKTOP_APP))
+#    include <fcntl.h>  // for O_RDONLY
+#    define FMT_USE_FCNTL 1
+#  else
+#    define FMT_USE_FCNTL 0
+#  endif
+#endif
+
+#ifndef FMT_POSIX
+#  if defined(_WIN32) && !defined(__MINGW32__)
+// Fix warnings about deprecated symbols.
+#    define FMT_POSIX(call) _##call
+#  else
+#    define FMT_POSIX(call) call
+#  endif
+#endif
+
+// Calls to system functions are wrapped in FMT_SYSTEM for testability.
+#ifdef FMT_SYSTEM
+#  define FMT_HAS_SYSTEM
+#  define FMT_POSIX_CALL(call) FMT_SYSTEM(call)
+#else
+#  define FMT_SYSTEM(call) ::call
+#  ifdef _WIN32
+// Fix warnings about deprecated symbols.
+#    define FMT_POSIX_CALL(call) ::_##call
+#  else
+#    define FMT_POSIX_CALL(call) ::call
+#  endif
+#endif
+
+// Retries the expression while it evaluates to error_result and errno
+// equals to EINTR.
+#ifndef _WIN32
+#  define FMT_RETRY_VAL(result, expression, error_result) \
+    do {                                                  \
+      (result) = (expression);                            \
+    } while ((result) == (error_result) && errno == EINTR)
+#else
+#  define FMT_RETRY_VAL(result, expression, error_result) result = (expression)
+#endif
+
+#define FMT_RETRY(result, expression) FMT_RETRY_VAL(result, expression, -1)
+
+FMT_BEGIN_NAMESPACE
+FMT_BEGIN_EXPORT
+
+/**
+ * A reference to a null-terminated string. It can be constructed from a C
+ * string or `std::string`.
+ *
+ * You can use one of the following type aliases for common character types:
+ *
+ * +---------------+-----------------------------+
+ * | Type          | Definition                  |
+ * +===============+=============================+
+ * | cstring_view  | basic_cstring_view<char>    |
+ * +---------------+-----------------------------+
+ * | wcstring_view | basic_cstring_view<wchar_t> |
+ * +---------------+-----------------------------+
+ *
+ * This class is most useful as a parameter type for functions that wrap C APIs.
+ */
+template <typename Char> class basic_cstring_view {
+ private:
+  const Char* data_;
+
+ public:
+  /// Constructs a string reference object from a C string.
+  basic_cstring_view(const Char* s) : data_(s) {}
+
+  /// Constructs a string reference from an `std::string` object.
+  basic_cstring_view(const std::basic_string<Char>& s) : data_(s.c_str()) {}
+
+  /// Returns the pointer to a C string.
+  auto c_str() const -> const Char* { return data_; }
+};
+
+using cstring_view = basic_cstring_view<char>;
+using wcstring_view = basic_cstring_view<wchar_t>;
+
+#ifdef _WIN32
+FMT_API const std::error_category& system_category() noexcept;
+
+namespace detail {
+FMT_API void format_windows_error(buffer<char>& out, int error_code,
+                                  const char* message) noexcept;
+}
+
+FMT_API std::system_error vwindows_error(int error_code, string_view format_str,
+                                         format_args args);
+
+/**
+ * Constructs a `std::system_error` object with the description of the form
+ *
+ *     <message>: <system-message>
+ *
+ * where `<message>` is the formatted message and `<system-message>` is the
+ * system message corresponding to the error code.
+ * `error_code` is a Windows error code as given by `GetLastError`.
+ * If `error_code` is not a valid error code such as -1, the system message
+ * will look like "error -1".
+ *
+ * **Example**:
+ *
+ *     // This throws a system_error with the description
+ *     //   cannot open file 'madeup': The system cannot find the file
+ * specified.
+ *     // or similar (system message may vary).
+ *     const char *filename = "madeup";
+ *     LPOFSTRUCT of = LPOFSTRUCT();
+ *     HFILE file = OpenFile(filename, &of, OF_READ);
+ *     if (file == HFILE_ERROR) {
+ *       throw fmt::windows_error(GetLastError(),
+ *                                "cannot open file '{}'", filename);
+ *     }
+ */
+template <typename... Args>
+std::system_error windows_error(int error_code, string_view message,
+                                const Args&... args) {
+  return vwindows_error(error_code, message, fmt::make_format_args(args...));
+}
+
+// Reports a Windows error without throwing an exception.
+// Can be used to report errors from destructors.
+FMT_API void report_windows_error(int error_code, const char* message) noexcept;
+#else
+inline auto system_category() noexcept -> const std::error_category& {
+  return std::system_category();
+}
+#endif  // _WIN32
+
+// std::system is not available on some platforms such as iOS (#2248).
+#ifdef __OSX__
+template <typename S, typename... Args, typename Char = char_t<S>>
+void say(const S& format_str, Args&&... args) {
+  std::system(format("say \"{}\"", format(format_str, args...)).c_str());
+}
+#endif
+
+// A buffered file.
+class buffered_file {
+ private:
+  FILE* file_;
+
+  friend class file;
+
+  explicit buffered_file(FILE* f) : file_(f) {}
+
+ public:
+  buffered_file(const buffered_file&) = delete;
+  void operator=(const buffered_file&) = delete;
+
+  // Constructs a buffered_file object which doesn't represent any file.
+  buffered_file() noexcept : file_(nullptr) {}
+
+  // Destroys the object closing the file it represents if any.
+  FMT_API ~buffered_file() noexcept;
+
+ public:
+  buffered_file(buffered_file&& other) noexcept : file_(other.file_) {
+    other.file_ = nullptr;
+  }
+
+  auto operator=(buffered_file&& other) -> buffered_file& {
+    close();
+    file_ = other.file_;
+    other.file_ = nullptr;
+    return *this;
+  }
+
+  // Opens a file.
+  FMT_API buffered_file(cstring_view filename, cstring_view mode);
+
+  // Closes the file.
+  FMT_API void close();
+
+  // Returns the pointer to a FILE object representing this file.
+  auto get() const noexcept -> FILE* { return file_; }
+
+  FMT_API auto descriptor() const -> int;
+
+  template <typename... T>
+  inline void print(string_view fmt, const T&... args) {
+    const auto& vargs = fmt::make_format_args(args...);
+    detail::is_locking<T...>() ? fmt::vprint_buffered(file_, fmt, vargs)
+                               : fmt::vprint(file_, fmt, vargs);
+  }
+};
+
+#if FMT_USE_FCNTL
+
+// A file. Closed file is represented by a file object with descriptor -1.
+// Methods that are not declared with noexcept may throw
+// fmt::system_error in case of failure. Note that some errors such as
+// closing the file multiple times will cause a crash on Windows rather
+// than an exception. You can get standard behavior by overriding the
+// invalid parameter handler with _set_invalid_parameter_handler.
+class FMT_API file {
+ private:
+  int fd_;  // File descriptor.
+
+  // Constructs a file object with a given descriptor.
+  explicit file(int fd) : fd_(fd) {}
+
+  friend struct pipe;
+
+ public:
+  // Possible values for the oflag argument to the constructor.
+  enum {
+    RDONLY = FMT_POSIX(O_RDONLY),  // Open for reading only.
+    WRONLY = FMT_POSIX(O_WRONLY),  // Open for writing only.
+    RDWR = FMT_POSIX(O_RDWR),      // Open for reading and writing.
+    CREATE = FMT_POSIX(O_CREAT),   // Create if the file doesn't exist.
+    APPEND = FMT_POSIX(O_APPEND),  // Open in append mode.
+    TRUNC = FMT_POSIX(O_TRUNC)     // Truncate the content of the file.
+  };
+
+  // Constructs a file object which doesn't represent any file.
+  file() noexcept : fd_(-1) {}
+
+  // Opens a file and constructs a file object representing this file.
+  file(cstring_view path, int oflag);
+
+ public:
+  file(const file&) = delete;
+  void operator=(const file&) = delete;
+
+  file(file&& other) noexcept : fd_(other.fd_) { other.fd_ = -1; }
+
+  // Move assignment is not noexcept because close may throw.
+  auto operator=(file&& other) -> file& {
+    close();
+    fd_ = other.fd_;
+    other.fd_ = -1;
+    return *this;
+  }
+
+  // Destroys the object closing the file it represents if any.
+  ~file() noexcept;
+
+  // Returns the file descriptor.
+  auto descriptor() const noexcept -> int { return fd_; }
+
+  // Closes the file.
+  void close();
+
+  // Returns the file size. The size has signed type for consistency with
+  // stat::st_size.
+  auto size() const -> long long;
+
+  // Attempts to read count bytes from the file into the specified buffer.
+  auto read(void* buffer, size_t count) -> size_t;
+
+  // Attempts to write count bytes from the specified buffer to the file.
+  auto write(const void* buffer, size_t count) -> size_t;
+
+  // Duplicates a file descriptor with the dup function and returns
+  // the duplicate as a file object.
+  static auto dup(int fd) -> file;
+
+  // Makes fd be the copy of this file descriptor, closing fd first if
+  // necessary.
+  void dup2(int fd);
+
+  // Makes fd be the copy of this file descriptor, closing fd first if
+  // necessary.
+  void dup2(int fd, std::error_code& ec) noexcept;
+
+  // Creates a buffered_file object associated with this file and detaches
+  // this file object from the file.
+  auto fdopen(const char* mode) -> buffered_file;
+
+#  if defined(_WIN32) && !defined(__MINGW32__)
+  // Opens a file and constructs a file object representing this file by
+  // wcstring_view filename. Windows only.
+  static file open_windows_file(wcstring_view path, int oflag);
+#  endif
+};
+
+struct FMT_API pipe {
+  file read_end;
+  file write_end;
+
+  // Creates a pipe setting up read_end and write_end file objects for reading
+  // and writing respectively.
+  pipe();
+};
+
+// Returns the memory page size.
+auto getpagesize() -> long;
+
+namespace detail {
+
+struct buffer_size {
+  buffer_size() = default;
+  size_t value = 0;
+  auto operator=(size_t val) const -> buffer_size {
+    auto bs = buffer_size();
+    bs.value = val;
+    return bs;
+  }
+};
+
+struct ostream_params {
+  int oflag = file::WRONLY | file::CREATE | file::TRUNC;
+  size_t buffer_size = BUFSIZ > 32768 ? BUFSIZ : 32768;
+
+  ostream_params() {}
+
+  template <typename... T>
+  ostream_params(T... params, int new_oflag) : ostream_params(params...) {
+    oflag = new_oflag;
+  }
+
+  template <typename... T>
+  ostream_params(T... params, detail::buffer_size bs)
+      : ostream_params(params...) {
+    this->buffer_size = bs.value;
+  }
+
+// Intel has a bug that results in failure to deduce a constructor
+// for empty parameter packs.
+#  if defined(__INTEL_COMPILER) && __INTEL_COMPILER < 2000
+  ostream_params(int new_oflag) : oflag(new_oflag) {}
+  ostream_params(detail::buffer_size bs) : buffer_size(bs.value) {}
+#  endif
+};
+
+class file_buffer final : public buffer<char> {
+ private:
+  file file_;
+
+  FMT_API static void grow(buffer<char>& buf, size_t);
+
+ public:
+  FMT_API file_buffer(cstring_view path, const ostream_params& params);
+  FMT_API file_buffer(file_buffer&& other) noexcept;
+  FMT_API ~file_buffer();
+
+  void flush() {
+    if (size() == 0) return;
+    file_.write(data(), size() * sizeof(data()[0]));
+    clear();
+  }
+
+  void close() {
+    flush();
+    file_.close();
+  }
+};
+
+}  // namespace detail
+
+constexpr auto buffer_size = detail::buffer_size();
+
+/// A fast output stream for writing from a single thread. Writing from
+/// multiple threads without external synchronization may result in a data race.
+class FMT_API ostream {
+ private:
+  FMT_MSC_WARNING(suppress : 4251)
+  detail::file_buffer buffer_;
+
+  ostream(cstring_view path, const detail::ostream_params& params)
+      : buffer_(path, params) {}
+
+ public:
+  ostream(ostream&& other) : buffer_(std::move(other.buffer_)) {}
+
+  ~ostream();
+
+  void flush() { buffer_.flush(); }
+
+  template <typename... T>
+  friend auto output_file(cstring_view path, T... params) -> ostream;
+
+  void close() { buffer_.close(); }
+
+  /// Formats `args` according to specifications in `fmt` and writes the
+  /// output to the file.
+  template <typename... T> void print(format_string<T...> fmt, T&&... args) {
+    vformat_to(appender(buffer_), fmt, fmt::make_format_args(args...));
+  }
+};
+
+/**
+ * Opens a file for writing. Supported parameters passed in `params`:
+ *
+ * - `<integer>`: Flags passed to [open](
+ *   https://pubs.opengroup.org/onlinepubs/007904875/functions/open.html)
+ *   (`file::WRONLY | file::CREATE | file::TRUNC` by default)
+ * - `buffer_size=<integer>`: Output buffer size
+ *
+ * **Example**:
+ *
+ *     auto out = fmt::output_file("guide.txt");
+ *     out.print("Don't {}", "Panic");
+ */
+template <typename... T>
+inline auto output_file(cstring_view path, T... params) -> ostream {
+  return {path, detail::ostream_params(params...)};
+}
+#endif  // FMT_USE_FCNTL
+
+FMT_END_EXPORT
+FMT_END_NAMESPACE
+
+#endif  // FMT_OS_H_
diff --git a/third_party/fmt/include/fmt/ostream.h b/third_party/fmt/include/fmt/ostream.h
index 6756e0e6..98faef65 100644
--- a/third_party/fmt/include/fmt/ostream.h
+++ b/third_party/fmt/include/fmt/ostream.h
@@ -8,157 +8,204 @@
 #ifndef FMT_OSTREAM_H_
 #define FMT_OSTREAM_H_
 
-#include "fmt/format.h"
-#include <ostream>
+#ifndef FMT_MODULE
+#  include <fstream>  // std::filebuf
+#endif
 
-FMT_BEGIN_NAMESPACE
-namespace internal {
-
-template <class Char>
-class formatbuf : public std::basic_streambuf<Char> {
-private:
-	using int_type = typename std::basic_streambuf<Char>::int_type;
-	using traits_type = typename std::basic_streambuf<Char>::traits_type;
-
-	buffer<Char>& buffer_;
-
-public:
-	formatbuf(buffer<Char>& buf) : buffer_(buf) {
-	}
-
-protected:
-	// The put-area is actually always empty. This makes the implementation
-	// simpler and has the advantage that the streambuf and the buffer are always
-	// in sync and sputc never writes into uninitialized memory. The obvious
-	// disadvantage is that each call to sputc always results in a (virtual) call
-	// to overflow. There is no disadvantage here for sputn since this always
-	// results in a call to xsputn.
-
-	int_type overflow(int_type ch = traits_type::eof())
-
-	    FMT_OVERRIDE {
-		if (!traits_type::eq_int_type(ch, traits_type::eof()))
-			buffer_.push_back(static_cast<Char>(ch));
-		return ch;
-	}
-
-	std::streamsize xsputn(const Char* s, std::streamsize count)
-
-	    FMT_OVERRIDE {
-		buffer_.append(s, s + count);
-		return count;
-	}
-};
-
-template <typename Char>
-struct test_stream : std::basic_ostream<Char> {
-private:
-	// Hide all operator<< from std::basic_ostream<Char>.
-	void_t<> operator<<(null<>);
-
-	void_t<> operator<<(const Char*);
+#ifdef _WIN32
+#  ifdef __GLIBCXX__
+#    include <ext/stdio_filebuf.h>
+#    include <ext/stdio_sync_filebuf.h>
+#  endif
+#  include <io.h>
+#endif
 
-	template <typename T, FMT_ENABLE_IF(std::is_convertible<T, int>::value && !std::is_enum<T>::value)>
+#include "chrono.h"  // formatbuf
 
-	void_t<> operator<<(T);
+FMT_BEGIN_NAMESPACE
+namespace detail {
+
+// Generate a unique explicit instantion in every translation unit using a tag
+// type in an anonymous namespace.
+namespace {
+struct file_access_tag {};
+}  // namespace
+template <typename Tag, typename BufType, FILE* BufType::*FileMemberPtr>
+class file_access {
+  friend auto get_file(BufType& obj) -> FILE* { return obj.*FileMemberPtr; }
 };
 
-// Checks if T has a user-defined operator<< (e.g. not a member of
-// std::ostream).
-template <typename T, typename Char>
-class is_streamable {
-private:
-	template <typename U>
-	static bool_constant<
-	    !std::is_same<decltype(std::declval<test_stream<Char>&>() << std::declval<U>()), void_t<>>::value>
-	test(int);
-
-	template <typename>
-	static std::false_type test(...);
-
-	using result =
-
-	    decltype(test<T>(
-
-	        0));
-
-public:
-	static const bool value = result::value;
-};
+#if FMT_MSC_VERSION
+template class file_access<file_access_tag, std::filebuf,
+                           &std::filebuf::_Myfile>;
+auto get_file(std::filebuf&) -> FILE*;
+#endif
+
+inline auto write_ostream_unicode(std::ostream& os, fmt::string_view data)
+    -> bool {
+  FILE* f = nullptr;
+#if FMT_MSC_VERSION && FMT_USE_RTTI
+  if (auto* buf = dynamic_cast<std::filebuf*>(os.rdbuf()))
+    f = get_file(*buf);
+  else
+    return false;
+#elif defined(_WIN32) && defined(__GLIBCXX__) && FMT_USE_RTTI
+  auto* rdbuf = os.rdbuf();
+  if (auto* sfbuf = dynamic_cast<__gnu_cxx::stdio_sync_filebuf<char>*>(rdbuf))
+    f = sfbuf->file();
+  else if (auto* fbuf = dynamic_cast<__gnu_cxx::stdio_filebuf<char>*>(rdbuf))
+    f = fbuf->file();
+  else
+    return false;
+#else
+  ignore_unused(os, data, f);
+#endif
+#ifdef _WIN32
+  if (f) {
+    int fd = _fileno(f);
+    if (_isatty(fd)) {
+      os.flush();
+      return write_console(fd, data);
+    }
+  }
+#endif
+  return false;
+}
+inline auto write_ostream_unicode(std::wostream&,
+                                  fmt::basic_string_view<wchar_t>) -> bool {
+  return false;
+}
 
 // Write the content of buf to os.
+// It is a separate function rather than a part of vprint to simplify testing.
 template <typename Char>
-void write(std::basic_ostream<Char>& os, buffer<Char>& buf) {
-	const Char* buf_data = buf.data();
-	using unsigned_streamsize = std::make_unsigned<std::streamsize>::type;
-	unsigned_streamsize size = buf.size();
-	unsigned_streamsize max_size = to_unsigned(max_value<std::streamsize>());
-	do {
-		unsigned_streamsize n = size <= max_size ? size : max_size;
-		os.write(buf_data, static_cast<std::streamsize>(n));
-		buf_data += n;
-		size -= n;
-	} while (size != 0);
+void write_buffer(std::basic_ostream<Char>& os, buffer<Char>& buf) {
+  const Char* buf_data = buf.data();
+  using unsigned_streamsize = std::make_unsigned<std::streamsize>::type;
+  unsigned_streamsize size = buf.size();
+  unsigned_streamsize max_size = to_unsigned(max_value<std::streamsize>());
+  do {
+    unsigned_streamsize n = size <= max_size ? size : max_size;
+    os.write(buf_data, static_cast<std::streamsize>(n));
+    buf_data += n;
+    size -= n;
+  } while (size != 0);
 }
 
 template <typename Char, typename T>
-void format_value(buffer<Char>& buf, const T& value, locale_ref loc = locale_ref()) {
-	formatbuf<Char> format_buf(buf);
-	std::basic_ostream<Char> output(&format_buf);
-	if (loc)
-		output.imbue(loc.get<std::locale>());
-	output.exceptions(std::ios_base::failbit | std::ios_base::badbit);
-	output << value;
-	buf.resize(buf.size());
+void format_value(buffer<Char>& buf, const T& value) {
+  auto&& format_buf = formatbuf<std::basic_streambuf<Char>>(buf);
+  auto&& output = std::basic_ostream<Char>(&format_buf);
+#if !defined(FMT_STATIC_THOUSANDS_SEPARATOR)
+  output.imbue(std::locale::classic());  // The default is always unlocalized.
+#endif
+  output << value;
+  output.exceptions(std::ios_base::failbit | std::ios_base::badbit);
 }
 
+template <typename T> struct streamed_view {
+  const T& value;
+};
+
+}  // namespace detail
+
 // Formats an object of type T that has an overloaded ostream operator<<.
-template <typename T, typename Char>
-struct fallback_formatter<T, Char, enable_if_t<is_streamable<T, Char>::value>>
-    : formatter<basic_string_view<Char>, Char> {
-	template <typename Context>
-	auto format(const T& value, Context& ctx) ->
+template <typename Char>
+struct basic_ostream_formatter : formatter<basic_string_view<Char>, Char> {
+  void set_debug_format() = delete;
+
+  template <typename T, typename Context>
+  auto format(const T& value, Context& ctx) const -> decltype(ctx.out()) {
+    auto buffer = basic_memory_buffer<Char>();
+    detail::format_value(buffer, value);
+    return formatter<basic_string_view<Char>, Char>::format(
+        {buffer.data(), buffer.size()}, ctx);
+  }
+};
 
-	    decltype(ctx.
+using ostream_formatter = basic_ostream_formatter<char>;
 
-	             out()
+template <typename T, typename Char>
+struct formatter<detail::streamed_view<T>, Char>
+    : basic_ostream_formatter<Char> {
+  template <typename Context>
+  auto format(detail::streamed_view<T> view, Context& ctx) const
+      -> decltype(ctx.out()) {
+    return basic_ostream_formatter<Char>::format(view.value, ctx);
+  }
+};
 
-	    ) {
-		basic_memory_buffer<Char> buffer;
-		format_value(buffer, value,
-		             ctx.
+/**
+ * Returns a view that formats `value` via an ostream `operator<<`.
+ *
+ * **Example**:
+ *
+ *     fmt::print("Current thread id: {}\n",
+ *                fmt::streamed(std::this_thread::get_id()));
+ */
+template <typename T>
+constexpr auto streamed(const T& value) -> detail::streamed_view<T> {
+  return {value};
+}
 
-		             locale()
+namespace detail {
 
-		);
-		basic_string_view<Char> str(buffer.data(), buffer.size());
-		return formatter<basic_string_view<Char>, Char>::format(str, ctx);
-	}
-};
-} // namespace internal
+inline void vprint_directly(std::ostream& os, string_view format_str,
+                            format_args args) {
+  auto buffer = memory_buffer();
+  detail::vformat_to(buffer, format_str, args);
+  detail::write_buffer(os, buffer);
+}
 
-template <typename Char>
-void vprint(std::basic_ostream<Char>& os, basic_string_view<Char> format_str,
-            basic_format_args<buffer_context<Char>> args) {
-	basic_memory_buffer<Char> buffer;
-	internal::vformat_to(buffer, format_str, args);
-	internal::write(os, buffer);
+}  // namespace detail
+
+FMT_EXPORT template <typename Char>
+void vprint(std::basic_ostream<Char>& os,
+            basic_string_view<type_identity_t<Char>> format_str,
+            typename detail::vformat_args<Char>::type args) {
+  auto buffer = basic_memory_buffer<Char>();
+  detail::vformat_to(buffer, format_str, args);
+  if (detail::write_ostream_unicode(os, {buffer.data(), buffer.size()})) return;
+  detail::write_buffer(os, buffer);
 }
 
 /**
-  \rst
-  Prints formatted data to the stream *os*.
+ * Prints formatted data to the stream `os`.
+ *
+ * **Example**:
+ *
+ *     fmt::print(cerr, "Don't {}!", "panic");
+ */
+FMT_EXPORT template <typename... T>
+void print(std::ostream& os, format_string<T...> fmt, T&&... args) {
+  const auto& vargs = fmt::make_format_args(args...);
+  if (detail::use_utf8())
+    vprint(os, fmt, vargs);
+  else
+    detail::vprint_directly(os, fmt, vargs);
+}
 
-  **Example**::
+FMT_EXPORT
+template <typename... Args>
+void print(std::wostream& os,
+           basic_format_string<wchar_t, type_identity_t<Args>...> fmt,
+           Args&&... args) {
+  vprint(os, fmt, fmt::make_format_args<buffered_context<wchar_t>>(args...));
+}
 
-    fmt::print(cerr, "Don't {}!", "panic");
-  \endrst
- */
-template <typename S, typename... Args, typename Char = enable_if_t<internal::is_string<S>::value, char_t<S>>>
-void print(std::basic_ostream<Char>& os, const S& format_str, Args&&... args) {
-	vprint(os, to_string_view(format_str), {internal::make_args_checked<Args...>(format_str, args...)});
+FMT_EXPORT template <typename... T>
+void println(std::ostream& os, format_string<T...> fmt, T&&... args) {
+  fmt::print(os, "{}\n", fmt::format(fmt, std::forward<T>(args)...));
+}
+
+FMT_EXPORT
+template <typename... Args>
+void println(std::wostream& os,
+             basic_format_string<wchar_t, type_identity_t<Args>...> fmt,
+             Args&&... args) {
+  print(os, L"{}\n", fmt::format(fmt, std::forward<Args>(args)...));
 }
 
 FMT_END_NAMESPACE
 
-#endif // FMT_OSTREAM_H_
+#endif  // FMT_OSTREAM_H_
diff --git a/third_party/fmt/include/fmt/printf.h b/third_party/fmt/include/fmt/printf.h
index cbe4868c..072cc6b3 100644
--- a/third_party/fmt/include/fmt/printf.h
+++ b/third_party/fmt/include/fmt/printf.h
@@ -8,132 +8,149 @@
 #ifndef FMT_PRINTF_H_
 #define FMT_PRINTF_H_
 
-#include "fmt/ostream.h"
-#include <algorithm> // std::max
-#include <limits>    // std::numeric_limits
-
-#ifdef min
-#undef min
+#ifndef FMT_MODULE
+#  include <algorithm>  // std::max
+#  include <limits>     // std::numeric_limits
 #endif
 
+#include "format.h"
+
 FMT_BEGIN_NAMESPACE
-namespace internal {
+FMT_BEGIN_EXPORT
 
-// Checks if a value fits in int - used to avoid warnings about comparing
-// signed and unsigned integers.
-template <bool IsSigned>
-struct int_checker {
-	template <typename T>
-	static bool fits_in_int(T value) {
-		unsigned max = max_value<int>();
-		return value <= max;
-	}
-
-	static bool fits_in_int(bool) {
-		return true;
-	}
+template <typename T> struct printf_formatter {
+  printf_formatter() = delete;
 };
 
-template <>
-struct int_checker<true> {
-	template <typename T>
-	static bool fits_in_int(T value) {
-		return value >= std::numeric_limits<int>::min() && value <= max_value<int>();
-	}
+template <typename Char> class basic_printf_context {
+ private:
+  basic_appender<Char> out_;
+  basic_format_args<basic_printf_context> args_;
 
-	static bool fits_in_int(int) {
-		return true;
-	}
-};
+  static_assert(std::is_same<Char, char>::value ||
+                    std::is_same<Char, wchar_t>::value,
+                "Unsupported code unit type.");
 
-class printf_precision_handler {
-public:
-	template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
+ public:
+  using char_type = Char;
+  using parse_context_type = basic_format_parse_context<Char>;
+  template <typename T> using formatter_type = printf_formatter<T>;
 
-	int operator()(T value) {
-		// if (!int_checker<std::numeric_limits<T>::is_signed>::fits_in_int(value))
-		//  FMT_THROW(duckdb::InvalidInputException("number is too big"));
-		return (std::max)(static_cast<int>(value), 0);
-	}
+  /// Constructs a `printf_context` object. References to the arguments are
+  /// stored in the context object so make sure they have appropriate lifetimes.
+  basic_printf_context(basic_appender<Char> out,
+                       basic_format_args<basic_printf_context> args)
+      : out_(out), args_(args) {}
 
-	template <typename T, FMT_ENABLE_IF(!std::is_integral<T>::value)>
+  auto out() -> basic_appender<Char> { return out_; }
+  void advance_to(basic_appender<Char>) {}
 
-	int operator()(T) {
-		//  FMT_THROW(duckdb::InvalidInputException("precision is not integer"));
-		return 0;
-	}
+  auto locale() -> detail::locale_ref { return {}; }
+
+  auto arg(int id) const -> basic_format_arg<basic_printf_context> {
+    return args_.get(id);
+  }
 };
 
-// An argument visitor that returns true iff arg is a zero integer.
-class is_zero_int {
-public:
-	template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
+namespace detail {
 
-	bool operator()(T value) {
-		return value == 0;
-	}
+// Checks if a value fits in int - used to avoid warnings about comparing
+// signed and unsigned integers.
+template <bool IsSigned> struct int_checker {
+  template <typename T> static auto fits_in_int(T value) -> bool {
+    unsigned max = to_unsigned(max_value<int>());
+    return value <= max;
+  }
+  static auto fits_in_int(bool) -> bool { return true; }
+};
+
+template <> struct int_checker<true> {
+  template <typename T> static auto fits_in_int(T value) -> bool {
+    return value >= (std::numeric_limits<int>::min)() &&
+           value <= max_value<int>();
+  }
+  static auto fits_in_int(int) -> bool { return true; }
+};
 
-	template <typename T, FMT_ENABLE_IF(!std::is_integral<T>::value)>
+struct printf_precision_handler {
+  template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
+  auto operator()(T value) -> int {
+    if (!int_checker<std::numeric_limits<T>::is_signed>::fits_in_int(value))
+      report_error("number is too big");
+    return (std::max)(static_cast<int>(value), 0);
+  }
+
+  template <typename T, FMT_ENABLE_IF(!std::is_integral<T>::value)>
+  auto operator()(T) -> int {
+    report_error("precision is not integer");
+    return 0;
+  }
+};
 
-	bool operator()(T) {
-		return false;
-	}
+// An argument visitor that returns true iff arg is a zero integer.
+struct is_zero_int {
+  template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
+  auto operator()(T value) -> bool {
+    return value == 0;
+  }
+
+  template <typename T, FMT_ENABLE_IF(!std::is_integral<T>::value)>
+  auto operator()(T) -> bool {
+    return false;
+  }
 };
 
-template <typename T>
-struct make_unsigned_or_bool : std::make_unsigned<T> {};
+template <typename T> struct make_unsigned_or_bool : std::make_unsigned<T> {};
 
-template <>
-struct make_unsigned_or_bool<bool> {
-	using type = bool;
+template <> struct make_unsigned_or_bool<bool> {
+  using type = bool;
 };
 
-template <typename T, typename Context>
-class arg_converter {
-private:
-	using char_type = typename Context::char_type;
-
-	basic_format_arg<Context>& arg_;
-	char_type type_;
-
-public:
-	arg_converter(basic_format_arg<Context>& arg, char_type type) : arg_(arg), type_(type) {
-	}
-
-	void operator()(bool value) {
-		if (type_ != 's')
-			operator()<bool>(value);
-	}
-
-	template <typename U, FMT_ENABLE_IF(std::is_integral<U>::value)>
-
-	void operator()(U value) {
-		bool is_signed = type_ == 'd' || type_ == 'i';
-		using target_type = conditional_t<std::is_same<T, void>::value, U, T>;
-		if (const_check(sizeof(target_type) <= sizeof(int))) {
-			// Extra casts are used to silence warnings.
-			if (is_signed) {
-				arg_ = internal::make_arg<Context>(static_cast<int>(static_cast<target_type>(value)));
-			} else {
-				using unsigned_type = typename make_unsigned_or_bool<target_type>::type;
-				arg_ = internal::make_arg<Context>(static_cast<unsigned>(static_cast<unsigned_type>(value)));
-			}
-		} else {
-			if (is_signed) {
-				// glibc's printf doesn't sign extend arguments of smaller types:
-				//   std::printf("%lld", -42);  // prints "4294967254"
-				// but we don't have to do the same because it's a UB.
-				arg_ = internal::make_arg<Context>(static_cast<long long>(value));
-			} else {
-				arg_ = internal::make_arg<Context>(static_cast<typename make_unsigned_or_bool<U>::type>(value));
-			}
-		}
-	}
-
-	template <typename U, FMT_ENABLE_IF(!std::is_integral<U>::value)>
-
-	void operator()(U) {
-	} // No conversion needed for non-integral types.
+template <typename T, typename Context> class arg_converter {
+ private:
+  using char_type = typename Context::char_type;
+
+  basic_format_arg<Context>& arg_;
+  char_type type_;
+
+ public:
+  arg_converter(basic_format_arg<Context>& arg, char_type type)
+      : arg_(arg), type_(type) {}
+
+  void operator()(bool value) {
+    if (type_ != 's') operator()<bool>(value);
+  }
+
+  template <typename U, FMT_ENABLE_IF(std::is_integral<U>::value)>
+  void operator()(U value) {
+    bool is_signed = type_ == 'd' || type_ == 'i';
+    using target_type = conditional_t<std::is_same<T, void>::value, U, T>;
+    if (const_check(sizeof(target_type) <= sizeof(int))) {
+      // Extra casts are used to silence warnings.
+      if (is_signed) {
+        auto n = static_cast<int>(static_cast<target_type>(value));
+        arg_ = detail::make_arg<Context>(n);
+      } else {
+        using unsigned_type = typename make_unsigned_or_bool<target_type>::type;
+        auto n = static_cast<unsigned>(static_cast<unsigned_type>(value));
+        arg_ = detail::make_arg<Context>(n);
+      }
+    } else {
+      if (is_signed) {
+        // glibc's printf doesn't sign extend arguments of smaller types:
+        //   std::printf("%lld", -42);  // prints "4294967254"
+        // but we don't have to do the same because it's a UB.
+        auto n = static_cast<long long>(value);
+        arg_ = detail::make_arg<Context>(n);
+      } else {
+        auto n = static_cast<typename make_unsigned_or_bool<U>::type>(value);
+        arg_ = detail::make_arg<Context>(n);
+      }
+    }
+  }
+
+  template <typename U, FMT_ENABLE_IF(!std::is_integral<U>::value)>
+  void operator()(U) {}  // No conversion needed for non-integral types.
 };
 
 // Converts an integer argument to T for printf, if T is an integral type.
@@ -142,627 +159,498 @@ class arg_converter {
 // unsigned).
 template <typename T, typename Context, typename Char>
 void convert_arg(basic_format_arg<Context>& arg, Char type) {
-	visit_format_arg(arg_converter<T, Context>(arg, type), arg);
+  arg.visit(arg_converter<T, Context>(arg, type));
 }
 
 // Converts an integer argument to char for printf.
-template <typename Context>
-class char_converter {
-private:
-	basic_format_arg<Context>& arg_;
-
-public:
-	explicit char_converter(basic_format_arg<Context>& arg) : arg_(arg) {
-	}
+template <typename Context> class char_converter {
+ private:
+  basic_format_arg<Context>& arg_;
 
-	template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
+ public:
+  explicit char_converter(basic_format_arg<Context>& arg) : arg_(arg) {}
 
-	void operator()(T value) {
-		arg_ = internal::make_arg<Context>(static_cast<typename Context::char_type>(value));
-	}
+  template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
+  void operator()(T value) {
+    auto c = static_cast<typename Context::char_type>(value);
+    arg_ = detail::make_arg<Context>(c);
+  }
 
-	template <typename T, FMT_ENABLE_IF(!std::is_integral<T>::value)>
+  template <typename T, FMT_ENABLE_IF(!std::is_integral<T>::value)>
+  void operator()(T) {}  // No conversion needed for non-integral types.
+};
 
-	void operator()(T) {
-	} // No conversion needed for non-integral types.
+// An argument visitor that return a pointer to a C string if argument is a
+// string or null otherwise.
+template <typename Char> struct get_cstring {
+  template <typename T> auto operator()(T) -> const Char* { return nullptr; }
+  auto operator()(const Char* s) -> const Char* { return s; }
 };
 
 // Checks if an argument is a valid printf width specifier and sets
 // left alignment if it is negative.
-template <typename Char>
 class printf_width_handler {
-private:
-	using format_specs = basic_format_specs<Char>;
-
-	format_specs& specs_;
-
-public:
-	explicit printf_width_handler(format_specs& specs) : specs_(specs) {
-	}
-
-	template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
-
-	unsigned operator()(T value) {
-		auto width = static_cast<uint32_or_64_or_128_t<T>>(value);
-		if (internal::is_negative(value)) {
-			specs_.align = align::left;
-			width = 0 - width;
-		}
-		// unsigned int_max = max_value<int>();
-		// if (width > int_max) FMT_THROW(duckdb::InvalidInputException("number is too big"));
-		return static_cast<unsigned>(width);
-	}
-
-	template <typename T, FMT_ENABLE_IF(!std::is_integral<T>::value)>
-
-	unsigned operator()(T) {
-		// FMT_THROW(duckdb::InvalidInputException("width is not integer"));
-		return 0;
-	}
+ private:
+  format_specs& specs_;
+
+ public:
+  explicit printf_width_handler(format_specs& specs) : specs_(specs) {}
+
+  template <typename T, FMT_ENABLE_IF(std::is_integral<T>::value)>
+  auto operator()(T value) -> unsigned {
+    auto width = static_cast<uint32_or_64_or_128_t<T>>(value);
+    if (detail::is_negative(value)) {
+      specs_.align = align::left;
+      width = 0 - width;
+    }
+    unsigned int_max = to_unsigned(max_value<int>());
+    if (width > int_max) report_error("number is too big");
+    return static_cast<unsigned>(width);
+  }
+
+  template <typename T, FMT_ENABLE_IF(!std::is_integral<T>::value)>
+  auto operator()(T) -> unsigned {
+    report_error("width is not integer");
+    return 0;
+  }
 };
 
-template <typename Char, typename Context>
-void printf(buffer<Char>& buf, basic_string_view<Char> format, basic_format_args<Context> args) {
-	Context(std::back_inserter(buf), format, args).format();
-}
-
-template <typename OutputIt, typename Char, typename Context>
-internal::truncating_iterator<OutputIt> printf(internal::truncating_iterator<OutputIt> it,
-                                               basic_string_view<Char> format, basic_format_args<Context> args) {
-	return Context(it, format, args).format();
+// Workaround for a bug with the XL compiler when initializing
+// printf_arg_formatter's base class.
+template <typename Char>
+auto make_arg_formatter(basic_appender<Char> iter, format_specs& s)
+    -> arg_formatter<Char> {
+  return {iter, s, locale_ref()};
 }
-} // namespace internal
-
-using internal::printf; // For printing into memory_buffer.
-
-template <typename Range>
-class printf_arg_formatter;
-
-template <typename OutputIt, typename Char>
-class basic_printf_context;
-
-/**
-  \rst
-  The ``printf`` argument formatter.
-  \endrst
- */
-template <typename Range>
-class printf_arg_formatter : public internal::arg_formatter_base<Range> {
-public:
-	using iterator = typename Range::iterator;
-
-private:
-	using char_type = typename Range::value_type;
-	using base = internal::arg_formatter_base<Range>;
-	using context_type = basic_printf_context<iterator, char_type>;
-
-	context_type& context_;
-
-	void write_null_pointer(char) {
-		this->specs()->type = 0;
-		this->write("(nil)");
-	}
-
-	void write_null_pointer(wchar_t) {
-		this->specs()->type = 0;
-		this->write(L"(nil)");
-	}
-
-public:
-	using format_specs = typename base::format_specs;
-
-	/**
-	  \rst
-	  Constructs an argument formatter object.
-	  *buffer* is a reference to the output buffer and *specs* contains format
-	  specifier information for standard argument types.
-	  \endrst
-	 */
-	printf_arg_formatter(iterator iter, format_specs& specs, context_type& ctx)
-	    : base(Range(iter), &specs, internal::locale_ref()), context_(ctx) {
-	}
-
-	template <typename T, FMT_ENABLE_IF(nautilus_fmt::internal::is_integral<T>::value)>
-
-	iterator operator()(T value) {
-		// MSVC2013 fails to compile separate overloads for bool and char_type so
-		// use std::is_same instead.
-		if (std::is_same<T, bool>::value) {
-			format_specs& fmt_specs = *this->specs();
-			if (fmt_specs.type != 's')
-				return base::operator()(value ? 1 : 0);
-			fmt_specs.type = 0;
-			this->write(value != 0);
-		} else if (std::is_same<T, char_type>::value) {
-			format_specs& fmt_specs = *this->specs();
-			if (fmt_specs.type && fmt_specs.type != 'c')
-				return (*this)(static_cast<int>(value));
-			fmt_specs.sign = sign::none;
-			fmt_specs.alt = false;
-			fmt_specs.align = align::right;
-			return base::operator()(value);
-		} else {
-			return base::operator()(value);
-		}
-		return this->out();
-	}
-
-	template <typename T, FMT_ENABLE_IF(std::is_floating_point<T>::value)>
-
-	iterator operator()(T value) {
-		return base::operator()(value);
-	}
-
-	/** Formats a null-terminated C string. */
-	iterator operator()(const char* value) {
-		if (value)
-			base::operator()(value);
-		else if (this->specs()->type == 'p')
-			write_null_pointer(char_type());
-		else
-			this->write("(null)");
-		return this->out();
-	}
-
-	/** Formats a null-terminated wide C string. */
-	iterator operator()(const wchar_t* value) {
-		if (value)
-			base::operator()(value);
-		else if (this->specs()->type == 'p')
-			write_null_pointer(char_type());
-		else
-			this->write(L"(null)");
-		return this->out();
-	}
-
-	iterator operator()(basic_string_view<char_type> value) {
-		return base::operator()(value);
-	}
-
-	iterator operator()(monostate value) {
-		return base::operator()(value);
-	}
-
-	/** Formats a pointer. */
-	iterator operator()(const void* value) {
-		if (value)
-			return base::operator()(value);
-		this->specs()->type = 0;
-		write_null_pointer(char_type());
-		return this->out();
-	}
-
-	/** Formats an argument of a custom (user-defined) type. */
-	iterator operator()(typename basic_format_arg<context_type>::handle handle) {
-		handle.format(context_.parse_context(), context_);
-		return this->out();
-	}
-};
-
-template <typename T>
-struct printf_formatter {
-	template <typename ParseContext>
-	auto parse(ParseContext& ctx) ->
-
-	    decltype(ctx.
-
-	             begin()
-
-	    ) {
-		return ctx.begin();
-	}
-
-	template <typename FormatContext>
-	auto format(const T& value, FormatContext& ctx) ->
 
-	    decltype(ctx.
-
-	             out()
-
-	    ) {
-		internal::format_value(internal::get_container(ctx.out()), value);
-		return ctx.out();
-	}
-};
-
-/** This template formats data and writes the output to a writer. */
-template <typename OutputIt, typename Char>
-class basic_printf_context {
-public:
-	/** The character type for the output. */
-	using char_type = Char;
-	using format_arg = basic_format_arg<basic_printf_context>;
-	template <typename T>
-	using formatter_type = printf_formatter<T>;
-
-private:
-	using format_specs = basic_format_specs<char_type>;
-
-	OutputIt out_;
-	basic_format_args<basic_printf_context> args_;
-	basic_format_parse_context<Char> parse_ctx_;
-
-	static void parse_flags(format_specs& specs, const Char*& it, const Char* end);
-
-	// Returns the argument with specified index or, if arg_index is -1, the next
-	// argument.
-	format_arg get_arg(int arg_index = -1);
-
-	// Parses argument index, flags and width and returns the argument index.
-	int parse_header(const Char*& it, const Char* end, format_specs& specs);
-
-public:
-	/**
-	 \rst
-	 Constructs a ``printf_context`` object. References to the arguments and
-	 the writer are stored in the context object so make sure they have
-	 appropriate lifetimes.
-	 \endrst
-	 */
-	basic_printf_context(OutputIt out, basic_string_view<char_type> format_str,
-	                     basic_format_args<basic_printf_context> args)
-	    : out_(out), args_(args), parse_ctx_(format_str) {
-	}
-
-	OutputIt out() {
-		return out_;
-	}
-
-	void advance_to(OutputIt it) {
-		out_ = it;
-	}
-
-	format_arg arg(int id) const {
-		return args_.get(id);
-	}
-
-	basic_format_parse_context<Char>& parse_context() {
-		return parse_ctx_;
-	}
-
-	FMT_CONSTEXPR void on_error(std::string message) {
-		parse_ctx_.on_error(message);
-	}
-
-	/** Formats stored arguments and writes the output to the range. */
-	template <typename ArgFormatter = printf_arg_formatter<buffer_range<Char>>>
-
-	OutputIt format();
+// The `printf` argument formatter.
+template <typename Char>
+class printf_arg_formatter : public arg_formatter<Char> {
+ private:
+  using base = arg_formatter<Char>;
+  using context_type = basic_printf_context<Char>;
+
+  context_type& context_;
+
+  void write_null_pointer(bool is_string = false) {
+    auto s = this->specs;
+    s.type = presentation_type::none;
+    write_bytes<Char>(this->out, is_string ? "(null)" : "(nil)", s);
+  }
+
+ public:
+  printf_arg_formatter(basic_appender<Char> iter, format_specs& s,
+                       context_type& ctx)
+      : base(make_arg_formatter(iter, s)), context_(ctx) {}
+
+  void operator()(monostate value) { base::operator()(value); }
+
+  template <typename T, FMT_ENABLE_IF(detail::is_integral<T>::value)>
+  void operator()(T value) {
+    // MSVC2013 fails to compile separate overloads for bool and Char so use
+    // std::is_same instead.
+    if (!std::is_same<T, Char>::value) {
+      base::operator()(value);
+      return;
+    }
+    format_specs s = this->specs;
+    if (s.type != presentation_type::none && s.type != presentation_type::chr) {
+      return (*this)(static_cast<int>(value));
+    }
+    s.sign = sign::none;
+    s.alt = false;
+    s.fill = ' ';  // Ignore '0' flag for char types.
+    // align::numeric needs to be overwritten here since the '0' flag is
+    // ignored for non-numeric types
+    if (s.align == align::none || s.align == align::numeric)
+      s.align = align::right;
+    write<Char>(this->out, static_cast<Char>(value), s);
+  }
+
+  template <typename T, FMT_ENABLE_IF(std::is_floating_point<T>::value)>
+  void operator()(T value) {
+    base::operator()(value);
+  }
+
+  void operator()(const char* value) {
+    if (value)
+      base::operator()(value);
+    else
+      write_null_pointer(this->specs.type != presentation_type::pointer);
+  }
+
+  void operator()(const wchar_t* value) {
+    if (value)
+      base::operator()(value);
+    else
+      write_null_pointer(this->specs.type != presentation_type::pointer);
+  }
+
+  void operator()(basic_string_view<Char> value) { base::operator()(value); }
+
+  void operator()(const void* value) {
+    if (value)
+      base::operator()(value);
+    else
+      write_null_pointer();
+  }
+
+  void operator()(typename basic_format_arg<context_type>::handle handle) {
+    auto parse_ctx = basic_format_parse_context<Char>({});
+    handle.format(parse_ctx, context_);
+  }
 };
 
-template <typename OutputIt, typename Char>
-void basic_printf_context<OutputIt, Char>::parse_flags(format_specs& specs, const Char*& it, const Char* end) {
-	for (; it != end; ++it) {
-		switch (*it) {
-		case '-':
-			specs.align = align::left;
-			break;
-		case '+':
-			specs.sign = sign::plus;
-			break;
-		case '0':
-			specs.fill[0] = '0';
-			break;
-		case ' ':
-			specs.sign = sign::space;
-			break;
-		case '#':
-			specs.alt = true;
-			break;
-		case ',':
-			specs.thousands = ',';
-			break;
-		case '\'':
-			specs.thousands = '\'';
-			break;
-		case '_':
-			specs.thousands = '_';
-			break;
-		default:
-			return;
-		}
-	}
+template <typename Char>
+void parse_flags(format_specs& specs, const Char*& it, const Char* end) {
+  for (; it != end; ++it) {
+    switch (*it) {
+    case '-':
+      specs.align = align::left;
+      break;
+    case '+':
+      specs.sign = sign::plus;
+      break;
+    case '0':
+      specs.fill = '0';
+      break;
+    case ' ':
+      if (specs.sign != sign::plus) specs.sign = sign::space;
+      break;
+    case '#':
+      specs.alt = true;
+      break;
+    default:
+      return;
+    }
+  }
 }
 
-template <typename OutputIt, typename Char>
-typename basic_printf_context<OutputIt, Char>::format_arg basic_printf_context<OutputIt, Char>::get_arg(int arg_index) {
-	if (arg_index < 0)
-		arg_index = parse_ctx_.next_arg_id();
-	else
-		parse_ctx_.check_arg_id(--arg_index);
-	return internal::get_arg(*this, arg_index);
+template <typename Char, typename GetArg>
+auto parse_header(const Char*& it, const Char* end, format_specs& specs,
+                  GetArg get_arg) -> int {
+  int arg_index = -1;
+  Char c = *it;
+  if (c >= '0' && c <= '9') {
+    // Parse an argument index (if followed by '$') or a width possibly
+    // preceded with '0' flag(s).
+    int value = parse_nonnegative_int(it, end, -1);
+    if (it != end && *it == '$') {  // value is an argument index
+      ++it;
+      arg_index = value != -1 ? value : max_value<int>();
+    } else {
+      if (c == '0') specs.fill = '0';
+      if (value != 0) {
+        // Nonzero value means that we parsed width and don't need to
+        // parse it or flags again, so return now.
+        if (value == -1) report_error("number is too big");
+        specs.width = value;
+        return arg_index;
+      }
+    }
+  }
+  parse_flags(specs, it, end);
+  // Parse width.
+  if (it != end) {
+    if (*it >= '0' && *it <= '9') {
+      specs.width = parse_nonnegative_int(it, end, -1);
+      if (specs.width == -1) report_error("number is too big");
+    } else if (*it == '*') {
+      ++it;
+      specs.width = static_cast<int>(
+          get_arg(-1).visit(detail::printf_width_handler(specs)));
+    }
+  }
+  return arg_index;
 }
 
-template <typename OutputIt, typename Char>
-int basic_printf_context<OutputIt, Char>::parse_header(const Char*& it, const Char* end, format_specs& specs) {
-	int arg_index = -1;
-	char_type c = *it;
-	if (c >= '0' && c <= '9') {
-		// Parse an argument index (if followed by '$') or a width possibly
-		// preceded with '0' flag(s).
-		internal::error_handler eh;
-		int value = parse_nonnegative_int(it, end, eh);
-		if (it != end && *it == '$') { // value is an argument index
-			++it;
-			arg_index = value;
-		} else {
-			if (c == '0')
-				specs.fill[0] = '0';
-			if (value != 0) {
-				// Nonzero value means that we parsed width and don't need to
-				// parse it or flags again, so return now.
-				specs.width = value;
-				return arg_index;
-			}
-		}
-	}
-	parse_flags(specs, it, end);
-	// Parse width.
-	if (it != end) {
-		if (*it >= '0' && *it <= '9') {
-			internal::error_handler eh;
-			specs.width = parse_nonnegative_int(it, end, eh);
-		} else if (*it == '*') {
-			++it;
-			specs.width =
-			    static_cast<int>(visit_format_arg(internal::printf_width_handler<char_type>(specs), get_arg()));
-		}
-	}
-	return arg_index;
+inline auto parse_printf_presentation_type(char c, type t, bool& upper)
+    -> presentation_type {
+  using pt = presentation_type;
+  constexpr auto integral_set = sint_set | uint_set | bool_set | char_set;
+  switch (c) {
+  case 'd':
+    return in(t, integral_set) ? pt::dec : pt::none;
+  case 'o':
+    return in(t, integral_set) ? pt::oct : pt::none;
+  case 'X':
+    upper = true;
+    FMT_FALLTHROUGH;
+  case 'x':
+    return in(t, integral_set) ? pt::hex : pt::none;
+  case 'E':
+    upper = true;
+    FMT_FALLTHROUGH;
+  case 'e':
+    return in(t, float_set) ? pt::exp : pt::none;
+  case 'F':
+    upper = true;
+    FMT_FALLTHROUGH;
+  case 'f':
+    return in(t, float_set) ? pt::fixed : pt::none;
+  case 'G':
+    upper = true;
+    FMT_FALLTHROUGH;
+  case 'g':
+    return in(t, float_set) ? pt::general : pt::none;
+  case 'A':
+    upper = true;
+    FMT_FALLTHROUGH;
+  case 'a':
+    return in(t, float_set) ? pt::hexfloat : pt::none;
+  case 'c':
+    return in(t, integral_set) ? pt::chr : pt::none;
+  case 's':
+    return in(t, string_set | cstring_set) ? pt::string : pt::none;
+  case 'p':
+    return in(t, pointer_set | cstring_set) ? pt::pointer : pt::none;
+  default:
+    return pt::none;
+  }
 }
 
-template <typename OutputIt, typename Char>
-template <typename ArgFormatter>
-OutputIt basic_printf_context<OutputIt, Char>::format() {
-	auto out = this->out();
-	const Char* start = parse_ctx_.begin();
-	const Char* end = parse_ctx_.end();
-	auto it = start;
-	while (it != end) {
-		char_type c = *it++;
-		if (c != '%')
-			continue;
-		if (it != end && *it == c) {
-			out = std::copy(start, it, out);
-			start = ++it;
-			continue;
-		}
-		out = std::copy(start, it - 1, out);
-
-		format_specs specs;
-		specs.align = align::right;
-
-		// Parse argument index, flags and width.
-		int arg_index = parse_header(it, end, specs);
-		if (arg_index == 0)
-			on_error("argument index out of range");
-
-		// Parse precision.
-		bool empty_precision = false;
-		if (it != end && *it == '.') {
-			++it;
-			c = it != end ? *it : 0;
-			if ('0' <= c && c <= '9') {
-				internal::error_handler eh;
-				specs.precision = parse_nonnegative_int(it, end, eh);
-			} else if (c == '*') {
-				++it;
-				specs.precision = static_cast<int>(visit_format_arg(internal::printf_precision_handler(), get_arg()));
-			} else {
-				specs.precision = 0;
-				empty_precision = true;
-			}
-		}
-
-		format_arg arg = get_arg(arg_index);
-		if (specs.alt && visit_format_arg(internal::is_zero_int(), arg))
-			specs.alt = false;
-		if (specs.fill[0] == '0') {
-			if (arg.is_arithmetic())
-				specs.align = align::numeric;
-			else
-				specs.fill[0] = ' '; // Ignore '0' flag for non-numeric types.
-		}
-
-		// Parse length and convert the argument to the required type.
-		c = it != end ? *it++ : 0;
-		char_type t = it != end ? *it : 0;
-		using internal::convert_arg;
-		switch (c) {
-		case 'h':
-			if (t == 'h') {
-				++it;
-				t = it != end ? *it : 0;
-				convert_arg<signed char>(arg, t);
-			} else {
-				convert_arg<short>(arg, t);
-			}
-			break;
-		case 'l':
-			if (t == 'l') {
-				++it;
-				t = it != end ? *it : 0;
-				convert_arg<long long>(arg, t);
-			} else {
-				convert_arg<long>(arg, t);
-			}
-			break;
-		case 'j':
-			convert_arg<intmax_t>(arg, t);
-			break;
-		case 'z':
-			convert_arg<std::size_t>(arg, t);
-			break;
-		case 't':
-			convert_arg<std::ptrdiff_t>(arg, t);
-			break;
-		case 'L':
-			// printf produces garbage when 'L' is omitted for long double, no
-			// need to do the same.
-			break;
-		default:
-			--it;
-			convert_arg<void>(arg, c);
-		}
-
-		// Parse type.
-		// if (it == end)
-		// FMT_THROW(duckdb::InvalidInputException("invalid format string"));
-		specs.type = static_cast<char>(*it++);
-		if (arg.is_integral()) {
-			// Normalize type.
-			switch (specs.type) {
-			case 'i':
-			case 'u':
-				specs.type = 'd';
-				break;
-			case 'c':
-				visit_format_arg(internal::char_converter<basic_printf_context>(arg), arg);
-				break;
-			}
-		}
-		if (specs.type == 'd' && empty_precision) {
-			specs.thousands = '.';
-		}
-
-		start = it;
-
-		// Format argument.
-		visit_format_arg(ArgFormatter(out, specs, *this), arg);
-	}
-	return std::copy(start, it, out);
+template <typename Char, typename Context>
+void vprintf(buffer<Char>& buf, basic_string_view<Char> format,
+             basic_format_args<Context> args) {
+  using iterator = basic_appender<Char>;
+  auto out = iterator(buf);
+  auto context = basic_printf_context<Char>(out, args);
+  auto parse_ctx = basic_format_parse_context<Char>(format);
+
+  // Returns the argument with specified index or, if arg_index is -1, the next
+  // argument.
+  auto get_arg = [&](int arg_index) {
+    if (arg_index < 0)
+      arg_index = parse_ctx.next_arg_id();
+    else
+      parse_ctx.check_arg_id(--arg_index);
+    return detail::get_arg(context, arg_index);
+  };
+
+  const Char* start = parse_ctx.begin();
+  const Char* end = parse_ctx.end();
+  auto it = start;
+  while (it != end) {
+    if (!find<false, Char>(it, end, '%', it)) {
+      it = end;  // find leaves it == nullptr if it doesn't find '%'.
+      break;
+    }
+    Char c = *it++;
+    if (it != end && *it == c) {
+      write(out, basic_string_view<Char>(start, to_unsigned(it - start)));
+      start = ++it;
+      continue;
+    }
+    write(out, basic_string_view<Char>(start, to_unsigned(it - 1 - start)));
+
+    auto specs = format_specs();
+    specs.align = align::right;
+
+    // Parse argument index, flags and width.
+    int arg_index = parse_header(it, end, specs, get_arg);
+    if (arg_index == 0) report_error("argument not found");
+
+    // Parse precision.
+    if (it != end && *it == '.') {
+      ++it;
+      c = it != end ? *it : 0;
+      if ('0' <= c && c <= '9') {
+        specs.precision = parse_nonnegative_int(it, end, 0);
+      } else if (c == '*') {
+        ++it;
+        specs.precision =
+            static_cast<int>(get_arg(-1).visit(printf_precision_handler()));
+      } else {
+        specs.precision = 0;
+      }
+    }
+
+    auto arg = get_arg(arg_index);
+    // For d, i, o, u, x, and X conversion specifiers, if a precision is
+    // specified, the '0' flag is ignored
+    if (specs.precision >= 0 && arg.is_integral()) {
+      // Ignore '0' for non-numeric types or if '-' present.
+      specs.fill = ' ';
+    }
+    if (specs.precision >= 0 && arg.type() == type::cstring_type) {
+      auto str = arg.visit(get_cstring<Char>());
+      auto str_end = str + specs.precision;
+      auto nul = std::find(str, str_end, Char());
+      auto sv = basic_string_view<Char>(
+          str, to_unsigned(nul != str_end ? nul - str : specs.precision));
+      arg = make_arg<basic_printf_context<Char>>(sv);
+    }
+    if (specs.alt && arg.visit(is_zero_int())) specs.alt = false;
+    if (specs.fill.template get<Char>() == '0') {
+      if (arg.is_arithmetic() && specs.align != align::left)
+        specs.align = align::numeric;
+      else
+        specs.fill = ' ';  // Ignore '0' flag for non-numeric types or if '-'
+                           // flag is also present.
+    }
+
+    // Parse length and convert the argument to the required type.
+    c = it != end ? *it++ : 0;
+    Char t = it != end ? *it : 0;
+    switch (c) {
+    case 'h':
+      if (t == 'h') {
+        ++it;
+        t = it != end ? *it : 0;
+        convert_arg<signed char>(arg, t);
+      } else {
+        convert_arg<short>(arg, t);
+      }
+      break;
+    case 'l':
+      if (t == 'l') {
+        ++it;
+        t = it != end ? *it : 0;
+        convert_arg<long long>(arg, t);
+      } else {
+        convert_arg<long>(arg, t);
+      }
+      break;
+    case 'j':
+      convert_arg<intmax_t>(arg, t);
+      break;
+    case 'z':
+      convert_arg<size_t>(arg, t);
+      break;
+    case 't':
+      convert_arg<std::ptrdiff_t>(arg, t);
+      break;
+    case 'L':
+      // printf produces garbage when 'L' is omitted for long double, no
+      // need to do the same.
+      break;
+    default:
+      --it;
+      convert_arg<void>(arg, c);
+    }
+
+    // Parse type.
+    if (it == end) report_error("invalid format string");
+    char type = static_cast<char>(*it++);
+    if (arg.is_integral()) {
+      // Normalize type.
+      switch (type) {
+      case 'i':
+      case 'u':
+        type = 'd';
+        break;
+      case 'c':
+        arg.visit(char_converter<basic_printf_context<Char>>(arg));
+        break;
+      }
+    }
+    bool upper = false;
+    specs.type = parse_printf_presentation_type(type, arg.type(), upper);
+    if (specs.type == presentation_type::none)
+      report_error("invalid format specifier");
+    specs.upper = upper;
+
+    start = it;
+
+    // Format argument.
+    arg.visit(printf_arg_formatter<Char>(out, specs, context));
+  }
+  write(out, basic_string_view<Char>(start, to_unsigned(it - start)));
 }
+}  // namespace detail
 
-template <typename Char>
-using basic_printf_context_t = basic_printf_context<std::back_insert_iterator<internal::buffer<Char>>, Char>;
-
-using printf_context = basic_printf_context_t<char>;
-using wprintf_context = basic_printf_context_t<wchar_t>;
+using printf_context = basic_printf_context<char>;
+using wprintf_context = basic_printf_context<wchar_t>;
 
 using printf_args = basic_format_args<printf_context>;
 using wprintf_args = basic_format_args<wprintf_context>;
 
-/**
-  \rst
-  Constructs an `~fmt::format_arg_store` object that contains references to
-  arguments and can be implicitly converted to `~fmt::printf_args`.
-  \endrst
- */
-template <typename... Args>
-inline format_arg_store<printf_context, Args...> make_printf_args(const Args&... args) {
-	return {args...};
-}
-
-/**
-  \rst
-  Constructs an `~fmt::format_arg_store` object that contains references to
-  arguments and can be implicitly converted to `~fmt::wprintf_args`.
-  \endrst
- */
-template <typename... Args>
-inline format_arg_store<wprintf_context, Args...> make_wprintf_args(const Args&... args) {
-	return {args...};
-}
-
-template <typename S, typename Char = char_t<S>>
-inline std::basic_string<Char> vsprintf(const S& format, basic_format_args<basic_printf_context_t<Char>> args) {
-	basic_memory_buffer<Char> buffer;
-	printf(buffer, to_string_view(format), args);
-	return to_string(buffer);
+/// Constructs an `format_arg_store` object that contains references to
+/// arguments and can be implicitly converted to `printf_args`.
+template <typename Char = char, typename... T>
+inline auto make_printf_args(T&... args)
+    -> decltype(fmt::make_format_args<basic_printf_context<Char>>(args...)) {
+  return fmt::make_format_args<basic_printf_context<Char>>(args...);
 }
 
-/**
-  \rst
-  Formats arguments and returns the result as a string.
-
-  **Example**::
-
-    std::string message = fmt::sprintf("The answer is %d", 42);
-  \endrst
-*/
-template <typename S, typename... Args, typename Char = enable_if_t<internal::is_string<S>::value, char_t<S>>>
-inline std::basic_string<Char> sprintf(const S& format, const Args&... args) {
-	using context = basic_printf_context_t<Char>;
-	return vsprintf(to_string_view(format), {make_format_args<context>(args...)});
-}
+template <typename Char> struct vprintf_args {
+  using type = basic_format_args<basic_printf_context<Char>>;
+};
 
-template <typename S, typename Char = char_t<S>>
-inline int vfprintf(std::FILE* f, const S& format, basic_format_args<basic_printf_context_t<Char>> args) {
-	basic_memory_buffer<Char> buffer;
-	printf(buffer, to_string_view(format), args);
-	std::size_t size = buffer.size();
-	return std::fwrite(buffer.data(), sizeof(Char), size, f) < size ? -1 : static_cast<int>(size);
+template <typename Char>
+inline auto vsprintf(basic_string_view<Char> fmt,
+                     typename vprintf_args<Char>::type args)
+    -> std::basic_string<Char> {
+  auto buf = basic_memory_buffer<Char>();
+  detail::vprintf(buf, fmt, args);
+  return to_string(buf);
 }
 
 /**
-  \rst
-  Prints formatted data to the file *f*.
-
-  **Example**::
-
-    fmt::fprintf(stderr, "Don't %s!", "panic");
-  \endrst
+ * Formats `args` according to specifications in `fmt` and returns the result
+ * as as string.
+ *
+ * **Example**:
+ *
+ *     std::string message = fmt::sprintf("The answer is %d", 42);
  */
-template <typename S, typename... Args, typename Char = enable_if_t<internal::is_string<S>::value, char_t<S>>>
-inline int fprintf(std::FILE* f, const S& format, const Args&... args) {
-	using context = basic_printf_context_t<Char>;
-	return vfprintf(f, to_string_view(format), {make_format_args<context>(args...)});
+template <typename S, typename... T, typename Char = char_t<S>>
+inline auto sprintf(const S& fmt, const T&... args) -> std::basic_string<Char> {
+  return vsprintf(detail::to_string_view(fmt),
+                  fmt::make_format_args<basic_printf_context<Char>>(args...));
 }
 
-template <typename S, typename Char = char_t<S>>
-inline int vprintf(const S& format, basic_format_args<basic_printf_context_t<Char>> args) {
-	return vfprintf(stdout, to_string_view(format), args);
+template <typename Char>
+inline auto vfprintf(std::FILE* f, basic_string_view<Char> fmt,
+                     typename vprintf_args<Char>::type args) -> int {
+  auto buf = basic_memory_buffer<Char>();
+  detail::vprintf(buf, fmt, args);
+  size_t size = buf.size();
+  return std::fwrite(buf.data(), sizeof(Char), size, f) < size
+             ? -1
+             : static_cast<int>(size);
 }
 
 /**
-  \rst
-  Prints formatted data to ``stdout``.
-
-  **Example**::
-
-    fmt::printf("Elapsed time: %.2f seconds", 1.23);
-  \endrst
+ * Formats `args` according to specifications in `fmt` and writes the output
+ * to `f`.
+ *
+ * **Example**:
+ *
+ *     fmt::fprintf(stderr, "Don't %s!", "panic");
  */
-template <typename S, typename... Args, FMT_ENABLE_IF(internal::is_string<S>::value)>
-inline int printf(const S& format_str, const Args&... args) {
-	using context = basic_printf_context_t<char_t<S>>;
-	return vprintf(to_string_view(format_str), {make_format_args<context>(args...)});
-}
-
-template <typename S, typename Char = char_t<S>>
-inline int vfprintf(std::basic_ostream<Char>& os, const S& format,
-                    basic_format_args<basic_printf_context_t<Char>> args) {
-	basic_memory_buffer<Char> buffer;
-	printf(buffer, to_string_view(format), args);
-	internal::write(os, buffer);
-	return static_cast<int>(buffer.size());
+template <typename S, typename... T, typename Char = char_t<S>>
+inline auto fprintf(std::FILE* f, const S& fmt, const T&... args) -> int {
+  return vfprintf(f, detail::to_string_view(fmt),
+                  make_printf_args<Char>(args...));
 }
 
-/** Formats arguments and writes the output to the range. */
-template <typename ArgFormatter, typename Char,
-          typename Context = basic_printf_context<typename ArgFormatter::iterator, Char>>
-typename ArgFormatter::iterator vprintf(internal::buffer<Char>& out, basic_string_view<Char> format_str,
-                                        basic_format_args<Context> args) {
-	typename ArgFormatter::iterator iter(out);
-	Context(iter, format_str, args).template format<ArgFormatter>();
-	return iter;
+template <typename Char>
+FMT_DEPRECATED inline auto vprintf(basic_string_view<Char> fmt,
+                                   typename vprintf_args<Char>::type args)
+    -> int {
+  return vfprintf(stdout, fmt, args);
 }
 
 /**
-  \rst
-  Prints formatted data to the stream *os*.
-
-  **Example**::
-
-    fmt::fprintf(cerr, "Don't %s!", "panic");
-  \endrst
+ * Formats `args` according to specifications in `fmt` and writes the output
+ * to `stdout`.
+ *
+ * **Example**:
+ *
+ *   fmt::printf("Elapsed time: %.2f seconds", 1.23);
  */
-template <typename S, typename... Args, typename Char = char_t<S>>
-inline int fprintf(std::basic_ostream<Char>& os, const S& format_str, const Args&... args) {
-	using context = basic_printf_context_t<Char>;
-	return vfprintf(os, to_string_view(format_str), {make_format_args<context>(args...)});
+template <typename... T>
+inline auto printf(string_view fmt, const T&... args) -> int {
+  return vfprintf(stdout, fmt, make_printf_args(args...));
+}
+template <typename... T>
+FMT_DEPRECATED inline auto printf(basic_string_view<wchar_t> fmt,
+                                  const T&... args) -> int {
+  return vfprintf(stdout, fmt, make_printf_args<wchar_t>(args...));
 }
 
+FMT_END_EXPORT
 FMT_END_NAMESPACE
 
-#endif // FMT_PRINTF_H_
+#endif  // FMT_PRINTF_H_
diff --git a/third_party/fmt/include/fmt/ranges.h b/third_party/fmt/include/fmt/ranges.h
new file mode 100644
index 00000000..0d3dfbd8
--- /dev/null
+++ b/third_party/fmt/include/fmt/ranges.h
@@ -0,0 +1,882 @@
+// Formatting library for C++ - range and tuple support
+//
+// Copyright (c) 2012 - present, Victor Zverovich and {fmt} contributors
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_RANGES_H_
+#define FMT_RANGES_H_
+
+#ifndef FMT_MODULE
+#  include <initializer_list>
+#  include <iterator>
+#  include <string>
+#  include <tuple>
+#  include <type_traits>
+#  include <utility>
+#endif
+
+#include "format.h"
+
+FMT_BEGIN_NAMESPACE
+
+FMT_EXPORT
+enum class range_format { disabled, map, set, sequence, string, debug_string };
+
+namespace detail {
+
+template <typename T> class is_map {
+  template <typename U> static auto check(U*) -> typename U::mapped_type;
+  template <typename> static void check(...);
+
+ public:
+  static constexpr const bool value =
+      !std::is_void<decltype(check<T>(nullptr))>::value;
+};
+
+template <typename T> class is_set {
+  template <typename U> static auto check(U*) -> typename U::key_type;
+  template <typename> static void check(...);
+
+ public:
+  static constexpr const bool value =
+      !std::is_void<decltype(check<T>(nullptr))>::value && !is_map<T>::value;
+};
+
+template <typename... Ts> struct conditional_helper {};
+
+template <typename T, typename _ = void> struct is_range_ : std::false_type {};
+
+#if !FMT_MSC_VERSION || FMT_MSC_VERSION > 1800
+
+#  define FMT_DECLTYPE_RETURN(val)  \
+    ->decltype(val) { return val; } \
+    static_assert(                  \
+        true, "")  // This makes it so that a semicolon is required after the
+                   // macro, which helps clang-format handle the formatting.
+
+// C array overload
+template <typename T, std::size_t N>
+auto range_begin(const T (&arr)[N]) -> const T* {
+  return arr;
+}
+template <typename T, std::size_t N>
+auto range_end(const T (&arr)[N]) -> const T* {
+  return arr + N;
+}
+
+template <typename T, typename Enable = void>
+struct has_member_fn_begin_end_t : std::false_type {};
+
+template <typename T>
+struct has_member_fn_begin_end_t<T, void_t<decltype(*std::declval<T>().begin()),
+                                           decltype(std::declval<T>().end())>>
+    : std::true_type {};
+
+// Member function overloads.
+template <typename T>
+auto range_begin(T&& rng) FMT_DECLTYPE_RETURN(static_cast<T&&>(rng).begin());
+template <typename T>
+auto range_end(T&& rng) FMT_DECLTYPE_RETURN(static_cast<T&&>(rng).end());
+
+// ADL overloads. Only participate in overload resolution if member functions
+// are not found.
+template <typename T>
+auto range_begin(T&& rng)
+    -> enable_if_t<!has_member_fn_begin_end_t<T&&>::value,
+                   decltype(begin(static_cast<T&&>(rng)))> {
+  return begin(static_cast<T&&>(rng));
+}
+template <typename T>
+auto range_end(T&& rng) -> enable_if_t<!has_member_fn_begin_end_t<T&&>::value,
+                                       decltype(end(static_cast<T&&>(rng)))> {
+  return end(static_cast<T&&>(rng));
+}
+
+template <typename T, typename Enable = void>
+struct has_const_begin_end : std::false_type {};
+template <typename T, typename Enable = void>
+struct has_mutable_begin_end : std::false_type {};
+
+template <typename T>
+struct has_const_begin_end<
+    T, void_t<decltype(*detail::range_begin(
+                  std::declval<const remove_cvref_t<T>&>())),
+              decltype(detail::range_end(
+                  std::declval<const remove_cvref_t<T>&>()))>>
+    : std::true_type {};
+
+template <typename T>
+struct has_mutable_begin_end<
+    T, void_t<decltype(*detail::range_begin(std::declval<T&>())),
+              decltype(detail::range_end(std::declval<T&>())),
+              // the extra int here is because older versions of MSVC don't
+              // SFINAE properly unless there are distinct types
+              int>> : std::true_type {};
+
+template <typename T>
+struct is_range_<T, void>
+    : std::integral_constant<bool, (has_const_begin_end<T>::value ||
+                                    has_mutable_begin_end<T>::value)> {};
+#  undef FMT_DECLTYPE_RETURN
+#endif
+
+// tuple_size and tuple_element check.
+template <typename T> class is_tuple_like_ {
+  template <typename U>
+  static auto check(U* p) -> decltype(std::tuple_size<U>::value, int());
+  template <typename> static void check(...);
+
+ public:
+  static constexpr const bool value =
+      !std::is_void<decltype(check<T>(nullptr))>::value;
+};
+
+// Check for integer_sequence
+#if defined(__cpp_lib_integer_sequence) || FMT_MSC_VERSION >= 1900
+template <typename T, T... N>
+using integer_sequence = std::integer_sequence<T, N...>;
+template <size_t... N> using index_sequence = std::index_sequence<N...>;
+template <size_t N> using make_index_sequence = std::make_index_sequence<N>;
+#else
+template <typename T, T... N> struct integer_sequence {
+  using value_type = T;
+
+  static FMT_CONSTEXPR auto size() -> size_t { return sizeof...(N); }
+};
+
+template <size_t... N> using index_sequence = integer_sequence<size_t, N...>;
+
+template <typename T, size_t N, T... Ns>
+struct make_integer_sequence : make_integer_sequence<T, N - 1, N - 1, Ns...> {};
+template <typename T, T... Ns>
+struct make_integer_sequence<T, 0, Ns...> : integer_sequence<T, Ns...> {};
+
+template <size_t N>
+using make_index_sequence = make_integer_sequence<size_t, N>;
+#endif
+
+template <typename T>
+using tuple_index_sequence = make_index_sequence<std::tuple_size<T>::value>;
+
+template <typename T, typename C, bool = is_tuple_like_<T>::value>
+class is_tuple_formattable_ {
+ public:
+  static constexpr const bool value = false;
+};
+template <typename T, typename C> class is_tuple_formattable_<T, C, true> {
+  template <size_t... Is>
+  static auto all_true(index_sequence<Is...>,
+                       integer_sequence<bool, (Is >= 0)...>) -> std::true_type;
+  static auto all_true(...) -> std::false_type;
+
+  template <size_t... Is>
+  static auto check(index_sequence<Is...>) -> decltype(all_true(
+      index_sequence<Is...>{},
+      integer_sequence<bool,
+                       (is_formattable<typename std::tuple_element<Is, T>::type,
+                                       C>::value)...>{}));
+
+ public:
+  static constexpr const bool value =
+      decltype(check(tuple_index_sequence<T>{}))::value;
+};
+
+template <typename Tuple, typename F, size_t... Is>
+FMT_CONSTEXPR void for_each(index_sequence<Is...>, Tuple&& t, F&& f) {
+  using std::get;
+  // Using a free function get<Is>(Tuple) now.
+  const int unused[] = {0, ((void)f(get<Is>(t)), 0)...};
+  ignore_unused(unused);
+}
+
+template <typename Tuple, typename F>
+FMT_CONSTEXPR void for_each(Tuple&& t, F&& f) {
+  for_each(tuple_index_sequence<remove_cvref_t<Tuple>>(),
+           std::forward<Tuple>(t), std::forward<F>(f));
+}
+
+template <typename Tuple1, typename Tuple2, typename F, size_t... Is>
+void for_each2(index_sequence<Is...>, Tuple1&& t1, Tuple2&& t2, F&& f) {
+  using std::get;
+  const int unused[] = {0, ((void)f(get<Is>(t1), get<Is>(t2)), 0)...};
+  ignore_unused(unused);
+}
+
+template <typename Tuple1, typename Tuple2, typename F>
+void for_each2(Tuple1&& t1, Tuple2&& t2, F&& f) {
+  for_each2(tuple_index_sequence<remove_cvref_t<Tuple1>>(),
+            std::forward<Tuple1>(t1), std::forward<Tuple2>(t2),
+            std::forward<F>(f));
+}
+
+namespace tuple {
+// Workaround a bug in MSVC 2019 (v140).
+template <typename Char, typename... T>
+using result_t = std::tuple<formatter<remove_cvref_t<T>, Char>...>;
+
+using std::get;
+template <typename Tuple, typename Char, std::size_t... Is>
+auto get_formatters(index_sequence<Is...>)
+    -> result_t<Char, decltype(get<Is>(std::declval<Tuple>()))...>;
+}  // namespace tuple
+
+#if FMT_MSC_VERSION && FMT_MSC_VERSION < 1920
+// Older MSVC doesn't get the reference type correctly for arrays.
+template <typename R> struct range_reference_type_impl {
+  using type = decltype(*detail::range_begin(std::declval<R&>()));
+};
+
+template <typename T, std::size_t N> struct range_reference_type_impl<T[N]> {
+  using type = T&;
+};
+
+template <typename T>
+using range_reference_type = typename range_reference_type_impl<T>::type;
+#else
+template <typename Range>
+using range_reference_type =
+    decltype(*detail::range_begin(std::declval<Range&>()));
+#endif
+
+// We don't use the Range's value_type for anything, but we do need the Range's
+// reference type, with cv-ref stripped.
+template <typename Range>
+using uncvref_type = remove_cvref_t<range_reference_type<Range>>;
+
+template <typename Formatter>
+FMT_CONSTEXPR auto maybe_set_debug_format(Formatter& f, bool set)
+    -> decltype(f.set_debug_format(set)) {
+  f.set_debug_format(set);
+}
+template <typename Formatter>
+FMT_CONSTEXPR void maybe_set_debug_format(Formatter&, ...) {}
+
+template <typename T>
+struct range_format_kind_
+    : std::integral_constant<range_format,
+                             std::is_same<uncvref_type<T>, T>::value
+                                 ? range_format::disabled
+                             : is_map<T>::value ? range_format::map
+                             : is_set<T>::value ? range_format::set
+                                                : range_format::sequence> {};
+
+template <range_format K>
+using range_format_constant = std::integral_constant<range_format, K>;
+
+// These are not generic lambdas for compatibility with C++11.
+template <typename ParseContext> struct parse_empty_specs {
+  template <typename Formatter> FMT_CONSTEXPR void operator()(Formatter& f) {
+    f.parse(ctx);
+    detail::maybe_set_debug_format(f, true);
+  }
+  ParseContext& ctx;
+};
+template <typename FormatContext> struct format_tuple_element {
+  using char_type = typename FormatContext::char_type;
+
+  template <typename T>
+  void operator()(const formatter<T, char_type>& f, const T& v) {
+    if (i > 0) ctx.advance_to(detail::copy<char_type>(separator, ctx.out()));
+    ctx.advance_to(f.format(v, ctx));
+    ++i;
+  }
+
+  int i;
+  FormatContext& ctx;
+  basic_string_view<char_type> separator;
+};
+
+}  // namespace detail
+
+template <typename T> struct is_tuple_like {
+  static constexpr const bool value =
+      detail::is_tuple_like_<T>::value && !detail::is_range_<T>::value;
+};
+
+template <typename T, typename C> struct is_tuple_formattable {
+  static constexpr const bool value =
+      detail::is_tuple_formattable_<T, C>::value;
+};
+
+template <typename Tuple, typename Char>
+struct formatter<Tuple, Char,
+                 enable_if_t<fmt::is_tuple_like<Tuple>::value &&
+                             fmt::is_tuple_formattable<Tuple, Char>::value>> {
+ private:
+  decltype(detail::tuple::get_formatters<Tuple, Char>(
+      detail::tuple_index_sequence<Tuple>())) formatters_;
+
+  basic_string_view<Char> separator_ = detail::string_literal<Char, ',', ' '>{};
+  basic_string_view<Char> opening_bracket_ =
+      detail::string_literal<Char, '('>{};
+  basic_string_view<Char> closing_bracket_ =
+      detail::string_literal<Char, ')'>{};
+
+ public:
+  FMT_CONSTEXPR formatter() {}
+
+  FMT_CONSTEXPR void set_separator(basic_string_view<Char> sep) {
+    separator_ = sep;
+  }
+
+  FMT_CONSTEXPR void set_brackets(basic_string_view<Char> open,
+                                  basic_string_view<Char> close) {
+    opening_bracket_ = open;
+    closing_bracket_ = close;
+  }
+
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+    auto it = ctx.begin();
+    if (it != ctx.end() && *it != '}') report_error("invalid format specifier");
+    detail::for_each(formatters_, detail::parse_empty_specs<ParseContext>{ctx});
+    return it;
+  }
+
+  template <typename FormatContext>
+  auto format(const Tuple& value, FormatContext& ctx) const
+      -> decltype(ctx.out()) {
+    ctx.advance_to(detail::copy<Char>(opening_bracket_, ctx.out()));
+    detail::for_each2(
+        formatters_, value,
+        detail::format_tuple_element<FormatContext>{0, ctx, separator_});
+    return detail::copy<Char>(closing_bracket_, ctx.out());
+  }
+};
+
+template <typename T, typename Char> struct is_range {
+  static constexpr const bool value =
+      detail::is_range_<T>::value && !detail::has_to_string_view<T>::value;
+};
+
+namespace detail {
+template <typename Context> struct range_mapper {
+  using mapper = arg_mapper<Context>;
+
+  template <typename T,
+            FMT_ENABLE_IF(has_formatter<remove_cvref_t<T>, Context>::value)>
+  static auto map(T&& value) -> T&& {
+    return static_cast<T&&>(value);
+  }
+  template <typename T,
+            FMT_ENABLE_IF(!has_formatter<remove_cvref_t<T>, Context>::value)>
+  static auto map(T&& value)
+      -> decltype(mapper().map(static_cast<T&&>(value))) {
+    return mapper().map(static_cast<T&&>(value));
+  }
+};
+
+template <typename Char, typename Element>
+using range_formatter_type =
+    formatter<remove_cvref_t<decltype(range_mapper<buffered_context<Char>>{}
+                                          .map(std::declval<Element>()))>,
+              Char>;
+
+template <typename R>
+using maybe_const_range =
+    conditional_t<has_const_begin_end<R>::value, const R, R>;
+
+// Workaround a bug in MSVC 2015 and earlier.
+#if !FMT_MSC_VERSION || FMT_MSC_VERSION >= 1910
+template <typename R, typename Char>
+struct is_formattable_delayed
+    : is_formattable<uncvref_type<maybe_const_range<R>>, Char> {};
+#endif
+}  // namespace detail
+
+template <typename...> struct conjunction : std::true_type {};
+template <typename P> struct conjunction<P> : P {};
+template <typename P1, typename... Pn>
+struct conjunction<P1, Pn...>
+    : conditional_t<bool(P1::value), conjunction<Pn...>, P1> {};
+
+template <typename T, typename Char, typename Enable = void>
+struct range_formatter;
+
+template <typename T, typename Char>
+struct range_formatter<
+    T, Char,
+    enable_if_t<conjunction<std::is_same<T, remove_cvref_t<T>>,
+                            is_formattable<T, Char>>::value>> {
+ private:
+  detail::range_formatter_type<Char, T> underlying_;
+  basic_string_view<Char> separator_ = detail::string_literal<Char, ',', ' '>{};
+  basic_string_view<Char> opening_bracket_ =
+      detail::string_literal<Char, '['>{};
+  basic_string_view<Char> closing_bracket_ =
+      detail::string_literal<Char, ']'>{};
+  bool is_debug = false;
+
+  template <typename Output, typename It, typename Sentinel, typename U = T,
+            FMT_ENABLE_IF(std::is_same<U, Char>::value)>
+  auto write_debug_string(Output& out, It it, Sentinel end) const -> Output {
+    auto buf = basic_memory_buffer<Char>();
+    for (; it != end; ++it) buf.push_back(*it);
+    auto specs = format_specs();
+    specs.type = presentation_type::debug;
+    return detail::write<Char>(
+        out, basic_string_view<Char>(buf.data(), buf.size()), specs);
+  }
+
+  template <typename Output, typename It, typename Sentinel, typename U = T,
+            FMT_ENABLE_IF(!std::is_same<U, Char>::value)>
+  auto write_debug_string(Output& out, It, Sentinel) const -> Output {
+    return out;
+  }
+
+ public:
+  FMT_CONSTEXPR range_formatter() {}
+
+  FMT_CONSTEXPR auto underlying() -> detail::range_formatter_type<Char, T>& {
+    return underlying_;
+  }
+
+  FMT_CONSTEXPR void set_separator(basic_string_view<Char> sep) {
+    separator_ = sep;
+  }
+
+  FMT_CONSTEXPR void set_brackets(basic_string_view<Char> open,
+                                  basic_string_view<Char> close) {
+    opening_bracket_ = open;
+    closing_bracket_ = close;
+  }
+
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+    auto it = ctx.begin();
+    auto end = ctx.end();
+    detail::maybe_set_debug_format(underlying_, true);
+    if (it == end) return underlying_.parse(ctx);
+
+    switch (detail::to_ascii(*it)) {
+    case 'n':
+      set_brackets({}, {});
+      ++it;
+      break;
+    case '?':
+      is_debug = true;
+      set_brackets({}, {});
+      ++it;
+      if (it == end || *it != 's') report_error("invalid format specifier");
+      FMT_FALLTHROUGH;
+    case 's':
+      if (!std::is_same<T, Char>::value)
+        report_error("invalid format specifier");
+      if (!is_debug) {
+        set_brackets(detail::string_literal<Char, '"'>{},
+                     detail::string_literal<Char, '"'>{});
+        set_separator({});
+        detail::maybe_set_debug_format(underlying_, false);
+      }
+      ++it;
+      return it;
+    }
+
+    if (it != end && *it != '}') {
+      if (*it != ':') report_error("invalid format specifier");
+      detail::maybe_set_debug_format(underlying_, false);
+      ++it;
+    }
+
+    ctx.advance_to(it);
+    return underlying_.parse(ctx);
+  }
+
+  template <typename R, typename FormatContext>
+  auto format(R&& range, FormatContext& ctx) const -> decltype(ctx.out()) {
+    auto mapper = detail::range_mapper<buffered_context<Char>>();
+    auto out = ctx.out();
+    auto it = detail::range_begin(range);
+    auto end = detail::range_end(range);
+    if (is_debug) return write_debug_string(out, std::move(it), end);
+
+    out = detail::copy<Char>(opening_bracket_, out);
+    int i = 0;
+    for (; it != end; ++it) {
+      if (i > 0) out = detail::copy<Char>(separator_, out);
+      ctx.advance_to(out);
+      auto&& item = *it;  // Need an lvalue
+      out = underlying_.format(mapper.map(item), ctx);
+      ++i;
+    }
+    out = detail::copy<Char>(closing_bracket_, out);
+    return out;
+  }
+};
+
+FMT_EXPORT
+template <typename T, typename Char, typename Enable = void>
+struct range_format_kind
+    : conditional_t<
+          is_range<T, Char>::value, detail::range_format_kind_<T>,
+          std::integral_constant<range_format, range_format::disabled>> {};
+
+template <typename R, typename Char>
+struct formatter<
+    R, Char,
+    enable_if_t<conjunction<
+        bool_constant<
+            range_format_kind<R, Char>::value != range_format::disabled &&
+            range_format_kind<R, Char>::value != range_format::map &&
+            range_format_kind<R, Char>::value != range_format::string &&
+            range_format_kind<R, Char>::value != range_format::debug_string>
+// Workaround a bug in MSVC 2015 and earlier.
+#if !FMT_MSC_VERSION || FMT_MSC_VERSION >= 1910
+        ,
+        detail::is_formattable_delayed<R, Char>
+#endif
+        >::value>> {
+ private:
+  using range_type = detail::maybe_const_range<R>;
+  range_formatter<detail::uncvref_type<range_type>, Char> range_formatter_;
+
+ public:
+  using nonlocking = void;
+
+  FMT_CONSTEXPR formatter() {
+    if (detail::const_check(range_format_kind<R, Char>::value !=
+                            range_format::set))
+      return;
+    range_formatter_.set_brackets(detail::string_literal<Char, '{'>{},
+                                  detail::string_literal<Char, '}'>{});
+  }
+
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+    return range_formatter_.parse(ctx);
+  }
+
+  template <typename FormatContext>
+  auto format(range_type& range, FormatContext& ctx) const
+      -> decltype(ctx.out()) {
+    return range_formatter_.format(range, ctx);
+  }
+};
+
+// A map formatter.
+template <typename R, typename Char>
+struct formatter<
+    R, Char,
+    enable_if_t<range_format_kind<R, Char>::value == range_format::map>> {
+ private:
+  using map_type = detail::maybe_const_range<R>;
+  using element_type = detail::uncvref_type<map_type>;
+
+  decltype(detail::tuple::get_formatters<element_type, Char>(
+      detail::tuple_index_sequence<element_type>())) formatters_;
+  bool no_delimiters_ = false;
+
+ public:
+  FMT_CONSTEXPR formatter() {}
+
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+    auto it = ctx.begin();
+    auto end = ctx.end();
+    if (it != end) {
+      if (detail::to_ascii(*it) == 'n') {
+        no_delimiters_ = true;
+        ++it;
+      }
+      if (it != end && *it != '}') {
+        if (*it != ':') report_error("invalid format specifier");
+        ++it;
+      }
+      ctx.advance_to(it);
+    }
+    detail::for_each(formatters_, detail::parse_empty_specs<ParseContext>{ctx});
+    return it;
+  }
+
+  template <typename FormatContext>
+  auto format(map_type& map, FormatContext& ctx) const -> decltype(ctx.out()) {
+    auto out = ctx.out();
+    basic_string_view<Char> open = detail::string_literal<Char, '{'>{};
+    if (!no_delimiters_) out = detail::copy<Char>(open, out);
+    int i = 0;
+    auto mapper = detail::range_mapper<buffered_context<Char>>();
+    basic_string_view<Char> sep = detail::string_literal<Char, ',', ' '>{};
+    for (auto&& value : map) {
+      if (i > 0) out = detail::copy<Char>(sep, out);
+      ctx.advance_to(out);
+      detail::for_each2(formatters_, mapper.map(value),
+                        detail::format_tuple_element<FormatContext>{
+                            0, ctx, detail::string_literal<Char, ':', ' '>{}});
+      ++i;
+    }
+    basic_string_view<Char> close = detail::string_literal<Char, '}'>{};
+    if (!no_delimiters_) out = detail::copy<Char>(close, out);
+    return out;
+  }
+};
+
+// A (debug_)string formatter.
+template <typename R, typename Char>
+struct formatter<
+    R, Char,
+    enable_if_t<range_format_kind<R, Char>::value == range_format::string ||
+                range_format_kind<R, Char>::value ==
+                    range_format::debug_string>> {
+ private:
+  using range_type = detail::maybe_const_range<R>;
+  using string_type =
+      conditional_t<std::is_constructible<
+                        detail::std_string_view<Char>,
+                        decltype(detail::range_begin(std::declval<R>())),
+                        decltype(detail::range_end(std::declval<R>()))>::value,
+                    detail::std_string_view<Char>, std::basic_string<Char>>;
+
+  formatter<string_type, Char> underlying_;
+
+ public:
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+    return underlying_.parse(ctx);
+  }
+
+  template <typename FormatContext>
+  auto format(range_type& range, FormatContext& ctx) const
+      -> decltype(ctx.out()) {
+    auto out = ctx.out();
+    if (detail::const_check(range_format_kind<R, Char>::value ==
+                            range_format::debug_string))
+      *out++ = '"';
+    out = underlying_.format(
+        string_type{detail::range_begin(range), detail::range_end(range)}, ctx);
+    if (detail::const_check(range_format_kind<R, Char>::value ==
+                            range_format::debug_string))
+      *out++ = '"';
+    return out;
+  }
+};
+
+template <typename It, typename Sentinel, typename Char = char>
+struct join_view : detail::view {
+  It begin;
+  Sentinel end;
+  basic_string_view<Char> sep;
+
+  join_view(It b, Sentinel e, basic_string_view<Char> s)
+      : begin(std::move(b)), end(e), sep(s) {}
+};
+
+template <typename It, typename Sentinel, typename Char>
+struct formatter<join_view<It, Sentinel, Char>, Char> {
+ private:
+  using value_type =
+#ifdef __cpp_lib_ranges
+      std::iter_value_t<It>;
+#else
+      typename std::iterator_traits<It>::value_type;
+#endif
+  formatter<remove_cvref_t<value_type>, Char> value_formatter_;
+
+  using view_ref = conditional_t<std::is_copy_constructible<It>::value,
+                                 const join_view<It, Sentinel, Char>&,
+                                 join_view<It, Sentinel, Char>&&>;
+
+ public:
+  using nonlocking = void;
+
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> const Char* {
+    return value_formatter_.parse(ctx);
+  }
+
+  template <typename FormatContext>
+  auto format(view_ref& value, FormatContext& ctx) const
+      -> decltype(ctx.out()) {
+    auto it = std::forward<view_ref>(value).begin;
+    auto out = ctx.out();
+    if (it == value.end) return out;
+    out = value_formatter_.format(*it, ctx);
+    ++it;
+    while (it != value.end) {
+      out = detail::copy<Char>(value.sep.begin(), value.sep.end(), out);
+      ctx.advance_to(out);
+      out = value_formatter_.format(*it, ctx);
+      ++it;
+    }
+    return out;
+  }
+};
+
+/// Returns a view that formats the iterator range `[begin, end)` with elements
+/// separated by `sep`.
+template <typename It, typename Sentinel>
+auto join(It begin, Sentinel end, string_view sep) -> join_view<It, Sentinel> {
+  return {std::move(begin), end, sep};
+}
+
+/**
+ * Returns a view that formats `range` with elements separated by `sep`.
+ *
+ * **Example**:
+ *
+ *     auto v = std::vector<int>{1, 2, 3};
+ *     fmt::print("{}", fmt::join(v, ", "));
+ *     // Output: 1, 2, 3
+ *
+ * `fmt::join` applies passed format specifiers to the range elements:
+ *
+ *     fmt::print("{:02}", fmt::join(v, ", "));
+ *     // Output: 01, 02, 03
+ */
+template <typename Range>
+auto join(Range&& r, string_view sep)
+    -> join_view<decltype(detail::range_begin(r)),
+                 decltype(detail::range_end(r))> {
+  return {detail::range_begin(r), detail::range_end(r), sep};
+}
+
+template <typename Char, typename... T> struct tuple_join_view : detail::view {
+  const std::tuple<T...>& tuple;
+  basic_string_view<Char> sep;
+
+  tuple_join_view(const std::tuple<T...>& t, basic_string_view<Char> s)
+      : tuple(t), sep{s} {}
+};
+
+// Define FMT_TUPLE_JOIN_SPECIFIERS to enable experimental format specifiers
+// support in tuple_join. It is disabled by default because of issues with
+// the dynamic width and precision.
+#ifndef FMT_TUPLE_JOIN_SPECIFIERS
+#  define FMT_TUPLE_JOIN_SPECIFIERS 0
+#endif
+
+template <typename Char, typename... T>
+struct formatter<tuple_join_view<Char, T...>, Char> {
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+    return do_parse(ctx, std::integral_constant<size_t, sizeof...(T)>());
+  }
+
+  template <typename FormatContext>
+  auto format(const tuple_join_view<Char, T...>& value,
+              FormatContext& ctx) const -> typename FormatContext::iterator {
+    return do_format(value, ctx,
+                     std::integral_constant<size_t, sizeof...(T)>());
+  }
+
+ private:
+  std::tuple<formatter<typename std::decay<T>::type, Char>...> formatters_;
+
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto do_parse(ParseContext& ctx,
+                              std::integral_constant<size_t, 0>)
+      -> decltype(ctx.begin()) {
+    return ctx.begin();
+  }
+
+  template <typename ParseContext, size_t N>
+  FMT_CONSTEXPR auto do_parse(ParseContext& ctx,
+                              std::integral_constant<size_t, N>)
+      -> decltype(ctx.begin()) {
+    auto end = ctx.begin();
+#if FMT_TUPLE_JOIN_SPECIFIERS
+    end = std::get<sizeof...(T) - N>(formatters_).parse(ctx);
+    if (N > 1) {
+      auto end1 = do_parse(ctx, std::integral_constant<size_t, N - 1>());
+      if (end != end1)
+        report_error("incompatible format specs for tuple elements");
+    }
+#endif
+    return end;
+  }
+
+  template <typename FormatContext>
+  auto do_format(const tuple_join_view<Char, T...>&, FormatContext& ctx,
+                 std::integral_constant<size_t, 0>) const ->
+      typename FormatContext::iterator {
+    return ctx.out();
+  }
+
+  template <typename FormatContext, size_t N>
+  auto do_format(const tuple_join_view<Char, T...>& value, FormatContext& ctx,
+                 std::integral_constant<size_t, N>) const ->
+      typename FormatContext::iterator {
+    auto out = std::get<sizeof...(T) - N>(formatters_)
+                   .format(std::get<sizeof...(T) - N>(value.tuple), ctx);
+    if (N <= 1) return out;
+    out = detail::copy<Char>(value.sep, out);
+    ctx.advance_to(out);
+    return do_format(value, ctx, std::integral_constant<size_t, N - 1>());
+  }
+};
+
+namespace detail {
+// Check if T has an interface like a container adaptor (e.g. std::stack,
+// std::queue, std::priority_queue).
+template <typename T> class is_container_adaptor_like {
+  template <typename U> static auto check(U* p) -> typename U::container_type;
+  template <typename> static void check(...);
+
+ public:
+  static constexpr const bool value =
+      !std::is_void<decltype(check<T>(nullptr))>::value;
+};
+
+template <typename Container> struct all {
+  const Container& c;
+  auto begin() const -> typename Container::const_iterator { return c.begin(); }
+  auto end() const -> typename Container::const_iterator { return c.end(); }
+};
+}  // namespace detail
+
+template <typename T, typename Char>
+struct formatter<
+    T, Char,
+    enable_if_t<conjunction<detail::is_container_adaptor_like<T>,
+                            bool_constant<range_format_kind<T, Char>::value ==
+                                          range_format::disabled>>::value>>
+    : formatter<detail::all<typename T::container_type>, Char> {
+  using all = detail::all<typename T::container_type>;
+  template <typename FormatContext>
+  auto format(const T& t, FormatContext& ctx) const -> decltype(ctx.out()) {
+    struct getter : T {
+      static auto get(const T& t) -> all {
+        return {t.*(&getter::c)};  // Access c through the derived class.
+      }
+    };
+    return formatter<all>::format(getter::get(t), ctx);
+  }
+};
+
+FMT_BEGIN_EXPORT
+
+/**
+ * Returns an object that formats `std::tuple` with elements separated by `sep`.
+ *
+ * **Example**:
+ *
+ *     auto t = std::tuple<int, char>{1, 'a'};
+ *     fmt::print("{}", fmt::join(t, ", "));
+ *     // Output: 1, a
+ */
+template <typename... T>
+FMT_CONSTEXPR auto join(const std::tuple<T...>& tuple, string_view sep)
+    -> tuple_join_view<char, T...> {
+  return {tuple, sep};
+}
+
+/**
+ * Returns an object that formats `std::initializer_list` with elements
+ * separated by `sep`.
+ *
+ * **Example**:
+ *
+ *     fmt::print("{}", fmt::join({1, 2, 3}, ", "));
+ *     // Output: "1, 2, 3"
+ */
+template <typename T>
+auto join(std::initializer_list<T> list, string_view sep)
+    -> join_view<const T*, const T*> {
+  return join(std::begin(list), std::end(list), sep);
+}
+
+FMT_END_EXPORT
+FMT_END_NAMESPACE
+
+#endif  // FMT_RANGES_H_
diff --git a/third_party/fmt/include/fmt/std.h b/third_party/fmt/include/fmt/std.h
new file mode 100644
index 00000000..fb43940b
--- /dev/null
+++ b/third_party/fmt/include/fmt/std.h
@@ -0,0 +1,699 @@
+// Formatting library for C++ - formatters for standard library types
+//
+// Copyright (c) 2012 - present, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_STD_H_
+#define FMT_STD_H_
+
+#include "format.h"
+#include "ostream.h"
+
+#ifndef FMT_MODULE
+#  include <atomic>
+#  include <bitset>
+#  include <complex>
+#  include <cstdlib>
+#  include <exception>
+#  include <memory>
+#  include <thread>
+#  include <type_traits>
+#  include <typeinfo>
+#  include <utility>
+#  include <vector>
+
+// Check FMT_CPLUSPLUS to suppress a bogus warning in MSVC.
+#  if FMT_CPLUSPLUS >= 201703L
+#    if FMT_HAS_INCLUDE(<filesystem>)
+#      include <filesystem>
+#    endif
+#    if FMT_HAS_INCLUDE(<variant>)
+#      include <variant>
+#    endif
+#    if FMT_HAS_INCLUDE(<optional>)
+#      include <optional>
+#    endif
+#  endif
+// Use > instead of >= in the version check because <source_location> may be
+// available after C++17 but before C++20 is marked as implemented.
+#  if FMT_CPLUSPLUS > 201703L && FMT_HAS_INCLUDE(<source_location>)
+#    include <source_location>
+#  endif
+#  if FMT_CPLUSPLUS > 202002L && FMT_HAS_INCLUDE(<expected>)
+#    include <expected>
+#  endif
+#endif  // FMT_MODULE
+
+#if FMT_HAS_INCLUDE(<version>)
+#  include <version>
+#endif
+
+// GCC 4 does not support FMT_HAS_INCLUDE.
+#if FMT_HAS_INCLUDE(<cxxabi.h>) || defined(__GLIBCXX__)
+#  include <cxxabi.h>
+// Android NDK with gabi++ library on some architectures does not implement
+// abi::__cxa_demangle().
+#  ifndef __GABIXX_CXXABI_H__
+#    define FMT_HAS_ABI_CXA_DEMANGLE
+#  endif
+#endif
+
+// For older Xcode versions, __cpp_lib_xxx flags are inaccurately defined.
+#ifndef FMT_CPP_LIB_FILESYSTEM
+#  ifdef __cpp_lib_filesystem
+#    define FMT_CPP_LIB_FILESYSTEM __cpp_lib_filesystem
+#  else
+#    define FMT_CPP_LIB_FILESYSTEM 0
+#  endif
+#endif
+
+#ifndef FMT_CPP_LIB_VARIANT
+#  ifdef __cpp_lib_variant
+#    define FMT_CPP_LIB_VARIANT __cpp_lib_variant
+#  else
+#    define FMT_CPP_LIB_VARIANT 0
+#  endif
+#endif
+
+#if FMT_CPP_LIB_FILESYSTEM
+FMT_BEGIN_NAMESPACE
+
+namespace detail {
+
+template <typename Char, typename PathChar>
+auto get_path_string(const std::filesystem::path& p,
+                     const std::basic_string<PathChar>& native) {
+  if constexpr (std::is_same_v<Char, char> && std::is_same_v<PathChar, wchar_t>)
+    return to_utf8<wchar_t>(native, to_utf8_error_policy::replace);
+  else
+    return p.string<Char>();
+}
+
+template <typename Char, typename PathChar>
+void write_escaped_path(basic_memory_buffer<Char>& quoted,
+                        const std::filesystem::path& p,
+                        const std::basic_string<PathChar>& native) {
+  if constexpr (std::is_same_v<Char, char> &&
+                std::is_same_v<PathChar, wchar_t>) {
+    auto buf = basic_memory_buffer<wchar_t>();
+    write_escaped_string<wchar_t>(std::back_inserter(buf), native);
+    bool valid = to_utf8<wchar_t>::convert(quoted, {buf.data(), buf.size()});
+    FMT_ASSERT(valid, "invalid utf16");
+  } else if constexpr (std::is_same_v<Char, PathChar>) {
+    write_escaped_string<std::filesystem::path::value_type>(
+        std::back_inserter(quoted), native);
+  } else {
+    write_escaped_string<Char>(std::back_inserter(quoted), p.string<Char>());
+  }
+}
+
+}  // namespace detail
+
+FMT_EXPORT
+template <typename Char> struct formatter<std::filesystem::path, Char> {
+ private:
+  format_specs specs_;
+  detail::arg_ref<Char> width_ref_;
+  bool debug_ = false;
+  char path_type_ = 0;
+
+ public:
+  FMT_CONSTEXPR void set_debug_format(bool set = true) { debug_ = set; }
+
+  template <typename ParseContext> FMT_CONSTEXPR auto parse(ParseContext& ctx) {
+    auto it = ctx.begin(), end = ctx.end();
+    if (it == end) return it;
+
+    it = detail::parse_align(it, end, specs_);
+    if (it == end) return it;
+
+    it = detail::parse_dynamic_spec(it, end, specs_.width, width_ref_, ctx);
+    if (it != end && *it == '?') {
+      debug_ = true;
+      ++it;
+    }
+    if (it != end && (*it == 'g')) path_type_ = detail::to_ascii(*it++);
+    return it;
+  }
+
+  template <typename FormatContext>
+  auto format(const std::filesystem::path& p, FormatContext& ctx) const {
+    auto specs = specs_;
+    auto path_string =
+        !path_type_ ? p.native()
+                    : p.generic_string<std::filesystem::path::value_type>();
+
+    detail::handle_dynamic_spec<detail::width_checker>(specs.width, width_ref_,
+                                                       ctx);
+    if (!debug_) {
+      auto s = detail::get_path_string<Char>(p, path_string);
+      return detail::write(ctx.out(), basic_string_view<Char>(s), specs);
+    }
+    auto quoted = basic_memory_buffer<Char>();
+    detail::write_escaped_path(quoted, p, path_string);
+    return detail::write(ctx.out(),
+                         basic_string_view<Char>(quoted.data(), quoted.size()),
+                         specs);
+  }
+};
+
+class path : public std::filesystem::path {
+ public:
+  auto display_string() const -> std::string {
+    const std::filesystem::path& base = *this;
+    return fmt::format(FMT_STRING("{}"), base);
+  }
+  auto system_string() const -> std::string { return string(); }
+
+  auto generic_display_string() const -> std::string {
+    const std::filesystem::path& base = *this;
+    return fmt::format(FMT_STRING("{:g}"), base);
+  }
+  auto generic_system_string() const -> std::string { return generic_string(); }
+};
+
+FMT_END_NAMESPACE
+#endif  // FMT_CPP_LIB_FILESYSTEM
+
+FMT_BEGIN_NAMESPACE
+FMT_EXPORT
+template <std::size_t N, typename Char>
+struct formatter<std::bitset<N>, Char> : nested_formatter<string_view> {
+ private:
+  // Functor because C++11 doesn't support generic lambdas.
+  struct writer {
+    const std::bitset<N>& bs;
+
+    template <typename OutputIt>
+    FMT_CONSTEXPR auto operator()(OutputIt out) -> OutputIt {
+      for (auto pos = N; pos > 0; --pos) {
+        out = detail::write<Char>(out, bs[pos - 1] ? Char('1') : Char('0'));
+      }
+
+      return out;
+    }
+  };
+
+ public:
+  template <typename FormatContext>
+  auto format(const std::bitset<N>& bs, FormatContext& ctx) const
+      -> decltype(ctx.out()) {
+    return write_padded(ctx, writer{bs});
+  }
+};
+
+FMT_EXPORT
+template <typename Char>
+struct formatter<std::thread::id, Char> : basic_ostream_formatter<Char> {};
+FMT_END_NAMESPACE
+
+#ifdef __cpp_lib_optional
+FMT_BEGIN_NAMESPACE
+FMT_EXPORT
+template <typename T, typename Char>
+struct formatter<std::optional<T>, Char,
+                 std::enable_if_t<is_formattable<T, Char>::value>> {
+ private:
+  formatter<T, Char> underlying_;
+  static constexpr basic_string_view<Char> optional =
+      detail::string_literal<Char, 'o', 'p', 't', 'i', 'o', 'n', 'a', 'l',
+                             '('>{};
+  static constexpr basic_string_view<Char> none =
+      detail::string_literal<Char, 'n', 'o', 'n', 'e'>{};
+
+  template <class U>
+  FMT_CONSTEXPR static auto maybe_set_debug_format(U& u, bool set)
+      -> decltype(u.set_debug_format(set)) {
+    u.set_debug_format(set);
+  }
+
+  template <class U>
+  FMT_CONSTEXPR static void maybe_set_debug_format(U&, ...) {}
+
+ public:
+  template <typename ParseContext> FMT_CONSTEXPR auto parse(ParseContext& ctx) {
+    maybe_set_debug_format(underlying_, true);
+    return underlying_.parse(ctx);
+  }
+
+  template <typename FormatContext>
+  auto format(const std::optional<T>& opt, FormatContext& ctx) const
+      -> decltype(ctx.out()) {
+    if (!opt) return detail::write<Char>(ctx.out(), none);
+
+    auto out = ctx.out();
+    out = detail::write<Char>(out, optional);
+    ctx.advance_to(out);
+    out = underlying_.format(*opt, ctx);
+    return detail::write(out, ')');
+  }
+};
+FMT_END_NAMESPACE
+#endif  // __cpp_lib_optional
+
+#if defined(__cpp_lib_expected) || FMT_CPP_LIB_VARIANT
+
+FMT_BEGIN_NAMESPACE
+namespace detail {
+
+template <typename Char, typename OutputIt, typename T>
+auto write_escaped_alternative(OutputIt out, const T& v) -> OutputIt {
+  if constexpr (has_to_string_view<T>::value)
+    return write_escaped_string<Char>(out, detail::to_string_view(v));
+  if constexpr (std::is_same_v<T, Char>) return write_escaped_char(out, v);
+  return write<Char>(out, v);
+}
+
+}  // namespace detail
+
+FMT_END_NAMESPACE
+#endif
+
+#ifdef __cpp_lib_expected
+FMT_BEGIN_NAMESPACE
+
+FMT_EXPORT
+template <typename T, typename E, typename Char>
+struct formatter<std::expected<T, E>, Char,
+                 std::enable_if_t<is_formattable<T, Char>::value &&
+                                  is_formattable<E, Char>::value>> {
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+    return ctx.begin();
+  }
+
+  template <typename FormatContext>
+  auto format(const std::expected<T, E>& value, FormatContext& ctx) const
+      -> decltype(ctx.out()) {
+    auto out = ctx.out();
+
+    if (value.has_value()) {
+      out = detail::write<Char>(out, "expected(");
+      out = detail::write_escaped_alternative<Char>(out, *value);
+    } else {
+      out = detail::write<Char>(out, "unexpected(");
+      out = detail::write_escaped_alternative<Char>(out, value.error());
+    }
+    *out++ = ')';
+    return out;
+  }
+};
+FMT_END_NAMESPACE
+#endif  // __cpp_lib_expected
+
+#ifdef __cpp_lib_source_location
+FMT_BEGIN_NAMESPACE
+FMT_EXPORT
+template <> struct formatter<std::source_location> {
+  template <typename ParseContext> FMT_CONSTEXPR auto parse(ParseContext& ctx) {
+    return ctx.begin();
+  }
+
+  template <typename FormatContext>
+  auto format(const std::source_location& loc, FormatContext& ctx) const
+      -> decltype(ctx.out()) {
+    auto out = ctx.out();
+    out = detail::write(out, loc.file_name());
+    out = detail::write(out, ':');
+    out = detail::write<char>(out, loc.line());
+    out = detail::write(out, ':');
+    out = detail::write<char>(out, loc.column());
+    out = detail::write(out, ": ");
+    out = detail::write(out, loc.function_name());
+    return out;
+  }
+};
+FMT_END_NAMESPACE
+#endif
+
+#if FMT_CPP_LIB_VARIANT
+FMT_BEGIN_NAMESPACE
+namespace detail {
+
+template <typename T>
+using variant_index_sequence =
+    std::make_index_sequence<std::variant_size<T>::value>;
+
+template <typename> struct is_variant_like_ : std::false_type {};
+template <typename... Types>
+struct is_variant_like_<std::variant<Types...>> : std::true_type {};
+
+// formattable element check.
+template <typename T, typename C> class is_variant_formattable_ {
+  template <std::size_t... Is>
+  static std::conjunction<
+      is_formattable<std::variant_alternative_t<Is, T>, C>...>
+      check(std::index_sequence<Is...>);
+
+ public:
+  static constexpr const bool value =
+      decltype(check(variant_index_sequence<T>{}))::value;
+};
+
+}  // namespace detail
+
+template <typename T> struct is_variant_like {
+  static constexpr const bool value = detail::is_variant_like_<T>::value;
+};
+
+template <typename T, typename C> struct is_variant_formattable {
+  static constexpr const bool value =
+      detail::is_variant_formattable_<T, C>::value;
+};
+
+FMT_EXPORT
+template <typename Char> struct formatter<std::monostate, Char> {
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+    return ctx.begin();
+  }
+
+  template <typename FormatContext>
+  auto format(const std::monostate&, FormatContext& ctx) const
+      -> decltype(ctx.out()) {
+    return detail::write<Char>(ctx.out(), "monostate");
+  }
+};
+
+FMT_EXPORT
+template <typename Variant, typename Char>
+struct formatter<
+    Variant, Char,
+    std::enable_if_t<std::conjunction_v<
+        is_variant_like<Variant>, is_variant_formattable<Variant, Char>>>> {
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+    return ctx.begin();
+  }
+
+  template <typename FormatContext>
+  auto format(const Variant& value, FormatContext& ctx) const
+      -> decltype(ctx.out()) {
+    auto out = ctx.out();
+
+    out = detail::write<Char>(out, "variant(");
+    FMT_TRY {
+      std::visit(
+          [&](const auto& v) {
+            out = detail::write_escaped_alternative<Char>(out, v);
+          },
+          value);
+    }
+    FMT_CATCH(const std::bad_variant_access&) {
+      detail::write<Char>(out, "valueless by exception");
+    }
+    *out++ = ')';
+    return out;
+  }
+};
+FMT_END_NAMESPACE
+#endif  // FMT_CPP_LIB_VARIANT
+
+FMT_BEGIN_NAMESPACE
+FMT_EXPORT
+template <typename Char> struct formatter<std::error_code, Char> {
+  template <typename ParseContext>
+  FMT_CONSTEXPR auto parse(ParseContext& ctx) -> decltype(ctx.begin()) {
+    return ctx.begin();
+  }
+
+  template <typename FormatContext>
+  FMT_CONSTEXPR auto format(const std::error_code& ec, FormatContext& ctx) const
+      -> decltype(ctx.out()) {
+    auto out = ctx.out();
+    out = detail::write_bytes<Char>(out, ec.category().name(), format_specs());
+    out = detail::write<Char>(out, Char(':'));
+    out = detail::write<Char>(out, ec.value());
+    return out;
+  }
+};
+
+#if FMT_USE_RTTI
+namespace detail {
+
+template <typename Char, typename OutputIt>
+auto write_demangled_name(OutputIt out, const std::type_info& ti) -> OutputIt {
+#  ifdef FMT_HAS_ABI_CXA_DEMANGLE
+  int status = 0;
+  std::size_t size = 0;
+  std::unique_ptr<char, void (*)(void*)> demangled_name_ptr(
+      abi::__cxa_demangle(ti.name(), nullptr, &size, &status), &std::free);
+
+  string_view demangled_name_view;
+  if (demangled_name_ptr) {
+    demangled_name_view = demangled_name_ptr.get();
+
+    // Normalization of stdlib inline namespace names.
+    // libc++ inline namespaces.
+    //  std::__1::*       -> std::*
+    //  std::__1::__fs::* -> std::*
+    // libstdc++ inline namespaces.
+    //  std::__cxx11::*             -> std::*
+    //  std::filesystem::__cxx11::* -> std::filesystem::*
+    if (demangled_name_view.starts_with("std::")) {
+      char* begin = demangled_name_ptr.get();
+      char* to = begin + 5;  // std::
+      for (char *from = to, *end = begin + demangled_name_view.size();
+           from < end;) {
+        // This is safe, because demangled_name is NUL-terminated.
+        if (from[0] == '_' && from[1] == '_') {
+          char* next = from + 1;
+          while (next < end && *next != ':') next++;
+          if (next[0] == ':' && next[1] == ':') {
+            from = next + 2;
+            continue;
+          }
+        }
+        *to++ = *from++;
+      }
+      demangled_name_view = {begin, detail::to_unsigned(to - begin)};
+    }
+  } else {
+    demangled_name_view = string_view(ti.name());
+  }
+  return detail::write_bytes<Char>(out, demangled_name_view);
+#  elif FMT_MSC_VERSION
+  const string_view demangled_name(ti.name());
+  for (std::size_t i = 0; i < demangled_name.size(); ++i) {
+    auto sub = demangled_name;
+    sub.remove_prefix(i);
+    if (sub.starts_with("enum ")) {
+      i += 4;
+      continue;
+    }
+    if (sub.starts_with("class ") || sub.starts_with("union ")) {
+      i += 5;
+      continue;
+    }
+    if (sub.starts_with("struct ")) {
+      i += 6;
+      continue;
+    }
+    if (*sub.begin() != ' ') *out++ = *sub.begin();
+  }
+  return out;
+#  else
+  return detail::write_bytes<Char>(out, string_view(ti.name()));
+#  endif
+}
+
+}  // namespace detail
+
+FMT_EXPORT
+template <typename Char>
+struct formatter<std::type_info, Char  // DEPRECATED! Mixing code unit types.
+                 > {
+ public:
+  FMT_CONSTEXPR auto parse(basic_format_parse_context<Char>& ctx)
+      -> decltype(ctx.begin()) {
+    return ctx.begin();
+  }
+
+  template <typename Context>
+  auto format(const std::type_info& ti, Context& ctx) const
+      -> decltype(ctx.out()) {
+    return detail::write_demangled_name<Char>(ctx.out(), ti);
+  }
+};
+#endif
+
+FMT_EXPORT
+template <typename T, typename Char>
+struct formatter<
+    T, Char,  // DEPRECATED! Mixing code unit types.
+    typename std::enable_if<std::is_base_of<std::exception, T>::value>::type> {
+ private:
+  bool with_typename_ = false;
+
+ public:
+  FMT_CONSTEXPR auto parse(basic_format_parse_context<Char>& ctx)
+      -> decltype(ctx.begin()) {
+    auto it = ctx.begin();
+    auto end = ctx.end();
+    if (it == end || *it == '}') return it;
+    if (*it == 't') {
+      ++it;
+      with_typename_ = FMT_USE_RTTI != 0;
+    }
+    return it;
+  }
+
+  template <typename Context>
+  auto format(const std::exception& ex, Context& ctx) const
+      -> decltype(ctx.out()) {
+    auto out = ctx.out();
+#if FMT_USE_RTTI
+    if (with_typename_) {
+      out = detail::write_demangled_name<Char>(out, typeid(ex));
+      *out++ = ':';
+      *out++ = ' ';
+    }
+#endif
+    return detail::write_bytes<Char>(out, string_view(ex.what()));
+  }
+};
+
+namespace detail {
+
+template <typename T, typename Enable = void>
+struct has_flip : std::false_type {};
+
+template <typename T>
+struct has_flip<T, void_t<decltype(std::declval<T>().flip())>>
+    : std::true_type {};
+
+template <typename T> struct is_bit_reference_like {
+  static constexpr const bool value =
+      std::is_convertible<T, bool>::value &&
+      std::is_nothrow_assignable<T, bool>::value && has_flip<T>::value;
+};
+
+#ifdef _LIBCPP_VERSION
+
+// Workaround for libc++ incompatibility with C++ standard.
+// According to the Standard, `bitset::operator[] const` returns bool.
+template <typename C>
+struct is_bit_reference_like<std::__bit_const_reference<C>> {
+  static constexpr const bool value = true;
+};
+
+#endif
+
+}  // namespace detail
+
+// We can't use std::vector<bool, Allocator>::reference and
+// std::bitset<N>::reference because the compiler can't deduce Allocator and N
+// in partial specialization.
+FMT_EXPORT
+template <typename BitRef, typename Char>
+struct formatter<BitRef, Char,
+                 enable_if_t<detail::is_bit_reference_like<BitRef>::value>>
+    : formatter<bool, Char> {
+  template <typename FormatContext>
+  FMT_CONSTEXPR auto format(const BitRef& v, FormatContext& ctx) const
+      -> decltype(ctx.out()) {
+    return formatter<bool, Char>::format(v, ctx);
+  }
+};
+
+template <typename T, typename Deleter>
+auto ptr(const std::unique_ptr<T, Deleter>& p) -> const void* {
+  return p.get();
+}
+template <typename T> auto ptr(const std::shared_ptr<T>& p) -> const void* {
+  return p.get();
+}
+
+FMT_EXPORT
+template <typename T, typename Char>
+struct formatter<std::atomic<T>, Char,
+                 enable_if_t<is_formattable<T, Char>::value>>
+    : formatter<T, Char> {
+  template <typename FormatContext>
+  auto format(const std::atomic<T>& v, FormatContext& ctx) const
+      -> decltype(ctx.out()) {
+    return formatter<T, Char>::format(v.load(), ctx);
+  }
+};
+
+#ifdef __cpp_lib_atomic_flag_test
+FMT_EXPORT
+template <typename Char>
+struct formatter<std::atomic_flag, Char> : formatter<bool, Char> {
+  template <typename FormatContext>
+  auto format(const std::atomic_flag& v, FormatContext& ctx) const
+      -> decltype(ctx.out()) {
+    return formatter<bool, Char>::format(v.test(), ctx);
+  }
+};
+#endif  // __cpp_lib_atomic_flag_test
+
+FMT_EXPORT
+template <typename T, typename Char> struct formatter<std::complex<T>, Char> {
+ private:
+  detail::dynamic_format_specs<Char> specs_;
+
+  template <typename FormatContext, typename OutputIt>
+  FMT_CONSTEXPR auto do_format(const std::complex<T>& c,
+                               detail::dynamic_format_specs<Char>& specs,
+                               FormatContext& ctx, OutputIt out) const
+      -> OutputIt {
+    if (c.real() != 0) {
+      *out++ = Char('(');
+      out = detail::write<Char>(out, c.real(), specs, ctx.locale());
+      specs.sign = sign::plus;
+      out = detail::write<Char>(out, c.imag(), specs, ctx.locale());
+      if (!detail::isfinite(c.imag())) *out++ = Char(' ');
+      *out++ = Char('i');
+      *out++ = Char(')');
+      return out;
+    }
+    out = detail::write<Char>(out, c.imag(), specs, ctx.locale());
+    if (!detail::isfinite(c.imag())) *out++ = Char(' ');
+    *out++ = Char('i');
+    return out;
+  }
+
+ public:
+  FMT_CONSTEXPR auto parse(basic_format_parse_context<Char>& ctx)
+      -> decltype(ctx.begin()) {
+    if (ctx.begin() == ctx.end() || *ctx.begin() == '}') return ctx.begin();
+    return parse_format_specs(ctx.begin(), ctx.end(), specs_, ctx,
+                              detail::type_constant<T, Char>::value);
+  }
+
+  template <typename FormatContext>
+  auto format(const std::complex<T>& c, FormatContext& ctx) const
+      -> decltype(ctx.out()) {
+    auto specs = specs_;
+    if (specs.width_ref.kind != detail::arg_id_kind::none ||
+        specs.precision_ref.kind != detail::arg_id_kind::none) {
+      detail::handle_dynamic_spec<detail::width_checker>(specs.width,
+                                                         specs.width_ref, ctx);
+      detail::handle_dynamic_spec<detail::precision_checker>(
+          specs.precision, specs.precision_ref, ctx);
+    }
+
+    if (specs.width == 0) return do_format(c, specs, ctx, ctx.out());
+    auto buf = basic_memory_buffer<Char>();
+
+    auto outer_specs = format_specs();
+    outer_specs.width = specs.width;
+    outer_specs.fill = specs.fill;
+    outer_specs.align = specs.align;
+
+    specs.width = 0;
+    specs.fill = {};
+    specs.align = align::none;
+
+    do_format(c, specs, ctx, basic_appender<Char>(buf));
+    return detail::write<Char>(ctx.out(),
+                               basic_string_view<Char>(buf.data(), buf.size()),
+                               outer_specs);
+  }
+};
+
+FMT_END_NAMESPACE
+#endif  // FMT_STD_H_
diff --git a/third_party/fmt/include/fmt/xchar.h b/third_party/fmt/include/fmt/xchar.h
new file mode 100644
index 00000000..b1f39ed2
--- /dev/null
+++ b/third_party/fmt/include/fmt/xchar.h
@@ -0,0 +1,322 @@
+// Formatting library for C++ - optional wchar_t and exotic character support
+//
+// Copyright (c) 2012 - present, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#ifndef FMT_XCHAR_H_
+#define FMT_XCHAR_H_
+
+#include "color.h"
+#include "format.h"
+#include "ranges.h"
+
+#ifndef FMT_MODULE
+#  include <cwchar>
+#  if !defined(FMT_STATIC_THOUSANDS_SEPARATOR)
+#    include <locale>
+#  endif
+#endif
+
+FMT_BEGIN_NAMESPACE
+namespace detail {
+
+template <typename T>
+using is_exotic_char = bool_constant<!std::is_same<T, char>::value>;
+
+template <typename S, typename = void> struct format_string_char {};
+
+template <typename S>
+struct format_string_char<
+    S, void_t<decltype(sizeof(detail::to_string_view(std::declval<S>())))>> {
+  using type = char_t<S>;
+};
+
+template <typename S>
+struct format_string_char<S, enable_if_t<is_compile_string<S>::value>> {
+  using type = typename S::char_type;
+};
+
+template <typename S>
+using format_string_char_t = typename format_string_char<S>::type;
+
+inline auto write_loc(basic_appender<wchar_t> out, loc_value value,
+                      const format_specs& specs, locale_ref loc) -> bool {
+#ifndef FMT_STATIC_THOUSANDS_SEPARATOR
+  auto& numpunct =
+      std::use_facet<std::numpunct<wchar_t>>(loc.get<std::locale>());
+  auto separator = std::wstring();
+  auto grouping = numpunct.grouping();
+  if (!grouping.empty()) separator = std::wstring(1, numpunct.thousands_sep());
+  return value.visit(loc_writer<wchar_t>{out, specs, separator, grouping, {}});
+#endif
+  return false;
+}
+}  // namespace detail
+
+FMT_BEGIN_EXPORT
+
+using wstring_view = basic_string_view<wchar_t>;
+using wformat_parse_context = basic_format_parse_context<wchar_t>;
+using wformat_context = buffered_context<wchar_t>;
+using wformat_args = basic_format_args<wformat_context>;
+using wmemory_buffer = basic_memory_buffer<wchar_t>;
+
+#if FMT_GCC_VERSION && FMT_GCC_VERSION < 409
+// Workaround broken conversion on older gcc.
+template <typename... Args> using wformat_string = wstring_view;
+inline auto runtime(wstring_view s) -> wstring_view { return s; }
+#else
+template <typename... Args>
+using wformat_string = basic_format_string<wchar_t, type_identity_t<Args>...>;
+inline auto runtime(wstring_view s) -> runtime_format_string<wchar_t> {
+  return {{s}};
+}
+#endif
+
+template <> struct is_char<wchar_t> : std::true_type {};
+template <> struct is_char<char16_t> : std::true_type {};
+template <> struct is_char<char32_t> : std::true_type {};
+
+#ifdef __cpp_char8_t
+template <>
+struct is_char<char8_t> : bool_constant<detail::is_utf8_enabled()> {};
+#endif
+
+template <typename... T>
+constexpr auto make_wformat_args(T&... args)
+    -> decltype(fmt::make_format_args<wformat_context>(args...)) {
+  return fmt::make_format_args<wformat_context>(args...);
+}
+
+inline namespace literals {
+#if FMT_USE_USER_DEFINED_LITERALS && !FMT_USE_NONTYPE_TEMPLATE_ARGS
+constexpr auto operator""_a(const wchar_t* s, size_t)
+    -> detail::udl_arg<wchar_t> {
+  return {s};
+}
+#endif
+}  // namespace literals
+
+template <typename It, typename Sentinel>
+auto join(It begin, Sentinel end, wstring_view sep)
+    -> join_view<It, Sentinel, wchar_t> {
+  return {begin, end, sep};
+}
+
+template <typename Range>
+auto join(Range&& range, wstring_view sep)
+    -> join_view<detail::iterator_t<Range>, detail::sentinel_t<Range>,
+                 wchar_t> {
+  return join(std::begin(range), std::end(range), sep);
+}
+
+template <typename T>
+auto join(std::initializer_list<T> list, wstring_view sep)
+    -> join_view<const T*, const T*, wchar_t> {
+  return join(std::begin(list), std::end(list), sep);
+}
+
+template <typename... T>
+auto join(const std::tuple<T...>& tuple, basic_string_view<wchar_t> sep)
+    -> tuple_join_view<wchar_t, T...> {
+  return {tuple, sep};
+}
+
+template <typename Char, FMT_ENABLE_IF(!std::is_same<Char, char>::value)>
+auto vformat(basic_string_view<Char> format_str,
+             typename detail::vformat_args<Char>::type args)
+    -> std::basic_string<Char> {
+  auto buf = basic_memory_buffer<Char>();
+  detail::vformat_to(buf, format_str, args);
+  return to_string(buf);
+}
+
+template <typename... T>
+auto format(wformat_string<T...> fmt, T&&... args) -> std::wstring {
+  return vformat(fmt::wstring_view(fmt), fmt::make_wformat_args(args...));
+}
+
+template <typename OutputIt, typename... T>
+auto format_to(OutputIt out, wformat_string<T...> fmt, T&&... args)
+    -> OutputIt {
+  return vformat_to(out, fmt::wstring_view(fmt),
+                    fmt::make_wformat_args(args...));
+}
+
+// Pass char_t as a default template parameter instead of using
+// std::basic_string<char_t<S>> to reduce the symbol size.
+template <typename S, typename... T,
+          typename Char = detail::format_string_char_t<S>,
+          FMT_ENABLE_IF(!std::is_same<Char, char>::value &&
+                        !std::is_same<Char, wchar_t>::value)>
+auto format(const S& format_str, T&&... args) -> std::basic_string<Char> {
+  return vformat(detail::to_string_view(format_str),
+                 fmt::make_format_args<buffered_context<Char>>(args...));
+}
+
+template <typename Locale, typename S,
+          typename Char = detail::format_string_char_t<S>,
+          FMT_ENABLE_IF(detail::is_locale<Locale>::value&&
+                            detail::is_exotic_char<Char>::value)>
+inline auto vformat(const Locale& loc, const S& format_str,
+                    typename detail::vformat_args<Char>::type args)
+    -> std::basic_string<Char> {
+  return detail::vformat(loc, detail::to_string_view(format_str), args);
+}
+
+template <typename Locale, typename S, typename... T,
+          typename Char = detail::format_string_char_t<S>,
+          FMT_ENABLE_IF(detail::is_locale<Locale>::value&&
+                            detail::is_exotic_char<Char>::value)>
+inline auto format(const Locale& loc, const S& format_str, T&&... args)
+    -> std::basic_string<Char> {
+  return detail::vformat(
+      loc, detail::to_string_view(format_str),
+      fmt::make_format_args<buffered_context<Char>>(args...));
+}
+
+template <typename OutputIt, typename S,
+          typename Char = detail::format_string_char_t<S>,
+          FMT_ENABLE_IF(detail::is_output_iterator<OutputIt, Char>::value&&
+                            detail::is_exotic_char<Char>::value)>
+auto vformat_to(OutputIt out, const S& format_str,
+                typename detail::vformat_args<Char>::type args) -> OutputIt {
+  auto&& buf = detail::get_buffer<Char>(out);
+  detail::vformat_to(buf, detail::to_string_view(format_str), args);
+  return detail::get_iterator(buf, out);
+}
+
+template <typename OutputIt, typename S, typename... T,
+          typename Char = detail::format_string_char_t<S>,
+          FMT_ENABLE_IF(detail::is_output_iterator<OutputIt, Char>::value &&
+                        !std::is_same<Char, char>::value &&
+                        !std::is_same<Char, wchar_t>::value)>
+inline auto format_to(OutputIt out, const S& fmt, T&&... args) -> OutputIt {
+  return vformat_to(out, detail::to_string_view(fmt),
+                    fmt::make_format_args<buffered_context<Char>>(args...));
+}
+
+template <typename Locale, typename S, typename OutputIt, typename... Args,
+          typename Char = detail::format_string_char_t<S>,
+          FMT_ENABLE_IF(detail::is_output_iterator<OutputIt, Char>::value&&
+                            detail::is_locale<Locale>::value&&
+                                detail::is_exotic_char<Char>::value)>
+inline auto vformat_to(OutputIt out, const Locale& loc, const S& format_str,
+                       typename detail::vformat_args<Char>::type args)
+    -> OutputIt {
+  auto&& buf = detail::get_buffer<Char>(out);
+  vformat_to(buf, detail::to_string_view(format_str), args,
+             detail::locale_ref(loc));
+  return detail::get_iterator(buf, out);
+}
+
+template <typename OutputIt, typename Locale, typename S, typename... T,
+          typename Char = detail::format_string_char_t<S>,
+          bool enable = detail::is_output_iterator<OutputIt, Char>::value &&
+                        detail::is_locale<Locale>::value &&
+                        detail::is_exotic_char<Char>::value>
+inline auto format_to(OutputIt out, const Locale& loc, const S& format_str,
+                      T&&... args) ->
+    typename std::enable_if<enable, OutputIt>::type {
+  return vformat_to(out, loc, detail::to_string_view(format_str),
+                    fmt::make_format_args<buffered_context<Char>>(args...));
+}
+
+template <typename OutputIt, typename Char, typename... Args,
+          FMT_ENABLE_IF(detail::is_output_iterator<OutputIt, Char>::value&&
+                            detail::is_exotic_char<Char>::value)>
+inline auto vformat_to_n(OutputIt out, size_t n,
+                         basic_string_view<Char> format_str,
+                         typename detail::vformat_args<Char>::type args)
+    -> format_to_n_result<OutputIt> {
+  using traits = detail::fixed_buffer_traits;
+  auto buf = detail::iterator_buffer<OutputIt, Char, traits>(out, n);
+  detail::vformat_to(buf, format_str, args);
+  return {buf.out(), buf.count()};
+}
+
+template <typename OutputIt, typename S, typename... T,
+          typename Char = detail::format_string_char_t<S>,
+          FMT_ENABLE_IF(detail::is_output_iterator<OutputIt, Char>::value&&
+                            detail::is_exotic_char<Char>::value)>
+inline auto format_to_n(OutputIt out, size_t n, const S& fmt, T&&... args)
+    -> format_to_n_result<OutputIt> {
+  return vformat_to_n(out, n, fmt::basic_string_view<Char>(fmt),
+                      fmt::make_format_args<buffered_context<Char>>(args...));
+}
+
+template <typename S, typename... T,
+          typename Char = detail::format_string_char_t<S>,
+          FMT_ENABLE_IF(detail::is_exotic_char<Char>::value)>
+inline auto formatted_size(const S& fmt, T&&... args) -> size_t {
+  auto buf = detail::counting_buffer<Char>();
+  detail::vformat_to(buf, detail::to_string_view(fmt),
+                     fmt::make_format_args<buffered_context<Char>>(args...));
+  return buf.count();
+}
+
+inline void vprint(std::FILE* f, wstring_view fmt, wformat_args args) {
+  auto buf = wmemory_buffer();
+  detail::vformat_to(buf, fmt, args);
+  buf.push_back(L'\0');
+  if (std::fputws(buf.data(), f) == -1)
+    FMT_THROW(system_error(errno, FMT_STRING("cannot write to file")));
+}
+
+inline void vprint(wstring_view fmt, wformat_args args) {
+  vprint(stdout, fmt, args);
+}
+
+template <typename... T>
+void print(std::FILE* f, wformat_string<T...> fmt, T&&... args) {
+  return vprint(f, wstring_view(fmt), fmt::make_wformat_args(args...));
+}
+
+template <typename... T> void print(wformat_string<T...> fmt, T&&... args) {
+  return vprint(wstring_view(fmt), fmt::make_wformat_args(args...));
+}
+
+template <typename... T>
+void println(std::FILE* f, wformat_string<T...> fmt, T&&... args) {
+  return print(f, L"{}\n", fmt::format(fmt, std::forward<T>(args)...));
+}
+
+template <typename... T> void println(wformat_string<T...> fmt, T&&... args) {
+  return print(L"{}\n", fmt::format(fmt, std::forward<T>(args)...));
+}
+
+inline auto vformat(const text_style& ts, wstring_view fmt, wformat_args args)
+    -> std::wstring {
+  auto buf = wmemory_buffer();
+  detail::vformat_to(buf, ts, fmt, args);
+  return fmt::to_string(buf);
+}
+
+template <typename... T>
+inline auto format(const text_style& ts, wformat_string<T...> fmt, T&&... args)
+    -> std::wstring {
+  return fmt::vformat(ts, fmt, fmt::make_wformat_args(args...));
+}
+
+template <typename... T>
+FMT_DEPRECATED void print(std::FILE* f, const text_style& ts,
+                          wformat_string<T...> fmt, const T&... args) {
+  vprint(f, ts, fmt, fmt::make_wformat_args(args...));
+}
+
+template <typename... T>
+FMT_DEPRECATED void print(const text_style& ts, wformat_string<T...> fmt,
+                          const T&... args) {
+  return print(stdout, ts, fmt, args...);
+}
+
+/// Converts `value` to `std::wstring` using the default format for type `T`.
+template <typename T> inline auto to_wstring(const T& value) -> std::wstring {
+  return format(FMT_STRING(L"{}"), value);
+}
+FMT_END_EXPORT
+FMT_END_NAMESPACE
+
+#endif  // FMT_XCHAR_H_
diff --git a/third_party/fmt/src/fmt.cc b/third_party/fmt/src/fmt.cc
new file mode 100644
index 00000000..fb514ad7
--- /dev/null
+++ b/third_party/fmt/src/fmt.cc
@@ -0,0 +1,135 @@
+module;
+
+// Put all implementation-provided headers into the global module fragment
+// to prevent attachment to this module.
+#ifndef FMT_IMPORT_STD
+#  include <algorithm>
+#  include <bitset>
+#  include <chrono>
+#  include <cmath>
+#  include <complex>
+#  include <cstddef>
+#  include <cstdint>
+#  include <cstdio>
+#  include <cstdlib>
+#  include <cstring>
+#  include <ctime>
+#  include <exception>
+#  include <expected>
+#  include <filesystem>
+#  include <fstream>
+#  include <functional>
+#  include <iterator>
+#  include <limits>
+#  include <locale>
+#  include <memory>
+#  include <optional>
+#  include <ostream>
+#  include <source_location>
+#  include <stdexcept>
+#  include <string>
+#  include <string_view>
+#  include <system_error>
+#  include <thread>
+#  include <type_traits>
+#  include <typeinfo>
+#  include <utility>
+#  include <variant>
+#  include <vector>
+#else
+#  include <limits.h>
+#  include <stdint.h>
+#  include <stdio.h>
+#  include <time.h>
+#endif
+#include <cerrno>
+#include <climits>
+#include <version>
+
+#if __has_include(<cxxabi.h>)
+#  include <cxxabi.h>
+#endif
+#if defined(_MSC_VER) || defined(__MINGW32__)
+#  include <intrin.h>
+#endif
+#if defined __APPLE__ || defined(__FreeBSD__)
+#  include <xlocale.h>
+#endif
+#if __has_include(<winapifamily.h>)
+#  include <winapifamily.h>
+#endif
+#if (__has_include(<fcntl.h>) || defined(__APPLE__) || \
+     defined(__linux__)) &&                            \
+    (!defined(WINAPI_FAMILY) || (WINAPI_FAMILY == WINAPI_FAMILY_DESKTOP_APP))
+#  include <fcntl.h>
+#  include <sys/stat.h>
+#  include <sys/types.h>
+#  ifndef _WIN32
+#    include <unistd.h>
+#  else
+#    include <io.h>
+#  endif
+#endif
+#ifdef _WIN32
+#  if defined(__GLIBCXX__)
+#    include <ext/stdio_filebuf.h>
+#    include <ext/stdio_sync_filebuf.h>
+#  endif
+#  define WIN32_LEAN_AND_MEAN
+#  include <windows.h>
+#endif
+
+export module fmt;
+
+#ifdef FMT_IMPORT_STD
+import std;
+#endif
+
+#define FMT_EXPORT export
+#define FMT_BEGIN_EXPORT export {
+#define FMT_END_EXPORT }
+
+// If you define FMT_ATTACH_TO_GLOBAL_MODULE
+//  - all declarations are detached from module 'fmt'
+//  - the module behaves like a traditional static library, too
+//  - all library symbols are mangled traditionally
+//  - you can mix TUs with either importing or #including the {fmt} API
+#ifdef FMT_ATTACH_TO_GLOBAL_MODULE
+extern "C++" {
+#endif
+
+#ifndef FMT_OS
+#  define FMT_OS 1
+#endif
+
+// All library-provided declarations and definitions must be in the module
+// purview to be exported.
+#include "fmt/args.h"
+#include "fmt/chrono.h"
+#include "fmt/color.h"
+#include "fmt/compile.h"
+#include "fmt/format.h"
+#if FMT_OS
+#  include "fmt/os.h"
+#endif
+#include "fmt/ostream.h"
+#include "fmt/printf.h"
+#include "fmt/ranges.h"
+#include "fmt/std.h"
+#include "fmt/xchar.h"
+
+#ifdef FMT_ATTACH_TO_GLOBAL_MODULE
+}
+#endif
+
+// gcc doesn't yet implement private module fragments
+#if !FMT_GCC_VERSION
+module :private;
+#endif
+
+#if FMT_HAS_INCLUDE("format.cc")
+#  include "format.cc"
+#endif
+#if FMT_OS && FMT_HAS_INCLUDE("os.cc")
+#  include "os.cc"
+#endif
diff --git a/third_party/fmt/src/format.cc b/third_party/fmt/src/format.cc
new file mode 100644
index 00000000..391d3a24
--- /dev/null
+++ b/third_party/fmt/src/format.cc
@@ -0,0 +1,43 @@
+// Formatting library for C++
+//
+// Copyright (c) 2012 - 2016, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+#include "fmt/format-inl.h"
+
+FMT_BEGIN_NAMESPACE
+namespace detail {
+
+template FMT_API auto dragonbox::to_decimal(float x) noexcept
+    -> dragonbox::decimal_fp<float>;
+template FMT_API auto dragonbox::to_decimal(double x) noexcept
+    -> dragonbox::decimal_fp<double>;
+
+#ifndef FMT_STATIC_THOUSANDS_SEPARATOR
+template FMT_API locale_ref::locale_ref(const std::locale& loc);
+template FMT_API auto locale_ref::get<std::locale>() const -> std::locale;
+#endif
+
+// Explicit instantiations for char.
+
+template FMT_API auto thousands_sep_impl(locale_ref)
+    -> thousands_sep_result<char>;
+template FMT_API auto decimal_point_impl(locale_ref) -> char;
+
+template FMT_API void buffer<char>::append(const char*, const char*);
+
+template FMT_API void vformat_to(buffer<char>&, string_view,
+                                 typename vformat_args<>::type, locale_ref);
+
+// Explicit instantiations for wchar_t.
+
+template FMT_API auto thousands_sep_impl(locale_ref)
+    -> thousands_sep_result<wchar_t>;
+template FMT_API auto decimal_point_impl(locale_ref) -> wchar_t;
+
+template FMT_API void buffer<wchar_t>::append(const wchar_t*, const wchar_t*);
+
+}  // namespace detail
+FMT_END_NAMESPACE
diff --git a/third_party/fmt/src/os.cc b/third_party/fmt/src/os.cc
new file mode 100644
index 00000000..27366499
--- /dev/null
+++ b/third_party/fmt/src/os.cc
@@ -0,0 +1,403 @@
+// Formatting library for C++ - optional OS-specific functionality
+//
+// Copyright (c) 2012 - 2016, Victor Zverovich
+// All rights reserved.
+//
+// For the license information refer to format.h.
+
+// Disable bogus MSVC warnings.
+#if !defined(_CRT_SECURE_NO_WARNINGS) && defined(_MSC_VER)
+#  define _CRT_SECURE_NO_WARNINGS
+#endif
+
+#include "fmt/os.h"
+
+#ifndef FMT_MODULE
+#  include <climits>
+
+#  if FMT_USE_FCNTL
+#    include <sys/stat.h>
+#    include <sys/types.h>
+
+#    ifdef _WRS_KERNEL    // VxWorks7 kernel
+#      include <ioLib.h>  // getpagesize
+#    endif
+
+#    ifndef _WIN32
+#      include <unistd.h>
+#    else
+#      ifndef WIN32_LEAN_AND_MEAN
+#        define WIN32_LEAN_AND_MEAN
+#      endif
+#      include <io.h>
+#    endif  // _WIN32
+#  endif    // FMT_USE_FCNTL
+
+#  ifdef _WIN32
+#    include <windows.h>
+#  endif
+#endif
+
+#ifdef _WIN32
+#  ifndef S_IRUSR
+#    define S_IRUSR _S_IREAD
+#  endif
+#  ifndef S_IWUSR
+#    define S_IWUSR _S_IWRITE
+#  endif
+#  ifndef S_IRGRP
+#    define S_IRGRP 0
+#  endif
+#  ifndef S_IWGRP
+#    define S_IWGRP 0
+#  endif
+#  ifndef S_IROTH
+#    define S_IROTH 0
+#  endif
+#  ifndef S_IWOTH
+#    define S_IWOTH 0
+#  endif
+#endif
+
+namespace {
+#ifdef _WIN32
+// Return type of read and write functions.
+using rwresult = int;
+
+// On Windows the count argument to read and write is unsigned, so convert
+// it from size_t preventing integer overflow.
+inline unsigned convert_rwcount(std::size_t count) {
+  return count <= UINT_MAX ? static_cast<unsigned>(count) : UINT_MAX;
+}
+#elif FMT_USE_FCNTL
+// Return type of read and write functions.
+using rwresult = ssize_t;
+
+inline std::size_t convert_rwcount(std::size_t count) { return count; }
+#endif
+}  // namespace
+
+FMT_BEGIN_NAMESPACE
+
+#ifdef _WIN32
+namespace detail {
+
+class system_message {
+  system_message(const system_message&) = delete;
+  void operator=(const system_message&) = delete;
+
+  unsigned long result_;
+  wchar_t* message_;
+
+  static bool is_whitespace(wchar_t c) noexcept {
+    return c == L' ' || c == L'\n' || c == L'\r' || c == L'\t' || c == L'\0';
+  }
+
+ public:
+  explicit system_message(unsigned long error_code)
+      : result_(0), message_(nullptr) {
+    result_ = FormatMessageW(
+        FORMAT_MESSAGE_ALLOCATE_BUFFER | FORMAT_MESSAGE_FROM_SYSTEM |
+            FORMAT_MESSAGE_IGNORE_INSERTS,
+        nullptr, error_code, MAKELANGID(LANG_NEUTRAL, SUBLANG_DEFAULT),
+        reinterpret_cast<wchar_t*>(&message_), 0, nullptr);
+    if (result_ != 0) {
+      while (result_ != 0 && is_whitespace(message_[result_ - 1])) {
+        --result_;
+      }
+    }
+  }
+  ~system_message() { LocalFree(message_); }
+  explicit operator bool() const noexcept { return result_ != 0; }
+  operator basic_string_view<wchar_t>() const noexcept {
+    return basic_string_view<wchar_t>(message_, result_);
+  }
+};
+
+class utf8_system_category final : public std::error_category {
+ public:
+  const char* name() const noexcept override { return "system"; }
+  std::string message(int error_code) const override {
+    auto&& msg = system_message(error_code);
+    if (msg) {
+      auto utf8_message = to_utf8<wchar_t>();
+      if (utf8_message.convert(msg)) {
+        return utf8_message.str();
+      }
+    }
+    return "unknown error";
+  }
+};
+
+}  // namespace detail
+
+FMT_API const std::error_category& system_category() noexcept {
+  static const detail::utf8_system_category category;
+  return category;
+}
+
+std::system_error vwindows_error(int err_code, string_view format_str,
+                                 format_args args) {
+  auto ec = std::error_code(err_code, system_category());
+  return std::system_error(ec, vformat(format_str, args));
+}
+
+void detail::format_windows_error(detail::buffer<char>& out, int error_code,
+                                  const char* message) noexcept {
+  FMT_TRY {
+    auto&& msg = system_message(error_code);
+    if (msg) {
+      auto utf8_message = to_utf8<wchar_t>();
+      if (utf8_message.convert(msg)) {
+        fmt::format_to(appender(out), FMT_STRING("{}: {}"), message,
+                       string_view(utf8_message));
+        return;
+      }
+    }
+  }
+  FMT_CATCH(...) {}
+  format_error_code(out, error_code, message);
+}
+
+void report_windows_error(int error_code, const char* message) noexcept {
+  report_error(detail::format_windows_error, error_code, message);
+}
+#endif  // _WIN32
+
+buffered_file::~buffered_file() noexcept {
+  if (file_ && FMT_SYSTEM(fclose(file_)) != 0)
+    report_system_error(errno, "cannot close file");
+}
+
+buffered_file::buffered_file(cstring_view filename, cstring_view mode) {
+  FMT_RETRY_VAL(file_, FMT_SYSTEM(fopen(filename.c_str(), mode.c_str())),
+                nullptr);
+  if (!file_)
+    FMT_THROW(system_error(errno, FMT_STRING("cannot open file {}"),
+                           filename.c_str()));
+}
+
+void buffered_file::close() {
+  if (!file_) return;
+  int result = FMT_SYSTEM(fclose(file_));
+  file_ = nullptr;
+  if (result != 0)
+    FMT_THROW(system_error(errno, FMT_STRING("cannot close file")));
+}
+
+int buffered_file::descriptor() const {
+#ifdef FMT_HAS_SYSTEM
+  // fileno is a macro on OpenBSD.
+#  ifdef fileno
+#    undef fileno
+#  endif
+  int fd = FMT_POSIX_CALL(fileno(file_));
+#elif defined(_WIN32)
+  int fd = _fileno(file_);
+#else
+  int fd = fileno(file_);
+#endif
+  if (fd == -1)
+    FMT_THROW(system_error(errno, FMT_STRING("cannot get file descriptor")));
+  return fd;
+}
+
+#if FMT_USE_FCNTL
+#  ifdef _WIN32
+using mode_t = int;
+#  endif
+
+constexpr mode_t default_open_mode =
+    S_IRUSR | S_IWUSR | S_IRGRP | S_IWGRP | S_IROTH | S_IWOTH;
+
+file::file(cstring_view path, int oflag) {
+#  if defined(_WIN32) && !defined(__MINGW32__)
+  fd_ = -1;
+  auto converted = detail::utf8_to_utf16(string_view(path.c_str()));
+  *this = file::open_windows_file(converted.c_str(), oflag);
+#  else
+  FMT_RETRY(fd_, FMT_POSIX_CALL(open(path.c_str(), oflag, default_open_mode)));
+  if (fd_ == -1)
+    FMT_THROW(
+        system_error(errno, FMT_STRING("cannot open file {}"), path.c_str()));
+#  endif
+}
+
+file::~file() noexcept {
+  // Don't retry close in case of EINTR!
+  // See http://linux.derkeiler.com/Mailing-Lists/Kernel/2005-09/3000.html
+  if (fd_ != -1 && FMT_POSIX_CALL(close(fd_)) != 0)
+    report_system_error(errno, "cannot close file");
+}
+
+void file::close() {
+  if (fd_ == -1) return;
+  // Don't retry close in case of EINTR!
+  // See http://linux.derkeiler.com/Mailing-Lists/Kernel/2005-09/3000.html
+  int result = FMT_POSIX_CALL(close(fd_));
+  fd_ = -1;
+  if (result != 0)
+    FMT_THROW(system_error(errno, FMT_STRING("cannot close file")));
+}
+
+long long file::size() const {
+#  ifdef _WIN32
+  // Use GetFileSize instead of GetFileSizeEx for the case when _WIN32_WINNT
+  // is less than 0x0500 as is the case with some default MinGW builds.
+  // Both functions support large file sizes.
+  DWORD size_upper = 0;
+  HANDLE handle = reinterpret_cast<HANDLE>(_get_osfhandle(fd_));
+  DWORD size_lower = FMT_SYSTEM(GetFileSize(handle, &size_upper));
+  if (size_lower == INVALID_FILE_SIZE) {
+    DWORD error = GetLastError();
+    if (error != NO_ERROR)
+      FMT_THROW(windows_error(GetLastError(), "cannot get file size"));
+  }
+  unsigned long long long_size = size_upper;
+  return (long_size << sizeof(DWORD) * CHAR_BIT) | size_lower;
+#  else
+  using Stat = struct stat;
+  Stat file_stat = Stat();
+  if (FMT_POSIX_CALL(fstat(fd_, &file_stat)) == -1)
+    FMT_THROW(system_error(errno, FMT_STRING("cannot get file attributes")));
+  static_assert(sizeof(long long) >= sizeof(file_stat.st_size),
+                "return type of file::size is not large enough");
+  return file_stat.st_size;
+#  endif
+}
+
+std::size_t file::read(void* buffer, std::size_t count) {
+  rwresult result = 0;
+  FMT_RETRY(result, FMT_POSIX_CALL(read(fd_, buffer, convert_rwcount(count))));
+  if (result < 0)
+    FMT_THROW(system_error(errno, FMT_STRING("cannot read from file")));
+  return detail::to_unsigned(result);
+}
+
+std::size_t file::write(const void* buffer, std::size_t count) {
+  rwresult result = 0;
+  FMT_RETRY(result, FMT_POSIX_CALL(write(fd_, buffer, convert_rwcount(count))));
+  if (result < 0)
+    FMT_THROW(system_error(errno, FMT_STRING("cannot write to file")));
+  return detail::to_unsigned(result);
+}
+
+file file::dup(int fd) {
+  // Don't retry as dup doesn't return EINTR.
+  // http://pubs.opengroup.org/onlinepubs/009695399/functions/dup.html
+  int new_fd = FMT_POSIX_CALL(dup(fd));
+  if (new_fd == -1)
+    FMT_THROW(system_error(
+        errno, FMT_STRING("cannot duplicate file descriptor {}"), fd));
+  return file(new_fd);
+}
+
+void file::dup2(int fd) {
+  int result = 0;
+  FMT_RETRY(result, FMT_POSIX_CALL(dup2(fd_, fd)));
+  if (result == -1) {
+    FMT_THROW(system_error(
+        errno, FMT_STRING("cannot duplicate file descriptor {} to {}"), fd_,
+        fd));
+  }
+}
+
+void file::dup2(int fd, std::error_code& ec) noexcept {
+  int result = 0;
+  FMT_RETRY(result, FMT_POSIX_CALL(dup2(fd_, fd)));
+  if (result == -1) ec = std::error_code(errno, std::generic_category());
+}
+
+buffered_file file::fdopen(const char* mode) {
+// Don't retry as fdopen doesn't return EINTR.
+#  if defined(__MINGW32__) && defined(_POSIX_)
+  FILE* f = ::fdopen(fd_, mode);
+#  else
+  FILE* f = FMT_POSIX_CALL(fdopen(fd_, mode));
+#  endif
+  if (!f) {
+    FMT_THROW(system_error(
+        errno, FMT_STRING("cannot associate stream with file descriptor")));
+  }
+  buffered_file bf(f);
+  fd_ = -1;
+  return bf;
+}
+
+#  if defined(_WIN32) && !defined(__MINGW32__)
+file file::open_windows_file(wcstring_view path, int oflag) {
+  int fd = -1;
+  auto err = _wsopen_s(&fd, path.c_str(), oflag, _SH_DENYNO, default_open_mode);
+  if (fd == -1) {
+    FMT_THROW(system_error(err, FMT_STRING("cannot open file {}"),
+                           detail::to_utf8<wchar_t>(path.c_str()).c_str()));
+  }
+  return file(fd);
+}
+#  endif
+
+pipe::pipe() {
+  int fds[2] = {};
+#  ifdef _WIN32
+  // Make the default pipe capacity same as on Linux 2.6.11+.
+  enum { DEFAULT_CAPACITY = 65536 };
+  int result = FMT_POSIX_CALL(pipe(fds, DEFAULT_CAPACITY, _O_BINARY));
+#  else
+  // Don't retry as the pipe function doesn't return EINTR.
+  // http://pubs.opengroup.org/onlinepubs/009696799/functions/pipe.html
+  int result = FMT_POSIX_CALL(pipe(fds));
+#  endif
+  if (result != 0)
+    FMT_THROW(system_error(errno, FMT_STRING("cannot create pipe")));
+  // The following assignments don't throw.
+  read_end = file(fds[0]);
+  write_end = file(fds[1]);
+}
+
+#  if !defined(__MSDOS__)
+long getpagesize() {
+#    ifdef _WIN32
+  SYSTEM_INFO si;
+  GetSystemInfo(&si);
+  return si.dwPageSize;
+#    else
+#      ifdef _WRS_KERNEL
+  long size = FMT_POSIX_CALL(getpagesize());
+#      else
+  long size = FMT_POSIX_CALL(sysconf(_SC_PAGESIZE));
+#      endif
+
+  if (size < 0)
+    FMT_THROW(system_error(errno, FMT_STRING("cannot get memory page size")));
+  return size;
+#    endif
+}
+#  endif
+
+namespace detail {
+
+void file_buffer::grow(buffer<char>& buf, size_t) {
+  if (buf.size() == buf.capacity()) static_cast<file_buffer&>(buf).flush();
+}
+
+file_buffer::file_buffer(cstring_view path, const ostream_params& params)
+    : buffer<char>(grow), file_(path, params.oflag) {
+  set(new char[params.buffer_size], params.buffer_size);
+}
+
+file_buffer::file_buffer(file_buffer&& other) noexcept
+    : buffer<char>(grow, other.data(), other.size(), other.capacity()),
+      file_(std::move(other.file_)) {
+  other.clear();
+  other.set(nullptr, 0);
+}
+
+file_buffer::~file_buffer() {
+  flush();
+  delete[] data();
+}
+}  // namespace detail
+
+ostream::~ostream() = default;
+#endif  // FMT_USE_FCNTL
+FMT_END_NAMESPACE
diff --git a/third_party/fmt/support/cmake/FindSetEnv.cmake b/third_party/fmt/support/cmake/FindSetEnv.cmake
new file mode 100644
index 00000000..4e2da540
--- /dev/null
+++ b/third_party/fmt/support/cmake/FindSetEnv.cmake
@@ -0,0 +1,7 @@
+# A CMake script to find SetEnv.cmd.
+
+find_program(WINSDK_SETENV NAMES SetEnv.cmd
+  PATHS "[HKEY_LOCAL_MACHINE\\SOFTWARE\\Microsoft\\Microsoft SDKs\\Windows;CurrentInstallFolder]/bin")
+if (WINSDK_SETENV AND PRINT_PATH)
+  execute_process(COMMAND ${CMAKE_COMMAND} -E echo "${WINSDK_SETENV}")
+endif ()
diff --git a/third_party/fmt/support/cmake/JoinPaths.cmake b/third_party/fmt/support/cmake/JoinPaths.cmake
new file mode 100644
index 00000000..32d6d668
--- /dev/null
+++ b/third_party/fmt/support/cmake/JoinPaths.cmake
@@ -0,0 +1,26 @@
+# This module provides function for joining paths
+# known from from most languages
+#
+# Original license:
+# SPDX-License-Identifier: (MIT OR CC0-1.0)
+# Explicit permission given to distribute this module under
+# the terms of the project as described in /LICENSE.rst.
+# Copyright 2020 Jan Tojnar
+# https://github.com/jtojnar/cmake-snips
+#
+# Modelled after Python’s os.path.join
+# https://docs.python.org/3.7/library/os.path.html#os.path.join
+# Windows not supported
+function(join_paths joined_path first_path_segment)
+    set(temp_path "${first_path_segment}")
+    foreach(current_segment IN LISTS ARGN)
+        if(NOT ("${current_segment}" STREQUAL ""))
+            if(IS_ABSOLUTE "${current_segment}")
+                set(temp_path "${current_segment}")
+            else()
+                set(temp_path "${temp_path}/${current_segment}")
+            endif()
+        endif()
+    endforeach()
+    set(${joined_path} "${temp_path}" PARENT_SCOPE)
+endfunction()
diff --git a/third_party/fmt/support/cmake/fmt-config.cmake.in b/third_party/fmt/support/cmake/fmt-config.cmake.in
new file mode 100644
index 00000000..bc1684f2
--- /dev/null
+++ b/third_party/fmt/support/cmake/fmt-config.cmake.in
@@ -0,0 +1,7 @@
+@PACKAGE_INIT@
+
+if (NOT TARGET fmt::fmt)
+  include(${CMAKE_CURRENT_LIST_DIR}/@targets_export_name@.cmake)
+endif ()
+
+check_required_components(fmt)
diff --git a/third_party/fmt/support/cmake/fmt.pc.in b/third_party/fmt/support/cmake/fmt.pc.in
new file mode 100644
index 00000000..29976a8a
--- /dev/null
+++ b/third_party/fmt/support/cmake/fmt.pc.in
@@ -0,0 +1,11 @@
+prefix=@CMAKE_INSTALL_PREFIX@
+exec_prefix=@CMAKE_INSTALL_PREFIX@
+libdir=@libdir_for_pc_file@
+includedir=@includedir_for_pc_file@
+
+Name: fmt
+Description: A modern formatting library
+Version: @FMT_VERSION@
+Libs: -L${libdir} -l@FMT_LIB_NAME@
+Cflags: -I${includedir}
+